![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | #tab-description | 2023-05-04 02:26 | 116K | |
![[ ]](/icons/layout.gif) | 00_SMW4_TRG_01_02_TO..> | 2023-05-03 09:31 | 89K | |
![[ ]](/icons/unknown.gif) | 00_horng_acct11c_tb_..> | 2023-05-03 13:44 | 47K | |
![[IMG]](/icons/image2.gif) | 00001-325x361-1-100x..> | 2023-08-05 01:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00001-325x361-1-300x..> | 2023-08-14 08:18 | 19K | |
![[IMG]](/icons/image2.gif) | 00001-325x361-1.jpg | 2023-05-03 10:28 | 37K | |
![[IMG]](/icons/image2.gif) | 00003-325x361-1-100x..> | 2023-08-05 06:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | 00003-325x361-1-300x..> | 2023-08-13 20:42 | 21K | |
![[IMG]](/icons/image2.gif) | 00003-325x361-1.jpg | 2023-05-03 10:27 | 40K | |
![[IMG]](/icons/image2.gif) | 00005-325x361-1-100x..> | 2023-08-05 04:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00005-325x361-1-300x..> | 2023-08-05 01:52 | 23K | |
![[IMG]](/icons/image2.gif) | 00005-325x361-1.jpg | 2023-05-03 10:05 | 42K | |
![[IMG]](/icons/image2.gif) | 00006-325x361-1-100x..> | 2023-08-05 15:22 | 4.6K | |
![[IMG]](/icons/image2.gif) | 00006-325x361-1-300x..> | 2023-08-05 01:52 | 31K | |
![[IMG]](/icons/image2.gif) | 00006-325x361-1.jpg | 2023-05-03 09:56 | 60K | |
![[IMG]](/icons/image2.gif) | 00011-325x361-1-100x..> | 2023-08-06 07:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00011-325x361-1-300x..> | 2023-08-05 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | 00011-325x361-1.jpg | 2023-05-03 10:32 | 43K | |
![[IMG]](/icons/image2.gif) | 00014-325x361-1-100x..> | 2023-08-05 01:51 | 4.8K | |
![[IMG]](/icons/image2.gif) | 00014-325x361-1-300x..> | 2023-08-20 22:31 | 30K | |
![[IMG]](/icons/image2.gif) | 00014-325x361-1.jpg | 2023-05-03 09:24 | 56K | |
![[IMG]](/icons/image2.gif) | 00016-325x361-1-100x..> | 2023-08-06 11:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | 00016-325x361-1-300x..> | 2023-08-08 15:50 | 24K | |
![[IMG]](/icons/image2.gif) | 00016-325x361-1.jpg | 2023-05-03 09:45 | 43K | |
![[IMG]](/icons/image2.gif) | 00023-325x361-1-100x..> | 2023-08-05 15:31 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00023-325x361-1-300x..> | 2023-08-09 01:01 | 20K | |
![[IMG]](/icons/image2.gif) | 00023-325x361-1.jpg | 2023-05-03 10:02 | 37K | |
![[IMG]](/icons/image2.gif) | 00025-325x361-1-100x..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00025-325x361-1-300x..> | 2023-08-05 02:29 | 24K | |
![[IMG]](/icons/image2.gif) | 00025-325x361-1.jpg | 2023-05-04 01:49 | 49K | |
![[IMG]](/icons/image2.gif) | 00028-325x361-1-100x..> | 2023-08-05 01:08 | 3.9K | |
![[IMG]](/icons/image2.gif) | 00028-325x361-1-300x..> | 2023-08-10 19:32 | 25K | |
![[IMG]](/icons/image2.gif) | 00028-325x361-1.jpg | 2023-05-03 09:25 | 49K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-1-100x..> | 2023-08-05 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-1-300x..> | 2023-08-05 04:36 | 21K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-1.jpg | 2023-05-03 09:31 | 42K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-2-100x..> | 2023-08-05 14:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-2-300x..> | 2023-08-24 21:55 | 21K | |
![[IMG]](/icons/image2.gif) | 00030-325x361-2.jpg | 2023-05-03 09:48 | 42K | |
![[IMG]](/icons/image2.gif) | 00033-325x361-1-100x..> | 2023-08-07 18:02 | 3.9K | |
![[IMG]](/icons/image2.gif) | 00033-325x361-1-300x..> | 2023-08-08 23:01 | 25K | |
![[IMG]](/icons/image2.gif) | 00033-325x361-1.jpg | 2023-05-03 10:32 | 48K | |
![[IMG]](/icons/image2.gif) | 00034-325x361-1-100x..> | 2023-08-05 01:54 | 2.8K | |
![[IMG]](/icons/image2.gif) | 00034-325x361-1-300x..> | 2023-08-08 14:34 | 15K | |
![[IMG]](/icons/image2.gif) | 00034-325x361-1.jpg | 2023-05-03 11:16 | 25K | |
![[IMG]](/icons/image2.gif) | 00035-325x361-1-100x..> | 2023-08-05 03:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | 00035-325x361-1-300x..> | 2023-08-08 14:34 | 16K | |
![[IMG]](/icons/image2.gif) | 00035-325x361-1.jpg | 2023-05-03 09:29 | 29K | |
![[IMG]](/icons/image2.gif) | 00036-325x361-1-100x..> | 2023-08-05 01:51 | 2.4K | |
![[IMG]](/icons/image2.gif) | 00036-325x361-1-300x..> | 2023-08-08 06:42 | 14K | |
![[IMG]](/icons/image2.gif) | 00036-325x361-1.jpg | 2023-05-03 11:18 | 25K | |
![[IMG]](/icons/image2.gif) | 00037-325x361-1-100x..> | 2023-08-06 10:17 | 4.2K | |
![[IMG]](/icons/image2.gif) | 00037-325x361-1-300x..> | 2023-08-08 01:24 | 27K | |
![[IMG]](/icons/image2.gif) | 00037-325x361-1.jpg | 2023-05-03 10:06 | 53K | |
![[IMG]](/icons/image2.gif) | 00038-325x361-1-100x..> | 2023-08-05 03:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | 00038-325x361-1-300x..> | 2023-08-12 12:45 | 19K | |
![[IMG]](/icons/image2.gif) | 00038-325x361-1.jpg | 2023-05-03 10:39 | 38K | |
![[IMG]](/icons/image2.gif) | 0023984155--100x100.jpg | 2023-08-05 03:41 | 16K | |
![[IMG]](/icons/image2.gif) | 0023984155-.jpg | 2023-05-03 09:49 | 27K | |
![[IMG]](/icons/image2.gif) | 00389-325x361-1-100x..> | 2023-08-06 01:48 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00389-325x361-1-300x..> | 2023-08-15 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | 00389-325x361-1.jpg | 2023-05-03 10:41 | 30K | |
![[IMG]](/icons/image2.gif) | 00390-325x361-1-100x..> | 2023-08-06 05:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | 00390-325x361-1-300x..> | 2023-08-05 02:29 | 17K | |
![[IMG]](/icons/image2.gif) | 00390-325x361-1.jpg | 2023-05-03 10:13 | 31K | |
![[IMG]](/icons/image2.gif) | 00392-325x361-1-100x..> | 2023-08-06 05:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | 00392-325x361-1-300x..> | 2023-08-05 05:34 | 20K | |
![[IMG]](/icons/image2.gif) | 00392-325x361-1.jpg | 2023-05-04 02:20 | 37K | |
![[IMG]](/icons/image2.gif) | 00419-1-325x361-1-10..> | 2023-08-06 13:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00419-1-325x361-1-30..> | 2023-08-23 08:24 | 20K | |
![[IMG]](/icons/image2.gif) | 00419-1-325x361-1.jpg | 2023-05-03 10:12 | 39K | |
![[IMG]](/icons/image2.gif) | 00420-325x361-1-100x..> | 2023-08-05 02:45 | 4.3K | |
![[IMG]](/icons/image2.gif) | 00420-325x361-1-300x..> | 2023-08-13 20:42 | 24K | |
![[IMG]](/icons/image2.gif) | 00420-325x361-1.jpg | 2023-05-03 10:29 | 44K | |
![[IMG]](/icons/image2.gif) | 00425-325x361-1-100x..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 00425-325x361-1-300x..> | 2023-09-05 01:19 | 17K | |
![[IMG]](/icons/image2.gif) | 00425-325x361-1.jpg | 2023-05-03 10:56 | 32K | |
![[IMG]](/icons/image2.gif) | 00516-325x361-1-100x..> | 2023-08-08 16:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | 00516-325x361-1-300x..> | 2023-08-11 11:08 | 15K | |
![[IMG]](/icons/image2.gif) | 00516-325x361-1.jpg | 2023-05-03 10:31 | 28K | |
![[IMG]](/icons/image2.gif) | 00561-325x361-1-100x..> | 2023-08-05 01:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00561-325x361-1-300x..> | 2023-08-05 16:15 | 18K | |
![[IMG]](/icons/image2.gif) | 00561-325x361-1.jpg | 2023-05-03 10:39 | 34K | |
![[IMG]](/icons/image2.gif) | 00573-325x361-1-100x..> | 2023-08-06 10:16 | 4.5K | |
![[IMG]](/icons/image2.gif) | 00573-325x361-1-300x..> | 2023-08-08 16:38 | 22K | |
![[IMG]](/icons/image2.gif) | 00573-325x361-1.jpg | 2023-05-03 10:30 | 41K | |
![[IMG]](/icons/image2.gif) | 00575-325x361-1-100x..> | 2023-08-05 16:26 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00575-325x361-1-300x..> | 2023-08-08 11:12 | 21K | |
![[IMG]](/icons/image2.gif) | 00575-325x361-1.jpg | 2023-05-03 09:48 | 38K | |
![[IMG]](/icons/image2.gif) | 00577-325x361-1-100x..> | 2023-08-05 01:12 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00577-325x361-1-300x..> | 2023-08-06 13:11 | 24K | |
![[IMG]](/icons/image2.gif) | 00577-325x361-1.jpg | 2023-05-04 02:21 | 45K | |
![[IMG]](/icons/image2.gif) | 00606-325x361-1-100x..> | 2023-08-06 05:44 | 4.3K | |
![[IMG]](/icons/image2.gif) | 00606-325x361-1-300x..> | 2023-08-20 22:31 | 21K | |
![[IMG]](/icons/image2.gif) | 00606-325x361-1.jpg | 2023-05-03 10:22 | 40K | |
![[IMG]](/icons/image2.gif) | 00621-321x361-1-100x..> | 2023-08-05 02:45 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00621-321x361-1-300x..> | 2023-08-12 04:51 | 22K | |
![[IMG]](/icons/image2.gif) | 00621-321x361-1.jpg | 2023-05-04 01:57 | 42K | |
![[IMG]](/icons/image2.gif) | 00624-325x361-1-100x..> | 2023-08-06 08:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | 00624-325x361-1-300x..> | 2023-08-12 04:51 | 14K | |
![[IMG]](/icons/image2.gif) | 00624-325x361-1.jpg | 2023-05-03 10:45 | 26K | |
![[IMG]](/icons/image2.gif) | 00634-325x361-1-100x..> | 2023-08-06 06:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | 00634-325x361-1-300x..> | 2023-08-14 08:18 | 23K | |
![[IMG]](/icons/image2.gif) | 00634-325x361-1.jpg | 2023-05-03 10:10 | 45K | |
![[IMG]](/icons/image2.gif) | 00635-325x361-1-100x..> | 2023-08-05 01:54 | 3.3K | |
![[IMG]](/icons/image2.gif) | 00635-325x361-1-300x..> | 2023-08-14 00:55 | 20K | |
![[IMG]](/icons/image2.gif) | 00635-325x361-1.jpg | 2023-05-03 11:00 | 37K | |
![[IMG]](/icons/image2.gif) | 00636-325x361-1-100x..> | 2023-08-05 01:09 | 4.5K | |
![[IMG]](/icons/image2.gif) | 00636-325x361-1-300x..> | 2023-08-06 17:25 | 26K | |
![[IMG]](/icons/image2.gif) | 00636-325x361-1.jpg | 2023-05-03 10:04 | 52K | |
![[IMG]](/icons/image2.gif) | 00637-325x361-1-100x..> | 2023-08-06 08:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00637-325x361-1-300x..> | 2023-08-12 06:54 | 24K | |
![[IMG]](/icons/image2.gif) | 00637-325x361-1.jpg | 2023-05-03 10:22 | 44K | |
![[IMG]](/icons/image2.gif) | 00638-325x361-1-100x..> | 2023-08-05 01:52 | 3.1K | |
![[IMG]](/icons/image2.gif) | 00638-325x361-1-300x..> | 2023-09-05 01:19 | 17K | |
![[IMG]](/icons/image2.gif) | 00638-325x361-1.jpg | 2023-05-03 09:42 | 32K | |
![[IMG]](/icons/image2.gif) | 00640-325x361-1-100x..> | 2023-08-08 06:38 | 2.4K | |
![[IMG]](/icons/image2.gif) | 00640-325x361-1-300x..> | 2023-09-05 01:19 | 11K | |
![[IMG]](/icons/image2.gif) | 00640-325x361-1.jpg | 2023-05-03 10:09 | 20K | |
![[IMG]](/icons/image2.gif) | 00644-325x361-1-100x..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00644-325x361-1-300x..> | 2023-08-08 07:33 | 20K | |
![[IMG]](/icons/image2.gif) | 00644-325x361-1.jpg | 2023-05-03 10:08 | 39K | |
![[IMG]](/icons/image2.gif) | 00645-325x361-1-100x..> | 2023-08-07 11:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | 00645-325x361-1-300x..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | 00645-325x361-1.jpg | 2023-05-03 09:38 | 38K | |
![[IMG]](/icons/image2.gif) | 00648-325x361-1-100x..> | 2023-08-06 21:21 | 4.2K | |
![[IMG]](/icons/image2.gif) | 00648-325x361-1-300x..> | 2023-08-10 13:41 | 21K | |
![[IMG]](/icons/image2.gif) | 00648-325x361-1.jpg | 2023-05-03 10:30 | 38K | |
![[IMG]](/icons/image2.gif) | 00652-325x361-1-100x..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00652-325x361-1-300x..> | 2023-08-05 01:52 | 17K | |
![[IMG]](/icons/image2.gif) | 00652-325x361-1.jpg | 2023-05-03 09:52 | 31K | |
![[IMG]](/icons/image2.gif) | 00656-325x361-1-100x..> | 2023-08-06 11:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | 00656-325x361-1-300x..> | 2023-08-15 01:38 | 15K | |
![[IMG]](/icons/image2.gif) | 00656-325x361-1.jpg | 2023-05-03 09:23 | 27K | |
![[IMG]](/icons/image2.gif) | 00676-325x361-1-100x..> | 2023-08-05 01:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00676-325x361-1-300x..> | 2023-08-20 07:59 | 18K | |
![[IMG]](/icons/image2.gif) | 00676-325x361-1.jpg | 2023-05-03 11:05 | 34K | |
![[IMG]](/icons/image2.gif) | 00677-325x361-1-100x..> | 2023-08-05 07:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00677-325x361-1-300x..> | 2023-08-20 07:59 | 16K | |
![[IMG]](/icons/image2.gif) | 00677-325x361-1.jpg | 2023-05-03 10:18 | 27K | |
![[IMG]](/icons/image2.gif) | 00678-325x361-1-100x..> | 2023-08-09 12:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00678-325x361-1-300x..> | 2023-08-19 07:17 | 16K | |
![[IMG]](/icons/image2.gif) | 00678-325x361-1.jpg | 2023-05-03 09:33 | 28K | |
![[IMG]](/icons/image2.gif) | 00681-325x361-1-100x..> | 2023-08-05 02:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | 00681-325x361-1-300x..> | 2023-08-19 02:34 | 18K | |
![[IMG]](/icons/image2.gif) | 00681-325x361-1.jpg | 2023-05-03 10:36 | 34K | |
![[IMG]](/icons/image2.gif) | 00684-325x361-1-100x..> | 2023-08-06 10:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00684-325x361-1-300x..> | 2023-08-19 02:34 | 17K | |
![[IMG]](/icons/image2.gif) | 00684-325x361-1.jpg | 2023-05-04 01:50 | 30K | |
![[IMG]](/icons/image2.gif) | 00686-325x361-1-100x..> | 2023-08-05 06:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00686-325x361-1-300x..> | 2023-08-11 12:04 | 17K | |
![[IMG]](/icons/image2.gif) | 00686-325x361-1.jpg | 2023-05-03 09:32 | 31K | |
![[IMG]](/icons/image2.gif) | 00691-325x361-1-100x..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00691-325x361-1-300x..> | 2023-08-11 12:04 | 19K | |
![[IMG]](/icons/image2.gif) | 00691-325x361-1.jpg | 2023-05-03 10:04 | 34K | |
![[IMG]](/icons/image2.gif) | 00696-325x361-1-100x..> | 2023-08-05 01:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00696-325x361-1-300x..> | 2023-08-11 12:04 | 19K | |
![[IMG]](/icons/image2.gif) | 00696-325x361-1.jpg | 2023-05-03 10:02 | 33K | |
![[IMG]](/icons/image2.gif) | 0070909849-100x100.jpg | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0070909849.jpg | 2023-05-03 10:41 | 13K | |
![[IMG]](/icons/image2.gif) | 00710-325x361-1-100x..> | 2023-08-06 11:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00710-325x361-1-300x..> | 2023-08-05 02:29 | 16K | |
![[IMG]](/icons/image2.gif) | 00710-325x361-1.jpg | 2023-05-03 09:50 | 30K | |
![[IMG]](/icons/image2.gif) | 0071062572_PDP100__4..> | 2023-08-05 04:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0071062572_PDP100__4..> | 2023-05-03 10:54 | 25K | |
![[IMG]](/icons/image2.gif) | 00715-325x361-1-100x..> | 2023-08-05 14:00 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00715-325x361-1-300x..> | 2023-08-05 05:34 | 20K | |
![[IMG]](/icons/image2.gif) | 00715-325x361-1.jpg | 2023-05-03 09:58 | 36K | |
![[IMG]](/icons/image2.gif) | 00721-325x361-1-100x..> | 2023-08-05 02:55 | 2.4K | |
![[IMG]](/icons/image2.gif) | 00721-325x361-1-300x..> | 2023-08-08 11:12 | 11K | |
![[IMG]](/icons/image2.gif) | 00721-325x361-1.jpg | 2023-05-03 10:26 | 20K | |
![[IMG]](/icons/image2.gif) | 00724-325x361-1-100x..> | 2023-08-06 09:42 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00724-325x361-1-300x..> | 2023-08-08 17:46 | 37K | |
![[IMG]](/icons/image2.gif) | 00724-325x361-1.jpg | 2023-05-03 10:37 | 77K | |
![[IMG]](/icons/image2.gif) | 00726-325x361-1-100x..> | 2023-08-05 04:36 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00726-325x361-1-300x..> | 2023-08-17 17:27 | 18K | |
![[IMG]](/icons/image2.gif) | 00726-325x361-1.jpg | 2023-05-03 11:00 | 33K | |
![[IMG]](/icons/image2.gif) | 00729-325x361-1-100x..> | 2023-08-05 15:32 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00729-325x361-1-300x..> | 2023-08-14 08:18 | 18K | |
![[IMG]](/icons/image2.gif) | 00729-325x361-1.jpg | 2023-05-03 10:37 | 35K | |
![[IMG]](/icons/image2.gif) | 0073511188-100x100.jpg | 2023-08-05 01:51 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0073511188.jpg | 2023-05-03 10:34 | 16K | |
![[ ]](/icons/layout.gif) | 0073512958-spl.pdf | 2023-05-03 13:41 | 776K | |
![[IMG]](/icons/image2.gif) | 0073513725-100x100.jpg | 2023-08-05 05:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0073513725.jpg | 2023-05-03 10:08 | 18K | |
![[IMG]](/icons/image2.gif) | 0073525200-100x100.jpg | 2023-08-06 11:14 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0073525200.jpg | 2023-05-03 10:44 | 15K | |
![[IMG]](/icons/image2.gif) | 0073525472-100x100.jpg | 2023-08-06 04:17 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0073525472.jpg | 2023-05-03 09:18 | 23K | |
![[IMG]](/icons/image2.gif) | 00756-325x361-1-100x..> | 2023-08-06 12:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | 00756-325x361-1-300x..> | 2023-08-05 06:17 | 13K | |
![[IMG]](/icons/image2.gif) | 00756-325x361-1.jpg | 2023-05-03 09:20 | 23K | |
![[IMG]](/icons/image2.gif) | 00758-325x361-1-100x..> | 2023-08-05 16:16 | 2.8K | |
![[IMG]](/icons/image2.gif) | 00758-325x361-1-300x..> | 2023-08-12 22:16 | 14K | |
![[IMG]](/icons/image2.gif) | 00758-325x361-1.jpg | 2023-05-03 11:18 | 27K | |
![[IMG]](/icons/image2.gif) | 00766-325x361-1-100x..> | 2023-08-05 03:41 | 4.7K | |
![[IMG]](/icons/image2.gif) | 00766-325x361-1-300x..> | 2023-08-14 00:55 | 31K | |
![[IMG]](/icons/image2.gif) | 00766-325x361-1.jpg | 2023-05-03 10:02 | 59K | |
![[ ]](/icons/layout.gif) | 0077258495-tspl.pdf | 2023-05-03 13:41 | 468K | |
![[IMG]](/icons/image2.gif) | 0077662644-100x100.jpg | 2023-08-09 09:11 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0077662644.jpg | 2023-05-03 11:15 | 18K | |
![[IMG]](/icons/image2.gif) | 0077801911-100x100.jpg | 2023-08-06 07:47 | 2.2K | |
![[IMG]](/icons/image2.gif) | 0077801911.jpg | 2023-05-03 09:58 | 10K | |
![[IMG]](/icons/image2.gif) | 007782072X-1-100x100..> | 2023-08-07 17:07 | 3.5K | |
![[IMG]](/icons/image2.gif) | 007782072X-1-300x300..> | 2023-08-12 15:36 | 20K | |
![[IMG]](/icons/image2.gif) | 007782072X-1.jpeg | 2023-05-03 11:18 | 23K | |
![[IMG]](/icons/image2.gif) | 0077861817-100x100.jpg | 2023-08-09 00:59 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0077861817.jpg | 2023-05-03 09:41 | 13K | |
![[ ]](/icons/layout.gif) | 0078027101-tspl.pdf | 2023-05-03 13:42 | 79K | |
![[IMG]](/icons/image2.gif) | 00790-325x361-1-100x..> | 2023-08-05 01:12 | 1.8K | |
![[IMG]](/icons/image2.gif) | 00790-325x361-1-300x..> | 2023-08-08 07:32 | 8.2K | |
![[IMG]](/icons/image2.gif) | 00790-325x361-1.jpg | 2023-05-03 10:43 | 16K | |
![[IMG]](/icons/image2.gif) | 00791-325x361-1-100x..> | 2023-08-06 10:20 | 2.5K | |
![[IMG]](/icons/image2.gif) | 00791-325x361-1-300x..> | 2023-08-08 07:32 | 12K | |
![[IMG]](/icons/image2.gif) | 00791-325x361-1.jpg | 2023-05-03 10:16 | 22K | |
![[IMG]](/icons/image2.gif) | 00797-325x361-1-100x..> | 2023-08-05 15:33 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00797-325x361-1-300x..> | 2023-08-09 18:53 | 23K | |
![[IMG]](/icons/image2.gif) | 00797-325x361-1.jpg | 2023-05-03 09:48 | 45K | |
![[IMG]](/icons/image2.gif) | 00800-325x361-1-100x..> | 2023-08-08 07:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | 00800-325x361-1-300x..> | 2023-08-14 08:18 | 19K | |
![[IMG]](/icons/image2.gif) | 00800-325x361-1.jpg | 2023-05-03 09:28 | 37K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1-1-10..> | 2023-08-05 02:55 | 3.0K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1-1-30..> | 2023-08-08 22:06 | 15K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1-1.jpg | 2023-05-03 09:52 | 28K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1-100x..> | 2023-08-05 14:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1-300x..> | 2023-08-12 04:50 | 15K | |
![[IMG]](/icons/image2.gif) | 00801-325x361-1.jpg | 2023-05-03 09:31 | 28K | |
![[IMG]](/icons/image2.gif) | 00809-325x361-1-100x..> | 2023-08-08 06:39 | 3.5K | |
![[IMG]](/icons/image2.gif) | 00809-325x361-1-300x..> | 2023-08-14 00:55 | 23K | |
![[IMG]](/icons/image2.gif) | 00809-325x361-1.jpg | 2023-05-03 10:45 | 43K | |
![[IMG]](/icons/image2.gif) | 00814-325x361-1-100x..> | 2023-08-05 01:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00814-325x361-1-300x..> | 2023-08-12 04:48 | 24K | |
![[IMG]](/icons/image2.gif) | 00814-325x361-1.jpg | 2023-05-04 01:48 | 46K | |
![[IMG]](/icons/image2.gif) | 00817-325x361-1-100x..> | 2023-08-05 01:52 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00817-325x361-1-300x..> | 2023-08-08 01:24 | 21K | |
![[IMG]](/icons/image2.gif) | 00817-325x361-1.jpg | 2023-05-03 10:25 | 38K | |
![[IMG]](/icons/image2.gif) | 00818-325x361-1-100x..> | 2023-08-05 03:35 | 2.5K | |
![[IMG]](/icons/image2.gif) | 00818-325x361-1-300x..> | 2023-08-12 20:37 | 13K | |
![[IMG]](/icons/image2.gif) | 00818-325x361-1.jpg | 2023-05-03 10:41 | 25K | |
![[IMG]](/icons/image2.gif) | 00820-325x361-1-100x..> | 2023-08-05 15:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00820-325x361-1-300x..> | 2023-08-05 02:31 | 21K | |
![[IMG]](/icons/image2.gif) | 00820-325x361-1.jpg | 2023-05-03 09:25 | 39K | |
![[IMG]](/icons/image2.gif) | 00821-325x361-1-100x..> | 2023-08-05 17:20 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00821-325x361-1-300x..> | 2023-08-05 01:51 | 20K | |
![[IMG]](/icons/image2.gif) | 00821-325x361-1.jpg | 2023-05-03 09:12 | 36K | |
![[IMG]](/icons/image2.gif) | 00882-325x361-1-100x..> | 2023-08-05 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00882-325x361-1-300x..> | 2023-08-12 03:57 | 19K | |
![[IMG]](/icons/image2.gif) | 00882-325x361-1.jpg | 2023-05-03 10:04 | 34K | |
![[IMG]](/icons/image2.gif) | 00884-325x361-1-100x..> | 2023-08-05 15:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | 00884-325x361-1-300x..> | 2023-08-11 02:47 | 17K | |
![[IMG]](/icons/image2.gif) | 00884-325x361-1.jpg | 2023-05-03 10:46 | 33K | |
![[IMG]](/icons/image2.gif) | 00885-325x361-1-100x..> | 2023-08-08 10:57 | 3.9K | |
![[IMG]](/icons/image2.gif) | 00885-325x361-1-300x..> | 2023-08-17 17:27 | 18K | |
![[IMG]](/icons/image2.gif) | 00885-325x361-1.jpg | 2023-05-03 09:38 | 31K | |
![[IMG]](/icons/image2.gif) | 00886-325x361-1-100x..> | 2023-08-05 05:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | 00886-325x361-1-300x..> | 2023-08-17 17:27 | 20K | |
![[IMG]](/icons/image2.gif) | 00886-325x361-1.jpg | 2023-05-03 11:09 | 39K | |
![[IMG]](/icons/image2.gif) | 00887-325x361-1-100x..> | 2023-08-05 17:20 | 2.9K | |
![[IMG]](/icons/image2.gif) | 00887-325x361-1-300x..> | 2023-08-05 01:13 | 17K | |
![[IMG]](/icons/image2.gif) | 00887-325x361-1.jpg | 2023-05-04 02:29 | 33K | |
![[IMG]](/icons/image2.gif) | 00889-325x361-1-100x..> | 2023-08-05 03:37 | 2.6K | |
![[IMG]](/icons/image2.gif) | 00889-325x361-1-300x..> | 2023-08-08 14:34 | 14K | |
![[IMG]](/icons/image2.gif) | 00889-325x361-1.jpg | 2023-05-03 10:14 | 26K | |
![[IMG]](/icons/image2.gif) | 00890-325x361-1-100x..> | 2023-08-05 21:57 | 2.7K | |
![[IMG]](/icons/image2.gif) | 00890-325x361-1-300x..> | 2023-08-08 14:34 | 14K | |
![[IMG]](/icons/image2.gif) | 00890-325x361-1.jpg | 2023-05-03 10:11 | 29K | |
![[IMG]](/icons/image2.gif) | 00892-325x361-1-100x..> | 2023-08-05 02:46 | 4.3K | |
![[IMG]](/icons/image2.gif) | 00892-325x361-1-300x..> | 2023-08-05 05:34 | 23K | |
![[IMG]](/icons/image2.gif) | 00892-325x361-1.jpg | 2023-05-03 09:29 | 42K | |
![[IMG]](/icons/image2.gif) | 00894-325x361-1-100x..> | 2023-08-06 10:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00894-325x361-1-300x..> | 2023-08-05 05:34 | 22K | |
![[IMG]](/icons/image2.gif) | 00894-325x361-1.jpg | 2023-05-03 11:18 | 41K | |
![[IMG]](/icons/image2.gif) | 00895-325x361-1-100x..> | 2023-08-05 17:20 | 3.5K | |
![[IMG]](/icons/image2.gif) | 00895-325x361-1-300x..> | 2023-08-06 16:00 | 21K | |
![[IMG]](/icons/image2.gif) | 00895-325x361-1.jpg | 2023-05-03 10:38 | 40K | |
![[IMG]](/icons/image2.gif) | 00903-325x361-1-100x..> | 2023-08-05 02:03 | 3.9K | |
![[IMG]](/icons/image2.gif) | 00903-325x361-1-300x..> | 2023-08-08 23:01 | 20K | |
![[IMG]](/icons/image2.gif) | 00903-325x361-1.jpg | 2023-05-03 10:16 | 36K | |
![[IMG]](/icons/image2.gif) | 00905-325x361-1-100x..> | 2023-08-08 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00905-325x361-1-300x..> | 2023-08-09 09:12 | 20K | |
![[IMG]](/icons/image2.gif) | 00905-325x361-1.jpg | 2023-05-03 10:05 | 38K | |
![[IMG]](/icons/image2.gif) | 00912-325x361-1-100x..> | 2023-08-05 05:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | 00912-325x361-1-300x..> | 2023-08-13 20:42 | 17K | |
![[IMG]](/icons/image2.gif) | 00912-325x361-1.jpg | 2023-05-03 09:48 | 33K | |
![[IMG]](/icons/image2.gif) | 00914-325x361-1-100x..> | 2023-08-06 20:55 | 3.7K | |
![[IMG]](/icons/image2.gif) | 00914-325x361-1-300x..> | 2023-08-13 20:42 | 17K | |
![[IMG]](/icons/image2.gif) | 00914-325x361-1.jpg | 2023-05-03 10:04 | 32K | |
![[IMG]](/icons/image2.gif) | 00918-325x361-1-100x..> | 2023-08-05 03:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | 00918-325x361-1-300x..> | 2023-08-15 20:03 | 23K | |
![[IMG]](/icons/image2.gif) | 00918-325x361-1.jpg | 2023-05-03 10:20 | 43K | |
![[IMG]](/icons/image2.gif) | 00920-325x361-1-100x..> | 2023-08-05 01:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | 00920-325x361-1-300x..> | 2023-08-05 01:51 | 19K | |
![[IMG]](/icons/image2.gif) | 00920-325x361-1.jpg | 2023-05-03 09:11 | 33K | |
![[IMG]](/icons/image2.gif) | 00921-325x361-1-100x..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00921-325x361-1-300x..> | 2023-08-12 04:51 | 23K | |
![[IMG]](/icons/image2.gif) | 00921-325x361-1.jpg | 2023-05-03 11:24 | 42K | |
![[IMG]](/icons/image2.gif) | 00922-325x361-1-100x..> | 2023-08-05 17:20 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00922-325x361-1-300x..> | 2023-08-19 07:17 | 21K | |
![[IMG]](/icons/image2.gif) | 00922-325x361-1.jpg | 2023-05-03 10:38 | 40K | |
![[IMG]](/icons/image2.gif) | 00924-325x361-1-100x..> | 2023-08-05 01:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | 00924-325x361-1-300x..> | 2023-08-08 15:50 | 26K | |
![[IMG]](/icons/image2.gif) | 00924-325x361-1.jpg | 2023-05-03 11:00 | 51K | |
![[IMG]](/icons/image2.gif) | 00925-325x361-1-100x..> | 2023-08-06 02:41 | 4.5K | |
![[IMG]](/icons/image2.gif) | 00925-325x361-1-300x..> | 2023-08-08 15:50 | 22K | |
![[IMG]](/icons/image2.gif) | 00925-325x361-1.jpg | 2023-05-03 10:34 | 40K | |
![[IMG]](/icons/image2.gif) | 00927-325x361-1-100x..> | 2023-08-06 03:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | 00927-325x361-1-300x..> | 2023-08-08 15:50 | 16K | |
![[IMG]](/icons/image2.gif) | 00927-325x361-1.jpg | 2023-05-03 09:19 | 30K | |
![[IMG]](/icons/image2.gif) | 00929-325x361-1-100x..> | 2023-08-09 04:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00929-325x361-1-300x..> | 2023-08-08 15:50 | 20K | |
![[IMG]](/icons/image2.gif) | 00929-325x361-1.jpg | 2023-05-03 10:32 | 38K | |
![[IMG]](/icons/image2.gif) | 00932-325x361-1-100x..> | 2023-08-06 05:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 00932-325x361-1-300x..> | 2023-08-08 21:47 | 24K | |
![[IMG]](/icons/image2.gif) | 00932-325x361-1.jpg | 2023-05-03 10:00 | 46K | |
![[IMG]](/icons/image2.gif) | 00936-326x361-1-100x..> | 2023-08-05 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00936-326x361-1-300x..> | 2023-08-08 21:47 | 21K | |
![[IMG]](/icons/image2.gif) | 00936-326x361-1.jpg | 2023-05-03 10:36 | 40K | |
![[IMG]](/icons/image2.gif) | 00937-325x361-1-100x..> | 2023-08-05 02:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | 00937-325x361-1-300x..> | 2023-08-08 21:47 | 17K | |
![[IMG]](/icons/image2.gif) | 00937-325x361-1.jpg | 2023-05-03 10:41 | 29K | |
![[IMG]](/icons/image2.gif) | 00941-325x361-1-100x..> | 2023-08-05 06:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | 00941-325x361-1-300x..> | 2023-08-08 21:47 | 21K | |
![[IMG]](/icons/image2.gif) | 00941-325x361-1.jpg | 2023-05-03 09:58 | 39K | |
![[ ]](/icons/unknown.gif) | 01-9781337091992.docx | 2023-05-03 10:51 | 610K | |
![[ ]](/icons/layout.gif) | 01-IMLM-6E-032175094..> | 2023-05-03 10:27 | 248K | |
![[ ]](/icons/unknown.gif) | 01-Test-Bank-for-Ess..> | 2023-05-04 02:09 | 36K | |
![[ ]](/icons/unknown.gif) | 01-Test-Bank-for-Int..> | 2023-05-04 02:20 | 73K | |
![[ ]](/icons/unknown.gif) | 01-Test-Bank-for-Ope..> | 2023-05-04 02:08 | 419K | |
![[ ]](/icons/unknown.gif) | 01-Test-Bank-for-Pri..> | 2023-05-04 02:11 | 146K | |
![[ ]](/icons/compressed.gif) | 01-Test-bank-Memmler..> | 2023-05-04 02:05 | 4.3K | |
![[ ]](/icons/layout.gif) | 01SMW4_TSM.pdf | 2023-05-03 09:52 | 102K | |
![[ ]](/icons/unknown.gif) | 01TB_CNA6e.doc | 2023-05-03 10:21 | 121K | |
![[ ]](/icons/compressed.gif) | 01_20170928085453.zip | 2023-05-03 11:04 | 9.8K | |
![[ ]](/icons/unknown.gif) | 01_AdministrativeSki..> | 2023-05-04 02:01 | 61K | |
![[ ]](/icons/compressed.gif) | 01_FSAV2e_SM_FINAL_0..> | 2023-05-03 10:15 | 309K | |
![[ ]](/icons/layout.gif) | 01_IS4_TBRG.pdf | 2023-05-03 09:25 | 148K | |
![[ ]](/icons/unknown.gif) | 01_Resources-List-fo..> | 2023-05-03 09:47 | 108K | |
![[ ]](/icons/unknown.gif) | 01_Suff_lr5e_im_c01...> | 2023-05-04 02:01 | 62K | |
![[ ]](/icons/unknown.gif) | 01_Suff_lr5e_tb_c01...> | 2023-05-04 02:01 | 29K | |
![[ ]](/icons/compressed.gif) | 01_TB_HDEV-2CE.zip | 2023-05-03 09:50 | 42K | |
![[ ]](/icons/unknown.gif) | 01__An_Overview_of_M..> | 2023-05-04 01:55 | 159K | |
![[ ]](/icons/unknown.gif) | 01_altsol_7e.doc | 2023-05-03 11:01 | 85K | |
![[ ]](/icons/unknown.gif) | 01_aren_aud14c_tb.doc | 2023-05-03 11:10 | 169K | |
![[ ]](/icons/unknown.gif) | 01_kotler_TIF_CH01.doc | 2023-05-03 09:26 | 1.1M | |
![[ ]](/icons/unknown.gif) | 01_krm_om10_ism_ch01..> | 2023-05-03 09:30 | 409K | |
![[ ]](/icons/layout.gif) | 01_pozz_for-psych5_t..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/compressed.gif) | 01_test_bank.zip | 2023-05-03 09:26 | 189K | |
![[ ]](/icons/compressed.gif) | 01im-inv.zip | 2023-05-03 09:29 | 7.4K | |
![[ ]](/icons/layout.gif) | 010-018_CH02_Musser.pdf | 2023-05-03 11:20 | 333K | |
![[IMG]](/icons/image2.gif) | 0130129399-500x500-1..> | 2023-05-03 11:25 | 47K | |
![[IMG]](/icons/image2.gif) | 013017615X-500x500-1..> | 2023-05-03 10:47 | 62K | |
![[IMG]](/icons/image2.gif) | 0130351172-100x100.jpg | 2023-08-05 02:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0130351172-300x300.jpg | 2023-08-05 19:10 | 14K | |
![[IMG]](/icons/image2.gif) | 0130351172.jpg | 2023-05-03 09:44 | 55K | |
![[IMG]](/icons/image2.gif) | 0130413313-500x500-1..> | 2023-05-03 10:16 | 62K | |
![[IMG]](/icons/image2.gif) | 013061792X-100x100.jpg | 2023-08-06 07:38 | 2.9K | |
![[IMG]](/icons/image2.gif) | 013061792X-300x300.jpg | 2023-08-23 01:25 | 15K | |
![[IMG]](/icons/image2.gif) | 013061792X.jpg | 2023-05-03 09:45 | 58K | |
![[IMG]](/icons/image2.gif) | 0130653535-100x100.jpg | 2023-08-05 16:26 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0130653535-300x300.jpg | 2023-08-09 04:10 | 27K | |
![[IMG]](/icons/image2.gif) | 0130653535.jpg | 2023-05-03 09:21 | 144K | |
![[IMG]](/icons/image2.gif) | 0130673897-100x100.jpg | 2023-08-06 10:20 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0130673897-300x300.jpg | 2023-08-20 08:54 | 19K | |
![[IMG]](/icons/image2.gif) | 0130673897.jpg | 2023-05-03 10:33 | 154K | |
![[IMG]](/icons/image2.gif) | 0130814199-100x100.jpg | 2023-08-05 06:25 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0130814199-300x300.jpg | 2023-08-09 22:25 | 24K | |
![[IMG]](/icons/image2.gif) | 0130814199.jpg | 2023-05-03 10:35 | 400K | |
![[IMG]](/icons/image2.gif) | 01308595591-500x500-..> | 2023-05-04 02:12 | 62K | |
![[IMG]](/icons/image2.gif) | 0130871214-100x100.jpg | 2023-08-05 01:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0130871214-300x300.jpg | 2023-08-05 21:03 | 18K | |
![[IMG]](/icons/image2.gif) | 0130871214.jpg | 2023-05-03 11:13 | 183K | |
![[IMG]](/icons/image2.gif) | 0131014595-500x5001-..> | 2023-05-03 10:09 | 53K | |
![[IMG]](/icons/image2.gif) | 0131015044_TestBank-..> | 2023-08-05 03:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0131015044_TestBank-..> | 2023-08-08 14:29 | 19K | |
![[IMG]](/icons/image2.gif) | 0131015044_TestBank.jpg | 2023-05-04 02:09 | 84K | |
![[IMG]](/icons/image2.gif) | 013119402X-100x100.jpg | 2023-08-06 05:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 013119402X-300x300.jpg | 2023-08-12 04:49 | 25K | |
![[IMG]](/icons/image2.gif) | 013119402X.jpg | 2023-05-04 02:13 | 112K | |
![[IMG]](/icons/image2.gif) | 0131245104-500x500-1..> | 2023-05-03 10:14 | 54K | |
![[IMG]](/icons/image2.gif) | 0131367730-100x100.jpg | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0131367730-300x300.jpg | 2023-08-16 18:42 | 15K | |
![[IMG]](/icons/image2.gif) | 0131367730.jpg | 2023-05-03 10:58 | 65K | |
![[IMG]](/icons/image2.gif) | 0131390481-470x615-1..> | 2023-08-05 19:13 | 4.6K | |
![[IMG]](/icons/image2.gif) | 0131390481-470x615-1..> | 2023-08-06 06:37 | 27K | |
![[IMG]](/icons/image2.gif) | 0131390481-470x615-1..> | 2023-05-04 01:48 | 113K | |
![[ ]](/icons/compressed.gif) | 013139407X_ism01-170..> | 2023-05-03 13:41 | 124K | |
![[ ]](/icons/layout.gif) | 0131395076_ISMch01-2..> | 2023-05-03 10:35 | 462K | |
![[IMG]](/icons/image2.gif) | 0131395319-100x100.jpg | 2023-08-06 04:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0131395319-300x300.jpg | 2023-08-12 08:35 | 26K | |
![[IMG]](/icons/image2.gif) | 0131395319.jpg | 2023-05-03 11:20 | 153K | |
![[IMG]](/icons/image2.gif) | 01313953861-100x100.jpg | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 01313953861-300x300.jpg | 2023-08-12 04:49 | 19K | |
![[IMG]](/icons/image2.gif) | 01313953861.jpg | 2023-05-03 11:07 | 108K | |
![[IMG]](/icons/image2.gif) | 0131429159-100x100.jpg | 2023-08-06 11:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0131429159-300x300.jpg | 2023-08-10 19:39 | 19K | |
![[IMG]](/icons/image2.gif) | 0131429159.jpg | 2023-05-03 10:21 | 71K | |
![[IMG]](/icons/image2.gif) | 0131433563-100x100.jpg | 2023-08-05 16:26 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0131433563-300x300.jpg | 2023-08-05 15:35 | 16K | |
![[IMG]](/icons/image2.gif) | 0131433563.jpg | 2023-05-03 09:21 | 85K | |
![[IMG]](/icons/image2.gif) | 0131441515-500x500-1..> | 2023-05-04 02:14 | 52K | |
![[IMG]](/icons/image2.gif) | 0131447866-100x100.jpg | 2023-08-06 13:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0131447866-300x300.jpg | 2023-08-05 03:41 | 23K | |
![[IMG]](/icons/image2.gif) | 0131447866.jpg | 2023-05-03 09:51 | 96K | |
![[IMG]](/icons/image2.gif) | 0131456679-100x100.jpg | 2023-08-05 15:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0131456679-300x300.jpg | 2023-08-21 07:04 | 22K | |
![[IMG]](/icons/image2.gif) | 0131456679.jpg | 2023-05-03 10:04 | 113K | |
![[ ]](/icons/layout.gif) | 0131490958-spl.pdf | 2023-05-03 13:41 | 1.8M | |
![[IMG]](/icons/image2.gif) | 0131573101-500x500-1..> | 2023-05-03 09:19 | 50K | |
![[IMG]](/icons/image2.gif) | 0131679953-100x100.jpg | 2023-08-06 19:18 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0131679953-300x300.jpg | 2023-08-14 20:35 | 18K | |
![[IMG]](/icons/image2.gif) | 0131679953.jpg | 2023-05-03 10:20 | 82K | |
![[IMG]](/icons/image2.gif) | 0131707345-100x100.jpg | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0131707345-300x300.jpg | 2023-08-11 14:00 | 22K | |
![[IMG]](/icons/image2.gif) | 0131707345.jpg | 2023-05-03 09:22 | 132K | |
![[IMG]](/icons/image2.gif) | 0131716808-500x500-1..> | 2023-05-03 10:38 | 75K | |
![[IMG]](/icons/image2.gif) | 0131716808-500x5001-..> | 2023-05-03 09:37 | 75K | |
![[IMG]](/icons/image2.gif) | 0131722107-500x500-1..> | 2023-05-03 11:23 | 44K | |
![[IMG]](/icons/image2.gif) | 0131742760-100x100.jpg | 2023-08-05 03:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0131742760-300x300.jpg | 2023-08-05 04:35 | 21K | |
![[IMG]](/icons/image2.gif) | 0131742760.jpg | 2023-05-04 02:23 | 100K | |
![[ ]](/icons/layout.gif) | 0131755862_ism01.pdf | 2023-05-03 09:32 | 524K | |
![[IMG]](/icons/image2.gif) | 0131825089-100x100.jpg | 2023-08-05 03:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0131825089-300x300.jpg | 2023-08-13 23:17 | 17K | |
![[IMG]](/icons/image2.gif) | 0131825089.jpg | 2023-05-03 10:19 | 90K | |
![[IMG]](/icons/image2.gif) | 0131848682-100x100.jpg | 2023-08-06 07:48 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0131848682-300x300.jpg | 2023-08-05 15:35 | 12K | |
![[IMG]](/icons/image2.gif) | 0131848682.jpg | 2023-05-03 09:57 | 70K | |
![[IMG]](/icons/image2.gif) | 0131854992-100x100.jpg | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0131854992-300x300.jpg | 2023-08-12 04:49 | 25K | |
![[IMG]](/icons/image2.gif) | 0131854992.jpg | 2023-05-03 09:44 | 129K | |
![[IMG]](/icons/image2.gif) | 01318669151-500x500-..> | 2023-05-03 10:46 | 46K | |
![[IMG]](/icons/image2.gif) | 0131873253-100x100.jpg | 2023-08-08 06:37 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0131873253-300x300.jpg | 2023-08-11 20:41 | 24K | |
![[IMG]](/icons/image2.gif) | 0131873253.jpg | 2023-05-03 09:25 | 109K | |
![[IMG]](/icons/image2.gif) | 0131879251-100x100.jpg | 2023-08-09 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0131879251-300x300.jpg | 2023-08-05 04:35 | 20K | |
![[IMG]](/icons/image2.gif) | 0131879251.jpg | 2023-05-03 11:25 | 91K | |
![[IMG]](/icons/image2.gif) | 0131879693-100x100.jpg | 2023-08-06 10:18 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0131879693-300x300.jpg | 2023-08-13 23:17 | 33K | |
![[IMG]](/icons/image2.gif) | 0131879693.jpg | 2023-05-03 11:20 | 160K | |
![[IMG]](/icons/image2.gif) | 0131888595-SM-100x10..> | 2023-08-05 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0131888595-SM-300x30..> | 2023-08-05 17:23 | 20K | |
![[IMG]](/icons/image2.gif) | 0131888595-SM.jpg | 2023-05-04 02:16 | 112K | |
![[IMG]](/icons/image2.gif) | 0131891723-500x500-1..> | 2023-05-03 10:47 | 41K | |
![[IMG]](/icons/image2.gif) | 0131930648-100x100.jpg | 2023-08-05 15:29 | 5.8K | |
![[IMG]](/icons/image2.gif) | 0131930648-300x300.jpg | 2023-08-05 05:34 | 29K | |
![[IMG]](/icons/image2.gif) | 0131930648.jpg | 2023-05-04 02:13 | 130K | |
![[IMG]](/icons/image2.gif) | 013198926X-100x100.jpg | 2023-08-05 04:34 | 4.9K | |
![[IMG]](/icons/image2.gif) | 013198926X-300x300.jpg | 2023-08-06 07:49 | 35K | |
![[IMG]](/icons/image2.gif) | 013198926X.jpg | 2023-05-04 02:12 | 162K | |
![[IMG]](/icons/image2.gif) | 0131991108-100x100.jpg | 2023-08-05 16:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0131991108-300x300.jpg | 2023-08-08 14:34 | 21K | |
![[IMG]](/icons/image2.gif) | 0131991108.jpg | 2023-05-03 09:50 | 81K | |
![[IMG]](/icons/image2.gif) | 0132009161-500x500-1..> | 2023-05-03 11:19 | 47K | |
![[IMG]](/icons/image2.gif) | 0132118572-500x500-1..> | 2023-05-03 10:36 | 44K | |
![[IMG]](/icons/image2.gif) | 01321223081-500x500-..> | 2023-05-03 10:37 | 38K | |
![[IMG]](/icons/image2.gif) | 0132125420-100x100.jpg | 2023-08-09 15:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0132125420-300x300.jpg | 2023-08-05 01:51 | 18K | |
![[IMG]](/icons/image2.gif) | 0132125420.jpg | 2023-05-03 09:18 | 80K | |
![[IMG]](/icons/image2.gif) | 0132128195-100x100.jpg | 2023-08-06 11:15 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0132128195-300x300.jpg | 2023-08-12 15:36 | 12K | |
![[IMG]](/icons/image2.gif) | 0132128195.jpg | 2023-05-03 09:44 | 47K | |
![[IMG]](/icons/image2.gif) | 0132129485-522x600-1..> | 2023-08-08 23:56 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0132129485-522x600-1..> | 2023-08-15 11:23 | 16K | |
![[IMG]](/icons/image2.gif) | 0132129485-522x600-1..> | 2023-05-03 09:22 | 44K | |
![[IMG]](/icons/image2.gif) | 01321354691-500x500-..> | 2023-05-03 10:24 | 42K | |
![[IMG]](/icons/image2.gif) | 0132136422-100x100.jpg | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0132136422-300x300.jpg | 2023-08-05 15:35 | 17K | |
![[IMG]](/icons/image2.gif) | 0132136422.jpg | 2023-05-03 09:45 | 81K | |
![[ ]](/icons/compressed.gif) | 0132136430_Ch01a-180..> | 2023-05-03 09:45 | 460K | |
![[IMG]](/icons/image2.gif) | 01321456691-100x100.jpg | 2023-08-05 04:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | 01321456691-300x300.jpg | 2023-08-05 04:36 | 15K | |
![[IMG]](/icons/image2.gif) | 01321456691.jpg | 2023-05-03 09:23 | 84K | |
![[IMG]](/icons/image2.gif) | 0132145766-100x100.jpg | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0132145766-300x300.jpg | 2023-08-28 19:47 | 18K | |
![[IMG]](/icons/image2.gif) | 0132145766.jpg | 2023-05-03 10:17 | 80K | |
![[IMG]](/icons/image2.gif) | 01321463201-100x100.jpg | 2023-08-05 16:16 | 3.5K | |
![[IMG]](/icons/image2.gif) | 01321463201-300x300.jpg | 2023-08-15 07:57 | 24K | |
![[IMG]](/icons/image2.gif) | 01321463201.jpg | 2023-05-03 09:39 | 117K | |
![[IMG]](/icons/image2.gif) | 01321475561-500x500-..> | 2023-05-03 10:16 | 47K | |
![[IMG]](/icons/image2.gif) | 0132149117-100x100.jpg | 2023-08-05 15:33 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0132149117-300x300.jpg | 2023-08-14 14:13 | 20K | |
![[IMG]](/icons/image2.gif) | 0132149117.jpg | 2023-05-03 09:30 | 92K | |
![[IMG]](/icons/image2.gif) | 01321491171-100x100.jpg | 2023-08-07 14:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | 01321491171-300x300.jpg | 2023-08-05 05:34 | 20K | |
![[IMG]](/icons/image2.gif) | 01321491171.jpg | 2023-05-03 09:29 | 92K | |
![[IMG]](/icons/image2.gif) | 0132151006-500x500-1..> | 2023-05-03 10:57 | 73K | |
![[IMG]](/icons/image2.gif) | 0132151499-100x100.jpg | 2023-08-06 07:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0132151499-300x300.jpg | 2023-08-24 12:35 | 19K | |
![[IMG]](/icons/image2.gif) | 0132151499.jpg | 2023-05-03 10:02 | 86K | |
![[IMG]](/icons/image2.gif) | 0132154803-1-100x100..> | 2023-08-07 07:19 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0132154803-1-300x300..> | 2023-08-17 21:56 | 12K | |
![[IMG]](/icons/image2.gif) | 0132154803-1.jpg | 2023-05-03 09:33 | 68K | |
![[IMG]](/icons/image2.gif) | 0132154803-100x100.jpg | 2023-08-06 12:19 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0132154803-300x300.jpg | 2023-08-21 19:12 | 12K | |
![[IMG]](/icons/image2.gif) | 0132154803.jpg | 2023-05-03 09:32 | 68K | |
![[IMG]](/icons/image2.gif) | 0132158108-100x100.jpg | 2023-08-06 05:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0132158108-300x300.jpg | 2023-08-10 04:12 | 21K | |
![[IMG]](/icons/image2.gif) | 0132158108.jpg | 2023-05-03 09:27 | 104K | |
![[IMG]](/icons/image2.gif) | 0132158620-500x500-1..> | 2023-05-03 10:45 | 38K | |
![[IMG]](/icons/image2.gif) | 0132161117-100x100.jpg | 2023-08-05 02:29 | 1.7K | |
![[IMG]](/icons/image2.gif) | 0132161117-300x300.jpg | 2023-08-17 00:57 | 10K | |
![[IMG]](/icons/image2.gif) | 0132161117.jpg | 2023-05-03 09:36 | 57K | |
![[IMG]](/icons/image2.gif) | 0132162768-100x100.jpg | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132162768-300x300.jpg | 2023-08-06 08:47 | 24K | |
![[IMG]](/icons/image2.gif) | 0132162768.jpg | 2023-05-03 10:01 | 118K | |
![[IMG]](/icons/image2.gif) | 0132164361-100x100.jpg | 2023-08-05 05:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0132164361-300x300.jpg | 2023-09-04 20:54 | 22K | |
![[IMG]](/icons/image2.gif) | 0132164361.jpg | 2023-05-03 10:10 | 114K | |
![[IMG]](/icons/image2.gif) | 013221735X-100x100.jpg | 2023-08-06 13:07 | 2.4K | |
![[IMG]](/icons/image2.gif) | 013221735X-300x300.jpg | 2023-08-09 10:17 | 12K | |
![[IMG]](/icons/image2.gif) | 013221735X.jpg | 2023-05-03 10:35 | 57K | |
![[IMG]](/icons/image2.gif) | 0132272687-100x100.jpg | 2023-08-05 06:19 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0132272687-300x300.jpg | 2023-08-23 01:25 | 14K | |
![[IMG]](/icons/image2.gif) | 0132272687.jpg | 2023-05-03 09:39 | 65K | |
![[IMG]](/icons/image2.gif) | 0132310236-100x100.jpg | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0132310236-300x300.jpg | 2023-08-27 07:51 | 18K | |
![[IMG]](/icons/image2.gif) | 0132310236.jpg | 2023-05-03 10:08 | 89K | |
![[IMG]](/icons/image2.gif) | 0132310600-100x100.jpg | 2023-08-05 17:15 | 4.9K | |
![[IMG]](/icons/image2.gif) | 0132310600-300x300.jpg | 2023-08-24 13:16 | 31K | |
![[IMG]](/icons/image2.gif) | 0132310600.jpg | 2023-05-03 10:09 | 145K | |
![[IMG]](/icons/image2.gif) | 0132316811-100x100.jpg | 2023-08-06 13:10 | 4.6K | |
![[IMG]](/icons/image2.gif) | 0132316811-300x300.jpg | 2023-08-05 15:35 | 28K | |
![[IMG]](/icons/image2.gif) | 0132316811.jpg | 2023-05-03 10:24 | 146K | |
![[IMG]](/icons/image2.gif) | 0132435780-472x600-4..> | 2023-08-06 12:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0132435780-472x600-4..> | 2023-08-14 20:35 | 14K | |
![[IMG]](/icons/image2.gif) | 0132435780-472x600-4..> | 2023-05-04 02:12 | 39K | |
![[IMG]](/icons/image2.gif) | 0132459310-100x100.jpg | 2023-08-05 14:40 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0132459310-300x300.jpg | 2023-08-09 13:45 | 28K | |
![[IMG]](/icons/image2.gif) | 0132459310.jpg | 2023-05-04 02:27 | 114K | |
![[IMG]](/icons/image2.gif) | 0132473984_SM-100x10..> | 2023-08-08 22:59 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132473984_SM-300x30..> | 2023-08-12 08:35 | 23K | |
![[IMG]](/icons/image2.gif) | 0132473984_SM.jpg | 2023-05-04 02:17 | 106K | |
![[IMG]](/icons/image2.gif) | 0132492644-100x100.jpg | 2023-08-06 07:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0132492644-300x300.jpg | 2023-08-05 04:34 | 17K | |
![[IMG]](/icons/image2.gif) | 0132492644.jpg | 2023-05-04 01:56 | 100K | |
![[IMG]](/icons/image2.gif) | 0132492679-500x500-1..> | 2023-05-03 10:07 | 30K | |
![[ ]](/icons/layout.gif) | 0132497379_ism01.pdf | 2023-05-03 13:42 | 35K | |
![[ ]](/icons/layout.gif) | 0132497468-Ch04_ISM.pdf | 2023-05-03 11:12 | 130K | |
![[IMG]](/icons/image2.gif) | 0132540746-100x100.jpg | 2023-08-05 06:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0132540746-300x300.jpg | 2023-10-22 21:21 | 18K | |
![[IMG]](/icons/image2.gif) | 0132540746.jpg | 2023-05-03 10:45 | 85K | |
![[IMG]](/icons/image2.gif) | 013254380X-SM2-100x1..> | 2023-08-05 16:16 | 4.8K | |
![[IMG]](/icons/image2.gif) | 013254380X-SM2-300x3..> | 2023-08-05 01:15 | 29K | |
![[IMG]](/icons/image2.gif) | 013254380X-SM2.jpg | 2023-05-03 09:07 | 130K | |
![[IMG]](/icons/image2.gif) | 013254458X-500x50010..> | 2023-05-03 09:30 | 63K | |
![[IMG]](/icons/image2.gif) | 0132553112-500x500-1..> | 2023-05-03 09:23 | 59K | |
![[IMG]](/icons/image2.gif) | 0132555506-500x500-1..> | 2023-05-03 10:08 | 55K | |
![[IMG]](/icons/image2.gif) | 0132555522-100x100.jpg | 2023-08-08 06:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0132555522-300x300.jpg | 2023-08-09 02:53 | 27K | |
![[IMG]](/icons/image2.gif) | 0132555522.jpg | 2023-05-03 10:45 | 128K | |
![[IMG]](/icons/image2.gif) | 013255593X-100x100.jpg | 2023-08-05 04:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 013255593X-300x300.jpg | 2023-08-24 12:35 | 22K | |
![[IMG]](/icons/image2.gif) | 013255593X.jpg | 2023-05-03 10:16 | 108K | |
![[IMG]](/icons/image2.gif) | 0132556383-500x500-1..> | 2023-05-03 09:41 | 52K | |
![[IMG]](/icons/image2.gif) | 0132559226-100x100.jpg | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0132559226-300x300.jpg | 2023-08-12 06:52 | 15K | |
![[IMG]](/icons/image2.gif) | 0132559226.jpg | 2023-05-03 09:53 | 61K | |
![[IMG]](/icons/image2.gif) | 0132559927-100x100.jpg | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0132559927-300x300.jpg | 2023-08-05 14:33 | 14K | |
![[IMG]](/icons/image2.gif) | 0132559927-506x600-1..> | 2023-08-06 16:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0132559927-506x600-1..> | 2023-08-24 12:35 | 13K | |
![[IMG]](/icons/image2.gif) | 0132559927-506x600-1..> | 2023-05-03 09:43 | 34K | |
![[IMG]](/icons/image2.gif) | 0132559927.jpg | 2023-05-03 09:24 | 63K | |
![[IMG]](/icons/image2.gif) | 0132575671-100x100.jpg | 2023-08-06 12:14 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0132575671-300x300.jpg | 2023-08-11 20:41 | 22K | |
![[IMG]](/icons/image2.gif) | 0132575671.jpg | 2023-05-03 10:30 | 144K | |
![[IMG]](/icons/image2.gif) | 0132576147-100x100.jpg | 2023-08-05 01:27 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0132576147-300x300.jpg | 2023-08-15 09:51 | 24K | |
![[IMG]](/icons/image2.gif) | 0132576147-500x500-1..> | 2023-05-03 10:09 | 56K | |
![[IMG]](/icons/image2.gif) | 0132576147.jpg | 2023-05-03 10:11 | 109K | |
![[IMG]](/icons/image2.gif) | 0132576589-500x500-1..> | 2023-05-03 10:42 | 30K | |
![[IMG]](/icons/image2.gif) | 0132577534-100x100.jpg | 2023-08-05 05:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0132577534-300x300.jpg | 2023-08-25 22:45 | 21K | |
![[IMG]](/icons/image2.gif) | 0132577534.jpg | 2023-05-03 10:14 | 87K | |
![[IMG]](/icons/image2.gif) | 01325775341-100x100.jpg | 2023-08-06 07:49 | 4.3K | |
![[IMG]](/icons/image2.gif) | 01325775341-300x300.jpg | 2023-08-12 14:44 | 21K | |
![[IMG]](/icons/image2.gif) | 01325775341.jpg | 2023-05-03 10:14 | 87K | |
![[IMG]](/icons/image2.gif) | 0132582570-500x500-1..> | 2023-05-03 09:25 | 85K | |
![[ ]](/icons/unknown.gif) | 0132596121_ch_01.doc | 2023-05-03 09:43 | 43K | |
![[IMG]](/icons/image2.gif) | 0132605163-100x100.jpg | 2023-08-06 19:31 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132605163-300x300.jpg | 2023-10-12 15:27 | 28K | |
![[IMG]](/icons/image2.gif) | 0132605163.jpg | 2023-05-03 10:50 | 150K | |
![[IMG]](/icons/image2.gif) | 0132605368-500x500-1..> | 2023-05-03 10:09 | 52K | |
![[IMG]](/icons/image2.gif) | 0132616173-500x500-1..> | 2023-05-03 10:38 | 35K | |
![[IMG]](/icons/image2.gif) | 0132620553-100x100.jpg | 2023-08-05 10:49 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0132620553-300x300.jpg | 2023-08-05 15:30 | 26K | |
![[IMG]](/icons/image2.gif) | 0132620553.jpg | 2023-05-04 01:55 | 134K | |
![[IMG]](/icons/image2.gif) | 01326205531-100x100.jpg | 2023-08-05 02:13 | 4.4K | |
![[IMG]](/icons/image2.gif) | 01326205531-300x300.jpg | 2023-08-06 09:44 | 26K | |
![[IMG]](/icons/image2.gif) | 01326205531.jpg | 2023-05-04 01:51 | 134K | |
![[IMG]](/icons/image2.gif) | 0132622610-500x500-1..> | 2023-05-03 09:38 | 36K | |
![[IMG]](/icons/image2.gif) | 0132626322-100x100.jpg | 2023-08-06 05:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0132626322-300x300.jpg | 2023-08-08 21:06 | 15K | |
![[IMG]](/icons/image2.gif) | 0132626322.jpg | 2023-05-03 11:12 | 69K | |
![[IMG]](/icons/image2.gif) | 0132658127-500x5001-..> | 2023-05-03 11:25 | 60K | |
![[IMG]](/icons/image2.gif) | 0132664151-100x100.jpg | 2023-08-06 01:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0132664151-300x300.jpg | 2023-08-19 08:10 | 18K | |
![[IMG]](/icons/image2.gif) | 0132664151.jpg | 2023-05-03 09:51 | 88K | |
![[IMG]](/icons/image2.gif) | 0132665816-100x100.jpg | 2023-08-06 05:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0132665816-300x300.jpg | 2023-08-19 08:10 | 20K | |
![[IMG]](/icons/image2.gif) | 0132665816.jpg | 2023-05-04 02:10 | 111K | |
![[IMG]](/icons/image2.gif) | 0132719150-100x100.jpg | 2023-08-05 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0132719150-300x300.jpg | 2023-09-15 06:43 | 15K | |
![[IMG]](/icons/image2.gif) | 0132719150.jpg | 2023-05-03 11:17 | 73K | |
![[ ]](/icons/unknown.gif) | 0132724154_irm01.doc | 2023-05-03 11:11 | 135K | |
![[IMG]](/icons/image2.gif) | 0132729040-500x500-1..> | 2023-05-03 10:12 | 43K | |
![[ ]](/icons/unknown.gif) | 0132739615_im01.doc | 2023-05-03 10:46 | 86K | |
![[IMG]](/icons/image2.gif) | 0132741059-500x500-1..> | 2023-05-03 11:18 | 65K | |
![[IMG]](/icons/image2.gif) | 0132741377-100x100.jpg | 2023-08-05 04:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0132741377-300x300.jpg | 2023-09-19 02:11 | 19K | |
![[IMG]](/icons/image2.gif) | 0132741377.jpg | 2023-05-03 10:13 | 93K | |
![[IMG]](/icons/image2.gif) | 013274239X2-500x500-..> | 2023-05-03 09:45 | 43K | |
![[IMG]](/icons/image2.gif) | 0132742926-500x500-1..> | 2023-05-03 10:20 | 53K | |
![[IMG]](/icons/image2.gif) | 0132743957-100x100.jpg | 2023-08-05 15:31 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0132743957-300x300.jpg | 2023-08-08 14:29 | 23K | |
![[IMG]](/icons/image2.gif) | 0132743957.jpg | 2023-05-03 10:44 | 102K | |
![[IMG]](/icons/image2.gif) | 01327439571-100x100.jpg | 2023-08-05 06:25 | 4.3K | |
![[IMG]](/icons/image2.gif) | 01327439571-300x300.jpg | 2023-08-09 12:13 | 23K | |
![[IMG]](/icons/image2.gif) | 01327439571.jpg | 2023-05-03 09:56 | 102K | |
![[IMG]](/icons/image2.gif) | 0132744287-100x100.jpg | 2023-08-06 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0132744287-300x300.jpg | 2023-08-05 17:23 | 22K | |
![[IMG]](/icons/image2.gif) | 0132744287.jpg | 2023-05-03 10:46 | 98K | |
![[IMG]](/icons/image2.gif) | 01327473242-100x100.jpg | 2023-08-08 07:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | 01327473242-300x300.jpg | 2023-08-18 09:10 | 16K | |
![[IMG]](/icons/image2.gif) | 01327473242.jpg | 2023-05-03 09:52 | 73K | |
![[IMG]](/icons/image2.gif) | 01327511271-100x100.jpg | 2023-08-08 14:33 | 3.7K | |
![[IMG]](/icons/image2.gif) | 01327511271-300x300.jpg | 2023-08-08 17:45 | 19K | |
![[IMG]](/icons/image2.gif) | 01327511271.jpg | 2023-05-03 09:42 | 81K | |
![[IMG]](/icons/image2.gif) | 0132751267-100x100.jpg | 2023-08-08 07:33 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132751267-300x300.jpg | 2023-09-14 17:47 | 24K | |
![[IMG]](/icons/image2.gif) | 0132751267.jpg | 2023-05-03 09:33 | 119K | |
![[IMG]](/icons/image2.gif) | 0132751917-100x100.jpg | 2023-08-06 10:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0132751917-300x300.jpg | 2023-08-05 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | 0132751917.jpg | 2023-05-03 10:12 | 71K | |
![[IMG]](/icons/image2.gif) | 0132752670-100x100.jpg | 2023-08-05 04:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0132752670-300x300.jpg | 2023-08-09 10:17 | 22K | |
![[IMG]](/icons/image2.gif) | 0132752670.jpg | 2023-05-03 10:01 | 104K | |
![[IMG]](/icons/image2.gif) | 013275441X-500x5001-..> | 2023-05-03 09:39 | 59K | |
![[IMG]](/icons/image2.gif) | 0132756544-100x100.jpg | 2023-08-05 17:20 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0132756544-300x300.jpg | 2023-08-05 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 0132756544.jpg | 2023-05-04 02:18 | 81K | |
![[IMG]](/icons/image2.gif) | 0132760770-100x100.jpg | 2023-08-05 14:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0132760770-300x300.jpg | 2023-08-24 21:55 | 15K | |
![[IMG]](/icons/image2.gif) | 0132760770.jpg | 2023-05-03 10:33 | 68K | |
![[IMG]](/icons/image2.gif) | 0132770245-100x100.jpg | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0132770245-300x300.jpg | 2023-08-12 04:49 | 19K | |
![[IMG]](/icons/image2.gif) | 0132770245.jpg | 2023-05-03 10:14 | 90K | |
![[IMG]](/icons/image2.gif) | 0132773694-100x100.jpg | 2023-08-05 06:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0132773694-300x300.jpg | 2023-08-12 04:49 | 16K | |
![[IMG]](/icons/image2.gif) | 0132773694.jpg | 2023-05-03 10:32 | 77K | |
![[IMG]](/icons/image2.gif) | 0132773708-100x100.jpg | 2023-08-05 16:20 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0132773708-300x300.jpg | 2023-08-20 21:48 | 23K | |
![[IMG]](/icons/image2.gif) | 0132773708.jpg | 2023-05-03 09:36 | 116K | |
![[IMG]](/icons/image2.gif) | 01327737081-100x100.jpg | 2023-08-05 01:13 | 4.0K | |
![[IMG]](/icons/image2.gif) | 01327737081-300x300.jpg | 2023-08-12 04:49 | 23K | |
![[IMG]](/icons/image2.gif) | 01327737081.jpg | 2023-05-03 10:01 | 116K | |
![[IMG]](/icons/image2.gif) | 0132774178-500x500-1..> | 2023-05-03 09:49 | 30K | |
![[ ]](/icons/layout.gif) | 0132775425_Ch01-1591..> | 2023-05-03 10:20 | 458K | |
![[IMG]](/icons/image2.gif) | 0132776014-100x100.jpg | 2023-08-08 21:04 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0132776014-300x300.jpg | 2023-08-05 03:41 | 20K | |
![[IMG]](/icons/image2.gif) | 0132776014.jpg | 2023-05-03 10:40 | 88K | |
![[IMG]](/icons/image2.gif) | 01327833981-500x500-..> | 2023-05-04 02:14 | 55K | |
![[IMG]](/icons/image2.gif) | 0132788659-100x100.jpg | 2023-08-05 04:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132788659-300x300.jpg | 2023-08-08 14:34 | 21K | |
![[IMG]](/icons/image2.gif) | 0132788659.jpg | 2023-05-03 10:22 | 112K | |
![[ ]](/icons/unknown.gif) | 0132788667_CH01-1744..> | 2023-05-03 10:22 | 16K | |
![[IMG]](/icons/image2.gif) | 0132789469-100x100.jpg | 2023-08-05 05:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0132789469-300x300.jpg | 2023-08-22 23:45 | 23K | |
![[IMG]](/icons/image2.gif) | 0132789469.jpg | 2023-05-03 10:30 | 112K | |
![[IMG]](/icons/image2.gif) | 01328255891-500x500-..> | 2023-05-04 01:55 | 54K | |
![[IMG]](/icons/image2.gif) | 0132828944-100x100.jpg | 2023-08-05 15:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0132828944-300x300.jpg | 2023-09-03 16:54 | 16K | |
![[IMG]](/icons/image2.gif) | 0132828944.jpg | 2023-05-03 10:55 | 97K | |
![[IMG]](/icons/image2.gif) | 013283071X-100x100.jpg | 2023-08-05 14:36 | 4.2K | |
![[IMG]](/icons/image2.gif) | 013283071X-300x300.jpg | 2023-08-05 01:51 | 20K | |
![[IMG]](/icons/image2.gif) | 013283071X.jpg | 2023-05-03 09:05 | 103K | |
![[IMG]](/icons/image2.gif) | 0132832887-100x100.jpg | 2023-08-05 02:45 | 2.4K | |
![[IMG]](/icons/image2.gif) | 0132832887-300x300.jpg | 2023-08-23 01:25 | 12K | |
![[IMG]](/icons/image2.gif) | 0132832887.jpg | 2023-05-03 10:52 | 52K | |
![[IMG]](/icons/image2.gif) | 0132833212-100x100.jpg | 2023-08-05 01:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0132833212-300x300.jpg | 2023-08-09 12:13 | 24K | |
![[IMG]](/icons/image2.gif) | 0132833212.jpg | 2023-05-04 02:15 | 122K | |
![[IMG]](/icons/image2.gif) | 013284737X-500x500-1..> | 2023-05-03 10:23 | 41K | |
![[IMG]](/icons/image2.gif) | 0132856204-100x100.jpg | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0132856204-300x300.jpg | 2023-08-14 19:44 | 24K | |
![[IMG]](/icons/image2.gif) | 0132856204.jpg | 2023-05-03 10:24 | 111K | |
![[IMG]](/icons/image2.gif) | 0132858037-500x500-1..> | 2023-05-03 09:46 | 46K | |
![[IMG]](/icons/image2.gif) | 0132859297-100x100.jpg | 2023-08-05 16:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0132859297-300x300.jpg | 2023-08-15 16:02 | 16K | |
![[IMG]](/icons/image2.gif) | 0132859297.jpg | 2023-05-03 09:52 | 83K | |
![[IMG]](/icons/image2.gif) | 0132866889-100x100.jpg | 2023-08-05 16:28 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0132866889-300x300.jpg | 2023-08-05 03:41 | 18K | |
![[IMG]](/icons/image2.gif) | 0132866889.jpg | 2023-05-04 02:02 | 112K | |
![[IMG]](/icons/image2.gif) | 0132876825-500x5001-..> | 2023-05-04 02:14 | 61K | |
![[IMG]](/icons/image2.gif) | 0132876825-500x5001-..> | 2023-05-04 01:50 | 61K | |
![[IMG]](/icons/image2.gif) | 01328768251-500x500-..> | 2023-05-04 02:14 | 61K | |
![[IMG]](/icons/image2.gif) | 0132893622-500x500-1..> | 2023-05-03 11:04 | 66K | |
![[IMG]](/icons/image2.gif) | 01329071191-500x500-..> | 2023-05-04 01:55 | 45K | |
![[IMG]](/icons/image2.gif) | 0132915383-100x100.jpg | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0132915383-300x300.jpg | 2023-08-14 20:35 | 21K | |
![[IMG]](/icons/image2.gif) | 0132915383.jpg | 2023-05-03 09:33 | 102K | |
![[IMG]](/icons/image2.gif) | 0132916525-500x500-1..> | 2023-05-03 10:37 | 71K | |
![[IMG]](/icons/image2.gif) | 0132923726-100x100.jpg | 2023-08-06 03:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0132923726-300x300.jpg | 2023-08-05 21:01 | 25K | |
![[IMG]](/icons/image2.gif) | 0132923726.jpg | 2023-05-03 10:23 | 132K | |
![[IMG]](/icons/image2.gif) | 01329237261-100x100.jpg | 2023-08-06 08:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | 01329237261-300x300.jpg | 2023-08-15 11:23 | 25K | |
![[IMG]](/icons/image2.gif) | 01329237261.jpg | 2023-05-03 10:36 | 132K | |
![[IMG]](/icons/image2.gif) | 0132926865-500x500-1..> | 2023-05-03 11:18 | 32K | |
![[IMG]](/icons/image2.gif) | 01329268651-500x500-..> | 2023-05-03 10:00 | 32K | |
![[IMG]](/icons/image2.gif) | 01329301961-100x100.jpg | 2023-08-05 05:29 | 4.7K | |
![[IMG]](/icons/image2.gif) | 01329301961-300x300.jpg | 2023-08-10 16:04 | 37K | |
![[IMG]](/icons/image2.gif) | 01329301961.jpg | 2023-05-03 09:50 | 150K | |
![[IMG]](/icons/image2.gif) | 0132935287-100x100.jpg | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0132935287-300x300.jpg | 2023-08-09 18:40 | 17K | |
![[IMG]](/icons/image2.gif) | 0132935287.jpg | 2023-05-03 09:19 | 84K | |
![[IMG]](/icons/image2.gif) | 0132935791-100x100.jpg | 2023-08-05 04:34 | 5.0K | |
![[IMG]](/icons/image2.gif) | 0132935791-300x300.jpg | 2023-08-08 16:42 | 30K | |
![[IMG]](/icons/image2.gif) | 0132935791.jpg | 2023-05-03 10:46 | 131K | |
![[IMG]](/icons/image2.gif) | 0132946033-100x100.jpg | 2023-08-08 15:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0132946033-300x300.jpg | 2023-08-06 17:28 | 15K | |
![[IMG]](/icons/image2.gif) | 0132946033.jpg | 2023-05-03 11:13 | 74K | |
![[IMG]](/icons/image2.gif) | 0132950618-100x100.jpg | 2023-08-05 14:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0132950618-300x300.jpg | 2023-08-22 20:06 | 15K | |
![[IMG]](/icons/image2.gif) | 0132950618.jpg | 2023-05-03 09:27 | 61K | |
![[IMG]](/icons/image2.gif) | 0132953463-500x500-1..> | 2023-05-03 09:25 | 51K | |
![[IMG]](/icons/image2.gif) | 01329551482-100x100.jpg | 2023-08-05 14:35 | 4.6K | |
![[IMG]](/icons/image2.gif) | 01329551482-300x300.jpg | 2023-10-16 23:36 | 26K | |
![[IMG]](/icons/image2.gif) | 01329551482.jpg | 2023-05-03 10:38 | 131K | |
![[IMG]](/icons/image2.gif) | 0132968088-100x100.jpg | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0132968088-300x300.jpg | 2023-09-04 20:54 | 27K | |
![[IMG]](/icons/image2.gif) | 0132968088.jpg | 2023-05-03 11:14 | 124K | |
![[IMG]](/icons/image2.gif) | 0132971291-100x100.jpg | 2023-08-06 11:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0132971291-300x300.jpg | 2023-08-06 10:15 | 21K | |
![[IMG]](/icons/image2.gif) | 0132971291.jpg | 2023-05-03 10:20 | 94K | |
![[IMG]](/icons/image2.gif) | 0132984660-100x100.jpg | 2023-08-06 07:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0132984660-300x300.jpg | 2023-08-12 04:50 | 19K | |
![[IMG]](/icons/image2.gif) | 0132984660.jpg | 2023-05-03 09:53 | 93K | |
![[IMG]](/icons/image2.gif) | 0132989999-500x500-1..> | 2023-05-03 10:27 | 36K | |
![[IMG]](/icons/image2.gif) | 013299044X-100x100.jpg | 2023-08-05 05:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | 013299044X-300x300.jpg | 2023-08-05 01:13 | 20K | |
![[IMG]](/icons/image2.gif) | 013299044X.jpg | 2023-05-03 09:06 | 93K | |
![[IMG]](/icons/image2.gif) | 0132991292-100x100.jpg | 2023-08-06 05:44 | 2.1K | |
![[IMG]](/icons/image2.gif) | 0132991292-300x300.jpg | 2023-08-20 21:48 | 11K | |
![[IMG]](/icons/image2.gif) | 0132991292.jpg | 2023-05-04 02:11 | 67K | |
![[IMG]](/icons/image2.gif) | 0132991330-100x100.jpg | 2023-08-05 01:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0132991330-300x300.jpg | 2023-08-10 19:39 | 16K | |
![[IMG]](/icons/image2.gif) | 0132991330.jpg | 2023-05-03 11:01 | 91K | |
![[IMG]](/icons/image2.gif) | 0132992817-100x100.jpg | 2023-08-05 16:28 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0132992817-300x300.jpg | 2023-08-12 04:49 | 23K | |
![[IMG]](/icons/image2.gif) | 0132992817.jpg | 2023-05-03 09:31 | 119K | |
![[IMG]](/icons/image2.gif) | 0132992914-100x100.jpg | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0132992914-300x300.jpg | 2023-08-10 18:33 | 24K | |
![[IMG]](/icons/image2.gif) | 0132992914.jpg | 2023-05-03 10:37 | 146K | |
![[ ]](/icons/layout.gif) | 0133007472-tspl.pdf | 2023-05-03 13:42 | 231K | |
![[IMG]](/icons/image2.gif) | 01330095641-100x100.jpg | 2023-08-05 06:25 | 4.6K | |
![[IMG]](/icons/image2.gif) | 01330095641-300x300.jpg | 2023-08-08 14:34 | 29K | |
![[IMG]](/icons/image2.gif) | 01330095641.jpg | 2023-05-03 11:04 | 155K | |
![[IMG]](/icons/image2.gif) | 0133017370-100x100.jpg | 2023-08-06 10:20 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0133017370-300x300.jpg | 2023-08-05 14:41 | 24K | |
![[IMG]](/icons/image2.gif) | 0133017370.jpg | 2023-05-03 10:04 | 102K | |
![[ ]](/icons/layout.gif) | 0133022382-tspl.pdf | 2023-05-03 13:43 | 175K | |
![[IMG]](/icons/image2.gif) | 01330229271-100x100.jpg | 2023-08-05 15:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | 01330229271-300x300.jpg | 2023-08-20 21:48 | 20K | |
![[IMG]](/icons/image2.gif) | 01330229271.jpg | 2023-05-03 10:27 | 98K | |
![[ ]](/icons/compressed.gif) | 0133022986_tb_02-177..> | 2023-05-03 10:27 | 121K | |
![[IMG]](/icons/image2.gif) | 0133023354-500x500-1..> | 2023-05-03 09:44 | 47K | |
![[ ]](/icons/compressed.gif) | 0133023443_SM_Sample..> | 2023-05-03 13:43 | 220K | |
![[IMG]](/icons/image2.gif) | 01330234431-100x100.jpg | 2023-08-05 02:03 | 3.2K | |
![[IMG]](/icons/image2.gif) | 01330234431-300x300.jpg | 2023-08-05 03:43 | 17K | |
![[IMG]](/icons/image2.gif) | 01330234431.jpg | 2023-05-04 02:15 | 67K | |
![[IMG]](/icons/image2.gif) | 013302444X-500x5001-..> | 2023-05-03 09:31 | 62K | |
![[IMG]](/icons/image2.gif) | 0133029670-100x100.jpg | 2023-08-05 16:26 | 2.3K | |
![[IMG]](/icons/image2.gif) | 0133029670-300x300.jpg | 2023-08-06 08:43 | 11K | |
![[IMG]](/icons/image2.gif) | 0133029670.jpg | 2023-05-03 11:18 | 61K | |
![[IMG]](/icons/image2.gif) | 0133033090-500x5001-..> | 2023-05-03 09:58 | 54K | |
![[IMG]](/icons/image2.gif) | 0133034003-500x5002-..> | 2023-05-04 02:07 | 45K | |
![[IMG]](/icons/image2.gif) | 0133034070-500x500-1..> | 2023-05-03 10:42 | 56K | |
![[IMG]](/icons/image2.gif) | 0133040674-500x5002-..> | 2023-05-03 09:42 | 48K | |
![[IMG]](/icons/image2.gif) | 0133050572-500x500-1..> | 2023-05-03 10:23 | 39K | |
![[IMG]](/icons/image2.gif) | 0133050696-100x100.jpg | 2023-08-05 14:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133050696-300x300.jpg | 2023-09-04 20:54 | 20K | |
![[IMG]](/icons/image2.gif) | 0133050696.jpg | 2023-05-03 10:55 | 98K | |
![[IMG]](/icons/image2.gif) | 0133050904-500x5002-..> | 2023-05-03 10:32 | 57K | |
![[IMG]](/icons/image2.gif) | 0133058352-100x100.jpg | 2023-08-06 13:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0133058352-300x300.jpg | 2023-08-08 07:33 | 21K | |
![[IMG]](/icons/image2.gif) | 0133058352.jpg | 2023-05-03 10:17 | 111K | |
![[IMG]](/icons/image2.gif) | 013305974X-500x50011..> | 2023-05-03 09:07 | 49K | |
![[IMG]](/icons/image2.gif) | 0133061639-100x100.jpg | 2023-08-05 17:17 | 2.0K | |
![[IMG]](/icons/image2.gif) | 0133061639-300x300.jpg | 2023-08-10 19:39 | 10K | |
![[IMG]](/icons/image2.gif) | 0133061639.jpg | 2023-05-03 10:28 | 59K | |
![[IMG]](/icons/image2.gif) | 0133068307-500x500-1..> | 2023-05-03 10:18 | 42K | |
![[ ]](/icons/unknown.gif) | 0133068307-Checkpoin..> | 2023-05-03 10:18 | 20K | |
![[IMG]](/icons/image2.gif) | 01330683071-500x500-..> | 2023-05-03 10:18 | 42K | |
![[IMG]](/icons/image2.gif) | 0133073777-500x500-1..> | 2023-05-03 09:23 | 46K | |
![[IMG]](/icons/image2.gif) | 0133073831-500x5001-..> | 2023-05-03 10:46 | 52K | |
![[IMG]](/icons/image2.gif) | 0133083578-500x500-1..> | 2023-05-03 10:00 | 49K | |
![[IMG]](/icons/image2.gif) | 0133084043-100x100.jpg | 2023-08-05 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0133084043-300x300.jpg | 2023-08-11 04:33 | 15K | |
![[IMG]](/icons/image2.gif) | 0133084043.jpg | 2023-05-03 11:02 | 72K | |
![[IMG]](/icons/image2.gif) | 0133096017-100x100.jpg | 2023-08-06 11:19 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0133096017-300x300.jpg | 2023-08-08 14:34 | 19K | |
![[IMG]](/icons/image2.gif) | 0133096017.jpg | 2023-05-03 10:53 | 106K | |
![[IMG]](/icons/image2.gif) | 0133096084-500x500-1..> | 2023-05-03 09:27 | 47K | |
![[IMG]](/icons/image2.gif) | 0133098729-100x100.jpg | 2023-08-05 14:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0133098729-300x300.jpg | 2023-08-18 10:03 | 29K | |
![[IMG]](/icons/image2.gif) | 0133098729.jpg | 2023-05-03 10:46 | 138K | |
![[IMG]](/icons/image2.gif) | 013309880X4-100x100.jpg | 2023-08-06 10:17 | 5.0K | |
![[IMG]](/icons/image2.gif) | 013309880X4-300x300.jpg | 2023-08-28 21:31 | 33K | |
![[IMG]](/icons/image2.gif) | 013309880X4.jpg | 2023-05-03 10:32 | 182K | |
![[IMG]](/icons/image2.gif) | 0133103064-100x100.jpg | 2023-08-05 06:25 | 2.0K | |
![[IMG]](/icons/image2.gif) | 0133103064-300x300.jpg | 2023-09-08 15:33 | 10K | |
![[IMG]](/icons/image2.gif) | 0133103064.jpg | 2023-05-03 10:28 | 61K | |
![[IMG]](/icons/image2.gif) | 0133125904-100x100.jpg | 2023-08-06 11:18 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0133125904-300x300.jpg | 2023-08-21 07:04 | 19K | |
![[IMG]](/icons/image2.gif) | 0133125904.jpg | 2023-05-03 09:23 | 85K | |
![[IMG]](/icons/image2.gif) | 0133126145-500x500-1..> | 2023-05-03 10:24 | 61K | |
![[ ]](/icons/unknown.gif) | 0133126161_tif_1.doc | 2023-05-04 02:27 | 89K | |
![[ ]](/icons/compressed.gif) | 0133128059_ISM_CH01-..> | 2023-05-03 09:23 | 13K | |
![[IMG]](/icons/image2.gif) | 0133129454-500x500-1..> | 2023-05-03 10:03 | 46K | |
![[IMG]](/icons/image2.gif) | 01331294541-500x500-..> | 2023-05-03 10:03 | 46K | |
![[IMG]](/icons/image2.gif) | 0133129543-500x5001-..> | 2023-05-03 09:34 | 25K | |
![[IMG]](/icons/image2.gif) | 01331297481-500x500-..> | 2023-05-03 11:22 | 37K | |
![[IMG]](/icons/image2.gif) | 0133130762-100x100.jpg | 2023-08-05 01:56 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0133130762-300x300.jpg | 2023-08-18 10:49 | 20K | |
![[IMG]](/icons/image2.gif) | 0133130762.jpg | 2023-05-03 10:55 | 98K | |
![[IMG]](/icons/image2.gif) | 01331308001-500x500-..> | 2023-05-03 09:18 | 53K | |
![[IMG]](/icons/image2.gif) | 0133130983-500x500-1..> | 2023-05-03 09:58 | 30K | |
![[IMG]](/icons/image2.gif) | 013314867X-100x100.jpg | 2023-08-08 14:32 | 4.1K | |
![[IMG]](/icons/image2.gif) | 013314867X-300x300.jpg | 2023-08-16 22:56 | 22K | |
![[IMG]](/icons/image2.gif) | 013314867X.jpg | 2023-05-03 10:06 | 81K | |
![[IMG]](/icons/image2.gif) | 0133148688-100x100.jpg | 2023-08-08 06:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0133148688-300x300.jpg | 2023-09-06 23:57 | 27K | |
![[IMG]](/icons/image2.gif) | 0133148688.jpg | 2023-05-03 09:28 | 113K | |
![[IMG]](/icons/image2.gif) | 0133156591-100x100.jpg | 2023-08-05 06:15 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0133156591-300x300.jpg | 2023-09-19 06:07 | 20K | |
![[IMG]](/icons/image2.gif) | 0133156591.jpg | 2023-05-03 10:23 | 99K | |
![[IMG]](/icons/image2.gif) | 0133156842-100x100.jpg | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0133156842-300x300.jpg | 2023-09-01 08:54 | 21K | |
![[IMG]](/icons/image2.gif) | 0133156842.jpg | 2023-05-03 11:03 | 94K | |
![[IMG]](/icons/image2.gif) | 013325092X2-500x500-..> | 2023-05-03 09:21 | 50K | |
![[IMG]](/icons/image2.gif) | 013325092X3-500x500-..> | 2023-05-03 10:27 | 50K | |
![[IMG]](/icons/image2.gif) | 0133251039-100x100.jpg | 2023-08-08 04:48 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0133251039-300x300.jpg | 2023-08-16 01:58 | 14K | |
![[IMG]](/icons/image2.gif) | 0133251039.jpg | 2023-05-03 11:01 | 76K | |
![[IMG]](/icons/image2.gif) | 01332510391-100x100.jpg | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 01332510391-300x300.jpg | 2023-08-05 04:35 | 14K | |
![[IMG]](/icons/image2.gif) | 01332510391.jpg | 2023-05-03 09:55 | 76K | |
![[IMG]](/icons/image2.gif) | 0133254119-100x100.jpg | 2023-08-08 07:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0133254119-300x300.jpg | 2023-08-30 11:17 | 18K | |
![[IMG]](/icons/image2.gif) | 0133254119.jpg | 2023-05-03 10:31 | 105K | |
![[IMG]](/icons/image2.gif) | 0133254194-1-100x100..> | 2023-08-06 08:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0133254194-1-300x300..> | 2023-08-05 03:41 | 23K | |
![[IMG]](/icons/image2.gif) | 0133254194-1.jpg | 2023-05-03 09:28 | 138K | |
![[IMG]](/icons/image2.gif) | 0133254194-100x100.jpg | 2023-08-07 10:43 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0133254194-300x300.jpg | 2023-08-20 19:36 | 23K | |
![[IMG]](/icons/image2.gif) | 0133254194.jpg | 2023-05-03 09:33 | 138K | |
![[IMG]](/icons/image2.gif) | 0133254208-100x100.jpg | 2023-08-05 14:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0133254208-300x300.jpg | 2023-08-20 19:36 | 13K | |
![[IMG]](/icons/image2.gif) | 0133254208.jpg | 2023-05-03 10:47 | 49K | |
![[IMG]](/icons/image2.gif) | 0133257835-100x100.jpg | 2023-08-06 05:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0133257835-300x300.jpg | 2023-08-11 04:33 | 18K | |
![[IMG]](/icons/image2.gif) | 0133257835.jpg | 2023-05-03 09:26 | 88K | |
![[IMG]](/icons/image2.gif) | 013335508X-100x100.jpg | 2023-08-07 05:28 | 3.9K | |
![[IMG]](/icons/image2.gif) | 013335508X-300x300.jpg | 2023-08-06 10:20 | 23K | |
![[IMG]](/icons/image2.gif) | 013335508X.jpg | 2023-05-03 10:22 | 127K | |
![[IMG]](/icons/image2.gif) | 0133360903-100x100.jpg | 2023-08-05 01:08 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133360903-300x300.jpg | 2023-08-27 05:21 | 25K | |
![[IMG]](/icons/image2.gif) | 0133360903.jpg | 2023-05-04 01:56 | 134K | |
![[IMG]](/icons/image2.gif) | 013336092X-500x500-1..> | 2023-05-03 09:56 | 37K | |
![[IMG]](/icons/image2.gif) | 0133369137-100x100.jpg | 2023-08-05 15:35 | 4.9K | |
![[IMG]](/icons/image2.gif) | 0133369137-300x300.jpg | 2023-10-29 12:50 | 29K | |
![[IMG]](/icons/image2.gif) | 0133369137.jpg | 2023-05-03 09:55 | 140K | |
![[IMG]](/icons/image2.gif) | 0133370437-100x100.jpg | 2023-08-05 01:13 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133370437-300x300.jpg | 2023-09-03 16:54 | 21K | |
![[IMG]](/icons/image2.gif) | 0133370437.jpg | 2023-05-03 10:10 | 93K | |
![[IMG]](/icons/image2.gif) | 0133370461-100x100.jpg | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0133370461-300x300.jpg | 2023-08-24 21:55 | 21K | |
![[IMG]](/icons/image2.gif) | 0133370461.jpg | 2023-05-03 10:39 | 112K | |
![[IMG]](/icons/image2.gif) | 01333704611-100x100.jpg | 2023-08-08 20:05 | 3.6K | |
![[IMG]](/icons/image2.gif) | 01333704611-300x300.jpg | 2023-08-05 04:36 | 21K | |
![[IMG]](/icons/image2.gif) | 01333704611.jpg | 2023-05-03 09:39 | 112K | |
![[IMG]](/icons/image2.gif) | 01333793371-500x500-..> | 2023-05-03 09:18 | 62K | |
![[ ]](/icons/layout.gif) | 0133400824-tspl.pdf | 2023-05-03 13:42 | 99K | |
![[IMG]](/icons/image2.gif) | 0133403882-100x100.jpg | 2023-08-05 03:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0133403882-300x300.jpg | 2023-08-14 23:08 | 12K | |
![[IMG]](/icons/image2.gif) | 0133403882.jpg | 2023-05-03 09:35 | 53K | |
![[IMG]](/icons/image2.gif) | 0133406954-500x500-1..> | 2023-05-03 10:46 | 62K | |
![[IMG]](/icons/image2.gif) | 0133407934-100x100.jpg | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133407934-300x300.jpg | 2023-08-20 01:49 | 28K | |
![[IMG]](/icons/image2.gif) | 0133407934.jpg | 2023-05-03 10:07 | 144K | |
![[IMG]](/icons/image2.gif) | 0133423824-500x500-1..> | 2023-05-03 09:34 | 46K | |
![[IMG]](/icons/image2.gif) | 0133423824-500x500-2..> | 2023-05-03 10:04 | 46K | |
![[IMG]](/icons/image2.gif) | 0133423972-100x100.jpg | 2023-08-05 16:28 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0133423972-300x300.jpg | 2023-10-19 03:55 | 11K | |
![[IMG]](/icons/image2.gif) | 0133423972.jpg | 2023-05-04 02:26 | 55K | |
![[IMG]](/icons/image2.gif) | 01334298651-500x500-..> | 2023-05-03 09:32 | 41K | |
![[ ]](/icons/layout.gif) | 0133439291_ism01-207..> | 2023-05-03 10:25 | 726K | |
![[IMG]](/icons/image2.gif) | 0133444791-100x100.jpg | 2023-08-05 17:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0133444791-300x300.jpg | 2023-08-05 01:51 | 14K | |
![[IMG]](/icons/image2.gif) | 0133444791.jpg | 2023-05-03 08:57 | 77K | |
![[IMG]](/icons/image2.gif) | 0133446336-100x100.jpg | 2023-08-05 01:56 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0133446336-300x300.jpg | 2023-08-17 21:56 | 15K | |
![[IMG]](/icons/image2.gif) | 0133446336.jpg | 2023-05-03 09:41 | 62K | |
![[IMG]](/icons/image2.gif) | 0133446344-100x100.jpg | 2023-08-05 03:41 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0133446344-300x300.jpg | 2023-08-09 20:29 | 27K | |
![[IMG]](/icons/image2.gif) | 0133446344-490x600-1..> | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133446344-490x600-1..> | 2023-08-14 20:35 | 25K | |
![[IMG]](/icons/image2.gif) | 0133446344-490x600-1..> | 2023-05-03 09:43 | 75K | |
![[IMG]](/icons/image2.gif) | 0133446344.jpg | 2023-05-03 09:23 | 129K | |
![[IMG]](/icons/image2.gif) | 0133450880-100x100.jpg | 2023-08-06 13:10 | 2.3K | |
![[IMG]](/icons/image2.gif) | 0133450880-300x300.jpg | 2023-08-11 04:33 | 11K | |
![[IMG]](/icons/image2.gif) | 0133450880.jpg | 2023-05-03 10:02 | 49K | |
![[IMG]](/icons/image2.gif) | 01334512751-500x500-..> | 2023-05-03 11:21 | 65K | |
![[IMG]](/icons/image2.gif) | 0133454428-100x100.jpg | 2023-08-05 04:35 | 2.0K | |
![[IMG]](/icons/image2.gif) | 0133454428-300x300.jpg | 2023-08-21 04:41 | 8.7K | |
![[IMG]](/icons/image2.gif) | 0133454428.jpg | 2023-05-03 10:36 | 45K | |
![[IMG]](/icons/image2.gif) | 0133457109-500x500-1..> | 2023-05-03 10:26 | 40K | |
![[IMG]](/icons/image2.gif) | 0133457109-500x5001-..> | 2023-05-03 09:19 | 40K | |
![[IMG]](/icons/image2.gif) | 0133457230-500x500-1..> | 2023-05-03 09:50 | 43K | |
![[IMG]](/icons/image2.gif) | 0133457230-500x5001-..> | 2023-05-03 10:19 | 43K | |
![[IMG]](/icons/image2.gif) | 0133458555-510x600-1..> | 2023-08-05 01:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0133458555-510x600-1..> | 2023-08-21 08:26 | 17K | |
![[IMG]](/icons/image2.gif) | 0133458555-510x600-1..> | 2023-05-03 09:53 | 56K | |
![[IMG]](/icons/image2.gif) | 01334722641-100x100.jpg | 2023-08-08 07:32 | 4.4K | |
![[IMG]](/icons/image2.gif) | 01334722641-300x300.jpg | 2023-08-08 17:45 | 29K | |
![[IMG]](/icons/image2.gif) | 01334722641.jpg | 2023-05-03 09:56 | 138K | |
![[IMG]](/icons/image2.gif) | 0133477436-500x500-1..> | 2023-05-03 09:35 | 67K | |
![[IMG]](/icons/image2.gif) | 0133480348-100x100.jpg | 2023-08-05 04:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0133480348-300x300.jpg | 2023-09-01 21:32 | 24K | |
![[IMG]](/icons/image2.gif) | 0133480348.jpg | 2023-05-03 09:51 | 125K | |
![[IMG]](/icons/image2.gif) | 0133485080-100x100.jpg | 2023-08-05 05:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0133485080-300x300.jpg | 2023-08-05 04:35 | 22K | |
![[IMG]](/icons/image2.gif) | 0133485080.jpg | 2023-05-04 02:10 | 112K | |
![[ ]](/icons/layout.gif) | 0133485110_ism01-204..> | 2023-05-04 02:10 | 376K | |
![[IMG]](/icons/image2.gif) | 0133486885-100x100.jpg | 2023-08-07 11:32 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0133486885-300x300.jpg | 2023-09-04 20:54 | 13K | |
![[IMG]](/icons/image2.gif) | 0133486885.jpg | 2023-05-04 01:53 | 59K | |
![[IMG]](/icons/image2.gif) | 013349991X-100x100.jpg | 2023-08-09 15:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | 013349991X-300x300.jpg | 2023-08-06 10:20 | 25K | |
![[IMG]](/icons/image2.gif) | 013349991X.jpg | 2023-05-03 10:45 | 119K | |
![[IMG]](/icons/image2.gif) | 0133506290-100x100.jpg | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0133506290-300x300.jpg | 2023-08-20 19:36 | 21K | |
![[IMG]](/icons/image2.gif) | 0133506290-500x500-1..> | 2023-05-03 09:47 | 58K | |
![[IMG]](/icons/image2.gif) | 0133506290.jpg | 2023-05-03 09:38 | 113K | |
![[IMG]](/icons/image2.gif) | 0133506320-100x100.jpg | 2023-08-05 16:27 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0133506320-300x300.jpg | 2023-08-09 02:53 | 23K | |
![[IMG]](/icons/image2.gif) | 0133506320.jpg | 2023-05-03 11:06 | 108K | |
![[IMG]](/icons/image2.gif) | 0133507335-100x100.jpg | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0133507335-300x300.jpg | 2023-08-14 14:13 | 17K | |
![[IMG]](/icons/image2.gif) | 0133507335.jpg | 2023-05-03 09:35 | 94K | |
![[IMG]](/icons/image2.gif) | 0133523675-100x100.jpg | 2023-08-05 04:31 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0133523675-300x300.jpg | 2023-08-08 08:38 | 17K | |
![[IMG]](/icons/image2.gif) | 0133523675.jpg | 2023-05-03 10:13 | 81K | |
![[IMG]](/icons/image2.gif) | 0133545172-500x5001-..> | 2023-05-03 10:01 | 44K | |
![[IMG]](/icons/image2.gif) | 0133545199_TestBank-..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0133545199_TestBank-..> | 2023-08-12 04:39 | 17K | |
![[IMG]](/icons/image2.gif) | 0133545199_TestBank.jpg | 2023-05-04 02:12 | 71K | |
![[IMG]](/icons/image2.gif) | 0133546438-500x500-1..> | 2023-05-03 09:58 | 42K | |
![[IMG]](/icons/image2.gif) | 0133571750-100x100.jpg | 2023-08-08 10:58 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0133571750-300x300.jpg | 2023-08-15 20:03 | 21K | |
![[IMG]](/icons/image2.gif) | 0133571750-500x500-1..> | 2023-05-03 09:21 | 49K | |
![[IMG]](/icons/image2.gif) | 0133571750.jpg | 2023-05-03 11:18 | 93K | |
![[IMG]](/icons/image2.gif) | 0133575217.jpg | 2023-05-04 02:16 | 15K | |
![[IMG]](/icons/image2.gif) | 01335768411-100x100.jpg | 2023-08-06 02:45 | 4.9K | |
![[IMG]](/icons/image2.gif) | 01335768411-300x300.jpg | 2023-08-17 09:42 | 37K | |
![[IMG]](/icons/image2.gif) | 01335768411.jpg | 2023-05-03 10:28 | 184K | |
![[ ]](/icons/unknown.gif) | 0133582345_tif01.doc | 2023-05-03 09:50 | 205K | |
![[IMG]](/icons/image2.gif) | 013374163X-500x500-1..> | 2023-05-03 09:28 | 47K | |
![[IMG]](/icons/image2.gif) | 013374163X1-500x500-..> | 2023-05-03 09:39 | 47K | |
![[ ]](/icons/layout.gif) | 0133747182-tspl.pdf | 2023-05-03 14:06 | 87K | |
![[IMG]](/icons/image2.gif) | 0133769054-477x611-1..> | 2023-08-06 05:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0133769054-477x611-1..> | 2023-08-14 03:16 | 14K | |
![[IMG]](/icons/image2.gif) | 0133769054-477x611-1..> | 2023-05-03 10:42 | 61K | |
![[IMG]](/icons/image2.gif) | 0133769402-100x100.jpg | 2023-08-05 16:26 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0133769402-300x300.jpg | 2023-08-28 22:18 | 22K | |
![[IMG]](/icons/image2.gif) | 0133769402.jpg | 2023-05-03 09:58 | 106K | |
![[IMG]](/icons/image2.gif) | 0133775844-100x100.jpg | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0133775844-300x300.jpg | 2023-08-13 16:06 | 22K | |
![[IMG]](/icons/image2.gif) | 0133775844.jpg | 2023-05-03 10:37 | 99K | |
![[IMG]](/icons/image2.gif) | 0133776743-100x100.jpg | 2023-08-05 06:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0133776743-300x300.jpg | 2023-08-09 19:39 | 14K | |
![[IMG]](/icons/image2.gif) | 0133776743.jpg | 2023-05-03 10:57 | 65K | |
![[IMG]](/icons/image2.gif) | 0133801314-488x611-1..> | 2023-08-05 02:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0133801314-488x611-1..> | 2023-08-06 12:19 | 22K | |
![[IMG]](/icons/image2.gif) | 0133801314-488x611-1..> | 2023-05-03 10:02 | 97K | |
![[ ]](/icons/layout.gif) | 0133804070_ism01-211..> | 2023-05-03 10:14 | 1.6M | |
![[IMG]](/icons/image2.gif) | 0133805913-500x500-1..> | 2023-05-03 09:45 | 56K | |
![[IMG]](/icons/image2.gif) | 01338059131-500x500-..> | 2023-05-03 10:14 | 56K | |
![[IMG]](/icons/image2.gif) | 0133813460-500x500-1..> | 2023-05-03 10:17 | 78K | |
![[IMG]](/icons/image2.gif) | 0133842746-100x100.jpg | 2023-08-05 03:41 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0133842746-300x300.jpg | 2023-08-24 00:52 | 27K | |
![[IMG]](/icons/image2.gif) | 0133842746.jpg | 2023-05-03 10:03 | 151K | |
![[IMG]](/icons/image2.gif) | 01338649601-500x500-..> | 2023-05-03 09:57 | 38K | |
![[IMG]](/icons/image2.gif) | 0133864979-500x500-1..> | 2023-05-03 10:09 | 40K | |
![[IMG]](/icons/image2.gif) | 0133892808-500x500-1..> | 2023-05-03 10:09 | 75K | |
![[IMG]](/icons/image2.gif) | 0133915387-100x100.jpg | 2023-08-07 14:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0133915387-300x300.jpg | 2023-08-08 14:34 | 19K | |
![[IMG]](/icons/image2.gif) | 0133915387.jpg | 2023-05-03 09:32 | 104K | |
![[IMG]](/icons/image2.gif) | 0133915425-100x100.jpg | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0133915425-300x300.jpg | 2023-08-08 14:34 | 23K | |
![[IMG]](/icons/image2.gif) | 0133915425.jpg | 2023-05-03 10:05 | 115K | |
![[ ]](/icons/layout.gif) | 0133915441_ISM01-229..> | 2023-05-03 10:05 | 1.8M | |
![[IMG]](/icons/image2.gif) | 0133918920-100x100.jpg | 2023-08-06 11:14 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0133918920-300x300.jpg | 2023-08-08 14:34 | 24K | |
![[IMG]](/icons/image2.gif) | 0133918920.jpg | 2023-05-03 11:19 | 138K | |
![[ ]](/icons/layout.gif) | 0133936724-tspl.pdf | 2023-05-03 14:07 | 348K | |
![[IMG]](/icons/image2.gif) | 0133943038-100x100.jpg | 2023-08-06 09:42 | 4.6K | |
![[IMG]](/icons/image2.gif) | 0133943038-300x300.jpg | 2023-08-08 15:50 | 33K | |
![[IMG]](/icons/image2.gif) | 0133943038.jpg | 2023-05-03 09:43 | 186K | |
![[IMG]](/icons/image2.gif) | 0133969614-100x100.jpg | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0133969614-300x300.jpg | 2023-08-23 01:25 | 19K | |
![[IMG]](/icons/image2.gif) | 0133969614.jpg | 2023-05-04 01:53 | 101K | |
![[ ]](/icons/layout.gif) | 0133979091_HechtISM_..> | 2023-05-03 10:59 | 219K | |
![[ ]](/icons/layout.gif) | 0134042433-tspl.pdf | 2023-05-03 14:07 | 426K | |
![[IMG]](/icons/image2.gif) | 0134060482-1-495x600..> | 2023-08-09 01:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0134060482-1-495x600..> | 2023-08-12 08:35 | 22K | |
![[IMG]](/icons/image2.gif) | 0134060482-1-495x600..> | 2023-05-03 11:00 | 79K | |
![[IMG]](/icons/image2.gif) | 0134060482-495x600-1..> | 2023-08-06 08:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0134060482-495x600-1..> | 2023-08-23 23:13 | 22K | |
![[IMG]](/icons/image2.gif) | 0134060482-495x600-1..> | 2023-05-03 11:00 | 79K | |
![[IMG]](/icons/image2.gif) | 0134077342-477x611-1..> | 2023-08-08 07:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0134077342-477x611-1..> | 2023-08-05 23:08 | 14K | |
![[IMG]](/icons/image2.gif) | 0134077342-477x611-1..> | 2023-05-03 09:54 | 57K | |
![[IMG]](/icons/image2.gif) | 013416721x.jpg | 2023-05-04 02:21 | 11K | |
![[ ]](/icons/layout.gif) | 0134173058-spl.pdf | 2023-05-03 13:41 | 1.6M | |
![[ ]](/icons/unknown.gif) | 0134387600_imtb_Samp..> | 2023-05-03 10:51 | 444K | |
![[IMG]](/icons/image2.gif) | 013439495x-537x600-1..> | 2023-08-06 16:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | 013439495x-537x600-1..> | 2023-08-25 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | 013439495x-537x600-1..> | 2023-05-03 10:55 | 50K | |
![[IMG]](/icons/image2.gif) | 0134413326.jpg | 2023-05-04 02:19 | 11K | |
![[IMG]](/icons/image2.gif) | 013446074x.jpg | 2023-05-04 02:18 | 13K | |
![[ ]](/icons/layout.gif) | 0134479440-spl.pdf | 2023-05-03 13:42 | 350K | |
![[IMG]](/icons/image2.gif) | 0134525043.jpg | 2023-05-04 02:20 | 12K | |
![[ ]](/icons/layout.gif) | 0134532600-spl.pdf | 2023-05-03 13:41 | 219K | |
![[ ]](/icons/unknown.gif) | 0134617061_TB_Module..> | 2023-05-03 13:41 | 360K | |
![[ ]](/icons/unknown.gif) | 0134617061_TB_Module..> | 2023-05-03 13:41 | 280K | |
![[ ]](/icons/unknown.gif) | 0134617126_TB_Ch01.doc | 2023-05-04 02:00 | 55K | |
![[IMG]](/icons/image2.gif) | 0134627245.jpg | 2023-05-04 02:20 | 10K | |
![[IMG]](/icons/image2.gif) | 0134633288-1-506x600..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0134633288-1-506x600..> | 2023-08-23 21:13 | 22K | |
![[IMG]](/icons/image2.gif) | 0134633288-1-506x600..> | 2023-05-04 02:03 | 65K | |
![[IMG]](/icons/image2.gif) | 0134699815.jpg | 2023-05-04 02:17 | 13K | |
![[IMG]](/icons/image2.gif) | 0134701232-1-507x600..> | 2023-08-07 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0134701232-1-507x600..> | 2023-08-30 09:02 | 17K | |
![[IMG]](/icons/image2.gif) | 0134701232-1-507x600..> | 2023-05-04 02:24 | 48K | |
![[IMG]](/icons/image2.gif) | 0134702336-1-100x100..> | 2023-08-05 01:52 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0134702336-1-300x300..> | 2023-09-05 02:50 | 23K | |
![[IMG]](/icons/image2.gif) | 0134702336-1.jpg | 2023-05-04 02:08 | 135K | |
![[IMG]](/icons/image2.gif) | 0134702336.jpg | 2023-05-04 02:06 | 16K | |
![[ ]](/icons/unknown.gif) | 0134711475_ARNETT_3e..> | 2023-05-04 02:16 | 538K | |
![[IMG]](/icons/image2.gif) | 0134740211_SolutionM..> | 2023-08-06 15:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0134740211_SolutionM..> | 2023-08-08 14:34 | 25K | |
![[IMG]](/icons/image2.gif) | 0134740211_SolutionM..> | 2023-05-04 02:15 | 133K | |
![[IMG]](/icons/image2.gif) | 013476059x.jpg | 2023-05-04 01:53 | 10K | |
![[IMG]](/icons/image2.gif) | 0134760611.jpg | 2023-05-04 01:52 | 12K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-1..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-1..> | 2023-09-12 12:05 | 19K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-1..> | 2023-05-04 02:28 | 59K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-2..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-2..> | 2023-08-12 04:50 | 19K | |
![[IMG]](/icons/image2.gif) | 0134773632-506x600-2..> | 2023-05-04 02:28 | 59K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-1..> | 2023-08-07 06:18 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-1..> | 2023-09-04 21:53 | 22K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-1..> | 2023-05-04 02:02 | 76K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-2..> | 2023-08-09 05:58 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-2..> | 2023-08-18 04:17 | 22K | |
![[IMG]](/icons/image2.gif) | 0134796551-518x600-2..> | 2023-05-04 02:02 | 76K | |
![[IMG]](/icons/image2.gif) | 0134800931-100x100.jpg | 2023-08-06 17:28 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0134800931-300x300.jpg | 2023-09-05 02:50 | 22K | |
![[IMG]](/icons/image2.gif) | 0134800931.jpg | 2023-05-04 02:18 | 120K | |
![[IMG]](/icons/image2.gif) | 0134804678-1-506x600..> | 2023-08-06 09:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0134804678-1-506x600..> | 2023-08-09 02:53 | 20K | |
![[IMG]](/icons/image2.gif) | 0134804678-1-506x600..> | 2023-05-03 11:24 | 63K | |
![[IMG]](/icons/image2.gif) | 0134807790-1-100x100..> | 2023-08-06 16:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0134807790-1-300x300..> | 2023-08-09 02:53 | 22K | |
![[IMG]](/icons/image2.gif) | 0134807790-1.jpg | 2023-05-04 01:57 | 100K | |
![[IMG]](/icons/image2.gif) | 0134812948-100x100.jpeg | 2023-08-05 01:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0134812948-300x300.jpeg | 2023-08-24 00:00 | 16K | |
![[IMG]](/icons/image2.gif) | 0134812948.jpeg | 2023-05-04 02:24 | 48K | |
![[IMG]](/icons/image2.gif) | 0134833163-498x600-1..> | 2023-08-07 04:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0134833163-498x600-1..> | 2023-09-15 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | 0134833163-498x600-1..> | 2023-05-04 02:26 | 54K | |
![[IMG]](/icons/image2.gif) | 013484534X-1-536x600..> | 2023-08-05 15:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | 013484534X-1-536x600..> | 2023-08-31 23:41 | 23K | |
![[IMG]](/icons/image2.gif) | 013484534X-1-536x600..> | 2023-05-04 02:16 | 85K | |
![[IMG]](/icons/image2.gif) | 0134854438-506x600-1..> | 2023-08-05 16:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0134854438-506x600-1..> | 2023-08-24 00:00 | 19K | |
![[IMG]](/icons/image2.gif) | 0134854438-506x600-1..> | 2023-05-03 11:10 | 61K | |
![[IMG]](/icons/image2.gif) | 013486817x.jpg | 2023-05-04 01:54 | 13K | |
![[IMG]](/icons/image2.gif) | 0134868188.jpg | 2023-05-04 01:54 | 17K | |
![[IMG]](/icons/image2.gif) | 0134876814.jpg | 2023-05-04 01:51 | 13K | |
![[IMG]](/icons/image2.gif) | 0134877713.jpg | 2023-05-04 02:07 | 14K | |
![[IMG]](/icons/image2.gif) | 013496456X-100x100.jpg | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | 013496456X-300x300.jpg | 2023-08-13 06:55 | 20K | |
![[IMG]](/icons/image2.gif) | 013496456X.jpg | 2023-05-03 11:10 | 79K | |
![[IMG]](/icons/image2.gif) | 0134989457.jpg | 2023-05-04 01:52 | 12K | |
![[IMG]](/icons/image2.gif) | 0134998456-100x100.jpg | 2023-08-05 14:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0134998456.jpg | 2023-05-03 11:10 | 7.9K | |
![[IMG]](/icons/image2.gif) | 0135005108-500x500-1..> | 2023-05-03 10:51 | 73K | |
![[IMG]](/icons/image2.gif) | 0135007348-492x600-4..> | 2023-08-06 13:12 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0135007348-492x600-4..> | 2023-08-13 15:24 | 20K | |
![[IMG]](/icons/image2.gif) | 0135007348-492x600-4..> | 2023-05-04 01:47 | 58K | |
![[IMG]](/icons/image2.gif) | 0135007593-100x100.jpg | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0135007593-300x300.jpg | 2023-09-22 10:56 | 17K | |
![[IMG]](/icons/image2.gif) | 0135007593.jpg | 2023-05-03 10:33 | 98K | |
![[IMG]](/icons/image2.gif) | 0135014638-100x100.jpg | 2023-08-06 12:18 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0135014638-300x300.jpg | 2023-08-14 23:55 | 22K | |
![[IMG]](/icons/image2.gif) | 0135014638.jpg | 2023-05-03 10:23 | 106K | |
![[IMG]](/icons/image2.gif) | 0135022681-100x100.jpg | 2023-08-05 01:56 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0135022681-300x300.jpg | 2023-10-16 23:36 | 26K | |
![[IMG]](/icons/image2.gif) | 0135022681.jpg | 2023-05-03 11:27 | 143K | |
![[IMG]](/icons/image2.gif) | 0135031508-100x100.jpg | 2023-08-05 03:40 | 4.7K | |
![[IMG]](/icons/image2.gif) | 0135031508-300x300.jpg | 2023-09-22 22:39 | 27K | |
![[ ]](/icons/layout.gif) | 0135031508-tspl.pdf | 2023-05-04 02:14 | 276K | |
![[IMG]](/icons/image2.gif) | 0135031508.jpg | 2023-05-04 02:14 | 96K | |
![[IMG]](/icons/image2.gif) | 0135045207-100x100.jpg | 2023-08-06 08:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0135045207.jpg | 2023-05-03 10:31 | 9.6K | |
![[IMG]](/icons/image2.gif) | 0135055784.jpg | 2023-05-03 10:30 | 59K | |
![[IMG]](/icons/image2.gif) | 0135065496-100x100.jpg | 2023-08-05 17:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0135065496-300x300.jpg | 2023-08-13 23:04 | 15K | |
![[IMG]](/icons/image2.gif) | 0135065496.jpg | 2023-05-03 09:44 | 94K | |
![[IMG]](/icons/image2.gif) | 0135066034-100x100.jpg | 2023-08-06 07:49 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0135066034-300x300.jpg | 2023-08-25 22:45 | 26K | |
![[IMG]](/icons/image2.gif) | 0135066034.jpg | 2023-05-03 09:42 | 137K | |
![[IMG]](/icons/image2.gif) | 0135077931-100x100.jpg | 2023-08-05 06:25 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0135077931-300x300.jpg | 2023-08-10 19:39 | 27K | |
![[IMG]](/icons/image2.gif) | 0135077931.jpg | 2023-05-03 10:45 | 123K | |
![[IMG]](/icons/image2.gif) | 0135084075_SM-100x10..> | 2023-08-06 07:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0135084075_SM-300x30..> | 2023-08-14 00:56 | 24K | |
![[IMG]](/icons/image2.gif) | 0135084075_SM.jpg | 2023-05-04 02:25 | 130K | |
![[ ]](/icons/unknown.gif) | 0135085071-CHAPTER-1..> | 2023-05-03 10:27 | 16K | |
![[IMG]](/icons/image2.gif) | 01350850711-500x500-..> | 2023-05-03 10:27 | 60K | |
![[ ]](/icons/compressed.gif) | 0135095980_ch_01.zip | 2023-05-03 10:50 | 17K | |
![[IMG]](/icons/image2.gif) | 013511473X-500x50010..> | 2023-05-03 09:36 | 52K | |
![[IMG]](/icons/image2.gif) | 013511473X1-500x5001..> | 2023-05-03 09:07 | 52K | |
![[IMG]](/icons/image2.gif) | 0135121035-100x100.jpg | 2023-08-08 22:59 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0135121035.jpg | 2023-05-03 10:52 | 16K | |
![[ ]](/icons/unknown.gif) | 0135124964_im01.doc | 2023-05-03 09:27 | 96K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB-1-100x..> | 2023-08-06 07:48 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB-1-300x..> | 2023-09-17 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB-1.jpg | 2023-05-04 02:11 | 21K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB-100x10..> | 2023-08-06 16:00 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB-300x30..> | 2023-09-17 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | 0135126770_TB.jpg | 2023-05-03 11:09 | 21K | |
![[IMG]](/icons/image2.gif) | 0135130468-500x500-1..> | 2023-05-03 11:07 | 71K | |
![[IMG]](/icons/image2.gif) | 01351341021-500x500-..> | 2023-05-03 10:51 | 44K | |
![[IMG]](/icons/image2.gif) | 0135145708-100x100.jpg | 2023-08-05 04:31 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0135145708-300x300.jpg | 2023-08-22 08:49 | 19K | |
![[IMG]](/icons/image2.gif) | 0135145708.jpg | 2023-05-03 09:28 | 105K | |
![[IMG]](/icons/image2.gif) | 0135154669_TB-100x10..> | 2023-08-06 11:18 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0135154669_TB-300x30..> | 2023-09-18 23:05 | 24K | |
![[IMG]](/icons/image2.gif) | 0135154669_TB.jpg | 2023-05-04 01:58 | 123K | |
![[IMG]](/icons/image2.gif) | 0135155568-100x100.jpg | 2023-08-05 01:09 | 4.8K | |
![[IMG]](/icons/image2.gif) | 0135155568-300x300.jpg | 2023-09-05 00:52 | 25K | |
![[IMG]](/icons/image2.gif) | 0135155568.jpg | 2023-05-03 10:33 | 122K | |
![[IMG]](/icons/image2.gif) | 013517564X-507x600-1..> | 2023-08-06 16:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | 013517564X-507x600-1..> | 2023-08-10 18:33 | 21K | |
![[IMG]](/icons/image2.gif) | 013517564X-507x600-1..> | 2023-05-04 02:11 | 64K | |
![[IMG]](/icons/image2.gif) | 0135180864-1-518x600..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0135180864-1-518x600..> | 2023-08-10 18:33 | 16K | |
![[IMG]](/icons/image2.gif) | 0135180864-1-518x600..> | 2023-05-04 02:00 | 46K | |
![[IMG]](/icons/image2.gif) | 0135192013-518x600-1..> | 2023-08-05 14:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0135192013-518x600-1..> | 2023-08-22 23:45 | 23K | |
![[IMG]](/icons/image2.gif) | 0135192013-518x600-1..> | 2023-05-04 02:03 | 65K | |
![[IMG]](/icons/image2.gif) | 013520688x.jpg | 2023-05-04 01:54 | 19K | |
![[IMG]](/icons/image2.gif) | 0135218330.jpg | 2023-05-04 01:53 | 16K | |
![[IMG]](/icons/image2.gif) | 013600637X-100x100.jpg | 2023-08-05 09:32 | 3.5K | |
![[IMG]](/icons/image2.gif) | 013600637X-300x300.jpg | 2023-08-05 01:14 | 25K | |
![[IMG]](/icons/image2.gif) | 013600637X.jpg | 2023-05-03 09:07 | 131K | |
![[IMG]](/icons/image2.gif) | 0136013333-100x100.jpg | 2023-08-05 05:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0136013333-300x300.jpg | 2023-08-08 14:34 | 22K | |
![[IMG]](/icons/image2.gif) | 0136013333.jpg | 2023-05-04 01:51 | 96K | |
![[IMG]](/icons/image2.gif) | 0136016383-100x100.jpg | 2023-08-05 04:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0136016383-300x300.jpg | 2023-08-08 14:34 | 25K | |
![[IMG]](/icons/image2.gif) | 0136016383.jpg | 2023-05-03 11:02 | 127K | |
![[IMG]](/icons/image2.gif) | 0136020038-100x100.jpg | 2023-08-06 09:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0136020038-300x300.jpg | 2023-08-05 14:40 | 21K | |
![[IMG]](/icons/image2.gif) | 0136020038.jpg | 2023-05-04 01:57 | 112K | |
![[IMG]](/icons/image2.gif) | 0136020585-100x100.jpg | 2023-08-05 14:39 | 5.5K | |
![[IMG]](/icons/image2.gif) | 0136020585-300x300.jpg | 2023-08-05 01:51 | 32K | |
![[IMG]](/icons/image2.gif) | 0136020585.jpg | 2023-05-03 09:20 | 146K | |
![[IMG]](/icons/image2.gif) | 0136025137-100x100.jpg | 2023-08-05 21:03 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0136025137-300x300.jpg | 2023-08-05 15:35 | 17K | |
![[IMG]](/icons/image2.gif) | 0136025137.jpg | 2023-05-03 10:36 | 74K | |
![[IMG]](/icons/image2.gif) | 0136042597-500x5001-..> | 2023-05-03 10:50 | 64K | |
![[IMG]](/icons/image2.gif) | 0136053580-500x5001-..> | 2023-05-03 09:30 | 42K | |
![[IMG]](/icons/image2.gif) | 0136070760-500x500-1..> | 2023-05-04 01:48 | 48K | |
![[IMG]](/icons/image2.gif) | 0136072240-500x500-1..> | 2023-05-03 10:23 | 67K | |
![[IMG]](/icons/image2.gif) | 0136079482-100x100.jpg | 2023-08-05 01:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0136079482-300x300.jpg | 2023-08-09 12:13 | 19K | |
![[IMG]](/icons/image2.gif) | 0136079482.jpg | 2023-05-03 10:42 | 85K | |
![[ ]](/icons/compressed.gif) | 0136079490_ism01-140..> | 2023-05-03 10:42 | 890K | |
![[IMG]](/icons/image2.gif) | 0136085296-100x100.jpg | 2023-08-08 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0136085296-300x300.jpg | 2023-08-18 04:17 | 16K | |
![[IMG]](/icons/image2.gif) | 0136085296.jpg | 2023-05-03 09:56 | 80K | |
![[IMG]](/icons/image2.gif) | 013608592X-500x50010..> | 2023-05-04 02:13 | 56K | |
![[IMG]](/icons/image2.gif) | 0136086209-500x500-1..> | 2023-05-03 09:55 | 37K | |
![[IMG]](/icons/image2.gif) | 013608916X-500x50011..> | 2023-05-04 01:54 | 44K | |
![[IMG]](/icons/image2.gif) | 0136090192-100x100.jpg | 2023-08-05 04:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0136090192-300x300.jpg | 2023-08-31 13:55 | 30K | |
![[IMG]](/icons/image2.gif) | 0136090192.jpg | 2023-05-03 11:07 | 144K | |
![[IMG]](/icons/image2.gif) | 0136100910-500x500-1..> | 2023-05-03 09:57 | 53K | |
![[IMG]](/icons/image2.gif) | 0136106897-100x100.jpg | 2023-08-08 20:04 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0136106897-300x300.jpg | 2023-09-12 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 0136106897.jpg | 2023-05-03 09:52 | 99K | |
![[IMG]](/icons/image2.gif) | 013610729X-500x50011..> | 2023-05-03 09:07 | 51K | |
![[IMG]](/icons/image2.gif) | 0136110584-100x100.jpg | 2023-08-06 08:46 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0136110584-300x300.jpg | 2023-08-12 14:44 | 29K | |
![[IMG]](/icons/image2.gif) | 0136110584.jpg | 2023-05-04 02:02 | 162K | |
![[IMG]](/icons/image2.gif) | 0136115276-100x100.jpg | 2023-08-05 04:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0136115276-300x300.jpg | 2023-08-08 17:45 | 17K | |
![[IMG]](/icons/image2.gif) | 0136115276.jpg | 2023-05-03 09:50 | 115K | |
![[IMG]](/icons/image2.gif) | 0136115624-100x100.jpg | 2023-08-06 10:17 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0136115624-300x300.jpg | 2023-08-05 04:37 | 29K | |
![[IMG]](/icons/image2.gif) | 0136115624.jpg | 2023-05-03 10:52 | 129K | |
![[IMG]](/icons/image2.gif) | 0136117007-500x500-1..> | 2023-05-04 01:53 | 36K | |
![[IMG]](/icons/image2.gif) | 01361573941-470x5871..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 01361573941-470x5871..> | 2023-09-12 22:07 | 26K | |
![[IMG]](/icons/image2.gif) | 01361573941-470x5871..> | 2023-05-04 02:10 | 100K | |
![[IMG]](/icons/image2.gif) | 0136919901-100x100.jpg | 2023-08-05 03:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0136919901-300x300.jpg | 2023-08-21 07:04 | 25K | |
![[IMG]](/icons/image2.gif) | 0136919901.jpg | 2023-05-03 09:46 | 116K | |
![[IMG]](/icons/image2.gif) | 013700916X-100x100.jpg | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | 013700916X-300x300.jpg | 2023-08-21 05:38 | 15K | |
![[IMG]](/icons/image2.gif) | 013700916X.jpg | 2023-05-03 09:50 | 63K | |
![[IMG]](/icons/image2.gif) | 0137015976-500x500-1..> | 2023-05-04 02:19 | 32K | |
![[IMG]](/icons/image2.gif) | 0137021178-500x500-1..> | 2023-05-04 02:01 | 63K | |
![[IMG]](/icons/image2.gif) | 013703038X1-500x500-..> | 2023-05-03 09:06 | 47K | |
![[IMG]](/icons/image2.gif) | 0137033702-100x100.jpg | 2023-08-08 07:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0137033702-300x300.jpg | 2023-09-08 18:22 | 28K | |
![[IMG]](/icons/image2.gif) | 0137033702.jpg | 2023-05-03 09:26 | 191K | |
![[IMG]](/icons/image2.gif) | 0137035152-100x100.jpg | 2023-08-08 06:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0137035152-300x300.jpg | 2023-08-11 11:53 | 21K | |
![[IMG]](/icons/image2.gif) | 0137035152.jpg | 2023-05-03 10:07 | 114K | |
![[IMG]](/icons/image2.gif) | 01370368411-500x500-..> | 2023-05-03 10:47 | 56K | |
![[ ]](/icons/layout.gif) | 0137048858-tspl.pdf | 2023-05-03 13:42 | 192K | |
![[IMG]](/icons/image2.gif) | 0137050135-100x100.jpg | 2023-08-05 06:25 | 4.8K | |
![[IMG]](/icons/image2.gif) | 0137050135-300x300.jpg | 2023-08-06 15:35 | 27K | |
![[IMG]](/icons/image2.gif) | 0137050135.jpg | 2023-05-03 09:53 | 126K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x630-..> | 2023-08-06 09:42 | 2.6K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x630-..> | 2023-08-17 09:42 | 9.8K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x630-..> | 2023-05-03 10:17 | 49K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x6301..> | 2023-08-06 05:46 | 2.6K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x6301..> | 2023-08-24 00:00 | 9.8K | |
![[IMG]](/icons/image2.gif) | 01370667321-470x6301..> | 2023-05-03 10:37 | 49K | |
![[IMG]](/icons/image2.gif) | 0137075464-500x500-1..> | 2023-05-04 02:22 | 62K | |
![[IMG]](/icons/image2.gif) | 0137075464-500x500-1..> | 2023-05-04 02:10 | 62K | |
![[IMG]](/icons/image2.gif) | 0137126026-500x500-1..> | 2023-05-03 10:04 | 66K | |
![[IMG]](/icons/image2.gif) | 0137146124-100x100.jpg | 2023-08-06 12:11 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0137146124-300x300.jpg | 2023-08-17 10:32 | 25K | |
![[IMG]](/icons/image2.gif) | 0137146124.jpg | 2023-05-03 10:38 | 110K | |
![[IMG]](/icons/image2.gif) | 0138004641-100x100.jpg | 2023-08-06 13:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0138004641-300x300.jpg | 2023-08-13 04:19 | 21K | |
![[IMG]](/icons/image2.gif) | 0138004641.jpg | 2023-05-03 10:07 | 88K | |
![[IMG]](/icons/image2.gif) | 0138011605-100x100.jpg | 2023-08-05 14:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0138011605-300x300.jpg | 2023-09-15 08:58 | 15K | |
![[IMG]](/icons/image2.gif) | 0138011605.jpg | 2023-05-04 02:23 | 75K | |
![[ ]](/icons/layout.gif) | 0138142866_ch13.pdf | 2023-05-03 09:39 | 664K | |
![[IMG]](/icons/image2.gif) | 0138151695-470x571-1..> | 2023-08-05 16:27 | 2.0K | |
![[IMG]](/icons/image2.gif) | 0138151695-470x571-1..> | 2023-08-21 12:24 | 9.1K | |
![[IMG]](/icons/image2.gif) | 0138151695-470x571-1..> | 2023-05-04 01:51 | 42K | |
![[ ]](/icons/layout.gif) | 0176530835-spl.pdf | 2023-05-03 13:42 | 182K | |
![[IMG]](/icons/image2.gif) | 017653086X-100x100.jpg | 2023-08-06 11:16 | 2.1K | |
![[IMG]](/icons/image2.gif) | 017653086X.jpg | 2023-05-03 09:49 | 7.7K | |
![[IMG]](/icons/image2.gif) | 0176796061.gif | 2023-05-04 02:22 | 14K | |
![[ ]](/icons/compressed.gif) | 02IM_NTLC5e.zip | 2023-05-03 10:26 | 23K | |
![[ ]](/icons/layout.gif) | 02_LarsonFarber_ISM_..> | 2023-05-03 10:24 | 78K | |
![[ ]](/icons/unknown.gif) | 02_TB_93899_ch01_001..> | 2023-05-03 10:45 | 64K | |
![[IMG]](/icons/image2.gif) | 0201350998-100x100.jpg | 2023-08-05 02:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0201350998-300x300.jpg | 2023-08-05 04:36 | 20K | |
![[IMG]](/icons/image2.gif) | 0201350998.jpg | 2023-05-03 09:22 | 75K | |
![[IMG]](/icons/image2.gif) | 0201361833-100x100.jpg | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0201361833-300x300.jpg | 2023-08-05 04:35 | 17K | |
![[IMG]](/icons/image2.gif) | 0201361833.jpg | 2023-05-03 11:23 | 68K | |
![[IMG]](/icons/image2.gif) | 0201498405-500x500-1..> | 2023-05-04 02:17 | 39K | |
![[IMG]](/icons/image2.gif) | 0201543613-100x100.jpg | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 0201543613-300x300.jpg | 2023-08-05 15:35 | 19K | |
![[IMG]](/icons/image2.gif) | 0201543613.jpg | 2023-05-03 09:20 | 84K | |
![[IMG]](/icons/image2.gif) | 0201612445-500x5001-..> | 2023-05-04 01:51 | 54K | |
![[IMG]](/icons/image2.gif) | 0201741253-500x500-1..> | 2023-05-03 10:45 | 92K | |
![[IMG]](/icons/image2.gif) | 0201773449-470x5811-..> | 2023-08-06 08:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0201773449-470x5811-..> | 2023-08-21 08:26 | 12K | |
![[IMG]](/icons/image2.gif) | 0201773449-470x5811-..> | 2023-05-03 10:40 | 39K | |
![[IMG]](/icons/image2.gif) | 0205001912-100x100.jpg | 2023-08-05 06:24 | 4.7K | |
![[IMG]](/icons/image2.gif) | 0205001912-300x300.jpg | 2023-08-30 20:27 | 28K | |
![[IMG]](/icons/image2.gif) | 0205001912.jpg | 2023-05-03 10:08 | 137K | |
![[IMG]](/icons/image2.gif) | 0205006574-100x100.jpg | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0205006574-300x300.jpg | 2023-09-04 20:54 | 19K | |
![[IMG]](/icons/image2.gif) | 0205006574.jpg | 2023-05-03 09:58 | 76K | |
![[ ]](/icons/layout.gif) | 0205011217-tspl.pdf | 2023-05-03 13:43 | 689K | |
![[IMG]](/icons/image2.gif) | 0205024351-100x100.jpg | 2023-08-08 04:08 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0205024351-300x300.jpg | 2023-08-06 17:25 | 19K | |
![[IMG]](/icons/image2.gif) | 0205024351.jpg | 2023-05-03 09:31 | 90K | |
![[IMG]](/icons/image2.gif) | 0205042341-100x100.jpg | 2023-08-05 16:22 | 5.6K | |
![[IMG]](/icons/image2.gif) | 0205042341-300x300.jpg | 2023-08-06 07:49 | 36K | |
![[IMG]](/icons/image2.gif) | 0205042341.jpg | 2023-05-03 09:46 | 152K | |
![[IMG]](/icons/image2.gif) | 0205042503-516x600-1..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0205042503-516x600-1..> | 2023-08-30 20:27 | 24K | |
![[IMG]](/icons/image2.gif) | 0205042503-516x600-1..> | 2023-05-04 01:54 | 68K | |
![[ ]](/icons/layout.gif) | 0205042503-tspl.pdf | 2023-05-04 01:54 | 1.3M | |
![[IMG]](/icons/image2.gif) | 0205215793-100x100.jpg | 2023-08-08 22:01 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0205215793-300x300.jpg | 2023-08-05 01:54 | 23K | |
![[IMG]](/icons/image2.gif) | 0205215793.jpg | 2023-05-03 10:34 | 123K | |
![[IMG]](/icons/image2.gif) | 0205216528-100x100.jpg | 2023-08-05 14:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0205216528-300x300.jpg | 2023-08-23 01:30 | 26K | |
![[IMG]](/icons/image2.gif) | 0205216528.jpg | 2023-05-03 09:26 | 134K | |
![[IMG]](/icons/image2.gif) | 0205222617-100x100.jpg | 2023-08-05 15:22 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0205222617-300x300.jpg | 2023-09-11 04:22 | 19K | |
![[IMG]](/icons/image2.gif) | 0205222617.jpg | 2023-05-03 09:58 | 98K | |
![[IMG]](/icons/image2.gif) | 0205223516-100x100.jpg | 2023-08-05 01:11 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0205223516-300x300.jpg | 2023-08-08 08:19 | 23K | |
![[IMG]](/icons/image2.gif) | 0205223516.jpg | 2023-05-03 09:41 | 117K | |
![[IMG]](/icons/image2.gif) | 0205231683-100x100.jpg | 2023-08-05 15:33 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0205231683-300x300.jpg | 2023-08-06 11:19 | 21K | |
![[IMG]](/icons/image2.gif) | 0205231683.jpg | 2023-05-04 02:26 | 96K | |
![[IMG]](/icons/image2.gif) | 0205234992-100x100.jpg | 2023-08-06 09:42 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0205234992-300x300.jpg | 2023-08-13 22:07 | 20K | |
![[IMG]](/icons/image2.gif) | 0205234992.jpg | 2023-05-03 10:00 | 95K | |
![[IMG]](/icons/image2.gif) | 0205251617-100x100.jpg | 2023-08-06 03:36 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0205251617-300x300.jpg | 2023-08-31 05:36 | 23K | |
![[IMG]](/icons/image2.gif) | 0205251617.jpg | 2023-05-03 10:39 | 111K | |
![[IMG]](/icons/image2.gif) | 0205332927-100x100.jpg | 2023-08-06 03:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0205332927-300x300.jpg | 2023-10-18 03:50 | 21K | |
![[IMG]](/icons/image2.gif) | 0205332927.jpg | 2023-05-03 09:20 | 90K | |
![[ ]](/icons/layout.gif) | 0205340547-tspl.pdf | 2023-05-03 13:43 | 51K | |
![[IMG]](/icons/image2.gif) | 0205359132-500x500-1..> | 2023-05-03 09:22 | 55K | |
![[IMG]](/icons/image2.gif) | 0205377939-500x500-1..> | 2023-05-03 10:27 | 33K | |
![[IMG]](/icons/image2.gif) | 0205435424-500x500-1..> | 2023-05-04 02:25 | 86K | |
![[IMG]](/icons/image2.gif) | 0205461085-100x100.jpg | 2023-08-05 01:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0205461085-300x300.jpg | 2023-08-05 01:13 | 25K | |
![[IMG]](/icons/image2.gif) | 0205461085.jpg | 2023-05-03 09:18 | 141K | |
![[IMG]](/icons/image2.gif) | 0205569234-100x100.jpg | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0205569234-300x300.jpg | 2023-08-06 06:37 | 18K | |
![[IMG]](/icons/image2.gif) | 0205569234.jpg | 2023-05-04 02:23 | 93K | |
![[IMG]](/icons/image2.gif) | 0205593399-100x100.jpg | 2023-08-06 10:17 | 5.0K | |
![[IMG]](/icons/image2.gif) | 0205593399-300x300.jpg | 2023-08-15 06:50 | 34K | |
![[IMG]](/icons/image2.gif) | 0205593399.jpg | 2023-05-04 02:11 | 187K | |
![[IMG]](/icons/image2.gif) | 0205638007-100x100.jpg | 2023-08-05 14:00 | 4.6K | |
![[IMG]](/icons/image2.gif) | 0205638007-300x300.jpg | 2023-08-06 11:14 | 24K | |
![[IMG]](/icons/image2.gif) | 0205638007.jpg | 2023-05-04 01:51 | 115K | |
![[IMG]](/icons/image2.gif) | 0205698077-100x100.jpg | 2023-08-06 09:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0205698077-300x300.jpg | 2023-09-11 04:22 | 29K | |
![[IMG]](/icons/image2.gif) | 0205698077.jpg | 2023-05-03 10:34 | 158K | |
![[IMG]](/icons/image2.gif) | 0205718116-100x100.jpg | 2023-08-05 14:34 | 4.8K | |
![[IMG]](/icons/image2.gif) | 0205718116-300x300.jpg | 2023-08-27 10:06 | 29K | |
![[IMG]](/icons/image2.gif) | 0205718116.jpg | 2023-05-03 10:06 | 137K | |
![[ ]](/icons/layout.gif) | 0205733166-tspl.pdf | 2023-05-03 13:43 | 481K | |
![[IMG]](/icons/image2.gif) | 0205763138-100x100.jpg | 2023-08-05 17:20 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0205763138-300x300.jpg | 2023-09-11 04:22 | 28K | |
![[ ]](/icons/layout.gif) | 0205763138-tspl.pdf | 2023-05-04 01:51 | 166K | |
![[IMG]](/icons/image2.gif) | 0205763138.jpg | 2023-05-04 01:51 | 63K | |
![[IMG]](/icons/image2.gif) | 0205793835-100x100.jpg | 2023-08-05 01:27 | 5.2K | |
![[IMG]](/icons/image2.gif) | 0205793835-300x300.jpg | 2023-08-30 20:27 | 31K | |
![[IMG]](/icons/image2.gif) | 0205793835.jpg | 2023-05-03 09:38 | 146K | |
![[IMG]](/icons/image2.gif) | 0205798780_TestBank-..> | 2023-08-06 11:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0205798780_TestBank-..> | 2023-08-21 07:47 | 26K | |
![[IMG]](/icons/image2.gif) | 0205798780_TestBank.jpg | 2023-05-04 02:19 | 133K | |
![[IMG]](/icons/image2.gif) | 0205843387-100x100.jpg | 2023-08-05 20:18 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0205843387-300x300.jpg | 2023-08-15 20:03 | 12K | |
![[IMG]](/icons/image2.gif) | 0205843387.jpg | 2023-05-03 09:43 | 70K | |
![[IMG]](/icons/image2.gif) | 020584894X-100x100.jpg | 2023-08-06 07:46 | 4.6K | |
![[IMG]](/icons/image2.gif) | 020584894X-300x300.jpg | 2023-08-30 20:27 | 25K | |
![[IMG]](/icons/image2.gif) | 020584894X.jpg | 2023-05-03 09:26 | 128K | |
![[IMG]](/icons/image2.gif) | 0205864813-100x100.jpg | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0205864813-300x300.jpg | 2023-08-27 02:56 | 19K | |
![[IMG]](/icons/image2.gif) | 0205864813.jpg | 2023-05-03 10:26 | 97K | |
![[IMG]](/icons/image2.gif) | 0205867472-100x100.jpg | 2023-08-05 01:13 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0205867472-300x300.jpg | 2023-08-15 20:03 | 15K | |
![[IMG]](/icons/image2.gif) | 0205867472.jpg | 2023-05-03 10:05 | 85K | |
![[IMG]](/icons/image2.gif) | 0205881432-100x100.jpg | 2023-08-06 02:48 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0205881432-300x300.jpg | 2023-08-17 23:54 | 22K | |
![[IMG]](/icons/image2.gif) | 0205881432.jpg | 2023-05-03 09:28 | 94K | |
![[IMG]](/icons/image2.gif) | 0205886086-500x500-1..> | 2023-05-03 09:39 | 50K | |
![[IMG]](/icons/image2.gif) | 0205911854-100x100.jpg | 2023-08-06 01:48 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0205911854.jpg | 2023-05-03 11:01 | 16K | |
![[IMG]](/icons/image2.gif) | 0205916783-100x100.jpg | 2023-08-06 03:24 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0205916783-300x300.jpg | 2023-08-07 22:43 | 22K | |
![[IMG]](/icons/image2.gif) | 0205916783.jpg | 2023-05-03 10:48 | 98K | |
![[ ]](/icons/layout.gif) | 0205924174_TestBank_..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 020593109X_TestBank-..> | 2023-08-08 08:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | 020593109X_TestBank-..> | 2023-10-21 10:08 | 15K | |
![[IMG]](/icons/image2.gif) | 020593109X_TestBank.jpg | 2023-05-04 02:09 | 80K | |
![[IMG]](/icons/image2.gif) | 0205937519-100x100.jpg | 2023-08-09 02:53 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0205937519-300x300.jpg | 2023-08-15 03:43 | 27K | |
![[IMG]](/icons/image2.gif) | 0205937519.jpg | 2023-05-03 09:35 | 126K | |
![[ ]](/icons/layout.gif) | 0205944566-tspl.pdf | 2023-05-03 13:43 | 134K | |
![[IMG]](/icons/image2.gif) | 0205961061-500x500-1..> | 2023-05-03 10:35 | 48K | |
![[IMG]](/icons/image2.gif) | 0205963048-100x100.jpg | 2023-08-05 03:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0205963048-300x300.jpg | 2023-08-13 16:06 | 21K | |
![[IMG]](/icons/image2.gif) | 0205963048.jpg | 2023-05-03 11:08 | 89K | |
![[IMG]](/icons/image2.gif) | 0205968090-100x100.jpg | 2023-08-08 08:32 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0205968090-300x300.jpg | 2023-09-18 20:17 | 17K | |
![[IMG]](/icons/image2.gif) | 0205968090.jpg | 2023-05-03 10:43 | 75K | |
![[IMG]](/icons/image2.gif) | 0205968775-100x100.jpg | 2023-08-05 04:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0205968775-300x300.jpg | 2023-08-05 04:35 | 24K | |
![[IMG]](/icons/image2.gif) | 0205968775.jpg | 2023-05-03 10:18 | 115K | |
![[IMG]](/icons/image2.gif) | 0205980244-100x100.jpg | 2023-08-08 14:32 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0205980244-300x300.jpg | 2023-08-14 03:16 | 15K | |
![[IMG]](/icons/image2.gif) | 0205980244.jpg | 2023-05-03 10:00 | 87K | |
![[IMG]](/icons/image2.gif) | 0205985807_SolutionM..> | 2023-08-06 14:42 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0205985807_SolutionM..> | 2023-08-05 14:37 | 28K | |
![[IMG]](/icons/image2.gif) | 0205985807_SolutionM..> | 2023-05-04 02:01 | 120K | |
![[IMG]](/icons/image2.gif) | 0205985807_TestBank-..> | 2023-08-06 11:05 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0205985807_TestBank-..> | 2023-08-13 23:04 | 28K | |
![[IMG]](/icons/image2.gif) | 0205985807_TestBank.jpg | 2023-05-04 02:01 | 120K | |
![[ ]](/icons/unknown.gif) | 0205985807_TestBank_..> | 2023-05-04 02:01 | 0 | |
![[IMG]](/icons/image2.gif) | 0205987923-100x100.jpg | 2023-08-05 06:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0205987923-300x300.jpg | 2023-08-08 16:42 | 12K | |
![[IMG]](/icons/image2.gif) | 0205987923.jpg | 2023-05-03 11:01 | 46K | |
![[IMG]](/icons/image2.gif) | 0205989365-100x100.jpg | 2023-08-05 19:10 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0205989365-300x300.jpg | 2023-08-09 20:29 | 21K | |
![[IMG]](/icons/image2.gif) | 0205989365.jpg | 2023-05-03 10:32 | 108K | |
![[IMG]](/icons/image2.gif) | 0205989802-100x100.jpg | 2023-08-06 08:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0205989802-300x300.jpg | 2023-08-14 03:16 | 17K | |
![[IMG]](/icons/image2.gif) | 0205989802.jpg | 2023-05-03 10:10 | 86K | |
![[IMG]](/icons/image2.gif) | 0205989810-100x100.jpg | 2023-08-06 08:45 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0205989810-300x300.jpg | 2023-08-27 05:08 | 21K | |
![[IMG]](/icons/image2.gif) | 0205989810.jpg | 2023-05-03 09:44 | 104K | |
![[IMG]](/icons/image2.gif) | 02059950391-100x100.jpg | 2023-08-06 09:43 | 6.1K | |
![[IMG]](/icons/image2.gif) | 02059950391-300x300.jpg | 2023-08-09 22:25 | 37K | |
![[IMG]](/icons/image2.gif) | 02059950391.jpg | 2023-05-03 10:31 | 185K | |
![[IMG]](/icons/image2.gif) | 0273716549-500x500-1..> | 2023-05-03 10:46 | 38K | |
![[IMG]](/icons/image2.gif) | 0273716867-500x500-1..> | 2023-05-03 09:26 | 33K | |
![[IMG]](/icons/image2.gif) | 0273769030-100x100.jpg | 2023-08-06 13:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0273769030-300x300.jpg | 2023-08-09 22:25 | 25K | |
![[IMG]](/icons/image2.gif) | 0273769030.jpg | 2023-05-03 09:49 | 129K | |
![[IMG]](/icons/image2.gif) | 02992-228x228-1.jpg | 2023-05-03 10:19 | 14K | |
![[ ]](/icons/layout.gif) | 03_ROCKS_6191_05_ch0..> | 2023-05-03 10:26 | 195K | |
![[ ]](/icons/unknown.gif) | 03_krm_om10_tif_ch02..> | 2023-05-03 09:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | 0321194365-100x100.jpg | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0321194365-300x300.jpg | 2023-08-29 04:54 | 20K | |
![[IMG]](/icons/image2.gif) | 0321194365.jpg | 2023-05-03 09:50 | 103K | |
![[IMG]](/icons/image2.gif) | 0321228383-500x500-1..> | 2023-05-03 09:25 | 65K | |
![[IMG]](/icons/image2.gif) | 0321268458-500x500-1..> | 2023-05-03 09:20 | 61K | |
![[IMG]](/icons/image2.gif) | 03212684581-500x500-..> | 2023-05-04 02:14 | 61K | |
![[IMG]](/icons/image2.gif) | 0321288351-500x500-1..> | 2023-05-03 10:09 | 31K | |
![[IMG]](/icons/image2.gif) | 0321321367-500x500-1..> | 2023-05-03 09:49 | 71K | |
![[IMG]](/icons/image2.gif) | 0321322215-500x500-1..> | 2023-05-03 09:27 | 33K | |
![[IMG]](/icons/image2.gif) | 0321336119-100x100.jpg | 2023-08-06 10:16 | 2.4K | |
![[IMG]](/icons/image2.gif) | 0321336119-300x300.jpg | 2023-08-21 19:12 | 14K | |
![[IMG]](/icons/image2.gif) | 0321336119.jpg | 2023-05-03 10:11 | 19K | |
![[IMG]](/icons/image2.gif) | 0321479815-100x100.jpg | 2023-08-08 06:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0321479815-300x300.jpg | 2023-08-05 04:36 | 19K | |
![[IMG]](/icons/image2.gif) | 0321479815.jpg | 2023-05-03 09:49 | 103K | |
![[IMG]](/icons/image2.gif) | 0321486129-500x5002-..> | 2023-05-04 01:52 | 68K | |
![[ ]](/icons/compressed.gif) | 0321512383_SM_Sample..> | 2023-05-03 13:42 | 280K | |
![[IMG]](/icons/image2.gif) | 0321527704-100x100.jpg | 2023-08-05 01:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0321527704-300x300.jpg | 2023-08-05 21:03 | 17K | |
![[IMG]](/icons/image2.gif) | 0321527704.jpg | 2023-05-03 10:47 | 89K | |
![[IMG]](/icons/image2.gif) | 0321537351-500x500-1..> | 2023-05-03 11:07 | 49K | |
![[IMG]](/icons/image2.gif) | 0321541405-500x500-1..> | 2023-05-03 09:36 | 41K | |
![[IMG]](/icons/image2.gif) | 0321542568-500x500-1..> | 2023-05-03 10:07 | 52K | |
![[IMG]](/icons/image2.gif) | 0321545893-500x5001-..> | 2023-05-03 09:41 | 60K | |
![[IMG]](/icons/image2.gif) | 0321577442-500x500-1..> | 2023-05-03 10:21 | 44K | |
![[IMG]](/icons/image2.gif) | 0321592565-100x100.jpg | 2023-08-05 15:32 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0321592565-300x300.jpg | 2023-08-24 12:35 | 16K | |
![[IMG]](/icons/image2.gif) | 0321592565.jpg | 2023-05-03 09:35 | 69K | |
![[IMG]](/icons/image2.gif) | 0321595483-506x600-1..> | 2023-08-05 16:15 | 2.4K | |
![[IMG]](/icons/image2.gif) | 0321595483-506x600-1..> | 2023-08-16 10:25 | 11K | |
![[IMG]](/icons/image2.gif) | 0321595483-506x600-1..> | 2023-05-03 10:37 | 39K | |
![[IMG]](/icons/image2.gif) | 0321637739-500x5001-..> | 2023-05-03 11:04 | 56K | |
![[IMG]](/icons/image2.gif) | 03216414851-500x500-..> | 2023-05-03 10:46 | 33K | |
![[ ]](/icons/compressed.gif) | 0321661001_TB_PDF.zip | 2023-05-03 09:59 | 225K | |
![[IMG]](/icons/image2.gif) | 0321689550-100x100.jpg | 2023-08-05 04:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0321689550-300x300.jpg | 2023-08-22 23:45 | 24K | |
![[IMG]](/icons/image2.gif) | 0321689550.jpg | 2023-05-03 09:36 | 115K | |
![[IMG]](/icons/image2.gif) | 0321689577-100x100.jpg | 2023-08-06 03:45 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0321689577-300x300.jpg | 2023-08-05 15:27 | 30K | |
![[IMG]](/icons/image2.gif) | 0321689577.jpg | 2023-05-03 10:27 | 162K | |
![[IMG]](/icons/image2.gif) | 03217153571-100x100.jpg | 2023-08-05 15:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | 03217153571-300x300.jpg | 2023-08-16 10:25 | 21K | |
![[IMG]](/icons/image2.gif) | 03217153571.jpg | 2023-05-04 01:47 | 104K | |
![[IMG]](/icons/image2.gif) | 0321716027-100x100.jpg | 2023-08-05 06:17 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0321716027-300x300.jpg | 2023-08-31 13:55 | 11K | |
![[IMG]](/icons/image2.gif) | 0321716027.jpg | 2023-05-03 09:31 | 63K | |
![[IMG]](/icons/image2.gif) | 0321722507-100x100.jpg | 2023-08-06 03:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | 0321722507-300x300.jpg | 2023-08-08 20:09 | 21K | |
![[IMG]](/icons/image2.gif) | 0321722507.jpg | 2023-05-03 11:22 | 120K | |
![[IMG]](/icons/image2.gif) | 0321726391-100x100.jpg | 2023-08-05 04:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0321726391-300x300.jpg | 2023-08-23 01:25 | 15K | |
![[IMG]](/icons/image2.gif) | 0321726391.jpg | 2023-05-03 10:45 | 90K | |
![[IMG]](/icons/image2.gif) | 0321729730-100x100.jpg | 2023-08-06 09:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0321729730-300x300.jpg | 2023-08-08 07:33 | 15K | |
![[IMG]](/icons/image2.gif) | 0321729730.jpg | 2023-05-03 10:20 | 84K | |
![[IMG]](/icons/image2.gif) | 0321736079-100x100.jpg | 2023-08-06 05:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0321736079-300x300.jpg | 2023-08-23 23:59 | 35K | |
![[IMG]](/icons/image2.gif) | 0321736079.jpg | 2023-05-03 10:08 | 195K | |
![[IMG]](/icons/image2.gif) | 0321750004-100x100.jpg | 2023-08-05 02:46 | 5.2K | |
![[IMG]](/icons/image2.gif) | 0321750004-300x300.jpg | 2023-08-05 05:34 | 36K | |
![[IMG]](/icons/image2.gif) | 0321750004.jpg | 2023-05-03 09:59 | 202K | |
![[IMG]](/icons/image2.gif) | 0321750128-100x100.jpg | 2023-08-05 01:09 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0321750128-300x300.jpg | 2023-08-09 02:53 | 17K | |
![[IMG]](/icons/image2.gif) | 0321750128.jpg | 2023-05-03 10:19 | 80K | |
![[IMG]](/icons/image2.gif) | 0321750942-500x500-1..> | 2023-05-03 10:27 | 45K | |
![[IMG]](/icons/image2.gif) | 03217596641-100x100.jpg | 2023-08-05 15:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | 03217596641-300x300.jpg | 2023-08-13 16:06 | 20K | |
![[IMG]](/icons/image2.gif) | 03217596641.jpg | 2023-05-03 11:14 | 93K | |
![[IMG]](/icons/image2.gif) | 03217617151-500x500-..> | 2023-05-04 01:47 | 34K | |
![[IMG]](/icons/image2.gif) | 0321765796-100x100.jpg | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | 0321765796-300x300.jpg | 2023-08-15 16:02 | 14K | |
![[IMG]](/icons/image2.gif) | 0321765796.jpg | 2023-05-03 10:12 | 54K | |
![[IMG]](/icons/image2.gif) | 0321766113-100x100.jpg | 2023-08-05 02:46 | 6.0K | |
![[IMG]](/icons/image2.gif) | 0321766113-300x300.jpg | 2023-08-06 06:37 | 30K | |
![[ ]](/icons/layout.gif) | 0321766113-tspl.pdf | 2023-05-03 09:43 | 137K | |
![[IMG]](/icons/image2.gif) | 0321766113.jpg | 2023-05-03 09:43 | 119K | |
![[IMG]](/icons/image2.gif) | 0321774353_TestBank-..> | 2023-08-06 12:08 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0321774353_TestBank-..> | 2023-08-27 09:34 | 19K | |
![[IMG]](/icons/image2.gif) | 0321774353_TestBank.jpg | 2023-05-04 02:10 | 86K | |
![[ ]](/icons/unknown.gif) | 0321774353_TestBank_..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 0321776402-100x100.jpg | 2023-08-05 14:36 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0321776402-300x300.jpg | 2023-08-24 02:13 | 15K | |
![[IMG]](/icons/image2.gif) | 0321776402.jpg | 2023-05-03 10:42 | 63K | |
![[IMG]](/icons/image2.gif) | 0321794036-100x100.jpg | 2023-08-05 14:33 | 4.8K | |
![[IMG]](/icons/image2.gif) | 0321794036-300x300.jpg | 2023-08-29 04:54 | 31K | |
![[IMG]](/icons/image2.gif) | 0321794036.jpg | 2023-05-03 10:50 | 160K | |
![[IMG]](/icons/image2.gif) | 0321795431-100x100.jpg | 2023-08-06 11:04 | 3.9K | |
![[IMG]](/icons/image2.gif) | 0321795431-300x300.jpg | 2023-08-05 15:35 | 20K | |
![[IMG]](/icons/image2.gif) | 0321795431.jpg | 2023-05-03 09:24 | 84K | |
![[IMG]](/icons/image2.gif) | 0321795466-100x100.jpg | 2023-08-05 06:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0321795466-300x300.jpg | 2023-08-19 01:45 | 19K | |
![[IMG]](/icons/image2.gif) | 0321795466.jpg | 2023-05-03 09:57 | 98K | |
![[IMG]](/icons/image2.gif) | 0321797051_SM-100x10..> | 2023-08-05 15:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 0321797051_SM-300x30..> | 2023-08-22 23:45 | 20K | |
![[IMG]](/icons/image2.gif) | 0321797051_SM.jpg | 2023-05-04 02:19 | 95K | |
![[IMG]](/icons/image2.gif) | 0321797094-100x100.jpg | 2023-08-05 02:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0321797094-300x300.jpg | 2023-08-12 14:44 | 17K | |
![[IMG]](/icons/image2.gif) | 0321797094.jpg | 2023-05-03 10:53 | 75K | |
![[IMG]](/icons/image2.gif) | 0321802632-500x500-1..> | 2023-05-03 09:24 | 88K | |
![[IMG]](/icons/image2.gif) | 03218032051-100x100.jpg | 2023-08-08 07:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 03218032051-300x300.jpg | 2023-08-22 15:02 | 23K | |
![[IMG]](/icons/image2.gif) | 03218032051.jpg | 2023-05-03 09:27 | 103K | |
![[IMG]](/icons/image2.gif) | 032180709X-100x100.jpg | 2023-08-05 05:29 | 3.4K | |
![[IMG]](/icons/image2.gif) | 032180709X-300x300.jpg | 2023-08-05 04:36 | 19K | |
![[IMG]](/icons/image2.gif) | 032180709X.jpg | 2023-05-03 10:29 | 77K | |
![[IMG]](/icons/image2.gif) | 032180726X-100x100.jpg | 2023-08-05 03:37 | 3.8K | |
![[IMG]](/icons/image2.gif) | 032180726X-300x300.jpg | 2023-09-12 22:07 | 23K | |
![[IMG]](/icons/image2.gif) | 032180726X.jpg | 2023-05-03 09:43 | 125K | |
![[IMG]](/icons/image2.gif) | 0321812611-100x100.jpg | 2023-08-05 02:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | 0321812611-300x300.jpg | 2023-08-08 06:27 | 19K | |
![[IMG]](/icons/image2.gif) | 0321812611.jpg | 2023-05-03 09:57 | 111K | |
![[IMG]](/icons/image2.gif) | 0321818946-100x100.jpg | 2023-08-06 07:45 | 4.9K | |
![[IMG]](/icons/image2.gif) | 0321818946-300x300.jpg | 2023-08-13 19:44 | 33K | |
![[IMG]](/icons/image2.gif) | 0321818946.jpg | 2023-05-03 09:39 | 172K | |
![[IMG]](/icons/image2.gif) | 0321820436_SolutionM..> | 2023-08-05 06:23 | 4.9K | |
![[IMG]](/icons/image2.gif) | 0321820436_SolutionM..> | 2023-08-12 15:36 | 33K | |
![[IMG]](/icons/image2.gif) | 0321820436_SolutionM..> | 2023-05-04 02:00 | 160K | |
![[IMG]](/icons/image2.gif) | 032182184X-100x100.jpg | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 032182184X-300x300.jpg | 2023-08-05 04:35 | 19K | |
![[IMG]](/icons/image2.gif) | 032182184X.jpg | 2023-05-03 09:51 | 126K | |
![[IMG]](/icons/image2.gif) | 03218281001-500x500-..> | 2023-05-03 09:19 | 76K | |
![[IMG]](/icons/image2.gif) | 0321828321-100x100.jpg | 2023-08-08 08:29 | 4.5K | |
![[IMG]](/icons/image2.gif) | 0321828321-300x300.jpg | 2023-09-04 19:11 | 23K | |
![[IMG]](/icons/image2.gif) | 0321828321.jpg | 2023-05-03 10:15 | 96K | |
![[IMG]](/icons/image2.gif) | 03218376141-100x100.jpg | 2023-08-05 18:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | 03218376141-300x300.jpg | 2023-08-13 23:17 | 17K | |
![[IMG]](/icons/image2.gif) | 03218376141.jpg | 2023-05-03 09:48 | 84K | |
![[IMG]](/icons/image2.gif) | 0321864409-100x100.jpg | 2023-08-05 01:52 | 4.6K | |
![[IMG]](/icons/image2.gif) | 0321864409-300x300.jpg | 2023-08-16 15:50 | 27K | |
![[IMG]](/icons/image2.gif) | 0321864409.jpg | 2023-05-03 10:05 | 135K | |
![[IMG]](/icons/image2.gif) | 0321884183-100x100.jpg | 2023-08-05 06:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | 0321884183-300x300.jpg | 2023-08-05 04:35 | 22K | |
![[IMG]](/icons/image2.gif) | 0321884183.jpg | 2023-05-03 10:07 | 99K | |
![[IMG]](/icons/image2.gif) | 0321886844-100x100.jpg | 2023-08-05 02:46 | 4.1K | |
![[IMG]](/icons/image2.gif) | 0321886844-300x300.jpg | 2023-09-05 00:53 | 24K | |
![[IMG]](/icons/image2.gif) | 0321886844.jpg | 2023-05-04 02:10 | 116K | |
![[IMG]](/icons/image2.gif) | 0321886879-100x100.jpg | 2023-08-05 05:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0321886879-300x300.jpg | 2023-08-14 21:32 | 24K | |
![[IMG]](/icons/image2.gif) | 0321886879.jpg | 2023-05-03 09:48 | 122K | |
![[IMG]](/icons/image2.gif) | 0321888642-100x100.jpg | 2023-08-05 17:20 | 2.7K | |
![[IMG]](/icons/image2.gif) | 0321888642-300x300.jpg | 2023-08-21 05:38 | 14K | |
![[IMG]](/icons/image2.gif) | 0321888642.jpg | 2023-05-03 09:40 | 73K | |
![[IMG]](/icons/image2.gif) | 0321890132-100x100.jpg | 2023-08-09 17:52 | 5.0K | |
![[IMG]](/icons/image2.gif) | 0321890132-300x300.jpg | 2023-08-12 07:27 | 30K | |
![[IMG]](/icons/image2.gif) | 0321890132.jpg | 2023-05-03 10:32 | 145K | |
![[IMG]](/icons/image2.gif) | 032189023X1-500x500-..> | 2023-05-03 09:20 | 39K | |
![[IMG]](/icons/image2.gif) | 03218912441-500x500-..> | 2023-05-03 09:25 | 53K | |
![[IMG]](/icons/image2.gif) | 03218918721-500x500-..> | 2023-05-03 10:28 | 43K | |
![[IMG]](/icons/image2.gif) | 03218919101-500x500-..> | 2023-05-03 09:20 | 48K | |
![[IMG]](/icons/image2.gif) | 03218919291-500x500-..> | 2023-05-03 09:57 | 51K | |
![[IMG]](/icons/image2.gif) | 03218919371-500x500-..> | 2023-05-03 10:40 | 65K | |
![[IMG]](/icons/image2.gif) | 03218919531-500x500-..> | 2023-05-03 09:21 | 33K | |
![[IMG]](/icons/image2.gif) | 03218971961-500x500-..> | 2023-05-03 09:34 | 34K | |
![[IMG]](/icons/image2.gif) | 032189720X1-500x500-..> | 2023-05-03 09:31 | 38K | |
![[ ]](/icons/layout.gif) | 0321897218-chapter-1..> | 2023-05-03 09:31 | 157K | |
![[IMG]](/icons/image2.gif) | 0321897390-100x100.jpg | 2023-08-05 17:23 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0321897390.jpg | 2023-05-03 09:33 | 15K | |
![[IMG]](/icons/image2.gif) | 0321897617-1-100x100..> | 2023-08-05 01:13 | 2.4K | |
![[IMG]](/icons/image2.gif) | 0321897617-1-300x300..> | 2023-08-12 04:49 | 18K | |
![[IMG]](/icons/image2.gif) | 0321897617-1.jpg | 2023-05-03 10:02 | 126K | |
![[IMG]](/icons/image2.gif) | 0321897617-100x100.jpg | 2023-08-06 07:45 | 2.4K | |
![[IMG]](/icons/image2.gif) | 0321897617-300x300.jpg | 2023-08-27 05:08 | 18K | |
![[IMG]](/icons/image2.gif) | 0321897617.jpg | 2023-05-03 09:32 | 126K | |
![[IMG]](/icons/image2.gif) | 0321900448-100x100.jpg | 2023-08-05 03:41 | 1.6K | |
![[IMG]](/icons/image2.gif) | 0321900448-300x300.jpg | 2023-08-19 01:45 | 7.7K | |
![[IMG]](/icons/image2.gif) | 0321900448.jpg | 2023-05-03 10:26 | 54K | |
![[IMG]](/icons/image2.gif) | 032190303X-100x100.jpg | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | 032190303X-300x300.jpg | 2023-10-26 03:30 | 17K | |
![[IMG]](/icons/image2.gif) | 032190303X.jpg | 2023-05-03 09:38 | 80K | |
![[IMG]](/icons/image2.gif) | 032190303X1-100x100.jpg | 2023-08-05 03:39 | 3.7K | |
![[IMG]](/icons/image2.gif) | 032190303X1-300x300.jpg | 2023-08-21 02:16 | 17K | |
![[IMG]](/icons/image2.gif) | 032190303X1.jpg | 2023-05-03 10:11 | 80K | |
![[IMG]](/icons/image2.gif) | 0321913949-100x100.jpg | 2023-08-06 11:14 | 2.8K | |
![[IMG]](/icons/image2.gif) | 0321913949-300x300.jpg | 2023-08-22 20:06 | 13K | |
![[IMG]](/icons/image2.gif) | 0321913949.jpg | 2023-05-03 10:55 | 73K | |
![[IMG]](/icons/image2.gif) | 0321922212-100x100.jpg | 2023-08-06 11:16 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0321922212-300x300.jpg | 2023-08-29 04:54 | 21K | |
![[IMG]](/icons/image2.gif) | 0321922212.jpg | 2023-05-03 10:27 | 88K | |
![[IMG]](/icons/image2.gif) | 0321928423-500x5001-..> | 2023-05-03 09:59 | 30K | |
![[IMG]](/icons/image2.gif) | 03219379451-500x500-..> | 2023-05-03 09:20 | 85K | |
![[IMG]](/icons/image2.gif) | 03219379531-500x500-..> | 2023-05-03 09:31 | 57K | |
![[IMG]](/icons/image2.gif) | 0321939646-100x100.jpg | 2023-08-06 08:46 | 5.1K | |
![[IMG]](/icons/image2.gif) | 0321939646-300x300.jpg | 2023-08-10 16:04 | 31K | |
![[IMG]](/icons/image2.gif) | 0321939646.jpg | 2023-05-03 09:38 | 151K | |
![[IMG]](/icons/image2.gif) | 0321943643-100x100.jpg | 2023-08-05 05:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0321943643-300x300.jpg | 2023-08-29 04:54 | 17K | |
![[IMG]](/icons/image2.gif) | 0321943643.jpg | 2023-05-03 11:10 | 110K | |
![[IMG]](/icons/image2.gif) | 0321944518-100x100.jpg | 2023-08-05 03:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0321944518-300x300.jpg | 2023-08-05 15:27 | 28K | |
![[IMG]](/icons/image2.gif) | 0321944518.jpg | 2023-05-03 09:54 | 151K | |
![[IMG]](/icons/image2.gif) | 0321947622-100x100.jpg | 2023-08-06 17:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | 0321947622-300x300.jpg | 2023-08-06 17:28 | 15K | |
![[IMG]](/icons/image2.gif) | 0321947622.jpg | 2023-05-03 11:07 | 71K | |
![[IMG]](/icons/image2.gif) | 0321953312-500x5001-..> | 2023-05-04 02:29 | 42K | |
![[IMG]](/icons/image2.gif) | 0321965159-100x100.jpg | 2023-08-05 04:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | 0321965159-300x300.jpg | 2023-08-18 04:17 | 32K | |
![[IMG]](/icons/image2.gif) | 0321965159.jpg | 2023-05-03 09:39 | 179K | |
![[IMG]](/icons/image2.gif) | 0321965175-100x100.jpg | 2023-08-05 05:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | 0321965175-300x300.jpg | 2023-08-13 06:55 | 32K | |
![[IMG]](/icons/image2.gif) | 0321965175.jpg | 2023-05-03 10:10 | 179K | |
![[IMG]](/icons/image2.gif) | 0321970144-_SM-100x1..> | 2023-08-05 05:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | 0321970144-_SM-300x3..> | 2023-08-17 18:14 | 22K | |
![[IMG]](/icons/image2.gif) | 0321970144-_SM.jpg | 2023-05-03 09:23 | 86K | |
![[ ]](/icons/layout.gif) | 0321970144_TestBank_..> | 2023-05-03 09:43 | 150K | |
![[IMG]](/icons/image2.gif) | 03219805571-500x500-..> | 2023-05-03 09:20 | 64K | |
![[IMG]](/icons/image2.gif) | 0321997824-100x100.jpg | 2023-08-06 10:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | 0321997824-300x300.jpg | 2023-08-27 05:21 | 19K | |
![[IMG]](/icons/image2.gif) | 0321997824.jpg | 2023-05-03 10:46 | 80K | |
![[IMG]](/icons/image2.gif) | 0323083889-100x100.jpg | 2023-08-06 04:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 0323083889.jpg | 2023-05-04 01:52 | 16K | |
![[ ]](/icons/layout.gif) | 0323171117-tspl.pdf | 2023-05-03 13:40 | 129K | |
![[ ]](/icons/compressed.gif) | 0324786662_TB_ch01.zip | 2023-05-03 10:24 | 13K | |
![[ ]](/icons/unknown.gif) | 0357033841_632479.docx | 2023-05-04 02:03 | 27K | |
![[IMG]](/icons/image2.gif) | 0393123960-100x100.jpg | 2023-08-06 03:28 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0393123960.jpg | 2023-05-03 10:38 | 17K | |
![[IMG]](/icons/image2.gif) | 04703832751-100x100.jpg | 2023-08-05 01:52 | 30K | |
![[IMG]](/icons/image2.gif) | 04703832751-300x300.jpg | 2023-08-05 21:01 | 71K | |
![[IMG]](/icons/image2.gif) | 04703832751.jpg | 2023-05-04 02:15 | 85K | |
![[IMG]](/icons/image2.gif) | 0470673419-100x100.jpg | 2023-08-05 01:12 | 3.8K | |
![[IMG]](/icons/image2.gif) | 0470673419.jpg | 2023-05-03 10:06 | 17K | |
![[IMG]](/icons/image2.gif) | 0470907762_TB-100x10..> | 2023-08-05 06:24 | 19K | |
![[IMG]](/icons/image2.gif) | 0470907762_TB-300x30..> | 2023-08-20 18:55 | 45K | |
![[IMG]](/icons/image2.gif) | 0470907762_TB.jpg | 2023-05-04 02:15 | 64K | |
![[IMG]](/icons/image2.gif) | 0471232793_SolutionM..> | 2023-08-07 15:49 | 2.5K | |
![[IMG]](/icons/image2.gif) | 0471232793_SolutionM..> | 2023-08-08 17:45 | 13K | |
![[IMG]](/icons/image2.gif) | 0471232793_SolutionM..> | 2023-05-04 02:17 | 17K | |
![[IMG]](/icons/image2.gif) | 0471410772_01__SX220..> | 2023-08-05 06:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | 0471410772_01__SX220..> | 2023-05-03 10:02 | 14K | |
![[ ]](/icons/layout.gif) | 049550470X-tspl.pdf | 2023-05-03 13:41 | 232K | |
![[IMG]](/icons/image2.gif) | 0495556718-100x100.jpg | 2023-08-05 06:25 | 2.3K | |
![[IMG]](/icons/image2.gif) | 0495556718.jpg | 2023-05-03 09:22 | 9.9K | |
![[ ]](/icons/compressed.gif) | 0495573558_153237.zip | 2023-05-03 10:22 | 19K | |
![[ ]](/icons/unknown.gif) | 0495915254_266107.doc | 2023-05-03 09:40 | 192K | |
![[ ]](/icons/unknown.gif) | 0538452196_245323.doc | 2023-05-03 10:34 | 46K | |
![[IMG]](/icons/image2.gif) | 053848117X-100x100.jpg | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | 053848117X.jpg | 2023-05-03 10:27 | 13K | |
![[ ]](/icons/compressed.gif) | 0538731095_223854.zip | 2023-05-04 02:13 | 661K | |
![[IMG]](/icons/image2.gif) | 0558813747-100x100.jpg | 2023-08-06 12:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | 0558813747-300x300.jpg | 2023-08-14 19:44 | 23K | |
![[IMG]](/icons/image2.gif) | 0558813747-500x500-1..> | 2023-05-03 09:45 | 62K | |
![[IMG]](/icons/image2.gif) | 0558813747.jpg | 2023-05-03 10:38 | 105K | |
![[ ]](/icons/unknown.gif) | 07-Test-Bank-for-Eco..> | 2023-05-04 01:56 | 753K | |
![[IMG]](/icons/image2.gif) | 0716776812-100x100.jpg | 2023-08-05 14:38 | 2.1K | |
![[IMG]](/icons/image2.gif) | 0716776812.jpg | 2023-05-03 11:12 | 7.4K | |
![[IMG]](/icons/image2.gif) | 07303435451-100x100.jpg | 2023-08-05 04:34 | 11K | |
![[IMG]](/icons/image2.gif) | 07303435451-300x300.jpg | 2023-08-24 01:33 | 37K | |
![[IMG]](/icons/image2.gif) | 07303435451.jpg | 2023-05-04 02:11 | 49K | |
![[IMG]](/icons/image2.gif) | 07303446221-100x100.jpg | 2023-08-09 00:59 | 18K | |
![[IMG]](/icons/image2.gif) | 07303446221-300x300.jpg | 2023-08-12 23:31 | 52K | |
![[IMG]](/icons/image2.gif) | 07303446221.jpg | 2023-05-03 11:07 | 69K | |
![[ ]](/icons/layout.gif) | 080364549X-tspl.pdf | 2023-05-03 13:40 | 284K | |
![[ ]](/icons/layout.gif) | 09779_V3_Ch01_SWFT20..> | 2023-05-04 02:04 | 173K | |
![[ ]](/icons/layout.gif) | 09793_V2_ch01_SWFT20..> | 2023-05-04 02:05 | 168K | |
![[ ]](/icons/layout.gif) | 09816_V4_Ch01_SWFT20..> | 2023-05-04 01:57 | 153K | |
![[ ]](/icons/unknown.gif) | 1-1.rtf | 2023-05-03 13:43 | 3.0M | |
![[IMG]](/icons/image2.gif) | 1-2-100x100.jpg | 2023-08-08 07:32 | 14K | |
![[IMG]](/icons/image2.gif) | 1-2-300x300.jpg | 2023-08-10 21:17 | 32K | |
![[IMG]](/icons/image2.gif) | 1-2.jpg | 2023-05-04 02:12 | 139K | |
![[IMG]](/icons/image2.gif) | 1-16-100x100.jpg | 2023-08-06 13:05 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1-16-300x300.jpg | 2023-08-06 03:41 | 16K | |
![[IMG]](/icons/image2.gif) | 1-16.jpg | 2023-05-03 10:26 | 37K | |
![[IMG]](/icons/image2.gif) | 1-21-100x100.jpg | 2023-08-05 03:40 | 2.4K | |
![[IMG]](/icons/image2.gif) | 1-21-300x300.jpg | 2023-08-10 16:04 | 11K | |
![[IMG]](/icons/image2.gif) | 1-21.jpg | 2023-05-03 09:27 | 15K | |
![[IMG]](/icons/image2.gif) | 1-24-100x100.jpg | 2023-08-05 01:52 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1-24-300x300.jpg | 2023-08-06 16:00 | 19K | |
![[IMG]](/icons/image2.gif) | 1-24.jpg | 2023-05-03 10:37 | 39K | |
![[IMG]](/icons/image2.gif) | 1-28-100x100.jpg | 2023-08-08 06:39 | 2.3K | |
![[IMG]](/icons/image2.gif) | 1-28-300x300.jpg | 2023-08-14 03:16 | 10K | |
![[IMG]](/icons/image2.gif) | 1-28.jpg | 2023-05-03 10:37 | 27K | |
![[IMG]](/icons/image2.gif) | 1-40-100x100.jpg | 2023-08-05 15:31 | 4.1K | |
![[IMG]](/icons/image2.gif) | 1-40-300x300.jpg | 2023-08-13 04:19 | 22K | |
![[IMG]](/icons/image2.gif) | 1-40.jpg | 2023-05-03 11:02 | 46K | |
![[IMG]](/icons/image2.gif) | 1-41-100x100.jpg | 2023-08-05 03:40 | 4.4K | |
![[IMG]](/icons/image2.gif) | 1-41-300x300.jpg | 2023-08-17 04:49 | 23K | |
![[IMG]](/icons/image2.gif) | 1-41.jpg | 2023-05-03 10:40 | 52K | |
![[IMG]](/icons/image2.gif) | 1-45-100x100.jpg | 2023-08-06 12:08 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1-45-300x300.jpg | 2023-08-06 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | 1-45.jpg | 2023-05-03 11:20 | 33K | |
![[ ]](/icons/unknown.gif) | 1-9780323551311.rtf | 2023-05-03 11:14 | 60K | |
![[ ]](/icons/unknown.gif) | 1-9781260261523.docx | 2023-05-04 01:56 | 68K | |
![[IMG]](/icons/image2.gif) | 1-97813055834121-100..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 1-97813055834121-300..> | 2023-09-04 00:09 | 20K | |
![[IMG]](/icons/image2.gif) | 1-97813055834121.jpg | 2023-05-04 02:26 | 41K | |
![[ ]](/icons/unknown.gif) | 1-Human-Genetics-Con..> | 2023-05-03 10:22 | 31K | |
![[ ]](/icons/compressed.gif) | 1-Medical-Surgical-N..> | 2023-05-04 01:52 | 8.7K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-For-Fund..> | 2023-05-03 09:41 | 88K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-For-The-..> | 2023-05-03 09:33 | 119K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-For-Toda..> | 2023-05-03 09:47 | 15K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-for-Cogn..> | 2023-05-03 09:44 | 110K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-for-Empl..> | 2023-05-03 10:41 | 160K | |
![[ ]](/icons/unknown.gif) | 1-Test-Bank-for-Medi..> | 2023-05-03 10:24 | 29K | |
![[ ]](/icons/layout.gif) | 1-Test-Bank-for-Psyc..> | 2023-05-03 10:28 | 1.6M | |
![[ ]](/icons/compressed.gif) | 1-Test-bank-for-Inte..> | 2023-05-03 10:05 | 18K | |
![[ ]](/icons/unknown.gif) | 1-Walking-the-Plank...> | 2023-05-03 10:16 | 80K | |
![[ ]](/icons/compressed.gif) | 1.zip | 2023-05-04 02:19 | 54K | |
![[ ]](/icons/unknown.gif) | 1_1___Problem_Solvin..> | 2023-05-03 10:53 | 145K | |
![[ ]](/icons/unknown.gif) | 1_Abnormal_Behavior...> | 2023-05-03 13:42 | 64K | |
![[ ]](/icons/unknown.gif) | 1e-IM-Chapter1-Solut..> | 2023-05-03 10:18 | 76K | |
![[IMG]](/icons/image2.gif) | 2-4-100x100.jpg | 2023-08-08 21:05 | 3.2K | |
![[IMG]](/icons/image2.gif) | 2-4-300x300.jpg | 2023-09-04 21:53 | 17K | |
![[IMG]](/icons/image2.gif) | 2-4.jpg | 2023-05-03 10:53 | 25K | |
![[IMG]](/icons/image2.gif) | 2_1.jpg | 2023-05-03 09:25 | 63K | |
![[IMG]](/icons/image2.gif) | 2__34718.1400197665...> | 2023-05-03 10:46 | 8.7K | |
![[ ]](/icons/unknown.gif) | 2e-Chapter02_solutio..> | 2023-05-03 10:11 | 121K | |
![[IMG]](/icons/image2.gif) | 3-1-100x100.jpg | 2023-08-06 19:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | 3-1-300x300.jpg | 2023-08-30 07:22 | 18K | |
![[IMG]](/icons/image2.gif) | 3-1.jpg | 2023-05-04 02:01 | 31K | |
![[ ]](/icons/compressed.gif) | 4e779f9c2593f-unders..> | 2023-05-03 09:29 | 8.6K | |
![[ ]](/icons/compressed.gif) | 4ed_ch01_solutions.zip | 2023-05-03 10:17 | 108K | |
![[ ]](/icons/compressed.gif) | 7ED-SM_02.zip | 2023-05-03 10:40 | 21K | |
![[IMG]](/icons/image2.gif) | 8e-100x100.jpg | 2023-08-08 07:33 | 3.8K | |
![[IMG]](/icons/image2.gif) | 8e.jpg | 2023-05-03 10:44 | 23K | |
![[ ]](/icons/unknown.gif) | 8e_BGN_CH01_SM_final..> | 2023-05-04 01:59 | 723K | |
![[IMG]](/icons/image2.gif) | 9th-edition-test-ban..> | 2023-08-08 15:42 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9th-edition-test-ban..> | 2023-08-09 09:54 | 19K | |
![[IMG]](/icons/image2.gif) | 9th-edition-test-ban..> | 2023-05-03 10:22 | 52K | |
![[IMG]](/icons/image2.gif) | 10-3-100x100.jpg | 2023-08-05 06:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | 10-3-300x300.jpg | 2023-08-30 07:22 | 19K | |
![[IMG]](/icons/image2.gif) | 10-3.jpg | 2023-05-04 02:13 | 27K | |
![[IMG]](/icons/image2.gif) | 10-4-1-100x100.jpg | 2023-08-05 16:15 | 3.1K | |
![[IMG]](/icons/image2.gif) | 10-4-1-300x300.jpg | 2023-08-24 21:55 | 13K | |
![[IMG]](/icons/image2.gif) | 10-4-1.jpg | 2023-05-04 01:57 | 18K | |
![[ ]](/icons/compressed.gif) | 13eTIF01.zip | 2023-05-03 10:25 | 33K | |
![[IMG]](/icons/image2.gif) | 14bdfd_1a0eafa371ea4..> | 2023-05-04 02:20 | 45K | |
![[ ]](/icons/unknown.gif) | 14e_GNB_CH01_SM.docx | 2023-05-03 10:26 | 30K | |
![[ ]](/icons/unknown.gif) | 14e_TB_Ch01-Strategi..> | 2023-05-03 10:43 | 71K | |
![[IMG]](/icons/image2.gif) | 18_1.jpg | 2023-05-03 10:21 | 48K | |
![[ ]](/icons/compressed.gif) | 18e_Section5_Chapter..> | 2023-05-03 09:43 | 202K | |
![[IMG]](/icons/image2.gif) | 20-53da32093deff2-10..> | 2023-08-05 15:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | 20-53da32093deff2-30..> | 2023-08-08 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | 20-53da32093deff2.jpg | 2023-05-03 10:46 | 78K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff2-100..> | 2023-08-06 07:45 | 4.1K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff2-300..> | 2023-08-21 10:08 | 23K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff2.jpg | 2023-05-03 10:06 | 98K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff21-10..> | 2023-08-09 15:43 | 4.1K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff21-30..> | 2023-08-23 21:13 | 23K | |
![[IMG]](/icons/image2.gif) | 20-53da32093eff21.jpg | 2023-05-03 10:06 | 98K | |
![[IMG]](/icons/image2.gif) | 21_1_1.jpg | 2023-05-03 10:41 | 46K | |
![[IMG]](/icons/image2.gif) | 26_1.jpg | 2023-05-03 11:02 | 42K | |
![[IMG]](/icons/image2.gif) | 31-BzdMOiDL-100x100.jpg | 2023-08-05 15:35 | 1.6K | |
![[IMG]](/icons/image2.gif) | 31-BzdMOiDL-300x300.jpg | 2023-08-13 15:24 | 7.5K | |
![[IMG]](/icons/image2.gif) | 31-BzdMOiDL.jpg | 2023-05-04 02:22 | 14K | |
![[IMG]](/icons/image2.gif) | 31YVynxFxoL._SY300__..> | 2023-08-09 05:37 | 1.6K | |
![[IMG]](/icons/image2.gif) | 31YVynxFxoL._SY300__..> | 2023-05-03 10:45 | 6.5K | |
![[IMG]](/icons/image2.gif) | 31kVpVWTTnL._SX385_B..> | 2023-08-08 06:38 | 1.5K | |
![[IMG]](/icons/image2.gif) | 31kVpVWTTnL._SX385_B..> | 2023-08-18 21:48 | 7.1K | |
![[IMG]](/icons/image2.gif) | 31kVpVWTTnL._SX385_B..> | 2023-05-04 01:58 | 12K | |
![[IMG]](/icons/image2.gif) | 35__70598.1400197702..> | 2023-08-06 05:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | 35__70598.1400197702..> | 2023-05-03 09:32 | 15K | |
![[IMG]](/icons/image2.gif) | 36-53da321c077bb-100..> | 2023-08-08 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | 36-53da321c077bb-300..> | 2023-08-05 01:14 | 18K | |
![[IMG]](/icons/image2.gif) | 36-53da321c077bb.jpg | 2023-05-03 09:07 | 103K | |
![[IMG]](/icons/image2.gif) | 38.jpg | 2023-05-03 10:46 | 78K | |
![[IMG]](/icons/image2.gif) | 41-KBW20WkL._SX376_B..> | 2023-08-06 03:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41-KBW20WkL._SX376_B..> | 2023-10-11 08:33 | 15K | |
![[IMG]](/icons/image2.gif) | 41-KBW20WkL._SX376_B..> | 2023-05-03 11:04 | 26K | |
![[IMG]](/icons/image2.gif) | 41.jpg | 2023-05-03 09:59 | 56K | |
![[IMG]](/icons/image2.gif) | 41AzXhSO98L._SX365_B..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | 41AzXhSO98L._SX365_B..> | 2023-08-24 21:55 | 16K | |
![[IMG]](/icons/image2.gif) | 41AzXhSO98L._SX365_B..> | 2023-05-04 02:17 | 27K | |
![[IMG]](/icons/image2.gif) | 41C-aJCEBCL._SX258_B..> | 2023-08-05 05:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | 41C-aJCEBCL._SX258_B..> | 2023-05-03 10:23 | 19K | |
![[IMG]](/icons/image2.gif) | 41Csy1ENl0L-100x100.jpg | 2023-08-08 16:37 | 3.3K | |
![[IMG]](/icons/image2.gif) | 41Csy1ENl0L-300x300.jpg | 2023-08-12 06:52 | 15K | |
![[IMG]](/icons/image2.gif) | 41Csy1ENl0L.jpg | 2023-05-04 01:48 | 31K | |
![[IMG]](/icons/image2.gif) | 41D50mefkoL._SX258_B..> | 2023-08-05 14:39 | 3.6K | |
![[IMG]](/icons/image2.gif) | 41D50mefkoL._SX258_B..> | 2023-05-03 10:57 | 19K | |
![[IMG]](/icons/image2.gif) | 41D50mefkoL._SX258_B..> | 2023-08-09 08:49 | 3.6K | |
![[IMG]](/icons/image2.gif) | 41D50mefkoL._SX258_B..> | 2023-05-03 10:57 | 19K | |
![[IMG]](/icons/image2.gif) | 41DjXQ6lUiL._SX389_B..> | 2023-08-06 13:05 | 2.3K | |
![[IMG]](/icons/image2.gif) | 41DjXQ6lUiL._SX389_B..> | 2023-08-13 13:05 | 8.2K | |
![[IMG]](/icons/image2.gif) | 41DjXQ6lUiL._SX389_B..> | 2023-05-03 11:19 | 16K | |
![[IMG]](/icons/image2.gif) | 41Dx1SlMroL._SY300_-..> | 2023-08-05 04:35 | 2.3K | |
![[IMG]](/icons/image2.gif) | 41Dx1SlMroL._SY300_.jpg | 2023-05-03 11:15 | 10K | |
![[IMG]](/icons/image2.gif) | 41E9UcgOSZL._SX392_B..> | 2023-08-05 16:28 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41E9UcgOSZL._SX392_B..> | 2023-08-06 06:37 | 11K | |
![[IMG]](/icons/image2.gif) | 41E9UcgOSZL._SX392_B..> | 2023-05-04 02:22 | 20K | |
![[IMG]](/icons/image2.gif) | 41EbCFc-ZuL._SX402_B..> | 2023-08-06 13:03 | 2.6K | |
![[IMG]](/icons/image2.gif) | 41EbCFc-ZuL._SX402_B..> | 2023-08-11 12:03 | 14K | |
![[IMG]](/icons/image2.gif) | 41EbCFc-ZuL._SX402_B..> | 2023-05-04 02:15 | 33K | |
![[IMG]](/icons/image2.gif) | 41Ej4H1oNTL._SX410_B..> | 2023-08-06 12:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | 41Ej4H1oNTL._SX410_B..> | 2023-08-11 01:04 | 17K | |
![[IMG]](/icons/image2.gif) | 41Ej4H1oNTL._SX410_B..> | 2023-05-04 01:54 | 32K | |
![[IMG]](/icons/image2.gif) | 41Fp3vOVB2BL._SX258_..> | 2023-08-06 05:44 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41Fp3vOVB2BL._SX258_..> | 2023-05-03 10:59 | 13K | |
![[IMG]](/icons/image2.gif) | 41H7u-nFauL._SX379_B..> | 2023-08-05 05:30 | 2.2K | |
![[IMG]](/icons/image2.gif) | 41H7u-nFauL._SX379_B..> | 2023-08-25 19:27 | 12K | |
![[IMG]](/icons/image2.gif) | 41H7u-nFauL._SX379_B..> | 2023-05-03 11:08 | 22K | |
![[IMG]](/icons/image2.gif) | 41HHNhVriML._SX387_B..> | 2023-08-05 04:37 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41HHNhVriML._SX387_B..> | 2023-09-02 05:48 | 13K | |
![[IMG]](/icons/image2.gif) | 41HHNhVriML._SX387_B..> | 2023-05-03 10:54 | 18K | |
![[IMG]](/icons/image2.gif) | 41J6ODs9CVL._SX258_B..> | 2023-08-05 16:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | 41J6ODs9CVL._SX258_B..> | 2023-05-04 02:21 | 21K | |
![[IMG]](/icons/image2.gif) | 41J6ODs9CVL._SX258_B..> | 2023-08-05 02:03 | 4.1K | |
![[IMG]](/icons/image2.gif) | 41J6ODs9CVL._SX258_B..> | 2023-05-04 02:21 | 21K | |
![[IMG]](/icons/image2.gif) | 41KH49TuqRL._SX389_B..> | 2023-08-06 05:47 | 2.7K | |
![[IMG]](/icons/image2.gif) | 41KH49TuqRL._SX389_B..> | 2023-08-16 00:25 | 14K | |
![[IMG]](/icons/image2.gif) | 41KH49TuqRL._SX389_B..> | 2023-05-04 02:22 | 25K | |
![[IMG]](/icons/image2.gif) | 41KvjS7tMsL._SX257_B..> | 2023-08-05 03:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41KvjS7tMsL._SX257_B..> | 2023-05-03 11:03 | 15K | |
![[IMG]](/icons/image2.gif) | 41OfP53ISiL._BO22042..> | 2023-05-03 10:46 | 15K | |
![[IMG]](/icons/image2.gif) | 41OujntOamL._SX389_B..> | 2023-08-05 17:19 | 3.9K | |
![[IMG]](/icons/image2.gif) | 41OujntOamL._SX389_B..> | 2023-09-01 03:43 | 17K | |
![[IMG]](/icons/image2.gif) | 41OujntOamL._SX389_B..> | 2023-05-04 02:19 | 30K | |
![[IMG]](/icons/image2.gif) | 41PeEafuUdL._SX388_B..> | 2023-08-08 07:32 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41PeEafuUdL._SX388_B..> | 2023-09-05 00:52 | 13K | |
![[IMG]](/icons/image2.gif) | 41PeEafuUdL._SX388_B..> | 2023-05-04 01:54 | 25K | |
![[IMG]](/icons/image2.gif) | 41Pl9jT73KL._SY300__..> | 2023-08-05 01:11 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41Pl9jT73KL._SY300__..> | 2023-05-03 10:03 | 13K | |
![[IMG]](/icons/image2.gif) | 41QkJDvQquL._SY300__..> | 2023-08-05 04:37 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41QkJDvQquL._SY300__..> | 2023-05-03 09:40 | 14K | |
![[IMG]](/icons/image2.gif) | 41QomZI0DSL._SX258_B..> | 2023-08-09 08:06 | 3.1K | |
![[IMG]](/icons/image2.gif) | 41QomZI0DSL._SX258_B..> | 2023-05-03 10:52 | 14K | |
![[IMG]](/icons/image2.gif) | 41RKQzcSvIL.-SY300--..> | 2023-08-05 02:46 | 2.1K | |
![[IMG]](/icons/image2.gif) | 41RKQzcSvIL.-SY300-.jpg | 2023-05-04 02:16 | 11K | |
![[IMG]](/icons/image2.gif) | 41RKQzcSvIL._SY300_-..> | 2023-08-05 03:41 | 2.1K | |
![[IMG]](/icons/image2.gif) | 41RKQzcSvIL._SY300_.jpg | 2023-05-03 09:38 | 11K | |
![[IMG]](/icons/image2.gif) | 41RLm6-AvVL-3-100x10..> | 2023-08-06 07:45 | 13K | |
![[IMG]](/icons/image2.gif) | 41RLm6-AvVL-3.jpg | 2023-05-04 01:57 | 31K | |
![[IMG]](/icons/image2.gif) | 41S5DisoTrL._SX376_B..> | 2023-08-05 16:16 | 2.5K | |
![[IMG]](/icons/image2.gif) | 41S5DisoTrL._SX376_B..> | 2023-08-07 18:53 | 13K | |
![[IMG]](/icons/image2.gif) | 41S5DisoTrL._SX376_B..> | 2023-05-04 02:19 | 20K | |
![[IMG]](/icons/image2.gif) | 41T-pR0bHIL._SX395_B..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | 41T-pR0bHIL._SX395_B..> | 2023-08-08 23:47 | 12K | |
![[IMG]](/icons/image2.gif) | 41T-pR0bHIL._SX395_B..> | 2023-05-04 01:55 | 23K | |
![[IMG]](/icons/image2.gif) | 41TZlUMb95L._SX413_B..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | 41TZlUMb95L._SX413_B..> | 2023-08-11 14:11 | 19K | |
![[IMG]](/icons/image2.gif) | 41TZlUMb95L._SX413_B..> | 2023-05-03 11:13 | 32K | |
![[IMG]](/icons/image2.gif) | 41TjCGt_N6L._SY300__..> | 2023-08-05 04:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41TjCGt_N6L._SY300__..> | 2023-05-04 01:53 | 14K | |
![[IMG]](/icons/image2.gif) | 41TzTsKDYHL._SY300__..> | 2023-08-05 04:34 | 2.1K | |
![[IMG]](/icons/image2.gif) | 41TzTsKDYHL._SY300__..> | 2023-05-03 09:22 | 11K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-08-05 02:55 | 3.4K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-09-04 20:54 | 18K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-05-04 01:48 | 30K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-08-06 22:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-08-14 23:08 | 18K | |
![[IMG]](/icons/image2.gif) | 41XAisk8HvL._SX389_B..> | 2023-05-04 01:47 | 30K | |
![[IMG]](/icons/image2.gif) | 41ZRAHRCpoL._SX403_B..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | 41ZRAHRCpoL._SX403_B..> | 2023-08-05 04:36 | 13K | |
![[IMG]](/icons/image2.gif) | 41ZRAHRCpoL._SX403_B..> | 2023-05-03 10:50 | 22K | |
![[IMG]](/icons/image2.gif) | 41ZfyA407XL._SX389_B..> | 2023-08-05 15:33 | 3.8K | |
![[IMG]](/icons/image2.gif) | 41ZfyA407XL._SX389_B..> | 2023-08-05 04:35 | 20K | |
![[IMG]](/icons/image2.gif) | 41ZfyA407XL._SX389_B..> | 2023-05-04 02:05 | 30K | |
![[IMG]](/icons/image2.gif) | 41Zsh5n466L._SX384_B..> | 2023-08-06 10:17 | 3.1K | |
![[IMG]](/icons/image2.gif) | 41Zsh5n466L._SX384_B..> | 2023-08-21 10:08 | 15K | |
![[IMG]](/icons/image2.gif) | 41Zsh5n466L._SX384_B..> | 2023-05-03 11:14 | 24K | |
![[IMG]](/icons/image2.gif) | 41_v2GZ_K2L._SY300__..> | 2023-08-08 13:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41_v2GZ_K2L._SY300__..> | 2023-05-03 11:21 | 13K | |
![[IMG]](/icons/image2.gif) | 41aSuhL6j-L-100x100.jpg | 2023-08-06 04:16 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41aSuhL6j-L-300x300.jpg | 2023-08-25 16:56 | 15K | |
![[IMG]](/icons/image2.gif) | 41aSuhL6j-L.jpg | 2023-05-04 01:50 | 29K | |
![[IMG]](/icons/image2.gif) | 41anrK-s6vL._SX387_B..> | 2023-08-05 09:32 | 2.7K | |
![[IMG]](/icons/image2.gif) | 41anrK-s6vL._SX387_B..> | 2023-08-13 23:17 | 13K | |
![[IMG]](/icons/image2.gif) | 41anrK-s6vL._SX387_B..> | 2023-05-04 02:21 | 23K | |
![[IMG]](/icons/image2.gif) | 41at3zz4GrL._SY300_-..> | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41at3zz4GrL._SY300_.jpg | 2023-05-03 10:10 | 13K | |
![[IMG]](/icons/image2.gif) | 41bIS-dUsfL-100x100.jpg | 2023-08-05 17:20 | 12K | |
![[IMG]](/icons/image2.gif) | 41bIS-dUsfL.jpg | 2023-05-04 02:15 | 30K | |
![[IMG]](/icons/image2.gif) | 41bdNJDxnML._SY300_-..> | 2023-08-06 03:52 | 3.6K | |
![[IMG]](/icons/image2.gif) | 41bdNJDxnML._SY300_.jpg | 2023-05-03 11:24 | 25K | |
![[IMG]](/icons/image2.gif) | 41cTJMaJC7L._SX382_B..> | 2023-08-05 04:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | 41cTJMaJC7L._SX382_B..> | 2023-08-12 03:36 | 15K | |
![[IMG]](/icons/image2.gif) | 41cTJMaJC7L._SX382_B..> | 2023-05-04 01:58 | 25K | |
![[IMG]](/icons/image2.gif) | 41fdPuesi-L._SY300_-..> | 2023-08-05 06:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41fdPuesi-L._SY300_.jpg | 2023-05-03 10:27 | 12K | |
![[IMG]](/icons/image2.gif) | 41hF7u6aVtL._SX373_B..> | 2023-08-05 14:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41hF7u6aVtL._SX373_B..> | 2023-08-05 04:35 | 15K | |
![[IMG]](/icons/image2.gif) | 41hF7u6aVtL._SX373_B..> | 2023-05-03 11:15 | 23K | |
![[IMG]](/icons/image2.gif) | 41jpBUqF4LL._SY300__..> | 2023-08-06 05:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41jpBUqF4LL._SY300__..> | 2023-05-03 10:10 | 12K | |
![[IMG]](/icons/image2.gif) | 41mCfO-z2BbL._SX258_..> | 2023-08-05 01:11 | 2.8K | |
![[IMG]](/icons/image2.gif) | 41mCfO-z2BbL._SX258_..> | 2023-05-03 11:03 | 13K | |
![[IMG]](/icons/image2.gif) | 41mW6RLUcqL.-SY300-1..> | 2023-08-05 04:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41mW6RLUcqL.-SY300-1..> | 2023-05-04 01:57 | 11K | |
![[IMG]](/icons/image2.gif) | 41osWcXeayL._SX387_B..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 41osWcXeayL._SX387_B..> | 2023-08-05 01:54 | 13K | |
![[IMG]](/icons/image2.gif) | 41osWcXeayL._SX387_B..> | 2023-05-04 01:59 | 28K | |
![[IMG]](/icons/image2.gif) | 41piUGfccrL._SX258_B..> | 2023-08-05 15:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 41piUGfccrL._SX258_B..> | 2023-05-03 09:50 | 18K | |
![[IMG]](/icons/image2.gif) | 41q6CN_wabL._SY300__..> | 2023-08-05 02:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | 41q6CN_wabL._SY300__..> | 2023-05-03 09:59 | 13K | |
![[IMG]](/icons/image2.gif) | 41ta77D_jnL__29886.1..> | 2023-08-05 04:34 | 2.3K | |
![[IMG]](/icons/image2.gif) | 41ta77D_jnL__29886.1..> | 2023-08-15 01:39 | 11K | |
![[IMG]](/icons/image2.gif) | 41ta77D_jnL__29886.1..> | 2023-05-03 09:47 | 24K | |
![[IMG]](/icons/image2.gif) | 41u3txsU0L._SX397_BO..> | 2023-08-06 13:02 | 2.3K | |
![[IMG]](/icons/image2.gif) | 41u3txsU0L._SX397_BO..> | 2023-08-09 08:03 | 12K | |
![[IMG]](/icons/image2.gif) | 41u3txsU0L._SX397_BO..> | 2023-05-03 11:23 | 19K | |
![[IMG]](/icons/image2.gif) | 41vINiY1ZVL._SX384_B..> | 2023-08-05 05:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | 41vINiY1ZVL._SX384_B..> | 2023-08-24 00:34 | 15K | |
![[IMG]](/icons/image2.gif) | 41vINiY1ZVL._SX384_B..> | 2023-05-04 01:53 | 25K | |
![[IMG]](/icons/image2.gif) | 41xsTKAUsAL._SX413_B..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 41xsTKAUsAL._SX413_B..> | 2023-09-08 14:47 | 14K | |
![[IMG]](/icons/image2.gif) | 41xsTKAUsAL._SX413_B..> | 2023-05-04 02:13 | 28K | |
![[IMG]](/icons/image2.gif) | 41y7o9H4h5L._BO22042..> | 2023-05-03 11:22 | 18K | |
![[IMG]](/icons/image2.gif) | 41yjTrln4bL._SX379_B..> | 2023-08-05 14:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | 41yjTrln4bL._SX379_B..> | 2023-08-05 15:35 | 14K | |
![[IMG]](/icons/image2.gif) | 41yjTrln4bL._SX379_B..> | 2023-05-03 10:56 | 25K | |
![[IMG]](/icons/image2.gif) | 41z5oXbYebL.-SY300--..> | 2023-08-06 12:35 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41z5oXbYebL.-SY300-.jpg | 2023-05-04 02:16 | 11K | |
![[IMG]](/icons/image2.gif) | 41z8E8wmy4L__08905.1..> | 2023-08-05 04:35 | 2.3K | |
![[IMG]](/icons/image2.gif) | 41z8E8wmy4L__08905.1..> | 2023-08-08 14:34 | 11K | |
![[IMG]](/icons/image2.gif) | 41z8E8wmy4L__08905.1..> | 2023-05-04 01:56 | 16K | |
![[IMG]](/icons/image2.gif) | 41zYp4ohfLL.-SY300-1..> | 2023-08-06 13:10 | 2.4K | |
![[IMG]](/icons/image2.gif) | 41zYp4ohfLL.-SY300-1..> | 2023-05-04 01:56 | 13K | |
![[IMG]](/icons/image2.gif) | 41zf0iRLjNL._SX348_B..> | 2023-08-05 01:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | 41zf0iRLjNL._SX348_B..> | 2023-08-30 18:06 | 16K | |
![[IMG]](/icons/image2.gif) | 41zf0iRLjNL._SX348_B..> | 2023-05-04 02:06 | 25K | |
![[IMG]](/icons/image2.gif) | 41zsYjyST3L._BO12042..> | 2023-08-06 03:28 | 3.8K | |
![[IMG]](/icons/image2.gif) | 41zsYjyST3L._BO12042..> | 2023-05-03 11:02 | 15K | |
![[IMG]](/icons/image2.gif) | 46_1.jpg | 2023-05-03 09:48 | 44K | |
![[IMG]](/icons/image2.gif) | 48.jpg | 2023-05-03 10:37 | 37K | |
![[IMG]](/icons/image2.gif) | 51-UB4osSzL._SX384_B..> | 2023-08-06 09:42 | 2.9K | |
![[IMG]](/icons/image2.gif) | 51-UB4osSzL._SX384_B..> | 2023-08-11 20:42 | 17K | |
![[IMG]](/icons/image2.gif) | 51-UB4osSzL._SX384_B..> | 2023-05-04 02:13 | 32K | |
![[IMG]](/icons/image2.gif) | 51-hSME1q1L._SX350_B..> | 2023-08-08 15:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51-hSME1q1L._SX350_B..> | 2023-10-15 18:08 | 18K | |
![[IMG]](/icons/image2.gif) | 51-hSME1q1L._SX350_B..> | 2023-05-04 02:02 | 30K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-08-06 11:13 | 4.1K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-08-12 07:27 | 26K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-05-04 02:20 | 49K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-08-06 11:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-08-10 16:04 | 26K | |
![[IMG]](/icons/image2.gif) | 51-jbCDUThL._SX389_B..> | 2023-05-04 02:20 | 49K | |
![[IMG]](/icons/image2.gif) | 51A6opFtLLL._SX258_B..> | 2023-08-05 02:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51A6opFtLLL._SX258_B..> | 2023-05-04 01:51 | 20K | |
![[IMG]](/icons/image2.gif) | 51ADXrWlioL._SX398_B..> | 2023-08-05 03:40 | 5.0K | |
![[IMG]](/icons/image2.gif) | 51ADXrWlioL._SX398_B..> | 2023-09-18 05:40 | 25K | |
![[IMG]](/icons/image2.gif) | 51ADXrWlioL._SX398_B..> | 2023-05-04 02:00 | 42K | |
![[IMG]](/icons/image2.gif) | 51AK37Ko_dL._SY300__..> | 2023-08-05 01:15 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51AK37Ko_dL._SY300__..> | 2023-05-03 11:24 | 16K | |
![[IMG]](/icons/image2.gif) | 51Ad4B7AjoL._SX389_B..> | 2023-08-09 05:00 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51Ad4B7AjoL._SX389_B..> | 2023-08-23 23:50 | 24K | |
![[IMG]](/icons/image2.gif) | 51Ad4B7AjoL._SX389_B..> | 2023-05-03 11:01 | 43K | |
![[IMG]](/icons/image2.gif) | 51AuSxMyAgL._SY300__..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51AuSxMyAgL._SY300__..> | 2023-05-04 01:47 | 21K | |
![[IMG]](/icons/image2.gif) | 51BcnLnJbZL._SY300__..> | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | 51BcnLnJbZL._SY300__..> | 2023-05-03 10:39 | 23K | |
![[IMG]](/icons/image2.gif) | 51Bz8E8M4QL-100x100.jpg | 2023-08-05 01:15 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51Bz8E8M4QL-300x300.jpg | 2023-08-15 18:11 | 17K | |
![[IMG]](/icons/image2.gif) | 51Bz8E8M4QL.jpg | 2023-05-04 02:12 | 42K | |
![[IMG]](/icons/image2.gif) | 51C-4PulhbL._SY300_-..> | 2023-08-05 01:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | 51C-4PulhbL._SY300_.jpg | 2023-05-03 10:37 | 16K | |
![[IMG]](/icons/image2.gif) | 51CVeRy-RXL-100x100.jpg | 2023-08-05 04:34 | 4.9K | |
![[IMG]](/icons/image2.gif) | 51CVeRy-RXL-300x300.jpg | 2023-08-23 23:59 | 32K | |
![[IMG]](/icons/image2.gif) | 51CVeRy-RXL.jpg | 2023-05-04 01:47 | 59K | |
![[IMG]](/icons/image2.gif) | 51ChlThAsmL._SX399_B..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51ChlThAsmL._SX399_B..> | 2023-09-04 00:09 | 27K | |
![[IMG]](/icons/image2.gif) | 51ChlThAsmL._SX399_B..> | 2023-05-03 11:02 | 57K | |
![[IMG]](/icons/image2.gif) | 51Ct5EkwHGL._SX258_B..> | 2023-08-06 07:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51Ct5EkwHGL._SX258_B..> | 2023-05-04 01:55 | 17K | |
![[IMG]](/icons/image2.gif) | 51D-9s5JrKL._SX385_B..> | 2023-08-07 06:18 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51D-9s5JrKL._SX385_B..> | 2023-08-29 02:09 | 23K | |
![[IMG]](/icons/image2.gif) | 51D-9s5JrKL._SX385_B..> | 2023-05-04 02:24 | 39K | |
![[IMG]](/icons/image2.gif) | 51DIodvx4oL._SX433_B..> | 2023-08-08 16:37 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51DIodvx4oL._SX433_B..> | 2023-10-15 18:08 | 20K | |
![[IMG]](/icons/image2.gif) | 51DIodvx4oL._SX433_B..> | 2023-05-04 02:12 | 37K | |
![[IMG]](/icons/image2.gif) | 51DLITte3XL._SX382_B..> | 2023-08-05 18:14 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51DLITte3XL._SX382_B..> | 2023-08-18 04:17 | 19K | |
![[IMG]](/icons/image2.gif) | 51DLITte3XL._SX382_B..> | 2023-05-04 01:59 | 33K | |
![[IMG]](/icons/image2.gif) | 51E2fcZBMmL._BO22042..> | 2023-05-03 10:23 | 23K | |
![[IMG]](/icons/image2.gif) | 51Ei2BLYcC6L._SX379_..> | 2023-08-05 04:17 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51Ei2BLYcC6L._SX379_..> | 2023-08-05 01:54 | 22K | |
![[IMG]](/icons/image2.gif) | 51Ei2BLYcC6L._SX379_..> | 2023-05-04 01:58 | 39K | |
![[IMG]](/icons/image2.gif) | 51FD27RX10L._BO22042..> | 2023-05-03 09:23 | 21K | |
![[IMG]](/icons/image2.gif) | 51FUZOXHwCL._SY300__..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51FUZOXHwCL._SY300__..> | 2023-05-03 10:54 | 18K | |
![[IMG]](/icons/image2.gif) | 51GBse2HW-L-100x100.jpg | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51GBse2HW-L-300x300.jpg | 2023-09-01 21:32 | 18K | |
![[IMG]](/icons/image2.gif) | 51GBse2HW-L.jpg | 2023-05-04 02:18 | 42K | |
![[IMG]](/icons/image2.gif) | 51GKfkI0LqL._SY300__..> | 2023-08-06 12:18 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51GKfkI0LqL._SY300__..> | 2023-05-03 10:17 | 15K | |
![[IMG]](/icons/image2.gif) | 51GlMadlqbL-100x100.jpg | 2023-08-05 06:24 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51GlMadlqbL-300x300.jpg | 2023-08-24 03:18 | 21K | |
![[IMG]](/icons/image2.gif) | 51GlMadlqbL.jpg | 2023-05-04 01:48 | 43K | |
![[IMG]](/icons/image2.gif) | 51Gn8uIie9L.-SY300--..> | 2023-08-05 04:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51Gn8uIie9L.-SY300-.jpg | 2023-05-04 02:17 | 16K | |
![[IMG]](/icons/image2.gif) | 51Gy7W6crVL._SX441_B..> | 2023-08-06 12:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51Gy7W6crVL._SX441_B..> | 2023-08-08 23:54 | 25K | |
![[IMG]](/icons/image2.gif) | 51Gy7W6crVL._SX441_B..> | 2023-05-04 02:01 | 48K | |
![[IMG]](/icons/image2.gif) | 51H0_cCZ15L._BO22042..> | 2023-05-03 11:25 | 20K | |
![[IMG]](/icons/image2.gif) | 51HUfRPqkVL._SY344_B..> | 2023-08-06 16:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51HUfRPqkVL._SY344_B..> | 2023-05-04 01:54 | 22K | |
![[IMG]](/icons/image2.gif) | 51I2B856Q8bL._SX399_..> | 2023-08-06 14:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51I2B856Q8bL._SX399_..> | 2023-08-12 04:49 | 19K | |
![[IMG]](/icons/image2.gif) | 51I2B856Q8bL._SX399_..> | 2023-05-03 11:19 | 31K | |
![[IMG]](/icons/image2.gif) | 51IEoLxskOL._SY300__..> | 2023-08-06 08:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51IEoLxskOL._SY300__..> | 2023-05-03 09:26 | 23K | |
![[IMG]](/icons/image2.gif) | 51J8ZvBvGEL._SX258_B..> | 2023-08-05 14:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51J8ZvBvGEL._SX258_B..> | 2023-05-03 11:17 | 22K | |
![[IMG]](/icons/image2.gif) | 51JrrrCc4vL._SX258_B..> | 2023-08-05 02:03 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51JrrrCc4vL._SX258_B..> | 2023-05-03 11:05 | 20K | |
![[IMG]](/icons/image2.gif) | 51JrrrCc4vL._SX258_B..> | 2023-08-08 14:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51JrrrCc4vL._SX258_B..> | 2023-05-03 11:05 | 20K | |
![[IMG]](/icons/image2.gif) | 51JtoiOscnL._SX258_B..> | 2023-08-05 01:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51JtoiOscnL._SX258_B..> | 2023-05-04 01:54 | 23K | |
![[IMG]](/icons/image2.gif) | 51JuFEwnEnL._SY300_-..> | 2023-08-05 15:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51JuFEwnEnL._SY300_.jpg | 2023-05-03 09:39 | 15K | |
![[IMG]](/icons/image2.gif) | 51Jz9Ooiz9L._SY300__..> | 2023-08-06 12:18 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51Jz9Ooiz9L._SY300__..> | 2023-05-03 09:59 | 15K | |
![[IMG]](/icons/image2.gif) | 51KltnQDX-L._SY300_-..> | 2023-08-06 12:01 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51KltnQDX-L._SY300_.jpg | 2023-05-03 09:32 | 15K | |
![[IMG]](/icons/image2.gif) | 51LfgUme2BXL._SX364_..> | 2023-08-05 05:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51LfgUme2BXL._SX364_..> | 2023-08-19 07:27 | 16K | |
![[IMG]](/icons/image2.gif) | 51LfgUme2BXL._SX364_..> | 2023-05-04 02:01 | 25K | |
![[IMG]](/icons/image2.gif) | 51LnI8irm-L._SX384_B..> | 2023-08-06 13:04 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51LnI8irm-L._SX384_B..> | 2023-08-06 10:20 | 18K | |
![[IMG]](/icons/image2.gif) | 51LnI8irm-L._SX384_B..> | 2023-05-04 02:04 | 42K | |
![[IMG]](/icons/image2.gif) | 51M-0nWU9AL._SX373_B..> | 2023-08-06 16:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51M-0nWU9AL._SX373_B..> | 2023-08-18 17:37 | 20K | |
![[IMG]](/icons/image2.gif) | 51M-0nWU9AL._SX373_B..> | 2023-05-04 02:16 | 44K | |
![[IMG]](/icons/image2.gif) | 51Ma1k-XkwL-100x100.jpg | 2023-08-05 04:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51Ma1k-XkwL-300x300.jpg | 2023-08-05 23:08 | 23K | |
![[IMG]](/icons/image2.gif) | 51Ma1k-XkwL.jpg | 2023-05-03 09:54 | 55K | |
![[IMG]](/icons/image2.gif) | 51Mc-JXD8lL._SX383_B..> | 2023-08-05 15:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51Mc-JXD8lL._SX383_B..> | 2023-09-11 04:22 | 18K | |
![[IMG]](/icons/image2.gif) | 51Mc-JXD8lL._SX383_B..> | 2023-05-03 11:23 | 28K | |
![[IMG]](/icons/image2.gif) | 51MpHRzDRTL._SX258_B..> | 2023-05-04 02:25 | 16K | |
![[IMG]](/icons/image2.gif) | 51N3GsJ8zL._SX389_BO..> | 2023-08-05 17:20 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51N3GsJ8zL._SX389_BO..> | 2023-08-09 18:40 | 22K | |
![[IMG]](/icons/image2.gif) | 51N3GsJ8zL._SX389_BO..> | 2023-05-04 01:55 | 37K | |
![[IMG]](/icons/image2.gif) | 51N7wCQjLKL._BO22042..> | 2023-05-03 10:17 | 18K | |
![[IMG]](/icons/image2.gif) | 51NBC24YkuL._SY300__..> | 2023-08-08 16:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51NBC24YkuL._SY300__..> | 2023-05-03 10:57 | 24K | |
![[IMG]](/icons/image2.gif) | 51NBm7yZYcL._SX412_B..> | 2023-08-07 21:20 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51NBm7yZYcL._SX412_B..> | 2023-08-08 08:19 | 21K | |
![[IMG]](/icons/image2.gif) | 51NBm7yZYcL._SX412_B..> | 2023-05-04 01:59 | 35K | |
![[IMG]](/icons/image2.gif) | 51NENYR8PiL._BO22042..> | 2023-05-03 10:23 | 22K | |
![[IMG]](/icons/image2.gif) | 51NJndBQeCL._SX258_B..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51NJndBQeCL._SX258_B..> | 2023-05-03 11:17 | 22K | |
![[IMG]](/icons/image2.gif) | 51NJndBQeCL._SX258_B..> | 2023-08-05 14:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51NJndBQeCL._SX258_B..> | 2023-05-03 11:17 | 22K | |
![[IMG]](/icons/image2.gif) | 51Nk5VP267L._SY344_B..> | 2023-08-05 15:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | 51Nk5VP267L._SY344_B..> | 2023-05-03 10:55 | 24K | |
![[IMG]](/icons/image2.gif) | 51NmDGbaEoL-100x100.jpg | 2023-08-06 07:48 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51NmDGbaEoL-300x300.jpg | 2023-08-19 04:14 | 24K | |
![[IMG]](/icons/image2.gif) | 51NmDGbaEoL.jpg | 2023-05-04 02:20 | 60K | |
![[IMG]](/icons/image2.gif) | 51NowshSFQL._SX388_B..> | 2023-08-05 15:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51NowshSFQL._SX388_B..> | 2023-08-06 07:49 | 20K | |
![[IMG]](/icons/image2.gif) | 51NowshSFQL._SX388_B..> | 2023-05-04 01:55 | 35K | |
![[IMG]](/icons/image2.gif) | 51P0_Ehn_eL._SY300__..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51P0_Ehn_eL._SY300__..> | 2023-05-03 11:25 | 16K | |
![[IMG]](/icons/image2.gif) | 51P7nAmDg9L._SX258_B..> | 2023-08-05 01:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51P7nAmDg9L._SX258_B..> | 2023-05-04 01:54 | 19K | |
![[IMG]](/icons/image2.gif) | 51PJ6XFDfhL._SX258_B..> | 2023-08-05 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51PJ6XFDfhL._SX258_B..> | 2023-05-04 02:02 | 25K | |
![[IMG]](/icons/image2.gif) | 51PrQu6SG6L-100x100.jpg | 2023-08-05 01:14 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51PrQu6SG6L-300x300.jpg | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | 51PrQu6SG6L.jpg | 2023-05-04 01:56 | 41K | |
![[IMG]](/icons/image2.gif) | 51QIyGQGnTL._SX398_B..> | 2023-08-06 08:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51QIyGQGnTL._SX398_B..> | 2023-08-12 06:52 | 22K | |
![[IMG]](/icons/image2.gif) | 51QIyGQGnTL._SX398_B..> | 2023-05-03 10:56 | 38K | |
![[IMG]](/icons/image2.gif) | 51QW-0WJeTL._SY300_-..> | 2023-08-05 01:33 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51QW-0WJeTL._SY300_.jpg | 2023-05-03 11:01 | 18K | |
![[IMG]](/icons/image2.gif) | 51QbYKFpQCL._SX402_B..> | 2023-08-08 16:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51QbYKFpQCL._SX402_B..> | 2023-08-08 06:46 | 20K | |
![[IMG]](/icons/image2.gif) | 51QbYKFpQCL._SX402_B..> | 2023-05-04 02:16 | 48K | |
![[IMG]](/icons/image2.gif) | 51QlhYCZ8ZL-100x100.jpg | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51QlhYCZ8ZL-300x300.jpg | 2023-08-10 04:13 | 17K | |
![[IMG]](/icons/image2.gif) | 51QlhYCZ8ZL.jpg | 2023-05-04 02:22 | 43K | |
![[IMG]](/icons/image2.gif) | 51R0sA17_eL._BO22042..> | 2023-05-03 09:54 | 21K | |
![[IMG]](/icons/image2.gif) | 51R44jTz2BL._SY300__..> | 2023-08-05 16:16 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51R44jTz2BL._SY300__..> | 2023-05-04 01:56 | 17K | |
![[IMG]](/icons/image2.gif) | 51RUF6jI5xL._SX384_B..> | 2023-08-05 03:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | 51RUF6jI5xL._SX384_B..> | 2023-08-10 19:35 | 21K | |
![[IMG]](/icons/image2.gif) | 51RUF6jI5xL._SX384_B..> | 2023-05-04 01:56 | 38K | |
![[IMG]](/icons/image2.gif) | 51Rcl5kHm9L._SY300__..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51Rcl5kHm9L._SY300__..> | 2023-05-03 09:47 | 20K | |
![[IMG]](/icons/image2.gif) | 51RjhWmWBVL._SY344_B..> | 2023-08-05 02:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51RjhWmWBVL._SY344_B..> | 2023-05-03 11:24 | 24K | |
![[IMG]](/icons/image2.gif) | 51S8o71Ms-L._SX375_B..> | 2023-05-04 02:29 | 50K | |
![[IMG]](/icons/image2.gif) | 51SqN5_XMYL._SL500_A..> | 2023-05-03 10:05 | 16K | |
![[IMG]](/icons/image2.gif) | 51SzayCTuJL._SX258_B..> | 2023-08-07 19:37 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51SzayCTuJL._SX258_B..> | 2023-05-03 11:16 | 24K | |
![[IMG]](/icons/image2.gif) | 51T85NIssSL._SX402_B..> | 2023-08-05 16:25 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51T85NIssSL._SX402_B..> | 2023-08-06 11:19 | 23K | |
![[IMG]](/icons/image2.gif) | 51T85NIssSL._SX402_B..> | 2023-05-03 10:51 | 40K | |
![[IMG]](/icons/image2.gif) | 51T96rArFPL.-SY300--..> | 2023-08-06 13:06 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51T96rArFPL.-SY300-.jpg | 2023-05-04 02:24 | 25K | |
![[IMG]](/icons/image2.gif) | 51TQqd4swZL._SX393_B..> | 2023-08-05 02:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51TQqd4swZL._SX393_B..> | 2023-08-09 02:53 | 21K | |
![[IMG]](/icons/image2.gif) | 51TQqd4swZL._SX393_B..> | 2023-05-04 02:15 | 37K | |
![[IMG]](/icons/image2.gif) | 51TXbcbIgzL._SY300_-..> | 2023-08-05 16:24 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51TXbcbIgzL._SY300_.jpg | 2023-05-03 10:29 | 15K | |
![[IMG]](/icons/image2.gif) | 51Tt5zmenCL__65470.1..> | 2023-08-05 06:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51Tt5zmenCL__65470.1..> | 2023-08-18 04:17 | 18K | |
![[IMG]](/icons/image2.gif) | 51Tt5zmenCL__65470.1..> | 2023-05-03 10:28 | 38K | |
![[IMG]](/icons/image2.gif) | 51U2vUqCiyL._SX388_B..> | 2023-08-08 06:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51U2vUqCiyL._SX388_B..> | 2023-08-08 06:43 | 22K | |
![[IMG]](/icons/image2.gif) | 51U2vUqCiyL._SX388_B..> | 2023-05-03 10:59 | 51K | |
![[IMG]](/icons/image2.gif) | 51UJ67UnXbL._SY300_-..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51UJ67UnXbL._SY300_.jpg | 2023-05-03 09:23 | 22K | |
![[IMG]](/icons/image2.gif) | 51UT88PxDHL._SX258_B..> | 2023-08-06 08:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51UT88PxDHL._SX258_B..> | 2023-05-04 02:01 | 21K | |
![[IMG]](/icons/image2.gif) | 51UUA7uP34L._SY300_-..> | 2023-08-07 13:27 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51UUA7uP34L._SY300_.jpg | 2023-05-03 09:32 | 16K | |
![[IMG]](/icons/image2.gif) | 51UlBp0RtjL._SCLZZZZ..> | 2023-08-05 15:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51UlBp0RtjL._SCLZZZZ..> | 2023-08-12 04:50 | 24K | |
![[IMG]](/icons/image2.gif) | 51UlBp0RtjL._SCLZZZZ..> | 2023-05-04 02:19 | 40K | |
![[IMG]](/icons/image2.gif) | 51UzQQnF-6L._SX258_B..> | 2023-08-05 01:52 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51UzQQnF-6L._SX258_B..> | 2023-05-04 02:00 | 22K | |
![[IMG]](/icons/image2.gif) | 51V6KWAftML._SY300__..> | 2023-08-05 01:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51V6KWAftML._SY300__..> | 2023-05-03 09:25 | 16K | |
![[IMG]](/icons/image2.gif) | 51VopnC60NL._SX402_B..> | 2023-08-06 12:14 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51VopnC60NL._SX402_B..> | 2023-08-25 19:27 | 20K | |
![[IMG]](/icons/image2.gif) | 51VopnC60NL._SX402_B..> | 2023-05-04 01:59 | 38K | |
![[IMG]](/icons/image2.gif) | 51VouwJk4pL._SX258_B..> | 2023-08-05 05:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51VouwJk4pL._SX258_B..> | 2023-05-03 11:11 | 27K | |
![[IMG]](/icons/image2.gif) | 51W9IrS9KsL._SY300_-..> | 2023-08-05 14:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51W9IrS9KsL._SY300_.jpg | 2023-05-03 10:21 | 20K | |
![[IMG]](/icons/image2.gif) | 51WIyewhXLL._SY300__..> | 2023-08-06 15:32 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51WIyewhXLL._SY300__..> | 2023-05-03 09:32 | 20K | |
![[IMG]](/icons/image2.gif) | 51WkqP0rI8L._SY300_-..> | 2023-08-05 06:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51WkqP0rI8L._SY300_.jpg | 2023-05-03 10:30 | 24K | |
![[IMG]](/icons/image2.gif) | 51X0Tl4J1DL._SX389_B..> | 2023-08-05 03:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51X0Tl4J1DL._SX389_B..> | 2023-08-05 14:41 | 25K | |
![[IMG]](/icons/image2.gif) | 51X0Tl4J1DL._SX389_B..> | 2023-05-04 01:57 | 45K | |
![[IMG]](/icons/image2.gif) | 51XNFpiS-WL._SX258_B..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51XNFpiS-WL._SX258_B..> | 2023-05-03 09:57 | 19K | |
![[IMG]](/icons/image2.gif) | 51XujhV4J3L._SY300_-..> | 2023-08-05 16:26 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51XujhV4J3L._SY300_.jpg | 2023-05-03 10:28 | 25K | |
![[IMG]](/icons/image2.gif) | 51YNuiTXq1L__64905.1..> | 2023-08-06 11:08 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51YNuiTXq1L__64905.1..> | 2023-08-08 17:45 | 22K | |
![[IMG]](/icons/image2.gif) | 51YNuiTXq1L__64905.1..> | 2023-05-03 10:19 | 41K | |
![[IMG]](/icons/image2.gif) | 51YquxqSkJL._SY300__..> | 2023-08-05 03:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51YquxqSkJL._SY300__..> | 2023-05-03 10:29 | 23K | |
![[IMG]](/icons/image2.gif) | 51ZCtOJwncL._SX258_B..> | 2023-08-05 21:05 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51ZCtOJwncL._SX258_B..> | 2023-05-04 02:01 | 21K | |
![[IMG]](/icons/image2.gif) | 51ZkSd5Zw_L._SY300__..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51ZkSd5Zw_L._SY300__..> | 2023-05-03 10:34 | 17K | |
![[IMG]](/icons/image2.gif) | 51ZlctPJWKL._BO22042..> | 2023-05-04 02:27 | 17K | |
![[IMG]](/icons/image2.gif) | 51Zp48WXvzL._SX412_B..> | 2023-08-08 00:00 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51Zp48WXvzL._SX412_B..> | 2023-08-10 16:04 | 22K | |
![[IMG]](/icons/image2.gif) | 51Zp48WXvzL._SX412_B..> | 2023-05-04 01:56 | 41K | |
![[IMG]](/icons/image2.gif) | 51Zyt7LhnQL._SX399_B..> | 2023-08-05 15:32 | 2.9K | |
![[IMG]](/icons/image2.gif) | 51Zyt7LhnQL._SX399_B..> | 2023-08-21 19:15 | 16K | |
![[IMG]](/icons/image2.gif) | 51Zyt7LhnQL._SX399_B..> | 2023-05-04 01:52 | 29K | |
![[IMG]](/icons/image2.gif) | 51_8qHEWFnL._SY300__..> | 2023-08-09 02:01 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51_8qHEWFnL._SY300__..> | 2023-05-03 09:21 | 16K | |
![[IMG]](/icons/image2.gif) | 51aLNzBPuCL._SY344_B..> | 2023-08-05 01:09 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51aLNzBPuCL._SY344_B..> | 2023-05-03 11:01 | 28K | |
![[IMG]](/icons/image2.gif) | 51amltJHccL._SX389_B..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51amltJHccL._SX389_B..> | 2023-08-16 10:25 | 19K | |
![[IMG]](/icons/image2.gif) | 51amltJHccL._SX389_B..> | 2023-05-04 01:50 | 35K | |
![[IMG]](/icons/image2.gif) | 51apy42BqgL._SY300_-..> | 2023-08-06 13:11 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51apy42BqgL._SY300_.jpg | 2023-05-03 10:26 | 15K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-08-05 15:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-08-12 04:49 | 27K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-05-03 11:14 | 47K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-08-06 07:46 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-08-13 22:07 | 27K | |
![[IMG]](/icons/image2.gif) | 51avZRnagAL._SX412_B..> | 2023-05-03 11:13 | 47K | |
![[IMG]](/icons/image2.gif) | 51b3oCzw1-L._SX258_B..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51b3oCzw1-L._SX258_B..> | 2023-05-03 10:41 | 20K | |
![[IMG]](/icons/image2.gif) | 51cSCW2h7nL-100x100.jpg | 2023-08-05 02:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51cSCW2h7nL-300x300.jpg | 2023-08-15 18:11 | 21K | |
![[IMG]](/icons/image2.gif) | 51cSCW2h7nL.jpg | 2023-05-04 02:23 | 49K | |
![[IMG]](/icons/image2.gif) | 51cTcXjGe-L._SX258_B..> | 2023-08-05 06:24 | 4.1K | |
![[IMG]](/icons/image2.gif) | 51cTcXjGe-L._SX258_B..> | 2023-05-03 11:23 | 26K | |
![[IMG]](/icons/image2.gif) | 51cm6eYK4ML._SX346_B..> | 2023-08-05 06:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | 51cm6eYK4ML._SX346_B..> | 2023-09-04 21:53 | 25K | |
![[IMG]](/icons/image2.gif) | 51cm6eYK4ML._SX346_B..> | 2023-05-04 02:05 | 43K | |
![[IMG]](/icons/image2.gif) | 51cnMTZsAmL._SX378_B..> | 2023-08-05 15:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51cnMTZsAmL._SX378_B..> | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | 51cnMTZsAmL._SX378_B..> | 2023-05-03 11:00 | 34K | |
![[IMG]](/icons/image2.gif) | 51cy8XOFnhL._SY300__..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51cy8XOFnhL._SY300__..> | 2023-05-04 01:59 | 19K | |
![[IMG]](/icons/image2.gif) | 51dFKVznISL-100x100.jpg | 2023-08-05 15:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51dFKVznISL-300x300.jpg | 2023-08-27 04:27 | 16K | |
![[IMG]](/icons/image2.gif) | 51dFKVznISL.jpg | 2023-05-04 01:47 | 32K | |
![[IMG]](/icons/image2.gif) | 51dUKy8Tj-L-100x100.jpg | 2023-08-05 05:30 | 4.5K | |
![[IMG]](/icons/image2.gif) | 51dUKy8Tj-L-300x300.jpg | 2023-08-14 21:32 | 25K | |
![[IMG]](/icons/image2.gif) | 51dUKy8Tj-L.jpg | 2023-05-04 02:25 | 45K | |
![[IMG]](/icons/image2.gif) | 51dX-b9NoyL._SX258_B..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51dX-b9NoyL._SX258_B..> | 2023-05-03 10:01 | 20K | |
![[IMG]](/icons/image2.gif) | 51dX3qle4IL._SX258_B..> | 2023-08-06 04:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51dX3qle4IL._SX258_B..> | 2023-05-03 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | 51dX3qle4IL._SX258_B..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51dX3qle4IL._SX258_B..> | 2023-05-03 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | 51dmpKhy9pL._SX258_B..> | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51dmpKhy9pL._SX258_B..> | 2023-05-04 01:55 | 16K | |
![[IMG]](/icons/image2.gif) | 51dxqgh8eL._SX384_BO..> | 2023-08-05 14:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51dxqgh8eL._SX384_BO..> | 2023-08-06 13:12 | 17K | |
![[IMG]](/icons/image2.gif) | 51dxqgh8eL._SX384_BO..> | 2023-05-04 02:06 | 54K | |
![[IMG]](/icons/image2.gif) | 51eCdvJwJQL._SY300_-..> | 2023-08-05 16:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | 51eCdvJwJQL._SY300_.jpg | 2023-05-03 09:25 | 14K | |
![[IMG]](/icons/image2.gif) | 51eDWOYK-pL-100x100.jpg | 2023-08-05 04:35 | 2.2K | |
![[IMG]](/icons/image2.gif) | 51eDWOYK-pL-300x300.jpg | 2023-08-16 17:47 | 12K | |
![[IMG]](/icons/image2.gif) | 51eDWOYK-pL.jpg | 2023-05-04 02:05 | 32K | |
![[IMG]](/icons/image2.gif) | 51eNM-ToudL._SY300_-..> | 2023-08-08 01:04 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51eNM-ToudL._SY300_.jpg | 2023-05-03 09:51 | 24K | |
![[IMG]](/icons/image2.gif) | 51eju9iuael._sx389_b..> | 2023-05-04 02:27 | 13K | |
![[IMG]](/icons/image2.gif) | 51evwSNBHXL._SX398_B..> | 2023-08-06 00:08 | 5.1K | |
![[IMG]](/icons/image2.gif) | 51evwSNBHXL._SX398_B..> | 2023-08-27 05:21 | 27K | |
![[IMG]](/icons/image2.gif) | 51evwSNBHXL._SX398_B..> | 2023-05-04 02:25 | 43K | |
![[IMG]](/icons/image2.gif) | 51f-rzskOML._SX258_B..> | 2023-08-05 02:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51f-rzskOML._SX258_B..> | 2023-05-04 01:58 | 22K | |
![[IMG]](/icons/image2.gif) | 51f2F7qn5vL._SX317_B..> | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51f2F7qn5vL._SX317_B..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | 51f2F7qn5vL._SX317_B..> | 2023-05-03 11:10 | 30K | |
![[IMG]](/icons/image2.gif) | 51f3As6eq0L__36284.1..> | 2023-08-06 05:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51f3As6eq0L__36284.1..> | 2023-08-20 08:54 | 20K | |
![[IMG]](/icons/image2.gif) | 51f3As6eq0L__36284.1..> | 2023-05-04 01:52 | 49K | |
![[IMG]](/icons/image2.gif) | 51frYIzwS1L._SX379_B..> | 2023-08-06 04:17 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51frYIzwS1L._SX379_B..> | 2023-08-05 04:36 | 20K | |
![[IMG]](/icons/image2.gif) | 51frYIzwS1L._SX379_B..> | 2023-05-04 02:01 | 35K | |
![[IMG]](/icons/image2.gif) | 51frtwLYYeL-100x100.jpg | 2023-08-06 09:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51frtwLYYeL-300x300.jpg | 2023-08-16 23:57 | 20K | |
![[IMG]](/icons/image2.gif) | 51frtwLYYeL.jpg | 2023-05-04 02:21 | 40K | |
![[IMG]](/icons/image2.gif) | 51g5PkwVZwL._SX389_B..> | 2023-08-06 08:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51g5PkwVZwL._SX389_B..> | 2023-09-04 20:54 | 19K | |
![[IMG]](/icons/image2.gif) | 51g5PkwVZwL._SX389_B..> | 2023-05-04 02:02 | 43K | |
![[IMG]](/icons/image2.gif) | 51go8SpcKyL._BO22042..> | 2023-05-03 11:07 | 25K | |
![[IMG]](/icons/image2.gif) | 51he1ALQGrL._SY300_-..> | 2023-08-05 06:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51he1ALQGrL._SY300_.jpg | 2023-05-03 09:43 | 19K | |
![[IMG]](/icons/image2.gif) | 51i2lU-OXOL-100x100.jpg | 2023-08-06 12:12 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51i2lU-OXOL-300x300.jpg | 2023-08-05 05:34 | 17K | |
![[IMG]](/icons/image2.gif) | 51i2lU-OXOL.jpg | 2023-05-03 10:09 | 38K | |
![[IMG]](/icons/image2.gif) | 51imyUjfAKL._SX258_B..> | 2023-08-06 04:17 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51imyUjfAKL._SX258_B..> | 2023-05-03 09:19 | 27K | |
![[IMG]](/icons/image2.gif) | 51j8ZC7N3QL._SX258_B..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51j8ZC7N3QL._SX258_B..> | 2023-05-03 11:04 | 21K | |
![[IMG]](/icons/image2.gif) | 51jDKrtIkL._SX388_BO..> | 2023-08-05 15:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51jDKrtIkL._SX388_BO..> | 2023-08-31 13:55 | 20K | |
![[IMG]](/icons/image2.gif) | 51jDKrtIkL._SX388_BO..> | 2023-05-04 02:06 | 32K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-08-06 09:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-08-05 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-05-04 02:17 | 33K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-08-05 14:36 | 2.6K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-09-05 02:50 | 15K | |
![[IMG]](/icons/image2.gif) | 51jY3iPrt0L._SCLZZZZ..> | 2023-05-04 02:17 | 33K | |
![[IMG]](/icons/image2.gif) | 51k3-zopVXL._SY300_-..> | 2023-08-06 16:28 | 2.3K | |
![[IMG]](/icons/image2.gif) | 51k3-zopVXL._SY300_.jpg | 2023-05-03 09:59 | 14K | |
![[IMG]](/icons/image2.gif) | 51k4nY28AQL._SY300__..> | 2023-08-05 01:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | 51k4nY28AQL._SY300__..> | 2023-05-03 10:54 | 15K | |
![[IMG]](/icons/image2.gif) | 51kAIaehNPL._SX258_B..> | 2023-08-05 14:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51kAIaehNPL._SX258_B..> | 2023-05-03 11:09 | 17K | |
![[IMG]](/icons/image2.gif) | 51kFfRHkdRL._SX389_B..> | 2023-08-05 17:22 | 4.5K | |
![[IMG]](/icons/image2.gif) | 51kFfRHkdRL._SX389_B..> | 2023-08-08 06:27 | 25K | |
![[IMG]](/icons/image2.gif) | 51kFfRHkdRL._SX389_B..> | 2023-05-03 11:02 | 40K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-08-05 02:46 | 4.7K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-08-28 17:05 | 26K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-05-04 02:18 | 46K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-08-06 08:47 | 4.7K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-08-09 22:25 | 26K | |
![[IMG]](/icons/image2.gif) | 51kR3HXFnUL._SX387_B..> | 2023-05-04 02:18 | 46K | |
![[IMG]](/icons/image2.gif) | 51kce8vnjtl._sx403_b..> | 2023-05-04 02:28 | 11K | |
![[IMG]](/icons/image2.gif) | 51l-hRsToHL._SX384_B..> | 2023-08-05 01:54 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51l-hRsToHL._SX384_B..> | 2023-08-18 17:37 | 20K | |
![[IMG]](/icons/image2.gif) | 51l-hRsToHL._SX384_B..> | 2023-05-03 10:58 | 34K | |
![[IMG]](/icons/image2.gif) | 51l4PguiFiL._SX423_B..> | 2023-08-06 08:44 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51l4PguiFiL._SX423_B..> | 2023-09-08 15:33 | 16K | |
![[IMG]](/icons/image2.gif) | 51l4PguiFiL._SX423_B..> | 2023-05-03 11:05 | 29K | |
![[IMG]](/icons/image2.gif) | 51lDRioQ5XL._SY344_B..> | 2023-08-05 01:09 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51lDRioQ5XL._SY344_B..> | 2023-05-03 10:50 | 29K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-08-08 14:29 | 21K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-05-04 02:14 | 37K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-08-06 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-08-09 12:13 | 21K | |
![[IMG]](/icons/image2.gif) | 51lHt9SmSGL._SX376_B..> | 2023-05-04 02:14 | 37K | |
![[IMG]](/icons/image2.gif) | 51lLjerP3nL._SX258_B..> | 2023-08-06 13:08 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51lLjerP3nL._SX258_B..> | 2023-05-03 10:51 | 19K | |
![[IMG]](/icons/image2.gif) | 51lPFzqLJ6L._BO22042..> | 2023-05-03 09:23 | 22K | |
![[IMG]](/icons/image2.gif) | 51lRsGKE4L._SX389_BO..> | 2023-08-05 16:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51lRsGKE4L._SX389_BO..> | 2023-08-16 22:56 | 20K | |
![[IMG]](/icons/image2.gif) | 51lRsGKE4L._SX389_BO..> | 2023-05-03 10:55 | 47K | |
![[IMG]](/icons/image2.gif) | 51lp7nk7ZuL._SX258_B..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51lp7nk7ZuL._SX258_B..> | 2023-05-03 11:15 | 19K | |
![[IMG]](/icons/image2.gif) | 51lp7nk7ZuL._SY300__..> | 2023-08-05 05:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51lp7nk7ZuL._SY300__..> | 2023-05-03 10:34 | 16K | |
![[IMG]](/icons/image2.gif) | 51lzkW5Od8L._SX398_B..> | 2023-08-08 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51lzkW5Od8L._SX398_B..> | 2023-08-10 02:23 | 19K | |
![[IMG]](/icons/image2.gif) | 51lzkW5Od8L._SX398_B..> | 2023-05-04 02:29 | 47K | |
![[IMG]](/icons/image2.gif) | 51mOJeQ2BoaL-100x100..> | 2023-08-05 15:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51mOJeQ2BoaL-300x300..> | 2023-08-16 01:58 | 16K | |
![[IMG]](/icons/image2.gif) | 51mOJeQ2BoaL.jpg | 2023-05-04 01:49 | 33K | |
![[IMG]](/icons/image2.gif) | 51mSNyxkuvL._SX285_-..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 51mSNyxkuvL._SX285_.jpg | 2023-05-03 10:36 | 20K | |
![[IMG]](/icons/image2.gif) | 51mUzb9P1LL._SY300_-..> | 2023-08-06 12:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51mUzb9P1LL._SY300_.jpg | 2023-05-03 09:33 | 20K | |
![[IMG]](/icons/image2.gif) | 51mfrsIGYrL._SX389_B..> | 2023-08-08 08:38 | 3.3K | |
![[IMG]](/icons/image2.gif) | 51mfrsIGYrL._SX389_B..> | 2023-08-09 22:25 | 19K | |
![[IMG]](/icons/image2.gif) | 51mfrsIGYrL._SX389_B..> | 2023-05-04 01:59 | 37K | |
![[IMG]](/icons/image2.gif) | 51mhn4OKrjL._SY300_-..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51mhn4OKrjL._SY300_.jpg | 2023-05-03 09:58 | 23K | |
![[IMG]](/icons/image2.gif) | 51mmCs8IhzL-100x100.jpg | 2023-08-05 17:21 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51mmCs8IhzL-300x300.jpg | 2023-08-24 00:34 | 21K | |
![[IMG]](/icons/image2.gif) | 51mmCs8IhzL.jpg | 2023-05-04 01:53 | 38K | |
![[IMG]](/icons/image2.gif) | 51mtZLzK6TL._SX398_B..> | 2023-08-08 06:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51mtZLzK6TL._SX398_B..> | 2023-08-16 16:54 | 22K | |
![[IMG]](/icons/image2.gif) | 51mtZLzK6TL._SX398_B..> | 2023-05-04 01:58 | 42K | |
![[IMG]](/icons/image2.gif) | 51mwwhN2BExL._SX418_..> | 2023-08-06 04:56 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51mwwhN2BExL._SX418_..> | 2023-09-11 23:26 | 25K | |
![[IMG]](/icons/image2.gif) | 51mwwhN2BExL._SX418_..> | 2023-05-03 11:21 | 48K | |
![[IMG]](/icons/image2.gif) | 51n1oNlB2QL._SX384_B..> | 2023-08-05 02:45 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51n1oNlB2QL._SX384_B..> | 2023-08-06 22:47 | 23K | |
![[IMG]](/icons/image2.gif) | 51n1oNlB2QL._SX384_B..> | 2023-05-04 02:16 | 39K | |
![[IMG]](/icons/image2.gif) | 51n7gYgXzlL-100x100.jpg | 2023-08-09 04:09 | 15K | |
![[IMG]](/icons/image2.gif) | 51n7gYgXzlL.jpg | 2023-05-04 02:17 | 42K | |
![[IMG]](/icons/image2.gif) | 51nBaE2snFL._SX382_B..> | 2023-08-08 18:18 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51nBaE2snFL._SX382_B..> | 2023-08-19 00:17 | 22K | |
![[IMG]](/icons/image2.gif) | 51nBaE2snFL._SX382_B..> | 2023-05-04 01:54 | 41K | |
![[IMG]](/icons/image2.gif) | 51oA4rsEAxL._SY300__..> | 2023-08-05 17:17 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51oA4rsEAxL._SY300__..> | 2023-05-03 10:00 | 16K | |
![[IMG]](/icons/image2.gif) | 51oCgUEv-7L-100x100.jpg | 2023-08-06 04:21 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51oCgUEv-7L-300x300.jpg | 2023-09-18 04:50 | 24K | |
![[IMG]](/icons/image2.gif) | 51oCgUEv-7L.jpg | 2023-05-04 02:21 | 62K | |
![[IMG]](/icons/image2.gif) | 51olyx1rUEL._SX258_B..> | 2023-08-05 17:20 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51olyx1rUEL._SX258_B..> | 2023-05-04 02:01 | 17K | |
![[IMG]](/icons/image2.gif) | 51ox1k6oyGL._SX258_B..> | 2023-08-05 01:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51ox1k6oyGL._SX258_B..> | 2023-05-03 10:56 | 23K | |
![[IMG]](/icons/image2.gif) | 51pi2RbJyfL-100x100.jpg | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | 51pi2RbJyfL-300x300.jpg | 2023-08-19 20:58 | 16K | |
![[IMG]](/icons/image2.gif) | 51pi2RbJyfL.jpg | 2023-05-04 02:26 | 35K | |
![[IMG]](/icons/image2.gif) | 51q0-z8B3uL._SX398_B..> | 2023-08-08 08:38 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51q0-z8B3uL._SX398_B..> | 2023-09-12 09:51 | 24K | |
![[IMG]](/icons/image2.gif) | 51q0-z8B3uL._SX398_B..> | 2023-05-04 02:09 | 49K | |
![[IMG]](/icons/image2.gif) | 51q3zCyhexL-100x100.jpg | 2023-08-06 13:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | 51q3zCyhexL-300x300.jpg | 2023-08-05 03:41 | 24K | |
![[IMG]](/icons/image2.gif) | 51q3zCyhexL.jpg | 2023-05-04 02:05 | 54K | |
![[IMG]](/icons/image2.gif) | 51qKigkaF-L._SY300_-..> | 2023-08-06 13:11 | 3.1K | |
![[IMG]](/icons/image2.gif) | 51qKigkaF-L._SY300_.jpg | 2023-05-03 09:47 | 20K | |
![[IMG]](/icons/image2.gif) | 51qixfE8DzL-100x100.jpg | 2023-08-06 05:44 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51qixfE8DzL-300x300.jpg | 2023-08-17 23:54 | 23K | |
![[IMG]](/icons/image2.gif) | 51qixfE8DzL.jpg | 2023-05-04 01:57 | 49K | |
![[IMG]](/icons/image2.gif) | 51rQdthOquL-100x100.jpg | 2023-08-08 10:57 | 13K | |
![[IMG]](/icons/image2.gif) | 51rQdthOquL.jpg | 2023-05-04 02:16 | 37K | |
![[IMG]](/icons/image2.gif) | 51rS7SckZHL._SY300__..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51rS7SckZHL._SY300__..> | 2023-05-03 10:25 | 18K | |
![[IMG]](/icons/image2.gif) | 51rxhypq87L._SX403_B..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51rxhypq87L._SX403_B..> | 2023-08-06 07:44 | 19K | |
![[IMG]](/icons/image2.gif) | 51rxhypq87L._SX403_B..> | 2023-05-03 11:12 | 33K | |
![[IMG]](/icons/image2.gif) | 51sN-dHEVYL._SX368_B..> | 2023-08-05 17:22 | 4.2K | |
![[IMG]](/icons/image2.gif) | 51sN-dHEVYL._SX368_B..> | 2023-08-10 18:29 | 18K | |
![[IMG]](/icons/image2.gif) | 51sN-dHEVYL._SX368_B..> | 2023-05-03 11:24 | 33K | |
![[IMG]](/icons/image2.gif) | 51sdNRgLZ5L._SX398_B..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51sdNRgLZ5L._SX398_B..> | 2023-08-10 16:04 | 18K | |
![[IMG]](/icons/image2.gif) | 51sdNRgLZ5L._SX398_B..> | 2023-05-04 01:59 | 36K | |
![[IMG]](/icons/image2.gif) | 51sq9ney-rl._sx389_b..> | 2023-05-04 02:26 | 13K | |
![[IMG]](/icons/image2.gif) | 51t5PlVdPUL._SX407_B..> | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51t5PlVdPUL._SX407_B..> | 2023-09-05 02:50 | 19K | |
![[IMG]](/icons/image2.gif) | 51t5PlVdPUL._SX407_B..> | 2023-05-03 11:13 | 32K | |
![[IMG]](/icons/image2.gif) | 51tITLBryL._AC_UL320..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51tITLBryL._AC_UL320..> | 2023-05-04 02:11 | 20K | |
![[IMG]](/icons/image2.gif) | 51tSsX5GKfL._SX388_B..> | 2023-08-08 14:33 | 3.0K | |
![[IMG]](/icons/image2.gif) | 51tSsX5GKfL._SX388_B..> | 2023-08-22 23:52 | 16K | |
![[IMG]](/icons/image2.gif) | 51tSsX5GKfL._SX388_B..> | 2023-05-04 02:02 | 25K | |
![[IMG]](/icons/image2.gif) | 51tU-KPgj2L._SY300_-..> | 2023-08-05 03:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51tU-KPgj2L._SY300_.jpg | 2023-05-03 09:50 | 16K | |
![[IMG]](/icons/image2.gif) | 51tlH1PusAL._SY300__..> | 2023-08-06 08:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51tlH1PusAL._SY300__..> | 2023-05-03 10:05 | 19K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-08-09 00:59 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-08-06 11:14 | 20K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-05-04 02:00 | 33K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-08-05 15:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-08-13 17:54 | 20K | |
![[IMG]](/icons/image2.gif) | 51twC2bwnKL._SX400_B..> | 2023-05-04 02:00 | 33K | |
![[IMG]](/icons/image2.gif) | 51us2B-EMfzL._SX258_..> | 2023-08-06 12:02 | 4.4K | |
![[IMG]](/icons/image2.gif) | 51us2B-EMfzL._SX258_..> | 2023-05-03 11:21 | 26K | |
![[IMG]](/icons/image2.gif) | 51uuN4RBCyL._SX398_B..> | 2023-08-05 02:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51uuN4RBCyL._SX398_B..> | 2023-08-06 11:14 | 23K | |
![[IMG]](/icons/image2.gif) | 51uuN4RBCyL._SX398_B..> | 2023-05-04 02:00 | 49K | |
![[IMG]](/icons/image2.gif) | 51vHUh4pdOL._SX412_B..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51vHUh4pdOL._SX412_B..> | 2023-09-02 05:56 | 21K | |
![[IMG]](/icons/image2.gif) | 51vHUh4pdOL._SX412_B..> | 2023-05-04 02:02 | 50K | |
![[IMG]](/icons/image2.gif) | 51vOkw0-hfL-100x100.jpg | 2023-08-05 15:31 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51vOkw0-hfL-300x300.jpg | 2023-08-05 03:40 | 21K | |
![[IMG]](/icons/image2.gif) | 51vOkw0-hfL.jpg | 2023-05-04 01:50 | 46K | |
![[IMG]](/icons/image2.gif) | 51vPIFIu0YL._SX258_B..> | 2023-08-05 02:46 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51vPIFIu0YL._SX258_B..> | 2023-05-03 10:55 | 25K | |
![[IMG]](/icons/image2.gif) | 51vPIFIu0YL._SX258_B..> | 2023-08-07 05:32 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51vPIFIu0YL._SX258_B..> | 2023-05-03 10:55 | 25K | |
![[IMG]](/icons/image2.gif) | 51w1vmvyOL._SX396_BO..> | 2023-08-07 10:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | 51w1vmvyOL._SX396_BO..> | 2023-08-22 23:52 | 17K | |
![[IMG]](/icons/image2.gif) | 51w1vmvyOL._SX396_BO..> | 2023-05-04 02:25 | 37K | |
![[IMG]](/icons/image2.gif) | 51w3xCwN0IL._SX398_B..> | 2023-08-08 07:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51w3xCwN0IL._SX398_B..> | 2023-08-08 20:09 | 19K | |
![[IMG]](/icons/image2.gif) | 51w3xCwN0IL._SX398_B..> | 2023-05-03 10:52 | 33K | |
![[IMG]](/icons/image2.gif) | 51wFsOY82B2BL._SX258..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | 51wFsOY82B2BL._SX258..> | 2023-05-03 10:52 | 26K | |
![[IMG]](/icons/image2.gif) | 51wLf1w2xoL._SY300_2..> | 2023-08-06 12:12 | 3.4K | |
![[IMG]](/icons/image2.gif) | 51wLf1w2xoL._SY300_2..> | 2023-05-03 09:11 | 17K | |
![[IMG]](/icons/image2.gif) | 51wOFHd6FZL-100x100.jpg | 2023-08-06 03:28 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51wOFHd6FZL-300x300.jpg | 2023-08-13 22:07 | 21K | |
![[IMG]](/icons/image2.gif) | 51wOFHd6FZL.jpg | 2023-05-03 11:07 | 42K | |
![[IMG]](/icons/image2.gif) | 51wUv82B2BM6L-100x10..> | 2023-08-05 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51wUv82B2BM6L-300x30..> | 2023-08-23 23:13 | 18K | |
![[IMG]](/icons/image2.gif) | 51wUv82B2BM6L.jpg | 2023-05-04 02:03 | 36K | |
![[IMG]](/icons/image2.gif) | 51wb_-qdupl._sx389_b..> | 2023-08-06 08:43 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51wb_-qdupl._sx389_b..> | 2023-08-08 17:45 | 23K | |
![[IMG]](/icons/image2.gif) | 51wb_-qdupl._sx389_b..> | 2023-05-04 01:51 | 65K | |
![[IMG]](/icons/image2.gif) | 51wczN4qzWL._SY300_-..> | 2023-08-08 17:05 | 3.6K | |
![[IMG]](/icons/image2.gif) | 51wczN4qzWL._SY300_.jpg | 2023-05-03 09:26 | 20K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-08-05 06:17 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-08-05 03:41 | 19K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-05-03 10:53 | 30K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-08-05 05:15 | 3.7K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-08-16 08:16 | 19K | |
![[IMG]](/icons/image2.gif) | 51wxKlwyxJL._SX389_B..> | 2023-05-03 10:53 | 30K | |
![[IMG]](/icons/image2.gif) | 51xXv6HIi1L._SY300__..> | 2023-08-05 16:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51xXv6HIi1L._SY300__..> | 2023-05-03 11:02 | 21K | |
![[IMG]](/icons/image2.gif) | 51xgeRznDTL__58549.1..> | 2023-08-05 22:02 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51xgeRznDTL__58549.1..> | 2023-08-17 10:32 | 16K | |
![[IMG]](/icons/image2.gif) | 51xgeRznDTL__58549.1..> | 2023-05-04 02:24 | 34K | |
![[IMG]](/icons/image2.gif) | 51xiks1gq6L-100x100.jpg | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 51xiks1gq6L-300x300.jpg | 2023-09-19 06:07 | 17K | |
![[IMG]](/icons/image2.gif) | 51xiks1gq6L.jpg | 2023-05-04 01:58 | 42K | |
![[IMG]](/icons/image2.gif) | 51yTeyHzlJL._SX258_B..> | 2023-08-05 23:58 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51yTeyHzlJL._SX258_B..> | 2023-05-04 02:03 | 24K | |
![[IMG]](/icons/image2.gif) | 51yTeyHzlJL._SX258_B..> | 2023-08-07 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51yTeyHzlJL._SX258_B..> | 2023-05-04 02:03 | 24K | |
![[IMG]](/icons/image2.gif) | 51yU-LyQNZL.-SY300--..> | 2023-08-08 17:39 | 4.3K | |
![[IMG]](/icons/image2.gif) | 51yU-LyQNZL.-SY300-.jpg | 2023-05-04 02:24 | 25K | |
![[IMG]](/icons/image2.gif) | 51yktg8E4AL.-SX285--..> | 2023-08-05 06:19 | 2.6K | |
![[IMG]](/icons/image2.gif) | 51yktg8E4AL.-SX285-.jpg | 2023-05-04 02:24 | 20K | |
![[IMG]](/icons/image2.gif) | 51ymrpslj3L._SX258_B..> | 2023-08-06 05:44 | 5.3K | |
![[IMG]](/icons/image2.gif) | 51ymrpslj3L._SX258_B..> | 2023-05-03 10:54 | 33K | |
![[IMG]](/icons/image2.gif) | 51ynTDmtJ5L._SX389_B..> | 2023-08-06 05:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | 51ynTDmtJ5L._SX389_B..> | 2023-08-09 09:14 | 22K | |
![[IMG]](/icons/image2.gif) | 51ynTDmtJ5L._SX389_B..> | 2023-05-04 02:00 | 36K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-08-05 01:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-08-09 09:11 | 26K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-05-04 02:17 | 59K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-08-05 02:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-08-21 10:12 | 26K | |
![[IMG]](/icons/image2.gif) | 51z7rnYmdOL._SX388_B..> | 2023-05-04 02:17 | 59K | |
![[IMG]](/icons/image2.gif) | 51zgArxW2fL-100x100.jpg | 2023-08-06 08:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | 51zgArxW2fL-300x300.jpg | 2023-08-05 05:34 | 20K | |
![[IMG]](/icons/image2.gif) | 51zgArxW2fL.jpg | 2023-05-03 11:06 | 33K | |
![[IMG]](/icons/image2.gif) | 53.jpg | 2023-05-03 10:36 | 59K | |
![[ ]](/icons/compressed.gif) | 54a1c314626db-busine..> | 2023-05-03 10:32 | 16K | |
![[ ]](/icons/layout.gif) | 54ac187739a4d-fundam..> | 2023-05-03 11:07 | 253K | |
![[IMG]](/icons/image2.gif) | 60_1.jpg | 2023-05-03 09:32 | 49K | |
![[IMG]](/icons/image2.gif) | 61A9VXXLvtL-100x100.jpg | 2023-08-06 13:03 | 4.4K | |
![[IMG]](/icons/image2.gif) | 61A9VXXLvtL-300x300.jpg | 2023-08-12 01:56 | 34K | |
![[IMG]](/icons/image2.gif) | 61A9VXXLvtL.jpg | 2023-05-04 01:56 | 87K | |
![[IMG]](/icons/image2.gif) | 61B9_Wv2dAL._SY300__..> | 2023-08-06 13:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 61B9_Wv2dAL._SY300__..> | 2023-05-04 02:20 | 24K | |
![[IMG]](/icons/image2.gif) | 61BzAGJnEAL._SX258_B..> | 2023-08-05 03:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | 61BzAGJnEAL._SX258_B..> | 2023-05-03 11:15 | 35K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-08-05 10:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-08-27 07:51 | 27K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-05-03 11:15 | 74K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-08-06 05:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-08-21 08:26 | 27K | |
![[IMG]](/icons/image2.gif) | 61BzgLXkurL__21368.1..> | 2023-05-03 10:19 | 74K | |
![[IMG]](/icons/image2.gif) | 61FaGUVIsfL._SX398_B..> | 2023-08-05 06:24 | 5.1K | |
![[IMG]](/icons/image2.gif) | 61FaGUVIsfL._SX398_B..> | 2023-08-05 16:25 | 28K | |
![[IMG]](/icons/image2.gif) | 61FaGUVIsfL._SX398_B..> | 2023-05-04 01:50 | 51K | |
![[IMG]](/icons/image2.gif) | 61FvUCIdfKL._SY300_-..> | 2023-08-06 08:43 | 4.4K | |
![[IMG]](/icons/image2.gif) | 61FvUCIdfKL._SY300_.jpg | 2023-05-03 11:20 | 28K | |
![[IMG]](/icons/image2.gif) | 61FyhNeyouL._SY300__..> | 2023-08-05 03:40 | 4.6K | |
![[IMG]](/icons/image2.gif) | 61FyhNeyouL._SY300__..> | 2023-05-03 10:11 | 28K | |
![[IMG]](/icons/image2.gif) | 61IfYuXVWDL._SX402_B..> | 2023-08-06 12:14 | 5.6K | |
![[IMG]](/icons/image2.gif) | 61IfYuXVWDL._SX402_B..> | 2023-08-06 09:43 | 38K | |
![[IMG]](/icons/image2.gif) | 61IfYuXVWDL._SX402_B..> | 2023-05-03 11:25 | 76K | |
![[IMG]](/icons/image2.gif) | 61JqUQD2eDL._SX258_B..> | 2023-08-05 06:24 | 5.7K | |
![[IMG]](/icons/image2.gif) | 61JqUQD2eDL._SX258_B..> | 2023-05-03 10:50 | 34K | |
![[IMG]](/icons/image2.gif) | 61MD-n2RkbL._SX258_B..> | 2023-08-05 14:41 | 4.9K | |
![[IMG]](/icons/image2.gif) | 61MD-n2RkbL._SX258_B..> | 2023-05-03 11:11 | 36K | |
![[IMG]](/icons/image2.gif) | 61RjSDA4L._SX410_BO1..> | 2023-08-05 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | 61RjSDA4L._SX410_BO1..> | 2023-09-05 00:53 | 29K | |
![[IMG]](/icons/image2.gif) | 61RjSDA4L._SX410_BO1..> | 2023-05-04 02:06 | 53K | |
![[IMG]](/icons/image2.gif) | 61_1.jpg | 2023-05-03 10:36 | 25K | |
![[IMG]](/icons/image2.gif) | 61bHsHl4CCL.-SX285--..> | 2023-08-06 08:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | 61bHsHl4CCL.-SX285-.jpg | 2023-05-04 02:18 | 33K | |
![[IMG]](/icons/image2.gif) | 61dQn2ZfMVL._SX412_B..> | 2023-08-05 01:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | 61dQn2ZfMVL._SX412_B..> | 2023-08-15 03:43 | 28K | |
![[IMG]](/icons/image2.gif) | 61dQn2ZfMVL._SX412_B..> | 2023-05-04 01:58 | 56K | |
![[IMG]](/icons/image2.gif) | 61f2ykPvAZL._SX387_B..> | 2023-08-05 05:30 | 5.1K | |
![[IMG]](/icons/image2.gif) | 61f2ykPvAZL._SX387_B..> | 2023-08-15 05:19 | 31K | |
![[IMG]](/icons/image2.gif) | 61f2ykPvAZL._SX387_B..> | 2023-05-03 11:09 | 61K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-08-05 03:41 | 5.1K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-09-12 09:51 | 33K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-05-04 02:16 | 61K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-08-05 02:47 | 5.1K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-08-12 04:50 | 33K | |
![[IMG]](/icons/image2.gif) | 61o2ouwuSOL._SX389_B..> | 2023-05-04 01:59 | 61K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-08-06 00:25 | 4.5K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-08-06 08:47 | 29K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-05-04 01:59 | 52K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-08-05 14:38 | 4.5K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-08-09 23:26 | 29K | |
![[IMG]](/icons/image2.gif) | 61pR1X-0w8L._SX398_B..> | 2023-05-04 01:56 | 52K | |
![[IMG]](/icons/image2.gif) | 61pVi09AO6L._SX388_B..> | 2023-08-05 17:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | 61pVi09AO6L._SX388_B..> | 2023-08-22 19:18 | 29K | |
![[IMG]](/icons/image2.gif) | 61pVi09AO6L._SX388_B..> | 2023-05-04 02:01 | 55K | |
![[IMG]](/icons/image2.gif) | 61qGS5g5DLL._SX258_B..> | 2023-08-09 02:49 | 3.9K | |
![[IMG]](/icons/image2.gif) | 61qGS5g5DLL._SX258_B..> | 2023-05-03 11:22 | 25K | |
![[IMG]](/icons/image2.gif) | 61q_howXK1L._SY300__..> | 2023-08-05 16:26 | 4.1K | |
![[IMG]](/icons/image2.gif) | 61q_howXK1L._SY300__..> | 2023-05-03 10:23 | 26K | |
![[IMG]](/icons/image2.gif) | 61tABZM4fJL-100x100.jpg | 2023-08-06 04:21 | 2.8K | |
![[IMG]](/icons/image2.gif) | 61tABZM4fJL-300x300.jpg | 2023-08-09 05:00 | 24K | |
![[IMG]](/icons/image2.gif) | 61tABZM4fJL.jpg | 2023-05-04 01:52 | 69K | |
![[IMG]](/icons/image2.gif) | 61tjv5V9kwL._SX258_B..> | 2023-08-05 02:46 | 4.5K | |
![[IMG]](/icons/image2.gif) | 61tjv5V9kwL._SX258_B..> | 2023-05-04 02:01 | 30K | |
![[IMG]](/icons/image2.gif) | 61uS9OleYBL._SX258_B..> | 2023-08-05 15:32 | 4.5K | |
![[IMG]](/icons/image2.gif) | 61uS9OleYBL._SX258_B..> | 2023-05-03 09:22 | 34K | |
![[IMG]](/icons/image2.gif) | 61ynKMRuaL._SX385_BO..> | 2023-08-06 10:20 | 4.1K | |
![[IMG]](/icons/image2.gif) | 61ynKMRuaL._SX385_BO..> | 2023-08-07 04:39 | 29K | |
![[IMG]](/icons/image2.gif) | 61ynKMRuaL._SX385_BO..> | 2023-05-04 01:59 | 68K | |
![[IMG]](/icons/image2.gif) | 71Z3ebd4M8L._SL1000_..> | 2023-08-08 06:43 | 4.0K | |
![[IMG]](/icons/image2.gif) | 71Z3ebd4M8L._SL1000_..> | 2023-08-18 10:03 | 23K | |
![[IMG]](/icons/image2.gif) | 71Z3ebd4M8L._SL1000_..> | 2023-05-04 01:51 | 66K | |
![[IMG]](/icons/image2.gif) | 71ymnU6VF1L._AA1500_..> | 2023-05-03 10:31 | 35K | |
![[IMG]](/icons/image2.gif) | 72.jpg | 2023-05-03 09:19 | 40K | |
![[IMG]](/icons/image2.gif) | 72_1.jpg | 2023-05-03 11:24 | 75K | |
![[IMG]](/icons/image2.gif) | 81Jax0-ydL._SX425_-1..> | 2023-08-05 05:29 | 4.9K | |
![[IMG]](/icons/image2.gif) | 81Jax0-ydL._SX425_-3..> | 2023-09-22 10:56 | 27K | |
![[IMG]](/icons/image2.gif) | 81Jax0-ydL._SX425_.jpg | 2023-05-04 02:15 | 53K | |
![[IMG]](/icons/image2.gif) | 85.jpg | 2023-05-03 09:44 | 37K | |
![[IMG]](/icons/image2.gif) | 91.jpg | 2023-05-03 10:12 | 60K | |
![[IMG]](/icons/image2.gif) | 93-53da326113607-100..> | 2023-08-05 16:22 | 4.1K | |
![[IMG]](/icons/image2.gif) | 93-53da326113607-300..> | 2023-08-18 10:03 | 29K | |
![[IMG]](/icons/image2.gif) | 93-53da326113607.jpg | 2023-05-03 11:03 | 303K | |
![[IMG]](/icons/image2.gif) | 102.jpg | 2023-05-03 10:19 | 40K | |
![[IMG]](/icons/image2.gif) | 104_1.jpg | 2023-05-03 09:38 | 34K | |
![[IMG]](/icons/image2.gif) | 127-53da328751492-10..> | 2023-08-05 05:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | 127-53da328751492.jpg | 2023-05-03 10:24 | 47K | |
![[IMG]](/icons/image2.gif) | 128-53da32888e3fc-10..> | 2023-08-05 17:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | 128-53da32888e3fc-30..> | 2023-08-22 23:45 | 12K | |
![[IMG]](/icons/image2.gif) | 128-53da32888e3fc.jpg | 2023-05-03 10:44 | 56K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb1-10..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb1-30..> | 2023-09-01 21:32 | 16K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb1.jpg | 2023-05-03 09:40 | 175K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb11-1..> | 2023-08-06 13:02 | 3.5K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb11-3..> | 2023-08-12 04:49 | 16K | |
![[IMG]](/icons/image2.gif) | 162-53da32af8ccb11.jpg | 2023-05-03 09:30 | 175K | |
![[IMG]](/icons/image2.gif) | 210-53da32e9a25dd-10..> | 2023-08-06 04:21 | 3.7K | |
![[IMG]](/icons/image2.gif) | 210-53da32e9a25dd-30..> | 2023-08-23 21:13 | 22K | |
![[IMG]](/icons/image2.gif) | 210-53da32e9a25dd.jpg | 2023-05-03 09:31 | 99K | |
![[IMG]](/icons/image2.gif) | 312H7v3rUmL._SY300__..> | 2023-08-05 17:17 | 1.7K | |
![[IMG]](/icons/image2.gif) | 312H7v3rUmL._SY300__..> | 2023-05-03 09:29 | 6.5K | |
![[IMG]](/icons/image2.gif) | 337-53da33822fdcf-10..> | 2023-08-06 10:17 | 4.0K | |
![[IMG]](/icons/image2.gif) | 337-53da33822fdcf-30..> | 2023-08-12 08:35 | 21K | |
![[IMG]](/icons/image2.gif) | 337-53da33822fdcf.jpg | 2023-05-04 02:13 | 89K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-1-100x..> | 2023-08-05 05:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-1-300x..> | 2023-08-05 15:27 | 16K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-1.jpg | 2023-05-04 02:01 | 47K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-2-100x..> | 2023-08-05 17:21 | 2.9K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-2-300x..> | 2023-08-09 13:53 | 16K | |
![[IMG]](/icons/image2.gif) | 357-3-492x600-2.jpg | 2023-05-04 02:01 | 47K | |
![[IMG]](/icons/image2.gif) | 410NFbF4GL._SX369_BO..> | 2023-08-08 16:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 410NFbF4GL._SX369_BO..> | 2023-08-13 19:44 | 17K | |
![[IMG]](/icons/image2.gif) | 410NFbF4GL._SX369_BO..> | 2023-05-04 02:28 | 29K | |
![[IMG]](/icons/image2.gif) | 410qHCkvOrL._SX393_B..> | 2023-08-05 01:12 | 3.2K | |
![[IMG]](/icons/image2.gif) | 410qHCkvOrL._SX393_B..> | 2023-08-06 08:47 | 16K | |
![[IMG]](/icons/image2.gif) | 410qHCkvOrL._SX393_B..> | 2023-05-04 01:58 | 25K | |
![[IMG]](/icons/image2.gif) | 412vBGUNPPL._SX389_B..> | 2023-08-07 12:04 | 2.6K | |
![[IMG]](/icons/image2.gif) | 412vBGUNPPL._SX389_B..> | 2023-08-20 19:01 | 14K | |
![[IMG]](/icons/image2.gif) | 412vBGUNPPL._SX389_B..> | 2023-05-04 02:05 | 22K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-08-06 13:03 | 3.0K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-08-20 21:48 | 15K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-05-04 02:10 | 24K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-08-05 15:47 | 3.0K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-08-12 04:49 | 15K | |
![[IMG]](/icons/image2.gif) | 415EoG7kE5L._SX390_B..> | 2023-05-04 02:10 | 24K | |
![[IMG]](/icons/image2.gif) | 442-53da33f463b6b-10..> | 2023-08-05 17:21 | 4.1K | |
![[IMG]](/icons/image2.gif) | 442-53da33f463b6b-30..> | 2023-08-14 20:35 | 24K | |
![[IMG]](/icons/image2.gif) | 442-53da33f463b6b.jpg | 2023-05-03 10:21 | 116K | |
![[IMG]](/icons/image2.gif) | 444-53da33f6676da-10..> | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | 444-53da33f6676da.jpg | 2023-05-03 11:15 | 29K | |
![[IMG]](/icons/image2.gif) | 456-53da34047b839-10..> | 2023-08-05 02:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | 456-53da34047b839-30..> | 2023-08-09 10:17 | 23K | |
![[IMG]](/icons/image2.gif) | 456-53da34047b839.jpg | 2023-05-03 11:21 | 69K | |
![[IMG]](/icons/image2.gif) | 499-53da3436126ae-10..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | 499-53da3436126ae.jpg | 2023-05-03 10:33 | 32K | |
![[IMG]](/icons/image2.gif) | 503-53da3439dd227-10..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | 503-53da3439dd227.jpg | 2023-05-03 09:32 | 29K | |
![[IMG]](/icons/image2.gif) | 510LJOqjkFL._SY300__..> | 2023-08-06 10:17 | 3.8K | |
![[IMG]](/icons/image2.gif) | 510LJOqjkFL._SY300__..> | 2023-05-03 09:30 | 20K | |
![[IMG]](/icons/image2.gif) | 510w6UscP8L._SX389_B..> | 2023-08-05 14:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 510w6UscP8L._SX389_B..> | 2023-08-05 04:35 | 20K | |
![[IMG]](/icons/image2.gif) | 510w6UscP8L._SX389_B..> | 2023-05-03 10:50 | 33K | |
![[IMG]](/icons/image2.gif) | 510y9SAI8mL._SX388_B..> | 2023-08-06 03:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | 510y9SAI8mL._SX388_B..> | 2023-08-22 15:02 | 21K | |
![[IMG]](/icons/image2.gif) | 510y9SAI8mL._SX388_B..> | 2023-05-04 01:48 | 38K | |
![[IMG]](/icons/image2.gif) | 511HurS7hOL._BO22042..> | 2023-05-04 02:21 | 18K | |
![[IMG]](/icons/image2.gif) | 511JdnhDMQL._SY300__..> | 2023-08-05 16:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | 511JdnhDMQL._SY300__..> | 2023-05-03 09:52 | 18K | |
![[IMG]](/icons/image2.gif) | 511NIvbVhrL._SX389_B..> | 2023-08-05 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | 511NIvbVhrL._SX389_B..> | 2023-08-21 07:47 | 25K | |
![[IMG]](/icons/image2.gif) | 511NIvbVhrL._SX389_B..> | 2023-05-04 02:24 | 59K | |
![[IMG]](/icons/image2.gif) | 511NQ06pVnL._SX388_B..> | 2023-08-08 06:31 | 4.5K | |
![[IMG]](/icons/image2.gif) | 511NQ06pVnL._SX388_B..> | 2023-10-20 06:19 | 27K | |
![[IMG]](/icons/image2.gif) | 511NQ06pVnL._SX388_B..> | 2023-05-04 02:25 | 50K | |
![[IMG]](/icons/image2.gif) | 511RRMZ9c4L._SX402_B..> | 2023-08-05 16:23 | 3.6K | |
![[IMG]](/icons/image2.gif) | 511RRMZ9c4L._SX402_B..> | 2023-08-06 17:28 | 21K | |
![[IMG]](/icons/image2.gif) | 511RRMZ9c4L._SX402_B..> | 2023-05-03 11:06 | 37K | |
![[IMG]](/icons/image2.gif) | 511RWuqUB0L._SY300__..> | 2023-08-05 01:13 | 2.9K | |
![[IMG]](/icons/image2.gif) | 511RWuqUB0L._SY300__..> | 2023-05-03 10:10 | 15K | |
![[IMG]](/icons/image2.gif) | 511TmVqc4LL._SX333_B..> | 2023-08-05 01:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | 511TmVqc4LL._SX333_B..> | 2023-09-06 23:57 | 17K | |
![[IMG]](/icons/image2.gif) | 511TmVqc4LL._SX333_B..> | 2023-05-04 02:19 | 38K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-08-06 08:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-10-29 12:50 | 23K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-05-04 01:53 | 40K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-08-05 05:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-08-19 01:45 | 23K | |
![[IMG]](/icons/image2.gif) | 511c9UhaLHL._SX388_B..> | 2023-05-04 01:52 | 40K | |
![[IMG]](/icons/image2.gif) | 511eHm59JnL._SX388_B..> | 2023-08-06 07:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | 511eHm59JnL._SX388_B..> | 2023-09-03 16:54 | 23K | |
![[IMG]](/icons/image2.gif) | 511eHm59JnL._SX388_B..> | 2023-05-04 02:29 | 54K | |
![[IMG]](/icons/image2.gif) | 511olqY6lsL._SX389_B..> | 2023-08-05 05:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | 511olqY6lsL._SX389_B..> | 2023-08-16 08:16 | 25K | |
![[IMG]](/icons/image2.gif) | 511olqY6lsL._SX389_B..> | 2023-05-04 02:15 | 53K | |
![[IMG]](/icons/image2.gif) | 511rjQ91gLL._SX383_B..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | 511rjQ91gLL._SX383_B..> | 2023-08-17 04:55 | 20K | |
![[IMG]](/icons/image2.gif) | 511rjQ91gLL._SX383_B..> | 2023-05-03 11:03 | 35K | |
![[IMG]](/icons/image2.gif) | 512BlVIr8r0L._SX258_..> | 2023-08-08 08:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | 512BlVIr8r0L._SX258_..> | 2023-05-04 02:00 | 22K | |
![[IMG]](/icons/image2.gif) | 512I-2cUY8L.-SY300-1..> | 2023-08-05 17:22 | 4.0K | |
![[IMG]](/icons/image2.gif) | 512I-2cUY8L.-SY300-1..> | 2023-05-04 01:56 | 19K | |
![[IMG]](/icons/image2.gif) | 512P9jwbmML._SX258_B..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | 512P9jwbmML._SX258_B..> | 2023-05-03 11:02 | 23K | |
![[IMG]](/icons/image2.gif) | 512bqCYT01L.-SX285--..> | 2023-08-05 16:28 | 3.8K | |
![[IMG]](/icons/image2.gif) | 512bqCYT01L.-SX285-.jpg | 2023-05-04 02:27 | 26K | |
![[IMG]](/icons/image2.gif) | 513Gsv9l9zL.-SX285--..> | 2023-08-06 11:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | 513Gsv9l9zL.-SX285-.jpg | 2023-05-04 02:19 | 25K | |
![[IMG]](/icons/image2.gif) | 513VTGbIQL._SX384_BO..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | 513VTGbIQL._SX384_BO..> | 2023-08-28 07:57 | 24K | |
![[IMG]](/icons/image2.gif) | 513VTGbIQL._SX384_BO..> | 2023-05-04 02:04 | 44K | |
![[IMG]](/icons/image2.gif) | 513VjuRzMGL._SX258_B..> | 2023-08-05 05:17 | 4.4K | |
![[IMG]](/icons/image2.gif) | 513VjuRzMGL._SX258_B..> | 2023-05-03 10:59 | 28K | |
![[IMG]](/icons/image2.gif) | 513jGOk00IL._SY300_-..> | 2023-08-05 16:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | 513jGOk00IL._SY300_.jpg | 2023-05-03 10:22 | 19K | |
![[IMG]](/icons/image2.gif) | 514-AKilpCL._SY300_-..> | 2023-08-05 17:22 | 3.5K | |
![[IMG]](/icons/image2.gif) | 514-AKilpCL._SY300_.jpg | 2023-05-03 09:43 | 16K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-08-06 12:18 | 19K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-05-04 02:27 | 42K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-08-08 22:02 | 3.4K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-09-17 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | 514bGAkATLL._SX398_B..> | 2023-05-04 02:27 | 42K | |
![[IMG]](/icons/image2.gif) | 515Tvro1FiL._SX384_B..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | 515Tvro1FiL._SX384_B..> | 2023-08-08 06:46 | 25K | |
![[IMG]](/icons/image2.gif) | 515Tvro1FiL._SX384_B..> | 2023-05-04 02:11 | 43K | |
![[IMG]](/icons/image2.gif) | 515fyYLGfvL-100x100.jpg | 2023-08-05 17:22 | 2.4K | |
![[IMG]](/icons/image2.gif) | 515fyYLGfvL-300x300.jpg | 2023-08-22 23:52 | 14K | |
![[IMG]](/icons/image2.gif) | 515fyYLGfvL.jpg | 2023-05-03 10:21 | 39K | |
![[IMG]](/icons/image2.gif) | 515ouAJZW2L._SY300__..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | 515ouAJZW2L._SY300__..> | 2023-05-03 09:36 | 22K | |
![[IMG]](/icons/image2.gif) | 516WkxEjNXL._SX408_B..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 516WkxEjNXL._SX408_B..> | 2023-08-10 03:31 | 26K | |
![[IMG]](/icons/image2.gif) | 516WkxEjNXL._SX408_B..> | 2023-05-03 11:13 | 46K | |
![[IMG]](/icons/image2.gif) | 516a6xG1VUL-100x100.jpg | 2023-08-05 01:54 | 3.5K | |
![[IMG]](/icons/image2.gif) | 516a6xG1VUL-300x300.jpg | 2023-09-18 05:40 | 27K | |
![[IMG]](/icons/image2.gif) | 516a6xG1VUL.jpg | 2023-05-04 01:49 | 60K | |
![[IMG]](/icons/image2.gif) | 516euwkds4l._sx352_b..> | 2023-05-04 02:28 | 14K | |
![[IMG]](/icons/image2.gif) | 516pyRhArEL-100x100.jpg | 2023-08-05 15:32 | 3.7K | |
![[IMG]](/icons/image2.gif) | 516pyRhArEL-300x300.jpg | 2023-08-08 23:54 | 22K | |
![[IMG]](/icons/image2.gif) | 516pyRhArEL.jpg | 2023-05-04 01:57 | 54K | |
![[IMG]](/icons/image2.gif) | 517WerHV11L._AC_-100..> | 2023-08-05 01:52 | 4.2K | |
![[IMG]](/icons/image2.gif) | 517WerHV11L._AC_-300..> | 2023-08-06 12:18 | 23K | |
![[IMG]](/icons/image2.gif) | 517WerHV11L._AC_.jpg | 2023-05-03 11:16 | 41K | |
![[IMG]](/icons/image2.gif) | 517cp32mGWL._SX398_B..> | 2023-08-05 04:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | 517cp32mGWL._SX398_B..> | 2023-08-21 07:47 | 21K | |
![[IMG]](/icons/image2.gif) | 517cp32mGWL._SX398_B..> | 2023-05-04 02:03 | 46K | |
![[IMG]](/icons/image2.gif) | 517k1kQJ68L._SX373_B..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 517k1kQJ68L._SX373_B..> | 2023-09-11 04:22 | 25K | |
![[IMG]](/icons/image2.gif) | 517k1kQJ68L._SX373_B..> | 2023-05-03 11:22 | 42K | |
![[IMG]](/icons/image2.gif) | 517n4dsxwcl._sx389_b..> | 2023-05-04 02:29 | 13K | |
![[IMG]](/icons/image2.gif) | 517pp20pFBL._SY300_-..> | 2023-08-05 02:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | 517pp20pFBL._SY300_.jpg | 2023-05-03 10:46 | 13K | |
![[IMG]](/icons/image2.gif) | 517uxmtfWoL._SX389_B..> | 2023-08-05 08:34 | 4.7K | |
![[IMG]](/icons/image2.gif) | 517uxmtfWoL._SX389_B..> | 2023-08-19 08:10 | 26K | |
![[IMG]](/icons/image2.gif) | 517uxmtfWoL._SX389_B..> | 2023-05-03 11:19 | 45K | |
![[IMG]](/icons/image2.gif) | 518bZ10klDL._SX360_B..> | 2023-08-05 17:22 | 3.7K | |
![[IMG]](/icons/image2.gif) | 518bZ10klDL._SX360_B..> | 2023-08-08 06:46 | 21K | |
![[IMG]](/icons/image2.gif) | 518bZ10klDL._SX360_B..> | 2023-05-03 10:54 | 46K | |
![[IMG]](/icons/image2.gif) | 518nXne92jL._SY300__..> | 2023-08-08 21:59 | 3.6K | |
![[IMG]](/icons/image2.gif) | 518nXne92jL._SY300__..> | 2023-05-03 11:20 | 20K | |
![[IMG]](/icons/image2.gif) | 519CTnn713L._BO22042..> | 2023-05-03 10:29 | 17K | |
![[IMG]](/icons/image2.gif) | 519RnNKAWbL._SX394_B..> | 2023-08-05 01:09 | 4.1K | |
![[IMG]](/icons/image2.gif) | 519RnNKAWbL._SX394_B..> | 2023-09-12 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 519RnNKAWbL._SX394_B..> | 2023-05-04 01:55 | 41K | |
![[IMG]](/icons/image2.gif) | 519YusQA0zL._SX379_B..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 519YusQA0zL._SX379_B..> | 2023-08-28 17:05 | 24K | |
![[IMG]](/icons/image2.gif) | 519YusQA0zL._SX379_B..> | 2023-05-03 11:11 | 44K | |
![[IMG]](/icons/image2.gif) | 519ehQZeYbL._SX379_B..> | 2023-08-06 07:37 | 2.8K | |
![[IMG]](/icons/image2.gif) | 519ehQZeYbL._SX379_B..> | 2023-08-09 02:53 | 18K | |
![[IMG]](/icons/image2.gif) | 519ehQZeYbL._SX379_B..> | 2023-05-04 02:23 | 41K | |
![[IMG]](/icons/image2.gif) | 534-53da34d4b66d5-10..> | 2023-08-05 05:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | 534-53da34d4b66d5-30..> | 2023-08-08 16:42 | 21K | |
![[IMG]](/icons/image2.gif) | 534-53da34d4b66d5.jpg | 2023-05-03 10:24 | 77K | |
![[IMG]](/icons/image2.gif) | 546-53da34e0d6106-76..> | 2023-08-05 05:30 | 2.4K | |
![[IMG]](/icons/image2.gif) | 546-53da34e0d6106-76..> | 2023-08-08 16:42 | 12K | |
![[IMG]](/icons/image2.gif) | 546-53da34e0d6106-76..> | 2023-05-03 09:30 | 113K | |
![[ ]](/icons/unknown.gif) | 577-55638-Chapter_01..> | 2023-05-03 11:13 | 147K | |
![[IMG]](/icons/image2.gif) | 610qk45vXxL._SX388_B..> | 2023-08-08 15:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | 610qk45vXxL._SX388_B..> | 2023-08-08 20:09 | 27K | |
![[IMG]](/icons/image2.gif) | 610qk45vXxL._SX388_B..> | 2023-05-04 02:19 | 63K | |
![[IMG]](/icons/image2.gif) | 612ArRulQlL-100x100.jpg | 2023-08-08 06:42 | 3.5K | |
![[IMG]](/icons/image2.gif) | 612ArRulQlL-300x300.jpg | 2023-08-28 22:18 | 25K | |
![[IMG]](/icons/image2.gif) | 612ArRulQlL.jpg | 2023-05-04 01:53 | 66K | |
![[IMG]](/icons/image2.gif) | 612foeKzqpL._SX366_B..> | 2023-08-05 01:56 | 4.8K | |
![[IMG]](/icons/image2.gif) | 612foeKzqpL._SX366_B..> | 2023-09-19 02:11 | 30K | |
![[IMG]](/icons/image2.gif) | 612foeKzqpL._SX366_B..> | 2023-05-03 10:51 | 50K | |
![[IMG]](/icons/image2.gif) | 616nIFlrpCL._SX397_B..> | 2023-08-05 16:24 | 4.1K | |
![[IMG]](/icons/image2.gif) | 616nIFlrpCL._SX397_B..> | 2023-10-24 23:19 | 25K | |
![[IMG]](/icons/image2.gif) | 616nIFlrpCL._SX397_B..> | 2023-05-04 01:59 | 52K | |
![[IMG]](/icons/image2.gif) | 617fJE00RvL-100x100.jpg | 2023-08-05 01:14 | 4.1K | |
![[IMG]](/icons/image2.gif) | 617fJE00RvL-300x300.jpg | 2023-08-09 08:04 | 29K | |
![[IMG]](/icons/image2.gif) | 617fJE00RvL.jpg | 2023-05-04 01:49 | 65K | |
![[IMG]](/icons/image2.gif) | 618U88sxASL._SX389_B..> | 2023-08-05 02:46 | 4.8K | |
![[IMG]](/icons/image2.gif) | 618U88sxASL._SX389_B..> | 2023-08-13 23:04 | 31K | |
![[IMG]](/icons/image2.gif) | 618U88sxASL._SX389_B..> | 2023-05-03 10:54 | 59K | |
![[IMG]](/icons/image2.gif) | 618q8C98ENL._SY300_-..> | 2023-08-05 16:24 | 5.2K | |
![[IMG]](/icons/image2.gif) | 618q8C98ENL._SY300_.jpg | 2023-05-03 10:00 | 28K | |
![[IMG]](/icons/image2.gif) | 671-53da35692b0ee-10..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | 671-53da35692b0ee-30..> | 2023-08-12 04:49 | 16K | |
![[IMG]](/icons/image2.gif) | 671-53da35692b0ee.jpg | 2023-05-03 09:23 | 57K | |
![[IMG]](/icons/image2.gif) | 673-53da356b345d9-10..> | 2023-08-05 16:24 | 5.0K | |
![[IMG]](/icons/image2.gif) | 673-53da356b345d9-30..> | 2023-08-12 04:49 | 27K | |
![[IMG]](/icons/image2.gif) | 673-53da356b345d9.jpg | 2023-05-03 10:22 | 124K | |
![[IMG]](/icons/image2.gif) | 715rWnFno6L__11390.1..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 715rWnFno6L__11390.1..> | 2023-08-14 00:56 | 19K | |
![[IMG]](/icons/image2.gif) | 715rWnFno6L__11390.1..> | 2023-05-03 10:20 | 147K | |
![[ ]](/icons/compressed.gif) | 735.zip | 2023-05-03 09:51 | 75K | |
![[IMG]](/icons/image2.gif) | 759-53da35cd5b341-10..> | 2023-08-06 07:48 | 4.0K | |
![[IMG]](/icons/image2.gif) | 759-53da35cd5b341.jpg | 2023-05-04 02:14 | 51K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9-1-..> | 2023-08-06 05:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9-1-..> | 2023-08-06 13:11 | 21K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9-1.jpg | 2023-05-03 10:38 | 260K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9-10..> | 2023-08-05 01:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9-30..> | 2023-08-09 01:55 | 21K | |
![[IMG]](/icons/image2.gif) | 763-53da35d2870f9.jpg | 2023-05-03 11:16 | 260K | |
![[IMG]](/icons/image2.gif) | 809-53da360a0fe01-10..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | 809-53da360a0fe01.jpg | 2023-05-03 09:55 | 31K | |
![[IMG]](/icons/image2.gif) | 814-53da360f4ecd1-10..> | 2023-08-06 10:19 | 1.9K | |
![[IMG]](/icons/image2.gif) | 814-53da360f4ecd1-30..> | 2023-08-05 01:51 | 9.3K | |
![[IMG]](/icons/image2.gif) | 814-53da360f4ecd1.jpg | 2023-05-03 09:19 | 26K | |
![[IMG]](/icons/image2.gif) | 830-53da3620e4dcf-10..> | 2023-08-05 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | 830-53da3620e4dcf-30..> | 2023-08-05 03:41 | 23K | |
![[IMG]](/icons/image2.gif) | 830-53da3620e4dcf.jpg | 2023-05-03 10:40 | 262K | |
![[IMG]](/icons/image2.gif) | 902-53da3672d105e-10..> | 2023-08-06 03:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | 902-53da3672d105e.jpg | 2023-05-03 11:23 | 29K | |
![[IMG]](/icons/image2.gif) | 913MTwAjscL._AC_UL32..> | 2023-08-05 16:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | 913MTwAjscL._AC_UL32..> | 2023-05-04 01:55 | 21K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2162-6_Te..> | 2023-08-06 08:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2162-6_Te..> | 2023-08-19 04:14 | 14K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2162-6_Te..> | 2023-05-03 11:12 | 24K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2494-8_Te..> | 2023-08-05 02:47 | 9.9K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2494-8_Te..> | 2023-09-21 17:27 | 23K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2494-8_Te..> | 2023-05-04 02:28 | 37K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-2682-9.jpg | 2023-05-04 02:20 | 15K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-3920-1.jpg | 2023-05-04 02:21 | 15K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-4373-4.jpg | 2023-05-04 02:21 | 16K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-4451-9.jpg | 2023-05-04 02:20 | 13K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-4563-9.jpg | 2023-05-04 02:20 | 16K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-5850-9.jpg | 2023-05-04 02:20 | 14K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-5867-7.jpg | 2023-05-04 02:21 | 10K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-6083-0.jpg | 2023-05-04 02:22 | 17K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7645-9_Te..> | 2023-08-05 15:34 | 11K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7645-9_Te..> | 2023-09-05 13:56 | 31K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7645-9_Te..> | 2023-05-04 02:28 | 56K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7991-7_Te..> | 2023-08-05 05:30 | 9.6K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7991-7_Te..> | 2023-08-30 12:05 | 21K | |
![[IMG]](/icons/image2.gif) | 978-0-8036-7991-7_Te..> | 2023-05-03 10:53 | 33K | |
![[IMG]](/icons/image2.gif) | 978-0071339605-1-100..> | 2023-08-05 02:03 | 4.6K | |
![[IMG]](/icons/image2.gif) | 978-0071339605-1-300..> | 2023-08-24 02:13 | 24K | |
![[IMG]](/icons/image2.gif) | 978-0071339605-1.jpg | 2023-05-03 11:05 | 38K | |
![[IMG]](/icons/image2.gif) | 978-0071339605-100x1..> | 2023-08-05 06:25 | 4.6K | |
![[IMG]](/icons/image2.gif) | 978-0071339605-300x3..> | 2023-08-22 00:46 | 24K | |
![[IMG]](/icons/image2.gif) | 978-0071339605.jpg | 2023-05-03 11:04 | 38K | |
![[IMG]](/icons/image2.gif) | 978-0134301068-100x1..> | 2023-08-06 16:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 978-0134301068-300x3..> | 2023-08-09 13:45 | 19K | |
![[IMG]](/icons/image2.gif) | 978-0134301068.jpg | 2023-05-03 11:11 | 29K | |
![[IMG]](/icons/image2.gif) | 978-0134477596-100x1..> | 2023-08-05 09:32 | 4.2K | |
![[IMG]](/icons/image2.gif) | 978-0134477596-300x3..> | 2023-08-05 03:41 | 24K | |
![[IMG]](/icons/image2.gif) | 978-0134477596.jpg | 2023-05-03 11:14 | 40K | |
![[IMG]](/icons/image2.gif) | 978-0134806938-100x1..> | 2023-08-06 09:51 | 4.8K | |
![[IMG]](/icons/image2.gif) | 978-0134806938-300x3..> | 2023-08-12 04:50 | 34K | |
![[IMG]](/icons/image2.gif) | 978-0134806938.jpg | 2023-05-03 11:08 | 62K | |
![[IMG]](/icons/image2.gif) | 978-0134817446-100x1..> | 2023-08-05 02:47 | 5.0K | |
![[IMG]](/icons/image2.gif) | 978-0134817446-300x3..> | 2023-08-29 01:19 | 35K | |
![[IMG]](/icons/image2.gif) | 978-0134817446.jpg | 2023-05-03 11:13 | 66K | |
![[IMG]](/icons/image2.gif) | 978-0134894805-1-100..> | 2023-08-05 16:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | 978-0134894805-1.jpg | 2023-05-03 11:11 | 11K | |
![[IMG]](/icons/image2.gif) | 978-0134894805-100x1..> | 2023-08-08 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | 978-0134894805.jpg | 2023-05-03 11:10 | 11K | |
![[IMG]](/icons/image2.gif) | 978-0176583057-100x1..> | 2023-08-08 20:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | 978-0176583057-300x3..> | 2023-08-06 12:18 | 25K | |
![[IMG]](/icons/image2.gif) | 978-0176583057.jpg | 2023-05-03 11:11 | 40K | |
![[IMG]](/icons/image2.gif) | 978-0176591991-1-100..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 978-0176591991-1-300..> | 2023-08-18 13:55 | 20K | |
![[IMG]](/icons/image2.gif) | 978-0176591991-1.jpg | 2023-05-03 10:56 | 39K | |
![[IMG]](/icons/image2.gif) | 978-0176591991-100x1..> | 2023-08-08 22:01 | 3.3K | |
![[IMG]](/icons/image2.gif) | 978-0176591991-300x3..> | 2023-08-11 04:33 | 20K | |
![[IMG]](/icons/image2.gif) | 978-0176591991.jpg | 2023-05-03 10:55 | 39K | |
![[IMG]](/icons/image2.gif) | 978-0205859078-100x1..> | 2023-08-05 17:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | 978-0205859078-300x3..> | 2023-08-15 20:03 | 16K | |
![[IMG]](/icons/image2.gif) | 978-0205859078.jpg | 2023-05-03 11:12 | 25K | |
![[IMG]](/icons/image2.gif) | 978-0321910394-100x1..> | 2023-08-05 01:33 | 4.1K | |
![[IMG]](/icons/image2.gif) | 978-0321910394-300x3..> | 2023-08-11 12:04 | 24K | |
![[IMG]](/icons/image2.gif) | 978-0321910394.jpg | 2023-05-03 11:13 | 54K | |
![[ ]](/icons/layout.gif) | 978-0323484374-tspl-..> | 2023-05-04 02:01 | 263K | |
![[IMG]](/icons/image2.gif) | 978-1-118-91470-0-10..> | 2023-08-06 05:47 | 18K | |
![[IMG]](/icons/image2.gif) | 978-1-118-91470-0-30..> | 2023-09-27 19:58 | 36K | |
![[IMG]](/icons/image2.gif) | 978-1-118-91470-0.jpg | 2023-05-03 11:03 | 51K | |
![[IMG]](/icons/image2.gif) | 978-1111540913-100x1..> | 2023-08-05 16:28 | 4.1K | |
![[IMG]](/icons/image2.gif) | 978-1111540913-300x3..> | 2023-08-05 21:01 | 23K | |
![[IMG]](/icons/image2.gif) | 978-1111540913.jpg | 2023-05-03 11:13 | 40K | |
![[IMG]](/icons/image2.gif) | 978-1118476956-100x1..> | 2023-08-05 04:35 | 24K | |
![[IMG]](/icons/image2.gif) | 978-1118476956-300x3..> | 2023-08-22 00:46 | 60K | |
![[IMG]](/icons/image2.gif) | 978-1118476956.jpg | 2023-05-03 11:04 | 79K | |
![[IMG]](/icons/image2.gif) | 978-1118582794-100x1..> | 2023-08-05 02:55 | 3.2K | |
![[IMG]](/icons/image2.gif) | 978-1118582794-300x3..> | 2023-08-24 00:34 | 20K | |
![[IMG]](/icons/image2.gif) | 978-1118582794.jpg | 2023-05-03 11:06 | 32K | |
![[IMG]](/icons/image2.gif) | 978-1118849385-100x1..> | 2023-08-08 22:02 | 3.8K | |
![[IMG]](/icons/image2.gif) | 978-1118849385-300x3..> | 2023-08-28 17:05 | 25K | |
![[IMG]](/icons/image2.gif) | 978-1118849385.jpg | 2023-05-03 11:12 | 40K | |
![[IMG]](/icons/image2.gif) | 978-1119117827-100x1..> | 2023-08-05 04:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | 978-1119117827-300x3..> | 2023-09-15 06:43 | 23K | |
![[IMG]](/icons/image2.gif) | 978-1119117827.jpg | 2023-05-03 10:59 | 39K | |
![[IMG]](/icons/image2.gif) | 978-1119120841-100x1..> | 2023-08-05 16:26 | 17K | |
![[IMG]](/icons/image2.gif) | 978-1119120841-300x3..> | 2023-08-17 04:55 | 48K | |
![[IMG]](/icons/image2.gif) | 978-1119120841.jpg | 2023-05-03 11:12 | 63K | |
![[IMG]](/icons/image2.gif) | 978-1119186656-1-100..> | 2023-08-08 06:38 | 12K | |
![[IMG]](/icons/image2.gif) | 978-1119186656-1-300..> | 2023-08-14 14:13 | 34K | |
![[IMG]](/icons/image2.gif) | 978-1119186656-1.jpg | 2023-05-03 11:10 | 69K | |
![[IMG]](/icons/image2.gif) | 978-1119186656-100x1..> | 2023-08-05 04:35 | 12K | |
![[IMG]](/icons/image2.gif) | 978-1119186656-300x3..> | 2023-08-05 05:34 | 34K | |
![[IMG]](/icons/image2.gif) | 978-1119186656.jpg | 2023-05-03 11:10 | 69K | |
![[IMG]](/icons/image2.gif) | 978-1259464294-1-100..> | 2023-08-06 17:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 978-1259464294-1.jpg | 2023-05-03 11:07 | 9.8K | |
![[IMG]](/icons/image2.gif) | 978-1259464294-100x1..> | 2023-08-05 05:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | 978-1259464294.jpg | 2023-05-03 11:06 | 9.8K | |
![[IMG]](/icons/image2.gif) | 978-1259713736-100x1..> | 2023-08-07 07:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | 978-1259713736-300x3..> | 2023-08-06 11:19 | 21K | |
![[IMG]](/icons/image2.gif) | 978-1259713736.jpg | 2023-05-03 11:09 | 36K | |
![[IMG]](/icons/image2.gif) | 978-1259917059-1-100..> | 2023-08-05 15:33 | 3.9K | |
![[IMG]](/icons/image2.gif) | 978-1259917059-1-300..> | 2023-08-05 07:10 | 25K | |
![[IMG]](/icons/image2.gif) | 978-1259917059-1.jpg | 2023-05-03 10:57 | 41K | |
![[IMG]](/icons/image2.gif) | 978-1259917059-100x1..> | 2023-08-05 05:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | 978-1259917059-300x3..> | 2023-08-05 07:10 | 25K | |
![[IMG]](/icons/image2.gif) | 978-1259917059.jpg | 2023-05-03 10:56 | 41K | |
![[IMG]](/icons/image2.gif) | 978-1260258349-100x1..> | 2023-08-08 06:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | 978-1260258349-300x3..> | 2023-08-23 01:30 | 20K | |
![[IMG]](/icons/image2.gif) | 978-1260258349.jpg | 2023-05-03 11:03 | 36K | |
![[IMG]](/icons/image2.gif) | 978-1285090894-1-100..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | 978-1285090894-1-300..> | 2023-08-09 09:14 | 18K | |
![[IMG]](/icons/image2.gif) | 978-1285090894-1.jpg | 2023-05-03 11:06 | 29K | |
![[IMG]](/icons/image2.gif) | 978-1285090894-100x1..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | 978-1285090894-300x3..> | 2023-08-15 03:43 | 18K | |
![[IMG]](/icons/image2.gif) | 978-1285090894.jpg | 2023-05-03 11:05 | 29K | |
![[IMG]](/icons/image2.gif) | 978-1337408851-100x1..> | 2023-08-08 23:55 | 3.6K | |
![[IMG]](/icons/image2.gif) | 978-1337408851-300x3..> | 2023-09-14 17:47 | 17K | |
![[IMG]](/icons/image2.gif) | 978-1337408851.jpg | 2023-05-03 10:56 | 28K | |
![[IMG]](/icons/image2.gif) | 978-1337613316-100x1..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 978-1337613316-300x3..> | 2023-08-13 17:54 | 20K | |
![[IMG]](/icons/image2.gif) | 978-1337613316.jpg | 2023-05-03 11:14 | 34K | |
![[ ]](/icons/unknown.gif) | 978-1437734935-Chapt..> | 2023-05-03 11:02 | 63K | |
![[IMG]](/icons/image2.gif) | 978-1473722651-100x1..> | 2023-08-08 21:04 | 4.6K | |
![[IMG]](/icons/image2.gif) | 978-1473722651-300x3..> | 2023-08-22 20:06 | 24K | |
![[IMG]](/icons/image2.gif) | 978-1473722651.jpg | 2023-05-03 11:09 | 37K | |
![[IMG]](/icons/image2.gif) | 1009-53da36f333563-5..> | 2023-08-09 02:03 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1009-53da36f333563-5..> | 2023-08-14 15:10 | 19K | |
![[IMG]](/icons/image2.gif) | 1009-53da36f333563-5..> | 2023-05-03 09:22 | 73K | |
![[IMG]](/icons/image2.gif) | 1045-53da37184d7c7-1..> | 2023-08-05 15:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | 1045-53da37184d7c7-3..> | 2023-08-16 23:57 | 15K | |
![[IMG]](/icons/image2.gif) | 1045-53da37184d7c7.jpg | 2023-05-03 09:32 | 39K | |
![[IMG]](/icons/image2.gif) | 1062-53da372b9ce51-1..> | 2023-08-07 10:36 | 2.6K | |
![[IMG]](/icons/image2.gif) | 1062-53da372b9ce51.jpg | 2023-05-03 09:40 | 14K | |
![[IMG]](/icons/image2.gif) | 1095-53da375008d76-1..> | 2023-08-06 08:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | 1095-53da375008d76.jpg | 2023-05-03 11:25 | 29K | |
![[IMG]](/icons/image2.gif) | 1210.jpg | 2023-05-03 09:26 | 43K | |
![[IMG]](/icons/image2.gif) | 1211-53da37dad18c0-1..> | 2023-08-06 08:46 | 1.7K | |
![[IMG]](/icons/image2.gif) | 1211-53da37dad18c0-3..> | 2023-08-16 15:50 | 9.9K | |
![[IMG]](/icons/image2.gif) | 1211-53da37dad18c0.jpg | 2023-05-03 10:46 | 26K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e-1..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e-3..> | 2023-08-12 07:27 | 23K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e.jpg | 2023-05-03 10:15 | 99K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e1-..> | 2023-08-06 11:15 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e1-..> | 2023-08-05 17:23 | 23K | |
![[IMG]](/icons/image2.gif) | 1295-53da383ea030e1.jpg | 2023-05-03 10:16 | 99K | |
![[IMG]](/icons/image2.gif) | 1400-53da38bde500f-1..> | 2023-08-08 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1400-53da38bde500f.jpg | 2023-05-03 09:44 | 34K | |
![[IMG]](/icons/image2.gif) | 1411-53da38cad0767-1..> | 2023-08-05 17:23 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1411-53da38cad0767.jpg | 2023-05-03 09:50 | 30K | |
![[IMG]](/icons/image2.gif) | 1500-53da3933c17141-..> | 2023-08-05 19:19 | 3.9K | |
![[IMG]](/icons/image2.gif) | 1500-53da3933c17141-..> | 2023-08-18 04:17 | 20K | |
![[IMG]](/icons/image2.gif) | 1500-53da3933c17141.jpg | 2023-05-03 09:22 | 97K | |
![[IMG]](/icons/image2.gif) | 1529-53da39583fc65-1..> | 2023-08-06 16:00 | 2.4K | |
![[IMG]](/icons/image2.gif) | 1529-53da39583fc65-3..> | 2023-08-05 01:12 | 13K | |
![[IMG]](/icons/image2.gif) | 1529-53da39583fc65.jpg | 2023-05-03 09:01 | 28K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf-1..> | 2023-08-08 06:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf-3..> | 2023-08-22 20:06 | 20K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf.jpg | 2023-05-03 09:38 | 83K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf1-..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf1-..> | 2023-08-21 04:41 | 20K | |
![[IMG]](/icons/image2.gif) | 1562-53da397f8babf1.jpg | 2023-05-03 09:38 | 83K | |
![[IMG]](/icons/image2.gif) | 1653-53da3a0fe4e10-1..> | 2023-08-05 05:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | 1653-53da3a0fe4e10-3..> | 2023-08-14 21:32 | 12K | |
![[IMG]](/icons/image2.gif) | 1653-53da3a0fe4e10.jpg | 2023-05-03 09:40 | 99K | |
![[IMG]](/icons/image2.gif) | 1674-53da3a2a6bfe3-1..> | 2023-08-05 03:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | 1674-53da3a2a6bfe3-3..> | 2023-08-15 16:04 | 24K | |
![[IMG]](/icons/image2.gif) | 1674-53da3a2a6bfe3.jpg | 2023-05-03 10:25 | 189K | |
![[ ]](/icons/compressed.gif) | 1734.zip | 2023-05-03 10:50 | 106K | |
![[IMG]](/icons/image2.gif) | 1792-53da3bbe4de4d1-..> | 2023-08-05 02:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | 1792-53da3bbe4de4d1-..> | 2023-08-16 15:50 | 18K | |
![[IMG]](/icons/image2.gif) | 1792-53da3bbe4de4d1.jpg | 2023-05-03 09:36 | 64K | |
![[IMG]](/icons/image2.gif) | 1894-53da3f1951f6a-1..> | 2023-08-05 09:59 | 4.2K | |
![[IMG]](/icons/image2.gif) | 1894-53da3f1951f6a-3..> | 2023-09-18 04:50 | 23K | |
![[IMG]](/icons/image2.gif) | 1894-53da3f1951f6a.jpg | 2023-05-03 10:30 | 69K | |
![[ ]](/icons/unknown.gif) | 2012-Dosage-Calculat..> | 2023-05-03 09:11 | 251K | |
![[IMG]](/icons/image2.gif) | 2012_cch__08251.1405..> | 2023-05-03 09:27 | 20K | |
![[ ]](/icons/compressed.gif) | 2015-medical-surgica..> | 2023-05-03 10:01 | 9.1K | |
![[ ]](/icons/layout.gif) | 2019-HESI-EXIT-V2.pdf | 2023-05-04 02:12 | 255K | |
![[IMG]](/icons/image2.gif) | 2019-RN-Proctored-Co..> | 2023-08-06 23:14 | 10K | |
![[IMG]](/icons/image2.gif) | 2019-RN-Proctored-Co..> | 2023-08-14 09:10 | 21K | |
![[IMG]](/icons/image2.gif) | 2019-RN-Proctored-Co..> | 2023-05-04 02:11 | 40K | |
![[IMG]](/icons/image2.gif) | 2056-53da3feed901d-1..> | 2023-08-06 08:43 | 3.6K | |
![[IMG]](/icons/image2.gif) | 2056-53da3feed901d-3..> | 2023-09-20 09:04 | 19K | |
![[IMG]](/icons/image2.gif) | 2056-53da3feed901d.jpg | 2023-05-03 10:01 | 175K | |
![[IMG]](/icons/image2.gif) | 2132-53da415ceb3fb-1..> | 2023-08-06 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 2132-53da415ceb3fb-3..> | 2023-09-05 02:50 | 17K | |
![[IMG]](/icons/image2.gif) | 2132-53da415ceb3fb.jpg | 2023-05-03 10:33 | 91K | |
![[IMG]](/icons/image2.gif) | 2208-53da424cc91f8-1..> | 2023-08-05 15:29 | 5.4K | |
![[IMG]](/icons/image2.gif) | 2208-53da424cc91f8-3..> | 2023-08-08 06:27 | 38K | |
![[IMG]](/icons/image2.gif) | 2208-53da424cc91f8.jpg | 2023-05-03 09:54 | 188K | |
![[IMG]](/icons/image2.gif) | 2306-53da42bf6e0e5-1..> | 2023-08-05 15:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | 2306-53da42bf6e0e5-3..> | 2023-09-08 15:33 | 16K | |
![[IMG]](/icons/image2.gif) | 2306-53da42bf6e0e5.jpg | 2023-05-03 11:07 | 60K | |
![[IMG]](/icons/image2.gif) | 2332-53da42df7335f-1..> | 2023-08-05 06:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | 2332-53da42df7335f-3..> | 2023-08-25 22:45 | 20K | |
![[IMG]](/icons/image2.gif) | 2332-53da42df7335f.jpg | 2023-05-03 09:59 | 172K | |
![[IMG]](/icons/image2.gif) | 2363-7-100x100.jpg | 2023-08-09 00:59 | 3.1K | |
![[IMG]](/icons/image2.gif) | 2363-7-300x300.jpg | 2023-08-05 16:24 | 16K | |
![[IMG]](/icons/image2.gif) | 2363-7.jpg | 2023-05-03 09:33 | 37K | |
![[IMG]](/icons/image2.gif) | 2392-53da4387b40b4-1..> | 2023-08-06 04:15 | 5.1K | |
![[IMG]](/icons/image2.gif) | 2392-53da4387b40b4-3..> | 2023-09-04 21:53 | 28K | |
![[IMG]](/icons/image2.gif) | 2392-53da4387b40b4.jpg | 2023-05-03 10:23 | 131K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b-1..> | 2023-08-05 03:44 | 4.4K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b-3..> | 2023-08-09 02:52 | 27K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b.jpg | 2023-05-03 10:40 | 213K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b1-..> | 2023-08-05 14:40 | 4.4K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b1-..> | 2023-08-18 10:49 | 27K | |
![[IMG]](/icons/image2.gif) | 2422-53da43a90742b1.jpg | 2023-05-03 10:43 | 213K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f5-1..> | 2023-08-07 05:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f5-3..> | 2023-08-05 01:51 | 13K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f5.jpg | 2023-05-03 09:19 | 39K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f51-..> | 2023-08-05 02:08 | 3.0K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f51-..> | 2023-10-28 14:38 | 13K | |
![[IMG]](/icons/image2.gif) | 2447-53da43c6344f51.jpg | 2023-05-03 10:34 | 39K | |
![[IMG]](/icons/image2.gif) | 2492-53da43fc88210-1..> | 2023-08-06 08:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | 2492-53da43fc88210-3..> | 2023-08-11 04:33 | 20K | |
![[IMG]](/icons/image2.gif) | 2492-53da43fc88210.jpg | 2023-05-03 09:46 | 48K | |
![[IMG]](/icons/image2.gif) | 2511-53da4412b5ba6-1..> | 2023-08-06 03:28 | 4.3K | |
![[IMG]](/icons/image2.gif) | 2511-53da4412b5ba6-3..> | 2023-10-22 10:04 | 22K | |
![[IMG]](/icons/image2.gif) | 2511-53da4412b5ba6.jpg | 2023-05-03 10:22 | 110K | |
![[IMG]](/icons/image2.gif) | 2574-7-100x100.jpg | 2023-08-05 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | 2574-7-300x300.jpg | 2023-09-14 18:39 | 17K | |
![[IMG]](/icons/image2.gif) | 2574-7.jpg | 2023-05-03 10:33 | 44K | |
![[IMG]](/icons/image2.gif) | 2585-53da45f914512-1..> | 2023-08-08 01:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | 2585-53da45f914512-3..> | 2023-08-29 06:04 | 23K | |
![[IMG]](/icons/image2.gif) | 2585-53da45f914512.jpg | 2023-05-03 10:31 | 217K | |
![[IMG]](/icons/image2.gif) | 2637-53da463b81d2f1-..> | 2023-08-08 23:53 | 3.9K | |
![[IMG]](/icons/image2.gif) | 2637-53da463b81d2f1-..> | 2023-08-11 03:44 | 22K | |
![[IMG]](/icons/image2.gif) | 2637-53da463b81d2f1.jpg | 2023-05-03 09:43 | 166K | |
![[IMG]](/icons/image2.gif) | 2643-53da4644f0859-1..> | 2023-08-09 02:53 | 3.8K | |
![[IMG]](/icons/image2.gif) | 2643-53da4644f0859-3..> | 2023-08-06 05:40 | 18K | |
![[IMG]](/icons/image2.gif) | 2643-53da4644f0859.jpg | 2023-05-03 10:38 | 150K | |
![[IMG]](/icons/image2.gif) | 2687-53da46f251427-1..> | 2023-08-05 03:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | 2687-53da46f251427-3..> | 2023-08-15 03:43 | 19K | |
![[IMG]](/icons/image2.gif) | 2687-53da46f251427.jpg | 2023-05-03 10:25 | 94K | |
![[ ]](/icons/compressed.gif) | 2777.zip | 2023-05-03 09:33 | 22K | |
![[IMG]](/icons/image2.gif) | 2808-53da47ec02722-1..> | 2023-08-05 01:09 | 2.6K | |
![[IMG]](/icons/image2.gif) | 2808-53da47ec02722-3..> | 2023-09-08 14:47 | 12K | |
![[IMG]](/icons/image2.gif) | 2808-53da47ec02722.jpg | 2023-05-03 09:23 | 52K | |
![[IMG]](/icons/image2.gif) | 2831-53da4806e7df1-1..> | 2023-08-05 05:30 | 2.3K | |
![[IMG]](/icons/image2.gif) | 2831-53da4806e7df1-3..> | 2023-09-30 10:49 | 11K | |
![[IMG]](/icons/image2.gif) | 2831-53da4806e7df1.jpg | 2023-05-03 11:20 | 45K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d4-1..> | 2023-08-05 04:35 | 5.0K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d4-3..> | 2023-08-23 02:15 | 28K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d4.jpg | 2023-05-03 09:59 | 125K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d41-..> | 2023-08-05 06:25 | 5.0K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d41-..> | 2023-08-09 12:49 | 28K | |
![[IMG]](/icons/image2.gif) | 2844-53da4816315d41.jpg | 2023-05-03 09:51 | 125K | |
![[IMG]](/icons/image2.gif) | 2845-53da481786a16-1..> | 2023-08-06 05:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | 2845-53da481786a16-3..> | 2023-08-09 18:40 | 23K | |
![[IMG]](/icons/image2.gif) | 2845-53da481786a16.jpg | 2023-05-03 10:23 | 101K | |
![[IMG]](/icons/image2.gif) | 2862-53da482c9ae59-1..> | 2023-08-05 14:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | 2862-53da482c9ae59-3..> | 2023-08-06 13:12 | 18K | |
![[IMG]](/icons/image2.gif) | 2862-53da482c9ae59.jpg | 2023-05-03 10:42 | 84K | |
![[IMG]](/icons/image2.gif) | 3134-100x100.jpg | 2023-08-05 01:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | 3134-300x300.jpg | 2023-08-05 15:27 | 15K | |
![[IMG]](/icons/image2.gif) | 3134.jpg | 2023-05-03 09:53 | 77K | |
![[IMG]](/icons/image2.gif) | 3663-7-100x100.jpg | 2023-08-06 07:46 | 5.4K | |
![[IMG]](/icons/image2.gif) | 3663-7-300x300.jpg | 2023-08-17 04:49 | 29K | |
![[IMG]](/icons/image2.gif) | 3663-7.jpg | 2023-05-03 09:51 | 66K | |
![[IMG]](/icons/image2.gif) | 3718-4-100x100.jpg | 2023-08-05 03:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | 3718-4-300x300.jpg | 2023-08-08 12:39 | 19K | |
![[IMG]](/icons/image2.gif) | 3718-4.jpg | 2023-05-03 10:14 | 35K | |
![[IMG]](/icons/image2.gif) | 3972-0-100x100.jpg | 2023-08-06 07:48 | 4.1K | |
![[IMG]](/icons/image2.gif) | 3972-0-300x300.jpg | 2023-08-06 13:11 | 21K | |
![[IMG]](/icons/image2.gif) | 3972-0.jpg | 2023-05-03 09:59 | 42K | |
![[IMG]](/icons/image2.gif) | 4120jkXtvQL._SX258_B..> | 2023-08-05 01:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | 4120jkXtvQL._SX258_B..> | 2023-05-04 01:59 | 18K | |
![[IMG]](/icons/image2.gif) | 4381-100x100.jpg | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 4381-300x300.jpg | 2023-09-02 05:06 | 16K | |
![[IMG]](/icons/image2.gif) | 4381.jpg | 2023-05-03 10:11 | 67K | |
![[IMG]](/icons/image2.gif) | 4847-54af9514d27e9-1..> | 2023-08-05 15:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | 4847-54af9514d27e9-3..> | 2023-09-14 19:34 | 16K | |
![[IMG]](/icons/image2.gif) | 4847-54af9514d27e9.jpeg | 2023-05-03 10:38 | 35K | |
![[IMG]](/icons/image2.gif) | 5113PL5jotL._SY344_B..> | 2023-08-05 18:14 | 4.4K | |
![[IMG]](/icons/image2.gif) | 5113PL5jotL._SY344_B..> | 2023-05-04 02:00 | 27K | |
![[IMG]](/icons/image2.gif) | 5113bPlgxOL._SY300_-..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | 5113bPlgxOL._SY300_.jpg | 2023-05-03 10:07 | 15K | |
![[IMG]](/icons/image2.gif) | 5128VO54vhL._SX258_B..> | 2023-08-06 13:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | 5128VO54vhL._SX258_B..> | 2023-05-03 11:01 | 21K | |
![[IMG]](/icons/image2.gif) | 5146X75RWML._SX381_B..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | 5146X75RWML._SX381_B..> | 2023-08-29 01:19 | 18K | |
![[IMG]](/icons/image2.gif) | 5146X75RWML._SX381_B..> | 2023-05-04 02:22 | 31K | |
![[IMG]](/icons/image2.gif) | 5151mBgTpjL._SX412_B..> | 2023-08-08 05:02 | 2.8K | |
![[IMG]](/icons/image2.gif) | 5151mBgTpjL._SX412_B..> | 2023-08-06 11:19 | 15K | |
![[IMG]](/icons/image2.gif) | 5151mBgTpjL._SX412_B..> | 2023-05-04 02:11 | 26K | |
![[IMG]](/icons/image2.gif) | 5161PjknOpL._SX398_B..> | 2023-08-05 02:46 | 4.5K | |
![[IMG]](/icons/image2.gif) | 5161PjknOpL._SX398_B..> | 2023-09-14 19:34 | 27K | |
![[IMG]](/icons/image2.gif) | 5161PjknOpL._SX398_B..> | 2023-05-04 02:18 | 45K | |
![[ ]](/icons/unknown.gif) | 9690-0131478648_im4.doc | 2023-05-03 09:51 | 695K | |
![[ ]](/icons/layout.gif) | 13515_Ch01_SM_lr_001..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 41806bGoroL._SY300_-..> | 2023-08-05 03:40 | 1.7K | |
![[IMG]](/icons/image2.gif) | 41806bGoroL._SY300_.jpg | 2023-05-03 10:43 | 10K | |
![[ ]](/icons/unknown.gif) | 42347_01tb.doc | 2023-05-03 09:36 | 49K | |
![[ ]](/icons/layout.gif) | 44086-Chapter-1.pdf | 2023-05-04 02:20 | 139K | |
![[ ]](/icons/layout.gif) | 52585-c1s1sol.pdf | 2023-05-03 10:22 | 97K | |
![[ ]](/icons/compressed.gif) | 53468.zip | 2023-05-03 09:24 | 0 | |
![[ ]](/icons/layout.gif) | 67104-Chapter01.pdf | 2023-05-04 02:12 | 182K | |
![[ ]](/icons/compressed.gif) | 73479-0135132037_ISM..> | 2023-05-03 09:31 | 111K | |
![[IMG]](/icons/image2.gif) | 75429_m.jpg | 2023-05-04 01:48 | 20K | |
![[ ]](/icons/unknown.gif) | 91322_01bookans.docx | 2023-05-03 10:21 | 14K | |
![[ ]](/icons/unknown.gif) | 91346_01tb.doc | 2023-05-03 10:48 | 52K | |
![[ ]](/icons/compressed.gif) | 91346_02cqa.zip | 2023-05-03 10:22 | 21K | |
![[ ]](/icons/unknown.gif) | 92336_02tb.doc | 2023-05-03 09:25 | 84K | |
![[IMG]](/icons/image2.gif) | 93173_m.jpg | 2023-05-04 01:48 | 18K | |
![[ ]](/icons/layout.gif) | 94659-chap14_solns.pdf | 2023-05-03 09:44 | 111K | |
![[ ]](/icons/unknown.gif) | 99533_01t.docx | 2023-05-03 10:16 | 29K | |
![[IMG]](/icons/image2.gif) | 170877_m.jpg | 2023-05-03 10:26 | 21K | |
![[ ]](/icons/compressed.gif) | 186451_02_018-047_Ma..> | 2023-05-03 09:28 | 1.3M | |
![[IMG]](/icons/image2.gif) | 233465_m.jpg | 2023-05-04 02:13 | 20K | |
![[IMG]](/icons/image2.gif) | 303649_m.jpg | 2023-05-04 02:19 | 13K | |
![[IMG]](/icons/image2.gif) | 393403-100x100.jpg | 2023-08-06 11:59 | 3.0K | |
![[IMG]](/icons/image2.gif) | 393403.jpg | 2023-05-04 01:48 | 4.9K | |
![[IMG]](/icons/image2.gif) | 414911_m.jpg | 2023-05-03 10:19 | 20K | |
![[IMG]](/icons/image2.gif) | 619396-100x100.jpg | 2023-08-05 17:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | 619396.jpg | 2023-05-03 11:20 | 21K | |
![[IMG]](/icons/image2.gif) | 652653_m.jpg | 2023-05-03 10:16 | 14K | |
![[IMG]](/icons/image2.gif) | 838141_m.jpg | 2023-05-03 10:48 | 16K | |
![[IMG]](/icons/image2.gif) | 871037_m.jpg | 2023-05-04 02:12 | 21K | |
![[IMG]](/icons/image2.gif) | 889434_m.jpg | 2023-05-03 09:21 | 15K | |
![[IMG]](/icons/image2.gif) | 949683_m.jpg | 2023-05-04 01:55 | 18K | |
![[IMG]](/icons/image2.gif) | 955186_m.jpg | 2023-05-03 09:52 | 13K | |
![[ ]](/icons/compressed.gif) | 975115_TBxx_CH02.zip | 2023-05-03 10:23 | 8.7K | |
![[IMG]](/icons/image2.gif) | 998861_m.jpg | 2023-05-03 10:06 | 14K | |
![[IMG]](/icons/image2.gif) | 1018919_m.jpg | 2023-05-03 10:41 | 16K | |
![[IMG]](/icons/image2.gif) | 1167824_m.jpg | 2023-05-04 02:11 | 20K | |
![[IMG]](/icons/image2.gif) | 1415153_m.jpg | 2023-05-03 10:30 | 19K | |
![[IMG]](/icons/image2.gif) | 1421485_m.jpg | 2023-05-03 09:28 | 23K | |
![[IMG]](/icons/image2.gif) | 1571607_m.jpg | 2023-05-03 09:52 | 18K | |
![[IMG]](/icons/image2.gif) | 1746441_m.jpg | 2023-05-03 09:47 | 17K | |
![[IMG]](/icons/image2.gif) | 3301557_m.jpg | 2023-05-04 01:53 | 14K | |
![[IMG]](/icons/image2.gif) | 3538169_m.jpg | 2023-05-03 10:47 | 7.1K | |
![[IMG]](/icons/image2.gif) | 3587543_m.jpg | 2023-05-04 02:27 | 9.2K | |
![[IMG]](/icons/image2.gif) | 3692273_m1.jpg | 2023-05-03 10:01 | 7.1K | |
![[IMG]](/icons/image2.gif) | 3876680_m.jpg | 2023-05-03 10:13 | 7.2K | |
![[IMG]](/icons/image2.gif) | 10345446_1409021111_..> | 2023-08-05 16:20 | 3.1K | |
![[IMG]](/icons/image2.gif) | 10345446_1409021111_..> | 2023-05-04 02:16 | 15K | |
![[ ]](/icons/compressed.gif) | 26617779_M01_TIMB185..> | 2023-05-03 09:53 | 22K | |
![[ ]](/icons/unknown.gif) | 111134650X_309973.doc | 2023-05-03 10:11 | 76K | |
![[IMG]](/icons/image2.gif) | 111827363X_TB-100x10..> | 2023-08-05 15:26 | 36K | |
![[IMG]](/icons/image2.gif) | 111827363X_TB-300x30..> | 2023-08-20 21:48 | 65K | |
![[IMG]](/icons/image2.gif) | 111827363X_TB.jpg | 2023-05-04 02:19 | 76K | |
![[IMG]](/icons/image2.gif) | 111950368X-1-100x100..> | 2023-08-05 01:08 | 15K | |
![[IMG]](/icons/image2.gif) | 111950368X-1-300x300..> | 2023-08-06 13:11 | 53K | |
![[IMG]](/icons/image2.gif) | 111950368X-1.jpg | 2023-05-04 02:07 | 78K | |
![[IMG]](/icons/image2.gif) | 111950368X-100x100.jpg | 2023-08-05 14:38 | 15K | |
![[IMG]](/icons/image2.gif) | 111950368X-300x300.jpg | 2023-08-11 14:00 | 53K | |
![[IMG]](/icons/image2.gif) | 111950368X.jpg | 2023-05-03 11:08 | 78K | |
![[ ]](/icons/unknown.gif) | 113394762X_391586.doc | 2023-05-03 09:35 | 262K | |
![[IMG]](/icons/image2.gif) | 125972266X_SolutionM..> | 2023-08-05 19:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | 125972266X_SolutionM..> | 2023-08-06 13:11 | 19K | |
![[IMG]](/icons/image2.gif) | 125972266X_SolutionM..> | 2023-05-04 02:02 | 21K | |
![[IMG]](/icons/image2.gif) | 125972266X_TestBank-..> | 2023-08-06 07:48 | 3.7K | |
![[IMG]](/icons/image2.gif) | 125972266X_TestBank-..> | 2023-08-11 14:00 | 19K | |
![[IMG]](/icons/image2.gif) | 125972266X_TestBank...> | 2023-05-04 02:02 | 21K | |
![[ ]](/icons/layout.gif) | 130509476X-spl.pdf | 2023-05-03 13:42 | 269K | |
![[ ]](/icons/layout.gif) | 148333354X-spl.pdf | 2023-05-03 13:41 | 273K | |
![[ ]](/icons/compressed.gif) | 517391827-health-ass..> | 2023-05-03 09:22 | 21K | |
![[ ]](/icons/layout.gif) | 1111308675_343356.pdf | 2023-05-03 13:44 | 491K | |
![[ ]](/icons/unknown.gif) | 1111341877_263279.doc | 2023-05-03 10:49 | 46K | |
![[ ]](/icons/layout.gif) | 1111532877-tspl.pdf | 2023-05-03 13:42 | 251K | |
![[ ]](/icons/unknown.gif) | 1111532877_308201.docx | 2023-05-04 02:18 | 45K | |
![[IMG]](/icons/image2.gif) | 1111830010-100x100.jpg | 2023-08-05 14:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1111830010.jpg | 2023-05-03 11:01 | 15K | |
![[ ]](/icons/compressed.gif) | 1111830991_318279.zip | 2023-05-03 09:25 | 18K | |
![[ ]](/icons/compressed.gif) | 1118063333_SolutionM..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 1118279018_SolutionM..> | 2023-08-08 08:37 | 14K | |
![[IMG]](/icons/image2.gif) | 1118279018_SolutionM..> | 2023-08-25 19:27 | 31K | |
![[IMG]](/icons/image2.gif) | 1118279018_SolutionM..> | 2023-05-04 02:03 | 44K | |
![[IMG]](/icons/image2.gif) | 1118345002_TB-100x10..> | 2023-08-06 13:11 | 16K | |
![[IMG]](/icons/image2.gif) | 1118345002_TB-300x30..> | 2023-10-29 09:09 | 41K | |
![[IMG]](/icons/image2.gif) | 1118345002_TB.jpg | 2023-05-04 02:16 | 50K | |
![[IMG]](/icons/image2.gif) | 1118425200-100x100.jpg | 2023-08-08 14:33 | 3.0K | |
![[IMG]](/icons/image2.gif) | 1118425200.jpg | 2023-05-03 09:48 | 12K | |
![[IMG]](/icons/image2.gif) | 1118582675-100x100.jpg | 2023-08-08 07:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | 1118582675.jpg | 2023-05-03 10:07 | 15K | |
![[IMG]](/icons/image2.gif) | 1118640047_SM-100x10..> | 2023-08-06 07:46 | 19K | |
![[IMG]](/icons/image2.gif) | 1118640047_SM-300x30..> | 2023-08-16 15:50 | 44K | |
![[IMG]](/icons/image2.gif) | 1118640047_SM.jpg | 2023-05-04 02:02 | 58K | |
![[IMG]](/icons/image2.gif) | 1118642066_SolutionM..> | 2023-08-08 23:54 | 4.9K | |
![[IMG]](/icons/image2.gif) | 1118642066_SolutionM..> | 2023-08-22 23:45 | 27K | |
![[IMG]](/icons/image2.gif) | 1118642066_SolutionM..> | 2023-05-04 01:56 | 35K | |
![[ ]](/icons/compressed.gif) | 1118642066_SolutionM..> | 2023-05-04 01:56 | 81K | |
![[IMG]](/icons/image2.gif) | 1118805119-1-100x100..> | 2023-08-06 08:45 | 22K | |
![[IMG]](/icons/image2.gif) | 1118805119-1-300x300..> | 2023-09-15 06:47 | 49K | |
![[IMG]](/icons/image2.gif) | 1118805119-1.jpg | 2023-05-03 10:35 | 65K | |
![[IMG]](/icons/image2.gif) | 1118805119-100x100.jpg | 2023-08-08 14:34 | 22K | |
![[IMG]](/icons/image2.gif) | 1118805119-300x300.jpg | 2023-08-12 04:50 | 49K | |
![[IMG]](/icons/image2.gif) | 1118805119.jpg | 2023-05-03 09:34 | 65K | |
![[ ]](/icons/unknown.gif) | 1118808843_TestBank_..> | 2023-05-03 13:40 | 0 | |
![[IMG]](/icons/image2.gif) | 1118875826_TestBank-..> | 2023-08-05 01:52 | 14K | |
![[IMG]](/icons/image2.gif) | 1118875826_TestBank-..> | 2023-08-09 02:53 | 34K | |
![[IMG]](/icons/image2.gif) | 1118875826_TestBank.jpg | 2023-05-04 02:03 | 44K | |
![[IMG]](/icons/image2.gif) | 1118890868_TestBank-..> | 2023-08-08 15:43 | 9.7K | |
![[IMG]](/icons/image2.gif) | 1118890868_TestBank-..> | 2023-08-05 04:37 | 30K | |
![[IMG]](/icons/image2.gif) | 1118890868_TestBank.jpg | 2023-05-04 02:18 | 47K | |
![[ ]](/icons/unknown.gif) | 1118890868_TestBank_..> | 2023-05-04 02:18 | 61K | |
![[ ]](/icons/layout.gif) | 1119048508-tspl.pdf | 2023-05-03 13:41 | 437K | |
![[IMG]](/icons/image2.gif) | 1119373204-1-100x100..> | 2023-08-06 04:36 | 12K | |
![[IMG]](/icons/image2.gif) | 1119373204-1-300x300..> | 2023-08-19 20:58 | 29K | |
![[IMG]](/icons/image2.gif) | 1119373204-1.jpg | 2023-05-04 02:04 | 42K | |
![[IMG]](/icons/image2.gif) | 1119373204-100x100.jpg | 2023-08-05 06:24 | 12K | |
![[IMG]](/icons/image2.gif) | 1119373204-300x300.jpg | 2023-08-18 10:03 | 29K | |
![[IMG]](/icons/image2.gif) | 1119373204.jpg | 2023-05-03 11:04 | 42K | |
![[IMG]](/icons/image2.gif) | 1119385628-1-100x100..> | 2023-08-05 17:17 | 3.2K | |
![[IMG]](/icons/image2.gif) | 1119385628-1-300x300..> | 2023-10-28 18:36 | 18K | |
![[IMG]](/icons/image2.gif) | 1119385628-1.jpg | 2023-05-04 01:47 | 31K | |
![[ ]](/icons/layout.gif) | 1119385628-tspl.pdf | 2023-05-04 01:47 | 110K | |
![[IMG]](/icons/image2.gif) | 1133104681-100x100.jpg | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | 1133104681.jpg | 2023-05-03 10:39 | 15K | |
![[ ]](/icons/layout.gif) | 1133106021_317922.pdf | 2023-05-04 01:52 | 141K | |
![[IMG]](/icons/image2.gif) | 1133435211-100x100.jpg | 2023-08-05 04:35 | 18K | |
![[IMG]](/icons/image2.gif) | 1133435211-300x300.jpg | 2023-08-12 08:35 | 42K | |
![[IMG]](/icons/image2.gif) | 1133435211.jpg | 2023-05-03 09:47 | 53K | |
![[ ]](/icons/unknown.gif) | 1133612318_418757.docx | 2023-05-03 13:44 | 56K | |
![[ ]](/icons/layout.gif) | 1259030776-spl.pdf | 2023-05-03 13:41 | 200K | |
![[ ]](/icons/layout.gif) | 1259030806-spl.pdf | 2023-05-03 13:41 | 314K | |
![[IMG]](/icons/image2.gif) | 1259103587-100x100.jpg | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | 1259103587.jpg | 2023-05-03 11:12 | 6.6K | |
![[IMG]](/icons/image2.gif) | 1259277178_Test-Bank..> | 2023-08-06 05:44 | 2.2K | |
![[IMG]](/icons/image2.gif) | 1259277178_Test-Bank..> | 2023-05-04 02:17 | 6.7K | |
![[ ]](/icons/layout.gif) | 1259420477-spl.pdf | 2023-05-03 13:41 | 858K | |
![[ ]](/icons/layout.gif) | 1259543471-spl.pdf | 2023-05-03 13:42 | 178K | |
![[ ]](/icons/layout.gif) | 1259544303-spl.pdf | 2023-05-03 13:41 | 500K | |
![[IMG]](/icons/image2.gif) | 1259654885-100x100.jpg | 2023-08-05 04:34 | 4.6K | |
![[IMG]](/icons/image2.gif) | 1259654885.jpg | 2023-05-03 11:15 | 10K | |
![[ ]](/icons/layout.gif) | 1259667472-spl.pdf | 2023-05-03 13:41 | 359K | |
![[IMG]](/icons/image2.gif) | 1259709965-1-100x100..> | 2023-08-06 12:18 | 4.4K | |
![[IMG]](/icons/image2.gif) | 1259709965-1-300x300..> | 2023-08-09 12:13 | 23K | |
![[IMG]](/icons/image2.gif) | 1259709965-1.jpeg | 2023-05-04 01:54 | 27K | |
![[IMG]](/icons/image2.gif) | 1259747980-100x100.jpeg | 2023-08-06 13:07 | 2.8K | |
![[IMG]](/icons/image2.gif) | 1259747980-300x300.jpeg | 2023-08-05 03:41 | 17K | |
![[IMG]](/icons/image2.gif) | 1259747980.jpeg | 2023-05-04 02:02 | 20K | |
![[IMG]](/icons/image2.gif) | 1259844714-1-100x100..> | 2023-08-06 10:19 | 4.2K | |
![[IMG]](/icons/image2.gif) | 1259844714-1-300x300..> | 2023-08-06 07:49 | 24K | |
![[IMG]](/icons/image2.gif) | 1259844714-1.jpeg | 2023-05-04 02:21 | 26K | |
![[IMG]](/icons/image2.gif) | 1259911144_SolutionM..> | 2023-08-05 17:19 | 3.5K | |
![[IMG]](/icons/image2.gif) | 1259911144_SolutionM..> | 2023-08-05 14:40 | 19K | |
![[IMG]](/icons/image2.gif) | 1259911144_SolutionM..> | 2023-05-04 02:25 | 22K | |
![[IMG]](/icons/image2.gif) | 1259918181-100x100.jpeg | 2023-08-05 01:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | 1259918181-300x300.jpeg | 2023-09-16 22:35 | 26K | |
![[IMG]](/icons/image2.gif) | 1259918181.jpeg | 2023-05-04 02:02 | 30K | |
![[IMG]](/icons/image2.gif) | 1259929647-1-100x100..> | 2023-08-06 07:45 | 6.2K | |
![[IMG]](/icons/image2.gif) | 1259929647-1-300x300..> | 2023-08-05 04:35 | 40K | |
![[IMG]](/icons/image2.gif) | 1259929647-1.jpeg | 2023-05-04 01:55 | 49K | |
![[IMG]](/icons/image2.gif) | 1259929655-1-100x100..> | 2023-08-05 01:12 | 4.6K | |
![[IMG]](/icons/image2.gif) | 1259929655-1-300x300..> | 2023-08-12 14:44 | 31K | |
![[IMG]](/icons/image2.gif) | 1259929655-1.jpeg | 2023-05-04 02:03 | 39K | |
![[IMG]](/icons/image2.gif) | 1259969614-1-100x100..> | 2023-08-05 14:34 | 5.0K | |
![[IMG]](/icons/image2.gif) | 1259969614-1.jpeg | 2023-05-04 02:10 | 24K | |
![[IMG]](/icons/image2.gif) | 1259969614-100x100.jpeg | 2023-08-05 15:43 | 5.0K | |
![[IMG]](/icons/image2.gif) | 1259969614.jpeg | 2023-05-04 02:09 | 24K | |
![[IMG]](/icons/image2.gif) | 1260013928-1-100x100..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | 1260013928-1-300x300..> | 2023-08-17 10:32 | 13K | |
![[IMG]](/icons/image2.gif) | 1260013928-1.jpeg | 2023-05-04 01:58 | 15K | |
![[IMG]](/icons/image2.gif) | 1260013928-100x100.jpeg | 2023-08-05 16:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | 1260013928-300x300.jpeg | 2023-08-30 14:11 | 13K | |
![[IMG]](/icons/image2.gif) | 1260013928.jpeg | 2023-05-04 01:58 | 15K | |
![[IMG]](/icons/image2.gif) | 1260148955-100x100.jpeg | 2023-08-05 14:39 | 5.1K | |
![[IMG]](/icons/image2.gif) | 1260148955-300x300.jpeg | 2023-08-09 02:53 | 38K | |
![[IMG]](/icons/image2.gif) | 1260148955.jpeg | 2023-05-04 02:12 | 45K | |
![[IMG]](/icons/image2.gif) | 1260231704-1-100x100..> | 2023-08-06 13:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1260231704-1-300x300..> | 2023-08-08 06:43 | 18K | |
![[IMG]](/icons/image2.gif) | 1260231704-1.jpeg | 2023-05-04 02:28 | 22K | |
![[IMG]](/icons/image2.gif) | 1260239519-100x100.jpeg | 2023-08-06 10:20 | 3.7K | |
![[IMG]](/icons/image2.gif) | 1260239519-300x300.jpeg | 2023-08-17 10:32 | 26K | |
![[IMG]](/icons/image2.gif) | 1260239519.jpeg | 2023-05-04 02:22 | 29K | |
![[IMG]](/icons/image2.gif) | 1260258971-100x100.jpeg | 2023-08-06 04:11 | 5.6K | |
![[IMG]](/icons/image2.gif) | 1260258971-300x300.jpeg | 2023-08-20 20:08 | 34K | |
![[IMG]](/icons/image2.gif) | 1260258971.jpeg | 2023-05-04 02:06 | 43K | |
![[IMG]](/icons/image2.gif) | 1260433099-1-100x100..> | 2023-08-06 09:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | 1260433099-1.jpeg | 2023-05-04 02:09 | 20K | |
![[IMG]](/icons/image2.gif) | 1260433099-100x100.jpeg | 2023-08-08 06:39 | 4.3K | |
![[IMG]](/icons/image2.gif) | 1260433099.jpeg | 2023-05-04 02:08 | 20K | |
![[IMG]](/icons/image2.gif) | 1260433110-100x100.jpeg | 2023-08-06 14:39 | 4.5K | |
![[IMG]](/icons/image2.gif) | 1260433110.jpeg | 2023-05-04 02:07 | 23K | |
![[IMG]](/icons/image2.gif) | 1260500233-1-100x100..> | 2023-08-05 17:23 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1260500233-1-300x300..> | 2023-08-12 04:50 | 16K | |
![[IMG]](/icons/image2.gif) | 1260500233-1.jpeg | 2023-05-04 02:26 | 19K | |
![[IMG]](/icons/image2.gif) | 1260500233-100x100.jpeg | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 1260500233-300x300.jpeg | 2023-09-03 21:18 | 16K | |
![[IMG]](/icons/image2.gif) | 1260500233.jpeg | 2023-05-04 02:27 | 19K | |
![[ ]](/icons/unknown.gif) | 1284076024_TestBank_..> | 2023-05-04 02:25 | 14K | |
![[ ]](/icons/layout.gif) | 1285448049_442902.pdf | 2023-05-04 01:55 | 93K | |
![[ ]](/icons/layout.gif) | 1285448383_437397.pdf | 2023-05-03 11:17 | 85K | |
![[ ]](/icons/layout.gif) | 1285458141-tspl.pdf | 2023-05-03 13:40 | 182K | |
![[ ]](/icons/unknown.gif) | 1285866371_453816.docx | 2023-05-03 11:19 | 41K | |
![[IMG]](/icons/image2.gif) | 1292002557-100x100.jpg | 2023-08-05 04:17 | 4.1K | |
![[IMG]](/icons/image2.gif) | 1292002557-300x300.jpg | 2023-08-12 04:50 | 23K | |
![[IMG]](/icons/image2.gif) | 1292002557.jpg | 2023-05-03 10:41 | 115K | |
![[IMG]](/icons/image2.gif) | 1292057211_TestBank-..> | 2023-08-06 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 1292057211_TestBank-..> | 2023-08-06 11:19 | 19K | |
![[IMG]](/icons/image2.gif) | 1292057211_TestBank.jpg | 2023-05-04 02:13 | 103K | |
![[ ]](/icons/unknown.gif) | 1292057211_TestBank_..> | 2023-05-04 02:13 | 0 | |
![[ ]](/icons/unknown.gif) | 1305091876_449348.docx | 2023-05-04 02:07 | 474K | |
![[ ]](/icons/unknown.gif) | 1305263529_462622.docx | 2023-05-03 09:36 | 36K | |
![[ ]](/icons/layout.gif) | 1305506383-spl.pdf | 2023-05-03 13:42 | 62K | |
![[IMG]](/icons/image2.gif) | 1305635930-100x100.jpg | 2023-08-06 08:33 | 17K | |
![[IMG]](/icons/image2.gif) | 1305635930-300x300.jpg | 2023-08-08 14:34 | 39K | |
![[IMG]](/icons/image2.gif) | 1305635930.jpg | 2023-05-03 10:12 | 59K | |
![[ ]](/icons/unknown.gif) | 1305645790_525951.docx | 2023-05-03 11:06 | 33K | |
![[ ]](/icons/unknown.gif) | 1337386499_602193.docx | 2023-05-03 10:52 | 32K | |
![[ ]](/icons/compressed.gif) | 1337397075_605761-1.zip | 2023-05-03 10:50 | 57K | |
![[ ]](/icons/compressed.gif) | 1337552127_580272.zip | 2023-05-03 13:42 | 25K | |
![[ ]](/icons/layout.gif) | 1337788287_624402.pdf | 2023-05-03 13:41 | 267K | |
![[ ]](/icons/layout.gif) | 1429234148-tspl.pdf | 2023-05-03 14:07 | 168K | |
![[IMG]](/icons/image2.gif) | 1451187904-100x100.jpg | 2023-08-08 14:32 | 2.9K | |
![[IMG]](/icons/image2.gif) | 1451187904.jpg | 2023-05-03 10:44 | 6.8K | |
![[ ]](/icons/layout.gif) | 1452276595-tspl.pdf | 2023-05-03 13:41 | 267K | |
![[IMG]](/icons/image2.gif) | 1455703702-100x100.jpg | 2023-08-08 15:05 | 3.4K | |
![[IMG]](/icons/image2.gif) | 1455703702.jpg | 2023-05-03 11:20 | 19K | |
![[ ]](/icons/layout.gif) | 1455726133-tspl.pdf | 2023-05-03 14:05 | 26K | |
![[IMG]](/icons/image2.gif) | 1464110700-100x100.jpg | 2023-08-08 22:58 | 3.5K | |
![[IMG]](/icons/image2.gif) | 1464110700.jpg | 2023-05-03 10:04 | 15K | |
![[ ]](/icons/layout.gif) | 1464124736-spl.pdf | 2023-05-03 13:42 | 1.3M | |
![[ ]](/icons/layout.gif) | 1464126100-tspl.pdf | 2023-05-03 13:40 | 177K | |
![[ ]](/icons/layout.gif) | 1464126119-spl.pdf | 2023-05-03 13:42 | 945K | |
![[IMG]](/icons/image2.gif) | 1464126135-2-100x100..> | 2023-08-06 09:42 | 3.8K | |
![[IMG]](/icons/image2.gif) | 1464126135-2-300x300..> | 2023-09-02 05:56 | 29K | |
![[IMG]](/icons/image2.gif) | 1464126135-2.jpg | 2023-05-04 02:03 | 55K | |
![[ ]](/icons/layout.gif) | 1464126135-tspl.pdf | 2023-05-04 02:03 | 115K | |
![[IMG]](/icons/image2.gif) | 1483317536-100x100.jpg | 2023-08-05 16:25 | 18K | |
![[IMG]](/icons/image2.gif) | 1483317536-300x300.jpg | 2023-08-06 07:49 | 39K | |
![[IMG]](/icons/image2.gif) | 1483317536.jpg | 2023-05-03 10:03 | 64K | |
![[IMG]](/icons/image2.gif) | 1483372243-100x100.jpg | 2023-08-08 17:49 | 5.0K | |
![[IMG]](/icons/image2.gif) | 1483372243-300x300.jpg | 2023-08-17 18:14 | 26K | |
![[IMG]](/icons/image2.gif) | 1483372243.jpg | 2023-05-03 11:22 | 48K | |
![[IMG]](/icons/image2.gif) | 1506333281-5-100x100..> | 2023-08-06 09:40 | 4.4K | |
![[IMG]](/icons/image2.gif) | 1506333281-5-300x300..> | 2023-09-04 20:54 | 28K | |
![[IMG]](/icons/image2.gif) | 1506333281-5.jpg | 2023-05-04 01:50 | 54K | |
![[ ]](/icons/layout.gif) | 1506333281-tspl.pdf | 2023-05-04 01:50 | 163K | |
![[IMG]](/icons/image2.gif) | 11188909491-100x100.jpg | 2023-08-05 16:24 | 16K | |
![[IMG]](/icons/image2.gif) | 11188909491-300x300.jpg | 2023-08-05 14:40 | 39K | |
![[IMG]](/icons/image2.gif) | 11188909491.jpg | 2023-05-04 02:03 | 57K | |
![[IMG]](/icons/image2.gif) | 11190485321-1-100x10..> | 2023-08-06 03:42 | 7.6K | |
![[IMG]](/icons/image2.gif) | 11190485321-1-300x30..> | 2023-08-06 13:11 | 41K | |
![[IMG]](/icons/image2.gif) | 11190485321-1.jpg | 2023-05-04 02:27 | 44K | |
![[IMG]](/icons/image2.gif) | 11191595631-100x100.jpg | 2023-08-05 14:38 | 22K | |
![[IMG]](/icons/image2.gif) | 11191595631-300x300.jpg | 2023-08-18 04:17 | 42K | |
![[IMG]](/icons/image2.gif) | 11191595631.jpg | 2023-05-04 02:17 | 59K | |
![[IMG]](/icons/image2.gif) | 11193193311-1-100x10..> | 2023-08-06 03:42 | 18K | |
![[IMG]](/icons/image2.gif) | 11193193311-1-300x30..> | 2023-08-20 02:38 | 44K | |
![[IMG]](/icons/image2.gif) | 11193193311-1.jpg | 2023-05-03 11:00 | 59K | |
![[IMG]](/icons/image2.gif) | 11193193311-2-100x10..> | 2023-08-05 05:34 | 18K | |
![[IMG]](/icons/image2.gif) | 11193193311-2-300x30..> | 2023-08-06 13:12 | 44K | |
![[IMG]](/icons/image2.gif) | 11193193311-2.jpg | 2023-05-04 02:28 | 59K | |
![[IMG]](/icons/image2.gif) | 11193193311-100x100.jpg | 2023-08-06 19:18 | 18K | |
![[IMG]](/icons/image2.gif) | 11193193311-300x300.jpg | 2023-08-06 13:12 | 44K | |
![[IMG]](/icons/image2.gif) | 11193193311.jpg | 2023-05-03 11:01 | 59K | |
![[IMG]](/icons/image2.gif) | 11193371861-100x100.jpg | 2023-08-06 09:30 | 18K | |
![[IMG]](/icons/image2.gif) | 11193371861-300x300.jpg | 2023-09-11 04:24 | 40K | |
![[IMG]](/icons/image2.gif) | 11193371861.jpg | 2023-05-03 10:57 | 55K | |
![[IMG]](/icons/image2.gif) | 11193714301-1-100x10..> | 2023-08-05 02:08 | 18K | |
![[IMG]](/icons/image2.gif) | 11193714301-1-300x30..> | 2023-08-08 14:34 | 38K | |
![[IMG]](/icons/image2.gif) | 11193714301-1.jpg | 2023-05-04 02:28 | 49K | |
![[IMG]](/icons/image2.gif) | 11193714301-100x100.jpg | 2023-08-05 02:46 | 18K | |
![[IMG]](/icons/image2.gif) | 11193714301-300x300.jpg | 2023-08-25 12:28 | 38K | |
![[IMG]](/icons/image2.gif) | 11193714301.jpg | 2023-05-03 10:54 | 49K | |
![[IMG]](/icons/image2.gif) | 11193916011-1-100x10..> | 2023-08-06 09:42 | 11K | |
![[IMG]](/icons/image2.gif) | 11193916011-1-300x30..> | 2023-08-08 17:45 | 32K | |
![[IMG]](/icons/image2.gif) | 11193916011-1.jpg | 2023-05-04 02:26 | 50K | |
![[IMG]](/icons/image2.gif) | 11193916011-100x100.jpg | 2023-08-05 04:35 | 11K | |
![[IMG]](/icons/image2.gif) | 11193916011-300x300.jpg | 2023-09-15 06:47 | 32K | |
![[IMG]](/icons/image2.gif) | 11193916011.jpg | 2023-05-03 11:00 | 50K | |
![[IMG]](/icons/image2.gif) | 11193926241-100x100.jpg | 2023-08-05 14:35 | 17K | |
![[IMG]](/icons/image2.gif) | 11193926241-300x300.jpg | 2023-08-08 14:34 | 35K | |
![[IMG]](/icons/image2.gif) | 11193926241.jpg | 2023-05-03 11:01 | 46K | |
![[IMG]](/icons/image2.gif) | 11193958601-100x100.jpg | 2023-08-05 03:39 | 17K | |
![[IMG]](/icons/image2.gif) | 11193958601-300x300.jpg | 2023-09-11 23:26 | 42K | |
![[IMG]](/icons/image2.gif) | 11193958601.jpg | 2023-05-04 02:10 | 55K | |
![[IMG]](/icons/image2.gif) | 11194116961-100x100.jpg | 2023-08-05 05:30 | 17K | |
![[IMG]](/icons/image2.gif) | 11194116961-300x300.jpg | 2023-08-08 23:47 | 37K | |
![[IMG]](/icons/image2.gif) | 11194116961.jpg | 2023-05-04 02:04 | 49K | |
![[IMG]](/icons/image2.gif) | 14833175361-100x100.jpg | 2023-08-06 12:14 | 18K | |
![[IMG]](/icons/image2.gif) | 14833175361-300x300.jpg | 2023-08-27 02:56 | 39K | |
![[IMG]](/icons/image2.gif) | 14833175361.jpg | 2023-05-03 09:24 | 64K | |
![[ ]](/icons/layout.gif) | 21061847733.pdf | 2023-05-04 02:07 | 333K | |
![[IMG]](/icons/image2.gif) | 9780060000387_TestBa..> | 2023-08-05 14:40 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9780060000387_TestBa..> | 2023-08-09 05:08 | 35K | |
![[IMG]](/icons/image2.gif) | 9780060000387_TestBa..> | 2023-05-03 10:58 | 64K | |
![[IMG]](/icons/image2.gif) | 9780072291353-100x10..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780072291353.jpg | 2023-05-04 01:47 | 8.9K | |
![[IMG]](/icons/image2.gif) | 9780072424430-100x10..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780072424430.jpg | 2023-05-03 10:49 | 8.5K | |
![[IMG]](/icons/image2.gif) | 9780072465235-100x10..> | 2023-08-06 22:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780072465235.jpg | 2023-05-04 01:55 | 6.8K | |
![[IMG]](/icons/image2.gif) | 9780072958867-100x10..> | 2023-08-07 09:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780072958867.jpg | 2023-05-04 02:10 | 8.0K | |
![[IMG]](/icons/image2.gif) | 9780073205342-100x10..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780073205342.jpg | 2023-05-03 10:20 | 5.6K | |
![[IMG]](/icons/image2.gif) | 9780073373645-100x10..> | 2023-08-06 00:58 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780073373645.jpg | 2023-05-03 10:47 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780073379654-100x10..> | 2023-08-06 10:18 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9780073379654.jpg | 2023-05-03 09:21 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780073382371-100x10..> | 2023-08-05 14:41 | 1.8K | |
![[IMG]](/icons/image2.gif) | 9780073382371.jpg | 2023-05-03 09:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780073397962_Soluti..> | 2023-08-05 05:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780073397962_Soluti..> | 2023-08-22 23:45 | 24K | |
![[IMG]](/icons/image2.gif) | 9780073397962_Soluti..> | 2023-05-04 01:57 | 30K | |
![[ ]](/icons/unknown.gif) | 9780073398198_Cengel..> | 2023-05-04 01:58 | 1.3M | |
![[IMG]](/icons/image2.gif) | 9780073398198_Soluti..> | 2023-08-05 03:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780073398198_Soluti..> | 2023-08-08 17:45 | 25K | |
![[IMG]](/icons/image2.gif) | 9780073398198_Soluti..> | 2023-05-04 01:58 | 33K | |
![[IMG]](/icons/image2.gif) | 9780073514246_TestBa..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780073514246_TestBa..> | 2023-09-12 09:51 | 21K | |
![[IMG]](/icons/image2.gif) | 9780073514246_TestBa..> | 2023-05-04 01:56 | 30K | |
![[ ]](/icons/unknown.gif) | 9780073514246_TestBa..> | 2023-05-04 01:56 | 21K | |
![[IMG]](/icons/image2.gif) | 9780073519586-100x10..> | 2023-08-06 14:39 | 17K | |
![[IMG]](/icons/image2.gif) | 9780073519586-300x30..> | 2023-08-13 23:17 | 36K | |
![[IMG]](/icons/image2.gif) | 9780073519586.jpg | 2023-05-03 09:54 | 53K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1-1-..> | 2023-08-05 16:26 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1-1-..> | 2023-08-05 01:51 | 12K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1-1.jpg | 2023-05-03 09:06 | 26K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1-10..> | 2023-08-05 09:32 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1-30..> | 2023-08-05 01:12 | 12K | |
![[IMG]](/icons/image2.gif) | 9780073524597-TB1.jpg | 2023-05-03 09:06 | 26K | |
![[IMG]](/icons/image2.gif) | 9780073530666-100x10..> | 2023-08-05 17:22 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780073530666.jpg | 2023-05-03 10:21 | 6.3K | |
![[IMG]](/icons/image2.gif) | 9780073530734-100x10..> | 2023-08-06 11:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780073530734.jpg | 2023-05-03 09:55 | 7.3K | |
![[ ]](/icons/unknown.gif) | 9780077820725_Soluti..> | 2023-05-03 11:18 | 87K | |
![[IMG]](/icons/image2.gif) | 9780077835439_TestBa..> | 2023-08-05 06:23 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780077835439_TestBa..> | 2023-08-27 07:51 | 19K | |
![[IMG]](/icons/image2.gif) | 9780077835439_TestBa..> | 2023-05-04 01:47 | 23K | |
![[IMG]](/icons/image2.gif) | 9780077842161_TestBa..> | 2023-08-08 21:07 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780077842161_TestBa..> | 2023-08-19 00:17 | 19K | |
![[IMG]](/icons/image2.gif) | 9780077842161_TestBa..> | 2023-05-04 01:58 | 22K | |
![[ ]](/icons/unknown.gif) | 9780077842161_TestBa..> | 2023-05-04 01:58 | 0 | |
![[IMG]](/icons/image2.gif) | 9780078025747-100x10..> | 2023-08-06 11:15 | 8.4K | |
![[IMG]](/icons/image2.gif) | 9780078025747.gif | 2023-05-03 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | 9780078027680_Soluti..> | 2023-08-05 15:27 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780078027680_Soluti..> | 2023-08-08 17:45 | 20K | |
![[IMG]](/icons/image2.gif) | 9780078027680_Soluti..> | 2023-05-04 01:53 | 29K | |
![[ ]](/icons/compressed.gif) | 9780078027680_Soluti..> | 2023-05-04 01:53 | 2.7M | |
![[IMG]](/icons/image2.gif) | 9780078028151_Soluti..> | 2023-08-05 16:28 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780078028151_Soluti..> | 2023-08-08 14:34 | 14K | |
![[IMG]](/icons/image2.gif) | 9780078028151_Soluti..> | 2023-05-04 02:11 | 20K | |
![[ ]](/icons/layout.gif) | 9780078028151_Soluti..> | 2023-05-04 02:11 | 0 | |
![[ ]](/icons/unknown.gif) | 9780078028182_Kasap_..> | 2023-05-03 13:43 | 1.6M | |
![[IMG]](/icons/image2.gif) | 9780078028946-100x10..> | 2023-08-06 11:13 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780078028946.jpg | 2023-05-03 09:34 | 7.0K | |
![[ ]](/icons/layout.gif) | 9780078035609_TestBa..> | 2023-05-03 13:43 | 1.1M | |
![[ ]](/icons/unknown.gif) | 9780078036958_Chapte..> | 2023-05-04 02:06 | 22K | |
![[IMG]](/icons/image2.gif) | 9780078036958_TestBa..> | 2023-08-05 05:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780078036958_TestBa..> | 2023-09-01 04:31 | 22K | |
![[IMG]](/icons/image2.gif) | 9780078036958_TestBa..> | 2023-05-04 02:06 | 24K | |
![[IMG]](/icons/image2.gif) | 9780078096600-100x10..> | 2023-08-06 13:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780078096600.jpg | 2023-05-03 09:47 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9780078112959_TestBa..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780078112959_TestBa..> | 2023-08-21 10:12 | 19K | |
![[IMG]](/icons/image2.gif) | 9780078112959_TestBa..> | 2023-05-04 02:00 | 25K | |
![[IMG]](/icons/image2.gif) | 9780078119170_TestBa..> | 2023-08-05 02:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780078119170_TestBa..> | 2023-08-14 23:55 | 17K | |
![[IMG]](/icons/image2.gif) | 9780078119170_TestBa..> | 2023-05-04 02:14 | 22K | |
![[ ]](/icons/unknown.gif) | 9780078119170_schick..> | 2023-05-04 02:14 | 23K | |
![[ ]](/icons/unknown.gif) | 9780078119217_Molloy..> | 2023-05-04 01:49 | 36K | |
![[IMG]](/icons/image2.gif) | 9780078119217_TestBa..> | 2023-08-06 08:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780078119217_TestBa..> | 2023-08-06 07:45 | 20K | |
![[IMG]](/icons/image2.gif) | 9780078119217_TestBa..> | 2023-05-04 01:49 | 28K | |
![[IMG]](/icons/image2.gif) | 9780080977737__62065..> | 2023-08-06 07:49 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780080977737__62065..> | 2023-05-03 11:20 | 15K | |
![[IMG]](/icons/image2.gif) | 9780080982045__04470..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780080982045__04470..> | 2023-05-03 10:36 | 16K | |
![[IMG]](/icons/image2.gif) | 9780123869449_Soluti..> | 2023-08-05 05:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780123869449_Soluti..> | 2023-08-15 16:02 | 19K | |
![[IMG]](/icons/image2.gif) | 9780123869449_Soluti..> | 2023-05-04 02:24 | 22K | |
![[ ]](/icons/layout.gif) | 9780123869906_Soluti..> | 2023-05-04 02:24 | 283K | |
![[IMG]](/icons/image2.gif) | 9780128142042-100x10..> | 2023-08-05 05:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780128142042.jpg | 2023-05-04 02:12 | 32K | |
![[ ]](/icons/layout.gif) | 9780128154793-spl.pdf | 2023-05-04 01:54 | 232K | |
![[IMG]](/icons/image2.gif) | 9780130090560.jpg | 2023-05-03 09:33 | 21K | |
![[IMG]](/icons/image2.gif) | 9780130887023-100x10..> | 2023-08-08 20:05 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780130887023.jpg | 2023-05-04 02:17 | 13K | |
![[IMG]](/icons/image2.gif) | 9780131194045-100x10..> | 2023-08-05 14:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780131194045.jpg | 2023-05-04 02:14 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9780131395060-100x10..> | 2023-08-05 01:14 | 6.4K | |
![[IMG]](/icons/image2.gif) | 9780131395060.gif | 2023-05-03 10:35 | 10K | |
![[IMG]](/icons/image2.gif) | 9780131465329-100x10..> | 2023-08-05 05:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780131465329.jpg | 2023-05-03 09:58 | 11K | |
![[IMG]](/icons/image2.gif) | 9780131577138-100x10..> | 2023-08-05 04:35 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780131577138-300x30..> | 2023-08-05 01:51 | 23K | |
![[IMG]](/icons/image2.gif) | 9780131577138.jpg | 2023-05-03 09:19 | 109K | |
![[IMG]](/icons/image2.gif) | 9780131725799-100x10..> | 2023-08-06 20:55 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780131725799.jpg | 2023-05-04 02:11 | 10K | |
![[IMG]](/icons/image2.gif) | 9780131751392-100x10..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780131751392.jpg | 2023-05-04 02:13 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780131877153-100x10..> | 2023-08-05 06:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780131877153.jpg | 2023-05-03 10:09 | 8.2K | |
![[ ]](/icons/unknown.gif) | 9780131888593_Soluti..> | 2023-05-04 02:16 | 51K | |
![[IMG]](/icons/image2.gif) | 9780132145183-100x10..> | 2023-08-05 04:35 | 8.3K | |
![[IMG]](/icons/image2.gif) | 9780132145183.gif | 2023-05-03 09:57 | 12K | |
![[ ]](/icons/layout.gif) | 9780132145398_TestBa..> | 2023-05-04 02:17 | 331K | |
![[IMG]](/icons/image2.gif) | 9780132148696-100x10..> | 2023-08-05 02:46 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780132148696.gif | 2023-05-04 02:12 | 16K | |
![[IMG]](/icons/image2.gif) | 9780132153683-100x10..> | 2023-08-05 14:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780132153683.jpg | 2023-05-03 10:18 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780132162746-100x10..> | 2023-08-05 14:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780132162746-300x30..> | 2023-08-05 04:35 | 17K | |
![[IMG]](/icons/image2.gif) | 9780132162746.jpg | 2023-05-03 10:11 | 63K | |
![[IMG]](/icons/image2.gif) | 9780132215008-100x10..> | 2023-08-05 01:51 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780132215008.jpg | 2023-05-03 10:02 | 16K | |
![[IMG]](/icons/image2.gif) | 9780132285353-100x10..> | 2023-08-05 04:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780132285353.jpg | 2023-05-04 02:12 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780132302562-100x10..> | 2023-08-05 15:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780132302562.jpg | 2023-05-03 10:37 | 18K | |
![[ ]](/icons/layout.gif) | 9780132473989_Soluti..> | 2023-05-04 02:17 | 53K | |
![[IMG]](/icons/image2.gif) | 9780132544368-100x10..> | 2023-08-05 14:37 | 8.2K | |
![[IMG]](/icons/image2.gif) | 9780132544368.gif | 2023-05-03 10:24 | 15K | |
![[IMG]](/icons/image2.gif) | 9780132551793-100x10..> | 2023-08-05 02:45 | 5.0K | |
![[IMG]](/icons/image2.gif) | 9780132551793.jpg | 2023-05-03 09:46 | 13K | |
![[IMG]](/icons/image2.gif) | 9780132556514-100x10..> | 2023-08-05 17:21 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780132556514.gif | 2023-05-03 10:48 | 15K | |
![[ ]](/icons/compressed.gif) | 9780132574952-TEST-B..> | 2023-05-03 10:23 | 40K | |
![[IMG]](/icons/image2.gif) | 9780132742399-100x10..> | 2023-08-06 10:17 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780132742399.jpg | 2023-05-03 10:27 | 8.5K | |
![[IMG]](/icons/image2.gif) | 9780132743549-100x10..> | 2023-08-05 15:26 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780132743549.jpg | 2023-05-03 10:39 | 6.5K | |
![[IMG]](/icons/image2.gif) | 9780132784023-100x10..> | 2023-08-05 14:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780132784023-300x30..> | 2023-08-15 07:57 | 23K | |
![[IMG]](/icons/image2.gif) | 9780132784023.jpg | 2023-05-03 09:49 | 106K | |
![[IMG]](/icons/image2.gif) | 9780132816243-100x10..> | 2023-08-05 01:09 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780132816243.jpg | 2023-05-03 09:50 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780132857949-100x10..> | 2023-08-05 04:34 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9780132857949.gif | 2023-05-03 09:54 | 14K | |
![[IMG]](/icons/image2.gif) | 9780132871693-100x10..> | 2023-08-05 15:30 | 6.7K | |
![[IMG]](/icons/image2.gif) | 9780132871693.gif | 2023-05-03 10:00 | 8.4K | |
![[ ]](/icons/layout.gif) | 9780132871938_TestBa..> | 2023-05-03 13:40 | 0 | |
![[ ]](/icons/layout.gif) | 9780132956314_TestBa..> | 2023-05-04 02:17 | 649K | |
![[ ]](/icons/compressed.gif) | 9780133024449_SM_Ch1..> | 2023-05-03 13:43 | 447K | |
![[IMG]](/icons/image2.gif) | 9780133050479-100x10..> | 2023-08-08 16:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | 9780133050479.gif | 2023-05-03 10:26 | 12K | |
![[ ]](/icons/unknown.gif) | 9780133050479_Chapte..> | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/layout.gif) | 9780133050479_TB_cha..> | 2023-05-03 10:26 | 394K | |
![[IMG]](/icons/image2.gif) | 9780133050578-100x10..> | 2023-08-05 02:03 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780133050578.jpg | 2023-05-03 10:24 | 6.1K | |
![[IMG]](/icons/image2.gif) | 9780133117417-100x10..> | 2023-08-09 05:08 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780133117417.jpg | 2023-05-03 10:35 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9780133126129_TestBa..> | 2023-08-07 05:25 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780133126129_TestBa..> | 2023-08-22 15:02 | 25K | |
![[IMG]](/icons/image2.gif) | 9780133126129_TestBa..> | 2023-05-04 02:27 | 54K | |
![[IMG]](/icons/image2.gif) | 9780133127478_Soluti..> | 2023-08-05 17:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780133127478_Soluti..> | 2023-08-11 20:41 | 25K | |
![[IMG]](/icons/image2.gif) | 9780133127478_Soluti..> | 2023-05-04 01:48 | 62K | |
![[IMG]](/icons/image2.gif) | 9780133144567_TestBa..> | 2023-08-05 04:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780133144567_TestBa..> | 2023-10-22 21:21 | 18K | |
![[IMG]](/icons/image2.gif) | 9780133144567_TestBa..> | 2023-05-03 11:01 | 44K | |
![[IMG]](/icons/image2.gif) | 9780133251968-100x10..> | 2023-08-05 01:09 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780133251968.jpg | 2023-05-03 10:19 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9780133356717-100x10..> | 2023-08-06 01:53 | 8.9K | |
![[IMG]](/icons/image2.gif) | 9780133356717.gif | 2023-05-03 10:39 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133370294_TestBa..> | 2023-08-06 09:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780133370294_TestBa..> | 2023-08-11 03:44 | 14K | |
![[IMG]](/icons/image2.gif) | 9780133370294_TestBa..> | 2023-05-04 02:02 | 32K | |
![[IMG]](/icons/image2.gif) | 9780133407921-100x10..> | 2023-08-06 08:31 | 6.2K | |
![[IMG]](/icons/image2.gif) | 9780133407921.gif | 2023-05-03 10:49 | 9.8K | |
![[ ]](/icons/unknown.gif) | 9780133414783_TestBa..> | 2023-05-03 13:43 | 80K | |
![[IMG]](/icons/image2.gif) | 9780133472233-100x10..> | 2023-08-06 10:18 | 11K | |
![[IMG]](/icons/image2.gif) | 9780133472233.gif | 2023-05-03 09:41 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133485974-100x10..> | 2023-08-06 05:46 | 8.0K | |
![[IMG]](/icons/image2.gif) | 9780133485974.gif | 2023-05-03 10:09 | 18K | |
![[ ]](/icons/unknown.gif) | 9780133495522_TestBa..> | 2023-05-03 10:59 | 22K | |
![[IMG]](/icons/image2.gif) | 9780133495522_Test_B..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780133495522_Test_B..> | 2023-08-31 05:36 | 18K | |
![[IMG]](/icons/image2.gif) | 9780133495522_Test_B..> | 2023-05-03 10:59 | 24K | |
![[ ]](/icons/unknown.gif) | 9780133545197_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9780133576870-100x10..> | 2023-08-05 01:41 | 5.9K | |
![[IMG]](/icons/image2.gif) | 9780133576870.gif | 2023-05-03 10:15 | 10K | |
![[IMG]](/icons/image2.gif) | 9780133591217_Soluti..> | 2023-08-08 06:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780133591217_Soluti..> | 2023-08-06 05:44 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133591217_Soluti..> | 2023-05-04 01:50 | 37K | |
![[IMG]](/icons/image2.gif) | 9780133591217_TestBa..> | 2023-08-05 15:32 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780133591217_TestBa..> | 2023-08-14 19:05 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133591217_TestBa..> | 2023-05-04 01:50 | 37K | |
![[IMG]](/icons/image2.gif) | 9780133763539-100x10..> | 2023-08-05 05:30 | 6.1K | |
![[IMG]](/icons/image2.gif) | 9780133763539.gif | 2023-05-03 09:26 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9780133770018-100x10..> | 2023-08-05 14:00 | 7.9K | |
![[IMG]](/icons/image2.gif) | 9780133770018.gif | 2023-05-03 09:21 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133770766_TestBa..> | 2023-08-08 06:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780133770766_TestBa..> | 2023-08-14 19:05 | 13K | |
![[IMG]](/icons/image2.gif) | 9780133770766_TestBa..> | 2023-05-03 11:11 | 26K | |
![[IMG]](/icons/image2.gif) | 9780133773927-100x10..> | 2023-08-05 03:41 | 11K | |
![[IMG]](/icons/image2.gif) | 9780133773927.gif | 2023-05-03 11:04 | 18K | |
![[IMG]](/icons/image2.gif) | 9780133775679-100x10..> | 2023-08-05 05:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780133775679-300x30..> | 2023-09-04 19:11 | 25K | |
![[IMG]](/icons/image2.gif) | 9780133775679.jpg | 2023-05-03 09:40 | 112K | |
![[IMG]](/icons/image2.gif) | 9780133791853_TestBa..> | 2023-08-06 16:00 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780133791853_TestBa..> | 2023-08-05 05:34 | 20K | |
![[IMG]](/icons/image2.gif) | 9780133791853_TestBa..> | 2023-05-04 02:00 | 25K | |
![[ ]](/icons/unknown.gif) | 9780133791853_TestBa..> | 2023-05-04 02:00 | 36K | |
![[IMG]](/icons/image2.gif) | 9780133806878-100x10..> | 2023-08-05 01:11 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780133806878.gif | 2023-05-03 09:18 | 19K | |
![[IMG]](/icons/image2.gif) | 9780133806885-100x10..> | 2023-08-05 01:51 | 11K | |
![[IMG]](/icons/image2.gif) | 9780133806885.gif | 2023-05-03 10:35 | 25K | |
![[IMG]](/icons/image2.gif) | 9780133808483-100x10..> | 2023-08-06 05:44 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9780133808483.gif | 2023-05-03 09:27 | 7.9K | |
![[ ]](/icons/layout.gif) | 9780133814934_TestBa..> | 2023-05-04 02:09 | 0 | |
![[IMG]](/icons/image2.gif) | 9780133815108_TestBa..> | 2023-08-05 04:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780133815108_TestBa..> | 2023-05-04 02:08 | 52K | |
![[IMG]](/icons/image2.gif) | 9780133829600-100x10..> | 2023-08-05 05:29 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9780133829600.gif | 2023-05-03 10:07 | 13K | |
![[IMG]](/icons/image2.gif) | 9780133855388-492x60..> | 2023-08-05 01:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780133855388-492x60..> | 2023-08-05 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | 9780133855388-492x60..> | 2023-05-03 10:59 | 47K | |
![[IMG]](/icons/image2.gif) | 9780133859812_TestBa..> | 2023-08-06 04:21 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780133859812_TestBa..> | 2023-09-25 08:34 | 16K | |
![[IMG]](/icons/image2.gif) | 9780133859812_TestBa..> | 2023-05-04 02:14 | 34K | |
![[IMG]](/icons/image2.gif) | 9780133890822-100x10..> | 2023-08-06 03:28 | 9.7K | |
![[IMG]](/icons/image2.gif) | 9780133890822.gif | 2023-05-03 10:21 | 20K | |
![[ ]](/icons/compressed.gif) | 9780133900378_02_Tes..> | 2023-05-03 10:27 | 166K | |
![[IMG]](/icons/image2.gif) | 9780133936735-100x10..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780133936735-300x30..> | 2023-08-11 21:14 | 27K | |
![[IMG]](/icons/image2.gif) | 9780133936735.jpg | 2023-05-03 11:08 | 69K | |
![[IMG]](/icons/image2.gif) | 9780133940190_TestBa..> | 2023-08-06 10:17 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780133940190_TestBa..> | 2023-08-15 20:03 | 12K | |
![[IMG]](/icons/image2.gif) | 9780133940190_TestBa..> | 2023-05-04 01:51 | 33K | |
![[ ]](/icons/layout.gif) | 9780133942651_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780133945911_TestBa..> | 2023-08-05 21:57 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780133945911_TestBa..> | 2023-08-06 13:12 | 28K | |
![[IMG]](/icons/image2.gif) | 9780133945911_TestBa..> | 2023-05-03 10:54 | 67K | |
![[ ]](/icons/unknown.gif) | 9780133945911_TestBa..> | 2023-05-03 10:54 | 69K | |
![[ ]](/icons/unknown.gif) | 9780133972757_ch01_T..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134004242_TestBa..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134004242_TestBa..> | 2023-08-10 04:13 | 26K | |
![[IMG]](/icons/image2.gif) | 9780134004242_TestBa..> | 2023-05-04 02:18 | 68K | |
![[IMG]](/icons/image2.gif) | 9780134010229_TestBa..> | 2023-08-06 13:03 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134010229_TestBa..> | 2023-09-08 18:22 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134010229_TestBa..> | 2023-05-04 02:09 | 36K | |
![[IMG]](/icons/image2.gif) | 9780134040998-1-100x..> | 2023-08-06 10:17 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9780134040998-1-300x..> | 2023-08-20 22:31 | 13K | |
![[IMG]](/icons/image2.gif) | 9780134040998-1.jpg | 2023-05-03 10:25 | 33K | |
![[ ]](/icons/unknown.gif) | 9780134044316_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134061641_TestBa..> | 2023-08-05 05:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780134061641_TestBa..> | 2023-09-09 03:32 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134061641_TestBa..> | 2023-05-04 02:09 | 38K | |
![[ ]](/icons/unknown.gif) | 9780134061641_TestBa..> | 2023-05-04 02:09 | 21K | |
![[IMG]](/icons/image2.gif) | 9780134103976_Soluti..> | 2023-08-05 03:35 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780134103976_Soluti..> | 2023-08-16 15:50 | 32K | |
![[IMG]](/icons/image2.gif) | 9780134103976_Soluti..> | 2023-05-03 11:17 | 81K | |
![[ ]](/icons/compressed.gif) | 9780134112831-TEST-B..> | 2023-05-04 02:03 | 146K | |
![[IMG]](/icons/image2.gif) | 9780134128528_TestBa..> | 2023-08-05 14:37 | 9.0K | |
![[IMG]](/icons/image2.gif) | 9780134128528_TestBa..> | 2023-08-09 07:04 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134128528_TestBa..> | 2023-05-04 02:13 | 38K | |
![[ ]](/icons/unknown.gif) | 9780134128528_TestBa..> | 2023-05-04 02:13 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134133539_TestBa..> | 2023-08-07 15:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134133539_TestBa..> | 2023-08-11 03:44 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134133539_TestBa..> | 2023-05-04 02:02 | 46K | |
![[ ]](/icons/layout.gif) | 9780134133539_TestBa..> | 2023-05-04 02:01 | 172K | |
![[IMG]](/icons/image2.gif) | 9780134145938_TestBa..> | 2023-08-05 02:45 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780134145938_TestBa..> | 2023-08-09 02:53 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134145938_TestBa..> | 2023-05-03 10:54 | 36K | |
![[ ]](/icons/layout.gif) | 9780134151908-Untitl..> | 2023-05-04 02:07 | 221K | |
![[IMG]](/icons/image2.gif) | 9780134151908_TestBa..> | 2023-08-06 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134151908_TestBa..> | 2023-08-16 08:16 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134151908_TestBa..> | 2023-05-04 02:07 | 44K | |
![[IMG]](/icons/image2.gif) | 9780134153117_TestBa..> | 2023-08-05 01:51 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134153117_TestBa..> | 2023-08-24 03:18 | 13K | |
![[IMG]](/icons/image2.gif) | 9780134153117_TestBa..> | 2023-05-03 10:56 | 29K | |
![[ ]](/icons/unknown.gif) | 9780134167220_ch01_T..> | 2023-05-04 02:15 | 119K | |
![[IMG]](/icons/image2.gif) | 9780134173054_TestBa..> | 2023-08-05 03:41 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780134173054_TestBa..> | 2023-08-12 07:27 | 14K | |
![[IMG]](/icons/image2.gif) | 9780134173054_TestBa..> | 2023-05-04 02:01 | 37K | |
![[IMG]](/icons/image2.gif) | 9780134202648_Soluti..> | 2023-08-05 01:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780134202648_Soluti..> | 2023-08-14 00:56 | 21K | |
![[IMG]](/icons/image2.gif) | 9780134202648_Soluti..> | 2023-05-03 11:12 | 41K | |
![[IMG]](/icons/image2.gif) | 9780134205571_Soluti..> | 2023-08-05 01:08 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780134205571_Soluti..> | 2023-08-11 11:53 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134205571_Soluti..> | 2023-05-04 01:52 | 62K | |
![[IMG]](/icons/image2.gif) | 9780134205571_TestBa..> | 2023-08-06 08:31 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780134205571_TestBa..> | 2023-09-19 06:07 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134205571_TestBa..> | 2023-05-04 01:52 | 62K | |
![[ ]](/icons/unknown.gif) | 9780134213118_Horngr..> | 2023-05-03 10:59 | 1.6M | |
![[ ]](/icons/unknown.gif) | 9780134286105_IRSM_C..> | 2023-05-04 02:00 | 120K | |
![[ ]](/icons/layout.gif) | 9780134292663_TestBa..> | 2023-05-03 13:42 | 206K | |
![[IMG]](/icons/image2.gif) | 9780134302386_Soluti..> | 2023-08-06 08:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134302386_Soluti..> | 2023-08-06 08:47 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134302386_Soluti..> | 2023-05-04 02:07 | 46K | |
![[ ]](/icons/layout.gif) | 9780134302386_Soluti..> | 2023-05-04 02:07 | 231K | |
![[IMG]](/icons/image2.gif) | 9780134302386_TestBa..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134302386_TestBa..> | 2023-08-21 10:10 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134302386_TestBa..> | 2023-05-04 02:07 | 46K | |
![[ ]](/icons/layout.gif) | 9780134302386_TestBa..> | 2023-05-04 02:07 | 292K | |
![[IMG]](/icons/image2.gif) | 9780134324838_Soluti..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134324838_Soluti..> | 2023-08-05 03:41 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134324838_Soluti..> | 2023-05-04 02:06 | 35K | |
![[ ]](/icons/unknown.gif) | 9780134413327_CH01_T..> | 2023-05-04 02:23 | 34K | |
![[IMG]](/icons/image2.gif) | 9780134421377_Soluti..> | 2023-08-05 14:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780134421377_Soluti..> | 2023-08-06 08:47 | 32K | |
![[IMG]](/icons/image2.gif) | 9780134421377_Soluti..> | 2023-05-04 02:08 | 85K | |
![[IMG]](/icons/image2.gif) | 9780134433691_TestBa..> | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134433691_TestBa..> | 2023-08-24 00:00 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134433691_TestBa..> | 2023-05-03 11:21 | 35K | |
![[IMG]](/icons/image2.gif) | 9780134444789_TestBa..> | 2023-08-05 02:03 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780134444789_TestBa..> | 2023-08-23 23:50 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134444789_TestBa..> | 2023-05-04 01:50 | 45K | |
![[ ]](/icons/layout.gif) | 9780134444789_TestBa..> | 2023-05-04 01:50 | 1.6M | |
![[IMG]](/icons/image2.gif) | 9780134448725_TestBa..> | 2023-08-05 16:23 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780134448725_TestBa..> | 2023-09-20 09:04 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134448725_TestBa..> | 2023-05-04 01:51 | 31K | |
![[ ]](/icons/layout.gif) | 9780134448725_TestBa..> | 2023-05-04 01:51 | 444K | |
![[ ]](/icons/unknown.gif) | 9780134458779_Soluti..> | 2023-05-03 13:43 | 36K | |
![[IMG]](/icons/image2.gif) | 9780134463971_Soluti..> | 2023-08-05 01:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134463971_Soluti..> | 2023-08-15 11:23 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134463971_Soluti..> | 2023-05-04 01:50 | 65K | |
![[IMG]](/icons/image2.gif) | 9780134468372_Soluti..> | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9780134468372_Soluti..> | 2023-08-12 04:50 | 23K | |
![[IMG]](/icons/image2.gif) | 9780134468372_Soluti..> | 2023-05-04 02:09 | 60K | |
![[IMG]](/icons/image2.gif) | 9780134472089_Soluit..> | 2023-08-06 10:16 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9780134472089_Soluit..> | 2023-08-24 12:35 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134472089_Soluit..> | 2023-05-04 02:20 | 45K | |
![[ ]](/icons/layout.gif) | 9780134472089_Soluti..> | 2023-05-04 02:20 | 392K | |
![[IMG]](/icons/image2.gif) | 9780134472089_TestBa..> | 2023-08-05 02:46 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9780134472089_TestBa..> | 2023-08-14 03:16 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134472089_TestBa..> | 2023-05-04 02:19 | 45K | |
![[ ]](/icons/unknown.gif) | 9780134472089_TestBa..> | 2023-05-04 02:19 | 55K | |
![[ ]](/icons/unknown.gif) | 9780134475585_TestBa..> | 2023-05-04 01:59 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134475882_TestBa..> | 2023-08-05 01:09 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780134475882_TestBa..> | 2023-08-28 22:18 | 30K | |
![[IMG]](/icons/image2.gif) | 9780134475882_TestBa..> | 2023-05-04 01:59 | 71K | |
![[ ]](/icons/layout.gif) | 9780134475882_TestBa..> | 2023-05-04 01:59 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134476308_Soluti..> | 2023-08-07 04:27 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134476308_Soluti..> | 2023-08-18 13:55 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134476308_Soluti..> | 2023-05-04 01:52 | 34K | |
![[IMG]](/icons/image2.gif) | 9780134477596_Soluti..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134477596_Soluti..> | 2023-08-12 03:36 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134477596_Soluti..> | 2023-05-03 11:08 | 49K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-08-08 06:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-09-06 02:57 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-05-03 11:07 | 58K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-08-08 17:37 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-08-05 03:41 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134486833-522x60..> | 2023-05-03 11:07 | 58K | |
![[IMG]](/icons/image2.gif) | 9780134494043_Soluti..> | 2023-08-06 05:44 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9780134494043_Soluti..> | 2023-08-10 16:04 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134494043_Soluti..> | 2023-05-04 01:53 | 66K | |
![[IMG]](/icons/image2.gif) | 9780134498379_Soluti..> | 2023-08-05 06:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780134498379_Soluti..> | 2023-08-11 20:42 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134498379_Soluti..> | 2023-05-04 01:53 | 38K | |
![[IMG]](/icons/image2.gif) | 9780134531830_TestBa..> | 2023-08-05 05:29 | 12K | |
![[IMG]](/icons/image2.gif) | 9780134531830_TestBa..> | 2023-08-07 04:40 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134531830_TestBa..> | 2023-05-04 02:01 | 55K | |
![[ ]](/icons/unknown.gif) | 9780134531830_TestBa..> | 2023-05-04 02:01 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134548647_TestBa..> | 2023-08-05 15:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134548647_TestBa..> | 2023-08-05 03:41 | 23K | |
![[IMG]](/icons/image2.gif) | 9780134548647_TestBa..> | 2023-05-03 11:07 | 66K | |
![[ ]](/icons/unknown.gif) | 9780134548661_TestBa..> | 2023-05-04 02:22 | 838K | |
![[IMG]](/icons/image2.gif) | 9780134548685_TestBa..> | 2023-08-05 05:30 | 14K | |
![[IMG]](/icons/image2.gif) | 9780134548685_TestBa..> | 2023-08-15 06:50 | 38K | |
![[IMG]](/icons/image2.gif) | 9780134548685_TestBa..> | 2023-05-03 11:11 | 78K | |
![[ ]](/icons/unknown.gif) | 9780134551906_Soluti..> | 2023-05-03 13:44 | 221K | |
![[ ]](/icons/layout.gif) | 9780134553511_TestBa..> | 2023-05-04 02:08 | 0 | |
![[ ]](/icons/unknown.gif) | 9780134559858_TestBa..> | 2023-05-03 13:44 | 16K | |
![[ ]](/icons/layout.gif) | 9780134564302-TEST-B..> | 2023-05-03 10:17 | 668K | |
![[ ]](/icons/unknown.gif) | 9780134572031_TestBa..> | 2023-05-03 13:41 | 35K | |
![[ ]](/icons/layout.gif) | 9780134604718-TEST-B..> | 2023-05-04 01:48 | 539K | |
![[ ]](/icons/layout.gif) | 9780134605173_TestBa..> | 2023-05-04 01:57 | 893K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-08-08 17:39 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-08-08 23:54 | 26K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-05-04 02:10 | 56K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-08-05 04:36 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-08-08 23:54 | 26K | |
![[IMG]](/icons/image2.gif) | 9780134605180_TestBa..> | 2023-05-04 02:08 | 56K | |
![[ ]](/icons/unknown.gif) | 9780134605180_TestBa..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134611037_Soluti..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134611037_Soluti..> | 2023-08-05 03:41 | 21K | |
![[IMG]](/icons/image2.gif) | 9780134611037_Soluti..> | 2023-05-04 02:07 | 48K | |
![[IMG]](/icons/image2.gif) | 9780134616803_TestBa..> | 2023-08-05 02:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134616803_TestBa..> | 2023-08-30 12:05 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134616803_TestBa..> | 2023-05-04 02:00 | 37K | |
![[ ]](/icons/unknown.gif) | 9780134616834_TestBa..> | 2023-05-03 13:41 | 54K | |
![[IMG]](/icons/image2.gif) | 9780134621586_TestBa..> | 2023-08-06 10:20 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9780134621586_TestBa..> | 2023-08-08 08:19 | 31K | |
![[IMG]](/icons/image2.gif) | 9780134621586_TestBa..> | 2023-05-04 01:47 | 78K | |
![[ ]](/icons/layout.gif) | 9780134628127_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/compressed.gif) | 9780134632339-TEST-B..> | 2023-05-03 13:44 | 84K | |
![[ ]](/icons/unknown.gif) | 9780134633282_sharda..> | 2023-05-04 02:02 | 59K | |
![[IMG]](/icons/image2.gif) | 9780134635200_Soluti..> | 2023-08-05 15:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134635200_Soluti..> | 2023-08-08 06:43 | 18K | |
![[IMG]](/icons/image2.gif) | 9780134635200_Soluti..> | 2023-05-04 02:05 | 38K | |
![[IMG]](/icons/image2.gif) | 9780134635200_TestBa..> | 2023-08-08 00:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134635200_TestBa..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | 9780134635200_TestBa..> | 2023-05-04 02:05 | 38K | |
![[IMG]](/icons/image2.gif) | 9780134636832_TestBa..> | 2023-08-08 10:57 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780134636832_TestBa..> | 2023-09-11 04:22 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134636832_TestBa..> | 2023-05-04 01:49 | 37K | |
![[IMG]](/icons/image2.gif) | 9780134641676_Soluti..> | 2023-08-05 02:46 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9780134641676_Soluti..> | 2023-08-20 02:38 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780134641676_Soluti..> | 2023-05-04 01:54 | 22K | |
![[IMG]](/icons/image2.gif) | 9780134642796_TestBa..> | 2023-08-05 06:24 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9780134642796_TestBa..> | 2023-08-30 09:45 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134642796_TestBa..> | 2023-05-04 01:51 | 51K | |
![[ ]](/icons/unknown.gif) | 9780134642796_TestBa..> | 2023-05-04 01:51 | 240K | |
![[IMG]](/icons/image2.gif) | 9780134674551_TestBa..> | 2023-08-06 13:06 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134674551_TestBa..> | 2023-09-23 01:07 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134674551_TestBa..> | 2023-05-04 02:10 | 34K | |
![[ ]](/icons/unknown.gif) | 9780134674551_TestBa..> | 2023-05-04 02:10 | 0 | |
![[ ]](/icons/unknown.gif) | 9780134682907_TestBa..> | 2023-05-04 02:07 | 35K | |
![[IMG]](/icons/image2.gif) | 9780134684901_Soluti..> | 2023-08-05 06:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134684901_Soluti..> | 2023-08-08 16:42 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134684901_Soluti..> | 2023-05-03 10:55 | 39K | |
![[IMG]](/icons/image2.gif) | 9780134684901_TestBa..> | 2023-08-08 19:14 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134684901_TestBa..> | 2023-08-23 23:59 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134684901_TestBa..> | 2023-05-03 10:56 | 39K | |
![[IMG]](/icons/image2.gif) | 9780134686837_Soluti..> | 2023-08-08 22:59 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134686837_Soluti..> | 2023-08-14 23:08 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134686837_Soluti..> | 2023-05-04 01:54 | 40K | |
![[IMG]](/icons/image2.gif) | 9780134695068_TestBa..> | 2023-08-06 02:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134695068_TestBa..> | 2023-08-25 22:45 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134695068_TestBa..> | 2023-05-04 02:21 | 54K | |
![[ ]](/icons/unknown.gif) | 9780134695068_TestBa..> | 2023-05-04 02:21 | 130K | |
![[IMG]](/icons/image2.gif) | 9780134697024_TestBa..> | 2023-08-08 15:42 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780134697024_TestBa..> | 2023-08-10 18:29 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134697024_TestBa..> | 2023-05-03 10:52 | 76K | |
![[ ]](/icons/layout.gif) | 9780134701233_TestBa..> | 2023-05-04 02:24 | 168K | |
![[IMG]](/icons/image2.gif) | 9780134707365_Soluti..> | 2023-08-06 03:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134707365_Soluti..> | 2023-08-06 13:11 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134707365_Soluti..> | 2023-05-04 02:06 | 37K | |
![[IMG]](/icons/image2.gif) | 9780134708201_TestBa..> | 2023-08-05 02:13 | 10K | |
![[IMG]](/icons/image2.gif) | 9780134708201_TestBa..> | 2023-09-11 23:26 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134708201_TestBa..> | 2023-05-04 02:09 | 54K | |
![[IMG]](/icons/image2.gif) | 9780134709321_TestBa..> | 2023-08-05 05:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780134709321_TestBa..> | 2023-10-22 21:21 | 21K | |
![[IMG]](/icons/image2.gif) | 9780134709321_TestBa..> | 2023-05-03 11:00 | 44K | |
![[ ]](/icons/unknown.gif) | 9780134709321_TestBa..> | 2023-05-03 11:00 | 41K | |
![[IMG]](/icons/image2.gif) | 9780134710679_TestBa..> | 2023-08-08 21:04 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780134710679_TestBa..> | 2023-08-08 21:10 | 29K | |
![[IMG]](/icons/image2.gif) | 9780134710679_TestBa..> | 2023-05-03 11:21 | 63K | |
![[ ]](/icons/unknown.gif) | 9780134710679_TestBa..> | 2023-05-03 11:21 | 52K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-08-05 02:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-09-11 04:24 | 12K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-05-04 01:51 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-08-06 11:14 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-09-11 04:24 | 12K | |
![[IMG]](/icons/image2.gif) | 9780134711010_TestBa..> | 2023-05-03 11:21 | 28K | |
![[ ]](/icons/unknown.gif) | 9780134711010_TestBa..> | 2023-05-04 01:51 | 51K | |
![[IMG]](/icons/image2.gif) | 9780134711409_TestBa..> | 2023-08-06 08:46 | 10K | |
![[IMG]](/icons/image2.gif) | 9780134711409_TestBa..> | 2023-08-30 20:27 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134711409_TestBa..> | 2023-05-04 01:51 | 46K | |
![[IMG]](/icons/image2.gif) | 9780134711447_TestBa..> | 2023-08-07 21:20 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780134711447_TestBa..> | 2023-09-05 00:52 | 13K | |
![[IMG]](/icons/image2.gif) | 9780134711447_TestBa..> | 2023-05-04 02:16 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134711751_TestBa..> | 2023-08-05 15:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780134711751_TestBa..> | 2023-08-24 00:00 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134711751_TestBa..> | 2023-05-03 11:20 | 35K | |
![[ ]](/icons/unknown.gif) | 9780134729329_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9780134729329_robbin..> | 2023-05-03 13:42 | 111K | |
![[IMG]](/icons/image2.gif) | 9780134729534_TestBa..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780134729534_TestBa..> | 2023-08-09 02:53 | 14K | |
![[IMG]](/icons/image2.gif) | 9780134729534_TestBa..> | 2023-05-03 10:54 | 30K | |
![[IMG]](/icons/image2.gif) | 9780134730332_TestBa..> | 2023-08-08 06:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134730332_TestBa..> | 2023-08-06 13:12 | 22K | |
![[IMG]](/icons/image2.gif) | 9780134730332_TestBa..> | 2023-05-04 02:12 | 52K | |
![[IMG]](/icons/image2.gif) | 9780134730684_TestBa..> | 2023-08-05 19:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134730684_TestBa..> | 2023-08-09 02:53 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134730684_TestBa..> | 2023-05-04 02:00 | 49K | |
![[ ]](/icons/layout.gif) | 9780134730684_TestBa..> | 2023-05-04 02:00 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134731889_Soluti..> | 2023-08-06 10:20 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134731889_Soluti..> | 2023-08-05 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134731889_Soluti..> | 2023-05-04 02:04 | 37K | |
![[IMG]](/icons/image2.gif) | 9780134732831_Soluti..> | 2023-08-07 02:43 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780134732831_Soluti..> | 2023-08-12 03:36 | 14K | |
![[IMG]](/icons/image2.gif) | 9780134732831_Soluti..> | 2023-05-03 11:06 | 31K | |
![[IMG]](/icons/image2.gif) | 9780134736587_TestBa..> | 2023-08-06 03:45 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780134736587_TestBa..> | 2023-09-01 03:43 | 29K | |
![[IMG]](/icons/image2.gif) | 9780134736587_TestBa..> | 2023-05-04 02:09 | 67K | |
![[ ]](/icons/unknown.gif) | 9780134736587_TestBa..> | 2023-05-04 02:09 | 144K | |
![[IMG]](/icons/image2.gif) | 9780134738314_TestBa..> | 2023-08-06 08:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134738314_TestBa..> | 2023-09-05 03:45 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134738314_TestBa..> | 2023-05-04 01:59 | 31K | |
![[ ]](/icons/layout.gif) | 9780134738321-SOLUTI..> | 2023-05-04 02:10 | 316K | |
![[ ]](/icons/unknown.gif) | 9780134738321_HO07_T..> | 2023-05-04 02:10 | 668K | |
![[IMG]](/icons/image2.gif) | 9780134739694_Soluti..> | 2023-08-06 17:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134739694_Soluti..> | 2023-08-23 02:15 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134739694_Soluti..> | 2023-05-03 11:03 | 54K | |
![[IMG]](/icons/image2.gif) | 9780134739694_TestBa..> | 2023-08-06 16:00 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134739694_TestBa..> | 2023-08-16 05:25 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134739694_TestBa..> | 2023-05-03 11:03 | 54K | |
![[ ]](/icons/unknown.gif) | 9780134739694_TestBa..> | 2023-05-03 11:03 | 86K | |
![[ ]](/icons/unknown.gif) | 9780134739694__ft201..> | 2023-05-03 11:03 | 93K | |
![[IMG]](/icons/image2.gif) | 9780134741062_TestBa..> | 2023-08-06 05:46 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780134741062_TestBa..> | 2023-08-18 10:49 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134741062_TestBa..> | 2023-05-04 02:08 | 38K | |
![[IMG]](/icons/image2.gif) | 9780134741147_TestBa..> | 2023-08-05 01:56 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780134741147_TestBa..> | 2023-08-08 23:47 | 21K | |
![[IMG]](/icons/image2.gif) | 9780134741147_TestBa..> | 2023-05-04 02:03 | 46K | |
![[ ]](/icons/layout.gif) | 9780134743813_QBDT_2..> | 2023-05-04 01:59 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134743813_Soluti..> | 2023-08-05 06:25 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134743813_Soluti..> | 2023-08-15 16:02 | 22K | |
![[IMG]](/icons/image2.gif) | 9780134743813_Soluti..> | 2023-05-04 01:59 | 54K | |
![[ ]](/icons/layout.gif) | 9780134755380_M01_TR..> | 2023-05-03 11:17 | 375K | |
![[IMG]](/icons/image2.gif) | 9780134755380_Soluti..> | 2023-08-05 05:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780134755380_Soluti..> | 2023-08-16 15:50 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134755380_Soluti..> | 2023-05-03 11:17 | 60K | |
![[IMG]](/icons/image2.gif) | 9780134755380_TestBa..> | 2023-08-05 01:12 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780134755380_TestBa..> | 2023-08-05 14:41 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134755380_TestBa..> | 2023-05-03 11:18 | 60K | |
![[ ]](/icons/unknown.gif) | 9780134755380_TestBa..> | 2023-05-03 11:18 | 239K | |
![[ ]](/icons/layout.gif) | 9780134756363-Chapte..> | 2023-05-03 13:44 | 857K | |
![[ ]](/icons/layout.gif) | 9780134759449_TestBa..> | 2023-05-04 02:18 | 124K | |
![[ ]](/icons/unknown.gif) | 9780134762586_TestBa..> | 2023-05-03 11:11 | 217K | |
![[ ]](/icons/layout.gif) | 9780134763644_BRIGGS..> | 2023-05-03 11:22 | 1.7M | |
![[IMG]](/icons/image2.gif) | 9780134763644_Soluti..> | 2023-08-06 13:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134763644_Soluti..> | 2023-08-21 19:12 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134763644_Soluti..> | 2023-05-03 11:22 | 78K | |
![[IMG]](/icons/image2.gif) | 9780134763644_TestBa..> | 2023-08-05 05:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780134763644_TestBa..> | 2023-08-10 04:13 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134763644_TestBa..> | 2023-05-03 11:22 | 78K | |
![[ ]](/icons/layout.gif) | 9780134763705_TestBa..> | 2023-05-03 13:44 | 200K | |
![[ ]](/icons/layout.gif) | 9780134765631_TestBa..> | 2023-05-03 11:22 | 4.7M | |
![[ ]](/icons/unknown.gif) | 9780134779263_TestBa..> | 2023-05-03 13:44 | 413K | |
![[IMG]](/icons/image2.gif) | 9780134785554_Soluti..> | 2023-08-05 05:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134785554_Soluti..> | 2023-08-05 14:41 | 18K | |
![[IMG]](/icons/image2.gif) | 9780134785554_Soluti..> | 2023-05-04 02:05 | 43K | |
![[ ]](/icons/compressed.gif) | 9780134785554_Soluti..> | 2023-05-04 02:05 | 301K | |
![[IMG]](/icons/image2.gif) | 9780134785554_TestBa..> | 2023-08-08 23:54 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134785554_TestBa..> | 2023-08-05 03:43 | 18K | |
![[IMG]](/icons/image2.gif) | 9780134785554_TestBa..> | 2023-05-04 02:05 | 43K | |
![[ ]](/icons/unknown.gif) | 9780134785554_TestBa..> | 2023-05-04 02:05 | 63K | |
![[ ]](/icons/unknown.gif) | 9780134792897_Causey..> | 2023-05-04 01:47 | 31K | |
![[IMG]](/icons/image2.gif) | 9780134792897_TestBa..> | 2023-08-05 01:52 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134792897_TestBa..> | 2023-08-24 21:55 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134792897_TestBa..> | 2023-05-04 01:48 | 42K | |
![[IMG]](/icons/image2.gif) | 9780134794105_TestBa..> | 2023-08-06 08:44 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134794105_TestBa..> | 2023-08-22 15:02 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134794105_TestBa..> | 2023-05-03 11:15 | 36K | |
![[IMG]](/icons/image2.gif) | 9780134794242_TestBa..> | 2023-08-07 07:23 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780134794242_TestBa..> | 2023-10-29 06:30 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134794242_TestBa..> | 2023-05-03 11:13 | 57K | |
![[ ]](/icons/unknown.gif) | 9780134794242_TestBa..> | 2023-05-03 11:13 | 298K | |
![[IMG]](/icons/image2.gif) | 9780134796956_TestBa..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780134796956_TestBa..> | 2023-10-29 06:30 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134796956_TestBa..> | 2023-05-04 01:59 | 100K | |
![[IMG]](/icons/image2.gif) | 9780134800318_TestBa..> | 2023-08-05 02:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134800318_TestBa..> | 2023-08-08 06:27 | 22K | |
![[IMG]](/icons/image2.gif) | 9780134800318_TestBa..> | 2023-05-04 02:07 | 54K | |
![[IMG]](/icons/image2.gif) | 9780134802763_TestBa..> | 2023-08-08 06:41 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780134802763_TestBa..> | 2023-10-29 06:30 | 33K | |
![[IMG]](/icons/image2.gif) | 9780134802763_TestBa..> | 2023-05-04 02:04 | 82K | |
![[ ]](/icons/layout.gif) | 9780134804675_TestBa..> | 2023-05-03 11:24 | 809K | |
![[IMG]](/icons/image2.gif) | 9780134831695_Soluti..> | 2023-08-08 07:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134831695_Soluti..> | 2023-08-15 11:23 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134831695_Soluti..> | 2023-05-04 02:25 | 36K | |
![[ ]](/icons/layout.gif) | 9780134831695_Soluti..> | 2023-05-04 02:25 | 833K | |
![[IMG]](/icons/image2.gif) | 9780134831695_TestBa..> | 2023-08-05 01:27 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134831695_TestBa..> | 2023-08-05 21:01 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134831695_TestBa..> | 2023-05-04 02:19 | 36K | |
![[ ]](/icons/unknown.gif) | 9780134831695_TestBa..> | 2023-05-04 02:19 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134832210_TestBa..> | 2023-08-06 08:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134832210_TestBa..> | 2023-08-24 03:18 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134832210_TestBa..> | 2023-05-03 10:57 | 40K | |
![[ ]](/icons/unknown.gif) | 9780134832210_woolfo..> | 2023-05-03 10:56 | 62K | |
![[ ]](/icons/layout.gif) | 9780134833163_kw_fa5..> | 2023-05-04 02:26 | 264K | |
![[IMG]](/icons/image2.gif) | 9780134833644-594x60..> | 2023-08-10 04:13 | 23K | |
![[IMG]](/icons/image2.gif) | 9780134833644-594x60..> | 2023-05-03 11:00 | 75K | |
![[IMG]](/icons/image2.gif) | 9780134833644-594x60..> | 2023-08-24 02:13 | 23K | |
![[IMG]](/icons/image2.gif) | 9780134833644-594x60..> | 2023-05-03 11:01 | 75K | |
![[IMG]](/icons/image2.gif) | 9780134848181_TestBa..> | 2023-08-06 09:41 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780134848181_TestBa..> | 2023-08-15 06:50 | 29K | |
![[IMG]](/icons/image2.gif) | 9780134848181_TestBa..> | 2023-05-04 01:55 | 75K | |
![[IMG]](/icons/image2.gif) | 9780134856230_TestBa..> | 2023-08-05 02:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780134856230_TestBa..> | 2023-08-05 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 9780134856230_TestBa..> | 2023-05-03 11:18 | 36K | |
![[IMG]](/icons/image2.gif) | 9780134858517_TestBa..> | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134858517_TestBa..> | 2023-09-05 10:14 | 16K | |
![[IMG]](/icons/image2.gif) | 9780134858517_TestBa..> | 2023-05-04 02:09 | 42K | |
![[IMG]](/icons/image2.gif) | 9780134862644_Soluti..> | 2023-08-06 08:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780134862644_Soluti..> | 2023-08-24 02:13 | 14K | |
![[IMG]](/icons/image2.gif) | 9780134862644_Soluti..> | 2023-05-03 11:21 | 28K | |
![[ ]](/icons/layout.gif) | 9780134862644_Soluti..> | 2023-05-03 11:21 | 839K | |
![[IMG]](/icons/image2.gif) | 9780134868189_TestBa..> | 2023-08-05 15:33 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780134868189_TestBa..> | 2023-08-11 01:46 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134868189_TestBa..> | 2023-05-04 02:03 | 61K | |
![[ ]](/icons/unknown.gif) | 9780134868189_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134871073_TestBa..> | 2023-08-05 03:39 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134871073_TestBa..> | 2023-08-14 19:05 | 18K | |
![[IMG]](/icons/image2.gif) | 9780134871073_TestBa..> | 2023-05-03 11:11 | 40K | |
![[IMG]](/icons/image2.gif) | 9780134877198_Soluti..> | 2023-08-05 04:34 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9780134877198_Soluti..> | 2023-08-05 17:23 | 20K | |
![[IMG]](/icons/image2.gif) | 9780134877198_Soluti..> | 2023-05-04 01:47 | 39K | |
![[IMG]](/icons/image2.gif) | 9780134878102_TestBa..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134878102_TestBa..> | 2023-08-05 01:54 | 25K | |
![[IMG]](/icons/image2.gif) | 9780134878102_TestBa..> | 2023-05-03 11:16 | 60K | |
![[IMG]](/icons/image2.gif) | 9780134880693_TestBa..> | 2023-08-05 05:17 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780134880693_TestBa..> | 2023-08-13 22:07 | 22K | |
![[IMG]](/icons/image2.gif) | 9780134880693_TestBa..> | 2023-05-04 01:48 | 55K | |
![[ ]](/icons/unknown.gif) | 9780134880693_TestBa..> | 2023-05-04 01:48 | 409K | |
![[ ]](/icons/layout.gif) | 9780134883847_TestBa..> | 2023-05-04 02:13 | 0 | |
![[IMG]](/icons/image2.gif) | 9780134887456_Soluti..> | 2023-08-06 07:48 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780134887456_Soluti..> | 2023-08-14 00:56 | 24K | |
![[IMG]](/icons/image2.gif) | 9780134887456_Soluti..> | 2023-05-04 02:20 | 52K | |
![[IMG]](/icons/image2.gif) | 9780134888989_TestBa..> | 2023-08-06 11:17 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780134888989_TestBa..> | 2023-08-07 18:53 | 26K | |
![[IMG]](/icons/image2.gif) | 9780134888989_TestBa..> | 2023-05-04 01:47 | 58K | |
![[ ]](/icons/unknown.gif) | 9780134888989_TestBa..> | 2023-05-04 01:47 | 402K | |
![[IMG]](/icons/image2.gif) | 9780134890265_Soluti..> | 2023-08-08 06:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780134890265_Soluti..> | 2023-08-12 04:49 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134890265_Soluti..> | 2023-05-03 10:57 | 30K | |
![[IMG]](/icons/image2.gif) | 9780134890265_TestBa..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780134890265_TestBa..> | 2023-08-16 22:56 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134890265_TestBa..> | 2023-05-03 10:57 | 30K | |
![[ ]](/icons/unknown.gif) | 9780134890371_Seiler..> | 2023-05-03 13:42 | 49K | |
![[ ]](/icons/unknown.gif) | 9780134890401_Soluti..> | 2023-05-04 02:15 | 65K | |
![[IMG]](/icons/image2.gif) | 9780134891514_TestBa..> | 2023-08-05 14:40 | 5.0K | |
![[IMG]](/icons/image2.gif) | 9780134891514_TestBa..> | 2023-08-29 04:54 | 30K | |
![[IMG]](/icons/image2.gif) | 9780134891514_TestBa..> | 2023-05-04 01:56 | 73K | |
![[ ]](/icons/unknown.gif) | 9780134891514_TestBa..> | 2023-05-04 01:56 | 267K | |
![[ ]](/icons/unknown.gif) | 9780134893662_TestBa..> | 2023-05-03 11:06 | 269K | |
![[ ]](/icons/layout.gif) | 9780134896441_ABC10e..> | 2023-05-04 01:53 | 317K | |
![[IMG]](/icons/image2.gif) | 9780134896441_Soluti..> | 2023-08-06 03:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134896441_Soluti..> | 2023-08-06 12:17 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134896441_Soluti..> | 2023-05-04 01:53 | 45K | |
![[IMG]](/icons/image2.gif) | 9780134896441_TestBa..> | 2023-08-08 14:32 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780134896441_TestBa..> | 2023-09-08 15:33 | 19K | |
![[IMG]](/icons/image2.gif) | 9780134896441_TestBa..> | 2023-05-04 01:54 | 45K | |
![[ ]](/icons/layout.gif) | 9780134896441_TestBa..> | 2023-05-04 01:54 | 224K | |
![[ ]](/icons/unknown.gif) | 9780134896489_TestBa..> | 2023-05-03 13:44 | 1.5M | |
![[IMG]](/icons/image2.gif) | 9780134898773_TestBa..> | 2023-08-08 06:38 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780134898773_TestBa..> | 2023-08-20 19:36 | 28K | |
![[IMG]](/icons/image2.gif) | 9780134898773_TestBa..> | 2023-05-04 02:27 | 68K | |
![[ ]](/icons/unknown.gif) | 9780134898773_TestBa..> | 2023-05-04 02:27 | 86K | |
![[ ]](/icons/unknown.gif) | 9780134899701_Soluti..> | 2023-05-03 13:42 | 1.1M | |
![[ ]](/icons/layout.gif) | 9780134900216_Green_..> | 2023-05-04 02:15 | 486K | |
![[IMG]](/icons/image2.gif) | 9780134900216_Soluti..> | 2023-08-08 07:31 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134900216_Soluti..> | 2023-08-05 21:03 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134900216_Soluti..> | 2023-05-04 02:15 | 33K | |
![[IMG]](/icons/image2.gif) | 9780134900216_TestBa..> | 2023-08-05 01:56 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780134900216_TestBa..> | 2023-09-12 22:07 | 15K | |
![[IMG]](/icons/image2.gif) | 9780134900216_TestBa..> | 2023-05-04 02:15 | 33K | |
![[ ]](/icons/layout.gif) | 9780134900216_TestBa..> | 2023-05-04 02:15 | 137K | |
![[IMG]](/icons/image2.gif) | 9780134988535_TestBa..> | 2023-08-06 05:49 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780134988535_TestBa..> | 2023-11-01 05:03 | 23K | |
![[IMG]](/icons/image2.gif) | 9780134988535_TestBa..> | 2023-05-04 02:03 | 54K | |
![[ ]](/icons/unknown.gif) | 9780134988696-chapte..> | 2023-05-03 13:41 | 62K | |
![[ ]](/icons/layout.gif) | 9780134988801_TestBa..> | 2023-05-03 13:43 | 401K | |
![[IMG]](/icons/image2.gif) | 9780135079256-100x10..> | 2023-08-05 05:30 | 5.3K | |
![[IMG]](/icons/image2.gif) | 9780135079256.jpg | 2023-05-03 10:06 | 14K | |
![[ ]](/icons/layout.gif) | 9780135084076_Soluti..> | 2023-05-04 02:25 | 0 | |
![[IMG]](/icons/image2.gif) | 9780135109786-100x10..> | 2023-08-05 15:29 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9780135109786.jpg | 2023-05-03 09:50 | 13K | |
![[ ]](/icons/layout.gif) | 9780135126776_tb_ch2..> | 2023-05-04 02:11 | 281K | |
![[ ]](/icons/unknown.gif) | 9780135154663_TB_Ch1..> | 2023-05-04 01:58 | 0 | |
![[ ]](/icons/layout.gif) | 9780135160619_Keown_..> | 2023-05-03 13:43 | 307K | |
![[ ]](/icons/layout.gif) | 9780135160619_TestBa..> | 2023-05-03 13:43 | 154K | |
![[ ]](/icons/unknown.gif) | 9780135161081_Soluti..> | 2023-05-03 13:43 | 194K | |
![[ ]](/icons/unknown.gif) | 9780135161081_TestBa..> | 2023-05-03 13:43 | 56K | |
![[ ]](/icons/layout.gif) | 9780135163047_M01_SU..> | 2023-05-03 13:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | 9780135163054_TestBa..> | 2023-08-05 05:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780135163054_TestBa..> | 2023-08-20 18:55 | 17K | |
![[IMG]](/icons/image2.gif) | 9780135163054_TestBa..> | 2023-05-04 02:08 | 38K | |
![[IMG]](/icons/image2.gif) | 9780135163504_TestBa..> | 2023-08-05 16:27 | 1.2K | |
![[IMG]](/icons/image2.gif) | 9780135163504_TestBa..> | 2023-08-07 18:53 | 5.3K | |
![[IMG]](/icons/image2.gif) | 9780135163504_TestBa..> | 2023-05-04 02:22 | 29K | |
![[ ]](/icons/unknown.gif) | 9780135163504_TestBa..> | 2023-05-04 02:22 | 488K | |
![[ ]](/icons/unknown.gif) | 9780135164204_Dunn_4..> | 2023-05-04 01:56 | 65K | |
![[IMG]](/icons/image2.gif) | 9780135164204_TestBa..> | 2023-08-05 03:40 | 8.4K | |
![[IMG]](/icons/image2.gif) | 9780135164204_TestBa..> | 2023-08-28 17:05 | 17K | |
![[IMG]](/icons/image2.gif) | 9780135164204_TestBa..> | 2023-05-04 01:56 | 34K | |
![[IMG]](/icons/image2.gif) | 9780135164686_TestBa..> | 2023-08-05 17:19 | 10K | |
![[IMG]](/icons/image2.gif) | 9780135164686_TestBa..> | 2023-08-05 04:37 | 25K | |
![[IMG]](/icons/image2.gif) | 9780135164686_TestBa..> | 2023-05-04 02:03 | 48K | |
![[ ]](/icons/unknown.gif) | 9780135164686_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9780135164730_Soluti..> | 2023-08-05 16:24 | 10K | |
![[IMG]](/icons/image2.gif) | 9780135164730_Soluti..> | 2023-08-09 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 9780135164730_Soluti..> | 2023-05-04 01:49 | 55K | |
![[IMG]](/icons/image2.gif) | 9780135164730_TestBa..> | 2023-08-08 22:01 | 10K | |
![[IMG]](/icons/image2.gif) | 9780135164730_TestBa..> | 2023-09-11 04:22 | 28K | |
![[IMG]](/icons/image2.gif) | 9780135164730_TestBa..> | 2023-05-04 01:49 | 55K | |
![[ ]](/icons/unknown.gif) | 9780135166369_TestBa..> | 2023-05-03 13:43 | 176K | |
![[IMG]](/icons/image2.gif) | 9780135166925_TestBa..> | 2023-08-05 16:22 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9780135166925_TestBa..> | 2023-08-28 17:05 | 34K | |
![[IMG]](/icons/image2.gif) | 9780135166925_TestBa..> | 2023-05-04 02:19 | 75K | |
![[ ]](/icons/unknown.gif) | 9780135166925_TestBa..> | 2023-05-04 02:19 | 29K | |
![[IMG]](/icons/image2.gif) | 9780135166932_TestBa..> | 2023-08-05 15:43 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780135166932_TestBa..> | 2023-09-18 20:17 | 15K | |
![[IMG]](/icons/image2.gif) | 9780135166932_TestBa..> | 2023-05-04 02:14 | 22K | |
![[ ]](/icons/unknown.gif) | 9780135166932_TestBa..> | 2023-05-04 02:14 | 354K | |
![[ ]](/icons/unknown.gif) | 9780135167304_TestBa..> | 2023-05-04 02:01 | 474K | |
![[IMG]](/icons/image2.gif) | 9780135172759_Soluti..> | 2023-08-06 10:20 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780135172759_Soluti..> | 2023-08-18 04:17 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135172759_Soluti..> | 2023-05-04 02:23 | 35K | |
![[ ]](/icons/unknown.gif) | 9780135172759_Soluti..> | 2023-05-04 02:23 | 39K | |
![[IMG]](/icons/image2.gif) | 9780135173602_TestBa..> | 2023-08-06 10:17 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780135173602_TestBa..> | 2023-08-09 01:54 | 27K | |
![[IMG]](/icons/image2.gif) | 9780135173602_TestBa..> | 2023-05-04 02:08 | 68K | |
![[ ]](/icons/unknown.gif) | 9780135176641_OConno..> | 2023-05-04 01:54 | 24K | |
![[IMG]](/icons/image2.gif) | 9780135176641_TestBa..> | 2023-08-06 07:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780135176641_TestBa..> | 2023-08-26 22:34 | 19K | |
![[IMG]](/icons/image2.gif) | 9780135176641_TestBa..> | 2023-05-04 01:54 | 26K | |
![[ ]](/icons/unknown.gif) | 9780135180860_TestBa..> | 2023-05-04 02:00 | 60K | |
![[IMG]](/icons/image2.gif) | 9780135183816_TestBa..> | 2023-08-06 03:34 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9780135183816_TestBa..> | 2023-09-09 03:32 | 31K | |
![[IMG]](/icons/image2.gif) | 9780135183816_TestBa..> | 2023-05-04 02:09 | 64K | |
![[ ]](/icons/unknown.gif) | 9780135183816_TestBa..> | 2023-05-04 02:09 | 64K | |
![[IMG]](/icons/image2.gif) | 9780135186237_TestBa..> | 2023-08-05 01:51 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9780135186237_TestBa..> | 2023-08-08 14:29 | 29K | |
![[IMG]](/icons/image2.gif) | 9780135186237_TestBa..> | 2023-05-04 02:18 | 63K | |
![[ ]](/icons/unknown.gif) | 9780135186237_TestBa..> | 2023-05-04 02:18 | 343K | |
![[ ]](/icons/layout.gif) | 9780135186282_TestBa..> | 2023-05-04 02:18 | 67K | |
![[ ]](/icons/unknown.gif) | 9780135187753_Soluti..> | 2023-05-03 13:43 | 62K | |
![[IMG]](/icons/image2.gif) | 9780135188026_TestBa..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780135188026_TestBa..> | 2023-08-09 20:29 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135188026_TestBa..> | 2023-05-04 01:48 | 35K | |
![[ ]](/icons/unknown.gif) | 9780135188026_TestBa..> | 2023-05-04 02:09 | 415K | |
![[IMG]](/icons/image2.gif) | 9780135188149_Soluit..> | 2023-08-09 09:07 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780135188149_Soluit..> | 2023-08-15 11:23 | 28K | |
![[IMG]](/icons/image2.gif) | 9780135188149_Soluit..> | 2023-05-04 01:49 | 76K | |
![[IMG]](/icons/image2.gif) | 9780135191767_TestBa..> | 2023-08-05 17:22 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780135191767_TestBa..> | 2023-08-24 13:16 | 27K | |
![[IMG]](/icons/image2.gif) | 9780135191767_TestBa..> | 2023-05-03 11:03 | 39K | |
![[IMG]](/icons/image2.gif) | 9780135191798_Soluti..> | 2023-08-05 02:46 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780135191798_Soluti..> | 2023-08-14 23:08 | 30K | |
![[IMG]](/icons/image2.gif) | 9780135191798_Soluti..> | 2023-05-04 02:24 | 72K | |
![[IMG]](/icons/image2.gif) | 9780135191798_TestBa..> | 2023-08-06 12:11 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780135191798_TestBa..> | 2023-09-04 20:54 | 30K | |
![[IMG]](/icons/image2.gif) | 9780135191798_TestBa..> | 2023-05-04 02:05 | 72K | |
![[ ]](/icons/unknown.gif) | 9780135191798_TestBa..> | 2023-05-04 02:05 | 104K | |
![[ ]](/icons/unknown.gif) | 9780135191798_laudon..> | 2023-05-04 02:24 | 132K | |
![[IMG]](/icons/image2.gif) | 9780135192016_TestBa..> | 2023-08-08 16:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135192016_TestBa..> | 2023-08-21 07:47 | 23K | |
![[IMG]](/icons/image2.gif) | 9780135192016_TestBa..> | 2023-05-04 01:51 | 48K | |
![[IMG]](/icons/image2.gif) | 9780135192146_TestBa..> | 2023-08-05 03:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780135192146_TestBa..> | 2023-08-08 23:47 | 13K | |
![[IMG]](/icons/image2.gif) | 9780135192146_TestBa..> | 2023-05-04 02:02 | 39K | |
![[ ]](/icons/unknown.gif) | 9780135192689_CH01_T..> | 2023-05-03 11:02 | 33K | |
![[IMG]](/icons/image2.gif) | 9780135196007_Soluti..> | 2023-08-09 02:05 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780135196007_Soluti..> | 2023-08-15 07:57 | 19K | |
![[IMG]](/icons/image2.gif) | 9780135196007_Soluti..> | 2023-05-04 01:53 | 39K | |
![[IMG]](/icons/image2.gif) | 9780135197349_TestBa..> | 2023-08-05 01:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780135197349_TestBa..> | 2023-08-16 05:25 | 23K | |
![[IMG]](/icons/image2.gif) | 9780135197349_TestBa..> | 2023-05-03 11:02 | 51K | |
![[ ]](/icons/layout.gif) | 9780135197349_TestBa..> | 2023-05-03 11:02 | 236K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-08-06 03:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-08-23 02:15 | 22K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-05-04 01:48 | 50K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-08-23 02:15 | 22K | |
![[IMG]](/icons/image2.gif) | 9780135197363_Soluti..> | 2023-05-03 11:02 | 50K | |
![[IMG]](/icons/image2.gif) | 9780135197363_TestBa..> | 2023-08-05 02:03 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135197363_TestBa..> | 2023-08-16 05:25 | 22K | |
![[IMG]](/icons/image2.gif) | 9780135197363_TestBa..> | 2023-05-04 01:48 | 50K | |
![[ ]](/icons/unknown.gif) | 9780135197363_TestBa..> | 2023-05-04 01:48 | 103K | |
![[ ]](/icons/unknown.gif) | 9780135197363_ft2020..> | 2023-05-04 01:48 | 98K | |
![[IMG]](/icons/image2.gif) | 9780135199978_Soluti..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135199978_Soluti..> | 2023-05-04 02:02 | 38K | |
![[IMG]](/icons/image2.gif) | 9780135199978_TestBa..> | 2023-08-05 19:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135199978_TestBa..> | 2023-05-04 02:02 | 38K | |
![[ ]](/icons/unknown.gif) | 9780135205570-chapte..> | 2023-05-03 10:53 | 252K | |
![[IMG]](/icons/image2.gif) | 9780135205570_TestBa..> | 2023-08-09 13:53 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135205570_TestBa..> | 2023-08-11 01:04 | 17K | |
![[IMG]](/icons/image2.gif) | 9780135205570_TestBa..> | 2023-05-03 10:53 | 40K | |
![[IMG]](/icons/image2.gif) | 9780135210529_Soluti..> | 2023-08-05 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780135210529_Soluti..> | 2023-08-08 14:34 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135210529_Soluti..> | 2023-05-03 10:55 | 36K | |
![[ ]](/icons/unknown.gif) | 9780135212172_Hooley..> | 2023-05-04 02:10 | 93K | |
![[ ]](/icons/unknown.gif) | 9780135212172_Hooley..> | 2023-05-03 13:43 | 111K | |
![[IMG]](/icons/image2.gif) | 9780135212172_Soluti..> | 2023-08-05 03:41 | 5.3K | |
![[IMG]](/icons/image2.gif) | 9780135212172_Soluti..> | 2023-08-21 06:52 | 22K | |
![[IMG]](/icons/image2.gif) | 9780135212172_Soluti..> | 2023-05-04 02:10 | 50K | |
![[ ]](/icons/unknown.gif) | 9780135212622_TestBa..> | 2023-05-03 13:42 | 684K | |
![[IMG]](/icons/image2.gif) | 9780135217955_TestBa..> | 2023-08-05 16:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135217955_TestBa..> | 2023-09-09 03:32 | 20K | |
![[IMG]](/icons/image2.gif) | 9780135217955_TestBa..> | 2023-05-04 02:13 | 43K | |
![[ ]](/icons/unknown.gif) | 9780135217955_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9780135218334_TestBa..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780135218334_TestBa..> | 2023-10-24 18:45 | 23K | |
![[IMG]](/icons/image2.gif) | 9780135218334_TestBa..> | 2023-05-03 11:01 | 55K | |
![[ ]](/icons/unknown.gif) | 9780135218334_TestBa..> | 2023-05-03 11:01 | 109K | |
![[IMG]](/icons/image2.gif) | 9780135225486_Soluti..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780135225486_Soluti..> | 2023-08-22 19:18 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135225486_Soluti..> | 2023-05-04 02:28 | 33K | |
![[ ]](/icons/unknown.gif) | 9780135225486_Soluti..> | 2023-05-04 02:28 | 35K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-08-05 16:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-08-31 13:55 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-05-04 02:28 | 33K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-08-05 04:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-08-31 13:55 | 16K | |
![[IMG]](/icons/image2.gif) | 9780135225486_TestBa..> | 2023-05-04 01:57 | 33K | |
![[ ]](/icons/unknown.gif) | 9780135225486_TestBa..> | 2023-05-04 02:28 | 36K | |
![[ ]](/icons/layout.gif) | 9780135229996_Gould_..> | 2023-05-04 02:21 | 858K | |
![[IMG]](/icons/image2.gif) | 9780135229996_TestBa..> | 2023-08-05 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780135229996_TestBa..> | 2023-08-20 18:55 | 29K | |
![[IMG]](/icons/image2.gif) | 9780135229996_TestBa..> | 2023-05-04 02:22 | 75K | |
![[IMG]](/icons/image2.gif) | 9780135230497-518x60..> | 2023-08-05 16:28 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135230497-518x60..> | 2023-09-19 02:11 | 24K | |
![[IMG]](/icons/image2.gif) | 9780135230497-518x60..> | 2023-05-04 02:20 | 81K | |
![[IMG]](/icons/image2.gif) | 9780135230497_TestBa..> | 2023-08-06 07:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135230497_TestBa..> | 2023-09-19 02:11 | 24K | |
![[IMG]](/icons/image2.gif) | 9780135230497_TestBa..> | 2023-05-04 02:08 | 58K | |
![[IMG]](/icons/image2.gif) | 9780135233344-_Test-..> | 2023-08-05 16:28 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780135233344-_Test-..> | 2023-08-28 22:18 | 25K | |
![[IMG]](/icons/image2.gif) | 9780135233344-_Test-..> | 2023-05-04 02:20 | 36K | |
![[ ]](/icons/unknown.gif) | 9780135233344_TestBa..> | 2023-05-04 02:20 | 67K | |
![[ ]](/icons/layout.gif) | 9780135240793-sample..> | 2023-05-04 02:04 | 618K | |
![[IMG]](/icons/image2.gif) | 9780135240793_TestBa..> | 2023-08-06 19:14 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780135240793_TestBa..> | 2023-10-29 06:30 | 15K | |
![[IMG]](/icons/image2.gif) | 9780135240793_TestBa..> | 2023-05-04 02:04 | 33K | |
![[ ]](/icons/compressed.gif) | 9780135245859_Soluti..> | 2023-05-03 13:44 | 190K | |
![[IMG]](/icons/image2.gif) | 9780135321133_TestBa..> | 2023-08-05 03:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135321133_TestBa..> | 2023-08-30 20:27 | 20K | |
![[IMG]](/icons/image2.gif) | 9780135321133_TestBa..> | 2023-05-04 01:55 | 48K | |
![[ ]](/icons/unknown.gif) | 9780135322857_Soluti..> | 2023-05-03 11:14 | 248K | |
![[IMG]](/icons/image2.gif) | 9780135322857_Soluti..> | 2023-08-05 06:19 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780135322857_Soluti..> | 2023-08-10 19:39 | 25K | |
![[IMG]](/icons/image2.gif) | 9780135322857_Soluti..> | 2023-05-03 11:14 | 64K | |
![[IMG]](/icons/image2.gif) | 9780135413326_TestBa..> | 2023-08-05 19:10 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780135413326_TestBa..> | 2023-08-05 17:22 | 20K | |
![[IMG]](/icons/image2.gif) | 9780135413326_TestBa..> | 2023-05-04 02:08 | 46K | |
![[ ]](/icons/layout.gif) | 9780135581735_TestBa..> | 2023-05-03 13:42 | 206K | |
![[IMG]](/icons/image2.gif) | 9780135651568_TestBa..> | 2023-08-05 06:25 | 21K | |
![[IMG]](/icons/image2.gif) | 9780135651568_TestBa..> | 2023-09-05 03:45 | 122K | |
![[IMG]](/icons/image2.gif) | 9780135651568_TestBa..> | 2023-05-04 02:18 | 312K | |
![[ ]](/icons/layout.gif) | 9780135651568_TestBa..> | 2023-05-04 02:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | 9780135780275_TestBa..> | 2023-08-05 01:51 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9780135780275_TestBa..> | 2023-08-11 03:44 | 11K | |
![[IMG]](/icons/image2.gif) | 9780135780275_TestBa..> | 2023-05-04 02:26 | 21K | |
![[ ]](/icons/layout.gif) | 9780135780275_TestBa..> | 2023-05-04 02:26 | 0 | |
![[IMG]](/icons/image2.gif) | 9780136015727-100x10..> | 2023-08-05 03:40 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780136015727.gif | 2023-05-03 10:14 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9780136033134-100x10..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780136033134.jpg | 2023-05-04 02:11 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780136036371-100x10..> | 2023-08-05 16:28 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780136036371.jpg | 2023-05-03 11:01 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9780136126638-100x10..> | 2023-08-06 08:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780136126638.jpg | 2023-05-03 10:25 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780136500810_Soluti..> | 2023-08-05 02:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780136500810_Soluti..> | 2023-08-17 09:42 | 14K | |
![[IMG]](/icons/image2.gif) | 9780136500810_Soluti..> | 2023-05-04 01:48 | 35K | |
![[IMG]](/icons/image2.gif) | 9780136500810_TestBa..> | 2023-08-05 01:56 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780136500810_TestBa..> | 2023-08-30 18:06 | 14K | |
![[IMG]](/icons/image2.gif) | 9780136500810_TestBa..> | 2023-05-04 01:48 | 35K | |
![[IMG]](/icons/image2.gif) | 9780136679110_Soluti..> | 2023-08-08 21:59 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780136679110_Soluti..> | 2023-08-10 16:04 | 15K | |
![[IMG]](/icons/image2.gif) | 9780136679110_Soluti..> | 2023-05-03 11:12 | 32K | |
![[ ]](/icons/compressed.gif) | 9780136679110_Soluti..> | 2023-05-03 11:12 | 2.8M | |
![[IMG]](/icons/image2.gif) | 9780136679110_TestBa..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780136679110_TestBa..> | 2023-08-20 22:38 | 15K | |
![[IMG]](/icons/image2.gif) | 9780136679110_TestBa..> | 2023-05-03 11:13 | 32K | |
![[ ]](/icons/unknown.gif) | 9780136679110_TestBa..> | 2023-05-03 11:13 | 22K | |
![[IMG]](/icons/image2.gif) | 9780137002696-100x10..> | 2023-08-05 01:56 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780137002696.jpg | 2023-05-03 10:47 | 5.2K | |
![[ ]](/icons/compressed.gif) | 9780137066735-TEST-B..> | 2023-05-03 10:37 | 16K | |
![[IMG]](/icons/image2.gif) | 9780137134731-100x10..> | 2023-08-05 03:41 | 6.0K | |
![[IMG]](/icons/image2.gif) | 9780137134731.gif | 2023-05-03 09:57 | 11K | |
![[IMG]](/icons/image2.gif) | 9780137444267-100x10..> | 2023-08-05 02:46 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780137444267.jpg | 2023-05-03 09:50 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780138147570-100x10..> | 2023-08-05 14:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780138147570.jpg | 2023-05-03 10:09 | 5.0K | |
![[ ]](/icons/layout.gif) | 9780176502416_TestBa..> | 2023-05-04 02:24 | 99K | |
![[IMG]](/icons/image2.gif) | 9780176502416_Test_B..> | 2023-08-06 12:11 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780176502416_Test_B..> | 2023-08-10 18:33 | 18K | |
![[IMG]](/icons/image2.gif) | 9780176502416_Test_B..> | 2023-05-04 02:24 | 19K | |
![[ ]](/icons/layout.gif) | 9780176515430_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9780176583057_TestBa..> | 2023-05-04 02:13 | 0 | |
![[ ]](/icons/unknown.gif) | 9780176700003_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9780176703486_TestBa..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780176703486_TestBa..> | 2023-08-06 17:25 | 13K | |
![[IMG]](/icons/image2.gif) | 9780176703486_TestBa..> | 2023-05-04 02:18 | 15K | |
![[ ]](/icons/unknown.gif) | 9780176703486_TestBa..> | 2023-05-04 02:18 | 58K | |
![[ ]](/icons/unknown.gif) | 9780176705480_TestBa..> | 2023-05-04 02:24 | 31K | |
![[IMG]](/icons/image2.gif) | 9780176798079_TestBa..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780176798079_TestBa..> | 2023-05-04 01:50 | 45K | |
![[ ]](/icons/unknown.gif) | 9780176798079_TestBa..> | 2023-05-04 01:50 | 31K | |
![[IMG]](/icons/image2.gif) | 9780176832186_Soluti..> | 2023-08-06 09:42 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780176832186_Soluti..> | 2023-08-09 10:17 | 20K | |
![[IMG]](/icons/image2.gif) | 9780176832186_Soluti..> | 2023-05-04 02:20 | 24K | |
![[ ]](/icons/unknown.gif) | 9780176832186_Soluti..> | 2023-05-04 02:20 | 64K | |
![[ ]](/icons/unknown.gif) | 9780176873219_TestBa..> | 2023-05-03 13:42 | 47K | |
![[IMG]](/icons/image2.gif) | 9780190847609_TestBa..> | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780190847609_TestBa..> | 2023-08-06 12:11 | 18K | |
![[IMG]](/icons/image2.gif) | 9780190847609_TestBa..> | 2023-05-04 01:49 | 25K | |
![[ ]](/icons/unknown.gif) | 9780190847623_TestBa..> | 2023-05-04 01:49 | 71K | |
![[IMG]](/icons/image2.gif) | 9780205179664_TestBa..> | 2023-08-05 05:30 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780205179664_TestBa..> | 2023-08-30 09:45 | 21K | |
![[IMG]](/icons/image2.gif) | 9780205179664_TestBa..> | 2023-05-04 02:11 | 28K | |
![[IMG]](/icons/image2.gif) | 9780205209279-100x10..> | 2023-08-05 16:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780205209279-300x30..> | 2023-09-20 09:04 | 22K | |
![[IMG]](/icons/image2.gif) | 9780205209279.jpg | 2023-05-03 10:19 | 31K | |
![[IMG]](/icons/image2.gif) | 9780205626755-100x10..> | 2023-08-08 06:43 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780205626755-300x30..> | 2023-08-15 04:42 | 20K | |
![[IMG]](/icons/image2.gif) | 9780205626755.jpg | 2023-05-03 11:12 | 115K | |
![[ ]](/icons/layout.gif) | 9780205798780_TestBa..> | 2023-05-04 02:19 | 69K | |
![[IMG]](/icons/image2.gif) | 9780205825769-100x10..> | 2023-08-08 06:46 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780205825769.jpg | 2023-05-03 09:38 | 7.2K | |
![[ ]](/icons/layout.gif) | 9780205912964_TestBa..> | 2023-05-03 09:26 | 181K | |
![[ ]](/icons/layout.gif) | 9780205957606-tspl.pdf | 2023-05-03 10:37 | 271K | |
![[ ]](/icons/unknown.gif) | 9780205991655_Soluti..> | 2023-05-04 02:01 | 0 | |
![[IMG]](/icons/image2.gif) | 9780262533058-100x10..> | 2023-08-05 05:15 | 16K | |
![[IMG]](/icons/image2.gif) | 9780262533058-300x30..> | 2023-08-05 14:40 | 27K | |
![[IMG]](/icons/image2.gif) | 9780262533058.jpg | 2023-05-04 02:24 | 46K | |
![[IMG]](/icons/image2.gif) | 9780273760184-100x10..> | 2023-08-08 14:33 | 1.9K | |
![[IMG]](/icons/image2.gif) | 9780273760184-300x30..> | 2023-08-24 21:55 | 9.3K | |
![[IMG]](/icons/image2.gif) | 9780273760184.jpg | 2023-05-03 10:41 | 26K | |
![[IMG]](/icons/image2.gif) | 9780321123916-100x10..> | 2023-08-05 04:37 | 2.0K | |
![[IMG]](/icons/image2.gif) | 9780321123916.jpg | 2023-05-03 10:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780321286727-100x10..> | 2023-08-05 14:39 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780321286727.jpg | 2023-05-03 10:04 | 8.0K | |
![[ ]](/icons/layout.gif) | 9780321452931_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9780321501110-100x10..> | 2023-08-06 11:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780321501110.jpg | 2023-05-03 10:49 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9780321533487-100x10..> | 2023-08-06 16:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780321533487.jpg | 2023-05-03 10:29 | 4.8K | |
![[ ]](/icons/layout.gif) | 9780321541642_TestBa..> | 2023-05-04 02:14 | 398K | |
![[IMG]](/icons/image2.gif) | 9780321564962-100x10..> | 2023-08-06 17:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780321564962.jpg | 2023-05-04 01:56 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780321615879-100x10..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780321615879.jpg | 2023-05-04 01:54 | 7.8K | |
![[IMG]](/icons/image2.gif) | 9780321620910-100x10..> | 2023-08-05 01:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780321620910.jpg | 2023-05-03 10:19 | 8.2K | |
![[IMG]](/icons/image2.gif) | 9780321640772-100x10..> | 2023-08-05 14:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780321640772.jpg | 2023-05-03 09:44 | 11K | |
![[IMG]](/icons/image2.gif) | 9780321644725-100x10..> | 2023-08-05 17:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780321644725.jpg | 2023-05-04 01:47 | 9.0K | |
![[ ]](/icons/layout.gif) | 9780321687937_TestBa..> | 2023-05-04 02:19 | 339K | |
![[IMG]](/icons/image2.gif) | 9780321687944-100x10..> | 2023-08-05 10:49 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780321687944.jpg | 2023-05-03 09:36 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780321691224-100x10..> | 2023-08-05 14:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780321691224.jpg | 2023-05-03 09:45 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780321691699-100x10..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780321691699.jpg | 2023-05-03 10:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780321726346-100x10..> | 2023-08-05 14:43 | 4.6K | |
![[ ]](/icons/compressed.gif) | 9780321726346-C2.zip | 2023-05-03 09:55 | 1.0M | |
![[IMG]](/icons/image2.gif) | 9780321726346.jpg | 2023-05-03 09:55 | 13K | |
![[IMG]](/icons/image2.gif) | 9780321743619-100x10..> | 2023-08-05 16:24 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9780321743619.gif | 2023-05-03 09:24 | 14K | |
![[IMG]](/icons/image2.gif) | 9780321748997-100x10..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780321748997.jpg | 2023-05-03 10:28 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9780321749000-100x10..> | 2023-08-09 17:42 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780321749000.jpg | 2023-05-03 10:40 | 9.3K | |
![[IMG]](/icons/image2.gif) | 9780321749802-100x10..> | 2023-08-05 01:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780321749802.jpg | 2023-05-04 02:14 | 9.0K | |
![[IMG]](/icons/image2.gif) | 9780321750105-100x10..> | 2023-08-06 13:03 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780321750105.jpg | 2023-05-03 09:26 | 7.4K | |
![[IMG]](/icons/image2.gif) | 9780321765802-100x10..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780321765802.jpg | 2023-05-03 10:31 | 11K | |
![[IMG]](/icons/image2.gif) | 9780321768247-100x10..> | 2023-08-05 03:41 | 10K | |
![[IMG]](/icons/image2.gif) | 9780321768247.gif | 2023-05-03 09:21 | 19K | |
![[IMG]](/icons/image2.gif) | 9780321769657-100x10..> | 2023-08-06 13:04 | 7.5K | |
![[IMG]](/icons/image2.gif) | 9780321769657.gif | 2023-05-03 11:03 | 11K | |
![[IMG]](/icons/image2.gif) | 9780321773890-100x10..> | 2023-08-05 02:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780321773890.jpg | 2023-05-03 10:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780321775856-100x10..> | 2023-08-06 11:13 | 11K | |
![[IMG]](/icons/image2.gif) | 9780321775856.gif | 2023-05-03 10:36 | 25K | |
![[IMG]](/icons/image2.gif) | 9780321797056_Soluti..> | 2023-05-04 02:19 | 187K | |
![[IMG]](/icons/image2.gif) | 9780321811141-100x10..> | 2023-08-08 05:02 | 8.3K | |
![[IMG]](/icons/image2.gif) | 9780321811141.gif | 2023-05-03 10:14 | 16K | |
![[IMG]](/icons/image2.gif) | 9780321811295-100x10..> | 2023-08-05 16:20 | 9.8K | |
![[IMG]](/icons/image2.gif) | 9780321811295.gif | 2023-05-03 09:21 | 18K | |
![[IMG]](/icons/image2.gif) | 9780321814050-100x10..> | 2023-08-05 16:27 | 6.8K | |
![[IMG]](/icons/image2.gif) | 9780321814050.gif | 2023-05-03 10:34 | 13K | |
![[ ]](/icons/layout.gif) | 9780321818942_Soluti..> | 2023-05-04 02:00 | 0 | |
![[IMG]](/icons/image2.gif) | 9780321833587-100x10..> | 2023-08-06 12:15 | 8.4K | |
![[IMG]](/icons/image2.gif) | 9780321833587.gif | 2023-05-03 10:42 | 15K | |
![[IMG]](/icons/image2.gif) | 9780321837349_TestBa..> | 2023-08-06 03:34 | 1.6K | |
![[IMG]](/icons/image2.gif) | 9780321837349_TestBa..> | 2023-08-14 03:24 | 6.2K | |
![[IMG]](/icons/image2.gif) | 9780321837349_TestBa..> | 2023-05-04 02:04 | 13K | |
![[IMG]](/icons/image2.gif) | 9780321900531-100x10..> | 2023-08-06 07:46 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9780321900531.gif | 2023-05-03 09:39 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780321907141-100x10..> | 2023-08-05 16:23 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9780321907141.gif | 2023-05-04 02:04 | 17K | |
![[IMG]](/icons/image2.gif) | 9780321908605_TestBa..> | 2023-08-08 00:51 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780321908605_TestBa..> | 2023-08-23 01:30 | 27K | |
![[IMG]](/icons/image2.gif) | 9780321908605_TestBa..> | 2023-05-03 11:14 | 68K | |
![[IMG]](/icons/image2.gif) | 9780321924308-100x10..> | 2023-08-08 22:02 | 6.3K | |
![[IMG]](/icons/image2.gif) | 9780321924308.gif | 2023-05-03 09:27 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9780321924711_TestBa..> | 2023-08-06 11:14 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780321924711_TestBa..> | 2023-08-09 01:55 | 22K | |
![[IMG]](/icons/image2.gif) | 9780321924711_TestBa..> | 2023-05-04 02:06 | 51K | |
![[ ]](/icons/layout.gif) | 9780321928290_TestBa..> | 2023-05-03 13:44 | 425K | |
![[IMG]](/icons/image2.gif) | 9780321929150_TestBa..> | 2023-08-05 05:23 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780321929150_TestBa..> | 2023-08-08 23:54 | 25K | |
![[IMG]](/icons/image2.gif) | 9780321929150_TestBa..> | 2023-05-04 02:09 | 59K | |
![[IMG]](/icons/image2.gif) | 9780321951724-100x10..> | 2023-08-06 03:28 | 7.4K | |
![[IMG]](/icons/image2.gif) | 9780321951724.gif | 2023-05-03 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | 9780321951786-100x10..> | 2023-08-05 01:54 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9780321951786.gif | 2023-05-03 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | 9780321970299-100x10..> | 2023-08-06 10:20 | 8.7K | |
![[IMG]](/icons/image2.gif) | 9780321970299.gif | 2023-05-03 09:44 | 14K | |
![[IMG]](/icons/image2.gif) | 9780321971371_TestBa..> | 2023-08-05 15:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780321971371_TestBa..> | 2023-08-13 23:07 | 30K | |
![[IMG]](/icons/image2.gif) | 9780321971371_TestBa..> | 2023-05-04 01:56 | 47K | |
![[IMG]](/icons/image2.gif) | 9780321981226-100x10..> | 2023-08-08 06:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780321981226.jpg | 2023-05-03 09:55 | 13K | |
![[IMG]](/icons/image2.gif) | 9780321997838_TestBa..> | 2023-08-06 07:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780321997838_TestBa..> | 2023-08-11 03:44 | 16K | |
![[IMG]](/icons/image2.gif) | 9780321997838_TestBa..> | 2023-05-04 02:02 | 41K | |
![[IMG]](/icons/image2.gif) | 9780323084659_TestBa..> | 2023-08-06 07:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780323084659_TestBa..> | 2023-08-18 09:10 | 12K | |
![[IMG]](/icons/image2.gif) | 9780323084659_TestBa..> | 2023-05-04 01:56 | 49K | |
![[IMG]](/icons/image2.gif) | 9780323084956_3_1.jpg | 2023-05-04 02:25 | 6.3K | |
![[ ]](/icons/unknown.gif) | 9780323086370_TestBa..> | 2023-05-04 01:56 | 147K | |
![[IMG]](/icons/image2.gif) | 9780323086448_3_1.jpg | 2023-05-04 02:25 | 7.0K | |
![[ ]](/icons/layout.gif) | 9780323086783_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323088541_3_1.jpg | 2023-05-04 02:21 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9780323089890_3_1.jpg | 2023-05-04 02:27 | 8.0K | |
![[IMG]](/icons/image2.gif) | 9780323091787-100x10..> | 2023-08-05 03:41 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9780323091787.jpg | 2023-05-03 10:33 | 26K | |
![[IMG]](/icons/image2.gif) | 9780323096218_3_1.jpg | 2023-05-04 02:25 | 6.5K | |
![[IMG]](/icons/image2.gif) | 9780323101097_TB-100..> | 2023-08-05 03:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780323101097_TB-300..> | 2023-08-16 00:25 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323101097_TB.jpg | 2023-05-03 09:28 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323112024-100x10..> | 2023-08-06 07:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780323112024.jpg | 2023-05-03 09:49 | 42K | |
![[IMG]](/icons/image2.gif) | 9780323112406_3_1.jpg | 2023-05-04 02:26 | 7.0K | |
![[ ]](/icons/compressed.gif) | 9780323171229-c01.zip | 2023-05-03 13:43 | 10K | |
![[IMG]](/icons/image2.gif) | 9780323172998_TestBa..> | 2023-08-06 09:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780323172998_TestBa..> | 2023-08-30 07:22 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323172998_TestBa..> | 2023-05-04 01:57 | 17K | |
![[ ]](/icons/unknown.gif) | 9780323172998_TestBa..> | 2023-05-04 01:57 | 102K | |
![[IMG]](/icons/image2.gif) | 9780323187114_3_1.jpg | 2023-05-04 02:22 | 7.6K | |
![[ ]](/icons/unknown.gif) | 9780323188357_TestBa..> | 2023-05-03 13:43 | 564K | |
![[IMG]](/icons/image2.gif) | 9780323222419-100x10..> | 2023-08-06 09:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780323222419.jpg | 2023-05-03 09:57 | 40K | |
![[ ]](/icons/layout.gif) | 9780323239257_TestBa..> | 2023-05-04 02:15 | 553K | |
![[IMG]](/icons/image2.gif) | 9780323266406_p0_v2_..> | 2023-08-06 07:49 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9780323266406_p0_v2_..> | 2023-10-28 14:38 | 23K | |
![[IMG]](/icons/image2.gif) | 9780323266406_p0_v2_..> | 2023-05-04 02:02 | 29K | |
![[IMG]](/icons/image2.gif) | 9780323287524_TestBa..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780323287524_TestBa..> | 2023-10-29 09:09 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323287524_TestBa..> | 2023-05-04 02:27 | 15K | |
![[ ]](/icons/unknown.gif) | 9780323287524_TestBa..> | 2023-05-04 02:27 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323289610_Soluti..> | 2023-08-06 11:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780323289610_Soluti..> | 2023-08-18 12:45 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323289610_Soluti..> | 2023-05-04 02:28 | 16K | |
![[ ]](/icons/layout.gif) | 9780323289610_Soluti..> | 2023-05-04 02:28 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323311120_TestBa..> | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780323311120_TestBa..> | 2023-08-30 03:59 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323311120_TestBa..> | 2023-05-04 01:58 | 16K | |
![[ ]](/icons/unknown.gif) | 9780323311120_TestBa..> | 2023-05-04 01:58 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323312882.jpg | 2023-05-04 02:23 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9780323315791_TestBa..> | 2023-08-05 17:17 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323315791_TestBa..> | 2023-08-17 18:22 | 19K | |
![[IMG]](/icons/image2.gif) | 9780323315791_TestBa..> | 2023-05-04 02:10 | 43K | |
![[ ]](/icons/unknown.gif) | 9780323315791_TestBa..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323320948_TestBa..> | 2023-08-09 08:02 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780323320948_TestBa..> | 2023-08-08 23:54 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323320948_TestBa..> | 2023-05-04 02:15 | 19K | |
![[ ]](/icons/layout.gif) | 9780323320948_TestBa..> | 2023-05-04 02:15 | 385K | |
![[ ]](/icons/layout.gif) | 9780323321389-TEST-B..> | 2023-05-03 10:22 | 305K | |
![[IMG]](/icons/image2.gif) | 9780323322249.jpg | 2023-05-04 02:23 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9780323327404_TestBa..> | 2023-08-05 02:31 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780323327404_TestBa..> | 2023-08-08 06:46 | 23K | |
![[IMG]](/icons/image2.gif) | 9780323327404_TestBa..> | 2023-05-04 02:26 | 55K | |
![[ ]](/icons/layout.gif) | 9780323327404_TestBa..> | 2023-05-03 13:40 | 0 | |
![[ ]](/icons/unknown.gif) | 9780323327404_TestBa..> | 2023-05-04 02:25 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323328524_TestBa..> | 2023-08-06 06:37 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780323328524_TestBa..> | 2023-08-12 06:52 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323328524_TestBa..> | 2023-05-04 02:02 | 23K | |
![[ ]](/icons/unknown.gif) | 9780323328524_TestBa..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323340830.jpg | 2023-05-04 02:28 | 6.7K | |
![[IMG]](/icons/image2.gif) | 9780323341264_TestBa..> | 2023-08-06 12:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780323341264_TestBa..> | 2023-08-08 14:34 | 22K | |
![[IMG]](/icons/image2.gif) | 9780323341264_TestBa..> | 2023-05-04 02:13 | 102K | |
![[ ]](/icons/unknown.gif) | 9780323341264_TestBa..> | 2023-05-04 02:13 | 25K | |
![[ ]](/icons/unknown.gif) | 9780323354103_TestBa..> | 2023-05-03 13:42 | 167K | |
![[IMG]](/icons/image2.gif) | 9780323354813.jpg | 2023-05-04 02:08 | 8.2K | |
![[IMG]](/icons/image2.gif) | 9780323355254.jpg | 2023-05-04 02:13 | 7.0K | |
![[ ]](/icons/layout.gif) | 9780323355636_TestBa..> | 2023-05-03 13:41 | 309K | |
![[IMG]](/icons/image2.gif) | 9780323356237_TestBa..> | 2023-08-06 04:21 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780323356237_TestBa..> | 2023-05-04 02:24 | 18K | |
![[ ]](/icons/unknown.gif) | 9780323356237_TestBa..> | 2023-05-04 02:24 | 48K | |
![[ ]](/icons/unknown.gif) | 9780323356312-c1.rtf | 2023-05-04 02:03 | 103K | |
![[IMG]](/icons/image2.gif) | 9780323356312_TestBa..> | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780323356312_TestBa..> | 2023-08-06 11:19 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323356312_TestBa..> | 2023-05-04 02:03 | 73K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-08-06 07:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-08-05 01:54 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-05-04 01:50 | 75K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-08-05 01:54 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323357210_TestBa..> | 2023-05-03 11:03 | 75K | |
![[ ]](/icons/unknown.gif) | 9780323358514-Adult_..> | 2023-05-03 13:43 | 1.1M | |
![[IMG]](/icons/image2.gif) | 9780323370608.jpg | 2023-05-04 02:27 | 7.4K | |
![[ ]](/icons/layout.gif) | 9780323390880_TestBa..> | 2023-05-03 13:43 | 324K | |
![[IMG]](/icons/image2.gif) | 9780323396219.jpg | 2023-05-04 02:28 | 6.6K | |
![[IMG]](/icons/image2.gif) | 9780323396219_TestBa..> | 2023-08-08 21:06 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780323396219_TestBa..> | 2023-08-09 13:45 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323396219_TestBa..> | 2023-05-04 02:12 | 16K | |
![[ ]](/icons/unknown.gif) | 9780323396219_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323398947.jpg | 2023-05-04 02:09 | 8.5K | |
![[IMG]](/icons/image2.gif) | 9780323400626.jpg | 2023-05-04 02:29 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780323400749.jpg | 2023-05-04 02:18 | 7.5K | |
![[IMG]](/icons/image2.gif) | 9780323401302.jpg | 2023-05-04 02:24 | 7.6K | |
![[ ]](/icons/unknown.gif) | 9780323401517_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323414425.jpg | 2023-05-04 02:12 | 7.3K | |
![[IMG]](/icons/image2.gif) | 9780323414876.jpg | 2023-05-04 02:07 | 8.2K | |
![[IMG]](/icons/image2.gif) | 9780323416351.jpg | 2023-05-04 02:22 | 7.9K | |
![[IMG]](/icons/image2.gif) | 9780323416368.jpg | 2023-05-04 02:23 | 8.9K | |
![[IMG]](/icons/image2.gif) | 9780323416757.jpg | 2023-05-04 02:24 | 8.4K | |
![[ ]](/icons/unknown.gif) | 9780323417334_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323427944.jpg | 2023-05-04 02:18 | 8.1K | |
![[IMG]](/icons/image2.gif) | 9780323430487.jpg | 2023-05-04 02:28 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9780323430548_TestBa..> | 2023-08-05 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780323430548_TestBa..> | 2023-08-10 18:29 | 20K | |
![[IMG]](/icons/image2.gif) | 9780323430548_TestBa..> | 2023-05-04 02:24 | 94K | |
![[ ]](/icons/unknown.gif) | 9780323430548_TestBa..> | 2023-05-04 02:24 | 76K | |
![[IMG]](/icons/image2.gif) | 9780323430937.jpg | 2023-05-04 02:29 | 9.3K | |
![[IMG]](/icons/image2.gif) | 9780323431316.jpg | 2023-05-04 02:08 | 6.9K | |
![[IMG]](/icons/image2.gif) | 9780323443555.jpg | 2023-05-04 02:13 | 7.4K | |
![[ ]](/icons/unknown.gif) | 9780323443555_TestBa..> | 2023-05-04 02:13 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323443562_TestBa..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780323443562_TestBa..> | 2023-09-06 23:57 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323443562_TestBa..> | 2023-05-04 01:58 | 59K | |
![[ ]](/icons/unknown.gif) | 9780323443562_TestBa..> | 2023-05-04 01:58 | 116K | |
![[IMG]](/icons/image2.gif) | 9780323449137.jpg | 2023-05-04 02:03 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323462235.jpg | 2023-05-04 02:17 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323479332.jpg | 2023-05-04 02:12 | 7.4K | |
![[IMG]](/icons/image2.gif) | 9780323479479.jpg | 2023-05-04 02:01 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323479783_TestBa..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780323479783_TestBa..> | 2023-08-06 10:20 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323479783_TestBa..> | 2023-05-03 11:19 | 90K | |
![[ ]](/icons/unknown.gif) | 9780323479783_TestBa..> | 2023-05-03 11:19 | 593K | |
![[IMG]](/icons/image2.gif) | 9780323479998.jpg | 2023-05-04 02:02 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323480239.jpg | 2023-05-04 02:19 | 7.9K | |
![[IMG]](/icons/image2.gif) | 9780323482189.jpg | 2023-05-04 02:07 | 8.4K | |
![[IMG]](/icons/image2.gif) | 9780323485258-100x10..> | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323485258.jpg | 2023-05-04 01:50 | 40K | |
![[IMG]](/icons/image2.gif) | 9780323497275.jpg | 2023-05-04 02:12 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9780323497275_TestBa..> | 2023-08-06 09:42 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323497275_TestBa..> | 2023-09-18 04:50 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323497275_TestBa..> | 2023-05-04 02:25 | 81K | |
![[ ]](/icons/unknown.gif) | 9780323497275_TestBa..> | 2023-05-04 02:25 | 129K | |
![[IMG]](/icons/image2.gif) | 9780323498111.jpg | 2023-05-04 02:03 | 19K | |
![[IMG]](/icons/image2.gif) | 9780323498449.jpg | 2023-05-04 02:18 | 7.6K | |
![[IMG]](/icons/image2.gif) | 9780323508643.jpg | 2023-05-04 02:04 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323510806.jpg | 2023-05-04 02:04 | 12K | |
![[IMG]](/icons/image2.gif) | 9780323512275.jpg | 2023-05-04 02:09 | 8.1K | |
![[IMG]](/icons/image2.gif) | 9780323528900.jpg | 2023-05-04 02:10 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9780323528948.jpg | 2023-05-04 02:06 | 16K | |
![[IMG]](/icons/image2.gif) | 9780323529495_TestBa..> | 2023-08-06 07:49 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780323529495_TestBa..> | 2023-10-17 07:23 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323529495_TestBa..> | 2023-05-04 02:03 | 75K | |
![[ ]](/icons/unknown.gif) | 9780323529495_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323531054.jpg | 2023-05-04 02:23 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9780323531993.jpg | 2023-05-04 02:05 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323532051.jpg | 2023-05-04 02:02 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323544092.jpg | 2023-05-04 02:23 | 7.9K | |
![[IMG]](/icons/image2.gif) | 9780323544801-100x10..> | 2023-08-06 11:15 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323544801.jpg | 2023-05-04 02:24 | 38K | |
![[IMG]](/icons/image2.gif) | 9780323544900.jpg | 2023-05-04 02:01 | 16K | |
![[IMG]](/icons/image2.gif) | 9780323547017.jpg | 2023-05-04 02:04 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323547581_TestBa..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780323547581_TestBa..> | 2023-08-09 13:45 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323547581_TestBa..> | 2023-05-04 01:48 | 77K | |
![[ ]](/icons/unknown.gif) | 9780323549394_TestBa..> | 2023-05-03 11:01 | 64K | |
![[IMG]](/icons/image2.gif) | 9780323550611.jpg | 2023-05-04 01:57 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323551199.jpg | 2023-05-04 02:00 | 16K | |
![[IMG]](/icons/image2.gif) | 9780323551274_TestBa..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323551274_TestBa..> | 2023-08-12 06:52 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323551274_TestBa..> | 2023-05-03 10:59 | 62K | |
![[ ]](/icons/unknown.gif) | 9780323551274_TestBa..> | 2023-05-03 10:59 | 1.9M | |
![[ ]](/icons/unknown.gif) | 9780323551281_TestBa..> | 2023-05-03 13:41 | 8.4K | |
![[IMG]](/icons/image2.gif) | 9780323551298_TestBa..> | 2023-08-05 01:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780323551298_TestBa..> | 2023-08-25 16:56 | 16K | |
![[IMG]](/icons/image2.gif) | 9780323551298_TestBa..> | 2023-05-04 01:50 | 71K | |
![[IMG]](/icons/image2.gif) | 9780323551311_TestBa..> | 2023-08-05 15:29 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780323551311_TestBa..> | 2023-08-23 23:13 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323551311_TestBa..> | 2023-05-03 11:15 | 56K | |
![[IMG]](/icons/image2.gif) | 9780323552356.jpg | 2023-05-04 02:00 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323553698.jpg | 2023-05-04 02:00 | 15K | |
![[IMG]](/icons/image2.gif) | 9780323554558_TestBa..> | 2023-08-05 08:50 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780323554558_TestBa..> | 2023-08-30 03:59 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323554558_TestBa..> | 2023-05-04 01:49 | 52K | |
![[ ]](/icons/unknown.gif) | 9780323554558_TestBa..> | 2023-05-04 01:49 | 71K | |
![[IMG]](/icons/image2.gif) | 9780323554596_TestBa..> | 2023-08-06 12:14 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780323554596_TestBa..> | 2023-08-12 06:52 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323554596_TestBa..> | 2023-05-04 02:08 | 54K | |
![[ ]](/icons/unknown.gif) | 9780323554596_TestBa..> | 2023-05-04 02:08 | 28K | |
![[IMG]](/icons/image2.gif) | 9780323555081.jpg | 2023-05-04 02:02 | 12K | |
![[ ]](/icons/unknown.gif) | 9780323566674_TestBa..> | 2023-05-03 13:44 | 66K | |
![[IMG]](/icons/image2.gif) | 9780323566681_TestBa..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780323566681_TestBa..> | 2023-09-01 03:43 | 18K | |
![[IMG]](/icons/image2.gif) | 9780323566681_TestBa..> | 2023-05-04 02:09 | 84K | |
![[IMG]](/icons/image2.gif) | 9780323566704_TestBa..> | 2023-08-05 02:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780323566704_TestBa..> | 2023-05-04 02:24 | 35K | |
![[ ]](/icons/unknown.gif) | 9780323566704_TestBa..> | 2023-05-04 02:24 | 158K | |
![[ ]](/icons/unknown.gif) | 9780323581288_TestBa..> | 2023-05-03 13:44 | 88K | |
![[IMG]](/icons/image2.gif) | 9780323581417.jpg | 2023-05-04 02:17 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323583473.jpg | 2023-05-04 02:11 | 8.8K | |
![[IMG]](/icons/image2.gif) | 9780323596589_TestBa..> | 2023-08-06 13:04 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780323596589_TestBa..> | 2023-08-08 07:33 | 20K | |
![[IMG]](/icons/image2.gif) | 9780323596589_TestBa..> | 2023-05-04 01:48 | 90K | |
![[ ]](/icons/layout.gif) | 9780323597654-sample..> | 2023-05-04 02:04 | 2.9M | |
![[IMG]](/icons/image2.gif) | 9780323597654_TestBa..> | 2023-08-08 02:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780323597654_TestBa..> | 2023-10-29 06:30 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323597654_TestBa..> | 2023-05-04 02:04 | 56K | |
![[IMG]](/icons/image2.gif) | 9780323597791_TestBa..> | 2023-08-06 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780323597791_TestBa..> | 2023-08-06 11:19 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323597791_TestBa..> | 2023-05-04 02:03 | 69K | |
![[ ]](/icons/unknown.gif) | 9780323597791_TestBa..> | 2023-05-04 02:03 | 256K | |
![[IMG]](/icons/image2.gif) | 9780323608718.jpg | 2023-05-04 01:59 | 14K | |
![[IMG]](/icons/image2.gif) | 9780323608817_1.jpg | 2023-05-04 01:58 | 9.4K | |
![[IMG]](/icons/image2.gif) | 9780323609173.jpg | 2023-05-04 01:59 | 13K | |
![[IMG]](/icons/image2.gif) | 9780323609234.jpg | 2023-05-04 01:59 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323624190_TestBa..> | 2023-08-06 12:14 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780323624190_TestBa..> | 2023-08-23 23:50 | 19K | |
![[IMG]](/icons/image2.gif) | 9780323624190_TestBa..> | 2023-05-04 02:10 | 83K | |
![[IMG]](/icons/image2.gif) | 9780323624480.jpg | 2023-05-04 01:58 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323639088_TestBa..> | 2023-08-05 16:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780323639088_TestBa..> | 2023-08-22 08:49 | 17K | |
![[IMG]](/icons/image2.gif) | 9780323639088_TestBa..> | 2023-05-04 01:58 | 41K | |
![[ ]](/icons/unknown.gif) | 9780323639088_TestBa..> | 2023-05-04 01:58 | 0 | |
![[IMG]](/icons/image2.gif) | 9780323641937_TestBa..> | 2023-08-05 01:51 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9780323641937_TestBa..> | 2023-08-16 01:58 | 11K | |
![[IMG]](/icons/image2.gif) | 9780323641937_TestBa..> | 2023-05-04 01:59 | 62K | |
![[IMG]](/icons/image2.gif) | 9780323661355_TestBa..> | 2023-08-05 16:23 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780323661355_TestBa..> | 2023-09-19 06:07 | 20K | |
![[IMG]](/icons/image2.gif) | 9780323661355_TestBa..> | 2023-05-04 02:00 | 94K | |
![[ ]](/icons/unknown.gif) | 9780323661355_TestBa..> | 2023-05-04 02:00 | 0 | |
![[ ]](/icons/unknown.gif) | 9780323694407_Test_B..> | 2023-05-03 13:42 | 85K | |
![[ ]](/icons/unknown.gif) | 9780323749732_TestBa..> | 2023-05-04 01:59 | 83K | |
![[IMG]](/icons/image2.gif) | 9780324224726-100x10..> | 2023-08-05 17:21 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780324224726.jpg | 2023-05-03 10:09 | 17K | |
![[IMG]](/icons/image2.gif) | 9780324319804-TB-100..> | 2023-08-05 02:46 | 1.8K | |
![[IMG]](/icons/image2.gif) | 9780324319804-TB-300..> | 2023-09-25 03:49 | 8.1K | |
![[IMG]](/icons/image2.gif) | 9780324319804-TB.jpg | 2023-05-04 02:26 | 9.2K | |
![[ ]](/icons/unknown.gif) | 9780324319804_TestBa..> | 2023-05-04 02:26 | 0 | |
![[IMG]](/icons/image2.gif) | 9780324599107-us-100..> | 2023-08-06 11:59 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780324599107-us-300..> | 2023-08-18 04:11 | 23K | |
![[IMG]](/icons/image2.gif) | 9780324599107-us.jpg | 2023-05-03 09:23 | 58K | |
![[ ]](/icons/unknown.gif) | 9780324639766_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9780324786620_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780357022689_TestBa..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780357022689_TestBa..> | 2023-08-05 15:33 | 31K | |
![[IMG]](/icons/image2.gif) | 9780357022689_TestBa..> | 2023-05-03 11:24 | 56K | |
![[ ]](/icons/unknown.gif) | 9780357022689_TestBa..> | 2023-05-03 11:24 | 29K | |
![[IMG]](/icons/image2.gif) | 9780357025680_TestBa..> | 2023-08-05 09:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9780357025680_TestBa..> | 2023-08-10 02:23 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357025680_TestBa..> | 2023-05-04 02:09 | 31K | |
![[ ]](/icons/unknown.gif) | 9780357025765_TestBa..> | 2023-05-03 13:43 | 63K | |
![[IMG]](/icons/image2.gif) | 9780357026205_TestBa..> | 2023-08-06 05:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780357026205_TestBa..> | 2023-09-17 19:43 | 22K | |
![[IMG]](/icons/image2.gif) | 9780357026205_TestBa..> | 2023-05-04 01:54 | 37K | |
![[ ]](/icons/unknown.gif) | 9780357026205_TestBa..> | 2023-05-04 01:54 | 51K | |
![[IMG]](/icons/image2.gif) | 9780357026380_Soluti..> | 2023-08-06 10:15 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780357026380_Soluti..> | 2023-08-09 10:17 | 16K | |
![[IMG]](/icons/image2.gif) | 9780357026380_Soluti..> | 2023-05-04 01:49 | 26K | |
![[IMG]](/icons/image2.gif) | 9780357026380_TestBa..> | 2023-08-05 17:17 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9780357026380_TestBa..> | 2023-08-10 02:23 | 16K | |
![[IMG]](/icons/image2.gif) | 9780357026380_TestBa..> | 2023-05-03 11:03 | 26K | |
![[ ]](/icons/unknown.gif) | 9780357026380_TestBa..> | 2023-05-03 11:03 | 53K | |
![[IMG]](/icons/image2.gif) | 9780357026441_Soluti..> | 2023-08-09 02:52 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9780357026441_Soluti..> | 2023-08-15 01:39 | 11K | |
![[IMG]](/icons/image2.gif) | 9780357026441_Soluti..> | 2023-05-03 11:12 | 31K | |
![[IMG]](/icons/image2.gif) | 9780357026991_Soluti..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780357026991_Soluti..> | 2023-08-23 22:04 | 22K | |
![[IMG]](/icons/image2.gif) | 9780357026991_Soluti..> | 2023-05-03 11:16 | 68K | |
![[IMG]](/icons/image2.gif) | 9780357026991_TestBa..> | 2023-08-05 14:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780357026991_TestBa..> | 2023-08-05 01:54 | 22K | |
![[IMG]](/icons/image2.gif) | 9780357026991_TestBa..> | 2023-05-03 11:16 | 68K | |
![[ ]](/icons/unknown.gif) | 9780357033609_PFIN7-..> | 2023-05-03 11:01 | 67K | |
![[IMG]](/icons/image2.gif) | 9780357033609_Soluti..> | 2023-08-09 08:03 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780357033609_Soluti..> | 2023-08-21 02:16 | 13K | |
![[IMG]](/icons/image2.gif) | 9780357033609_Soluti..> | 2023-05-03 11:01 | 39K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1-1-10..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1-1-30..> | 2023-08-12 04:50 | 21K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1-1.jpg | 2023-05-03 10:57 | 41K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1-100x..> | 2023-08-07 22:06 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1-300x..> | 2023-09-03 21:18 | 21K | |
![[IMG]](/icons/image2.gif) | 9780357033821-1.jpg | 2023-05-03 10:57 | 41K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-08-07 13:26 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-08-06 12:18 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-05-04 01:50 | 55K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-08-05 01:08 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-08-06 12:18 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357033838_Soluti..> | 2023-05-03 11:11 | 55K | |
![[ ]](/icons/compressed.gif) | 9780357033838_Soluti..> | 2023-05-04 01:50 | 1.8M | |
![[IMG]](/icons/image2.gif) | 9780357033838_TestBa..> | 2023-08-05 15:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357033838_TestBa..> | 2023-08-06 05:40 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357033838_TestBa..> | 2023-05-03 11:11 | 55K | |
![[ ]](/icons/unknown.gif) | 9780357033838_TestBa..> | 2023-05-03 11:11 | 58K | |
![[IMG]](/icons/image2.gif) | 9780357034859_TestBa..> | 2023-08-05 21:03 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780357034859_TestBa..> | 2023-09-12 12:05 | 28K | |
![[IMG]](/icons/image2.gif) | 9780357034859_TestBa..> | 2023-05-04 02:20 | 46K | |
![[ ]](/icons/compressed.gif) | 9780357034859_TestBa..> | 2023-05-04 02:20 | 1.0M | |
![[IMG]](/icons/image2.gif) | 9780357037911_Soluti..> | 2023-08-06 21:01 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780357037911_Soluti..> | 2023-08-23 21:13 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357037911_Soluti..> | 2023-05-04 01:58 | 33K | |
![[ ]](/icons/compressed.gif) | 9780357037911_Soluti..> | 2023-05-04 01:58 | 482K | |
![[IMG]](/icons/image2.gif) | 9780357037911_TestBa..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780357037911_TestBa..> | 2023-08-22 00:46 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357037911_TestBa..> | 2023-05-04 01:58 | 33K | |
![[ ]](/icons/unknown.gif) | 9780357037911_TestBa..> | 2023-05-04 01:58 | 31K | |
![[ ]](/icons/unknown.gif) | 9780357038314_Soluti..> | 2023-05-03 13:44 | 94K | |
![[ ]](/icons/unknown.gif) | 9780357038314_TestBa..> | 2023-05-03 13:44 | 84K | |
![[ ]](/icons/unknown.gif) | 9780357040775-Chapte..> | 2023-05-03 13:44 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357040775_Soluti..> | 2023-08-07 07:29 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9780357040775_Soluti..> | 2023-08-08 17:45 | 28K | |
![[IMG]](/icons/image2.gif) | 9780357040775_Soluti..> | 2023-05-04 01:51 | 46K | |
![[IMG]](/icons/image2.gif) | 9780357041710_Soluti..> | 2023-08-05 06:23 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780357041710_Soluti..> | 2023-08-20 08:54 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357041710_Soluti..> | 2023-05-03 10:55 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357045077_TestBa..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780357045077_TestBa..> | 2023-09-09 10:36 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357045077_TestBa..> | 2023-05-04 01:50 | 31K | |
![[ ]](/icons/unknown.gif) | 9780357045077_TestBa..> | 2023-05-04 01:50 | 26K | |
![[IMG]](/icons/image2.gif) | 9780357108291_TestBa..> | 2023-08-08 21:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357108291_TestBa..> | 2023-08-22 23:52 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357108291_TestBa..> | 2023-05-04 02:18 | 29K | |
![[ ]](/icons/unknown.gif) | 9780357108291_TestBa..> | 2023-05-04 02:18 | 36K | |
![[IMG]](/icons/image2.gif) | 9780357109144_Soluti..> | 2023-08-06 12:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780357109144_Soluti..> | 2023-08-11 11:53 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357109144_Soluti..> | 2023-05-04 02:04 | 35K | |
![[IMG]](/icons/image2.gif) | 9780357109144_TestBa..> | 2023-08-05 17:22 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780357109144_TestBa..> | 2023-09-11 15:33 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357109144_TestBa..> | 2023-05-04 02:04 | 35K | |
![[ ]](/icons/layout.gif) | 9780357109151_09809_..> | 2023-05-04 02:05 | 209K | |
![[IMG]](/icons/image2.gif) | 9780357109151_Soluti..> | 2023-08-08 09:18 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357109151_Soluti..> | 2023-08-11 11:53 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357109151_Soluti..> | 2023-05-04 02:05 | 34K | |
![[IMG]](/icons/image2.gif) | 9780357109151_TestBa..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357109151_TestBa..> | 2023-09-11 15:33 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357109151_TestBa..> | 2023-05-04 02:05 | 34K | |
![[ ]](/icons/layout.gif) | 9780357109151_TestBa..> | 2023-05-04 02:05 | 810K | |
![[IMG]](/icons/image2.gif) | 9780357109168_Soluti..> | 2023-08-07 19:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357109168_Soluti..> | 2023-08-11 11:53 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357109168_Soluti..> | 2023-05-04 02:05 | 35K | |
![[IMG]](/icons/image2.gif) | 9780357109168_TestBa..> | 2023-08-05 01:09 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357109168_TestBa..> | 2023-09-11 15:33 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357109168_TestBa..> | 2023-05-04 02:05 | 35K | |
![[IMG]](/icons/image2.gif) | 9780357109953_Soluti..> | 2023-08-05 01:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780357109953_Soluti..> | 2023-08-22 20:06 | 17K | |
![[IMG]](/icons/image2.gif) | 9780357109953_Soluti..> | 2023-05-04 01:50 | 28K | |
![[IMG]](/icons/image2.gif) | 9780357109953_TestBa..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780357109953_TestBa..> | 2023-08-05 05:30 | 17K | |
![[IMG]](/icons/image2.gif) | 9780357109953_TestBa..> | 2023-05-04 01:50 | 28K | |
![[ ]](/icons/unknown.gif) | 9780357114254_978035..> | 2023-05-04 02:24 | 608K | |
![[IMG]](/icons/image2.gif) | 9780357114254_Soluti..> | 2023-08-08 07:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780357114254_Soluti..> | 2023-08-09 12:13 | 14K | |
![[IMG]](/icons/image2.gif) | 9780357114254_Soluti..> | 2023-05-04 02:24 | 21K | |
![[IMG]](/icons/image2.gif) | 9780357118269_Soluti..> | 2023-08-05 06:23 | 1.9K | |
![[IMG]](/icons/image2.gif) | 9780357118269_Soluti..> | 2023-08-09 09:11 | 13K | |
![[IMG]](/icons/image2.gif) | 9780357118269_Soluti..> | 2023-05-04 02:04 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357118269_TestBa..> | 2023-08-08 01:35 | 1.9K | |
![[IMG]](/icons/image2.gif) | 9780357118269_TestBa..> | 2023-08-21 10:12 | 13K | |
![[IMG]](/icons/image2.gif) | 9780357118269_TestBa..> | 2023-05-04 02:04 | 20K | |
![[ ]](/icons/unknown.gif) | 9780357118269_TestBa..> | 2023-05-04 02:04 | 38K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-08-15 16:02 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-05-04 02:28 | 29K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-08-05 05:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-08-15 16:02 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357122273_Soluti..> | 2023-05-04 02:14 | 29K | |
![[ ]](/icons/layout.gif) | 9780357122273_Soluti..> | 2023-05-04 02:28 | 890K | |
![[IMG]](/icons/image2.gif) | 9780357122273_TestBa..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357122273_TestBa..> | 2023-09-23 07:28 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357122273_TestBa..> | 2023-05-04 02:28 | 29K | |
![[ ]](/icons/unknown.gif) | 9780357122273_TestBa..> | 2023-05-04 02:28 | 27K | |
![[IMG]](/icons/image2.gif) | 9780357127803_TestBa..> | 2023-08-05 14:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357127803_TestBa..> | 2023-10-03 21:37 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357127803_TestBa..> | 2023-05-03 11:21 | 30K | |
![[IMG]](/icons/image2.gif) | 9780357131381_TestBa..> | 2023-08-05 05:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357131381_TestBa..> | 2023-10-03 21:37 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357131381_TestBa..> | 2023-05-04 02:27 | 40K | |
![[ ]](/icons/unknown.gif) | 9780357131381_TestBa..> | 2023-05-04 02:27 | 84K | |
![[IMG]](/icons/image2.gif) | 9780357131695_Soluti..> | 2023-08-08 16:37 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780357131695_Soluti..> | 2023-08-10 22:17 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357131695_Soluti..> | 2023-05-04 01:48 | 37K | |
![[ ]](/icons/unknown.gif) | 9780357131695_Soluti..> | 2023-05-04 01:48 | 633K | |
![[IMG]](/icons/image2.gif) | 9780357131695_TestBa..> | 2023-08-08 17:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9780357131695_TestBa..> | 2023-08-27 07:51 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357131695_TestBa..> | 2023-05-04 01:48 | 37K | |
![[ ]](/icons/unknown.gif) | 9780357131695_TestBa..> | 2023-05-04 01:48 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357131787_Soluti..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780357131787_Soluti..> | 2023-08-06 04:49 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357131787_Soluti..> | 2023-05-03 11:15 | 37K | |
![[ ]](/icons/unknown.gif) | 9780357131787_Soluti..> | 2023-05-03 11:15 | 613K | |
![[IMG]](/icons/image2.gif) | 9780357132463_TestBa..> | 2023-08-05 03:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780357132463_TestBa..> | 2023-10-29 06:30 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357132463_TestBa..> | 2023-05-03 10:53 | 41K | |
![[ ]](/icons/unknown.gif) | 9780357132463_TestBa..> | 2023-05-03 10:52 | 36K | |
![[IMG]](/icons/image2.gif) | 9780357252680_Soluti..> | 2023-08-05 16:26 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357252680_Soluti..> | 2023-08-06 12:18 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357252680_Soluti..> | 2023-05-04 02:18 | 39K | |
![[IMG]](/icons/image2.gif) | 9780357252680_TestBa..> | 2023-08-06 19:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357252680_TestBa..> | 2023-09-15 08:58 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357252680_TestBa..> | 2023-05-04 02:18 | 39K | |
![[IMG]](/icons/image2.gif) | 9780357252765_Soluti..> | 2023-08-05 15:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780357252765_Soluti..> | 2023-08-14 00:56 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357252765_Soluti..> | 2023-05-04 02:19 | 40K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-08-05 05:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-08-14 19:05 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-05-04 02:19 | 40K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-08-06 10:13 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-08-14 19:05 | 25K | |
![[IMG]](/icons/image2.gif) | 9780357252765_TestBa..> | 2023-05-04 01:58 | 40K | |
![[IMG]](/icons/image2.gif) | 9780357257340_TestBa..> | 2023-08-05 01:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780357257340_TestBa..> | 2023-08-27 09:34 | 16K | |
![[IMG]](/icons/image2.gif) | 9780357257340_TestBa..> | 2023-05-04 02:14 | 23K | |
![[ ]](/icons/unknown.gif) | 9780357257340_TestBa..> | 2023-05-04 02:13 | 65K | |
![[IMG]](/icons/image2.gif) | 9780357308752_Soluti..> | 2023-08-06 11:15 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780357308752_Soluti..> | 2023-08-06 12:18 | 21K | |
![[IMG]](/icons/image2.gif) | 9780357308752_Soluti..> | 2023-05-04 02:02 | 59K | |
![[IMG]](/icons/image2.gif) | 9780357359327_Soluti..> | 2023-08-06 13:02 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357359327_Soluti..> | 2023-08-11 20:42 | 23K | |
![[IMG]](/icons/image2.gif) | 9780357359327_Soluti..> | 2023-05-04 01:58 | 33K | |
![[ ]](/icons/layout.gif) | 9780357359327_Soluti..> | 2023-05-04 01:58 | 480K | |
![[IMG]](/icons/image2.gif) | 9780357359334_Soluti..> | 2023-08-06 13:07 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357359334_Soluti..> | 2023-08-11 11:53 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357359334_Soluti..> | 2023-05-03 11:20 | 36K | |
![[ ]](/icons/layout.gif) | 9780357359334_Soluti..> | 2023-05-03 11:19 | 211K | |
![[IMG]](/icons/image2.gif) | 9780357359334_TestBa..> | 2023-08-05 01:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780357359334_TestBa..> | 2023-09-11 15:33 | 24K | |
![[IMG]](/icons/image2.gif) | 9780357359334_TestBa..> | 2023-05-03 11:20 | 36K | |
![[ ]](/icons/unknown.gif) | 9780357359334_TestBa..> | 2023-05-03 11:20 | 35K | |
![[IMG]](/icons/image2.gif) | 9780357364000_Soluti..> | 2023-08-05 02:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780357364000_Soluti..> | 2023-08-13 06:55 | 13K | |
![[IMG]](/icons/image2.gif) | 9780357364000_Soluti..> | 2023-05-04 02:22 | 19K | |
![[IMG]](/icons/image2.gif) | 9780357366479_TestBa..> | 2023-08-05 15:43 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9780357366479_TestBa..> | 2023-08-29 01:19 | 21K | |
![[IMG]](/icons/image2.gif) | 9780357366479_TestBa..> | 2023-05-04 01:57 | 32K | |
![[ ]](/icons/unknown.gif) | 9780357366479_TestBa..> | 2023-05-04 01:57 | 15K | |
![[IMG]](/icons/image2.gif) | 9780357378649_TestBa..> | 2023-08-05 09:59 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9780357378649_TestBa..> | 2023-08-28 17:05 | 16K | |
![[IMG]](/icons/image2.gif) | 9780357378649_TestBa..> | 2023-05-04 02:22 | 23K | |
![[ ]](/icons/unknown.gif) | 9780357378649_TestBa..> | 2023-05-04 02:22 | 22K | |
![[IMG]](/icons/image2.gif) | 9780357418697_Soluti..> | 2023-08-06 11:18 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780357418697_Soluti..> | 2023-08-16 23:57 | 22K | |
![[IMG]](/icons/image2.gif) | 9780357418697_Soluti..> | 2023-05-04 02:25 | 32K | |
![[ ]](/icons/unknown.gif) | 9780357418697_Soluti..> | 2023-05-04 02:25 | 80K | |
![[ ]](/icons/compressed.gif) | 9780357422083_Soluti..> | 2023-05-03 13:42 | 308K | |
![[IMG]](/icons/image2.gif) | 9780357422083_TestBa..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780357422083_TestBa..> | 2023-08-22 15:02 | 20K | |
![[IMG]](/icons/image2.gif) | 9780357422083_TestBa..> | 2023-05-04 02:16 | 31K | |
![[ ]](/icons/unknown.gif) | 9780357422083_TestBa..> | 2023-05-04 02:16 | 40K | |
![[ ]](/icons/unknown.gif) | 9780357442043_Soluti..> | 2023-05-03 13:43 | 96K | |
![[IMG]](/icons/image2.gif) | 9780357442043_TestBa..> | 2023-08-05 17:20 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780357442043_TestBa..> | 2023-08-28 19:47 | 15K | |
![[IMG]](/icons/image2.gif) | 9780357442043_TestBa..> | 2023-05-04 01:48 | 22K | |
![[ ]](/icons/unknown.gif) | 9780357442043_TestBa..> | 2023-05-04 01:48 | 39K | |
![[IMG]](/icons/image2.gif) | 9780357442142_TestBa..> | 2023-08-05 06:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780357442142_TestBa..> | 2023-08-05 05:34 | 17K | |
![[IMG]](/icons/image2.gif) | 9780357442142_TestBa..> | 2023-05-04 01:48 | 25K | |
![[ ]](/icons/unknown.gif) | 9780357442142_TestBa..> | 2023-05-04 01:48 | 25K | |
![[IMG]](/icons/image2.gif) | 9780387249681-100x10..> | 2023-08-05 03:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780387249681.jpg | 2023-05-03 09:53 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9780393124262_p0_v1_..> | 2023-08-07 04:28 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9780393124262_p0_v1_..> | 2023-05-04 01:55 | 33K | |
![[IMG]](/icons/image2.gif) | 9780393283402_TestBa..> | 2023-08-05 14:34 | 13K | |
![[IMG]](/icons/image2.gif) | 9780393283402_TestBa..> | 2023-08-18 00:57 | 22K | |
![[IMG]](/icons/image2.gif) | 9780393283402_TestBa..> | 2023-05-04 02:08 | 43K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300-1-..> | 2023-08-05 16:23 | 22K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300-1-..> | 2023-08-05 21:03 | 48K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300-1...> | 2023-05-04 01:57 | 138K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300-10..> | 2023-08-05 02:45 | 22K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300-30..> | 2023-08-09 05:08 | 48K | |
![[IMG]](/icons/image2.gif) | 9780393418040_300.jpeg | 2023-05-04 01:58 | 138K | |
![[ ]](/icons/unknown.gif) | 9780393418040_TestBa..> | 2023-05-04 01:57 | 175K | |
![[ ]](/icons/unknown.gif) | 9780393419337_REALWO..> | 2023-05-04 02:28 | 76K | |
![[IMG]](/icons/image2.gif) | 9780393421583_TestBa..> | 2023-08-05 07:10 | 14K | |
![[IMG]](/icons/image2.gif) | 9780393421583_TestBa..> | 2023-08-10 22:19 | 30K | |
![[IMG]](/icons/image2.gif) | 9780393421583_TestBa..> | 2023-05-04 02:01 | 58K | |
![[ ]](/icons/unknown.gif) | 9780393421583_TestBa..> | 2023-05-04 02:01 | 0 | |
![[ ]](/icons/unknown.gif) | 9780393603170_TestBa..> | 2023-05-03 10:54 | 55K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300-1-..> | 2023-08-08 06:43 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300-1-..> | 2023-08-23 22:04 | 28K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300-1...> | 2023-05-04 02:22 | 37K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300-10..> | 2023-08-05 04:35 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300-30..> | 2023-08-05 14:41 | 28K | |
![[IMG]](/icons/image2.gif) | 9780393614046_300.jpeg | 2023-05-04 02:22 | 37K | |
![[ ]](/icons/layout.gif) | 9780393615159_Soluti..> | 2023-05-04 02:22 | 4.7M | |
![[ ]](/icons/layout.gif) | 9780393615159_TestBa..> | 2023-05-04 02:22 | 665K | |
![[ ]](/icons/unknown.gif) | 9780393617542_TestBa..> | 2023-05-04 02:12 | 72K | |
![[ ]](/icons/unknown.gif) | 9780393624137_TestBa..> | 2023-05-03 13:42 | 121K | |
![[IMG]](/icons/image2.gif) | 9780393630749_300-10..> | 2023-08-06 12:11 | 8.1K | |
![[IMG]](/icons/image2.gif) | 9780393630749_300-30..> | 2023-08-20 19:01 | 31K | |
![[IMG]](/icons/image2.gif) | 9780393630749_300.jpeg | 2023-05-04 01:55 | 38K | |
![[ ]](/icons/layout.gif) | 9780393630749_orgkar..> | 2023-05-04 01:55 | 2.3M | |
![[IMG]](/icons/image2.gif) | 9780393631715_Soluti..> | 2023-08-05 17:20 | 5.8K | |
![[IMG]](/icons/image2.gif) | 9780393631715_Soluti..> | 2023-08-05 14:35 | 18K | |
![[IMG]](/icons/image2.gif) | 9780393631715_Soluti..> | 2023-05-04 01:59 | 51K | |
![[ ]](/icons/layout.gif) | 9780393631715_unduni..> | 2023-05-04 01:59 | 386K | |
![[IMG]](/icons/image2.gif) | 9780393631791_TestBa..> | 2023-08-08 16:35 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9780393631791_TestBa..> | 2023-08-29 02:09 | 30K | |
![[IMG]](/icons/image2.gif) | 9780393631791_TestBa..> | 2023-05-04 01:54 | 103K | |
![[ ]](/icons/unknown.gif) | 9780393631791_bionow..> | 2023-05-04 01:54 | 762K | |
![[ ]](/icons/unknown.gif) | 9780393639032_TestBa..> | 2023-05-03 13:41 | 156K | |
![[ ]](/icons/layout.gif) | 9780393640342_TestBa..> | 2023-05-03 13:40 | 394K | |
![[ ]](/icons/unknown.gif) | 9780393663716_TestBa..> | 2023-05-04 02:00 | 459K | |
![[ ]](/icons/unknown.gif) | 9780393664478_TestBa..> | 2023-05-04 01:54 | 259K | |
![[ ]](/icons/unknown.gif) | 9780393667134_PSYWOM..> | 2023-05-03 13:43 | 63K | |
![[IMG]](/icons/image2.gif) | 9780393667523_TestBa..> | 2023-08-05 04:17 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780393667523_TestBa..> | 2023-08-18 00:57 | 27K | |
![[IMG]](/icons/image2.gif) | 9780393667523_TestBa..> | 2023-05-04 02:10 | 125K | |
![[ ]](/icons/unknown.gif) | 9780393667523_TestBa..> | 2023-05-04 02:10 | 2.8M | |
![[IMG]](/icons/image2.gif) | 9780393667691_TestBa..> | 2023-08-05 01:09 | 6.0K | |
![[IMG]](/icons/image2.gif) | 9780393667691_TestBa..> | 2023-08-29 06:04 | 17K | |
![[IMG]](/icons/image2.gif) | 9780393667691_TestBa..> | 2023-05-04 01:50 | 70K | |
![[ ]](/icons/unknown.gif) | 9780393667691_TestBa..> | 2023-05-04 01:50 | 170K | |
![[ ]](/icons/unknown.gif) | 9780393668537_TestBa..> | 2023-05-03 13:44 | 41K | |
![[ ]](/icons/unknown.gif) | 9780393668964_AMNARS..> | 2023-05-03 13:43 | 179K | |
![[IMG]](/icons/image2.gif) | 9780393674170_TestBa..> | 2023-08-05 01:51 | 6.2K | |
![[IMG]](/icons/image2.gif) | 9780393674170_TestBa..> | 2023-08-10 16:04 | 19K | |
![[IMG]](/icons/image2.gif) | 9780393674170_TestBa..> | 2023-05-04 01:49 | 34K | |
![[ ]](/icons/unknown.gif) | 9780393674170_TestBa..> | 2023-05-04 01:49 | 68K | |
![[IMG]](/icons/image2.gif) | 9780393674187_TestBa..> | 2023-08-06 10:15 | 6.6K | |
![[IMG]](/icons/image2.gif) | 9780393674187_TestBa..> | 2023-08-10 16:04 | 21K | |
![[IMG]](/icons/image2.gif) | 9780393674187_TestBa..> | 2023-05-04 02:25 | 37K | |
![[ ]](/icons/unknown.gif) | 9780393674187_TestBa..> | 2023-05-04 02:25 | 68K | |
![[IMG]](/icons/image2.gif) | 9780393674699_TestBa..> | 2023-08-06 02:45 | 7.6K | |
![[IMG]](/icons/image2.gif) | 9780393674699_TestBa..> | 2023-09-04 00:09 | 32K | |
![[IMG]](/icons/image2.gif) | 9780393674699_TestBa..> | 2023-05-04 01:56 | 112K | |
![[ ]](/icons/unknown.gif) | 9780393675092_TestBa..> | 2023-05-04 01:47 | 50K | |
![[IMG]](/icons/image2.gif) | 9780393675191_TestBa..> | 2023-08-09 18:37 | 6.6K | |
![[IMG]](/icons/image2.gif) | 9780393675191_TestBa..> | 2023-08-30 14:11 | 19K | |
![[IMG]](/icons/image2.gif) | 9780393675191_TestBa..> | 2023-05-04 02:10 | 71K | |
![[ ]](/icons/unknown.gif) | 9780393675191_TestBa..> | 2023-05-04 02:10 | 190K | |
![[IMG]](/icons/image2.gif) | 9780393675368_TestBa..> | 2023-08-06 08:44 | 21K | |
![[IMG]](/icons/image2.gif) | 9780393675368_TestBa..> | 2023-09-12 22:07 | 57K | |
![[IMG]](/icons/image2.gif) | 9780393675368_TestBa..> | 2023-05-04 02:20 | 157K | |
![[ ]](/icons/unknown.gif) | 9780393675368_TestBa..> | 2023-05-04 02:20 | 146K | |
![[ ]](/icons/layout.gif) | 9780393675498_21CAST..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9780393675498_TestBa..> | 2023-08-05 03:41 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9780393675498_TestBa..> | 2023-08-15 09:51 | 26K | |
![[IMG]](/icons/image2.gif) | 9780393675498_TestBa..> | 2023-05-04 02:12 | 109K | |
![[IMG]](/icons/image2.gif) | 9780393679571_300-1-..> | 2023-08-05 03:41 | 7.3K | |
![[IMG]](/icons/image2.gif) | 9780393679571_300-1-..> | 2023-08-26 03:34 | 20K | |
![[IMG]](/icons/image2.gif) | 9780393679571_300-1...> | 2023-05-04 02:26 | 83K | |
![[ ]](/icons/unknown.gif) | 9780393679588_TestBa..> | 2023-05-04 02:26 | 264K | |
![[ ]](/icons/unknown.gif) | 9780393679946_AMPOLT..> | 2023-05-04 02:11 | 1.3M | |
![[ ]](/icons/unknown.gif) | 9780393680119_TestBa..> | 2023-05-04 01:57 | 48K | |
![[ ]](/icons/layout.gif) | 9780393680881_TestBa..> | 2023-05-03 13:41 | 332K | |
![[IMG]](/icons/image2.gif) | 9780393689600_TestBa..> | 2023-08-08 07:33 | 14K | |
![[IMG]](/icons/image2.gif) | 9780393689600_TestBa..> | 2023-10-02 01:57 | 32K | |
![[IMG]](/icons/image2.gif) | 9780393689600_TestBa..> | 2023-05-04 02:22 | 132K | |
![[IMG]](/icons/image2.gif) | 9780393690118_Soluti..> | 2023-08-05 01:41 | 5.9K | |
![[IMG]](/icons/image2.gif) | 9780393690118_Soluti..> | 2023-08-12 04:50 | 14K | |
![[IMG]](/icons/image2.gif) | 9780393690118_Soluti..> | 2023-05-04 01:49 | 51K | |
![[ ]](/icons/layout.gif) | 9780393690118_Soluti..> | 2023-05-04 01:49 | 1.1M | |
![[IMG]](/icons/image2.gif) | 9780393690118_TestBa..> | 2023-08-06 07:45 | 5.9K | |
![[IMG]](/icons/image2.gif) | 9780393690118_TestBa..> | 2023-09-08 18:22 | 14K | |
![[IMG]](/icons/image2.gif) | 9780393690118_TestBa..> | 2023-05-04 02:06 | 51K | |
![[ ]](/icons/layout.gif) | 9780393690118_TestBa..> | 2023-05-04 02:06 | 1.3M | |
![[ ]](/icons/unknown.gif) | 9780393691139_Lookin..> | 2023-05-04 01:56 | 189K | |
![[ ]](/icons/layout.gif) | 9780393696134_WEPEOP..> | 2023-05-03 13:42 | 265K | |
![[ ]](/icons/unknown.gif) | 9780393697308_TestBa..> | 2023-05-03 13:42 | 1.1M | |
![[ ]](/icons/layout.gif) | 9780393906097_TestBa..> | 2023-05-03 10:51 | 1.1M | |
![[ ]](/icons/layout.gif) | 9780393920291_978039..> | 2023-05-03 09:42 | 785K | |
![[ ]](/icons/layout.gif) | 9780393930788-tspl.pdf | 2023-05-03 09:35 | 149K | |
![[IMG]](/icons/image2.gif) | 9780393935776_3001-1..> | 2023-08-05 06:24 | 15K | |
![[IMG]](/icons/image2.gif) | 9780393935776_3001-3..> | 2023-08-09 13:56 | 37K | |
![[IMG]](/icons/image2.gif) | 9780393935776_3001.jpg | 2023-05-03 09:28 | 69K | |
![[IMG]](/icons/image2.gif) | 9780415790529_TestBa..> | 2023-08-05 16:16 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780415790529_TestBa..> | 2023-08-22 08:49 | 13K | |
![[IMG]](/icons/image2.gif) | 9780415790529_TestBa..> | 2023-05-04 02:26 | 18K | |
![[ ]](/icons/unknown.gif) | 9780415790529_TestBa..> | 2023-05-04 02:26 | 51K | |
![[IMG]](/icons/image2.gif) | 9780470128695-100x10..> | 2023-08-06 08:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780470128695.jpg | 2023-05-04 02:04 | 7.1K | |
![[ ]](/icons/compressed.gif) | 9780470322550_SM_Ch1..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780470343944_TestBa..> | 2023-08-08 08:33 | 30K | |
![[IMG]](/icons/image2.gif) | 9780470343944_TestBa..> | 2023-08-21 10:12 | 50K | |
![[IMG]](/icons/image2.gif) | 9780470343944_TestBa..> | 2023-05-04 02:26 | 68K | |
![[ ]](/icons/unknown.gif) | 9780470343944_TestBa..> | 2023-05-04 02:26 | 0 | |
![[ ]](/icons/compressed.gif) | 9780470383278_Soluti..> | 2023-05-03 13:40 | 0 | |
![[ ]](/icons/compressed.gif) | 9780470383278_TestBa..> | 2023-05-04 02:15 | 34K | |
![[ ]](/icons/layout.gif) | 9780470542095_TestBa..> | 2023-05-03 09:32 | 469K | |
![[ ]](/icons/layout.gif) | 9780470614730_Soluti..> | 2023-05-03 13:42 | 410K | |
![[ ]](/icons/layout.gif) | 9780470616376_Soluti..> | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | 9780470907764_Welkow..> | 2023-05-04 02:15 | 69K | |
![[IMG]](/icons/image2.gif) | 9780470938454_Soluti..> | 2023-08-05 14:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780470938454_Soluti..> | 2023-08-22 19:18 | 23K | |
![[IMG]](/icons/image2.gif) | 9780470938454_Soluti..> | 2023-05-04 02:25 | 43K | |
![[ ]](/icons/unknown.gif) | 9780470938454_Soluti..> | 2023-05-04 02:25 | 133K | |
![[IMG]](/icons/image2.gif) | 9780471152323-100x10..> | 2023-08-06 13:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9780471152323.jpg | 2023-05-03 10:52 | 6.3K | |
![[ ]](/icons/layout.gif) | 9780471232797_Soluti..> | 2023-05-04 02:17 | 237K | |
![[ ]](/icons/unknown.gif) | 9780471391906-ch01.doc | 2023-05-03 13:42 | 42K | |
![[IMG]](/icons/image2.gif) | 9780471401940-100x10..> | 2023-08-05 07:10 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780471401940.jpg | 2023-05-03 11:22 | 6.0K | |
![[IMG]](/icons/image2.gif) | 9780471464808-100x10..> | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780471464808.jpg | 2023-05-03 09:58 | 7.0K | |
![[IMG]](/icons/image2.gif) | 9780471487357-100x10..> | 2023-08-05 14:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9780471487357.jpg | 2023-05-03 09:55 | 6.0K | |
![[IMG]](/icons/image2.gif) | 9780471708582-100x10..> | 2023-08-05 03:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780471708582.jpg | 2023-05-04 01:54 | 6.2K | |
![[ ]](/icons/layout.gif) | 9780471737926_TestBa..> | 2023-05-04 02:27 | 0 | |
![[IMG]](/icons/image2.gif) | 9780471739319-100x10..> | 2023-08-06 11:15 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780471739319.jpg | 2023-05-04 02:03 | 5.6K | |
![[IMG]](/icons/image2.gif) | 9780471787358-100x10..> | 2023-08-06 10:20 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9780471787358.jpg | 2023-05-04 01:51 | 6.6K | |
![[IMG]](/icons/image2.gif) | 9780495082545_Soluti..> | 2023-08-06 08:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780495082545_Soluti..> | 2023-08-21 02:16 | 19K | |
![[IMG]](/icons/image2.gif) | 9780495082545_Soluti..> | 2023-05-04 01:58 | 25K | |
![[IMG]](/icons/image2.gif) | 9780495382171-100x10..> | 2023-08-05 06:25 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9780495382171.jpg | 2023-05-04 01:57 | 17K | |
![[ ]](/icons/layout.gif) | 9780495391524-tspl.pdf | 2023-05-03 10:48 | 135K | |
![[IMG]](/icons/image2.gif) | 9780495560647-100x10..> | 2023-08-05 20:18 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780495560647.jpg | 2023-05-03 10:05 | 8.6K | |
![[IMG]](/icons/image2.gif) | 9780521833455-100x10..> | 2023-08-05 01:09 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9780521833455.jpg | 2023-05-04 01:45 | 7.3K | |
![[IMG]](/icons/image2.gif) | 9780534391683-100x10..> | 2023-08-06 07:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780534391683.jpg | 2023-05-03 09:56 | 6.1K | |
![[IMG]](/icons/image2.gif) | 9780534548841-100x10..> | 2023-08-09 00:58 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9780534548841.jpg | 2023-05-04 02:18 | 18K | |
![[IMG]](/icons/image2.gif) | 9780534549305-100x10..> | 2023-08-06 10:16 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9780534549305.jpg | 2023-05-03 10:44 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9780534551629-100x10..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9780534551629.jpg | 2023-05-04 02:11 | 21K | |
![[ ]](/icons/layout.gif) | 9780538735346_TestBa..> | 2023-05-03 09:51 | 796K | |
![[ ]](/icons/unknown.gif) | 9780538745840_IM_ch0..> | 2023-05-03 10:53 | 106K | |
![[IMG]](/icons/image2.gif) | 9780618141807-100x10..> | 2023-08-05 15:29 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780618141807.jpg | 2023-05-04 02:13 | 13K | |
![[IMG]](/icons/image2.gif) | 9780729590198_4.jpg | 2023-05-04 02:29 | 5.9K | |
![[IMG]](/icons/image2.gif) | 9780729597012.jpg | 2023-05-04 02:17 | 9.5K | |
![[ ]](/icons/unknown.gif) | 9780730344629_kring1..> | 2023-05-03 11:07 | 48K | |
![[ ]](/icons/unknown.gif) | 9780730354925_Soluti..> | 2023-05-03 13:55 | 113K | |
![[IMG]](/icons/image2.gif) | 9780730356141_TestBa..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780730356141_TestBa..> | 2023-09-15 06:47 | 18K | |
![[IMG]](/icons/image2.gif) | 9780730356141_TestBa..> | 2023-05-04 02:27 | 25K | |
![[IMG]](/icons/image2.gif) | 9780759367050-100x10..> | 2023-08-05 02:46 | 17K | |
![[IMG]](/icons/image2.gif) | 9780759367050-300x30..> | 2023-08-08 15:50 | 33K | |
![[ ]](/icons/layout.gif) | 9780759367050-tspl-1..> | 2023-05-03 10:46 | 67K | |
![[IMG]](/icons/image2.gif) | 9780759367050.jpg | 2023-05-03 10:46 | 48K | |
![[ ]](/icons/unknown.gif) | 9780763755805_TB_Ch1..> | 2023-05-03 10:23 | 16K | |
![[IMG]](/icons/image2.gif) | 9780763756376_TestBa..> | 2023-08-05 03:40 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9780763756376_TestBa..> | 2023-08-20 20:08 | 15K | |
![[IMG]](/icons/image2.gif) | 9780763756376_TestBa..> | 2023-05-04 02:25 | 36K | |
![[IMG]](/icons/image2.gif) | 9780765644510_TestBa..> | 2023-08-05 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9780765644510_TestBa..> | 2023-10-12 12:35 | 24K | |
![[IMG]](/icons/image2.gif) | 9780765644510_TestBa..> | 2023-05-04 02:04 | 34K | |
![[ ]](/icons/layout.gif) | 9780765644510_TestBa..> | 2023-05-04 02:04 | 970K | |
![[ ]](/icons/unknown.gif) | 9780781777698-Chapte..> | 2023-05-03 10:39 | 21K | |
![[IMG]](/icons/image2.gif) | 9780789757463_TestBa..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780789757463_TestBa..> | 2023-08-28 22:20 | 18K | |
![[IMG]](/icons/image2.gif) | 9780789757463_TestBa..> | 2023-05-03 11:15 | 42K | |
![[IMG]](/icons/image2.gif) | 9780789759962_TestBa..> | 2023-08-06 12:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780789759962_TestBa..> | 2023-08-20 08:54 | 20K | |
![[IMG]](/icons/image2.gif) | 9780789759962_TestBa..> | 2023-05-04 02:10 | 29K | |
![[ ]](/icons/unknown.gif) | 9780789760500_Schmid..> | 2023-05-04 01:59 | 1.9M | |
![[IMG]](/icons/image2.gif) | 9780789760500_TestBa..> | 2023-08-05 16:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9780789760500_TestBa..> | 2023-08-24 01:33 | 23K | |
![[IMG]](/icons/image2.gif) | 9780789760500_TestBa..> | 2023-05-04 01:59 | 57K | |
![[ ]](/icons/unknown.gif) | 9780803621626_TestBa..> | 2023-05-03 11:11 | 38K | |
![[IMG]](/icons/image2.gif) | 9780803621794-100x10..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780803621794-300x30..> | 2023-08-08 16:36 | 19K | |
![[IMG]](/icons/image2.gif) | 9780803621794.jpg | 2023-05-03 09:25 | 43K | |
![[ ]](/icons/layout.gif) | 9780803622456_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9780803624948_TestBa..> | 2023-05-04 02:28 | 48K | |
![[IMG]](/icons/image2.gif) | 9780803625884_TestBa..> | 2023-08-05 06:25 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9780803625884_TestBa..> | 2023-10-17 07:23 | 26K | |
![[IMG]](/icons/image2.gif) | 9780803625884_TestBa..> | 2023-05-04 02:23 | 47K | |
![[ ]](/icons/layout.gif) | 9780803625884_TestBa..> | 2023-05-04 02:23 | 404K | |
![[IMG]](/icons/image2.gif) | 9780803627888_TestBa..> | 2023-08-08 18:24 | 11K | |
![[IMG]](/icons/image2.gif) | 9780803627888_TestBa..> | 2023-08-11 01:04 | 26K | |
![[IMG]](/icons/image2.gif) | 9780803627888_TestBa..> | 2023-05-04 02:26 | 40K | |
![[ ]](/icons/unknown.gif) | 9780803627888_TestBa..> | 2023-05-04 02:26 | 312K | |
![[IMG]](/icons/image2.gif) | 9780803636651_TestBa..> | 2023-08-05 05:30 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9780803636651_TestBa..> | 2023-08-14 15:10 | 23K | |
![[IMG]](/icons/image2.gif) | 9780803636651_TestBa..> | 2023-05-04 02:00 | 45K | |
![[ ]](/icons/layout.gif) | 9780803636651_TestBa..> | 2023-05-04 02:00 | 0 | |
![[IMG]](/icons/image2.gif) | 9780803638273-100x10..> | 2023-08-05 09:32 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9780803638273-300x30..> | 2023-08-08 16:38 | 28K | |
![[IMG]](/icons/image2.gif) | 9780803638273.jpg | 2023-05-03 09:52 | 64K | |
![[ ]](/icons/unknown.gif) | 9780803639713_TestBa..> | 2023-05-03 13:41 | 192K | |
![[IMG]](/icons/image2.gif) | 9780803640337_TestBa..> | 2023-08-08 12:42 | 10K | |
![[IMG]](/icons/image2.gif) | 9780803640337_TestBa..> | 2023-09-04 20:54 | 26K | |
![[IMG]](/icons/image2.gif) | 9780803640337_TestBa..> | 2023-05-04 01:58 | 41K | |
![[ ]](/icons/unknown.gif) | 9780803640337_TestBa..> | 2023-05-04 01:58 | 23K | |
![[ ]](/icons/unknown.gif) | 9780803640771_TestBa..> | 2023-05-03 10:54 | 119K | |
![[ ]](/icons/layout.gif) | 9780803640924_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780803643680_TestBa..> | 2023-08-05 07:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9780803643680_TestBa..> | 2023-08-12 06:52 | 23K | |
![[IMG]](/icons/image2.gif) | 9780803643680_TestBa..> | 2023-05-04 01:59 | 24K | |
![[ ]](/icons/unknown.gif) | 9780803643680_TestBa..> | 2023-05-04 01:59 | 133K | |
![[ ]](/icons/unknown.gif) | 9780803644007_TestBa..> | 2023-05-03 13:41 | 545K | |
![[ ]](/icons/unknown.gif) | 9780803659186_TestBa..> | 2023-05-03 13:44 | 29K | |
![[IMG]](/icons/image2.gif) | 9780803660410_TestBa..> | 2023-08-05 03:40 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9780803660410_TestBa..> | 2023-05-03 11:05 | 41K | |
![[ ]](/icons/layout.gif) | 9780803660410_TestBa..> | 2023-05-03 11:05 | 532K | |
![[ ]](/icons/unknown.gif) | 9780803660540_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9780803660854_TestBa..> | 2023-08-06 13:07 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9780803660854_TestBa..> | 2023-08-30 06:38 | 17K | |
![[IMG]](/icons/image2.gif) | 9780803660854_TestBa..> | 2023-05-04 02:06 | 25K | |
![[ ]](/icons/unknown.gif) | 9780803660854_TestBa..> | 2023-05-04 02:06 | 254K | |
![[IMG]](/icons/image2.gif) | 9780803661622_TestBa..> | 2023-08-06 12:08 | 10K | |
![[IMG]](/icons/image2.gif) | 9780803661622_TestBa..> | 2023-10-26 03:30 | 27K | |
![[IMG]](/icons/image2.gif) | 9780803661622_TestBa..> | 2023-05-03 11:00 | 45K | |
![[ ]](/icons/unknown.gif) | 9780803661622_TestBa..> | 2023-05-03 11:00 | 20K | |
![[ ]](/icons/unknown.gif) | 9780803666535_Ch01_T..> | 2023-05-03 13:40 | 147K | |
![[ ]](/icons/unknown.gif) | 9780803666542_Ch01_T..> | 2023-05-04 01:49 | 139K | |
![[IMG]](/icons/image2.gif) | 9780803666542_TestBa..> | 2023-08-06 13:09 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9780803666542_TestBa..> | 2023-08-05 06:24 | 22K | |
![[IMG]](/icons/image2.gif) | 9780803666542_TestBa..> | 2023-05-04 01:49 | 37K | |
![[IMG]](/icons/image2.gif) | 9780803666610_TestBa..> | 2023-08-05 01:52 | 10K | |
![[IMG]](/icons/image2.gif) | 9780803666610_TestBa..> | 2023-08-19 04:14 | 26K | |
![[IMG]](/icons/image2.gif) | 9780803666610_TestBa..> | 2023-05-04 02:12 | 45K | |
![[ ]](/icons/unknown.gif) | 9780803666610_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9780803667044_TestBa..> | 2023-08-06 23:14 | 10K | |
![[IMG]](/icons/image2.gif) | 9780803667044_TestBa..> | 2023-05-04 02:20 | 37K | |
![[ ]](/icons/unknown.gif) | 9780803667044_TestBa..> | 2023-05-04 02:20 | 39K | |
![[IMG]](/icons/image2.gif) | 9780803667181_TestBa..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780803667181_TestBa..> | 2023-10-29 12:50 | 19K | |
![[IMG]](/icons/image2.gif) | 9780803667181_TestBa..> | 2023-05-04 02:04 | 31K | |
![[ ]](/icons/layout.gif) | 9780803667181_TestBa..> | 2023-05-04 02:04 | 222K | |
![[ ]](/icons/unknown.gif) | 9780803668140_TestBa..> | 2023-05-04 01:56 | 132K | |
![[IMG]](/icons/image2.gif) | 9780803668317_TestBa..> | 2023-08-06 07:48 | 14K | |
![[IMG]](/icons/image2.gif) | 9780803668317_TestBa..> | 2023-08-09 13:45 | 31K | |
![[IMG]](/icons/image2.gif) | 9780803668317_TestBa..> | 2023-05-04 02:01 | 113K | |
![[ ]](/icons/unknown.gif) | 9780803668317_TestBa..> | 2023-05-04 02:01 | 0 | |
![[ ]](/icons/unknown.gif) | 9780803669062_TestBa..> | 2023-05-04 02:11 | 137K | |
![[IMG]](/icons/image2.gif) | 9780803669376_TestBa..> | 2023-08-05 18:14 | 10K | |
![[IMG]](/icons/image2.gif) | 9780803669376_TestBa..> | 2023-08-11 01:04 | 26K | |
![[IMG]](/icons/image2.gif) | 9780803669376_TestBa..> | 2023-05-03 10:53 | 43K | |
![[ ]](/icons/layout.gif) | 9780803669376_TestBa..> | 2023-05-03 10:53 | 177K | |
![[ ]](/icons/unknown.gif) | 9780803674875_TestBa..> | 2023-05-03 13:42 | 62K | |
![[ ]](/icons/unknown.gif) | 9780803676459_TestBa..> | 2023-05-04 02:28 | 183K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-08-05 16:23 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-09-01 03:43 | 22K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-05-04 02:29 | 32K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-08-05 04:31 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-08-09 13:50 | 22K | |
![[IMG]](/icons/image2.gif) | 9780803676787_TestBa..> | 2023-05-04 02:10 | 32K | |
![[ ]](/icons/unknown.gif) | 9780803676787_TestBa..> | 2023-05-04 02:29 | 270K | |
![[ ]](/icons/unknown.gif) | 9780803676909_TestBa..> | 2023-05-03 13:44 | 558K | |
![[IMG]](/icons/image2.gif) | 9780803677111_TestBa..> | 2023-08-05 15:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780803677111_TestBa..> | 2023-10-22 19:34 | 19K | |
![[IMG]](/icons/image2.gif) | 9780803677111_TestBa..> | 2023-05-04 01:55 | 32K | |
![[ ]](/icons/unknown.gif) | 9780803677111_TestBa..> | 2023-05-04 01:55 | 300K | |
![[ ]](/icons/unknown.gif) | 9780803679917_TestBa..> | 2023-05-03 10:53 | 105K | |
![[IMG]](/icons/image2.gif) | 9780803689923_TestBa..> | 2023-08-05 05:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9780803689923_TestBa..> | 2023-08-16 17:47 | 23K | |
![[IMG]](/icons/image2.gif) | 9780803689923_TestBa..> | 2023-05-04 02:11 | 36K | |
![[ ]](/icons/unknown.gif) | 9780803689923_TestBa..> | 2023-05-04 02:10 | 219K | |
![[ ]](/icons/compressed.gif) | 9780803694118_TestBa..> | 2023-05-04 02:07 | 24K | |
![[IMG]](/icons/image2.gif) | 9780805304022-100x10..> | 2023-08-05 01:09 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9780805304022.jpg | 2023-05-04 02:10 | 14K | |
![[IMG]](/icons/image2.gif) | 9780805395921-100x10..> | 2023-08-05 03:40 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9780805395921.jpg | 2023-05-03 09:24 | 11K | |
![[ ]](/icons/unknown.gif) | 9780840028556_SMTB_S..> | 2023-05-03 11:18 | 22K | |
![[IMG]](/icons/image2.gif) | 9780840068651_TestBa..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9780840068651_TestBa..> | 2023-08-27 10:06 | 16K | |
![[IMG]](/icons/image2.gif) | 9780840068651_TestBa..> | 2023-05-04 02:03 | 17K | |
![[ ]](/icons/unknown.gif) | 9780840068651_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9780898714548-100x10..> | 2023-08-06 09:42 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9780898714548.jpg | 2023-05-04 02:11 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-08-07 13:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-09-05 00:53 | 20K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-05-04 02:27 | 40K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-08-06 12:10 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-09-05 00:53 | 20K | |
![[IMG]](/icons/image2.gif) | 9781108436694_TestBa..> | 2023-05-04 02:10 | 40K | |
![[ ]](/icons/unknown.gif) | 9781108436694_TestBa..> | 2023-05-04 02:27 | 35K | |
![[ ]](/icons/layout.gif) | 9781108496988_Soluti..> | 2023-05-03 13:43 | 337K | |
![[ ]](/icons/layout.gif) | 9781111186661-TEST-B..> | 2023-05-04 02:21 | 299K | |
![[ ]](/icons/unknown.gif) | 9781111308674_TestBa..> | 2023-05-03 13:44 | 247K | |
![[IMG]](/icons/image2.gif) | 9781111342135_TB-100..> | 2023-08-05 17:15 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781111342135_TB-300..> | 2023-08-20 20:08 | 18K | |
![[IMG]](/icons/image2.gif) | 9781111342135_TB.jpg | 2023-05-03 11:00 | 20K | |
![[ ]](/icons/unknown.gif) | 9781111342135_TestBa..> | 2023-05-03 11:00 | 171K | |
![[ ]](/icons/layout.gif) | 9781111539580_TestBa..> | 2023-05-04 02:24 | 13K | |
![[IMG]](/icons/image2.gif) | 9781111569624-100x10..> | 2023-08-06 10:17 | 16K | |
![[IMG]](/icons/image2.gif) | 9781111569624-300x30..> | 2023-08-21 06:52 | 34K | |
![[IMG]](/icons/image2.gif) | 9781111569624.jpg | 2023-05-03 09:29 | 48K | |
![[ ]](/icons/layout.gif) | 9781111571269_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781111820855-100x10..> | 2023-08-08 22:00 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781111820855-300x30..> | 2023-08-17 00:57 | 20K | |
![[IMG]](/icons/image2.gif) | 9781111820855.jpg | 2023-05-03 10:56 | 69K | |
![[ ]](/icons/compressed.gif) | 9781111822705_Soluti..> | 2023-05-03 09:19 | 14K | |
![[ ]](/icons/unknown.gif) | 9781111829742_Lefran..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781111835583_Soluti..> | 2023-05-03 13:41 | 68K | |
![[IMG]](/icons/image2.gif) | 9781111839970_TB-100..> | 2023-08-05 16:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781111839970_TB-300..> | 2023-08-05 04:37 | 20K | |
![[IMG]](/icons/image2.gif) | 9781111839970_TB.jpg | 2023-05-04 02:02 | 22K | |
![[ ]](/icons/unknown.gif) | 9781111839970_TestBa..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9781118092330_Soluti..> | 2023-08-05 01:52 | 18K | |
![[IMG]](/icons/image2.gif) | 9781118092330_Soluti..> | 2023-08-25 19:27 | 39K | |
![[IMG]](/icons/image2.gif) | 9781118092330_Soluti..> | 2023-05-04 02:17 | 50K | |
![[ ]](/icons/layout.gif) | 9781118092330_Soluti..> | 2023-05-04 02:17 | 956K | |
![[IMG]](/icons/image2.gif) | 9781118133576_TB-1-1..> | 2023-08-06 13:12 | 11K | |
![[IMG]](/icons/image2.gif) | 9781118133576_TB-1-3..> | 2023-08-20 19:01 | 32K | |
![[IMG]](/icons/image2.gif) | 9781118133576_TB-1.jpg | 2023-05-04 01:56 | 76K | |
![[ ]](/icons/layout.gif) | 9781118133576_TestBa..> | 2023-05-04 01:56 | 212K | |
![[ ]](/icons/layout.gif) | 9781118162286_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781118273630_TestBa..> | 2023-05-04 02:18 | 100K | |
![[ ]](/icons/layout.gif) | 9781118279014_Soluti..> | 2023-05-04 02:03 | 0 | |
![[ ]](/icons/layout.gif) | 9781118324578_Soluti..> | 2023-05-03 13:41 | 963K | |
![[ ]](/icons/layout.gif) | 9781118345009_TestBa..> | 2023-05-04 02:16 | 821K | |
![[IMG]](/icons/image2.gif) | 9781118396209_TestBa..> | 2023-08-05 06:24 | 11K | |
![[IMG]](/icons/image2.gif) | 9781118396209_TestBa..> | 2023-08-06 06:37 | 24K | |
![[IMG]](/icons/image2.gif) | 9781118396209_TestBa..> | 2023-05-04 02:07 | 31K | |
![[IMG]](/icons/image2.gif) | 9781118466728_TestBa..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781118466728_TestBa..> | 2023-08-15 03:43 | 20K | |
![[IMG]](/icons/image2.gif) | 9781118466728_TestBa..> | 2023-05-04 02:02 | 44K | |
![[ ]](/icons/layout.gif) | 9781118466728_TestBa..> | 2023-05-04 02:02 | 130K | |
![[ ]](/icons/compressed.gif) | 9781118557303_V1_Ch1..> | 2023-05-04 02:11 | 0 | |
![[ ]](/icons/layout.gif) | 9781118640043_Soluti..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9781118742976_Soluti..> | 2023-08-06 08:36 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9781118742976_Soluti..> | 2023-08-06 13:11 | 26K | |
![[IMG]](/icons/image2.gif) | 9781118742976_Soluti..> | 2023-05-04 02:06 | 36K | |
![[ ]](/icons/unknown.gif) | 9781118875827_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9781118883846_Soluti..> | 2023-08-06 04:19 | 9.7K | |
![[IMG]](/icons/image2.gif) | 9781118883846_Soluti..> | 2023-08-25 19:27 | 23K | |
![[IMG]](/icons/image2.gif) | 9781118883846_Soluti..> | 2023-05-03 11:19 | 28K | |
![[IMG]](/icons/image2.gif) | 9781118883846_TestBa..> | 2023-08-05 03:40 | 9.7K | |
![[IMG]](/icons/image2.gif) | 9781118883846_TestBa..> | 2023-08-08 14:34 | 23K | |
![[IMG]](/icons/image2.gif) | 9781118883846_TestBa..> | 2023-05-03 11:19 | 28K | |
![[ ]](/icons/unknown.gif) | 9781119048534_Soluti..> | 2023-05-04 02:27 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119048541_Soluti..> | 2023-08-05 04:35 | 7.6K | |
![[IMG]](/icons/image2.gif) | 9781119048541_Soluti..> | 2023-08-06 13:11 | 41K | |
![[IMG]](/icons/image2.gif) | 9781119048541_Soluti..> | 2023-05-04 02:27 | 44K | |
![[ ]](/icons/unknown.gif) | 9781119048541_Soluti..> | 2023-05-04 02:27 | 0 | |
![[ ]](/icons/layout.gif) | 9781119080701_Soluti..> | 2023-05-04 02:17 | 2.9M | |
![[IMG]](/icons/image2.gif) | 9781119234173_Soluti..> | 2023-08-06 08:47 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119234173_Soluti..> | 2023-08-08 08:38 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119234173_Soluti..> | 2023-05-04 02:04 | 35K | |
![[IMG]](/icons/image2.gif) | 9781119281818_TestBa..> | 2023-08-05 06:25 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119281818_TestBa..> | 2023-10-18 03:50 | 22K | |
![[IMG]](/icons/image2.gif) | 9781119281818_TestBa..> | 2023-05-04 02:04 | 28K | |
![[ ]](/icons/unknown.gif) | 9781119281818_TestBa..> | 2023-05-04 02:04 | 109K | |
![[ ]](/icons/unknown.gif) | 9781119298809_TestBa..> | 2023-05-03 13:42 | 91K | |
![[IMG]](/icons/image2.gif) | 9781119304708_TestBa..> | 2023-08-06 05:23 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119304708_TestBa..> | 2023-08-05 04:37 | 25K | |
![[IMG]](/icons/image2.gif) | 9781119304708_TestBa..> | 2023-05-03 10:57 | 34K | |
![[ ]](/icons/unknown.gif) | 9781119304708_TestBa..> | 2023-05-03 10:57 | 102K | |
![[ ]](/icons/unknown.gif) | 9781119305040_TestBa..> | 2023-05-03 13:44 | 21K | |
![[ ]](/icons/unknown.gif) | 9781119306160-ch01.doc | 2023-05-03 13:40 | 57K | |
![[ ]](/icons/layout.gif) | 9781119319337_Soluti..> | 2023-05-03 11:00 | 229K | |
![[ ]](/icons/layout.gif) | 9781119319337_TestBa..> | 2023-05-04 02:28 | 95K | |
![[ ]](/icons/layout.gif) | 9781119320425_sm1-00..> | 2023-05-03 13:42 | 28K | |
![[ ]](/icons/unknown.gif) | 9781119321118_Soluti..> | 2023-05-03 11:15 | 155K | |
![[ ]](/icons/unknown.gif) | 9781119337089_TestBa..> | 2023-05-03 10:57 | 15K | |
![[ ]](/icons/unknown.gif) | 9781119347958_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119367604_TestBa..> | 2023-08-09 11:08 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119367604_TestBa..> | 2023-08-15 20:03 | 27K | |
![[IMG]](/icons/image2.gif) | 9781119367604_TestBa..> | 2023-05-03 11:04 | 35K | |
![[ ]](/icons/unknown.gif) | 9781119367604_TestBa..> | 2023-05-03 11:04 | 87K | |
![[ ]](/icons/unknown.gif) | 9781119368830_TestBa..> | 2023-05-04 01:51 | 118K | |
![[ ]](/icons/unknown.gif) | 9781119371434_Soluti..> | 2023-05-04 02:28 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119373254_TestBa..> | 2023-08-05 15:31 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119373254_TestBa..> | 2023-08-19 20:58 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119373254_TestBa..> | 2023-05-04 02:12 | 30K | |
![[ ]](/icons/unknown.gif) | 9781119373254_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119379416_Soluti..> | 2023-08-05 01:41 | 12K | |
![[IMG]](/icons/image2.gif) | 9781119379416_Soluti..> | 2023-08-08 07:32 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119379416_Soluti..> | 2023-05-04 02:14 | 30K | |
![[ ]](/icons/layout.gif) | 9781119379416_Soluti..> | 2023-05-04 02:14 | 2.3M | |
![[IMG]](/icons/image2.gif) | 9781119379416_TestBa..> | 2023-08-05 01:51 | 12K | |
![[IMG]](/icons/image2.gif) | 9781119379416_TestBa..> | 2023-08-24 16:37 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119379416_TestBa..> | 2023-05-04 02:02 | 30K | |
![[ ]](/icons/unknown.gif) | 9781119379416_TestBa..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/layout.gif) | 9781119381648_Soluti..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781119390114_TestBa..> | 2023-05-04 01:57 | 244K | |
![[ ]](/icons/layout.gif) | 9781119391609_Soluti..> | 2023-05-04 02:26 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119392200_TestBa..> | 2023-08-05 03:41 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119392200_TestBa..> | 2023-08-06 11:19 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119392200_TestBa..> | 2023-05-04 02:03 | 32K | |
![[IMG]](/icons/image2.gif) | 9781119393412_TestBa..> | 2023-08-06 13:12 | 9.5K | |
![[IMG]](/icons/image2.gif) | 9781119393412_TestBa..> | 2023-08-09 02:53 | 21K | |
![[IMG]](/icons/image2.gif) | 9781119393412_TestBa..> | 2023-05-04 02:08 | 29K | |
![[ ]](/icons/layout.gif) | 9781119393412_TestBa..> | 2023-05-04 02:08 | 435K | |
![[ ]](/icons/unknown.gif) | 9781119395232_TestBa..> | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | 9781119395867_TestBa..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119401810_Soluti..> | 2023-08-06 05:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781119401810_Soluti..> | 2023-08-05 14:35 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119401810_Soluti..> | 2023-05-03 11:23 | 21K | |
![[ ]](/icons/unknown.gif) | 9781119401810_Soluti..> | 2023-05-03 11:23 | 41K | |
![[IMG]](/icons/image2.gif) | 9781119401810_TestBa..> | 2023-08-06 11:14 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781119401810_TestBa..> | 2023-08-23 19:36 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119401810_TestBa..> | 2023-05-03 11:23 | 21K | |
![[ ]](/icons/unknown.gif) | 9781119401810_TestBa..> | 2023-05-03 11:23 | 77K | |
![[IMG]](/icons/image2.gif) | 9781119403999_Soluti..> | 2023-08-06 05:44 | 9.3K | |
![[IMG]](/icons/image2.gif) | 9781119403999_Soluti..> | 2023-08-08 08:38 | 20K | |
![[IMG]](/icons/image2.gif) | 9781119403999_Soluti..> | 2023-05-04 01:55 | 27K | |
![[ ]](/icons/unknown.gif) | 9781119411697_TestBa..> | 2023-05-04 02:04 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-08-05 05:34 | 12K | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-05-04 02:24 | 18K | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-08-05 05:34 | 12K | |
![[IMG]](/icons/image2.gif) | 9781119484868_TestBa..> | 2023-05-04 01:58 | 18K | |
![[ ]](/icons/unknown.gif) | 9781119484868_TestBa..> | 2023-05-04 02:24 | 216K | |
![[ ]](/icons/unknown.gif) | 9781119491668_TestBa..> | 2023-05-03 13:42 | 46K | |
![[IMG]](/icons/image2.gif) | 9781119492443_Soluti..> | 2023-08-05 16:16 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119492443_Soluti..> | 2023-08-11 20:41 | 33K | |
![[IMG]](/icons/image2.gif) | 9781119492443_Soluti..> | 2023-05-04 02:27 | 51K | |
![[ ]](/icons/unknown.gif) | 9781119492443_Soluti..> | 2023-05-04 02:27 | 205K | |
![[IMG]](/icons/image2.gif) | 9781119493440_TestBa..> | 2023-08-06 03:24 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119493440_TestBa..> | 2023-08-23 23:50 | 35K | |
![[IMG]](/icons/image2.gif) | 9781119493440_TestBa..> | 2023-05-04 02:19 | 50K | |
![[ ]](/icons/unknown.gif) | 9781119493440_TestBa..> | 2023-05-04 02:19 | 64K | |
![[IMG]](/icons/image2.gif) | 9781119494171_Soluti..> | 2023-08-05 14:35 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119494171_Soluti..> | 2023-08-06 17:28 | 27K | |
![[IMG]](/icons/image2.gif) | 9781119494171_Soluti..> | 2023-05-04 02:21 | 36K | |
![[IMG]](/icons/image2.gif) | 9781119494638_Soluti..> | 2023-08-05 03:37 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119494638_Soluti..> | 2023-08-14 00:56 | 28K | |
![[IMG]](/icons/image2.gif) | 9781119494638_Soluti..> | 2023-05-03 10:58 | 40K | |
![[ ]](/icons/unknown.gif) | 9781119494638_Soluti..> | 2023-05-03 10:58 | 21K | |
![[ ]](/icons/unknown.gif) | 9781119495819_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119496335_TestBa..> | 2023-08-05 03:40 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119496335_TestBa..> | 2023-08-09 01:55 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119496335_TestBa..> | 2023-05-04 02:16 | 35K | |
![[ ]](/icons/unknown.gif) | 9781119496335_TestBa..> | 2023-05-04 02:16 | 58K | |
![[IMG]](/icons/image2.gif) | 9781119496489_Soluti..> | 2023-08-05 01:13 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119496489_Soluti..> | 2023-08-05 14:41 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119496489_Soluti..> | 2023-05-04 02:05 | 32K | |
![[ ]](/icons/unknown.gif) | 9781119496489_Soluti..> | 2023-05-04 02:05 | 72K | |
![[IMG]](/icons/image2.gif) | 9781119496489_TestBa..> | 2023-08-06 12:18 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119496489_TestBa..> | 2023-08-05 03:43 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119496489_TestBa..> | 2023-05-04 02:05 | 32K | |
![[ ]](/icons/unknown.gif) | 9781119496489_TestBa..> | 2023-05-04 02:05 | 41K | |
![[IMG]](/icons/image2.gif) | 9781119497110_Soluti..> | 2023-08-05 01:08 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119497110_Soluti..> | 2023-08-05 17:23 | 25K | |
![[IMG]](/icons/image2.gif) | 9781119497110_Soluti..> | 2023-05-04 02:02 | 31K | |
![[ ]](/icons/unknown.gif) | 9781119497493-ch01.docx | 2023-05-03 13:44 | 21K | |
![[IMG]](/icons/image2.gif) | 9781119497653_TestBa..> | 2023-08-08 22:00 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119497653_TestBa..> | 2023-09-08 14:47 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119497653_TestBa..> | 2023-05-04 02:19 | 33K | |
![[IMG]](/icons/image2.gif) | 9781119498056_TestBa..> | 2023-08-07 04:34 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119498056_TestBa..> | 2023-10-09 12:35 | 32K | |
![[IMG]](/icons/image2.gif) | 9781119498056_TestBa..> | 2023-05-04 01:48 | 42K | |
![[ ]](/icons/unknown.gif) | 9781119498056_TestBa..> | 2023-05-04 01:48 | 24K | |
![[IMG]](/icons/image2.gif) | 9781119498117_TestBa..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781119498117_TestBa..> | 2023-08-17 00:57 | 20K | |
![[IMG]](/icons/image2.gif) | 9781119498117_TestBa..> | 2023-05-04 02:23 | 33K | |
![[ ]](/icons/unknown.gif) | 9781119498117_TestBa..> | 2023-05-04 02:23 | 58K | |
![[IMG]](/icons/image2.gif) | 9781119503682_TestBa..> | 2023-08-05 14:40 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119503682_TestBa..> | 2023-08-09 01:55 | 33K | |
![[IMG]](/icons/image2.gif) | 9781119503682_TestBa..> | 2023-05-03 11:02 | 48K | |
![[ ]](/icons/unknown.gif) | 9781119503682_TestBa..> | 2023-05-03 11:08 | 217K | |
![[IMG]](/icons/image2.gif) | 9781119554929_TestBa..> | 2023-08-05 23:08 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119554929_TestBa..> | 2023-08-20 01:49 | 30K | |
![[IMG]](/icons/image2.gif) | 9781119554929_TestBa..> | 2023-05-04 02:06 | 41K | |
![[ ]](/icons/unknown.gif) | 9781119554929_TestBa..> | 2023-05-04 02:06 | 46K | |
![[IMG]](/icons/image2.gif) | 9781119561170_Soluti..> | 2023-08-05 16:20 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119561170_Soluti..> | 2023-08-05 04:35 | 27K | |
![[IMG]](/icons/image2.gif) | 9781119561170_Soluti..> | 2023-05-04 02:07 | 35K | |
![[IMG]](/icons/image2.gif) | 9781119561170_TestBa..> | 2023-08-05 03:39 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119561170_TestBa..> | 2023-08-16 01:58 | 27K | |
![[IMG]](/icons/image2.gif) | 9781119561170_TestBa..> | 2023-05-04 02:07 | 35K | |
![[ ]](/icons/unknown.gif) | 9781119562153_TestBa..> | 2023-05-03 13:42 | 74K | |
![[ ]](/icons/unknown.gif) | 9781119577638_Soluti..> | 2023-05-03 13:42 | 92K | |
![[IMG]](/icons/image2.gif) | 9781119577706_Soluti..> | 2023-08-05 06:25 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119577706_Soluti..> | 2023-08-08 08:38 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119577706_Soluti..> | 2023-05-04 02:10 | 34K | |
![[ ]](/icons/unknown.gif) | 9781119577706_Soluti..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119577706_TestBa..> | 2023-08-06 08:44 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119577706_TestBa..> | 2023-09-08 14:47 | 26K | |
![[IMG]](/icons/image2.gif) | 9781119577706_TestBa..> | 2023-05-04 02:10 | 34K | |
![[ ]](/icons/unknown.gif) | 9781119577706_TestBa..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9781119578123_TestBa..> | 2023-08-08 04:27 | 13K | |
![[IMG]](/icons/image2.gif) | 9781119578123_TestBa..> | 2023-08-21 19:15 | 25K | |
![[IMG]](/icons/image2.gif) | 9781119578123_TestBa..> | 2023-05-04 01:54 | 33K | |
![[ ]](/icons/unknown.gif) | 9781119578123_TestBa..> | 2023-05-04 01:54 | 70K | |
![[IMG]](/icons/image2.gif) | 9781119588702_TestBa..> | 2023-08-05 06:23 | 11K | |
![[IMG]](/icons/image2.gif) | 9781119588702_TestBa..> | 2023-08-18 10:49 | 28K | |
![[IMG]](/icons/image2.gif) | 9781119588702_TestBa..> | 2023-05-04 02:08 | 37K | |
![[ ]](/icons/layout.gif) | 9781119588702_TestBa..> | 2023-05-04 02:08 | 395K | |
![[IMG]](/icons/image2.gif) | 9781119594611_Soluti..> | 2023-08-06 11:13 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9781119594611_Soluti..> | 2023-08-12 04:50 | 22K | |
![[IMG]](/icons/image2.gif) | 9781119594611_Soluti..> | 2023-05-04 02:22 | 29K | |
![[ ]](/icons/unknown.gif) | 9781119594611_Soluti..> | 2023-05-04 02:22 | 346K | |
![[IMG]](/icons/image2.gif) | 9781119598169_TestBa..> | 2023-08-05 04:31 | 14K | |
![[IMG]](/icons/image2.gif) | 9781119598169_TestBa..> | 2023-08-05 14:38 | 30K | |
![[IMG]](/icons/image2.gif) | 9781119598169_TestBa..> | 2023-05-04 02:13 | 39K | |
![[ ]](/icons/unknown.gif) | 9781119598169_TestBa..> | 2023-05-04 02:13 | 363K | |
![[IMG]](/icons/image2.gif) | 9781133188636-TB111-..> | 2023-08-06 00:57 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781133188636-TB111-..> | 2023-08-05 01:12 | 15K | |
![[IMG]](/icons/image2.gif) | 9781133188636-TB111.jpg | 2023-05-03 09:12 | 30K | |
![[IMG]](/icons/image2.gif) | 9781133190646-TB-100..> | 2023-08-05 18:15 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9781133190646-TB.jpg | 2023-05-03 09:46 | 11K | |
![[IMG]](/icons/image2.gif) | 9781133435174-TB-100..> | 2023-08-08 22:01 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781133435174-TB.jpg | 2023-05-03 09:27 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9781133490678_Soluti..> | 2023-08-05 06:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781133490678_Soluti..> | 2023-08-09 09:14 | 14K | |
![[IMG]](/icons/image2.gif) | 9781133490678_Soluti..> | 2023-05-04 02:29 | 14K | |
![[ ]](/icons/layout.gif) | 9781133490678_Soluti..> | 2023-05-04 02:29 | 0 | |
![[ ]](/icons/unknown.gif) | 9781133526322_IM_ch0..> | 2023-05-03 11:24 | 92K | |
![[ ]](/icons/compressed.gif) | 9781133526322_TB_ch0..> | 2023-05-03 10:07 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9781133592969_Soluti..> | 2023-08-06 03:26 | 11K | |
![[IMG]](/icons/image2.gif) | 9781133592969_Soluti..> | 2023-08-09 22:25 | 31K | |
![[IMG]](/icons/image2.gif) | 9781133592969_Soluti..> | 2023-05-04 01:52 | 125K | |
![[IMG]](/icons/image2.gif) | 9781133594161-100x10..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781133594161.jpg | 2023-05-03 10:10 | 6.4K | |
![[ ]](/icons/layout.gif) | 9781133611097_TestBa..> | 2023-05-04 02:18 | 140K | |
![[ ]](/icons/unknown.gif) | 9781133814993_TESTBA..> | 2023-05-03 09:32 | 80K | |
![[IMG]](/icons/image2.gif) | 9781133939214_TestBa..> | 2023-08-06 02:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781133939214_TestBa..> | 2023-10-22 19:34 | 13K | |
![[IMG]](/icons/image2.gif) | 9781133939214_TestBa..> | 2023-05-04 02:19 | 13K | |
![[ ]](/icons/unknown.gif) | 9781133939214_TestBa..> | 2023-05-04 02:19 | 90K | |
![[ ]](/icons/compressed.gif) | 9781133957911-SOLUTI..> | 2023-05-03 09:27 | 453K | |
![[IMG]](/icons/image2.gif) | 9781138656697_TestBa..> | 2023-08-08 06:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781138656697_TestBa..> | 2023-05-04 02:27 | 34K | |
![[ ]](/icons/unknown.gif) | 9781138656697_TestBa..> | 2023-05-04 02:27 | 0 | |
![[IMG]](/icons/image2.gif) | 9781138898585_TestBa..> | 2023-08-05 15:31 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781138898585_TestBa..> | 2023-05-04 01:59 | 27K | |
![[ ]](/icons/unknown.gif) | 9781138898585_TestBa..> | 2023-05-04 01:59 | 24K | |
![[ ]](/icons/unknown.gif) | 9781259235719_Slavin..> | 2023-05-04 01:58 | 24K | |
![[ ]](/icons/unknown.gif) | 9781259235719_Slavin..> | 2023-05-04 01:58 | 60K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-08-05 05:30 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-08-21 19:12 | 27K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-05-04 02:24 | 43K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-08-05 02:45 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-08-21 19:12 | 27K | |
![[IMG]](/icons/image2.gif) | 9781259271304_Soluti..> | 2023-05-04 01:49 | 43K | |
![[ ]](/icons/layout.gif) | 9781259271304_Soluti..> | 2023-05-04 02:24 | 930K | |
![[IMG]](/icons/image2.gif) | 9781259271304_TestBa..> | 2023-08-08 21:04 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9781259271304_TestBa..> | 2023-08-07 18:00 | 27K | |
![[IMG]](/icons/image2.gif) | 9781259271304_TestBa..> | 2023-05-04 01:49 | 43K | |
![[ ]](/icons/unknown.gif) | 9781259271304_TestBa..> | 2023-05-04 01:49 | 182K | |
![[IMG]](/icons/image2.gif) | 9781259272011_Soluti..> | 2023-08-08 21:59 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781259272011_Soluti..> | 2023-08-08 14:34 | 19K | |
![[IMG]](/icons/image2.gif) | 9781259272011_Soluti..> | 2023-05-04 02:26 | 27K | |
![[ ]](/icons/unknown.gif) | 9781259272011_Soluti..> | 2023-05-04 02:26 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259273469_TestBa..> | 2023-08-06 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781259273469_TestBa..> | 2023-08-13 22:07 | 19K | |
![[IMG]](/icons/image2.gif) | 9781259273469_TestBa..> | 2023-05-04 01:56 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259273469_TestBa..> | 2023-05-04 01:56 | 165K | |
![[ ]](/icons/unknown.gif) | 9781259277177_Chapte..> | 2023-05-04 02:17 | 39K | |
![[ ]](/icons/layout.gif) | 9781259281594-tspl.pdf | 2023-05-03 11:02 | 127K | |
![[IMG]](/icons/image2.gif) | 9781259334870-1-100x..> | 2023-08-05 05:29 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259334870-1-300x..> | 2023-08-13 19:44 | 31K | |
![[IMG]](/icons/image2.gif) | 9781259334870-1.jpg | 2023-05-04 02:11 | 46K | |
![[IMG]](/icons/image2.gif) | 9781259334870-100x10..> | 2023-08-08 06:41 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259334870-300x30..> | 2023-08-12 15:36 | 31K | |
![[IMG]](/icons/image2.gif) | 9781259334870.jpg | 2023-05-03 10:35 | 46K | |
![[ ]](/icons/unknown.gif) | 9781259398629_McKinl..> | 2023-05-03 13:41 | 115K | |
![[ ]](/icons/unknown.gif) | 9781259464287_TestBa..> | 2023-05-03 11:23 | 179K | |
![[ ]](/icons/layout.gif) | 9781259573200-TEST-B..> | 2023-05-04 02:00 | 212K | |
![[IMG]](/icons/image2.gif) | 9781259573200_TestBa..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781259573200_TestBa..> | 2023-09-04 18:10 | 19K | |
![[IMG]](/icons/image2.gif) | 9781259573200_TestBa..> | 2023-05-04 02:09 | 23K | |
![[ ]](/icons/unknown.gif) | 9781259573200_TestBa..> | 2023-05-04 02:09 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259608568_TestBa..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259608568_TestBa..> | 2023-10-22 21:21 | 23K | |
![[IMG]](/icons/image2.gif) | 9781259608568_TestBa..> | 2023-05-03 11:01 | 25K | |
![[ ]](/icons/unknown.gif) | 9781259631757_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781259637155_Marsha..> | 2023-05-04 02:13 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259637155_Soluti..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781259637155_Soluti..> | 2023-08-12 14:44 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259637155_Soluti..> | 2023-05-04 02:13 | 21K | |
![[IMG]](/icons/image2.gif) | 9781259654657_Soluti..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259654657_Soluti..> | 2023-08-25 07:49 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259654657_Soluti..> | 2023-05-04 02:17 | 35K | |
![[IMG]](/icons/image2.gif) | 9781259654695_Soluti..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259654695_Soluti..> | 2023-08-16 23:57 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259654695_Soluti..> | 2023-05-04 01:50 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259654695_Soluti..> | 2023-05-04 01:50 | 98K | |
![[IMG]](/icons/image2.gif) | 9781259654695_TestBa..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259654695_TestBa..> | 2023-10-03 21:37 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259654695_TestBa..> | 2023-05-03 10:52 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259654695_TestBa..> | 2023-05-03 10:52 | 54K | |
![[IMG]](/icons/image2.gif) | 9781259654879_Soluti..> | 2023-08-05 01:52 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781259654879_Soluti..> | 2023-08-10 19:39 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259654879_Soluti..> | 2023-05-03 11:06 | 22K | |
![[ ]](/icons/layout.gif) | 9781259654879_Soluti..> | 2023-05-03 11:05 | 851K | |
![[IMG]](/icons/image2.gif) | 9781259654879_TestBa..> | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781259654879_TestBa..> | 2023-09-05 03:45 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259654879_TestBa..> | 2023-05-03 11:06 | 22K | |
![[ ]](/icons/layout.gif) | 9781259654879_TestBa..> | 2023-05-03 11:06 | 2.2M | |
![[ ]](/icons/layout.gif) | 9781259654886_SM15ce..> | 2023-05-04 02:20 | 851K | |
![[IMG]](/icons/image2.gif) | 9781259654886_Soluti..> | 2023-08-06 13:07 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259654886_Soluti..> | 2023-08-15 09:54 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259654886_Soluti..> | 2023-05-04 02:21 | 30K | |
![[IMG]](/icons/image2.gif) | 9781259654886_TestBa..> | 2023-08-06 07:44 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259654886_TestBa..> | 2023-09-23 01:07 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259654886_TestBa..> | 2023-05-03 11:05 | 30K | |
![[ ]](/icons/layout.gif) | 9781259654886_TestBa..> | 2023-05-03 11:05 | 3.4M | |
![[IMG]](/icons/image2.gif) | 9781259669934-100x10..> | 2023-08-06 14:39 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781259669934.jpeg | 2023-05-03 11:02 | 13K | |
![[ ]](/icons/layout.gif) | 9781259676512-spl.pdf | 2023-05-03 13:42 | 317K | |
![[ ]](/icons/compressed.gif) | 9781259680939.zip | 2023-05-03 10:58 | 30K | |
![[IMG]](/icons/image2.gif) | 9781259680939_TestBa..> | 2023-08-06 08:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781259680939_TestBa..> | 2023-08-17 03:14 | 15K | |
![[IMG]](/icons/image2.gif) | 9781259680939_TestBa..> | 2023-05-03 10:58 | 21K | |
![[ ]](/icons/unknown.gif) | 9781259685224_Gering..> | 2023-05-03 10:56 | 89K | |
![[ ]](/icons/unknown.gif) | 9781259685224_Gering..> | 2023-05-03 10:58 | 53K | |
![[ ]](/icons/unknown.gif) | 9781259692406_Ch01So..> | 2023-05-03 13:40 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259694516_TestBa..> | 2023-08-06 03:50 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781259694516_TestBa..> | 2023-08-28 21:31 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259694516_TestBa..> | 2023-05-04 02:20 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259694516_TestBa..> | 2023-05-04 02:20 | 95K | |
![[IMG]](/icons/image2.gif) | 9781259702730_TestBa..> | 2023-08-06 05:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781259702730_TestBa..> | 2023-09-12 12:05 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259702730_TestBa..> | 2023-05-04 02:09 | 25K | |
![[IMG]](/icons/image2.gif) | 9781259707766_TestBa..> | 2023-08-05 16:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781259707766_TestBa..> | 2023-08-17 03:14 | 12K | |
![[IMG]](/icons/image2.gif) | 9781259707766_TestBa..> | 2023-05-04 01:48 | 15K | |
![[ ]](/icons/unknown.gif) | 9781259707766_TestBa..> | 2023-05-04 01:48 | 53K | |
![[ ]](/icons/unknown.gif) | 9781259709074_Chapte..> | 2023-05-04 02:23 | 166K | |
![[ ]](/icons/unknown.gif) | 9781259709951_stephe..> | 2023-05-04 02:24 | 25K | |
![[ ]](/icons/unknown.gif) | 9781259709968_smith1..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259712357_TestBa..> | 2023-08-05 01:54 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781259712357_TestBa..> | 2023-08-09 12:09 | 18K | |
![[IMG]](/icons/image2.gif) | 9781259712357_TestBa..> | 2023-05-04 02:19 | 23K | |
![[ ]](/icons/unknown.gif) | 9781259712357_TestBa..> | 2023-05-04 02:09 | 0 | |
![[ ]](/icons/unknown.gif) | 9781259712357_cateor..> | 2023-05-04 02:19 | 48K | |
![[ ]](/icons/layout.gif) | 9781259722660_Soluti..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/layout.gif) | 9781259722660_TestBa..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/unknown.gif) | 9781259741104_Kay19e..> | 2023-05-04 02:11 | 0 | |
![[ ]](/icons/unknown.gif) | 9781259741104_Soluti..> | 2023-05-03 13:42 | 763K | |
![[IMG]](/icons/image2.gif) | 9781259741104_TestBa..> | 2023-08-08 06:40 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9781259741104_TestBa..> | 2023-05-04 02:11 | 16K | |
![[ ]](/icons/unknown.gif) | 9781259747984_Doupni..> | 2023-05-04 02:02 | 40K | |
![[IMG]](/icons/image2.gif) | 9781259747984_Soluti..> | 2023-08-05 17:19 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781259747984_Soluti..> | 2023-08-05 03:41 | 13K | |
![[IMG]](/icons/image2.gif) | 9781259747984_Soluti..> | 2023-05-04 02:18 | 17K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-08-05 02:03 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-08-09 01:55 | 13K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-05-04 02:18 | 17K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-08-05 16:24 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-08-09 01:55 | 13K | |
![[IMG]](/icons/image2.gif) | 9781259747984_TestBa..> | 2023-05-04 02:11 | 17K | |
![[IMG]](/icons/image2.gif) | 9781259755330_TestBa..> | 2023-08-06 03:49 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781259755330_TestBa..> | 2023-08-06 07:45 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259755330_TestBa..> | 2023-05-04 01:50 | 34K | |
![[ ]](/icons/layout.gif) | 9781259755330_TestBa..> | 2023-05-04 01:50 | 1.2M | |
![[IMG]](/icons/image2.gif) | 9781259822674_Soluti..> | 2023-08-06 08:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781259822674_Soluti..> | 2023-08-05 19:10 | 17K | |
![[IMG]](/icons/image2.gif) | 9781259822674_Soluti..> | 2023-05-04 01:57 | 21K | |
![[ ]](/icons/layout.gif) | 9781259822674_Thermo..> | 2023-05-04 01:57 | 758K | |
![[ ]](/icons/unknown.gif) | 9781259844713_Soluti..> | 2023-05-04 02:21 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259852022_schill..> | 2023-05-03 13:42 | 686K | |
![[ ]](/icons/unknown.gif) | 9781259852060_Frank7..> | 2023-05-04 02:00 | 54K | |
![[IMG]](/icons/image2.gif) | 9781259852060_TestBa..> | 2023-08-08 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781259852060_TestBa..> | 2023-08-06 04:15 | 14K | |
![[IMG]](/icons/image2.gif) | 9781259852060_TestBa..> | 2023-05-04 02:00 | 20K | |
![[ ]](/icons/unknown.gif) | 9781259870446_TestBa..> | 2023-05-03 13:42 | 69K | |
![[ ]](/icons/unknown.gif) | 9781259870491_TestBa..> | 2023-05-03 13:42 | 104K | |
![[IMG]](/icons/image2.gif) | 9781259870514_TestBa..> | 2023-08-05 04:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259870514_TestBa..> | 2023-05-04 01:57 | 37K | |
![[ ]](/icons/unknown.gif) | 9781259870514_miller..> | 2023-05-04 01:57 | 27K | |
![[IMG]](/icons/image2.gif) | 9781259870552_TestBa..> | 2023-08-06 07:49 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781259870552_TestBa..> | 2023-08-27 02:51 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259870552_TestBa..> | 2023-05-04 02:21 | 28K | |
![[ ]](/icons/unknown.gif) | 9781259870552_keyton..> | 2023-05-04 02:21 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259872976_Soluti..> | 2023-08-08 04:27 | 5.9K | |
![[IMG]](/icons/image2.gif) | 9781259872976_Soluti..> | 2023-08-11 11:53 | 38K | |
![[IMG]](/icons/image2.gif) | 9781259872976_Soluti..> | 2023-05-04 02:23 | 46K | |
![[IMG]](/icons/image2.gif) | 9781259880209-100x10..> | 2023-08-05 01:09 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9781259880209.jpeg | 2023-05-03 11:00 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259883989_TestBa..> | 2023-08-09 04:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259883989_TestBa..> | 2023-08-09 02:53 | 19K | |
![[IMG]](/icons/image2.gif) | 9781259883989_TestBa..> | 2023-05-04 02:23 | 26K | |
![[ ]](/icons/unknown.gif) | 9781259883989_TestBa..> | 2023-05-04 02:23 | 60K | |
![[ ]](/icons/unknown.gif) | 9781259903915_Soluti..> | 2023-05-03 11:06 | 180K | |
![[IMG]](/icons/image2.gif) | 9781259903915_TestBa..> | 2023-08-09 01:49 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781259903915_TestBa..> | 2023-09-20 09:04 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259903915_TestBa..> | 2023-05-04 01:49 | 25K | |
![[ ]](/icons/unknown.gif) | 9781259903915_TestBa..> | 2023-05-04 01:49 | 98K | |
![[ ]](/icons/unknown.gif) | 9781259911149_Bauer5..> | 2023-05-04 02:25 | 181K | |
![[ ]](/icons/layout.gif) | 9781259911149_Bauer5..> | 2023-05-04 02:25 | 1.3M | |
![[ ]](/icons/layout.gif) | 9781259911156_ISM_Ch..> | 2023-05-03 11:24 | 437K | |
![[IMG]](/icons/image2.gif) | 9781259911156_Soluti..> | 2023-08-05 14:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781259911156_Soluti..> | 2023-08-16 15:50 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259911156_Soluti..> | 2023-05-03 11:24 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259911156_TestBa..> | 2023-08-05 20:19 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781259911156_TestBa..> | 2023-08-05 14:41 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259911156_TestBa..> | 2023-05-03 11:24 | 28K | |
![[ ]](/icons/unknown.gif) | 9781259911156_TestBa..> | 2023-05-03 11:24 | 474K | |
![[IMG]](/icons/image2.gif) | 9781259911644_TestBa..> | 2023-08-06 11:17 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9781259911644_TestBa..> | 2023-08-05 05:34 | 13K | |
![[IMG]](/icons/image2.gif) | 9781259911644_TestBa..> | 2023-05-04 01:54 | 17K | |
![[ ]](/icons/unknown.gif) | 9781259911644_TestBa..> | 2023-05-04 01:54 | 48K | |
![[IMG]](/icons/image2.gif) | 9781259912405_TestBa..> | 2023-08-06 03:36 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781259912405_TestBa..> | 2023-08-26 03:34 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259912405_TestBa..> | 2023-05-04 02:04 | 21K | |
![[ ]](/icons/unknown.gif) | 9781259912405_patter..> | 2023-05-04 02:04 | 0 | |
![[ ]](/icons/unknown.gif) | 9781259912443_Losco6..> | 2023-05-04 01:49 | 33K | |
![[ ]](/icons/unknown.gif) | 9781259913877_TestBa..> | 2023-05-04 02:18 | 22K | |
![[ ]](/icons/unknown.gif) | 9781259916977_Christ..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259916977_Soluti..> | 2023-08-05 06:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781259916977_Soluti..> | 2023-08-18 10:03 | 18K | |
![[IMG]](/icons/image2.gif) | 9781259916977_Soluti..> | 2023-05-04 02:19 | 24K | |
![[ ]](/icons/layout.gif) | 9781259916977_Soluti..> | 2023-05-04 02:19 | 1.2M | |
![[ ]](/icons/layout.gif) | 9781259916977_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-08-05 16:24 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-08-05 06:25 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-05-04 02:03 | 36K | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-08-05 04:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-08-19 01:45 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259916984_Soluti..> | 2023-05-04 01:47 | 36K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-08-05 03:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-11-01 05:03 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-05-04 02:03 | 36K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-08-05 02:46 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-11-01 05:03 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259916984_TestBa..> | 2023-05-04 01:47 | 36K | |
![[IMG]](/icons/image2.gif) | 9781259917004_Soluti..> | 2023-08-05 15:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781259917004_Soluti..> | 2023-08-14 19:44 | 15K | |
![[IMG]](/icons/image2.gif) | 9781259917004_Soluti..> | 2023-05-04 02:08 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259917004_TestBa..> | 2023-08-05 15:26 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781259917004_TestBa..> | 2023-08-28 22:20 | 15K | |
![[IMG]](/icons/image2.gif) | 9781259917004_TestBa..> | 2023-05-04 02:10 | 20K | |
![[ ]](/icons/unknown.gif) | 9781259917028_bloche..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259917059_Soluto..> | 2023-08-05 16:23 | 6.8K | |
![[IMG]](/icons/image2.gif) | 9781259917059_Soluto..> | 2023-08-17 19:59 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259917059_Soluto..> | 2023-05-04 02:04 | 32K | |
![[IMG]](/icons/image2.gif) | 9781259917059_TestBa..> | 2023-08-05 15:31 | 6.8K | |
![[IMG]](/icons/image2.gif) | 9781259917059_TestBa..> | 2023-08-14 21:32 | 24K | |
![[IMG]](/icons/image2.gif) | 9781259917059_TestBa..> | 2023-05-04 02:04 | 32K | |
![[ ]](/icons/unknown.gif) | 9781259917066_Brewer..> | 2023-05-04 02:15 | 264K | |
![[IMG]](/icons/image2.gif) | 9781259917134_Soluti..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781259917134_Soluti..> | 2023-08-17 10:32 | 17K | |
![[IMG]](/icons/image2.gif) | 9781259917134_Soluti..> | 2023-05-04 02:00 | 23K | |
![[ ]](/icons/unknown.gif) | 9781259918926_Soluit..> | 2023-05-03 11:17 | 203K | |
![[IMG]](/icons/image2.gif) | 9781259922633_TestBa..> | 2023-08-08 01:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781259922633_TestBa..> | 2023-09-17 19:43 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259922633_TestBa..> | 2023-05-04 01:53 | 27K | |
![[ ]](/icons/unknown.gif) | 9781259922633_harris..> | 2023-05-04 01:53 | 22K | |
![[IMG]](/icons/image2.gif) | 9781259927621_TestBa..> | 2023-08-06 08:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9781259927621_TestBa..> | 2023-08-06 05:40 | 12K | |
![[IMG]](/icons/image2.gif) | 9781259927621_TestBa..> | 2023-05-04 02:02 | 16K | |
![[ ]](/icons/unknown.gif) | 9781259927645_batema..> | 2023-05-04 01:54 | 69K | |
![[IMG]](/icons/image2.gif) | 9781259929434_Soluti..> | 2023-08-05 14:34 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781259929434_Soluti..> | 2023-08-09 22:25 | 10K | |
![[IMG]](/icons/image2.gif) | 9781259929434_Soluti..> | 2023-05-04 01:52 | 14K | |
![[ ]](/icons/unknown.gif) | 9781259929632_Reynol..> | 2023-05-04 02:16 | 1.4M | |
![[IMG]](/icons/image2.gif) | 9781259929632_TestBa..> | 2023-08-06 11:14 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781259929632_TestBa..> | 2023-09-11 23:26 | 23K | |
![[IMG]](/icons/image2.gif) | 9781259929632_TestBa..> | 2023-05-04 02:16 | 29K | |
![[ ]](/icons/unknown.gif) | 9781259929649_Soluti..> | 2023-05-04 01:55 | 40K | |
![[ ]](/icons/unknown.gif) | 9781259929656_Soluti..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259963261_TestBa..> | 2023-08-06 11:14 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781259963261_TestBa..> | 2023-08-27 02:56 | 12K | |
![[IMG]](/icons/image2.gif) | 9781259963261_TestBa..> | 2023-05-04 01:48 | 20K | |
![[IMG]](/icons/image2.gif) | 9781259964947-1-100x..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781259964947-1-300x..> | 2023-08-24 00:34 | 21K | |
![[IMG]](/icons/image2.gif) | 9781259964947-1.jpeg | 2023-05-04 02:27 | 27K | |
![[IMG]](/icons/image2.gif) | 9781259964947-100x10..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781259964947-300x30..> | 2023-09-12 09:51 | 21K | |
![[IMG]](/icons/image2.gif) | 9781259964947.jpeg | 2023-05-04 02:26 | 27K | |
![[ ]](/icons/unknown.gif) | 9781259964947_Libby_..> | 2023-05-04 02:27 | 79K | |
![[ ]](/icons/unknown.gif) | 9781259964947_libby1..> | 2023-05-04 02:26 | 58K | |
![[ ]](/icons/unknown.gif) | 9781259969478_Lanen_..> | 2023-05-04 02:13 | 0 | |
![[IMG]](/icons/image2.gif) | 9781259969478_Soluti..> | 2023-08-05 17:21 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781259969478_Soluti..> | 2023-08-08 14:34 | 18K | |
![[IMG]](/icons/image2.gif) | 9781259969478_Soluti..> | 2023-05-04 02:13 | 25K | |
![[ ]](/icons/unknown.gif) | 9781259969478_lanen6..> | 2023-05-04 02:03 | 160K | |
![[ ]](/icons/layout.gif) | 9781259969515_Chapte..> | 2023-05-04 02:00 | 5.1M | |
![[IMG]](/icons/image2.gif) | 9781259969515_Soluti..> | 2023-08-08 15:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259969515_Soluti..> | 2023-05-04 02:00 | 11K | |
![[IMG]](/icons/image2.gif) | 9781259969515_TestBa..> | 2023-08-06 11:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259969515_TestBa..> | 2023-05-04 02:00 | 11K | |
![[ ]](/icons/unknown.gif) | 9781259969539_Richar..> | 2023-05-04 01:49 | 41K | |
![[IMG]](/icons/image2.gif) | 9781259969539_Soluti..> | 2023-08-05 23:08 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9781259969539_Soluti..> | 2023-08-17 19:59 | 29K | |
![[IMG]](/icons/image2.gif) | 9781259969539_Soluti..> | 2023-05-04 01:49 | 33K | |
![[IMG]](/icons/image2.gif) | 9781259969539_TestBa..> | 2023-08-05 04:17 | 4.9K | |
![[IMG]](/icons/image2.gif) | 9781259969539_TestBa..> | 2023-08-15 18:11 | 29K | |
![[IMG]](/icons/image2.gif) | 9781259969539_TestBa..> | 2023-05-04 01:49 | 33K | |
![[ ]](/icons/unknown.gif) | 9781259969546_Jones2..> | 2023-05-04 02:01 | 27K | |
![[ ]](/icons/unknown.gif) | 9781259969546_Jones_..> | 2023-05-04 02:01 | 29K | |
![[IMG]](/icons/image2.gif) | 9781259969546_Soluti..> | 2023-08-06 09:42 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259969546_Soluti..> | 2023-05-04 02:01 | 11K | |
![[IMG]](/icons/image2.gif) | 9781259969546_TestBa..> | 2023-08-05 20:19 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781259969546_TestBa..> | 2023-05-04 02:01 | 11K | |
![[IMG]](/icons/image2.gif) | 9781259969621_TestBa..> | 2023-08-05 03:37 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9781259969621_TestBa..> | 2023-08-06 11:19 | 28K | |
![[IMG]](/icons/image2.gif) | 9781259969621_TestBa..> | 2023-05-03 11:03 | 34K | |
![[ ]](/icons/unknown.gif) | 9781259969621_TestBa..> | 2023-05-03 11:03 | 32K | |
![[ ]](/icons/layout.gif) | 9781259969690_Soluti..> | 2023-05-03 13:43 | 3.9M | |
![[ ]](/icons/layout.gif) | 9781259969690_TestBa..> | 2023-05-03 13:43 | 797K | |
![[IMG]](/icons/image2.gif) | 9781259998164_Soluti..> | 2023-08-05 02:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781259998164_Soluti..> | 2023-08-23 21:13 | 16K | |
![[IMG]](/icons/image2.gif) | 9781259998164_Soluti..> | 2023-05-04 01:55 | 20K | |
![[ ]](/icons/unknown.gif) | 9781259998164_Soluti..> | 2023-05-04 01:55 | 96K | |
![[IMG]](/icons/image2.gif) | 9781260004724_Soluti..> | 2023-08-06 09:51 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781260004724_Soluti..> | 2023-08-05 15:27 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260004724_Soluti..> | 2023-05-04 02:21 | 14K | |
![[IMG]](/icons/image2.gif) | 9781260004731_Soluti..> | 2023-08-05 14:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260004731_Soluti..> | 2023-08-05 01:13 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260004731_Soluti..> | 2023-05-04 02:29 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-08-05 03:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-08-06 08:47 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-05-04 02:28 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-08-06 13:04 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-08-06 08:47 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260013832_Soluti..> | 2023-05-04 02:25 | 15K | |
![[ ]](/icons/unknown.gif) | 9781260013832_Soluti..> | 2023-05-04 02:28 | 65K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-08-06 03:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-08-21 19:15 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-05-04 02:25 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-08-09 07:04 | 2.4K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-08-21 19:15 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260013832_TestBa..> | 2023-05-04 02:13 | 15K | |
![[ ]](/icons/unknown.gif) | 9781260013832_TestBa..> | 2023-05-04 02:25 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260013870_TestBa..> | 2023-08-05 21:01 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260013870_TestBa..> | 2023-08-20 01:49 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260013870_TestBa..> | 2023-05-04 02:22 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-08-06 11:08 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-08-14 19:05 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-05-04 02:09 | 26K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-08-14 19:05 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260013894_TestBa..> | 2023-05-03 11:17 | 26K | |
![[ ]](/icons/unknown.gif) | 9781260013894_TestBa..> | 2023-05-04 02:09 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260013900_TestBa..> | 2023-08-05 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260013900_TestBa..> | 2023-11-01 05:03 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260013900_TestBa..> | 2023-05-04 02:25 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260013924_TestBa..> | 2023-08-06 09:42 | 1.9K | |
![[IMG]](/icons/image2.gif) | 9781260013924_TestBa..> | 2023-08-30 14:11 | 8.3K | |
![[IMG]](/icons/image2.gif) | 9781260013924_TestBa..> | 2023-05-04 02:15 | 12K | |
![[IMG]](/icons/image2.gif) | 9781260013955-100x10..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260013955-300x30..> | 2023-08-10 18:29 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260013955.jpeg | 2023-05-04 02:23 | 25K | |
![[ ]](/icons/unknown.gif) | 9781260013955_Ross_E..> | 2023-05-04 02:23 | 37K | |
![[IMG]](/icons/image2.gif) | 9781260013979_Soluti..> | 2023-08-06 04:18 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260013979_Soluti..> | 2023-08-08 14:34 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260013979_Soluti..> | 2023-05-04 01:54 | 30K | |
![[ ]](/icons/compressed.gif) | 9781260013979_Soluti..> | 2023-05-04 01:54 | 158K | |
![[ ]](/icons/unknown.gif) | 9781260013993_KDHH_1..> | 2023-05-04 01:55 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260013993_Soluti..> | 2023-08-06 13:11 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260013993_Soluti..> | 2023-08-21 02:16 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260013993_Soluti..> | 2023-05-04 01:55 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260013993_TestBa..> | 2023-08-08 14:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260013993_TestBa..> | 2023-10-19 03:55 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260013993_TestBa..> | 2023-05-04 01:55 | 28K | |
![[ ]](/icons/unknown.gif) | 9781260013993_kapoor..> | 2023-05-04 01:55 | 3.0M | |
![[ ]](/icons/unknown.gif) | 9781260017243_Shade3..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260017243_TestBa..> | 2023-08-05 14:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781260017243_TestBa..> | 2023-08-06 03:45 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260017243_TestBa..> | 2023-05-04 02:12 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260042269_TestBa..> | 2023-08-05 16:28 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781260042269_TestBa..> | 2023-08-15 20:03 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260042269_TestBa..> | 2023-05-04 02:17 | 28K | |
![[ ]](/icons/unknown.gif) | 9781260042269_feldma..> | 2023-05-04 02:17 | 35K | |
![[ ]](/icons/layout.gif) | 9781260043648-TEST-B..> | 2023-05-04 02:27 | 242K | |
![[IMG]](/icons/image2.gif) | 9781260043648_TestBa..> | 2023-08-06 11:19 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781260043648_TestBa..> | 2023-09-04 21:53 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260043648_TestBa..> | 2023-05-04 02:27 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260043747_TestBa..> | 2023-08-05 04:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260043747_TestBa..> | 2023-08-27 01:52 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260043747_TestBa..> | 2023-05-04 01:57 | 31K | |
![[ ]](/icons/layout.gif) | 9781260048384_Soluti..> | 2023-05-03 13:42 | 100K | |
![[ ]](/icons/unknown.gif) | 9781260048384_TestBa..> | 2023-05-03 13:42 | 28K | |
![[ ]](/icons/unknown.gif) | 9781260054309_Santro..> | 2023-05-04 02:28 | 42K | |
![[IMG]](/icons/image2.gif) | 9781260054309_TestBa..> | 2023-08-05 03:41 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9781260054309_TestBa..> | 2023-08-30 14:11 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260054309_TestBa..> | 2023-05-04 02:28 | 34K | |
![[IMG]](/icons/image2.gif) | 9781260056082_TestBa..> | 2023-08-05 14:37 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260056082_TestBa..> | 2023-09-12 09:51 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260056082_TestBa..> | 2023-05-04 02:04 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260060393_4.jpeg | 2023-05-04 02:27 | 14K | |
![[IMG]](/icons/image2.gif) | 9781260074956_TestBa..> | 2023-08-08 06:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260074956_TestBa..> | 2023-08-19 16:15 | 14K | |
![[IMG]](/icons/image2.gif) | 9781260074956_TestBa..> | 2023-05-04 01:54 | 19K | |
![[ ]](/icons/unknown.gif) | 9781260074956_TestBa..> | 2023-05-04 01:54 | 31K | |
![[ ]](/icons/layout.gif) | 9781260075113_Soluti..> | 2023-05-04 01:47 | 2.1M | |
![[IMG]](/icons/image2.gif) | 9781260075113_TestBa..> | 2023-08-06 04:11 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260075113_TestBa..> | 2023-09-08 14:47 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260075113_TestBa..> | 2023-05-04 02:28 | 22K | |
![[ ]](/icons/unknown.gif) | 9781260075113_TestBa..> | 2023-05-04 02:28 | 62K | |
![[IMG]](/icons/image2.gif) | 9781260075311_TestBa..> | 2023-08-06 09:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260075311_TestBa..> | 2023-10-12 15:27 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260075311_TestBa..> | 2023-05-04 02:14 | 26K | |
![[ ]](/icons/unknown.gif) | 9781260075311_TestBa..> | 2023-05-04 02:14 | 82K | |
![[IMG]](/icons/image2.gif) | 9781260087321_TestBa..> | 2023-08-05 05:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260087321_TestBa..> | 2023-05-03 11:22 | 30K | |
![[ ]](/icons/unknown.gif) | 9781260087321_TestBa..> | 2023-05-03 11:22 | 25K | |
![[ ]](/icons/unknown.gif) | 9781260087710_Grewal..> | 2023-05-04 01:56 | 65K | |
![[IMG]](/icons/image2.gif) | 9781260087710_TestBa..> | 2023-08-06 17:20 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260087710_TestBa..> | 2023-08-05 02:46 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260087710_TestBa..> | 2023-05-04 01:56 | 22K | |
![[ ]](/icons/unknown.gif) | 9781260087956_Schill..> | 2023-05-04 02:15 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260087956_Soluti..> | 2023-08-06 13:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260087956_Soluti..> | 2023-08-06 12:18 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260087956_Soluti..> | 2023-05-04 02:16 | 21K | |
![[ ]](/icons/unknown.gif) | 9781260087956_Soluti..> | 2023-05-04 02:16 | 139K | |
![[IMG]](/icons/image2.gif) | 9781260087956_TestBa..> | 2023-08-05 16:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260087956_TestBa..> | 2023-08-08 23:47 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260087956_TestBa..> | 2023-05-04 02:15 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260088373-1-100x..> | 2023-08-06 09:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781260088373-1-300x..> | 2023-08-09 05:08 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260088373-1.jpeg | 2023-05-04 02:22 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260088373-100x10..> | 2023-08-05 17:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781260088373-300x30..> | 2023-08-05 21:03 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260088373.jpeg | 2023-05-04 02:22 | 21K | |
![[ ]](/icons/unknown.gif) | 9781260088373_Hill11..> | 2023-05-04 02:15 | 53K | |
![[ ]](/icons/unknown.gif) | 9781260088373_Hill_G..> | 2023-05-04 02:15 | 105K | |
![[IMG]](/icons/image2.gif) | 9781260088373_Soluti..> | 2023-08-05 17:22 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260088373_Soluti..> | 2023-08-05 21:03 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260088373_Soluti..> | 2023-05-04 02:15 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260088373_TestBa..> | 2023-08-05 16:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260088373_TestBa..> | 2023-09-15 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260088373_TestBa..> | 2023-05-04 02:15 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260088878_TestBa..> | 2023-08-05 06:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260088878_TestBa..> | 2023-08-25 22:45 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260088878_TestBa..> | 2023-05-04 01:49 | 27K | |
![[ ]](/icons/unknown.gif) | 9781260088878_TestBa..> | 2023-05-04 01:49 | 46K | |
![[ ]](/icons/unknown.gif) | 9781260092332_Nickel..> | 2023-05-03 11:16 | 74K | |
![[IMG]](/icons/image2.gif) | 9781260092820_TestBa..> | 2023-08-08 06:39 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9781260092820_TestBa..> | 2023-09-06 02:57 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260092820_TestBa..> | 2023-05-04 02:12 | 32K | |
![[ ]](/icons/unknown.gif) | 9781260100044_Chapte..> | 2023-05-04 02:06 | 42K | |
![[ ]](/icons/unknown.gif) | 9781260119107_Smith6..> | 2023-05-04 01:58 | 256K | |
![[IMG]](/icons/image2.gif) | 9781260119107_TestBa..> | 2023-08-05 16:24 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781260119107_TestBa..> | 2023-08-13 23:07 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260119107_TestBa..> | 2023-05-04 01:58 | 29K | |
![[ ]](/icons/unknown.gif) | 9781260121209_Meyers..> | 2023-05-04 02:25 | 63K | |
![[IMG]](/icons/image2.gif) | 9781260121209_TestBa..> | 2023-08-06 17:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781260121209_TestBa..> | 2023-08-11 21:14 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260121209_TestBa..> | 2023-05-04 02:25 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260148909_TestBa..> | 2023-08-05 16:23 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260148909_TestBa..> | 2023-08-05 14:41 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260148909_TestBa..> | 2023-05-04 02:24 | 20K | |
![[ ]](/icons/unknown.gif) | 9781260148909_TestBa..> | 2023-05-04 02:24 | 59K | |
![[IMG]](/icons/image2.gif) | 9781260148916_TestBa..> | 2023-08-06 04:18 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260148916_TestBa..> | 2023-08-21 10:10 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260148916_TestBa..> | 2023-05-04 01:48 | 29K | |
![[ ]](/icons/unknown.gif) | 9781260148916_burdge..> | 2023-05-04 01:48 | 52K | |
![[ ]](/icons/unknown.gif) | 9781260148954_dennis..> | 2023-05-04 02:12 | 65K | |
![[ ]](/icons/unknown.gif) | 9781260153125_Chapte..> | 2023-05-04 01:59 | 61K | |
![[IMG]](/icons/image2.gif) | 9781260153125_TestBa..> | 2023-08-06 07:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781260153125_TestBa..> | 2023-08-06 13:12 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260153125_TestBa..> | 2023-05-04 01:59 | 32K | |
![[IMG]](/icons/image2.gif) | 9781260175769_TestBa..> | 2023-08-06 13:02 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260175769_TestBa..> | 2023-08-15 03:43 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260175769_TestBa..> | 2023-05-03 11:23 | 29K | |
![[ ]](/icons/unknown.gif) | 9781260175769_TestBa..> | 2023-05-03 11:23 | 17K | |
![[ ]](/icons/layout.gif) | 9781260189667_Spilke..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260193749-1-100x..> | 2023-08-05 17:17 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260193749-1.jpg | 2023-05-03 11:08 | 9.2K | |
![[IMG]](/icons/image2.gif) | 9781260193749-100x10..> | 2023-08-05 02:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260193749.jpg | 2023-05-03 11:08 | 9.2K | |
![[ ]](/icons/unknown.gif) | 9781260211887_willey..> | 2023-05-04 01:51 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260219715_TestBa..> | 2023-08-06 07:45 | 5.0K | |
![[IMG]](/icons/image2.gif) | 9781260219715_TestBa..> | 2023-08-13 15:24 | 33K | |
![[IMG]](/icons/image2.gif) | 9781260219715_TestBa..> | 2023-05-04 01:52 | 43K | |
![[ ]](/icons/unknown.gif) | 9781260220629_Sverdr..> | 2023-05-04 01:55 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260220629_TestBa..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260220629_TestBa..> | 2023-08-09 21:37 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260220629_TestBa..> | 2023-05-04 01:55 | 25K | |
![[ ]](/icons/unknown.gif) | 9781260225310_TestBa..> | 2023-05-04 02:17 | 54K | |
![[ ]](/icons/unknown.gif) | 9781260225327_TestBa..> | 2023-05-03 13:42 | 1.4M | |
![[IMG]](/icons/image2.gif) | 9781260226775_Soluti..> | 2023-08-05 04:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781260226775_Soluti..> | 2023-08-15 05:43 | 12K | |
![[IMG]](/icons/image2.gif) | 9781260226775_Soluti..> | 2023-05-04 02:27 | 16K | |
![[ ]](/icons/unknown.gif) | 9781260226775_Soluti..> | 2023-05-04 02:27 | 397K | |
![[ ]](/icons/unknown.gif) | 9781260231700_Mader1..> | 2023-05-04 02:09 | 0 | |
![[ ]](/icons/unknown.gif) | 9781260231700_Soluti..> | 2023-05-04 02:28 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260231700_TestBa..> | 2023-08-06 03:25 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781260231700_TestBa..> | 2023-08-11 14:11 | 13K | |
![[IMG]](/icons/image2.gif) | 9781260231700_TestBa..> | 2023-05-04 02:09 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260237764_TestBa..> | 2023-08-09 21:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781260237764_TestBa..> | 2023-09-08 18:22 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260237764_TestBa..> | 2023-05-04 01:48 | 35K | |
![[ ]](/icons/unknown.gif) | 9781260238877_Cachon..> | 2023-05-04 02:29 | 42K | |
![[IMG]](/icons/image2.gif) | 9781260238877__47203..> | 2023-05-04 02:29 | 35K | |
![[IMG]](/icons/image2.gif) | 9781260238877__47203..> | 2023-05-04 02:29 | 35K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-08-06 05:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-08-21 08:26 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-05-04 02:26 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-08-08 04:48 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-08-21 08:26 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260238884_Soluti..> | 2023-05-04 01:48 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260238884_TestBa..> | 2023-08-06 13:03 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781260238884_TestBa..> | 2023-08-18 10:49 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260238884_TestBa..> | 2023-05-04 02:27 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260238891_Soluti..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260238891_Soluti..> | 2023-08-24 12:35 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260238891_Soluti..> | 2023-05-04 02:29 | 27K | |
![[ ]](/icons/unknown.gif) | 9781260238891_Soluti..> | 2023-05-04 02:29 | 41K | |
![[IMG]](/icons/image2.gif) | 9781260238891_TestBa..> | 2023-08-06 01:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260238891_TestBa..> | 2023-08-06 15:35 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260238891_TestBa..> | 2023-05-04 02:29 | 27K | |
![[ ]](/icons/unknown.gif) | 9781260238891_TestBa..> | 2023-05-04 02:29 | 27K | |
![[ ]](/icons/unknown.gif) | 9781260239515_jaggia..> | 2023-05-04 01:58 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260240849_TestBa..> | 2023-08-06 05:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260240849_TestBa..> | 2023-08-05 01:54 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260240849_TestBa..> | 2023-05-04 02:23 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-08-08 16:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-08-10 22:23 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-05-04 02:11 | 32K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-08-06 08:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-08-10 22:23 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260240870_TestBa..> | 2023-05-04 02:09 | 32K | |
![[ ]](/icons/unknown.gif) | 9781260240870_TestBa..> | 2023-05-04 02:11 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260245844_TestBa..> | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781260245844_TestBa..> | 2023-08-31 04:03 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260245844_TestBa..> | 2023-05-04 02:28 | 34K | |
![[ ]](/icons/unknown.gif) | 9781260247138-Chap1_..> | 2023-05-04 02:08 | 43K | |
![[IMG]](/icons/image2.gif) | 9781260247138_TestBa..> | 2023-08-06 12:08 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9781260247138_TestBa..> | 2023-05-04 02:08 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260247770_Soluti..> | 2023-08-05 19:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260247770_Soluti..> | 2023-08-05 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260247770_Soluti..> | 2023-05-03 11:14 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260247770_TestBa..> | 2023-08-06 13:02 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260247770_TestBa..> | 2023-08-05 03:43 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260247770_TestBa..> | 2023-05-03 11:14 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260247787_TestBa..> | 2023-08-06 17:26 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260247787_TestBa..> | 2023-09-04 19:03 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260247787_TestBa..> | 2023-05-04 01:49 | 31K | |
![[ ]](/icons/unknown.gif) | 9781260247787_TestBa..> | 2023-05-04 01:49 | 214K | |
![[IMG]](/icons/image2.gif) | 9781260247800_TestBa..> | 2023-08-05 14:39 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260247800_TestBa..> | 2023-09-14 19:34 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260247800_TestBa..> | 2023-05-04 02:03 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260247824_Soluti..> | 2023-08-05 06:24 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781260247824_Soluti..> | 2023-08-18 10:03 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260247824_Soluti..> | 2023-05-04 02:22 | 16K | |
![[ ]](/icons/unknown.gif) | 9781260247824_Soluti..> | 2023-05-04 02:21 | 119K | |
![[IMG]](/icons/image2.gif) | 9781260247824_TestBa..> | 2023-08-05 14:36 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260247824_TestBa..> | 2023-08-19 20:58 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260247824_TestBa..> | 2023-05-04 01:49 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260247848_TestBa..> | 2023-08-05 01:08 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260247848_TestBa..> | 2023-08-06 08:44 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260247848_TestBa..> | 2023-05-04 01:59 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260247879_TestBa..> | 2023-08-06 08:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781260247879_TestBa..> | 2023-09-15 06:47 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260247879_TestBa..> | 2023-05-04 02:00 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260247886_TestBa..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260247886_TestBa..> | 2023-09-08 14:47 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260247886_TestBa..> | 2023-05-04 02:20 | 27K | |
![[ ]](/icons/layout.gif) | 9781260247886_TestBa..> | 2023-05-04 02:20 | 1.5M | |
![[ ]](/icons/unknown.gif) | 9781260247893_Kubase..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781260247961_Soluti..> | 2023-05-04 02:09 | 812K | |
![[ ]](/icons/layout.gif) | 9781260247961_TestBa..> | 2023-05-04 02:10 | 3.3M | |
![[IMG]](/icons/image2.gif) | 9781260247978_Soluti..> | 2023-08-06 12:17 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260247978_Soluti..> | 2023-08-23 02:15 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260247978_Soluti..> | 2023-05-04 02:16 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260247978_TestBa..> | 2023-08-06 08:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260247978_TestBa..> | 2023-08-11 09:16 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260247978_TestBa..> | 2023-05-03 11:22 | 28K | |
![[ ]](/icons/unknown.gif) | 9781260251340-Unname..> | 2023-05-04 01:54 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260251340_Soluti..> | 2023-08-05 16:28 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260251340_Soluti..> | 2023-08-05 03:41 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260251340_Soluti..> | 2023-05-04 01:53 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260251340_TestBa..> | 2023-08-05 03:40 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260251340_TestBa..> | 2023-09-06 02:57 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260251340_TestBa..> | 2023-05-04 01:54 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260253900_Soluti..> | 2023-08-06 03:24 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260253900_Soluti..> | 2023-08-08 14:34 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260253900_Soluti..> | 2023-05-04 01:59 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260253900_TestBa..> | 2023-08-10 16:59 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260253900_TestBa..> | 2023-08-06 22:47 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260253900_TestBa..> | 2023-05-04 01:59 | 22K | |
![[IMG]](/icons/image2.gif) | 9781260254105_TestBa..> | 2023-08-07 22:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260254105_TestBa..> | 2023-08-19 00:59 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260254105_TestBa..> | 2023-05-04 02:11 | 23K | |
![[ ]](/icons/unknown.gif) | 9781260258974_Rawson..> | 2023-05-04 02:06 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260259001_TestBa..> | 2023-08-06 03:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781260259001_TestBa..> | 2023-08-27 09:34 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260259001_TestBa..> | 2023-05-04 02:26 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260259025_TestBa..> | 2023-08-06 07:48 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781260259025_TestBa..> | 2023-08-05 03:43 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260259025_TestBa..> | 2023-05-03 11:12 | 35K | |
![[ ]](/icons/unknown.gif) | 9781260259025_TestBa..> | 2023-05-03 11:12 | 31K | |
![[IMG]](/icons/image2.gif) | 9781260259308_Soluti..> | 2023-08-05 16:23 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781260259308_Soluti..> | 2023-08-15 01:39 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260259308_Soluti..> | 2023-05-04 02:27 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260259315_TestBa..> | 2023-08-06 07:48 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260259315_TestBa..> | 2023-08-18 21:48 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260259315_TestBa..> | 2023-05-04 02:26 | 22K | |
![[ ]](/icons/unknown.gif) | 9781260259315_TestBa..> | 2023-05-04 02:26 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260260359_TestBa..> | 2023-08-05 06:24 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260260359_TestBa..> | 2023-09-08 15:33 | 26K | |
![[IMG]](/icons/image2.gif) | 9781260260359_TestBa..> | 2023-05-03 11:10 | 34K | |
![[ ]](/icons/unknown.gif) | 9781260260366-Chapte..> | 2023-05-04 02:08 | 172K | |
![[IMG]](/icons/image2.gif) | 9781260260366_TestBa..> | 2023-08-06 17:25 | 6.1K | |
![[IMG]](/icons/image2.gif) | 9781260260366_TestBa..> | 2023-08-25 22:45 | 38K | |
![[IMG]](/icons/image2.gif) | 9781260260366_TestBa..> | 2023-05-04 02:08 | 47K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-08-08 10:57 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-08-19 00:17 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-05-04 02:21 | 26K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-08-05 06:24 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-08-19 00:17 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260260472_TestBa..> | 2023-05-04 02:01 | 26K | |
![[IMG]](/icons/image2.gif) | 9781260260502_TestBa..> | 2023-08-06 09:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260260502_TestBa..> | 2023-08-30 07:22 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260260502_TestBa..> | 2023-05-04 02:16 | 25K | |
![[ ]](/icons/unknown.gif) | 9781260260502_TestBa..> | 2023-05-04 02:16 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260261523_Soluti..> | 2023-08-09 08:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260261523_Soluti..> | 2023-08-14 23:08 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260261523_Soluti..> | 2023-05-04 01:56 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260261523_TestBa..> | 2023-08-05 02:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781260261523_TestBa..> | 2023-09-08 14:47 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260261523_TestBa..> | 2023-05-04 01:56 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-08-06 20:23 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-09-05 10:14 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-05-04 02:09 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-09-05 10:14 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260261547_TestBa..> | 2023-05-04 01:59 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260262575_Soluti..> | 2023-08-05 15:29 | 5.5K | |
![[IMG]](/icons/image2.gif) | 9781260262575_Soluti..> | 2023-08-05 04:35 | 31K | |
![[IMG]](/icons/image2.gif) | 9781260262575_Soluti..> | 2023-05-04 02:27 | 36K | |
![[IMG]](/icons/image2.gif) | 9781260262582_Soluti..> | 2023-08-05 16:27 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781260262582_Soluti..> | 2023-08-05 03:41 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260262582_Soluti..> | 2023-05-04 01:51 | 17K | |
![[ ]](/icons/layout.gif) | 9781260262582_Soluti..> | 2023-05-04 01:51 | 617K | |
![[IMG]](/icons/image2.gif) | 9781260262582_TestBa..> | 2023-08-05 17:18 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781260262582_TestBa..> | 2023-08-20 19:36 | 11K | |
![[IMG]](/icons/image2.gif) | 9781260262582_TestBa..> | 2023-05-04 01:51 | 17K | |
![[ ]](/icons/unknown.gif) | 9781260262582_TestBa..> | 2023-05-04 01:51 | 46K | |
![[IMG]](/icons/image2.gif) | 9781260265217_TestBa..> | 2023-08-05 09:59 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260265217_TestBa..> | 2023-08-21 07:47 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260265217_TestBa..> | 2023-05-04 01:53 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260265224_Soluti..> | 2023-08-06 13:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260265224_Soluti..> | 2023-08-05 03:41 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260265224_Soluti..> | 2023-05-04 01:53 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260265224_TestBa..> | 2023-08-06 11:19 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260265224_TestBa..> | 2023-09-06 02:57 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260265224_TestBa..> | 2023-05-04 02:01 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260299441_Soluti..> | 2023-08-09 03:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260299441_Soluti..> | 2023-08-06 08:47 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260299441_Soluti..> | 2023-05-04 02:29 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260299441_TestBa..> | 2023-08-05 16:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260299441_TestBa..> | 2023-08-21 10:10 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260299441_TestBa..> | 2023-05-04 02:29 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260326864_TestBa..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781260326864_TestBa..> | 2023-09-15 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260326864_TestBa..> | 2023-05-04 02:03 | 23K | |
![[ ]](/icons/unknown.gif) | 9781260364125_TestBa..> | 2023-05-03 13:42 | 41K | |
![[IMG]](/icons/image2.gif) | 9781260395792_TestBa..> | 2023-08-06 05:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260395792_TestBa..> | 2023-08-26 22:34 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260395792_TestBa..> | 2023-05-04 02:28 | 34K | |
![[IMG]](/icons/image2.gif) | 9781260397123_TestBa..> | 2023-08-05 15:30 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9781260397123_TestBa..> | 2023-08-08 22:05 | 30K | |
![[IMG]](/icons/image2.gif) | 9781260397123_TestBa..> | 2023-05-04 02:00 | 36K | |
![[ ]](/icons/unknown.gif) | 9781260397123_Yarber..> | 2023-05-04 02:00 | 37K | |
![[IMG]](/icons/image2.gif) | 9781260397246_TestBa..> | 2023-08-05 03:41 | 7.2K | |
![[IMG]](/icons/image2.gif) | 9781260397246_TestBa..> | 2023-09-08 18:22 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260397246_TestBa..> | 2023-05-04 01:53 | 35K | |
![[ ]](/icons/unknown.gif) | 9781260397246_TestBa..> | 2023-05-04 01:53 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260397253_TestBa..> | 2023-08-06 05:46 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260397253_TestBa..> | 2023-08-18 09:10 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260397253_TestBa..> | 2023-05-04 01:57 | 24K | |
![[ ]](/icons/unknown.gif) | 9781260397253_TestBa..> | 2023-05-04 01:57 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260411997_TestBa..> | 2023-08-06 09:42 | 6.1K | |
![[IMG]](/icons/image2.gif) | 9781260411997_TestBa..> | 2023-08-17 03:14 | 38K | |
![[IMG]](/icons/image2.gif) | 9781260411997_TestBa..> | 2023-05-04 01:57 | 43K | |
![[ ]](/icons/unknown.gif) | 9781260411997_adler1..> | 2023-05-04 01:57 | 48K | |
![[ ]](/icons/unknown.gif) | 9781260433098_Spilke..> | 2023-05-04 02:08 | 89K | |
![[ ]](/icons/unknown.gif) | 9781260433098_TestBa..> | 2023-05-04 02:09 | 41K | |
![[IMG]](/icons/image2.gif) | 9781260433111_Soluti..> | 2023-08-05 02:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781260433111_Soluti..> | 2023-08-12 15:36 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260433111_Soluti..> | 2023-05-04 02:00 | 22K | |
![[ ]](/icons/unknown.gif) | 9781260433111_Spilke..> | 2023-05-04 02:07 | 415K | |
![[ ]](/icons/unknown.gif) | 9781260475227_kay1e_..> | 2023-05-03 11:03 | 22K | |
![[ ]](/icons/compressed.gif) | 9781260480856_Soluti..> | 2023-05-03 13:40 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260480856_TestBa..> | 2023-08-09 06:01 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781260480856_TestBa..> | 2023-09-09 03:32 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260480856_TestBa..> | 2023-05-04 02:00 | 40K | |
![[ ]](/icons/unknown.gif) | 9781260480856_mintz5..> | 2023-05-04 02:00 | 46K | |
![[ ]](/icons/unknown.gif) | 9781260486919_TestBa..> | 2023-05-03 13:42 | 81K | |
![[ ]](/icons/unknown.gif) | 9781260500196_TestBa..> | 2023-05-03 13:43 | 42K | |
![[ ]](/icons/unknown.gif) | 9781260500233_TestBa..> | 2023-05-04 02:27 | 48K | |
![[ ]](/icons/unknown.gif) | 9781260500653_Insel1..> | 2023-05-03 11:13 | 36K | |
![[IMG]](/icons/image2.gif) | 9781260500653_TestBa..> | 2023-08-09 09:08 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781260500653_TestBa..> | 2023-08-06 10:19 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260500653_TestBa..> | 2023-05-03 11:13 | 26K | |
![[IMG]](/icons/image2.gif) | 9781260507140_Soluti..> | 2023-08-05 01:12 | 1.7K | |
![[IMG]](/icons/image2.gif) | 9781260507140_Soluti..> | 2023-08-15 09:54 | 8.1K | |
![[IMG]](/icons/image2.gif) | 9781260507140_Soluti..> | 2023-05-04 02:28 | 11K | |
![[ ]](/icons/unknown.gif) | 9781260565553_Breale..> | 2023-05-04 02:24 | 27K | |
![[IMG]](/icons/image2.gif) | 9781260702378_TestBa..> | 2023-08-06 10:16 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260702378_TestBa..> | 2023-08-05 05:34 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260702378_TestBa..> | 2023-05-04 01:53 | 31K | |
![[IMG]](/icons/image2.gif) | 9781260702439_Soluti..> | 2023-08-08 08:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781260702439_Soluti..> | 2023-08-15 09:54 | 20K | |
![[IMG]](/icons/image2.gif) | 9781260702439_Soluti..> | 2023-05-04 02:01 | 25K | |
![[ ]](/icons/unknown.gif) | 9781260711455_Kerin_..> | 2023-05-04 01:55 | 185K | |
![[IMG]](/icons/image2.gif) | 9781260711455_TestBa..> | 2023-08-05 03:41 | 5.7K | |
![[IMG]](/icons/image2.gif) | 9781260711455_TestBa..> | 2023-08-25 22:45 | 37K | |
![[IMG]](/icons/image2.gif) | 9781260711455_TestBa..> | 2023-05-04 01:56 | 41K | |
![[ ]](/icons/unknown.gif) | 9781260711455_kerin8..> | 2023-05-04 01:56 | 39K | |
![[IMG]](/icons/image2.gif) | 9781260716283_Soluti..> | 2023-08-05 02:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781260716283_Soluti..> | 2023-08-28 22:18 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260716283_Soluti..> | 2023-05-04 02:29 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260720464_TestBa..> | 2023-08-05 17:17 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260720464_TestBa..> | 2023-08-05 05:34 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260720464_TestBa..> | 2023-05-04 01:52 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260727814_TestBa..> | 2023-08-05 15:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260727814_TestBa..> | 2023-08-21 04:41 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260727814_TestBa..> | 2023-05-04 02:26 | 33K | |
![[IMG]](/icons/image2.gif) | 9781260727821_Soluti..> | 2023-08-08 23:56 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260727821_Soluti..> | 2023-08-10 19:39 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260727821_Soluti..> | 2023-05-04 02:21 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260727821_TestBa..> | 2023-08-05 01:08 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781260727821_TestBa..> | 2023-09-08 15:33 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260727821_TestBa..> | 2023-05-04 02:21 | 29K | |
![[IMG]](/icons/image2.gif) | 9781260733723_TestBa..> | 2023-08-05 14:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781260733723_TestBa..> | 2023-08-22 00:46 | 18K | |
![[IMG]](/icons/image2.gif) | 9781260733723_TestBa..> | 2023-05-04 01:52 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260735178_Soluti..> | 2023-08-07 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260735178_Soluti..> | 2023-08-12 03:36 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260735178_Soluti..> | 2023-05-04 02:28 | 21K | |
![[IMG]](/icons/image2.gif) | 9781260735178_TestBa..> | 2023-08-06 11:15 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260735178_TestBa..> | 2023-08-16 16:54 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260735178_TestBa..> | 2023-05-04 02:03 | 21K | |
![[ ]](/icons/unknown.gif) | 9781260735178_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-08-05 05:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-08-30 14:11 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-05-04 02:09 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-08-05 05:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-08-30 14:11 | 15K | |
![[IMG]](/icons/image2.gif) | 9781260772166_TestBa..> | 2023-05-04 02:02 | 19K | |
![[IMG]](/icons/image2.gif) | 9781260780314_Soluti..> | 2023-08-06 09:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781260780314_Soluti..> | 2023-08-16 10:25 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260780314_Soluti..> | 2023-05-04 02:27 | 22K | |
![[ ]](/icons/unknown.gif) | 9781260780314_Soluti..> | 2023-05-04 02:27 | 57K | |
![[IMG]](/icons/image2.gif) | 9781260809954_Soluti..> | 2023-08-06 13:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260809954_Soluti..> | 2023-08-21 06:52 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260809954_Soluti..> | 2023-05-04 02:09 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260809954_TestBa..> | 2023-08-05 04:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781260809954_TestBa..> | 2023-08-14 21:32 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260809954_TestBa..> | 2023-05-04 02:28 | 28K | |
![[IMG]](/icons/image2.gif) | 9781260813760_Soluti..> | 2023-08-05 14:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781260813760_Soluti..> | 2023-08-12 04:50 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260813760_Soluti..> | 2023-05-03 11:04 | 31K | |
![[ ]](/icons/unknown.gif) | 9781260813760_Soluti..> | 2023-05-03 11:04 | 184K | |
![[IMG]](/icons/image2.gif) | 9781260814439_TestBa..> | 2023-08-06 04:47 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260814439_TestBa..> | 2023-08-16 16:05 | 16K | |
![[IMG]](/icons/image2.gif) | 9781260814439_TestBa..> | 2023-05-04 02:04 | 21K | |
![[ ]](/icons/unknown.gif) | 9781260822878_TestBa..> | 2023-05-03 13:44 | 24K | |
![[IMG]](/icons/image2.gif) | 9781260837445_TestBa..> | 2023-08-05 14:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781260837445_TestBa..> | 2023-09-12 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260837445_TestBa..> | 2023-05-04 02:22 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260888065_Soluti..> | 2023-08-07 14:35 | 4.6K | |
![[IMG]](/icons/image2.gif) | 9781260888065_Soluti..> | 2023-08-14 19:44 | 25K | |
![[IMG]](/icons/image2.gif) | 9781260888065_Soluti..> | 2023-05-04 02:00 | 34K | |
![[ ]](/icons/layout.gif) | 9781260888065_Soluti..> | 2023-05-04 02:00 | 1.5M | |
![[IMG]](/icons/image2.gif) | 9781260888065_TestBa..> | 2023-08-05 03:41 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9781260888065_TestBa..> | 2023-08-22 23:52 | 34K | |
![[IMG]](/icons/image2.gif) | 9781260888065_TestBa..> | 2023-05-04 01:59 | 38K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-08-09 05:02 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-09-08 20:36 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-05-04 01:53 | 23K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-08-06 11:17 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-08-09 09:11 | 17K | |
![[IMG]](/icons/image2.gif) | 9781260940541_Soluti..> | 2023-05-04 01:52 | 23K | |
![[IMG]](/icons/image2.gif) | 9781264068319_Soluti..> | 2023-08-06 07:49 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781264068319_Soluti..> | 2023-08-05 14:40 | 25K | |
![[IMG]](/icons/image2.gif) | 9781264068319_Soluti..> | 2023-05-04 02:29 | 26K | |
![[ ]](/icons/unknown.gif) | 9781264068319_Soluti..> | 2023-05-04 02:28 | 0 | |
![[ ]](/icons/unknown.gif) | 9781264112456_Soluti..> | 2023-05-04 02:20 | 397K | |
![[IMG]](/icons/image2.gif) | 9781264112456_Soluti..> | 2023-08-06 13:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781264112456_Soluti..> | 2023-08-10 19:39 | 13K | |
![[IMG]](/icons/image2.gif) | 9781264112456_Soluti..> | 2023-05-04 02:20 | 17K | |
![[ ]](/icons/unknown.gif) | 9781264112456_TestBa..> | 2023-05-04 01:50 | 1.8M | |
![[IMG]](/icons/image2.gif) | 9781264112456_TestBa..> | 2023-08-08 14:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781264112456_TestBa..> | 2023-09-05 03:45 | 13K | |
![[IMG]](/icons/image2.gif) | 9781264112456_TestBa..> | 2023-05-04 01:50 | 17K | |
![[IMG]](/icons/image2.gif) | 9781264368921_Soluti..> | 2023-08-08 07:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781264368921_Soluti..> | 2023-08-09 10:13 | 15K | |
![[IMG]](/icons/image2.gif) | 9781264368921_Soluti..> | 2023-05-04 02:01 | 22K | |
![[IMG]](/icons/image2.gif) | 9781264368921_TestBa..> | 2023-08-05 06:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781264368921_TestBa..> | 2023-08-13 19:44 | 15K | |
![[IMG]](/icons/image2.gif) | 9781264368921_TestBa..> | 2023-05-04 02:01 | 22K | |
![[IMG]](/icons/image2.gif) | 9781264369058_TestBa..> | 2023-08-05 06:24 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781264369058_TestBa..> | 2023-08-13 19:44 | 17K | |
![[IMG]](/icons/image2.gif) | 9781264369058_TestBa..> | 2023-05-04 02:01 | 25K | |
![[IMG]](/icons/image2.gif) | 9781264369126_TestBa..> | 2023-08-08 22:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781264369126_TestBa..> | 2023-08-14 15:10 | 16K | |
![[IMG]](/icons/image2.gif) | 9781264369126_TestBa..> | 2023-05-04 02:01 | 22K | |
![[ ]](/icons/unknown.gif) | 9781284152913-chapte..> | 2023-05-03 13:41 | 14K | |
![[IMG]](/icons/image2.gif) | 9781285065137-100x10..> | 2023-08-05 06:24 | 16K | |
![[IMG]](/icons/image2.gif) | 9781285065137-300x30..> | 2023-08-08 14:34 | 37K | |
![[IMG]](/icons/image2.gif) | 9781285065137.jpg | 2023-05-03 10:04 | 93K | |
![[ ]](/icons/unknown.gif) | 9781285073040_TestBa..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781285088808_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781285096261_SM-100..> | 2023-08-06 07:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781285096261_SM-300..> | 2023-08-24 02:13 | 17K | |
![[IMG]](/icons/image2.gif) | 9781285096261_SM.jpg | 2023-05-04 02:19 | 18K | |
![[ ]](/icons/compressed.gif) | 9781285096261_SM_Ch1..> | 2023-05-04 02:19 | 409K | |
![[ ]](/icons/compressed.gif) | 9781285171340_Ch01_T..> | 2023-05-04 02:00 | 91K | |
![[IMG]](/icons/image2.gif) | 9781285194790-us1-10..> | 2023-08-06 09:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781285194790-us1-30..> | 2023-09-04 20:54 | 15K | |
![[IMG]](/icons/image2.gif) | 9781285194790-us1.jpg | 2023-05-04 02:25 | 27K | |
![[IMG]](/icons/image2.gif) | 9781285198248-100x10..> | 2023-08-05 05:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781285198248-300x30..> | 2023-08-21 07:47 | 19K | |
![[IMG]](/icons/image2.gif) | 9781285198248.jpg | 2023-05-04 02:23 | 26K | |
![[IMG]](/icons/image2.gif) | 9781285420929_TestBa..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781285420929_TestBa..> | 2023-08-21 10:12 | 16K | |
![[IMG]](/icons/image2.gif) | 9781285420929_TestBa..> | 2023-05-04 02:10 | 17K | |
![[ ]](/icons/unknown.gif) | 9781285420929_TestBa..> | 2023-05-04 02:10 | 0 | |
![[ ]](/icons/unknown.gif) | 9781285429458_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781285432373_TestBa..> | 2023-08-05 05:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781285432373_TestBa..> | 2023-08-06 12:18 | 19K | |
![[IMG]](/icons/image2.gif) | 9781285432373_TestBa..> | 2023-05-04 01:57 | 33K | |
![[ ]](/icons/layout.gif) | 9781285432373_TestBa..> | 2023-05-04 01:57 | 92K | |
![[ ]](/icons/layout.gif) | 9781285433202_TestBa..> | 2023-05-04 02:12 | 0 | |
![[ ]](/icons/unknown.gif) | 9781285459059_Ch01_S..> | 2023-05-03 13:44 | 64K | |
![[IMG]](/icons/image2.gif) | 9781285734293_TB-100..> | 2023-08-06 12:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781285734293_TB-300..> | 2023-08-28 21:31 | 15K | |
![[IMG]](/icons/image2.gif) | 9781285734293_TB.jpg | 2023-05-04 02:19 | 16K | |
![[ ]](/icons/unknown.gif) | 9781285734293_TestBa..> | 2023-05-04 02:19 | 349K | |
![[IMG]](/icons/image2.gif) | 9781285736976_TestBa..> | 2023-08-05 05:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781285736976_TestBa..> | 2023-08-18 17:37 | 19K | |
![[IMG]](/icons/image2.gif) | 9781285736976_TestBa..> | 2023-05-04 02:26 | 18K | |
![[ ]](/icons/layout.gif) | 9781285736976_TestBa..> | 2023-05-04 02:26 | 0 | |
![[ ]](/icons/layout.gif) | 9781285746920_Chapte..> | 2023-05-04 02:11 | 0 | |
![[IMG]](/icons/image2.gif) | 9781285746920_TB-100..> | 2023-08-05 01:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781285746920_TB-300..> | 2023-09-09 10:36 | 23K | |
![[IMG]](/icons/image2.gif) | 9781285746920_TB.jpg | 2023-05-04 02:11 | 65K | |
![[IMG]](/icons/image2.gif) | 9781285862613_TestBa..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781285862613_TestBa..> | 2023-08-15 06:50 | 22K | |
![[IMG]](/icons/image2.gif) | 9781285862613_TestBa..> | 2023-05-03 11:10 | 71K | |
![[IMG]](/icons/image2.gif) | 9781285866390_Soluti..> | 2023-08-05 14:39 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781285866390_Soluti..> | 2023-08-15 07:57 | 16K | |
![[IMG]](/icons/image2.gif) | 9781285866390_Soluti..> | 2023-05-04 01:51 | 23K | |
![[ ]](/icons/unknown.gif) | 9781285866390_Soluti..> | 2023-05-04 01:51 | 197K | |
![[IMG]](/icons/image2.gif) | 9781285869407_TestBa..> | 2023-08-05 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781285869407_TestBa..> | 2023-08-18 03:24 | 15K | |
![[IMG]](/icons/image2.gif) | 9781285869407_TestBa..> | 2023-05-04 01:49 | 22K | |
![[IMG]](/icons/image2.gif) | 9781292127606_Soluti..> | 2023-08-05 14:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781292127606_Soluti..> | 2023-08-14 23:08 | 28K | |
![[IMG]](/icons/image2.gif) | 9781292127606_Soluti..> | 2023-05-04 01:52 | 144K | |
![[IMG]](/icons/image2.gif) | 9781292216355_TestBa..> | 2023-08-08 07:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9781292216355_TestBa..> | 2023-08-17 23:54 | 16K | |
![[IMG]](/icons/image2.gif) | 9781292216355_TestBa..> | 2023-05-03 11:10 | 40K | |
![[ ]](/icons/layout.gif) | 9781292216355_TestBa..> | 2023-05-03 11:10 | 572K | |
![[IMG]](/icons/image2.gif) | 9781292255460_TestBa..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781292255460_TestBa..> | 2023-08-11 12:58 | 14K | |
![[IMG]](/icons/image2.gif) | 9781292255460_TestBa..> | 2023-05-04 01:56 | 34K | |
![[IMG]](/icons/image2.gif) | 9781305078628_Soluti..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781305078628_Soluti..> | 2023-08-08 14:34 | 18K | |
![[IMG]](/icons/image2.gif) | 9781305078628_Soluti..> | 2023-05-04 02:17 | 26K | |
![[ ]](/icons/unknown.gif) | 9781305078628_Soluti..> | 2023-05-04 02:17 | 68K | |
![[IMG]](/icons/image2.gif) | 9781305079243_Soluti..> | 2023-08-05 05:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781305079243_Soluti..> | 2023-08-16 15:50 | 16K | |
![[IMG]](/icons/image2.gif) | 9781305079243_Soluti..> | 2023-05-04 02:02 | 17K | |
![[ ]](/icons/layout.gif) | 9781305079243_Soluti..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9781305091870_TestBa..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781305091870_TestBa..> | 2023-08-17 18:22 | 16K | |
![[IMG]](/icons/image2.gif) | 9781305091870_TestBa..> | 2023-05-04 02:07 | 28K | |
![[ ]](/icons/compressed.gif) | 9781305104969-TEST-B..> | 2023-05-03 13:42 | 28K | |
![[IMG]](/icons/image2.gif) | 9781305112100_TestBa..> | 2023-08-06 11:15 | 13K | |
![[IMG]](/icons/image2.gif) | 9781305112100_TestBa..> | 2023-09-01 04:31 | 26K | |
![[IMG]](/icons/image2.gif) | 9781305112100_TestBa..> | 2023-05-04 02:00 | 98K | |
![[IMG]](/icons/image2.gif) | 9781305118423_TestBa..> | 2023-08-05 15:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781305118423_TestBa..> | 2023-05-04 02:02 | 9.9K | |
![[ ]](/icons/unknown.gif) | 9781305118423_TestBa..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/unknown.gif) | 9781305251038_Soluti..> | 2023-05-03 13:41 | 57K | |
![[ ]](/icons/compressed.gif) | 9781305254619_ch01_p..> | 2023-05-03 09:50 | 45K | |
![[IMG]](/icons/image2.gif) | 9781305261488_TestBa..> | 2023-08-08 06:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781305261488_TestBa..> | 2023-08-19 00:59 | 20K | |
![[IMG]](/icons/image2.gif) | 9781305261488_TestBa..> | 2023-05-03 11:09 | 30K | |
![[IMG]](/icons/image2.gif) | 9781305263727_TestBa..> | 2023-08-06 10:18 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781305263727_TestBa..> | 2023-08-15 03:43 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305263727_TestBa..> | 2023-05-03 11:12 | 31K | |
![[ ]](/icons/unknown.gif) | 9781305263727_TestBa..> | 2023-05-03 11:12 | 33K | |
![[IMG]](/icons/image2.gif) | 9781305271487_TestBa..> | 2023-08-06 08:44 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781305271487_TestBa..> | 2023-08-13 13:07 | 26K | |
![[IMG]](/icons/image2.gif) | 9781305271487_TestBa..> | 2023-05-04 02:04 | 86K | |
![[ ]](/icons/unknown.gif) | 9781305405745_Soluti..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/layout.gif) | 9781305410473_TestBa..> | 2023-05-03 10:38 | 85K | |
![[IMG]](/icons/image2.gif) | 9781305497917_TestBa..> | 2023-08-06 05:45 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781305497917_TestBa..> | 2023-09-11 04:22 | 22K | |
![[IMG]](/icons/image2.gif) | 9781305497917_TestBa..> | 2023-05-04 01:51 | 32K | |
![[ ]](/icons/unknown.gif) | 9781305501188_TestBa..> | 2023-05-03 10:53 | 34K | |
![[IMG]](/icons/image2.gif) | 9781305501256_TestBa..> | 2023-08-06 08:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781305501256_TestBa..> | 2023-09-08 14:47 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305501256_TestBa..> | 2023-05-04 02:17 | 31K | |
![[ ]](/icons/unknown.gif) | 9781305501256_TestBa..> | 2023-05-04 02:17 | 35K | |
![[IMG]](/icons/image2.gif) | 9781305503090_TestBa..> | 2023-08-05 17:20 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781305503090_TestBa..> | 2023-08-30 09:45 | 25K | |
![[IMG]](/icons/image2.gif) | 9781305503090_TestBa..> | 2023-05-04 01:52 | 39K | |
![[IMG]](/icons/image2.gif) | 9781305504585_TestBa..> | 2023-08-06 08:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781305504585_TestBa..> | 2023-08-18 00:57 | 24K | |
![[IMG]](/icons/image2.gif) | 9781305504585_TestBa..> | 2023-05-04 02:10 | 35K | |
![[ ]](/icons/layout.gif) | 9781305506725_TestBa..> | 2023-05-03 10:55 | 2.5M | |
![[IMG]](/icons/image2.gif) | 9781305507272_Soluti..> | 2023-08-06 05:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781305507272_Soluti..> | 2023-08-12 08:35 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305507272_Soluti..> | 2023-05-03 11:13 | 59K | |
![[ ]](/icons/unknown.gif) | 9781305576940_Soluti..> | 2023-05-03 13:42 | 83K | |
![[IMG]](/icons/image2.gif) | 9781305576940_TestBa..> | 2023-08-06 09:44 | 13K | |
![[IMG]](/icons/image2.gif) | 9781305576940_TestBa..> | 2023-08-14 23:55 | 25K | |
![[IMG]](/icons/image2.gif) | 9781305576940_TestBa..> | 2023-05-04 01:47 | 103K | |
![[IMG]](/icons/image2.gif) | 9781305577244_Soluti..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781305577244_Soluti..> | 2023-08-25 19:27 | 14K | |
![[IMG]](/icons/image2.gif) | 9781305577244_Soluti..> | 2023-05-03 11:20 | 33K | |
![[IMG]](/icons/image2.gif) | 9781305577367_TestBa..> | 2023-08-05 01:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781305577367_TestBa..> | 2023-08-19 00:59 | 24K | |
![[IMG]](/icons/image2.gif) | 9781305577367_TestBa..> | 2023-05-03 11:08 | 37K | |
![[ ]](/icons/layout.gif) | 9781305577381-tspl.pdf | 2023-05-03 11:18 | 272K | |
![[IMG]](/icons/image2.gif) | 9781305580299_TestBa..> | 2023-08-05 04:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781305580299_TestBa..> | 2023-09-04 18:10 | 26K | |
![[IMG]](/icons/image2.gif) | 9781305580299_TestBa..> | 2023-05-04 02:25 | 41K | |
![[IMG]](/icons/image2.gif) | 9781305645790_TestBa..> | 2023-08-05 02:45 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9781305645790_TestBa..> | 2023-08-05 03:41 | 26K | |
![[IMG]](/icons/image2.gif) | 9781305645790_TestBa..> | 2023-05-03 11:06 | 38K | |
![[IMG]](/icons/image2.gif) | 9781305860926_Soluti..> | 2023-08-08 01:13 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781305860926_Soluti..> | 2023-08-21 19:12 | 22K | |
![[IMG]](/icons/image2.gif) | 9781305860926_Soluti..> | 2023-05-03 11:22 | 37K | |
![[IMG]](/icons/image2.gif) | 9781305860926_TestBa..> | 2023-08-05 03:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781305860926_TestBa..> | 2023-08-10 04:13 | 22K | |
![[IMG]](/icons/image2.gif) | 9781305860926_TestBa..> | 2023-05-03 11:23 | 37K | |
![[ ]](/icons/unknown.gif) | 9781305951495_Module..> | 2023-05-03 11:05 | 52K | |
![[ ]](/icons/unknown.gif) | 9781305951495_NP2018..> | 2023-05-03 11:04 | 20K | |
![[IMG]](/icons/image2.gif) | 9781305951495_Soluti..> | 2023-08-05 01:33 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781305951495_Soluti..> | 2023-08-20 08:54 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305951495_Soluti..> | 2023-05-03 11:04 | 68K | |
![[IMG]](/icons/image2.gif) | 9781305951495_TestBa..> | 2023-08-06 10:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781305951495_TestBa..> | 2023-09-01 08:54 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305951495_TestBa..> | 2023-05-03 11:05 | 68K | |
![[IMG]](/icons/image2.gif) | 9781305955448_TestBa..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781305955448_TestBa..> | 2023-09-18 05:40 | 24K | |
![[IMG]](/icons/image2.gif) | 9781305955448_TestBa..> | 2023-05-04 02:14 | 33K | |
![[ ]](/icons/unknown.gif) | 9781305955448_TestBa..> | 2023-05-04 02:14 | 22K | |
![[IMG]](/icons/image2.gif) | 9781305957404_Soluti..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781305957404_Soluti..> | 2023-08-16 15:50 | 24K | |
![[IMG]](/icons/image2.gif) | 9781305957404_Soluti..> | 2023-05-04 02:29 | 82K | |
![[IMG]](/icons/image2.gif) | 9781305957404_TestBa..> | 2023-08-06 10:20 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781305957404_TestBa..> | 2023-08-05 14:41 | 24K | |
![[IMG]](/icons/image2.gif) | 9781305957404_TestBa..> | 2023-05-03 11:18 | 82K | |
![[IMG]](/icons/image2.gif) | 9781305959828_TestBa..> | 2023-08-05 05:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781305959828_TestBa..> | 2023-08-27 05:21 | 14K | |
![[IMG]](/icons/image2.gif) | 9781305959828_TestBa..> | 2023-05-04 01:54 | 19K | |
![[ ]](/icons/unknown.gif) | 9781305959828_TestBa..> | 2023-05-04 01:54 | 54K | |
![[ ]](/icons/unknown.gif) | 9781305961135_TestBa..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9781305965720_TestBa..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781305965720_TestBa..> | 2023-08-15 09:51 | 18K | |
![[IMG]](/icons/image2.gif) | 9781305965720_TestBa..> | 2023-05-04 02:20 | 28K | |
![[ ]](/icons/layout.gif) | 9781305965720_TestBa..> | 2023-05-04 02:20 | 239K | |
![[IMG]](/icons/image2.gif) | 9781305966062_TestBa..> | 2023-08-06 10:18 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781305966062_TestBa..> | 2023-08-19 11:51 | 21K | |
![[IMG]](/icons/image2.gif) | 9781305966062_TestBa..> | 2023-05-03 11:10 | 57K | |
![[IMG]](/icons/image2.gif) | 9781305966369_Soluti..> | 2023-08-05 05:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781305966369_Soluti..> | 2023-08-12 03:36 | 19K | |
![[IMG]](/icons/image2.gif) | 9781305966369_Soluti..> | 2023-05-04 01:57 | 53K | |
![[ ]](/icons/unknown.gif) | 9781305966369_Soluti..> | 2023-05-04 01:57 | 131K | |
![[IMG]](/icons/image2.gif) | 9781305966369_TestBa..> | 2023-08-08 21:05 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781305966369_TestBa..> | 2023-08-19 00:59 | 17K | |
![[IMG]](/icons/image2.gif) | 9781305966369_TestBa..> | 2023-05-03 11:09 | 47K | |
![[ ]](/icons/unknown.gif) | 9781305966369_TestBa..> | 2023-05-03 11:09 | 33K | |
![[IMG]](/icons/image2.gif) | 9781305968349_Soluti..> | 2023-08-08 06:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781305968349_Soluti..> | 2023-08-21 06:52 | 18K | |
![[IMG]](/icons/image2.gif) | 9781305968349_Soluti..> | 2023-05-03 11:20 | 51K | |
![[ ]](/icons/layout.gif) | 9781305968349_Soluti..> | 2023-05-03 11:20 | 180K | |
![[IMG]](/icons/image2.gif) | 9781305970663_TestBa..> | 2023-08-05 02:46 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781305970663_TestBa..> | 2023-08-17 04:55 | 12K | |
![[IMG]](/icons/image2.gif) | 9781305970663_TestBa..> | 2023-05-03 11:12 | 41K | |
![[ ]](/icons/unknown.gif) | 9781305972544_Busine..> | 2023-05-04 02:14 | 329K | |
![[IMG]](/icons/image2.gif) | 9781305972544_Soluti..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781305972544_Soluti..> | 2023-08-23 21:13 | 18K | |
![[IMG]](/icons/image2.gif) | 9781305972544_Soluti..> | 2023-05-04 02:14 | 25K | |
![[IMG]](/icons/image2.gif) | 9781316508671_Soluti..> | 2023-08-05 06:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781316508671_Soluti..> | 2023-08-16 23:57 | 14K | |
![[IMG]](/icons/image2.gif) | 9781316508671_Soluti..> | 2023-05-04 02:16 | 27K | |
![[ ]](/icons/layout.gif) | 9781316508671_Soluti..> | 2023-05-04 02:16 | 518K | |
![[IMG]](/icons/image2.gif) | 9781316635742_Soluti..> | 2023-08-06 05:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781316635742_Soluti..> | 2023-08-05 15:35 | 17K | |
![[IMG]](/icons/image2.gif) | 9781316635742_Soluti..> | 2023-05-04 02:16 | 36K | |
![[ ]](/icons/layout.gif) | 9781316635742_Soluti..> | 2023-05-04 02:16 | 163K | |
![[IMG]](/icons/image2.gif) | 9781319013370_Soluti..> | 2023-08-05 17:22 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319013370_Soluti..> | 2023-08-09 09:14 | 25K | |
![[IMG]](/icons/image2.gif) | 9781319013370_Soluti..> | 2023-05-04 01:53 | 49K | |
![[IMG]](/icons/image2.gif) | 9781319013370_TestBa..> | 2023-08-05 15:29 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319013370_TestBa..> | 2023-09-17 19:43 | 25K | |
![[IMG]](/icons/image2.gif) | 9781319013370_TestBa..> | 2023-05-04 01:53 | 49K | |
![[ ]](/icons/unknown.gif) | 9781319013370_TestBa..> | 2023-05-04 01:53 | 2.4M | |
![[IMG]](/icons/image2.gif) | 9781319015855-100x10..> | 2023-08-06 05:46 | 20K | |
![[IMG]](/icons/image2.gif) | 9781319015855.jpg | 2023-05-04 01:53 | 68K | |
![[IMG]](/icons/image2.gif) | 9781319017712_TestBa..> | 2023-08-05 17:15 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9781319017712_TestBa..> | 2023-08-10 03:18 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319017712_TestBa..> | 2023-05-04 01:52 | 39K | |
![[ ]](/icons/layout.gif) | 9781319017712_TestBa..> | 2023-05-04 01:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | 9781319042578_Soluti..> | 2023-08-05 15:30 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319042578_Soluti..> | 2023-08-09 10:17 | 25K | |
![[IMG]](/icons/image2.gif) | 9781319042578_Soluti..> | 2023-05-04 02:05 | 47K | |
![[ ]](/icons/layout.gif) | 9781319042578_bps8e_..> | 2023-05-04 02:05 | 393K | |
![[IMG]](/icons/image2.gif) | 9781319050733_Soluti..> | 2023-08-06 07:47 | 9.3K | |
![[IMG]](/icons/image2.gif) | 9781319050733_Soluti..> | 2023-08-21 19:12 | 21K | |
![[IMG]](/icons/image2.gif) | 9781319050733_Soluti..> | 2023-05-04 01:49 | 38K | |
![[ ]](/icons/layout.gif) | 9781319050733_rogaws..> | 2023-05-04 01:49 | 1.1M | |
![[ ]](/icons/unknown.gif) | 9781319056889_TestBa..> | 2023-05-04 02:19 | 728K | |
![[ ]](/icons/unknown.gif) | 9781319060411_TestBa..> | 2023-05-04 01:57 | 94K | |
![[IMG]](/icons/image2.gif) | 9781319061715_TestBa..> | 2023-08-06 12:35 | 9.9K | |
![[IMG]](/icons/image2.gif) | 9781319061715_TestBa..> | 2023-08-20 01:49 | 22K | |
![[IMG]](/icons/image2.gif) | 9781319061715_TestBa..> | 2023-05-04 02:06 | 39K | |
![[ ]](/icons/unknown.gif) | 9781319061715_TestBa..> | 2023-05-04 02:06 | 242K | |
![[IMG]](/icons/image2.gif) | 9781319061722_MaC_So..> | 2023-08-05 07:04 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319061722_MaC_So..> | 2023-08-06 08:47 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319061722_MaC_So..> | 2023-05-04 02:06 | 44K | |
![[ ]](/icons/layout.gif) | 9781319061722_feenst..> | 2023-05-04 02:06 | 215K | |
![[IMG]](/icons/image2.gif) | 9781319061739_TestBa..> | 2023-08-06 15:35 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9781319061739_TestBa..> | 2023-08-17 23:54 | 21K | |
![[IMG]](/icons/image2.gif) | 9781319061739_TestBa..> | 2023-05-04 02:07 | 36K | |
![[IMG]](/icons/image2.gif) | 9781319079444_Soluti..> | 2023-08-05 22:02 | 11K | |
![[IMG]](/icons/image2.gif) | 9781319079444_Soluti..> | 2023-08-17 10:32 | 28K | |
![[IMG]](/icons/image2.gif) | 9781319079444_Soluti..> | 2023-05-03 10:51 | 54K | |
![[ ]](/icons/layout.gif) | 9781319079444_Soluti..> | 2023-05-03 10:50 | 283K | |
![[IMG]](/icons/image2.gif) | 9781319079444_TestBa..> | 2023-08-05 03:40 | 11K | |
![[IMG]](/icons/image2.gif) | 9781319079444_TestBa..> | 2023-08-09 01:54 | 28K | |
![[IMG]](/icons/image2.gif) | 9781319079444_TestBa..> | 2023-05-03 10:51 | 54K | |
![[ ]](/icons/unknown.gif) | 9781319079444_TestBa..> | 2023-05-03 10:51 | 139K | |
![[ ]](/icons/unknown.gif) | 9781319081959_TestBa..> | 2023-05-03 13:43 | 654K | |
![[ ]](/icons/unknown.gif) | 9781319098766_TestBa..> | 2023-05-04 02:01 | 385K | |
![[ ]](/icons/unknown.gif) | 9781319102784_TestBa..> | 2023-05-03 13:43 | 237K | |
![[ ]](/icons/unknown.gif) | 9781319103323_TestBa..> | 2023-05-04 01:59 | 0 | |
![[ ]](/icons/layout.gif) | 9781319104191_TestBa..> | 2023-05-03 11:21 | 3.1M | |
![[IMG]](/icons/image2.gif) | 9781319105563_TestBa..> | 2023-08-05 05:34 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319105563_TestBa..> | 2023-09-18 23:28 | 18K | |
![[IMG]](/icons/image2.gif) | 9781319105563_TestBa..> | 2023-05-03 11:22 | 31K | |
![[ ]](/icons/unknown.gif) | 9781319105563_TestBa..> | 2023-05-03 11:22 | 14K | |
![[IMG]](/icons/image2.gif) | 9781319107017_TestBa..> | 2023-08-05 16:16 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319107017_TestBa..> | 2023-09-12 12:05 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319107017_TestBa..> | 2023-05-04 02:09 | 45K | |
![[ ]](/icons/layout.gif) | 9781319107017_TestBa..> | 2023-05-04 02:09 | 246K | |
![[IMG]](/icons/image2.gif) | 9781319114633_TestBa..> | 2023-08-05 03:40 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319114633_TestBa..> | 2023-08-05 17:20 | 27K | |
![[IMG]](/icons/image2.gif) | 9781319114633_TestBa..> | 2023-05-04 01:50 | 58K | |
![[ ]](/icons/unknown.gif) | 9781319114633_TestBa..> | 2023-05-04 01:50 | 121K | |
![[IMG]](/icons/image2.gif) | 9781319136390_TestBa..> | 2023-08-06 21:01 | 9.7K | |
![[IMG]](/icons/image2.gif) | 9781319136390_TestBa..> | 2023-08-08 08:19 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319136390_TestBa..> | 2023-05-04 01:47 | 41K | |
![[ ]](/icons/layout.gif) | 9781319136390_TestBa..> | 2023-05-04 01:47 | 2.2M | |
![[ ]](/icons/unknown.gif) | 9781319140649_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781319148676_TestBa..> | 2023-08-05 16:25 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319148676_TestBa..> | 2023-05-04 02:06 | 55K | |
![[ ]](/icons/unknown.gif) | 9781319148676_TestBa..> | 2023-05-04 02:06 | 27K | |
![[IMG]](/icons/image2.gif) | 9781319195755_TestBa..> | 2023-08-08 23:56 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781319195755_TestBa..> | 2023-08-21 10:10 | 20K | |
![[IMG]](/icons/image2.gif) | 9781319195755_TestBa..> | 2023-05-04 02:26 | 39K | |
![[IMG]](/icons/image2.gif) | 9781319218331_Soluti..> | 2023-08-05 01:13 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319218331_Soluti..> | 2023-08-15 05:43 | 24K | |
![[IMG]](/icons/image2.gif) | 9781319218331_Soluti..> | 2023-05-04 02:22 | 45K | |
![[ ]](/icons/unknown.gif) | 9781319218331_Soluti..> | 2023-05-04 02:22 | 28K | |
![[IMG]](/icons/image2.gif) | 9781319218331_TestBa..> | 2023-08-05 14:34 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319218331_TestBa..> | 2023-08-16 22:56 | 24K | |
![[IMG]](/icons/image2.gif) | 9781319218331_TestBa..> | 2023-05-04 02:12 | 45K | |
![[ ]](/icons/unknown.gif) | 9781319218331_TestBa..> | 2023-05-04 02:12 | 0 | |
![[IMG]](/icons/image2.gif) | 9781319218393_TestBa..> | 2023-08-05 03:40 | 10K | |
![[IMG]](/icons/image2.gif) | 9781319218393_TestBa..> | 2023-09-27 19:59 | 24K | |
![[IMG]](/icons/image2.gif) | 9781319218393_TestBa..> | 2023-05-04 01:56 | 45K | |
![[ ]](/icons/unknown.gif) | 9781319218393_TestBa..> | 2023-05-04 01:56 | 340K | |
![[ ]](/icons/unknown.gif) | 9781319224639_TestBa..> | 2023-05-04 02:28 | 26K | |
![[IMG]](/icons/image2.gif) | 9781319235505-100x10..> | 2023-08-06 10:20 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781319235505-300x30..> | 2023-09-05 10:14 | 23K | |
![[IMG]](/icons/image2.gif) | 9781319235505.jpg | 2023-05-04 02:25 | 35K | |
![[ ]](/icons/unknown.gif) | 9781319282219_Berri1..> | 2023-05-04 02:06 | 111K | |
![[IMG]](/icons/image2.gif) | 9781319282219_Soluti..> | 2023-08-06 08:43 | 9.7K | |
![[IMG]](/icons/image2.gif) | 9781319282219_Soluti..> | 2023-08-11 20:42 | 21K | |
![[IMG]](/icons/image2.gif) | 9781319282219_Soluti..> | 2023-05-04 02:06 | 36K | |
![[IMG]](/icons/image2.gif) | 9781319282684_TestBa..> | 2023-08-05 04:35 | 22K | |
![[IMG]](/icons/image2.gif) | 9781319282684_TestBa..> | 2023-05-04 01:57 | 58K | |
![[ ]](/icons/unknown.gif) | 9781337090964_PF_19e..> | 2023-05-04 01:47 | 188K | |
![[IMG]](/icons/image2.gif) | 9781337090964_Soluti..> | 2023-08-05 16:24 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9781337090964_Soluti..> | 2023-08-15 07:57 | 12K | |
![[IMG]](/icons/image2.gif) | 9781337090964_Soluti..> | 2023-05-04 01:47 | 17K | |
![[ ]](/icons/layout.gif) | 9781337091992-SOLUTI..> | 2023-05-03 10:51 | 394K | |
![[IMG]](/icons/image2.gif) | 9781337091992_Soluti..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781337091992_Soluti..> | 2023-08-17 10:32 | 24K | |
![[IMG]](/icons/image2.gif) | 9781337091992_Soluti..> | 2023-05-03 10:51 | 36K | |
![[IMG]](/icons/image2.gif) | 9781337091992_TestBa..> | 2023-08-06 09:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781337091992_TestBa..> | 2023-08-09 01:54 | 24K | |
![[IMG]](/icons/image2.gif) | 9781337091992_TestBa..> | 2023-05-03 10:51 | 36K | |
![[ ]](/icons/unknown.gif) | 9781337093422_Ch01_C..> | 2023-05-03 13:41 | 31K | |
![[IMG]](/icons/image2.gif) | 9781337093453_TestBa..> | 2023-08-05 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781337093453_TestBa..> | 2023-08-12 07:27 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337093453_TestBa..> | 2023-05-04 02:01 | 27K | |
![[ ]](/icons/layout.gif) | 9781337094740_Segui_..> | 2023-05-03 13:42 | 500K | |
![[ ]](/icons/unknown.gif) | 9781337097536_Soluti..> | 2023-05-03 13:44 | 53K | |
![[IMG]](/icons/image2.gif) | 9781337098069_TestBa..> | 2023-08-05 02:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781337098069_TestBa..> | 2023-09-05 04:48 | 22K | |
![[IMG]](/icons/image2.gif) | 9781337098069_TestBa..> | 2023-05-04 02:17 | 31K | |
![[ ]](/icons/unknown.gif) | 9781337098069_TestBa..> | 2023-05-04 02:17 | 39K | |
![[IMG]](/icons/image2.gif) | 9781337098113_TestBa..> | 2023-08-05 16:28 | 2.2K | |
![[IMG]](/icons/image2.gif) | 9781337098113_TestBa..> | 2023-08-08 08:19 | 14K | |
![[IMG]](/icons/image2.gif) | 9781337098113_TestBa..> | 2023-05-04 01:56 | 34K | |
![[ ]](/icons/unknown.gif) | 9781337098113_TestBa..> | 2023-05-04 01:56 | 26K | |
![[IMG]](/icons/image2.gif) | 9781337098120_Soluti..> | 2023-08-05 01:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337098120_Soluti..> | 2023-08-17 09:42 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337098120_Soluti..> | 2023-05-03 11:05 | 62K | |
![[IMG]](/icons/image2.gif) | 9781337098120_TestBa..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337098120_TestBa..> | 2023-09-05 10:14 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337098120_TestBa..> | 2023-05-03 11:05 | 62K | |
![[ ]](/icons/unknown.gif) | 9781337098120_TestBa..> | 2023-05-03 11:05 | 33K | |
![[ ]](/icons/layout.gif) | 9781337098137_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337101110_TestBa..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337101110_TestBa..> | 2023-08-09 05:08 | 21K | |
![[IMG]](/icons/image2.gif) | 9781337101110_TestBa..> | 2023-05-04 02:03 | 34K | |
![[ ]](/icons/unknown.gif) | 9781337101110_TestBa..> | 2023-05-04 02:03 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337101356_Soluti..> | 2023-08-06 11:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781337101356_Soluti..> | 2023-08-08 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337101356_Soluti..> | 2023-05-04 01:48 | 25K | |
![[ ]](/icons/unknown.gif) | 9781337101356_Soluti..> | 2023-05-04 01:48 | 382K | |
![[IMG]](/icons/image2.gif) | 9781337101356_TestBa..> | 2023-08-05 05:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781337101356_TestBa..> | 2023-08-11 14:11 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337101356_TestBa..> | 2023-05-04 02:28 | 25K | |
![[ ]](/icons/unknown.gif) | 9781337101356_TestBa..> | 2023-05-04 02:28 | 73K | |
![[ ]](/icons/layout.gif) | 9781337101974_Soluti..> | 2023-05-03 13:41 | 321K | |
![[ ]](/icons/unknown.gif) | 9781337102278_TestBa..> | 2023-05-04 02:10 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337106665_TestBa..> | 2023-08-05 03:40 | 5.0K | |
![[IMG]](/icons/image2.gif) | 9781337106665_TestBa..> | 2023-09-09 16:07 | 34K | |
![[IMG]](/icons/image2.gif) | 9781337106665_TestBa..> | 2023-05-03 11:01 | 76K | |
![[ ]](/icons/unknown.gif) | 9781337106665_TestBa..> | 2023-05-03 11:01 | 29K | |
![[ ]](/icons/unknown.gif) | 9781337111522_Chapte..> | 2023-05-04 02:04 | 40K | |
![[IMG]](/icons/image2.gif) | 9781337111522_TestBa..> | 2023-08-05 15:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781337111522_TestBa..> | 2023-08-05 03:43 | 23K | |
![[IMG]](/icons/image2.gif) | 9781337111522_TestBa..> | 2023-05-04 02:04 | 40K | |
![[ ]](/icons/layout.gif) | 9781337271790-spl.pdf | 2023-05-03 10:54 | 1.0M | |
![[IMG]](/icons/image2.gif) | 9781337280563_Soluti..> | 2023-08-08 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781337280563_Soluti..> | 2023-08-16 10:25 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337280563_Soluti..> | 2023-05-04 02:00 | 17K | |
![[ ]](/icons/layout.gif) | 9781337280563_Soluti..> | 2023-05-04 02:00 | 0 | |
![[ ]](/icons/unknown.gif) | 9781337288781_Soluti..> | 2023-05-03 13:41 | 152K | |
![[ ]](/icons/unknown.gif) | 9781337288781_TestBa..> | 2023-05-04 02:00 | 33K | |
![[IMG]](/icons/image2.gif) | 9781337298292_Soluti..> | 2023-08-06 04:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781337298292_Soluti..> | 2023-08-15 17:34 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337298292_Soluti..> | 2023-05-04 02:10 | 26K | |
![[IMG]](/icons/image2.gif) | 9781337386494_Soluti..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781337386494_Soluti..> | 2023-08-20 02:38 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337386494_Soluti..> | 2023-05-03 10:52 | 31K | |
![[IMG]](/icons/image2.gif) | 9781337386494_TestBa..> | 2023-08-05 16:23 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781337386494_TestBa..> | 2023-08-10 18:29 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337386494_TestBa..> | 2023-05-03 10:53 | 31K | |
![[ ]](/icons/unknown.gif) | 9781337386494_TestBa..> | 2023-05-03 10:53 | 38K | |
![[IMG]](/icons/image2.gif) | 9781337387231_Soluti..> | 2023-08-06 03:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781337387231_Soluti..> | 2023-08-15 07:57 | 23K | |
![[IMG]](/icons/image2.gif) | 9781337387231_Soluti..> | 2023-05-04 01:50 | 35K | |
![[IMG]](/icons/image2.gif) | 9781337387231_TestBa..> | 2023-08-08 14:31 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781337387231_TestBa..> | 2023-08-10 20:28 | 23K | |
![[IMG]](/icons/image2.gif) | 9781337387231_TestBa..> | 2023-05-04 01:51 | 35K | |
![[IMG]](/icons/image2.gif) | 9781337395250_Soluti..> | 2023-08-05 04:34 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9781337395250_Soluti..> | 2023-08-08 14:34 | 30K | |
![[IMG]](/icons/image2.gif) | 9781337395250_Soluti..> | 2023-05-04 02:28 | 48K | |
![[ ]](/icons/unknown.gif) | 9781337395250_Soluti..> | 2023-05-04 02:28 | 0 | |
![[ ]](/icons/compressed.gif) | 9781337397070_Soluti..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781337397070_TestBa..> | 2023-05-04 01:57 | 32K | |
![[ ]](/icons/layout.gif) | 9781337397513_97520_..> | 2023-05-04 02:07 | 110K | |
![[IMG]](/icons/image2.gif) | 9781337397513_Soluti..> | 2023-08-05 01:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337397513_Soluti..> | 2023-08-09 22:25 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337397513_Soluti..> | 2023-05-04 02:08 | 29K | |
![[IMG]](/icons/image2.gif) | 9781337399074_Soluti..> | 2023-08-05 02:47 | 5.4K | |
![[IMG]](/icons/image2.gif) | 9781337399074_Soluti..> | 2023-08-06 10:19 | 35K | |
![[IMG]](/icons/image2.gif) | 9781337399074_Soluti..> | 2023-05-04 01:50 | 101K | |
![[ ]](/icons/unknown.gif) | 9781337399425_TestBa..> | 2023-05-03 13:43 | 15K | |
![[ ]](/icons/unknown.gif) | 9781337401043_TestBa..> | 2023-05-04 02:19 | 34K | |
![[IMG]](/icons/image2.gif) | 9781337405713_TestBa..> | 2023-08-05 16:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781337405713_TestBa..> | 2023-09-08 14:47 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337405713_TestBa..> | 2023-05-04 01:56 | 23K | |
![[ ]](/icons/unknown.gif) | 9781337405713_TestBa..> | 2023-05-04 01:56 | 32K | |
![[IMG]](/icons/image2.gif) | 9781337406291_Soluti..> | 2023-08-05 01:52 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781337406291_Soluti..> | 2023-08-06 08:47 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337406291_Soluti..> | 2023-05-04 02:08 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337406291_TestBa..> | 2023-08-06 08:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781337406291_TestBa..> | 2023-08-21 19:15 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337406291_TestBa..> | 2023-05-04 02:08 | 18K | |
![[ ]](/icons/compressed.gif) | 9781337406420_Soluti..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337407588_TestBa..> | 2023-08-06 16:00 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781337407588_TestBa..> | 2023-10-03 21:37 | 22K | |
![[IMG]](/icons/image2.gif) | 9781337407588_TestBa..> | 2023-05-04 02:18 | 47K | |
![[ ]](/icons/unknown.gif) | 9781337407588_TestBa..> | 2023-05-04 02:18 | 30K | |
![[IMG]](/icons/image2.gif) | 9781337408004_TestBa..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781337408004_TestBa..> | 2023-10-08 08:54 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337408004_TestBa..> | 2023-05-04 02:19 | 22K | |
![[ ]](/icons/unknown.gif) | 9781337408004_TestBa..> | 2023-05-04 02:19 | 48K | |
![[ ]](/icons/unknown.gif) | 9781337408271_TestBa..> | 2023-05-03 13:42 | 31K | |
![[IMG]](/icons/image2.gif) | 9781337553292_Soluti..> | 2023-08-05 03:39 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781337553292_Soluti..> | 2023-08-21 07:04 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337553292_Soluti..> | 2023-05-03 10:59 | 50K | |
![[IMG]](/icons/image2.gif) | 9781337553292_TestBa..> | 2023-08-08 06:39 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781337553292_TestBa..> | 2023-10-28 14:38 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337553292_TestBa..> | 2023-05-03 10:59 | 50K | |
![[IMG]](/icons/image2.gif) | 9781337553674_TestBa..> | 2023-08-06 07:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337553674_TestBa..> | 2023-08-18 00:57 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337553674_TestBa..> | 2023-05-04 02:26 | 26K | |
![[ ]](/icons/unknown.gif) | 9781337553674_TestBa..> | 2023-05-04 02:26 | 0 | |
![[ ]](/icons/layout.gif) | 9781337555081_Soluti..> | 2023-05-04 02:17 | 871K | |
![[ ]](/icons/unknown.gif) | 9781337555081_TestBa..> | 2023-05-04 02:17 | 51K | |
![[IMG]](/icons/image2.gif) | 9781337558860_TestBa..> | 2023-08-06 07:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781337558860_TestBa..> | 2023-08-21 10:10 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337558860_TestBa..> | 2023-05-04 02:08 | 20K | |
![[ ]](/icons/unknown.gif) | 9781337558860_TestBa..> | 2023-05-04 02:08 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337558938_TestBa..> | 2023-08-08 14:33 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781337558938_TestBa..> | 2023-08-20 01:49 | 27K | |
![[IMG]](/icons/image2.gif) | 9781337558938_TestBa..> | 2023-05-04 02:24 | 43K | |
![[ ]](/icons/unknown.gif) | 9781337558938_TestBa..> | 2023-05-04 01:56 | 31K | |
![[ ]](/icons/layout.gif) | 9781337563895-test-b..> | 2023-05-04 01:49 | 1.3M | |
![[IMG]](/icons/image2.gif) | 9781337563895_TestBa..> | 2023-08-05 19:27 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781337563895_TestBa..> | 2023-08-08 07:33 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337563895_TestBa..> | 2023-05-04 01:49 | 27K | |
![[IMG]](/icons/image2.gif) | 9781337564083_TestBa..> | 2023-08-06 13:04 | 4.3K | |
![[IMG]](/icons/image2.gif) | 9781337564083_TestBa..> | 2023-08-20 20:08 | 24K | |
![[IMG]](/icons/image2.gif) | 9781337564083_TestBa..> | 2023-05-03 10:53 | 35K | |
![[ ]](/icons/unknown.gif) | 9781337564083_TestBa..> | 2023-05-03 10:53 | 89K | |
![[IMG]](/icons/image2.gif) | 9781337565691_TestBa..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337565691_TestBa..> | 2023-08-17 18:22 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337565691_TestBa..> | 2023-05-04 02:07 | 25K | |
![[ ]](/icons/unknown.gif) | 9781337569798_Soluti..> | 2023-05-03 13:42 | 53K | |
![[ ]](/icons/unknown.gif) | 9781337570879_TestBa..> | 2023-05-04 01:59 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337571357_Soluti..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781337571357_Soluti..> | 2023-08-05 04:35 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337571357_Soluti..> | 2023-05-03 11:24 | 28K | |
![[ ]](/icons/unknown.gif) | 9781337571357_Soluti..> | 2023-05-03 11:24 | 1.2M | |
![[IMG]](/icons/image2.gif) | 9781337571357_TestBa..> | 2023-08-08 11:50 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781337571357_TestBa..> | 2023-08-16 01:58 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337571357_TestBa..> | 2023-05-03 11:25 | 28K | |
![[ ]](/icons/unknown.gif) | 9781337571357_TestBa..> | 2023-05-03 11:25 | 168K | |
![[IMG]](/icons/image2.gif) | 9781337612395_TestBa..> | 2023-08-05 01:13 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337612395_TestBa..> | 2023-08-15 20:03 | 29K | |
![[IMG]](/icons/image2.gif) | 9781337612395_TestBa..> | 2023-05-04 02:09 | 50K | |
![[ ]](/icons/layout.gif) | 9781337613316-spl.pdf | 2023-05-03 11:14 | 142K | |
![[IMG]](/icons/image2.gif) | 9781337613927_Soluti..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337613927_Soluti..> | 2023-08-21 19:12 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337613927_Soluti..> | 2023-05-04 02:18 | 21K | |
![[ ]](/icons/layout.gif) | 9781337613927_Soluti..> | 2023-05-04 02:18 | 1.3M | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-08-21 10:08 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-05-03 11:02 | 52K | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-08-08 17:37 | 3.4K | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-08-23 21:13 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337614436-518x60..> | 2023-05-03 11:02 | 52K | |
![[ ]](/icons/layout.gif) | 9781337614689_Soluti..> | 2023-05-04 02:27 | 0 | |
![[ ]](/icons/unknown.gif) | 9781337617390_Soluti..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | 9781337617390_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337619455_Soluti..> | 2023-08-05 06:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781337619455_Soluti..> | 2023-08-12 04:49 | 22K | |
![[IMG]](/icons/image2.gif) | 9781337619455_Soluti..> | 2023-05-04 02:09 | 37K | |
![[ ]](/icons/unknown.gif) | 9781337619455_Soluti..> | 2023-05-04 02:08 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337624268_TestBa..> | 2023-08-05 01:54 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9781337624268_TestBa..> | 2023-08-13 16:06 | 28K | |
![[IMG]](/icons/image2.gif) | 9781337624268_TestBa..> | 2023-05-04 01:53 | 49K | |
![[IMG]](/icons/image2.gif) | 9781337625982-100x10..> | 2023-08-06 07:47 | 2.1K | |
![[IMG]](/icons/image2.gif) | 9781337625982-300x30..> | 2023-09-22 22:43 | 12K | |
![[IMG]](/icons/image2.gif) | 9781337625982.jpg | 2023-05-04 01:57 | 18K | |
![[ ]](/icons/unknown.gif) | 9781337677103_TestBa..> | 2023-05-03 13:43 | 35K | |
![[ ]](/icons/unknown.gif) | 9781337687362_Alarid..> | 2023-05-03 13:41 | 148K | |
![[IMG]](/icons/image2.gif) | 9781337693660_TestBa..> | 2023-08-05 05:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781337693660_TestBa..> | 2023-08-24 00:00 | 21K | |
![[IMG]](/icons/image2.gif) | 9781337693660_TestBa..> | 2023-05-04 02:10 | 32K | |
![[IMG]](/icons/image2.gif) | 9781337694193_Soluti..> | 2023-08-05 01:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337694193_Soluti..> | 2023-08-14 20:35 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337694193_Soluti..> | 2023-05-04 02:26 | 22K | |
![[ ]](/icons/layout.gif) | 9781337694193_Soluti..> | 2023-05-04 02:26 | 179K | |
![[ ]](/icons/unknown.gif) | 9781337696326_Soluti..> | 2023-05-04 02:01 | 216K | |
![[IMG]](/icons/image2.gif) | 9781337696326_TestBa..> | 2023-08-06 10:18 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337696326_TestBa..> | 2023-08-16 22:56 | 20K | |
![[IMG]](/icons/image2.gif) | 9781337696326_TestBa..> | 2023-05-04 02:05 | 59K | |
![[ ]](/icons/unknown.gif) | 9781337696326_TestBa..> | 2023-05-04 02:03 | 101K | |
![[ ]](/icons/unknown.gif) | 9781337696456_TestBa..> | 2023-05-03 13:41 | 44K | |
![[IMG]](/icons/image2.gif) | 9781337702546_Soluti..> | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | 9781337702546_Soluti..> | 2023-08-11 11:53 | 25K | |
![[IMG]](/icons/image2.gif) | 9781337702546_Soluti..> | 2023-05-04 02:04 | 41K | |
![[IMG]](/icons/image2.gif) | 9781337794992_Soluti..> | 2023-08-05 18:14 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337794992_Soluti..> | 2023-08-15 09:54 | 21K | |
![[IMG]](/icons/image2.gif) | 9781337794992_Soluti..> | 2023-05-04 02:01 | 56K | |
![[IMG]](/icons/image2.gif) | 9781337794992_TestBa..> | 2023-08-05 02:03 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781337794992_TestBa..> | 2023-09-27 19:59 | 21K | |
![[IMG]](/icons/image2.gif) | 9781337794992_TestBa..> | 2023-05-04 02:03 | 56K | |
![[IMG]](/icons/image2.gif) | 9781337796620_TestBa..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781337796620_TestBa..> | 2023-08-27 02:56 | 18K | |
![[IMG]](/icons/image2.gif) | 9781337796620_TestBa..> | 2023-05-04 02:12 | 27K | |
![[ ]](/icons/unknown.gif) | 9781337796620_TestBa..> | 2023-05-04 02:11 | 0 | |
![[ ]](/icons/compressed.gif) | 9781337902601_Soluti..> | 2023-05-04 02:18 | 93K | |
![[IMG]](/icons/image2.gif) | 9781337902663_Soluti..> | 2023-08-06 03:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337902663_Soluti..> | 2023-08-08 17:45 | 19K | |
![[IMG]](/icons/image2.gif) | 9781337902663_Soluti..> | 2023-05-04 01:50 | 30K | |
![[ ]](/icons/unknown.gif) | 9781337902663_Soluti..> | 2023-05-04 01:50 | 155K | |
![[IMG]](/icons/image2.gif) | 9781337902663_TestBa..> | 2023-08-06 05:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337902663_TestBa..> | 2023-08-05 16:27 | 19K | |
![[IMG]](/icons/image2.gif) | 9781337902663_TestBa..> | 2023-05-04 01:50 | 30K | |
![[ ]](/icons/unknown.gif) | 9781337902663_TestBa..> | 2023-05-04 01:49 | 108K | |
![[IMG]](/icons/image2.gif) | 9781337902687_Soluti..> | 2023-08-08 06:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781337902687_Soluti..> | 2023-08-18 10:03 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337902687_Soluti..> | 2023-05-04 01:47 | 22K | |
![[ ]](/icons/layout.gif) | 9781337902687_Soluti..> | 2023-05-04 01:47 | 275K | |
![[ ]](/icons/unknown.gif) | 9781337902724_TestBa..> | 2023-05-03 13:42 | 12K | |
![[ ]](/icons/unknown.gif) | 9781337906371_Chapte..> | 2023-05-03 13:40 | 0 | |
![[ ]](/icons/unknown.gif) | 9781337909747_Soluti..> | 2023-05-04 02:19 | 78K | |
![[ ]](/icons/unknown.gif) | 9781337909747_TestBa..> | 2023-05-04 02:19 | 28K | |
![[IMG]](/icons/image2.gif) | 9781337910590_TestBa..> | 2023-08-05 14:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781337910590_TestBa..> | 2023-08-25 22:45 | 15K | |
![[IMG]](/icons/image2.gif) | 9781337910590_TestBa..> | 2023-05-04 01:50 | 20K | |
![[ ]](/icons/unknown.gif) | 9781337910590_TestBa..> | 2023-05-04 01:50 | 83K | |
![[IMG]](/icons/image2.gif) | 9781337911344_Soluti..> | 2023-08-08 06:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781337911344_Soluti..> | 2023-08-09 12:13 | 23K | |
![[IMG]](/icons/image2.gif) | 9781337911344_Soluti..> | 2023-05-03 11:06 | 65K | |
![[ ]](/icons/layout.gif) | 9781337911344_Soluti..> | 2023-05-03 11:06 | 402K | |
![[IMG]](/icons/image2.gif) | 9781337913102_Soluti..> | 2023-08-05 16:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781337913102_Soluti..> | 2023-08-12 04:50 | 16K | |
![[IMG]](/icons/image2.gif) | 9781337913102_Soluti..> | 2023-05-04 02:23 | 25K | |
![[IMG]](/icons/image2.gif) | 9781337914123_Soluti..> | 2023-08-05 17:22 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337914123_Soluti..> | 2023-08-09 12:13 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337914123_Soluti..> | 2023-05-04 02:03 | 27K | |
![[IMG]](/icons/image2.gif) | 9781337914123_TestBa..> | 2023-08-05 06:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781337914123_TestBa..> | 2023-08-06 05:40 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337914123_TestBa..> | 2023-05-04 02:03 | 27K | |
![[ ]](/icons/unknown.gif) | 9781337914123_hill_i..> | 2023-05-04 02:02 | 0 | |
![[IMG]](/icons/image2.gif) | 9781337916752_Soluti..> | 2023-08-05 06:23 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781337916752_Soluti..> | 2023-08-06 12:18 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337916752_Soluti..> | 2023-05-04 02:03 | 43K | |
![[IMG]](/icons/image2.gif) | 9781337916752_TestBa..> | 2023-08-06 07:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781337916752_TestBa..> | 2023-08-06 05:40 | 17K | |
![[IMG]](/icons/image2.gif) | 9781337916752_TestBa..> | 2023-05-04 02:03 | 43K | |
![[ ]](/icons/layout.gif) | 9781337917537_TestBa..> | 2023-05-03 13:42 | 288K | |
![[IMG]](/icons/image2.gif) | 9781337956413_TestBa..> | 2023-08-06 11:15 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781337956413_TestBa..> | 2023-09-01 21:32 | 21K | |
![[IMG]](/icons/image2.gif) | 9781337956413_TestBa..> | 2023-05-04 02:06 | 59K | |
![[ ]](/icons/unknown.gif) | 9781337956413_TestBa..> | 2023-05-04 02:06 | 16K | |
![[IMG]](/icons/image2.gif) | 9781401858773-100x10..> | 2023-08-06 09:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781401858773.jpg | 2023-05-03 11:04 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781412977739_TB-100..> | 2023-08-05 06:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781412977739_TB-300..> | 2023-08-16 16:54 | 15K | |
![[IMG]](/icons/image2.gif) | 9781412977739_TB.jpg | 2023-05-03 09:40 | 30K | |
![[IMG]](/icons/image2.gif) | 9781426628825_SM-100..> | 2023-08-06 02:48 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781426628825_SM-300..> | 2023-08-09 12:13 | 17K | |
![[IMG]](/icons/image2.gif) | 9781426628825_SM.jpg | 2023-05-04 02:16 | 20K | |
![[ ]](/icons/compressed.gif) | 9781426628825_SM_Ch1..> | 2023-05-04 02:16 | 53K | |
![[IMG]](/icons/image2.gif) | 9781429204941-TB2-10..> | 2023-08-05 05:30 | 5.1K | |
![[IMG]](/icons/image2.gif) | 9781429204941-TB2-30..> | 2023-08-09 19:34 | 33K | |
![[IMG]](/icons/image2.gif) | 9781429204941-TB2.jpg | 2023-05-03 09:18 | 323K | |
![[ ]](/icons/layout.gif) | 9781429229364-tspl.pdf | 2023-05-03 10:40 | 105K | |
![[IMG]](/icons/image2.gif) | 9781429232036_TB11-1..> | 2023-08-05 01:41 | 5.2K | |
![[IMG]](/icons/image2.gif) | 9781429232036_TB11-3..> | 2023-09-02 14:44 | 33K | |
![[IMG]](/icons/image2.gif) | 9781429232036_TB11.jpg | 2023-05-03 09:18 | 350K | |
![[IMG]](/icons/image2.gif) | 9781429234139_TB2-10..> | 2023-08-06 09:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781429234139_TB2-30..> | 2023-08-08 17:46 | 31K | |
![[IMG]](/icons/image2.gif) | 9781429234139_TB2.jpg | 2023-05-03 09:18 | 771K | |
![[ ]](/icons/layout.gif) | 9781429283427_KrugWe..> | 2023-05-04 02:08 | 0 | |
![[IMG]](/icons/image2.gif) | 9781429283427_Soluti..> | 2023-08-06 11:18 | 4.8K | |
![[IMG]](/icons/image2.gif) | 9781429283427_Soluti..> | 2023-08-15 09:54 | 32K | |
![[IMG]](/icons/image2.gif) | 9781429283427_Soluti..> | 2023-05-04 02:08 | 63K | |
![[ ]](/icons/unknown.gif) | 9781435440166_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781437706963_TestBa..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781437706963_TestBa..> | 2023-09-14 18:39 | 22K | |
![[IMG]](/icons/image2.gif) | 9781437706963_TestBa..> | 2023-05-04 02:17 | 24K | |
![[ ]](/icons/unknown.gif) | 9781437706963_TestBa..> | 2023-05-04 02:16 | 100K | |
![[ ]](/icons/layout.gif) | 9781437709445_TestBa..> | 2023-05-04 02:16 | 340K | |
![[ ]](/icons/layout.gif) | 9781437717075_TestBa..> | 2023-05-04 01:57 | 373K | |
![[ ]](/icons/unknown.gif) | 9781437717815_Chapte..> | 2023-05-04 02:05 | 87K | |
![[IMG]](/icons/image2.gif) | 9781437717815_TestBa..> | 2023-08-09 02:02 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781437717815_TestBa..> | 2023-09-30 01:35 | 19K | |
![[IMG]](/icons/image2.gif) | 9781437717815_TestBa..> | 2023-05-04 02:05 | 92K | |
![[IMG]](/icons/image2.gif) | 9781437727364_3_1.jpg | 2023-05-04 02:21 | 7.8K | |
![[ ]](/icons/layout.gif) | 9781437728019_TestBa..> | 2023-05-03 10:15 | 345K | |
![[ ]](/icons/layout.gif) | 9781439059432_TestBa..> | 2023-05-04 02:25 | 118K | |
![[IMG]](/icons/image2.gif) | 9781441923110-100x10..> | 2023-08-06 17:25 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781441923110.jpg | 2023-05-03 09:53 | 8.5K | |
![[IMG]](/icons/image2.gif) | 9781451111972_TestBa..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781451111972_TestBa..> | 2023-10-24 18:45 | 17K | |
![[IMG]](/icons/image2.gif) | 9781451111972_TestBa..> | 2023-05-04 02:08 | 23K | |
![[ ]](/icons/layout.gif) | 9781451128345_TEST_B..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781452203409-100x10..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781452203409.jpg | 2023-05-03 09:25 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9781452234984_TestBa..> | 2023-08-08 07:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781452234984_TestBa..> | 2023-08-06 05:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | 9781452234984_TestBa..> | 2023-05-04 02:03 | 14K | |
![[IMG]](/icons/image2.gif) | 9781453384862_TestBa..> | 2023-08-05 06:17 | 16K | |
![[IMG]](/icons/image2.gif) | 9781453384862_TestBa..> | 2023-08-08 10:57 | 123K | |
![[IMG]](/icons/image2.gif) | 9781453384862_TestBa..> | 2023-05-04 01:53 | 197K | |
![[IMG]](/icons/image2.gif) | 9781453386842_Soluti..> | 2023-08-08 22:02 | 12K | |
![[IMG]](/icons/image2.gif) | 9781453386842_Soluti..> | 2023-08-05 03:41 | 78K | |
![[IMG]](/icons/image2.gif) | 9781453386842_Soluti..> | 2023-05-04 02:24 | 140K | |
![[ ]](/icons/unknown.gif) | 9781453386842_Soluti..> | 2023-05-04 02:24 | 93K | |
![[IMG]](/icons/image2.gif) | 9781453386842_TestBa..> | 2023-08-08 06:43 | 12K | |
![[IMG]](/icons/image2.gif) | 9781453386842_TestBa..> | 2023-08-08 21:05 | 78K | |
![[IMG]](/icons/image2.gif) | 9781453386842_TestBa..> | 2023-05-04 01:57 | 140K | |
![[ ]](/icons/unknown.gif) | 9781453386842_TestBa..> | 2023-05-04 01:56 | 111K | |
![[IMG]](/icons/image2.gif) | 9781455733064_3_1.jpg | 2023-05-04 02:21 | 6.8K | |
![[IMG]](/icons/image2.gif) | 9781455741656_3_1.jpg | 2023-05-04 02:26 | 7.5K | |
![[IMG]](/icons/image2.gif) | 9781455745463.jpg | 2023-05-04 02:13 | 5.8K | |
![[IMG]](/icons/image2.gif) | 9781455751488_TestBa..> | 2023-08-08 21:59 | 2.7K | |
![[IMG]](/icons/image2.gif) | 9781455751488_TestBa..> | 2023-10-17 07:23 | 13K | |
![[IMG]](/icons/image2.gif) | 9781455751488_TestBa..> | 2023-05-04 02:25 | 16K | |
![[ ]](/icons/layout.gif) | 9781455751488_TestBa..> | 2023-05-04 02:25 | 307K | |
![[IMG]](/icons/image2.gif) | 9781455770052_TestBa..> | 2023-08-06 16:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781455770052_TestBa..> | 2023-08-05 01:13 | 15K | |
![[IMG]](/icons/image2.gif) | 9781455770052_TestBa..> | 2023-05-04 02:28 | 18K | |
![[ ]](/icons/layout.gif) | 9781455770052_TestBa..> | 2023-05-04 02:28 | 0 | |
![[ ]](/icons/unknown.gif) | 9781455770151_TestBa..> | 2023-05-03 13:42 | 108K | |
![[IMG]](/icons/image2.gif) | 9781464109478_TestBa..> | 2023-08-05 02:55 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781464109478_TestBa..> | 2023-08-13 15:24 | 14K | |
![[IMG]](/icons/image2.gif) | 9781464109478_TestBa..> | 2023-05-04 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | 9781464126130_TestBa..> | 2023-08-05 15:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781464126130_TestBa..> | 2023-09-02 05:06 | 25K | |
![[IMG]](/icons/image2.gif) | 9781464126130_TestBa..> | 2023-05-04 02:11 | 45K | |
![[ ]](/icons/layout.gif) | 9781464126130_TestBa..> | 2023-05-04 02:11 | 0 | |
![[IMG]](/icons/image2.gif) | 9781464177354-100x10..> | 2023-08-08 18:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781464177354.jpg | 2023-05-03 10:03 | 11K | |
![[IMG]](/icons/image2.gif) | 9781473719026_TestBa..> | 2023-08-06 16:00 | 4.7K | |
![[IMG]](/icons/image2.gif) | 9781473719026_TestBa..> | 2023-08-19 00:17 | 27K | |
![[IMG]](/icons/image2.gif) | 9781473719026_TestBa..> | 2023-05-04 02:06 | 43K | |
![[IMG]](/icons/image2.gif) | 9781473725331_TestBa..> | 2023-08-05 17:18 | 2.5K | |
![[IMG]](/icons/image2.gif) | 9781473725331_TestBa..> | 2023-08-16 22:56 | 12K | |
![[IMG]](/icons/image2.gif) | 9781473725331_TestBa..> | 2023-05-03 11:04 | 33K | |
![[IMG]](/icons/image2.gif) | 9781496350589_TestBa..> | 2023-08-06 04:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781496350589_TestBa..> | 2023-08-30 07:22 | 17K | |
![[IMG]](/icons/image2.gif) | 9781496350589_TestBa..> | 2023-05-04 02:24 | 22K | |
![[ ]](/icons/unknown.gif) | 9781496350602_TestBa..> | 2023-05-04 02:23 | 116K | |
![[ ]](/icons/unknown.gif) | 9781506315331_Crotea..> | 2023-05-03 13:42 | 33K | |
![[ ]](/icons/unknown.gif) | 9781506315478_Dainto..> | 2023-05-03 13:43 | 109K | |
![[IMG]](/icons/image2.gif) | 9781506330693_TestBa..> | 2023-08-05 04:35 | 2.3K | |
![[IMG]](/icons/image2.gif) | 9781506330693_TestBa..> | 2023-08-08 07:33 | 12K | |
![[IMG]](/icons/image2.gif) | 9781506330693_TestBa..> | 2023-05-04 01:54 | 16K | |
![[ ]](/icons/unknown.gif) | 9781506330693_TestBa..> | 2023-05-04 01:54 | 63K | |
![[ ]](/icons/unknown.gif) | 9781506331324_Bosson..> | 2023-05-04 01:47 | 54K | |
![[IMG]](/icons/image2.gif) | 9781506347202_Soluti..> | 2023-08-05 22:02 | 4.5K | |
![[IMG]](/icons/image2.gif) | 9781506347202_Soluti..> | 2023-08-13 06:55 | 22K | |
![[IMG]](/icons/image2.gif) | 9781506347202_Soluti..> | 2023-05-04 02:18 | 25K | |
![[ ]](/icons/layout.gif) | 9781506347202_Soluti..> | 2023-05-04 02:18 | 569K | |
![[ ]](/icons/unknown.gif) | 9781506350424_TestBa..> | 2023-05-04 02:27 | 47K | |
![[ ]](/icons/unknown.gif) | 9781506357355_Lopez-..> | 2023-05-03 13:42 | 63K | |
![[ ]](/icons/unknown.gif) | 9781506361192_Schutt..> | 2023-05-04 02:08 | 35K | |
![[IMG]](/icons/image2.gif) | 9781506361192_TestBa..> | 2023-08-08 21:06 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781506361192_TestBa..> | 2023-08-20 18:55 | 19K | |
![[IMG]](/icons/image2.gif) | 9781506361192_TestBa..> | 2023-05-04 02:08 | 41K | |
![[IMG]](/icons/image2.gif) | 9781506362724_TestBa..> | 2023-08-05 03:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | 9781506362724_TestBa..> | 2023-09-11 04:22 | 20K | |
![[IMG]](/icons/image2.gif) | 9781506362724_TestBa..> | 2023-05-04 02:27 | 45K | |
![[ ]](/icons/unknown.gif) | 9781506362724_TestBa..> | 2023-05-04 02:27 | 0 | |
![[ ]](/icons/unknown.gif) | 9781506363127_Bauer_..> | 2023-05-04 02:08 | 53K | |
![[ ]](/icons/unknown.gif) | 9781506363127_Soluti..> | 2023-05-04 02:21 | 35K | |
![[IMG]](/icons/image2.gif) | 9781506363127_TestBa..> | 2023-08-06 13:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781506363127_TestBa..> | 2023-08-08 22:05 | 18K | |
![[IMG]](/icons/image2.gif) | 9781506363127_TestBa..> | 2023-05-04 02:08 | 24K | |
![[ ]](/icons/unknown.gif) | 9781506365121_Hynes7..> | 2023-05-03 14:04 | 31K | |
![[IMG]](/icons/image2.gif) | 9781506367828_TestBa..> | 2023-08-06 11:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781506367828_TestBa..> | 2023-08-05 03:41 | 18K | |
![[IMG]](/icons/image2.gif) | 9781506367828_TestBa..> | 2023-05-03 11:08 | 37K | |
![[ ]](/icons/unknown.gif) | 9781506367828_TestBa..> | 2023-05-03 11:07 | 88K | |
![[ ]](/icons/unknown.gif) | 9781506368054_Spinel..> | 2023-05-04 02:26 | 105K | |
![[ ]](/icons/unknown.gif) | 9781506369051_Treadw..> | 2023-05-04 02:17 | 42K | |
![[ ]](/icons/unknown.gif) | 9781506373393_Kuther..> | 2023-05-04 01:56 | 102K | |
![[IMG]](/icons/image2.gif) | 9781506373393_TestBa..> | 2023-08-05 01:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781506373393_TestBa..> | 2023-08-31 04:03 | 17K | |
![[IMG]](/icons/image2.gif) | 9781506373393_TestBa..> | 2023-05-04 01:56 | 38K | |
![[ ]](/icons/unknown.gif) | 9781506379616_Polloc..> | 2023-05-03 13:43 | 32K | |
![[IMG]](/icons/image2.gif) | 9781506379654_Soluti..> | 2023-08-05 16:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781506379654_Soluti..> | 2023-08-25 19:27 | 19K | |
![[IMG]](/icons/image2.gif) | 9781506379654_Soluti..> | 2023-05-04 01:54 | 42K | |
![[ ]](/icons/unknown.gif) | 9781506379654_polloc..> | 2023-05-04 01:54 | 203K | |
![[IMG]](/icons/image2.gif) | 9781506382661_TestBa..> | 2023-08-05 02:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | 9781506382661_TestBa..> | 2023-08-06 10:20 | 12K | |
![[IMG]](/icons/image2.gif) | 9781506382661_TestBa..> | 2023-05-04 02:03 | 28K | |
![[IMG]](/icons/image2.gif) | 9781506384931_TestBa..> | 2023-08-05 16:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781506384931_TestBa..> | 2023-08-06 17:25 | 17K | |
![[IMG]](/icons/image2.gif) | 9781506384931_TestBa..> | 2023-05-04 01:56 | 26K | |
![[ ]](/icons/unknown.gif) | 9781506384931_TestBa..> | 2023-05-04 01:56 | 36K | |
![[ ]](/icons/unknown.gif) | 9781506387246_Bartol..> | 2023-05-04 02:07 | 45K | |
![[IMG]](/icons/image2.gif) | 9781506387246_TestBa..> | 2023-08-06 11:17 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781506387246_TestBa..> | 2023-08-16 01:58 | 16K | |
![[IMG]](/icons/image2.gif) | 9781506387246_TestBa..> | 2023-05-04 02:07 | 35K | |
![[ ]](/icons/unknown.gif) | 9781506387307_Lilly_..> | 2023-05-03 11:07 | 37K | |
![[IMG]](/icons/image2.gif) | 9781506387307_TestBa..> | 2023-08-05 01:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781506387307_TestBa..> | 2023-08-05 03:41 | 17K | |
![[IMG]](/icons/image2.gif) | 9781506387307_TestBa..> | 2023-05-03 11:07 | 37K | |
![[IMG]](/icons/image2.gif) | 9781506388465_TestBa..> | 2023-08-08 00:56 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781506388465_TestBa..> | 2023-08-30 18:06 | 13K | |
![[IMG]](/icons/image2.gif) | 9781506388465_TestBa..> | 2023-05-04 02:10 | 29K | |
![[ ]](/icons/unknown.gif) | 9781506389059_Healey..> | 2023-05-04 02:16 | 37K | |
![[IMG]](/icons/image2.gif) | 9781506389059_TestBa..> | 2023-08-08 20:08 | 3.3K | |
![[IMG]](/icons/image2.gif) | 9781506389059_TestBa..> | 2023-08-14 23:55 | 14K | |
![[IMG]](/icons/image2.gif) | 9781506389059_TestBa..> | 2023-05-04 02:16 | 31K | |
![[ ]](/icons/unknown.gif) | 9781506391410_Brandl..> | 2023-05-04 01:54 | 27K | |
![[IMG]](/icons/image2.gif) | 9781506391786_Soluit..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781506391786_Soluit..> | 2023-08-05 17:23 | 15K | |
![[IMG]](/icons/image2.gif) | 9781506391786_Soluit..> | 2023-05-04 02:01 | 30K | |
![[ ]](/icons/unknown.gif) | 9781506391786_Soluit..> | 2023-05-04 02:01 | 18K | |
![[ ]](/icons/unknown.gif) | 9781506398938_Levine..> | 2023-05-04 01:59 | 44K | |
![[ ]](/icons/unknown.gif) | 9781526423870_tuten_..> | 2023-05-04 02:15 | 65K | |
![[ ]](/icons/unknown.gif) | 9781544316185_TestBa..> | 2023-05-03 13:42 | 31K | |
![[ ]](/icons/unknown.gif) | 9781544317540_Test-B..> | 2023-05-04 02:14 | 53K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-08-05 04:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-08-09 12:49 | 18K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-05-04 02:14 | 24K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-08-06 10:20 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-08-09 12:49 | 18K | |
![[IMG]](/icons/image2.gif) | 9781544317540_TestBa..> | 2023-05-04 01:51 | 24K | |
![[ ]](/icons/unknown.gif) | 9781544320366_Garret..> | 2023-05-04 02:09 | 222K | |
![[IMG]](/icons/image2.gif) | 9781544324814_TestBa..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781544324814_TestBa..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | 9781544324814_TestBa..> | 2023-05-04 02:02 | 44K | |
![[ ]](/icons/unknown.gif) | 9781544324814_TestBa..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/unknown.gif) | 9781544325422_Smith7..> | 2023-05-04 02:29 | 31K | |
![[ ]](/icons/unknown.gif) | 9781544328867_Northo..> | 2023-05-04 02:24 | 46K | |
![[ ]](/icons/unknown.gif) | 9781544329253_Rennis..> | 2023-05-04 01:55 | 64K | |
![[ ]](/icons/unknown.gif) | 9781544330723_Rennis..> | 2023-05-04 01:57 | 67K | |
![[IMG]](/icons/image2.gif) | 9781544330723_TestBa..> | 2023-08-06 11:04 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781544330723_TestBa..> | 2023-08-08 06:27 | 17K | |
![[IMG]](/icons/image2.gif) | 9781544330723_TestBa..> | 2023-05-04 01:57 | 38K | |
![[ ]](/icons/unknown.gif) | 9781544330860_Hatten..> | 2023-05-04 02:07 | 41K | |
![[ ]](/icons/unknown.gif) | 9781544332284_Kuther..> | 2023-05-04 02:16 | 81K | |
![[IMG]](/icons/image2.gif) | 9781544332635_TestBa..> | 2023-08-05 04:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781544332635_TestBa..> | 2023-09-06 02:57 | 22K | |
![[IMG]](/icons/image2.gif) | 9781544332635_TestBa..> | 2023-05-04 02:21 | 31K | |
![[ ]](/icons/unknown.gif) | 9781544332635_TestBa..> | 2023-05-04 02:21 | 85K | |
![[ ]](/icons/unknown.gif) | 9781544332659_TestBa..> | 2023-05-04 02:25 | 36K | |
![[ ]](/icons/unknown.gif) | 9781544333342_Pelham..> | 2023-05-03 11:14 | 30K | |
![[IMG]](/icons/image2.gif) | 9781544333342_TestBa..> | 2023-08-06 13:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781544333342_TestBa..> | 2023-08-23 01:30 | 14K | |
![[IMG]](/icons/image2.gif) | 9781544333342_TestBa..> | 2023-05-03 11:14 | 28K | |
![[IMG]](/icons/image2.gif) | 9781544333427_TestBa..> | 2023-08-06 13:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | 9781544333427_TestBa..> | 2023-08-08 22:05 | 16K | |
![[IMG]](/icons/image2.gif) | 9781544333427_TestBa..> | 2023-05-04 02:00 | 38K | |
![[ ]](/icons/unknown.gif) | 9781544333427_TestBa..> | 2023-05-04 02:00 | 43K | |
![[ ]](/icons/unknown.gif) | 9781544333618_Pomera..> | 2023-05-04 02:17 | 39K | |
![[ ]](/icons/unknown.gif) | 9781544333663_Swanso..> | 2023-05-04 01:59 | 0 | |
![[IMG]](/icons/image2.gif) | 9781544333663_TestBa..> | 2023-08-08 21:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | 9781544333663_TestBa..> | 2023-08-16 17:47 | 17K | |
![[IMG]](/icons/image2.gif) | 9781544333663_TestBa..> | 2023-05-04 01:59 | 40K | |
![[ ]](/icons/unknown.gif) | 9781544334752_Lippma..> | 2023-05-03 11:09 | 193K | |
![[IMG]](/icons/image2.gif) | 9781544334752_TestBa..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781544334752_TestBa..> | 2023-08-19 00:59 | 13K | |
![[IMG]](/icons/image2.gif) | 9781544334752_TestBa..> | 2023-05-03 11:09 | 28K | |
![[ ]](/icons/unknown.gif) | 9781544338422_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781544339399_TestBa..> | 2023-08-05 16:16 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781544339399_TestBa..> | 2023-08-15 20:03 | 17K | |
![[IMG]](/icons/image2.gif) | 9781544339399_TestBa..> | 2023-05-04 01:55 | 26K | |
![[ ]](/icons/unknown.gif) | 9781544339399_Venkat..> | 2023-05-04 01:55 | 44K | |
![[IMG]](/icons/image2.gif) | 9781544351575_TestBa..> | 2023-08-05 16:26 | 4.4K | |
![[IMG]](/icons/image2.gif) | 9781544351575_TestBa..> | 2023-08-08 23:47 | 27K | |
![[IMG]](/icons/image2.gif) | 9781544351575_TestBa..> | 2023-05-04 02:29 | 41K | |
![[ ]](/icons/unknown.gif) | 9781544351575_TestBa..> | 2023-05-04 02:29 | 74K | |
![[IMG]](/icons/image2.gif) | 9781544351599_TestBa..> | 2023-08-06 10:18 | 2.6K | |
![[IMG]](/icons/image2.gif) | 9781544351599_TestBa..> | 2023-08-16 16:05 | 12K | |
![[IMG]](/icons/image2.gif) | 9781544351599_TestBa..> | 2023-05-04 01:55 | 29K | |
![[ ]](/icons/unknown.gif) | 9781544351599_TestBa..> | 2023-05-04 01:55 | 140K | |
![[IMG]](/icons/image2.gif) | 9781544351643_TestBa..> | 2023-08-06 12:02 | 3.1K | |
![[IMG]](/icons/image2.gif) | 9781544351643_TestBa..> | 2023-08-11 01:46 | 15K | |
![[IMG]](/icons/image2.gif) | 9781544351643_TestBa..> | 2023-05-04 02:27 | 33K | |
![[ ]](/icons/unknown.gif) | 9781544351643_TestBa..> | 2023-05-04 02:27 | 34K | |
![[ ]](/icons/unknown.gif) | 9781544353593_Banks5..> | 2023-05-03 11:10 | 48K | |
![[IMG]](/icons/image2.gif) | 9781544353593_TestBa..> | 2023-08-05 14:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | 9781544353593_TestBa..> | 2023-08-19 11:51 | 14K | |
![[IMG]](/icons/image2.gif) | 9781544353593_TestBa..> | 2023-05-03 11:10 | 27K | |
![[ ]](/icons/unknown.gif) | 9781544355184_Ritzer..> | 2023-05-04 01:54 | 54K | |
![[ ]](/icons/unknown.gif) | 9781544364476_TestBa..> | 2023-05-04 02:24 | 68K | |
![[ ]](/icons/unknown.gif) | 9781544366708_Miller..> | 2023-05-04 02:17 | 40K | |
![[ ]](/icons/unknown.gif) | 9781544366715_McBrid..> | 2023-05-04 02:16 | 41K | |
![[ ]](/icons/unknown.gif) | 9781544371009_Privit..> | 2023-05-04 02:24 | 50K | |
![[ ]](/icons/unknown.gif) | 9781544374611_Kraft7..> | 2023-05-04 02:22 | 48K | |
![[ ]](/icons/unknown.gif) | 9781544377438_Barbou..> | 2023-05-03 10:52 | 38K | |
![[IMG]](/icons/image2.gif) | 9781544377438_TestBa..> | 2023-08-05 16:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 9781544377438_TestBa..> | 2023-08-27 01:46 | 13K | |
![[IMG]](/icons/image2.gif) | 9781544377438_TestBa..> | 2023-05-03 10:52 | 20K | |
![[IMG]](/icons/image2.gif) | 9781544381855_Soluti..> | 2023-08-06 13:03 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781544381855_Soluti..> | 2023-08-05 17:23 | 12K | |
![[IMG]](/icons/image2.gif) | 9781544381855_Soluti..> | 2023-05-04 02:01 | 29K | |
![[IMG]](/icons/image2.gif) | 9781544381855_TestBa..> | 2023-08-05 14:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | 9781544381855_TestBa..> | 2023-08-12 07:27 | 12K | |
![[IMG]](/icons/image2.gif) | 9781544381855_TestBa..> | 2023-05-04 02:01 | 29K | |
![[ ]](/icons/unknown.gif) | 9781544381855_TestBa..> | 2023-05-04 02:01 | 184K | |
![[ ]](/icons/unknown.gif) | 9781544388922_Chambl..> | 2023-05-04 02:29 | 42K | |
![[IMG]](/icons/image2.gif) | 9781544388922_TestBa..> | 2023-08-05 16:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | 9781544388922_TestBa..> | 2023-09-04 20:54 | 17K | |
![[IMG]](/icons/image2.gif) | 9781544388922_TestBa..> | 2023-05-04 02:29 | 38K | |
![[ ]](/icons/layout.gif) | 9781608310753_TestBa..> | 2023-05-03 13:41 | 0 | |
![[IMG]](/icons/image2.gif) | 9781609136956-100x10..> | 2023-08-06 08:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | 9781609136956-300x30..> | 2023-08-17 19:58 | 19K | |
![[IMG]](/icons/image2.gif) | 9781609136956.jpg | 2023-05-03 10:11 | 22K | |
![[ ]](/icons/unknown.gif) | 9781618532336_FSAV-5..> | 2023-05-04 02:23 | 109K | |
![[IMG]](/icons/image2.gif) | 9781618532336_TestBa..> | 2023-08-09 08:04 | 3.7K | |
![[IMG]](/icons/image2.gif) | 9781618532336_TestBa..> | 2023-09-17 09:37 | 23K | |
![[IMG]](/icons/image2.gif) | 9781618532336_TestBa..> | 2023-05-04 02:23 | 38K | |
![[IMG]](/icons/image2.gif) | 9781771720489.jpg | 2023-05-04 02:10 | 8.7K | |
![[ ]](/icons/unknown.gif) | 9781771720489_TestBa..> | 2023-05-03 13:42 | 0 | |
![[IMG]](/icons/image2.gif) | 9781771720939.jpg | 2023-05-04 02:11 | 7.1K | |
![[IMG]](/icons/image2.gif) | 9781771720984.jpg | 2023-05-04 02:08 | 6.6K | |
![[IMG]](/icons/image2.gif) | 9781771721134.jpg | 2023-05-04 02:05 | 10K | |
![[IMG]](/icons/image2.gif) | 9781771721172.jpg | 2023-05-04 02:11 | 7.8K | |
![[IMG]](/icons/image2.gif) | 9781771721400_TestBa..> | 2023-08-05 04:37 | 3.6K | |
![[IMG]](/icons/image2.gif) | 9781771721400_TestBa..> | 2023-05-04 01:59 | 40K | |
![[ ]](/icons/unknown.gif) | 9781771721400_TestBa..> | 2023-05-04 01:59 | 84K | |
![[IMG]](/icons/image2.gif) | 9781771721585.jpg | 2023-05-04 02:03 | 14K | |
![[IMG]](/icons/image2.gif) | 9781926648613_3_1.jpg | 2023-05-04 02:25 | 6.4K | |
![[IMG]](/icons/image2.gif) | 9781926648729_3_1.jpg | 2023-05-04 02:21 | 5.6K | |
![[IMG]](/icons/image2.gif) | 9781927406625_4.jpg | 2023-05-04 02:29 | 7.7K | |
![[IMG]](/icons/image2.gif) | 9789810686185-100x10..> | 2023-08-05 05:30 | 5.4K | |
![[IMG]](/icons/image2.gif) | 9789810686185.gif | 2023-05-03 09:47 | 8.0K | |
![[IMG]](/icons/image2.gif) | 9789812548832.jpg | 2023-05-03 09:21 | 16K | |
![[IMG]](/icons/image2.gif) | 97800735306661-100x1..> | 2023-08-05 14:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | 97800735306661.jpg | 2023-05-03 10:22 | 6.3K | |
![[IMG]](/icons/image2.gif) | 97801329683621-100x1..> | 2023-08-06 04:18 | 6.5K | |
![[IMG]](/icons/image2.gif) | 97801329683621.gif | 2023-05-03 10:13 | 11K | |
![[IMG]](/icons/image2.gif) | 97801329913221-100x1..> | 2023-08-06 11:14 | 5.5K | |
![[IMG]](/icons/image2.gif) | 97801329913221.gif | 2023-05-03 10:48 | 8.5K | |
![[IMG]](/icons/image2.gif) | 97801330343871-100x1..> | 2023-08-05 16:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | 97801330343871.jpg | 2023-05-03 10:25 | 8.2K | |
![[IMG]](/icons/image2.gif) | 97801330504791-100x1..> | 2023-08-06 04:49 | 6.2K | |
![[IMG]](/icons/image2.gif) | 97801330504791.gif | 2023-05-04 02:13 | 12K | |
![[IMG]](/icons/image2.gif) | 97801333598481-100x1..> | 2023-08-06 12:01 | 3.4K | |
![[IMG]](/icons/image2.gif) | 97801333598481.gif | 2023-05-03 10:36 | 5.0K | |
![[IMG]](/icons/image2.gif) | 97801334851031-100x1..> | 2023-08-05 03:40 | 6.1K | |
![[IMG]](/icons/image2.gif) | 97801334851031.gif | 2023-05-03 10:44 | 9.8K | |
![[IMG]](/icons/image2.gif) | 97801335768701-100x1..> | 2023-08-05 16:29 | 5.9K | |
![[IMG]](/icons/image2.gif) | 97801335768701.gif | 2023-05-03 10:15 | 10K | |
![[IMG]](/icons/image2.gif) | 97801338020161-100x1..> | 2023-08-05 14:34 | 10K | |
![[IMG]](/icons/image2.gif) | 97801338020161.gif | 2023-05-03 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | 97801338038151-100x1..> | 2023-08-06 12:11 | 7.6K | |
![[IMG]](/icons/image2.gif) | 97801338038151.gif | 2023-05-04 02:23 | 13K | |
![[IMG]](/icons/image2.gif) | 97801338266921-100x1..> | 2023-08-05 01:09 | 4.8K | |
![[IMG]](/icons/image2.gif) | 97801338266921.gif | 2023-05-03 09:44 | 6.7K | |
![[IMG]](/icons/image2.gif) | 97801338649841-1-100..> | 2023-08-06 10:20 | 10K | |
![[IMG]](/icons/image2.gif) | 97801338649841-1.gif | 2023-05-03 09:52 | 20K | |
![[IMG]](/icons/image2.gif) | 97801338649841-100x1..> | 2023-08-05 04:34 | 10K | |
![[IMG]](/icons/image2.gif) | 97801338649841.gif | 2023-05-03 09:31 | 20K | |
![[IMG]](/icons/image2.gif) | 97801360363711-100x1..> | 2023-08-06 05:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | 97801360363711.jpg | 2023-05-03 10:45 | 5.1K | |
![[IMG]](/icons/image2.gif) | 97801370026961-100x1..> | 2023-08-06 12:11 | 3.5K | |
![[IMG]](/icons/image2.gif) | 97801370026961.jpg | 2023-05-03 09:49 | 5.2K | |
![[IMG]](/icons/image2.gif) | 97803218224201-100x1..> | 2023-08-05 01:51 | 8.4K | |
![[IMG]](/icons/image2.gif) | 97803218224201.gif | 2023-05-03 09:57 | 22K | |
![[IMG]](/icons/image2.gif) | 97803218901391-100x1..> | 2023-08-05 04:19 | 10K | |
![[IMG]](/icons/image2.gif) | 97803218901391.gif | 2023-05-03 10:32 | 19K | |
![[IMG]](/icons/image2.gif) | 97803218902381-100x1..> | 2023-08-05 14:43 | 7.0K | |
![[IMG]](/icons/image2.gif) | 97803218902381.gif | 2023-05-03 10:54 | 13K | |
![[IMG]](/icons/image2.gif) | 97803218912421-100x1..> | 2023-08-06 11:04 | 5.6K | |
![[IMG]](/icons/image2.gif) | 97803218912421.gif | 2023-05-03 09:25 | 8.2K | |
![[IMG]](/icons/image2.gif) | 97803218919381-100x1..> | 2023-08-08 06:41 | 9.3K | |
![[IMG]](/icons/image2.gif) | 97803218919381.gif | 2023-05-03 10:28 | 16K | |
![[IMG]](/icons/image2.gif) | 97803219025591-100x1..> | 2023-08-08 06:37 | 9.4K | |
![[IMG]](/icons/image2.gif) | 97803219025591.gif | 2023-05-03 10:14 | 15K | |
![[IMG]](/icons/image2.gif) | 97803219030371-100x1..> | 2023-08-05 03:41 | 6.6K | |
![[IMG]](/icons/image2.gif) | 97803219030371.gif | 2023-05-03 09:46 | 11K | |
![[IMG]](/icons/image2.gif) | 97803219197481-100x1..> | 2023-08-05 02:46 | 5.7K | |
![[IMG]](/icons/image2.gif) | 97803219197481.gif | 2023-05-03 10:42 | 8.8K | |
![[IMG]](/icons/image2.gif) | 97803219257251-100x1..> | 2023-08-06 11:17 | 4.9K | |
![[IMG]](/icons/image2.gif) | 97803219257251.gif | 2023-05-04 01:55 | 7.3K | |
![[IMG]](/icons/image2.gif) | 97807167384972-100x1..> | 2023-08-07 04:33 | 4.3K | |
![[IMG]](/icons/image2.gif) | 97807167384972.jpg | 2023-05-03 09:11 | 42K | |
![[IMG]](/icons/image2.gif) | 97808036231632-100x1..> | 2023-08-05 05:30 | 3.7K | |
![[IMG]](/icons/image2.gif) | 97808036231632.jpg | 2023-05-03 09:12 | 21K | |
![[IMG]](/icons/image2.gif) | A-Guidance-Approach-..> | 2023-08-05 14:38 | 4.0K | |
![[IMG]](/icons/image2.gif) | A-Guidance-Approach-..> | 2023-08-09 18:53 | 19K | |
![[IMG]](/icons/image2.gif) | A-Guidance-Approach-..> | 2023-05-04 01:49 | 52K | |
![[IMG]](/icons/image2.gif) | AAs-100x100.jpg | 2023-08-06 07:49 | 13K | |
![[IMG]](/icons/image2.gif) | AAs.jpg | 2023-05-03 09:23 | 43K | |
![[ ]](/icons/unknown.gif) | AIS10e_Ch_01.rtf | 2023-05-03 10:57 | 386K | |
![[ ]](/icons/unknown.gif) | AKMY-6e-ch01_SM.doc | 2023-05-03 09:25 | 185K | |
![[ ]](/icons/layout.gif) | AKSG-Chapter_001.pdf | 2023-05-04 02:11 | 134K | |
![[ ]](/icons/layout.gif) | APPA-Solution-Manual..> | 2023-05-03 10:46 | 113K | |
![[ ]](/icons/unknown.gif) | AT8_IRM_Ch01_2_TG.doc | 2023-05-03 10:02 | 115K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-08-05 06:28 | 9.9K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-08-14 09:10 | 20K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-05-03 11:07 | 37K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-08-06 12:12 | 9.9K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-08-14 09:10 | 20K | |
![[IMG]](/icons/image2.gif) | ATI-RN-Nutrition-201..> | 2023-05-03 11:08 | 38K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-V-exam-100x..> | 2023-08-05 06:15 | 10K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-V-exam-300x..> | 2023-08-14 09:10 | 22K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-V-exam.jpg | 2023-05-03 10:56 | 40K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-main-photo-..> | 2023-08-05 05:29 | 19K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-main-photo-..> | 2023-08-14 09:10 | 129K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-main-photo-..> | 2023-05-04 02:12 | 497K | |
![[IMG]](/icons/image2.gif) | ATI-TEAS-main-photo-..> | 2023-05-04 01:51 | 8.7M | |
![[ ]](/icons/layout.gif) | ATI_TEAS_V_Exam_Samp..> | 2023-05-03 10:56 | 2.5M | |
![[IMG]](/icons/image2.gif) | A_Topical_Approach_t..> | 2023-08-06 10:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | A_Topical_Approach_t..> | 2023-08-09 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | A_Topical_Approach_t..> | 2023-05-03 09:54 | 39K | |
![[ ]](/icons/layout.gif) | A_stin_6123_01_FM.pdf | 2023-05-03 10:35 | 85K | |
![[ ]](/icons/compressed.gif) | Abbott--Natural-Disa..> | 2023-05-03 09:59 | 14K | |
![[IMG]](/icons/image2.gif) | Abnormal_Child_Psych..> | 2023-08-06 09:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | Abnormal_Child_Psych..> | 2023-08-06 07:38 | 23K | |
![[IMG]](/icons/image2.gif) | Abnormal_Child_Psych..> | 2023-05-03 09:35 | 50K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-05 01:40 | 2.0K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-06 07:38 | 10K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-05-03 09:59 | 13K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-06 05:44 | 2.1K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-06 07:38 | 11K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-05-03 10:32 | 20K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-06 07:38 | 19K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-05-03 11:01 | 41K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-05 02:45 | 2.3K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-08-06 07:38 | 10K | |
![[IMG]](/icons/image2.gif) | Abnormal_Psychology_..> | 2023-05-03 10:15 | 23K | |
![[IMG]](/icons/image2.gif) | Accounting-9e-Horngr..> | 2023-08-05 17:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | Accounting-9e-Horngr..> | 2023-08-14 21:32 | 12K | |
![[IMG]](/icons/image2.gif) | Accounting-9e-Horngr..> | 2023-05-04 02:02 | 64K | |
![[IMG]](/icons/image2.gif) | Accounting-11e-Albre..> | 2023-08-06 05:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | Accounting-11e-Albre..> | 2023-08-21 06:52 | 13K | |
![[IMG]](/icons/image2.gif) | Accounting-11e-Albre..> | 2023-05-03 09:26 | 30K | |
![[IMG]](/icons/image2.gif) | Accounting-24e-Warre..> | 2023-08-05 10:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | Accounting-24e-Warre..> | 2023-08-10 17:02 | 20K | |
![[IMG]](/icons/image2.gif) | Accounting-24e-Warre..> | 2023-05-04 02:13 | 50K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-08-05 01:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-08-17 19:59 | 19K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-05-03 10:58 | 108K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-08-15 18:11 | 19K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-05-03 09:38 | 108K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | Accounting-Informati..> | 2023-05-03 09:21 | 20K | |
![[ ]](/icons/unknown.gif) | Accounting-Principle..> | 2023-05-03 13:42 | 407K | |
![[IMG]](/icons/image2.gif) | Accounting-Text-and-..> | 2023-05-03 10:37 | 19K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-06 11:04 | 2.6K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-05 07:10 | 17K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-05-03 10:23 | 38K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-06 03:28 | 2.6K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-05 07:10 | 17K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-05-03 09:57 | 38K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-05 07:10 | 20K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-05-03 09:19 | 48K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-05 15:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-09 01:23 | 26K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-05-03 10:36 | 57K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-06 13:11 | 4.1K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-08-09 01:23 | 26K | |
![[IMG]](/icons/image2.gif) | Accounting_Informati..> | 2023-05-03 10:09 | 57K | |
![[IMG]](/icons/image2.gif) | Accounting_Warren_23..> | 2023-08-06 12:12 | 3.2K | |
![[IMG]](/icons/image2.gif) | Accounting_Warren_23..> | 2023-08-17 16:42 | 17K | |
![[IMG]](/icons/image2.gif) | Accounting_Warren_23..> | 2023-05-04 02:15 | 30K | |
![[IMG]](/icons/image2.gif) | Accounting_for_Gover..> | 2023-05-03 10:24 | 16K | |
![[ ]](/icons/compressed.gif) | Activation-Test-Bank..> | 2023-05-03 10:22 | 12K | |
![[IMG]](/icons/image2.gif) | Adams-1st-Canadian-E..> | 2023-08-06 11:19 | 2.4K | |
![[IMG]](/icons/image2.gif) | Adams-1st-Canadian-E..> | 2023-08-08 16:38 | 12K | |
![[IMG]](/icons/image2.gif) | Adams-1st-Canadian-E..> | 2023-05-03 09:35 | 28K | |
![[IMG]](/icons/image2.gif) | Adams-Pharmacology-C..> | 2023-08-05 16:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | Adams-Pharmacology-C..> | 2023-05-03 10:18 | 24K | |
![[ ]](/icons/compressed.gif) | Adams-Pharmacology-C..> | 2023-05-03 10:18 | 19K | |
![[ ]](/icons/unknown.gif) | Adler-IRM-8e-Questio..> | 2023-05-03 13:40 | 0 | |
![[ ]](/icons/compressed.gif) | Adoloscene.10e.zip | 2023-05-03 10:58 | 19K | |
![[IMG]](/icons/image2.gif) | Adult_Development_an..> | 2023-08-05 15:33 | 3.4K | |
![[IMG]](/icons/image2.gif) | Adult_Development_an..> | 2023-08-17 16:42 | 16K | |
![[IMG]](/icons/image2.gif) | Adult_Development_an..> | 2023-05-03 09:25 | 37K | |
![[IMG]](/icons/image2.gif) | Advanced-Accounting-..> | 2023-08-09 16:42 | 2.3K | |
![[IMG]](/icons/image2.gif) | Advanced-Accounting-..> | 2023-05-04 02:28 | 14K | |
![[IMG]](/icons/image2.gif) | Advanced_Accounting_..> | 2023-08-05 06:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | Advanced_Accounting_..> | 2023-08-17 16:42 | 20K | |
![[IMG]](/icons/image2.gif) | Advanced_Accounting_..> | 2023-05-03 09:53 | 46K | |
![[IMG]](/icons/image2.gif) | Advanced_Accounting_..> | 2023-05-03 11:05 | 13K | |
![[ ]](/icons/compressed.gif) | Advanced_Accounting_..> | 2023-05-03 09:20 | 67K | |
![[IMG]](/icons/image2.gif) | Advanced_Health_Asse..> | 2023-05-04 02:04 | 34K | |
![[IMG]](/icons/image2.gif) | Advanced_Health_Asse..> | 2023-05-04 02:05 | 36K | |
![[IMG]](/icons/image2.gif) | Advanced_Practice_Nu..> | 2023-05-04 01:52 | 29K | |
![[ ]](/icons/unknown.gif) | Ahrens_12e_IM_Ch01.docx | 2023-05-03 13:41 | 31K | |
![[IMG]](/icons/image2.gif) | Alberts-4th-Edition-..> | 2023-08-05 15:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | Alberts-4th-Edition-..> | 2023-08-05 06:17 | 24K | |
![[IMG]](/icons/image2.gif) | Alberts-4th-Edition-..> | 2023-05-03 10:10 | 71K | |
![[IMG]](/icons/image2.gif) | Alberts-6th-Molecula..> | 2023-08-08 07:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | Alberts-6th-Molecula..> | 2023-08-09 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | Alberts-6th-Molecula..> | 2023-05-03 10:13 | 48K | |
![[ ]](/icons/compressed.gif) | Alberts-2015-6th-081..> | 2023-05-03 10:13 | 56K | |
![[ ]](/icons/compressed.gif) | Albrecht 11e_SM_Ch 0..> | 2023-05-03 09:26 | 69K | |
![[IMG]](/icons/image2.gif) | Alcamo-Microbiology-..> | 2023-08-05 01:51 | 4.4K | |
![[IMG]](/icons/image2.gif) | Alcamo-Microbiology-..> | 2023-08-18 21:48 | 29K | |
![[IMG]](/icons/image2.gif) | Alcamo-Microbiology-..> | 2023-05-03 09:34 | 82K | |
![[IMG]](/icons/image2.gif) | Alexanders_Care_of_t..> | 2023-05-04 02:07 | 34K | |
![[ ]](/icons/compressed.gif) | American-History-14e..> | 2023-05-03 10:32 | 21K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-08-25 19:27 | 16K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-05-03 11:05 | 37K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-08-05 16:29 | 4.5K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-08-06 03:48 | 26K | |
![[IMG]](/icons/image2.gif) | An-Introduction-to-M..> | 2023-05-03 09:31 | 66K | |
![[IMG]](/icons/image2.gif) | Anatomy-2e-Jenkins-1..> | 2023-08-05 01:12 | 2.3K | |
![[IMG]](/icons/image2.gif) | Anatomy-2e-Jenkins-3..> | 2023-08-24 20:17 | 12K | |
![[IMG]](/icons/image2.gif) | Anatomy-2e-Jenkins.jpg | 2023-05-03 10:43 | 33K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-2..> | 2023-08-05 01:56 | 2.6K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-2..> | 2023-08-24 20:17 | 14K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-2..> | 2023-05-03 09:45 | 81K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-4..> | 2023-08-05 17:21 | 3.4K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-4..> | 2023-08-24 20:17 | 21K | |
![[IMG]](/icons/image2.gif) | Anatomy-Physiology-4..> | 2023-05-03 09:59 | 123K | |
![[IMG]](/icons/image2.gif) | Anatomy_and_Physiolo..> | 2023-08-05 02:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | Anatomy_and_Physiolo..> | 2023-08-12 06:54 | 17K | |
![[IMG]](/icons/image2.gif) | Anatomy_and_Physiolo..> | 2023-05-03 09:38 | 35K | |
![[ ]](/icons/compressed.gif) | Anderson--Quantitati..> | 2023-05-03 09:38 | 11K | |
![[IMG]](/icons/image2.gif) | Andersons-Business-L..> | 2023-08-05 05:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | Andersons-Business-L..> | 2023-08-27 10:06 | 17K | |
![[IMG]](/icons/image2.gif) | Andersons-Business-L..> | 2023-05-03 10:24 | 43K | |
![[ ]](/icons/unknown.gif) | Answer-Guide-01AG_MN..> | 2023-05-03 09:34 | 64K | |
![[ ]](/icons/unknown.gif) | Answer-Key-for-Blood..> | 2023-05-04 01:51 | 206K | |
![[IMG]](/icons/image2.gif) | Anthropology-13e-Emb..> | 2023-08-08 23:54 | 5.1K | |
![[IMG]](/icons/image2.gif) | Anthropology-13e-Emb..> | 2023-08-27 10:06 | 33K | |
![[IMG]](/icons/image2.gif) | Anthropology-13e-Emb..> | 2023-05-03 11:20 | 198K | |
![[ ]](/icons/unknown.gif) | Appendix_A_Creating_..> | 2023-05-04 02:22 | 16K | |
![[IMG]](/icons/image2.gif) | Applied-Social-Resea..> | 2023-08-08 18:23 | 3.0K | |
![[IMG]](/icons/image2.gif) | Applied-Social-Resea..> | 2023-08-12 20:37 | 15K | |
![[IMG]](/icons/image2.gif) | Applied-Social-Resea..> | 2023-05-03 10:45 | 43K | |
![[IMG]](/icons/image2.gif) | Applied-Statics-and-..> | 2023-08-05 02:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | Applied-Statics-and-..> | 2023-08-21 00:08 | 22K | |
![[IMG]](/icons/image2.gif) | Applied-Statics-and-..> | 2023-05-03 10:38 | 27K | |
![[IMG]](/icons/image2.gif) | Aschenbrenner-3rd-Ed..> | 2023-08-06 08:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | Aschenbrenner-3rd-Ed..> | 2023-08-09 09:54 | 14K | |
![[IMG]](/icons/image2.gif) | Aschenbrenner-3rd-Ed..> | 2023-05-03 09:35 | 30K | |
![[IMG]](/icons/image2.gif) | Aschenbrenner-4e-100..> | 2023-08-05 14:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | Aschenbrenner-4e.jpg | 2023-05-03 10:53 | 13K | |
![[ ]](/icons/unknown.gif) | Atmos_12e_TB_CH02.doc | 2023-05-03 10:42 | 317K | |
![[IMG]](/icons/image2.gif) | Auditing-9e-Johnston..> | 2023-08-05 14:36 | 3.5K | |
![[IMG]](/icons/image2.gif) | Auditing-9e-Johnston..> | 2023-08-27 05:08 | 18K | |
![[IMG]](/icons/image2.gif) | Auditing-9e-Johnston..> | 2023-05-03 09:22 | 41K | |
![[ ]](/icons/unknown.gif) | Auditing-Assurance-S..> | 2023-05-03 09:20 | 490K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-08-05 04:31 | 4.4K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-08-12 14:47 | 27K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-05-03 10:18 | 58K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-08-05 04:19 | 4.4K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-08-05 01:51 | 27K | |
![[IMG]](/icons/image2.gif) | Auditing_A_Risk_Base..> | 2023-05-03 09:11 | 58K | |
![[IMG]](/icons/image2.gif) | Auditing_Cases_An_In..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | Auditing_Cases_An_In..> | 2023-08-12 04:49 | 17K | |
![[IMG]](/icons/image2.gif) | Auditing_Cases_An_In..> | 2023-05-03 10:24 | 18K | |
![[ ]](/icons/unknown.gif) | BH_FFM13_IM_ch01.doc | 2023-05-03 10:29 | 61K | |
![[ ]](/icons/unknown.gif) | BL10-P-ECQ-Ch-1-Heri..> | 2023-05-04 02:00 | 14K | |
![[ ]](/icons/unknown.gif) | BLB12-IRM-Ch-1_final..> | 2023-05-03 09:36 | 104K | |
![[ ]](/icons/unknown.gif) | BLB13-IRM-Ch-01-LSBE..> | 2023-05-03 10:05 | 114K | |
![[ ]](/icons/unknown.gif) | BLTC-10e-TB-Ch01.docx | 2023-05-03 09:47 | 67K | |
![[ ]](/icons/unknown.gif) | BU-1_version1-Test-B..> | 2023-05-04 02:01 | 48K | |
![[ ]](/icons/compressed.gif) | BUTCHER_TB_01_final.zip | 2023-05-03 13:42 | 156K | |
![[IMG]](/icons/image2.gif) | Baltzan3e12ms_nm2-10..> | 2023-08-05 05:17 | 2.1K | |
![[IMG]](/icons/image2.gif) | Baltzan3e12ms_nm2-30..> | 2023-08-23 21:13 | 9.6K | |
![[IMG]](/icons/image2.gif) | Baltzan3e12ms_nm2.jpg | 2023-05-03 10:30 | 21K | |
![[IMG]](/icons/image2.gif) | Baltzan4e10ms_nm2-10..> | 2023-08-05 14:37 | 1.4K | |
![[IMG]](/icons/image2.gif) | Baltzan4e10ms_nm2-30..> | 2023-08-21 04:41 | 6.0K | |
![[IMG]](/icons/image2.gif) | Baltzan4e10ms_nm2.jpg | 2023-05-03 11:08 | 11K | |
![[ ]](/icons/unknown.gif) | Baltzan9E_TB_CH01_ve..> | 2023-05-04 02:26 | 61K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-08-08 08:16 | 3.6K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-09-05 01:19 | 23K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-05-03 11:19 | 52K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-08-06 08:31 | 3.6K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-09-05 01:19 | 23K | |
![[IMG]](/icons/image2.gif) | Bank_Management_Koch..> | 2023-05-03 11:20 | 52K | |
![[IMG]](/icons/image2.gif) | Basic_Biomechanics_H..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | Basic_Biomechanics_H..> | 2023-09-05 01:19 | 17K | |
![[IMG]](/icons/image2.gif) | Basic_Biomechanics_H..> | 2023-05-03 09:42 | 38K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-08-05 15:31 | 3.0K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-09-05 01:19 | 18K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-05-03 11:17 | 40K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-09-05 01:19 | 18K | |
![[IMG]](/icons/image2.gif) | Basic_Business_Stati..> | 2023-05-03 09:41 | 40K | |
![[ ]](/icons/unknown.gif) | Basics-1_version1-Te..> | 2023-05-04 01:59 | 31K | |
![[ ]](/icons/unknown.gif) | Bate14e_IM_Chap01.docx | 2023-05-04 01:56 | 126K | |
![[IMG]](/icons/image2.gif) | Bates_Nursing_Guide_..> | 2023-05-04 02:06 | 25K | |
![[ ]](/icons/layout.gif) | Batteries_ecofootpri..> | 2023-05-03 11:19 | 159K | |
![[ ]](/icons/unknown.gif) | Baumeister_SocPsych_..> | 2023-05-04 01:51 | 122K | |
![[IMG]](/icons/image2.gif) | Baye7e10md_nm21-100x..> | 2023-08-06 16:00 | 3.0K | |
![[IMG]](/icons/image2.gif) | Baye7e10md_nm21-300x..> | 2023-09-08 20:36 | 14K | |
![[IMG]](/icons/image2.gif) | Baye7e10md_nm21.jpg | 2023-05-03 10:18 | 30K | |
![[IMG]](/icons/image2.gif) | Beasley-Modern-Elect..> | 2023-08-05 02:03 | 2.7K | |
![[IMG]](/icons/image2.gif) | Beasley-Modern-Elect..> | 2023-05-04 01:59 | 21K | |
![[ ]](/icons/compressed.gif) | Beasley-Modern-Elect..> | 2023-05-04 01:59 | 145K | |
![[IMG]](/icons/image2.gif) | Beckmann_and_Lings_O..> | 2023-05-04 02:06 | 35K | |
![[IMG]](/icons/image2.gif) | Beckmann_and_Lings_O..> | 2023-05-04 01:52 | 35K | |
![[ ]](/icons/unknown.gif) | BeebeComm6eTB_ch01.docx | 2023-05-03 13:42 | 63K | |
![[ ]](/icons/unknown.gif) | Beebe_Mottet_Chapter..> | 2023-05-03 09:12 | 77K | |
![[ ]](/icons/unknown.gif) | Beechy_TIF_Ch01.doc | 2023-05-03 09:06 | 68K | |
![[ ]](/icons/unknown.gif) | BeerMOM8e_04_Lesson1..> | 2023-05-04 01:59 | 1.3M | |
![[ ]](/icons/unknown.gif) | Bekaert_2e_SM_Ch01.doc | 2023-05-03 10:01 | 43K | |
![[ ]](/icons/compressed.gif) | Bennett--The-Essenti..> | 2023-05-03 09:19 | 22K | |
![[ ]](/icons/unknown.gif) | Bennett9e_Chapter01_..> | 2023-05-04 01:55 | 23K | |
![[ ]](/icons/compressed.gif) | Bereska_4e_TIF_ch01.zip | 2023-05-03 09:23 | 19K | |
![[IMG]](/icons/image2.gif) | Berman-10th-Edition-..> | 2023-08-08 02:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | Berman-10th-Edition-..> | 2023-08-20 07:59 | 16K | |
![[IMG]](/icons/image2.gif) | Berman-10th-Edition-..> | 2023-05-03 09:37 | 45K | |
![[ ]](/icons/compressed.gif) | Berman_10e_TIF_CH10.zip | 2023-05-03 09:37 | 26K | |
![[IMG]](/icons/image2.gif) | Bettelheim-9th-Intro..> | 2023-08-06 07:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | Bettelheim-9th-Intro..> | 2023-08-05 01:08 | 20K | |
![[IMG]](/icons/image2.gif) | Bettelheim-9th-Intro..> | 2023-05-03 10:13 | 50K | |
![[ ]](/icons/compressed.gif) | Bettelheim-2009-9th-..> | 2023-05-03 10:13 | 561K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-08-05 01:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-08-14 08:18 | 14K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-05-03 10:28 | 128K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-08-06 12:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-09-18 20:08 | 14K | |
![[IMG]](/icons/image2.gif) | Biological_Psycholog..> | 2023-05-03 10:51 | 128K | |
![[IMG]](/icons/image2.gif) | Biology_Concepts_and..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | Biology_Concepts_and..> | 2023-08-12 04:50 | 19K | |
![[IMG]](/icons/image2.gif) | Biology_Concepts_and..> | 2023-05-03 09:58 | 32K | |
![[IMG]](/icons/image2.gif) | Biopsychology_Pinel_..> | 2023-08-05 14:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | Biopsychology_Pinel_..> | 2023-08-05 02:31 | 16K | |
![[IMG]](/icons/image2.gif) | Biopsychology_Pinel_..> | 2023-05-03 09:37 | 30K | |
![[ ]](/icons/compressed.gif) | Blitzer--Thinking-Ma..> | 2023-05-03 09:32 | 168K | |
![[IMG]](/icons/image2.gif) | Bluman-Elementary-St..> | 2023-08-05 01:52 | 2.7K | |
![[IMG]](/icons/image2.gif) | Bluman-Elementary-St..> | 2023-08-23 23:59 | 16K | |
![[IMG]](/icons/image2.gif) | Bluman-Elementary-St..> | 2023-05-03 09:33 | 36K | |
![[IMG]](/icons/image2.gif) | Bodie8e10le_nm2-100x..> | 2023-08-05 03:40 | 1.8K | |
![[IMG]](/icons/image2.gif) | Bodie8e10le_nm2-300x..> | 2023-08-30 14:11 | 6.9K | |
![[IMG]](/icons/image2.gif) | Bodie8e10le_nm2.jpg | 2023-05-03 10:46 | 14K | |
![[IMG]](/icons/image2.gif) | BodieEss9e13le_nm2-1..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | BodieEss9e13le_nm2-3..> | 2023-08-17 10:32 | 13K | |
![[IMG]](/icons/image2.gif) | BodieEss9e13le_nm2.jpg | 2023-05-03 09:29 | 31K | |
![[ ]](/icons/unknown.gif) | Bodie_Essentials_of_..> | 2023-05-04 01:58 | 67K | |
![[IMG]](/icons/image2.gif) | Booth_Stoia3e13ss_nm..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | Booth_Stoia3e13ss_nm..> | 2023-08-27 10:06 | 20K | |
![[IMG]](/icons/image2.gif) | Booth_Stoia3e13ss_nm..> | 2023-05-04 02:12 | 45K | |
![[ ]](/icons/unknown.gif) | Bordwell-1_version1...> | 2023-05-04 02:04 | 19K | |
![[IMG]](/icons/image2.gif) | Borjas6e13bar_nm21-1..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | Borjas6e13bar_nm21-3..> | 2023-08-05 15:27 | 15K | |
![[IMG]](/icons/image2.gif) | Borjas6e13bar_nm21.jpg | 2023-05-03 10:55 | 37K | |
![[ ]](/icons/unknown.gif) | Borjas8e_SolutionsMa..> | 2023-05-04 02:21 | 107K | |
![[ ]](/icons/compressed.gif) | Bowerman--Business-S..> | 2023-05-03 10:19 | 314K | |
![[ ]](/icons/unknown.gif) | Bowman_TB_Ch01_Essen..> | 2023-05-03 10:50 | 93K | |
![[ ]](/icons/unknown.gif) | Brannon_HealthPsych_..> | 2023-05-03 10:25 | 100K | |
![[ ]](/icons/unknown.gif) | Brealey10e_Chapter01..> | 2023-05-03 14:06 | 28K | |
![[ ]](/icons/unknown.gif) | Brewer5ce_SM_Ch01_FI..> | 2023-05-04 01:58 | 32K | |
![[IMG]](/icons/image2.gif) | Brickley5e09md_nm2-1..> | 2023-08-05 18:15 | 2.6K | |
![[IMG]](/icons/image2.gif) | Brickley5e09md_nm2-3..> | 2023-08-09 09:11 | 14K | |
![[IMG]](/icons/image2.gif) | Brickley5e09md_nm2.jpg | 2023-05-03 11:23 | 36K | |
![[IMG]](/icons/image2.gif) | Brock-Biology-of-Mic..> | 2023-08-05 05:30 | 5.2K | |
![[IMG]](/icons/image2.gif) | Brock-Biology-of-Mic..> | 2023-08-25 16:56 | 32K | |
![[IMG]](/icons/image2.gif) | Brock-Biology-of-Mic..> | 2023-05-04 02:08 | 114K | |
![[IMG]](/icons/image2.gif) | Brunner_and_Suddarth..> | 2023-08-05 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | Brunner_and_Suddarth..> | 2023-08-05 02:31 | 18K | |
![[IMG]](/icons/image2.gif) | Brunner_and_Suddarth..> | 2023-05-03 10:29 | 28K | |
![[IMG]](/icons/image2.gif) | Building-a-Medical-V..> | 2023-08-05 14:38 | 15K | |
![[IMG]](/icons/image2.gif) | Building-a-Medical-V..> | 2023-05-03 09:31 | 38K | |
![[IMG]](/icons/image2.gif) | Building-a-Medical-V..> | 2023-08-06 05:44 | 3.6K | |
![[IMG]](/icons/image2.gif) | Building-a-Medical-V..> | 2023-08-27 05:21 | 20K | |
![[IMG]](/icons/image2.gif) | Building-a-Medical-V..> | 2023-05-03 10:06 | 48K | |
![[IMG]](/icons/image2.gif) | Burchum-9th-Edition-..> | 2023-08-05 01:56 | 2.5K | |
![[IMG]](/icons/image2.gif) | Burchum-9th-Edition-..> | 2023-08-08 16:38 | 13K | |
![[IMG]](/icons/image2.gif) | Burchum-9th-Edition-..> | 2023-05-03 09:55 | 33K | |
![[ ]](/icons/unknown.gif) | Burkley_TB_Chapter-2..> | 2023-05-04 02:19 | 62K | |
![[IMG]](/icons/image2.gif) | Burns_and_Groves_The..> | 2023-05-04 02:04 | 23K | |
![[IMG]](/icons/image2.gif) | Business-Communicati..> | 2023-08-08 04:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | Business-Communicati..> | 2023-08-05 01:12 | 15K | |
![[IMG]](/icons/image2.gif) | Business-Communicati..> | 2023-05-03 09:07 | 36K | |
![[IMG]](/icons/image2.gif) | Business-Essentials-..> | 2023-08-06 21:21 | 3.7K | |
![[IMG]](/icons/image2.gif) | Business-Essentials-..> | 2023-08-21 04:41 | 19K | |
![[IMG]](/icons/image2.gif) | Business-Essentials-..> | 2023-05-03 10:18 | 93K | |
![[IMG]](/icons/image2.gif) | Business-Law-Text-an..> | 2023-08-05 03:41 | 1.3K | |
![[IMG]](/icons/image2.gif) | Business-Law-Text-an..> | 2023-08-09 08:49 | 6.4K | |
![[IMG]](/icons/image2.gif) | Business-Law-Text-an..> | 2023-05-04 01:49 | 19K | |
![[IMG]](/icons/image2.gif) | Business_Analysis_an..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | Business_Analysis_an..> | 2023-08-05 02:31 | 17K | |
![[IMG]](/icons/image2.gif) | Business_Analysis_an..> | 2023-05-03 09:57 | 109K | |
![[IMG]](/icons/image2.gif) | Business_Analytics_D..> | 2023-08-05 15:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | Business_Analytics_D..> | 2023-08-05 02:31 | 20K | |
![[IMG]](/icons/image2.gif) | Business_Analytics_D..> | 2023-05-03 09:27 | 45K | |
![[IMG]](/icons/image2.gif) | Business_Law_Text_an..> | 2023-08-06 05:44 | 1.7K | |
![[IMG]](/icons/image2.gif) | Business_Law_Text_an..> | 2023-08-14 07:22 | 11K | |
![[IMG]](/icons/image2.gif) | Business_Law_Text_an..> | 2023-05-03 10:53 | 19K | |
![[IMG]](/icons/image2.gif) | Business_Law_Text_an..> | 2023-05-04 01:49 | 7.8K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-08-06 12:18 | 2.4K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-08-05 15:35 | 12K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-05-03 09:38 | 25K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-08-06 02:45 | 2.4K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-08-05 15:35 | 12K | |
![[IMG]](/icons/image2.gif) | Business_Research_Me..> | 2023-05-03 11:08 | 25K | |
![[IMG]](/icons/image2.gif) | C-500x600-500x600-1-..> | 2023-08-08 01:56 | 3.2K | |
![[IMG]](/icons/image2.gif) | C-500x600-500x600-1-..> | 2023-08-24 02:13 | 16K | |
![[IMG]](/icons/image2.gif) | C-500x600-500x600-1.jpg | 2023-05-04 01:57 | 47K | |
![[IMG]](/icons/image2.gif) | C-Programming-Progra..> | 2023-08-06 09:42 | 2.3K | |
![[IMG]](/icons/image2.gif) | C-Programming-Progra..> | 2023-05-03 11:24 | 5.9K | |
![[ ]](/icons/unknown.gif) | C1-Development-Throu..> | 2023-05-03 10:10 | 159K | |
![[ ]](/icons/unknown.gif) | C13_Horngren_V2_ISM...> | 2023-05-04 02:21 | 193K | |
![[ ]](/icons/compressed.gif) | C9780205966585TB.zip | 2023-05-03 14:02 | 40K | |
![[ ]](/icons/compressed.gif) | C9781439805336SM.zip | 2023-05-04 02:23 | 267K | |
![[ ]](/icons/compressed.gif) | C9781439851753SM.zip | 2023-05-04 02:23 | 5.3M | |
![[ ]](/icons/compressed.gif) | C9781439884829SM.zip | 2023-05-04 02:26 | 213K | |
![[ ]](/icons/compressed.gif) | C9781466560680SM.zip | 2023-05-04 02:29 | 583K | |
![[ ]](/icons/compressed.gif) | C9781466573154SM.zip | 2023-05-04 02:29 | 15M | |
![[ ]](/icons/compressed.gif) | C9781466590731SM.zip | 2023-05-04 02:22 | 1.0M | |
![[ ]](/icons/compressed.gif) | C9781482252231SM.zip | 2023-05-03 14:05 | 350K | |
![[ ]](/icons/compressed.gif) | C9781498738989TB.zip | 2023-05-04 02:23 | 2.8M | |
![[ ]](/icons/compressed.gif) | C9781848726673TB.zip | 2023-05-04 02:23 | 156K | |
![[ ]](/icons/compressed.gif) | C9781936523467TB.zip | 2023-05-04 02:25 | 96K | |
![[ ]](/icons/unknown.gif) | CAPS3eCh01_Test.docx | 2023-05-03 09:40 | 14K | |
![[ ]](/icons/unknown.gif) | CAST-Computerized-Mo..> | 2023-05-03 10:19 | 107K | |
![[ ]](/icons/unknown.gif) | CB8_IM_Ch01.doc | 2023-05-03 11:20 | 166K | |
![[ ]](/icons/unknown.gif) | CD6e_TB_00_FM.rtf | 2023-05-03 13:42 | 137K | |
![[ ]](/icons/unknown.gif) | CFFM8_IM_ch01.doc | 2023-05-03 10:04 | 66K | |
![[ ]](/icons/unknown.gif) | CFFM9-ch-01-IM-10-13..> | 2023-05-03 10:12 | 76K | |
![[ ]](/icons/unknown.gif) | CFFM10-ch-01-IM-12-1..> | 2023-05-03 11:23 | 81K | |
![[IMG]](/icons/image2.gif) | CFIN-3e-Besley-100x1..> | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | CFIN-3e-Besley-300x3..> | 2023-08-23 22:04 | 19K | |
![[IMG]](/icons/image2.gif) | CFIN-3e-Besley.jpg | 2023-05-03 10:42 | 48K | |
![[IMG]](/icons/image2.gif) | CFIN2-2e-Besley-100x..> | 2023-08-06 03:58 | 4.1K | |
![[IMG]](/icons/image2.gif) | CFIN2-2e-Besley-300x..> | 2023-08-23 22:04 | 22K | |
![[IMG]](/icons/image2.gif) | CFIN2-2e-Besley.jpeg | 2023-05-03 10:42 | 56K | |
![[ ]](/icons/unknown.gif) | CH01-2.docx | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | CH01-Introducton-Sol..> | 2023-05-04 02:13 | 15K | |
![[ ]](/icons/unknown.gif) | CH01-Test-Bank-for-F..> | 2023-05-03 09:29 | 53K | |
![[ ]](/icons/unknown.gif) | CH01-Test-Bank-for-F..> | 2023-05-03 11:03 | 60K | |
![[ ]](/icons/unknown.gif) | CH01-Test-Bank-for-M..> | 2023-05-03 13:41 | 31K | |
![[ ]](/icons/unknown.gif) | CH01-Testbank-BDC7e...> | 2023-05-03 09:38 | 108K | |
![[ ]](/icons/compressed.gif) | CH01-Testbank-NetSec..> | 2023-05-03 10:10 | 124K | |
![[ ]](/icons/compressed.gif) | CH01.zip | 2023-05-03 10:42 | 7.1K | |
![[ ]](/icons/unknown.gif) | CH01_Feldman_DALS7e_..> | 2023-05-03 10:32 | 224K | |
![[ ]](/icons/unknown.gif) | CH01_Revsine6e_SM.docx | 2023-05-03 10:21 | 53K | |
![[ ]](/icons/layout.gif) | CH0137-54pgs.pdf | 2023-05-04 01:47 | 196K | |
![[ ]](/icons/unknown.gif) | CH03_Berk_4CE_ISM.docx | 2023-05-04 02:20 | 173K | |
![[ ]](/icons/unknown.gif) | CH1.rtf | 2023-05-04 02:04 | 0 | |
![[ ]](/icons/compressed.gif) | CH1ATC_09.zip | 2023-05-03 10:15 | 18K | |
![[ ]](/icons/compressed.gif) | CHAPTER-1-ADJUSTING-..> | 2023-05-03 11:07 | 28K | |
![[ ]](/icons/unknown.gif) | CHAPTER-1-Solution-M..> | 2023-05-03 09:51 | 426K | |
![[ ]](/icons/compressed.gif) | CHAPTER-1-THE-TELEVI..> | 2023-05-03 10:00 | 2.1K | |
![[ ]](/icons/compressed.gif) | CHAPTER-1-Test-Bank-..> | 2023-05-03 09:55 | 11K | |
![[ ]](/icons/unknown.gif) | CHAPTER-1-Test-Bank-..> | 2023-05-03 10:47 | 28K | |
![[ ]](/icons/compressed.gif) | CHAPTER-2-SCIENCE-MA..> | 2023-05-03 09:22 | 207K | |
![[ ]](/icons/layout.gif) | CHAPTER-3-FORM-A.pdf | 2023-05-04 01:47 | 178K | |
![[ ]](/icons/unknown.gif) | CHAPTER_01_INTRODUCT..> | 2023-05-04 02:20 | 36K | |
![[ ]](/icons/unknown.gif) | CHAPTER_01_THE_POWER..> | 2023-05-03 10:32 | 17K | |
![[ ]](/icons/unknown.gif) | CHAPTER_01_WHAT_IS_E..> | 2023-05-03 11:03 | 29K | |
![[ ]](/icons/compressed.gif) | CHAPTER_02_14FINANCI..> | 2023-05-03 10:59 | 25K | |
![[ ]](/icons/unknown.gif) | CHAPTER_1_WHY_TEACH_..> | 2023-05-03 10:43 | 20K | |
![[ ]](/icons/unknown.gif) | CH_01_Introduction.docx | 2023-05-04 02:24 | 43K | |
![[ ]](/icons/unknown.gif) | CI5e_testbank_ch01.doc | 2023-05-03 13:42 | 186K | |
![[ ]](/icons/unknown.gif) | CKR_IB4_IM_01.docx | 2023-05-04 02:06 | 134K | |
![[ ]](/icons/unknown.gif) | CPM-4e-IM-Ch-1-17091..> | 2023-05-03 10:58 | 49K | |
![[IMG]](/icons/image2.gif) | CURRENT_Medical_Diag..> | 2023-05-04 02:07 | 36K | |
![[IMG]](/icons/image2.gif) | Calculus-Early-Trans..> | 2023-08-05 16:23 | 4.3K | |
![[IMG]](/icons/image2.gif) | Calculus-Early-Trans..> | 2023-08-13 04:19 | 22K | |
![[IMG]](/icons/image2.gif) | Calculus-Early-Trans..> | 2023-05-03 09:57 | 36K | |
![[IMG]](/icons/image2.gif) | Campbell_Biology_Con..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | Campbell_Biology_Con..> | 2023-08-12 04:50 | 21K | |
![[IMG]](/icons/image2.gif) | Campbell_Biology_Con..> | 2023-05-03 10:11 | 47K | |
![[IMG]](/icons/image2.gif) | Capital-Markets-4ed1..> | 2023-08-08 06:38 | 4.1K | |
![[IMG]](/icons/image2.gif) | Capital-Markets-4ed1..> | 2023-08-25 19:27 | 26K | |
![[IMG]](/icons/image2.gif) | Capital-Markets-4ed1..> | 2023-05-03 09:25 | 55K | |
![[ ]](/icons/unknown.gif) | Caproni-Management-S..> | 2023-05-04 02:21 | 71K | |
![[IMG]](/icons/image2.gif) | Capture-486x611-1-10..> | 2023-08-08 08:37 | 3.3K | |
![[IMG]](/icons/image2.gif) | Capture-486x611-1-30..> | 2023-08-11 11:08 | 17K | |
![[IMG]](/icons/image2.gif) | Capture-486x611-1.jpg | 2023-05-03 10:05 | 58K | |
![[ ]](/icons/compressed.gif) | Carbaugh--Internatio..> | 2023-05-03 10:27 | 6.7K | |
![[ ]](/icons/unknown.gif) | Cardin_IM_ch01.doc | 2023-05-03 09:33 | 71K | |
![[ ]](/icons/compressed.gif) | Cardin_IM_ch02.zip | 2023-05-03 09:32 | 15K | |
![[ ]](/icons/unknown.gif) | Cardiovascular-Syste..> | 2023-05-03 13:44 | 88K | |
![[IMG]](/icons/image2.gif) | Carey-Organic-Chemis..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | Carey-Organic-Chemis..> | 2023-08-13 23:07 | 20K | |
![[IMG]](/icons/image2.gif) | Carey-Organic-Chemis..> | 2023-05-03 10:03 | 40K | |
![[ ]](/icons/unknown.gif) | Case-02-Uber.docx | 2023-05-03 11:02 | 20K | |
![[ ]](/icons/unknown.gif) | Case01-9781119495673..> | 2023-05-03 13:42 | 221K | |
![[ ]](/icons/compressed.gif) | Case01_Milligan_IM.zip | 2023-05-03 09:40 | 133K | |
![[ ]](/icons/compressed.gif) | Case_01_Robin_Hood_T..> | 2023-05-03 10:35 | 12K | |
![[ ]](/icons/unknown.gif) | Case_01_Robin_Hood_T..> | 2023-05-03 09:49 | 99K | |
![[ ]](/icons/compressed.gif) | Case_1_1.zip | 2023-05-03 09:54 | 12K | |
![[ ]](/icons/unknown.gif) | Case_2_FedEx_UPS_201..> | 2023-05-04 01:59 | 99K | |
![[ ]](/icons/unknown.gif) | Case_Study_1_Enzyme_..> | 2023-05-04 02:01 | 33K | |
![[ ]](/icons/layout.gif) | Cavanaugh_7e_TB_Ch01..> | 2023-05-03 09:25 | 117K | |
![[IMG]](/icons/image2.gif) | Cengel4e12bar_nm2-10..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | Cengel4e12bar_nm2-30..> | 2023-08-08 17:45 | 20K | |
![[IMG]](/icons/image2.gif) | Cengel4e12bar_nm2.jpg | 2023-05-03 09:51 | 51K | |
![[ ]](/icons/unknown.gif) | Ch-01-Individual-Tax..> | 2023-05-03 09:20 | 71K | |
![[ ]](/icons/unknown.gif) | Ch-01-MT-Answer-Key_..> | 2023-05-03 09:41 | 20K | |
![[ ]](/icons/layout.gif) | Ch-1-Clinical-Reason..> | 2023-05-04 02:04 | 724K | |
![[ ]](/icons/layout.gif) | Ch-2-Evidence-Based-..> | 2023-05-04 02:06 | 745K | |
![[ ]](/icons/unknown.gif) | Ch01-9780803668423.docx | 2023-05-03 13:40 | 28K | |
![[ ]](/icons/compressed.gif) | Ch01-9781260247770.zip | 2023-05-03 11:14 | 233K | |
![[ ]](/icons/unknown.gif) | Ch01-AM-Clark-13e.docx | 2023-05-03 09:20 | 33K | |
![[ ]](/icons/unknown.gif) | Ch01-Family-Focused-..> | 2023-05-03 10:29 | 82K | |
![[ ]](/icons/compressed.gif) | Ch01-Financial-Manag..> | 2023-05-03 09:24 | 22K | |
![[ ]](/icons/compressed.gif) | Ch01-Financial-Manag..> | 2023-05-03 09:21 | 22K | |
![[ ]](/icons/unknown.gif) | Ch01-Introduction-s.doc | 2023-05-03 09:50 | 36K | |
![[ ]](/icons/unknown.gif) | Ch01-Solutions-Manua..> | 2023-05-03 09:38 | 45K | |
![[ ]](/icons/compressed.gif) | Ch01-Test-Bank-3-30-..> | 2023-05-03 11:05 | 77K | |
![[ ]](/icons/compressed.gif) | Ch01-Test-Bank-97814..> | 2023-05-04 01:52 | 1.1M | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-Essen..> | 2023-05-03 09:51 | 69K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-For-V..> | 2023-05-03 11:09 | 68K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-Mater..> | 2023-05-03 10:11 | 149K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-Readi..> | 2023-05-03 09:45 | 21K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-for-A..> | 2023-05-04 02:20 | 36K | |
![[ ]](/icons/layout.gif) | Ch01-Test-Bank-for-B..> | 2023-05-03 09:41 | 147K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-for-L..> | 2023-05-03 11:12 | 44K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-for-N..> | 2023-05-04 02:05 | 152K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-for-P..> | 2023-05-03 13:44 | 119K | |
![[ ]](/icons/unknown.gif) | Ch01-Test-Bank-for-S..> | 2023-05-03 09:35 | 50K | |
![[ ]](/icons/compressed.gif) | Ch01-The-New-Leaders..> | 2023-05-04 02:20 | 10K | |
![[ ]](/icons/unknown.gif) | Ch01.doc | 2023-05-03 09:57 | 265K | |
![[ ]](/icons/compressed.gif) | Ch 01.zip | 2023-05-03 09:57 | 136K | |
![[ ]](/icons/compressed.gif) | Ch01_01-Solution-Man..> | 2023-05-03 13:41 | 73K | |
![[ ]](/icons/unknown.gif) | Ch01_Concepts_8e_Sol..> | 2023-05-03 09:57 | 53K | |
![[ ]](/icons/unknown.gif) | Ch01_Exercises-Solut..> | 2023-05-03 10:52 | 209K | |
![[ ]](/icons/unknown.gif) | Ch01_Law_and_Legal_R..> | 2023-05-03 13:41 | 30K | |
![[ ]](/icons/unknown.gif) | Ch01_TB_Mowen.docx | 2023-05-03 11:20 | 42K | |
![[ ]](/icons/compressed.gif) | Ch01_TB_Pickar_3Ce.zip | 2023-05-03 09:26 | 64K | |
![[ ]](/icons/unknown.gif) | Ch01_TB_Pinel_9e.doc | 2023-05-03 09:37 | 222K | |
![[ ]](/icons/compressed.gif) | Ch01_Testbank-Test-B..> | 2023-05-04 02:07 | 28K | |
![[ ]](/icons/unknown.gif) | Ch01_The_Study_of_Co..> | 2023-05-03 13:42 | 17K | |
![[ ]](/icons/unknown.gif) | Ch01_Understanding_t..> | 2023-05-04 01:49 | 102K | |
![[ ]](/icons/unknown.gif) | Ch01__Strategic_Mana..> | 2023-05-03 10:49 | 170K | |
![[ ]](/icons/unknown.gif) | Ch02-0131014595.doc | 2023-05-03 10:09 | 70K | |
![[ ]](/icons/unknown.gif) | Ch02-P14-Build-a-Mod..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/compressed.gif) | Ch02Concepts-of-Pers..> | 2023-05-03 10:08 | 25K | |
![[ ]](/icons/compressed.gif) | Ch02Exercises-032148..> | 2023-05-04 01:52 | 8.9K | |
![[ ]](/icons/compressed.gif) | Ch02_Koch_4e_IML_add..> | 2023-05-03 09:50 | 13K | |
![[ ]](/icons/unknown.gif) | Ch03-Core-Concepts-o..> | 2023-05-03 09:57 | 44K | |
![[ ]](/icons/compressed.gif) | Ch03_ISM_Zinke-Allma..> | 2023-05-03 09:51 | 899K | |
![[ ]](/icons/compressed.gif) | Ch05_TB_Sizer_3Ce.zip | 2023-05-03 09:54 | 23K | |
![[ ]](/icons/layout.gif) | Ch1-2efinal.pdf | 2023-05-03 09:49 | 286K | |
![[ ]](/icons/unknown.gif) | Ch1-ISM-Solution-Man..> | 2023-05-03 10:47 | 40K | |
![[ ]](/icons/unknown.gif) | Ch1_Quiz-Quizzes-for..> | 2023-05-03 09:43 | 36K | |
![[ ]](/icons/layout.gif) | Ch2-10e-Solution-Man..> | 2023-05-04 02:29 | 177K | |
![[ ]](/icons/unknown.gif) | Ch2-Test-Bank-For-In..> | 2023-05-04 02:15 | 73K | |
![[ ]](/icons/unknown.gif) | Ch_01-Test-Bank-For-..> | 2023-05-03 09:38 | 267K | |
![[ ]](/icons/compressed.gif) | Ch_01-Test-Bank-for-..> | 2023-05-03 13:42 | 5.3K | |
![[ ]](/icons/compressed.gif) | Ch_02_Data_Models.zip | 2023-05-03 09:21 | 29K | |
![[ ]](/icons/compressed.gif) | Ch_02_Production_Pos..> | 2023-05-03 09:59 | 122K | |
![[ ]](/icons/layout.gif) | Ch_3-Solution-manual..> | 2023-05-03 10:54 | 416K | |
![[ ]](/icons/unknown.gif) | Chap-01_version1-978..> | 2023-05-04 02:00 | 90K | |
![[ ]](/icons/unknown.gif) | Chap001-Advanced-Acc..> | 2023-05-03 09:26 | 263K | |
![[ ]](/icons/unknown.gif) | Chap001-Advanced-Fin..> | 2023-05-03 09:19 | 784K | |
![[ ]](/icons/unknown.gif) | Chap001-Auditing-and..> | 2023-05-03 09:47 | 71K | |
![[ ]](/icons/unknown.gif) | Chap001-Auditing-and..> | 2023-05-03 10:40 | 142K | |
![[ ]](/icons/unknown.gif) | Chap001-Bank-Managem..> | 2023-05-03 09:58 | 85K | |
![[ ]](/icons/compressed.gif) | Chap001-Basic-Biomec..> | 2023-05-03 09:42 | 344K | |
![[ ]](/icons/unknown.gif) | Chap001-Business-Res..> | 2023-05-03 11:08 | 70K | |
![[ ]](/icons/unknown.gif) | Chap001-Business-and..> | 2023-05-03 10:16 | 62K | |
![[ ]](/icons/unknown.gif) | Chap001-Cost-Managem..> | 2023-05-03 09:51 | 347K | |
![[ ]](/icons/compressed.gif) | Chap001-Foundations-..> | 2023-05-04 02:29 | 16K | |
![[ ]](/icons/unknown.gif) | Chap001-Instructor-M..> | 2023-05-03 09:35 | 118K | |
![[ ]](/icons/unknown.gif) | Chap001-Intermediate..> | 2023-05-03 10:18 | 186K | |
![[ ]](/icons/unknown.gif) | Chap001-Internationa..> | 2023-05-03 11:12 | 84K | |
![[ ]](/icons/unknown.gif) | Chap001-Investments-..> | 2023-05-03 10:49 | 59K | |
![[ ]](/icons/unknown.gif) | Chap001-Managerial-A..> | 2023-05-03 10:34 | 313K | |
![[ ]](/icons/compressed.gif) | Chap001-Manual-of-St..> | 2023-05-03 09:40 | 4.8K | |
![[ ]](/icons/unknown.gif) | Chap001-Operations-M..> | 2023-05-03 10:56 | 81K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-Man..> | 2023-05-03 10:45 | 782K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-Man..> | 2023-05-03 09:29 | 132K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-Man..> | 2023-05-03 10:31 | 252K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-man..> | 2023-05-03 09:40 | 50K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-man..> | 2023-05-03 09:59 | 87K | |
![[ ]](/icons/unknown.gif) | Chap001-Solution-man..> | 2023-05-04 01:53 | 32K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-Fo..> | 2023-05-04 01:53 | 30K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-Fo..> | 2023-05-03 09:20 | 96K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-Fo..> | 2023-05-03 10:06 | 223K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-Fo..> | 2023-05-03 09:48 | 24K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-Fo..> | 2023-05-03 09:24 | 60K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-In..> | 2023-05-04 01:52 | 11K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 09:44 | 41K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 11:06 | 3.7K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 10:59 | 19K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 14:02 | 90K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 10:30 | 132K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 10:53 | 80K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 13:42 | 23K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 09:24 | 23K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 10:54 | 8.4K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 10:30 | 6.5K | |
![[ ]](/icons/compressed.gif) | Chap001-Test-Bank-fo..> | 2023-05-03 09:58 | 32K | |
![[ ]](/icons/unknown.gif) | Chap001-Test-bank-fo..> | 2023-05-03 10:22 | 79K | |
![[ ]](/icons/compressed.gif) | Chap001.zip | 2023-05-04 02:14 | 30K | |
![[ ]](/icons/unknown.gif) | Chap002-978007353066..> | 2023-05-03 10:21 | 46K | |
![[ ]](/icons/unknown.gif) | Chap002-Corporate-Fi..> | 2023-05-03 13:43 | 44K | |
![[ ]](/icons/unknown.gif) | Chap002-Test-Bank-fo..> | 2023-05-03 09:43 | 124K | |
![[ ]](/icons/unknown.gif) | Chap01-Solution-Manu..> | 2023-05-03 10:40 | 29K | |
![[ ]](/icons/layout.gif) | Chap1SBE12all9-13-12..> | 2023-05-03 09:23 | 126K | |
![[ ]](/icons/layout.gif) | Chap2-sols_US-4e.pdf | 2023-05-03 10:30 | 328K | |
![[ ]](/icons/layout.gif) | Chapra_SM02SCC.pdf | 2023-05-04 01:57 | 1.3M | |
![[ ]](/icons/unknown.gif) | Chapter-00148.doc | 2023-05-04 02:19 | 57K | |
![[ ]](/icons/unknown.gif) | Chapter-0016-3.doc | 2023-05-04 02:18 | 268K | |
![[ ]](/icons/unknown.gif) | Chapter-00167.doc | 2023-05-04 02:17 | 136K | |
![[ ]](/icons/unknown.gif) | Chapter-002-97800734..> | 2023-05-04 01:48 | 152K | |
![[ ]](/icons/compressed.gif) | Chapter-01-013292686..> | 2023-05-03 10:00 | 14K | |
![[ ]](/icons/unknown.gif) | Chapter-01-978013519..> | 2023-05-04 02:02 | 54K | |
![[ ]](/icons/layout.gif) | Chapter-01-978126088..> | 2023-05-04 01:59 | 1.2M | |
![[ ]](/icons/layout.gif) | Chapter-01-CM-Rev-1-..> | 2023-05-03 10:18 | 128K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Contempor..> | 2023-05-03 10:28 | 11K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Critical-..> | 2023-05-04 02:04 | 5.1K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Essay-Que..> | 2023-05-04 01:53 | 1.4K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Introduct..> | 2023-05-04 02:05 | 4.4K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Introduct..> | 2023-05-03 09:56 | 35K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Introduct..> | 2023-05-03 09:34 | 12K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Lifelong-..> | 2023-05-03 09:24 | 22K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Maternal-..> | 2023-05-03 09:26 | 2.9K | |
![[ ]](/icons/layout.gif) | Chapter-01-Preparati..> | 2023-05-04 02:02 | 81K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Principle..> | 2023-05-03 09:55 | 137K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Principle..> | 2023-05-03 09:42 | 137K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Principle..> | 2023-05-03 09:49 | 137K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Solution-..> | 2023-05-03 10:14 | 137K | |
![[ ]](/icons/layout.gif) | Chapter-01-Solution-..> | 2023-05-03 11:23 | 56K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Solution-..> | 2023-05-03 10:53 | 515K | |
![[ ]](/icons/layout.gif) | Chapter-01-Solution-..> | 2023-05-04 01:58 | 447K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Solution-..> | 2023-05-04 02:20 | 42K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Solution-..> | 2023-05-03 10:51 | 48K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Test-Bank..> | 2023-05-03 10:38 | 5.3K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-03 09:55 | 14K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Test-Bank..> | 2023-05-03 11:22 | 7.7K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Test-Bank..> | 2023-05-04 02:05 | 5.7K | |
![[ ]](/icons/compressed.gif) | Chapter-01-Test-Bank..> | 2023-05-03 09:29 | 9.9K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-04 02:21 | 165K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-03 13:41 | 53K | |
![[ ]](/icons/layout.gif) | Chapter-01-Test-Bank..> | 2023-05-04 01:48 | 176K | |
![[ ]](/icons/layout.gif) | Chapter-01-Test-Bank..> | 2023-05-03 10:12 | 110K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-04 02:28 | 80K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-03 11:05 | 79K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-03 09:18 | 33K | |
![[ ]](/icons/unknown.gif) | Chapter-01-Test-Bank..> | 2023-05-04 02:03 | 32K | |
![[ ]](/icons/layout.gif) | Chapter-01-What-Is-H..> | 2023-05-04 01:58 | 1.4M | |
![[ ]](/icons/unknown.gif) | Chapter-01-final-Tes..> | 2023-05-03 09:35 | 42K | |
![[ ]](/icons/unknown.gif) | Chapter-01.docx | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter-01_IM_8e-FIN..> | 2023-05-03 11:01 | 89K | |
![[ ]](/icons/unknown.gif) | Chapter-01_version1-..> | 2023-05-04 01:53 | 40K | |
![[ ]](/icons/compressed.gif) | Chapter-02-978013449..> | 2023-05-04 01:53 | 8.7K | |
![[ ]](/icons/compressed.gif) | Chapter-02-Altered-C..> | 2023-05-03 10:03 | 3.5K | |
![[ ]](/icons/compressed.gif) | Chapter-02-Explainin..> | 2023-05-03 11:11 | 29K | |
![[ ]](/icons/unknown.gif) | Chapter-02-Solution-..> | 2023-05-03 10:40 | 414K | |
![[ ]](/icons/compressed.gif) | Chapter-02-Test-Bank..> | 2023-05-04 01:55 | 13K | |
![[ ]](/icons/unknown.gif) | Chapter-02_Classicis..> | 2023-05-03 10:50 | 22K | |
![[ ]](/icons/layout.gif) | Chapter-03-US-final-..> | 2023-05-03 10:50 | 87K | |
![[ ]](/icons/compressed.gif) | Chapter-03.zip | 2023-05-03 09:51 | 9.0K | |
![[ ]](/icons/compressed.gif) | Chapter-04-Business-..> | 2023-05-03 09:27 | 892K | |
![[ ]](/icons/compressed.gif) | Chapter-05-Multiple-..> | 2023-05-03 10:05 | 43K | |
![[ ]](/icons/layout.gif) | Chapter-1-0136070760..> | 2023-05-04 01:48 | 1.3M | |
![[ ]](/icons/unknown.gif) | Chapter-1-2014-Princ..> | 2023-05-03 10:14 | 219K | |
![[ ]](/icons/layout.gif) | Chapter-1-9780134684..> | 2023-05-03 10:56 | 581K | |
![[ ]](/icons/compressed.gif) | Chapter-1-A-Guidance..> | 2023-05-04 01:49 | 3.5K | |
![[ ]](/icons/compressed.gif) | Chapter-1-A-History-..> | 2023-05-03 10:05 | 4.7K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Accounting..> | 2023-05-03 09:35 | 33K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Anthropolo..> | 2023-05-03 10:32 | 19K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Cell-Struc..> | 2023-05-03 10:21 | 16K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Cell-Struc..> | 2023-05-04 02:29 | 9.7K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Concepts-a..> | 2023-05-04 02:05 | 11K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Decision-M..> | 2023-05-04 01:52 | 5.8K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Entry-Into..> | 2023-05-03 10:26 | 4.6K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Exploring-..> | 2023-05-03 10:32 | 38K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Flynn-3e.doc | 2023-05-04 02:11 | 160K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Fundamenta..> | 2023-05-03 10:55 | 338K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Fundamenta..> | 2023-05-03 10:41 | 7.6K | |
![[ ]](/icons/unknown.gif) | Chapter-1-General-Pr..> | 2023-05-03 10:30 | 67K | |
![[ ]](/icons/unknown.gif) | Chapter-1-General-Pr..> | 2023-05-03 13:42 | 67K | |
![[ ]](/icons/unknown.gif) | Chapter-1-IM-2eR.doc | 2023-05-03 13:41 | 126K | |
![[ ]](/icons/unknown.gif) | Chapter-1-IM-Answers..> | 2023-05-03 10:34 | 20K | |
![[ ]](/icons/layout.gif) | Chapter-1-Intermedia..> | 2023-05-03 10:11 | 253K | |
![[ ]](/icons/layout.gif) | Chapter-1-Interview-..> | 2023-05-04 02:05 | 242K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Introducti..> | 2023-05-03 10:51 | 232K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Introducti..> | 2023-05-04 01:54 | 7.9K | |
![[ ]](/icons/layout.gif) | Chapter-1-Introducti..> | 2023-05-03 10:41 | 111K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Introducti..> | 2023-05-03 10:40 | 37K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Introducti..> | 2023-05-03 09:27 | 96K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Introducti..> | 2023-05-03 10:20 | 139K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Introducti..> | 2023-05-03 10:29 | 64K | |
![[ ]](/icons/layout.gif) | Chapter-1-Introducti..> | 2023-05-03 10:12 | 107K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Making-the..> | 2023-05-03 10:03 | 4.7K | |
![[ ]](/icons/unknown.gif) | Chapter-1-McGraw-Hil..> | 2023-05-03 10:22 | 223K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Perspectiv..> | 2023-05-03 10:31 | 4.3K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Principles..> | 2023-05-03 13:43 | 104K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Seeing-Old..> | 2023-05-03 10:41 | 20K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solution-M..> | 2023-05-03 10:23 | 60K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solution-M..> | 2023-05-04 01:59 | 30K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solution-M..> | 2023-05-03 09:29 | 35K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solution-M..> | 2023-05-04 01:52 | 77K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solutions-..> | 2023-05-03 09:28 | 152K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Solutions...> | 2023-05-03 09:54 | 44K | |
![[ ]](/icons/unknown.gif) | Chapter-1-TIF-Test-B..> | 2023-05-03 09:36 | 151K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-–-C..> | 2023-05-03 11:15 | 23K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-03 10:03 | 36K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-04 01:56 | 60K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-04 02:15 | 36K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-03 10:09 | 84K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-Bank-..> | 2023-05-04 02:24 | 17K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-Bank-..> | 2023-05-04 02:24 | 6.5K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-03 09:23 | 81K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-Bank-..> | 2023-05-03 13:42 | 3.7K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Test-Bank-..> | 2023-05-03 11:22 | 733K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-Bank-..> | 2023-05-04 01:54 | 4.1K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-bank-..> | 2023-05-04 02:06 | 3.9K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-bank-..> | 2023-05-04 02:07 | 7.7K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Test-bank-..> | 2023-05-04 02:06 | 3.8K | |
![[ ]](/icons/compressed.gif) | Chapter-1-The-Art-an..> | 2023-05-03 11:00 | 33K | |
![[ ]](/icons/unknown.gif) | Chapter-1-The-Journe..> | 2023-05-03 09:32 | 62K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Thorax.rtf | 2023-05-03 10:40 | 352K | |
![[ ]](/icons/compressed.gif) | Chapter-1-Thorax.zip | 2023-05-03 11:02 | 136K | |
![[ ]](/icons/unknown.gif) | Chapter-1-Trade-in-t..> | 2023-05-04 02:06 | 242K | |
![[ ]](/icons/unknown.gif) | Chapter-1-solutions-..> | 2023-05-04 01:48 | 32K | |
![[ ]](/icons/unknown.gif) | Chapter-1.doc | 2023-05-04 02:09 | 0 | |
![[ ]](/icons/layout.gif) | Chapter-1_Fund-of-Ma..> | 2023-05-03 09:55 | 209K | |
![[ ]](/icons/unknown.gif) | Chapter-1_version1-T..> | 2023-05-04 02:22 | 18K | |
![[ ]](/icons/layout.gif) | Chapter-2-9780134877..> | 2023-05-03 13:44 | 130K | |
![[ ]](/icons/unknown.gif) | Chapter-2-9781319195..> | 2023-05-04 02:26 | 89K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Addressing..> | 2023-05-03 13:41 | 3.2K | |
![[ ]](/icons/unknown.gif) | Chapter-2-Carbohydra..> | 2023-05-03 13:41 | 95K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Cost-Termi..> | 2023-05-03 10:41 | 34K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Critical-T..> | 2023-05-03 09:34 | 2.3K | |
![[ ]](/icons/compressed.gif) | Chapter-2-DTUI5-Disc..> | 2023-05-03 11:07 | 7.7K | |
![[ ]](/icons/unknown.gif) | Chapter-2-Evidence-B..> | 2023-05-03 13:41 | 36K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Fundamenta..> | 2023-05-04 02:04 | 4.6K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Health-Ass..> | 2023-05-03 10:41 | 3.7K | |
![[ ]](/icons/unknown.gif) | Chapter-2-Public-Hea..> | 2023-05-03 10:07 | 59K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Science-Sy..> | 2023-05-03 09:28 | 284K | |
![[ ]](/icons/compressed.gif) | Chapter-2-Software-I..> | 2023-05-03 10:11 | 3.0K | |
![[ ]](/icons/unknown.gif) | Chapter-2-The-Early-..> | 2023-05-03 09:30 | 124K | |
![[ ]](/icons/unknown.gif) | Chapter-2-The-Struct..> | 2023-05-03 10:28 | 226K | |
![[ ]](/icons/compressed.gif) | Chapter-2-m-files.zip | 2023-05-03 10:09 | 2.6K | |
![[ ]](/icons/unknown.gif) | Chapter-3-Key-Concep..> | 2023-05-03 10:15 | 34K | |
![[ ]](/icons/compressed.gif) | Chapter-3-Verbal-Com..> | 2023-05-03 10:29 | 3.5K | |
![[ ]](/icons/compressed.gif) | Chapter-4.zip | 2023-05-03 10:11 | 22K | |
![[ ]](/icons/compressed.gif) | Chapter-6.zip | 2023-05-03 09:35 | 2.5K | |
![[ ]](/icons/compressed.gif) | Chapter-9.zip | 2023-05-03 09:20 | 33K | |
![[ ]](/icons/compressed.gif) | Chapter-10-Home-Heal..> | 2023-05-03 10:47 | 4.4K | |
![[ ]](/icons/compressed.gif) | Chapter-23-Religious..> | 2023-05-03 10:34 | 10K | |
![[ ]](/icons/unknown.gif) | Chapter001-Microbiol..> | 2023-05-03 09:58 | 450K | |
![[ ]](/icons/unknown.gif) | Chapter001-Solution-..> | 2023-05-03 10:31 | 59K | |
![[ ]](/icons/layout.gif) | Chapter001-Solution-..> | 2023-05-03 10:19 | 85K | |
![[ ]](/icons/compressed.gif) | Chapter01-Solution-M..> | 2023-05-03 09:48 | 23K | |
![[ ]](/icons/compressed.gif) | Chapter01-Test-Bank-..> | 2023-05-03 10:09 | 13K | |
![[ ]](/icons/compressed.gif) | Chapter 01.zip | 2023-05-03 11:25 | 57K | |
![[ ]](/icons/compressed.gif) | Chapter 01 Essential..> | 2023-05-03 10:43 | 81K | |
![[ ]](/icons/compressed.gif) | Chapter 01 Solutions..> | 2023-05-03 10:38 | 483K | |
![[ ]](/icons/layout.gif) | Chapter01_sec-Soluti..> | 2023-05-04 02:06 | 396K | |
![[ ]](/icons/unknown.gif) | Chapter1-Fundamental..> | 2023-05-03 10:42 | 74K | |
![[ ]](/icons/unknown.gif) | Chapter1-Project-Tes..> | 2023-05-03 11:24 | 105K | |
![[ ]](/icons/unknown.gif) | Chapter1-Solution-Ma..> | 2023-05-03 09:05 | 121K | |
![[ ]](/icons/unknown.gif) | Chapter1-Test-Bank-F..> | 2023-05-03 10:42 | 38K | |
![[ ]](/icons/unknown.gif) | Chapter1-Test-Bank-F..> | 2023-05-03 10:00 | 40K | |
![[ ]](/icons/compressed.gif) | Chapter1-Test-Bank-f..> | 2023-05-03 09:28 | 186K | |
![[ ]](/icons/compressed.gif) | Chapter1-Test-Bank-f..> | 2023-05-03 11:11 | 18K | |
![[ ]](/icons/compressed.gif) | Chapter 1 Illustrati..> | 2023-05-03 10:31 | 45K | |
![[ ]](/icons/unknown.gif) | Chapter2-Solution-Ma..> | 2023-05-03 10:11 | 152K | |
![[ ]](/icons/unknown.gif) | Chapter6_6e.doc | 2023-05-03 09:36 | 42K | |
![[ ]](/icons/unknown.gif) | Chapter_00-978133756..> | 2023-05-04 02:07 | 64K | |
![[ ]](/icons/compressed.gif) | Chapter_001-97803233..> | 2023-05-03 13:41 | 8.0K | |
![[ ]](/icons/compressed.gif) | Chapter_001-97803234..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/compressed.gif) | Chapter_001-97814557..> | 2023-05-03 13:41 | 22K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Contempo..> | 2023-05-03 10:47 | 15K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Ethical-..> | 2023-05-03 09:52 | 31K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Foundati..> | 2023-05-03 09:39 | 8.5K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Nursing-..> | 2023-05-03 10:43 | 7.6K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Psychiat..> | 2023-05-03 10:34 | 95K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Public-H..> | 2023-05-03 10:03 | 227K | |
![[ ]](/icons/layout.gif) | Chapter_001-Solution..> | 2023-05-04 01:58 | 846K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:26 | 5.9K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:23 | 7.1K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:29 | 99K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:49 | 17K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:34 | 14K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:24 | 9.9K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 13:44 | 14K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:05 | 8.7K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:54 | 188K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:31 | 188K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-04 02:01 | 14K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:32 | 73K | |
![[ ]](/icons/layout.gif) | Chapter_001-Test-Ban..> | 2023-05-04 02:22 | 39K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:08 | 5.3K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 11:23 | 5.2K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 11:03 | 12K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:36 | 12K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:33 | 5.4K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 13:44 | 5.2K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-04 02:21 | 11K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 10:35 | 3.6K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:18 | 7.4K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:53 | 9.4K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:19 | 401K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:44 | 272K | |
![[ ]](/icons/compressed.gif) | Chapter_001-Test-Ban..> | 2023-05-03 09:32 | 4.8K | |
![[ ]](/icons/unknown.gif) | Chapter_001-Williams..> | 2023-05-03 09:28 | 213K | |
![[ ]](/icons/compressed.gif) | Chapter_001.zip | 2023-05-04 02:00 | 0 | |
![[ ]](/icons/layout.gif) | Chapter_002-Solution..> | 2023-05-03 11:12 | 2.1M | |
![[ ]](/icons/unknown.gif) | Chapter_002-Test-Ban..> | 2023-05-03 11:03 | 74K | |
![[ ]](/icons/compressed.gif) | Chapter_002-Test-Ban..> | 2023-05-03 10:33 | 404K | |
![[ ]](/icons/compressed.gif) | Chapter_002-Test-Ban..> | 2023-05-03 09:29 | 7.7K | |
![[ ]](/icons/compressed.gif) | Chapter_002-Test-Ban..> | 2023-05-03 09:41 | 7.6K | |
![[ ]](/icons/compressed.gif) | Chapter_002.zip | 2023-05-03 10:06 | 17K | |
![[ ]](/icons/compressed.gif) | Chapter_002_2.zip | 2023-05-03 09:31 | 25K | |
![[ ]](/icons/unknown.gif) | Chapter_005-Test-Ban..> | 2023-05-03 11:03 | 112K | |
![[ ]](/icons/unknown.gif) | Chapter_006-Test-Ban..> | 2023-05-03 10:23 | 52K | |
![[ ]](/icons/unknown.gif) | Chapter_01-978130526..> | 2023-05-03 11:09 | 31K | |
![[ ]](/icons/unknown.gif) | Chapter_01-978146418..> | 2023-05-03 13:41 | 39K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Canadian-..> | 2023-05-03 09:55 | 93K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Essential..> | 2023-05-03 10:47 | 97K | |
![[ ]](/icons/compressed.gif) | Chapter_01-Solution-..> | 2023-05-03 09:36 | 725K | |
![[ ]](/icons/layout.gif) | Chapter_01-Solution-..> | 2023-05-03 11:21 | 37K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-04 01:59 | 57K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-03 10:22 | 29K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-04 01:53 | 37K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-03 11:16 | 32K | |
![[ ]](/icons/compressed.gif) | Chapter_01-Test-Bank..> | 2023-05-03 10:53 | 8.6K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-03 13:41 | 73K | |
![[ ]](/icons/compressed.gif) | Chapter_01-Test-Bank..> | 2023-05-03 09:37 | 5.4K | |
![[ ]](/icons/compressed.gif) | Chapter_01-Test-Bank..> | 2023-05-03 09:27 | 7.1K | |
![[ ]](/icons/unknown.gif) | Chapter_01-Test-Bank..> | 2023-05-04 02:03 | 34K | |
![[ ]](/icons/compressed.gif) | Chapter_01-test-bank..> | 2023-05-03 10:26 | 8.8K | |
![[ ]](/icons/unknown.gif) | Chapter_01_-_The_Air..> | 2023-05-03 10:42 | 605K | |
![[ ]](/icons/unknown.gif) | Chapter_01_A_Perspec..> | 2023-05-03 09:53 | 27K | |
![[ ]](/icons/unknown.gif) | Chapter_01_An_Overvi..> | 2023-05-04 02:18 | 28K | |
![[ ]](/icons/unknown.gif) | Chapter_01_An_Overvi..> | 2023-05-04 02:16 | 31K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Business_..> | 2023-05-03 09:19 | 70K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Business_..> | 2023-05-04 02:19 | 67K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Criminal_..> | 2023-05-03 11:10 | 37K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Early_Hum..> | 2023-05-03 10:35 | 43K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Ethics_an..> | 2023-05-03 13:42 | 17K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Food_and_..> | 2023-05-03 09:29 | 36K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Freedom_O..> | 2023-05-03 13:41 | 38K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduci..> | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduci..> | 2023-05-03 13:44 | 60K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduci..> | 2023-05-03 10:44 | 417K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-04 02:16 | 22K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-03 13:43 | 35K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-04 02:25 | 28K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-04 02:08 | 20K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Introduct..> | 2023-05-03 10:58 | 31K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Law_and_L..> | 2023-05-04 02:22 | 31K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Litigatio..> | 2023-05-03 13:43 | 44K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Litigatio..> | 2023-05-03 11:15 | 15K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Measureme..> | 2023-05-03 10:42 | 214K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Police_Hi..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_01_Strategic..> | 2023-05-04 02:03 | 47K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Strategic..> | 2023-05-04 02:08 | 58K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Texas_Pol..> | 2023-05-04 02:29 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_Engli..> | 2023-05-03 10:51 | 15K | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_Entre..> | 2023-05-03 13:44 | 44K | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_Inves..> | 2023-05-04 01:52 | 35K | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_Peopl..> | 2023-05-03 11:02 | 64K | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_Role_..> | 2023-05-04 02:10 | 29K | |
![[ ]](/icons/unknown.gif) | Chapter_01_The_World..> | 2023-05-03 11:21 | 95K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Understan..> | 2023-05-04 02:24 | 48K | |
![[ ]](/icons/unknown.gif) | Chapter_01_What_Is_P..> | 2023-05-03 13:40 | 74K | |
![[ ]](/icons/unknown.gif) | Chapter_01_What_is_C..> | 2023-05-03 13:44 | 44K | |
![[ ]](/icons/unknown.gif) | Chapter_01_What_is_E..> | 2023-05-04 02:05 | 101K | |
![[ ]](/icons/unknown.gif) | Chapter_01_What_is_S..> | 2023-05-04 02:01 | 22K | |
![[ ]](/icons/unknown.gif) | Chapter_01_When_Old_..> | 2023-05-03 09:27 | 51K | |
![[ ]](/icons/unknown.gif) | Chapter_01_Whole_Num..> | 2023-05-03 09:35 | 45K | |
![[ ]](/icons/unknown.gif) | Chapter_01__Introduc..> | 2023-05-04 01:50 | 23K | |
![[ ]](/icons/layout.gif) | Chapter_01__Making_a..> | 2023-05-04 02:25 | 77K | |
![[ ]](/icons/layout.gif) | Chapter_01__Making_a..> | 2023-05-03 10:47 | 77K | |
![[ ]](/icons/layout.gif) | Chapter_01__Understa..> | 2023-05-04 02:05 | 324K | |
![[ ]](/icons/layout.gif) | Chapter_01___An_Over..> | 2023-05-04 01:56 | 103K | |
![[ ]](/icons/unknown.gif) | Chapter_01___Chemist..> | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_01___Data_an..> | 2023-05-04 02:20 | 77K | |
![[ ]](/icons/unknown.gif) | Chapter_01___Introdu..> | 2023-05-04 02:09 | 0 | |
![[ ]](/icons/compressed.gif) | Chapter_010-Test-Ban..> | 2023-05-03 11:20 | 7.9K | |
![[ ]](/icons/unknown.gif) | Chapter_02-978130595..> | 2023-05-03 13:43 | 136K | |
![[ ]](/icons/compressed.gif) | Chapter_02-_Neurobio..> | 2023-05-03 10:44 | 5.6K | |
![[ ]](/icons/compressed.gif) | Chapter_02_Energy_Wa..> | 2023-05-03 10:31 | 49K | |
![[ ]](/icons/compressed.gif) | Chapter_02_Life_Chem..> | 2023-05-03 09:21 | 242K | |
![[ ]](/icons/unknown.gif) | Chapter_02_Polar_Cov..> | 2023-05-04 01:48 | 273K | |
![[ ]](/icons/compressed.gif) | Chapter_02_Practical..> | 2023-05-03 10:45 | 45K | |
![[ ]](/icons/layout.gif) | Chapter_02_The_Hebre..> | 2023-05-03 09:54 | 122K | |
![[ ]](/icons/unknown.gif) | Chapter_02_The_Plant..> | 2023-05-04 02:29 | 114K | |
![[ ]](/icons/compressed.gif) | Chapter_02_The_Plant..> | 2023-05-03 10:15 | 106K | |
![[ ]](/icons/compressed.gif) | Chapter_02__An_Integ..> | 2023-05-03 09:59 | 96K | |
![[ ]](/icons/unknown.gif) | Chapter_02__Stakehol..> | 2023-05-03 11:02 | 53K | |
![[ ]](/icons/layout.gif) | Chapter_02__Working_..> | 2023-05-04 02:04 | 339K | |
![[ ]](/icons/unknown.gif) | Chapter_02___Alkanes..> | 2023-05-04 01:50 | 392K | |
![[ ]](/icons/unknown.gif) | Chapter_02___Atoms_a..> | 2023-05-04 01:59 | 0 | |
![[ ]](/icons/compressed.gif) | Chapter_027.zip | 2023-05-03 09:46 | 17K | |
![[ ]](/icons/unknown.gif) | Chapter_03_Measureme..> | 2023-05-03 10:04 | 115K | |
![[ ]](/icons/compressed.gif) | Chapter_061.zip | 2023-05-03 09:45 | 18K | |
![[ ]](/icons/compressed.gif) | Chapter_1-Solution-m..> | 2023-05-03 13:41 | 14K | |
![[ ]](/icons/unknown.gif) | Chapter_1_7e_Solutio..> | 2023-05-03 09:56 | 41K | |
![[ ]](/icons/compressed.gif) | Chapter_1_7e_Solutio..> | 2023-05-04 01:53 | 23K | |
![[ ]](/icons/unknown.gif) | Chapter_1_An_Introdu..> | 2023-05-03 11:18 | 69K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Assessment..> | 2023-05-04 02:03 | 20K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Crime_Crim..> | 2023-05-04 02:22 | 39K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Crime_and_..> | 2023-05-03 09:41 | 47K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Data_and_S..> | 2023-05-03 11:27 | 51K | |
![[ ]](/icons/layout.gif) | Chapter_1_Discoverin..> | 2023-05-03 09:37 | 82K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Discussion..> | 2023-05-04 02:19 | 61K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Ethics_and..> | 2023-05-03 10:47 | 16K | |
![[ ]](/icons/unknown.gif) | Chapter_1_First_Look..> | 2023-05-03 13:43 | 23K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Health_Car..> | 2023-05-04 01:57 | 34K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Historical..> | 2023-05-03 10:15 | 33K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Introducti..> | 2023-05-04 02:25 | 114K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Introducti..> | 2023-05-03 09:35 | 40K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Introducti..> | 2023-05-03 09:58 | 57K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Introducti..> | 2023-05-03 13:41 | 48K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Morality_E..> | 2023-05-03 10:18 | 34K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Nature_Hum..> | 2023-05-04 02:09 | 38K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Physics_an..> | 2023-05-03 10:59 | 62K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Police_His..> | 2023-05-04 02:13 | 36K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Strategic_..> | 2023-05-04 01:55 | 41K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_Ancien..> | 2023-05-03 10:03 | 46K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_Crimin..> | 2023-05-03 11:09 | 53K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_Nature..> | 2023-05-03 09:30 | 20K | |
![[ ]](/icons/compressed.gif) | Chapter_1_The_Sociol..> | 2023-05-03 09:28 | 15K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_Study_..> | 2023-05-04 02:10 | 84K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_Study_..> | 2023-05-03 10:44 | 51K | |
![[ ]](/icons/unknown.gif) | Chapter_1_The_World_..> | 2023-05-04 01:55 | 43K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Thinking_L..> | 2023-05-03 09:45 | 30K | |
![[ ]](/icons/unknown.gif) | Chapter_1_Understand..> | 2023-05-03 09:44 | 16K | |
![[ ]](/icons/layout.gif) | Chapter_1__An_Introd..> | 2023-05-03 10:13 | 49K | |
![[ ]](/icons/compressed.gif) | Chapter_2_Culture.zip | 2023-05-03 09:59 | 116K | |
![[ ]](/icons/compressed.gif) | Chapter_2_Culture_Re..> | 2023-05-03 13:43 | 18K | |
![[ ]](/icons/unknown.gif) | Chapter_2_Introducti..> | 2023-05-03 10:01 | 62K | |
![[ ]](/icons/compressed.gif) | Chapter_2_Observing_..> | 2023-05-03 10:47 | 21K | |
![[ ]](/icons/compressed.gif) | Chapter_2_The_First_..> | 2023-05-03 10:39 | 38K | |
![[ ]](/icons/compressed.gif) | Chapter_2_The_Unit_S..> | 2023-05-03 09:23 | 25K | |
![[ ]](/icons/layout.gif) | Chapter_2__14_The_Co..> | 2023-05-03 10:50 | 84K | |
![[ ]](/icons/compressed.gif) | Chapter_2__Theory_an..> | 2023-05-03 10:37 | 31K | |
![[ ]](/icons/layout.gif) | Chapter_11-Test-Bank..> | 2023-05-04 02:04 | 203K | |
![[ ]](/icons/unknown.gif) | Chapter_15_Maritime_..> | 2023-05-04 02:26 | 0 | |
![[ ]](/icons/layout.gif) | Chapter_15__Reconstr..> | 2023-05-04 02:02 | 0 | |
![[ ]](/icons/unknown.gif) | Chapter_16_The_Rise_..> | 2023-05-03 10:36 | 85K | |
![[ ]](/icons/compressed.gif) | Chapter_22_The_Ordea..> | 2023-05-03 10:01 | 101K | |
![[ ]](/icons/unknown.gif) | Cheeseman_LEB-IM_Ch0..> | 2023-05-03 10:00 | 81K | |
![[ ]](/icons/layout.gif) | Cheeseman_leb9_ch01.pdf | 2023-05-03 13:42 | 109K | |
![[ ]](/icons/layout.gif) | Chem-Principles-6e-I..> | 2023-05-03 13:41 | 191K | |
![[ ]](/icons/unknown.gif) | Chem_3_ISM_Ch_02.doc | 2023-05-03 09:22 | 417K | |
![[ ]](/icons/unknown.gif) | Chemical-1_version1...> | 2023-05-04 02:23 | 130K | |
![[IMG]](/icons/image2.gif) | Chemistry-8e-Zumdahl..> | 2023-08-09 05:08 | 2.8K | |
![[IMG]](/icons/image2.gif) | Chemistry-8e-Zumdahl..> | 2023-08-06 07:49 | 13K | |
![[IMG]](/icons/image2.gif) | Chemistry-8e-Zumdahl..> | 2023-05-03 10:34 | 34K | |
![[IMG]](/icons/image2.gif) | Chemistry-9e-Zumdahl..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | Chemistry-9e-Zumdahl..> | 2023-08-23 22:04 | 23K | |
![[IMG]](/icons/image2.gif) | Chemistry-9e-Zumdahl..> | 2023-05-03 10:11 | 66K | |
![[ ]](/icons/layout.gif) | Chemistry-10th-Editi..> | 2023-05-03 11:18 | 130K | |
![[ ]](/icons/compressed.gif) | Chemistry-Principles..> | 2023-05-03 10:00 | 97K | |
![[IMG]](/icons/image2.gif) | Chemistry_An_Introdu..> | 2023-08-06 04:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | Chemistry_An_Introdu..> | 2023-08-06 13:11 | 18K | |
![[IMG]](/icons/image2.gif) | Chemistry_An_Introdu..> | 2023-05-03 09:50 | 42K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Centra..> | 2023-08-06 12:56 | 4.0K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Centra..> | 2023-08-08 22:06 | 23K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Centra..> | 2023-05-03 10:17 | 52K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-08-05 01:27 | 3.4K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-08-12 04:50 | 19K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-05-03 10:23 | 43K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-08-05 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | Chemistry_The_Molecu..> | 2023-05-03 10:26 | 43K | |
![[ ]](/icons/unknown.gif) | Child-Development-An..> | 2023-05-03 09:50 | 101K | |
![[IMG]](/icons/image2.gif) | Child_Development_An..> | 2023-08-05 01:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | Child_Development_An..> | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | Child_Development_An..> | 2023-05-03 10:43 | 41K | |
![[IMG]](/icons/image2.gif) | Children-and-Their-D..> | 2023-08-05 16:16 | 4.9K | |
![[IMG]](/icons/image2.gif) | Children-and-Their-D..> | 2023-08-07 18:53 | 29K | |
![[IMG]](/icons/image2.gif) | Children-and-Their-D..> | 2023-05-03 09:38 | 140K | |
![[IMG]](/icons/image2.gif) | Children_and_Their_D..> | 2023-08-08 22:01 | 3.7K | |
![[IMG]](/icons/image2.gif) | Children_and_Their_D..> | 2023-08-08 07:33 | 22K | |
![[IMG]](/icons/image2.gif) | Children_and_Their_D..> | 2023-05-03 10:04 | 241K | |
![[ ]](/icons/compressed.gif) | Ciccarelli--Psycholo..> | 2023-05-03 09:44 | 66K | |
![[ ]](/icons/unknown.gif) | Clark-12e-TBA-Ch01.doc | 2023-05-03 10:35 | 55K | |
![[ ]](/icons/layout.gif) | Clements-1e-Chapter-..> | 2023-05-03 10:03 | 243K | |
![[IMG]](/icons/image2.gif) | Clinical-Procedures-..> | 2023-08-05 14:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | Clinical-Procedures-..> | 2023-08-09 06:04 | 17K | |
![[IMG]](/icons/image2.gif) | Clinical-Procedures-..> | 2023-05-03 10:34 | 40K | |
![[IMG]](/icons/image2.gif) | Cognitive_Psychology..> | 2023-08-05 14:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | Cognitive_Psychology..> | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | Cognitive_Psychology..> | 2023-05-03 11:04 | 50K | |
![[ ]](/icons/unknown.gif) | Colander11e_Chapter_..> | 2023-05-04 02:28 | 48K | |
![[IMG]](/icons/image2.gif) | College-Physics-7e-W..> | 2023-08-05 15:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | College-Physics-7e-W..> | 2023-08-16 10:25 | 17K | |
![[IMG]](/icons/image2.gif) | College-Physics-7e-W..> | 2023-05-03 10:56 | 101K | |
![[ ]](/icons/compressed.gif) | Comparative-Criminal..> | 2023-05-03 09:39 | 9.2K | |
![[ ]](/icons/compressed.gif) | Compensation-11e-Mil..> | 2023-05-03 10:43 | 19K | |
![[ ]](/icons/compressed.gif) | Computer-Forensics-a..> | 2023-05-03 09:47 | 157K | |
![[ ]](/icons/layout.gif) | Computer-Graphics-4e..> | 2023-05-03 09:30 | 158K | |
![[ ]](/icons/unknown.gif) | ComputerSecurityFund..> | 2023-05-03 11:15 | 47K | |
![[IMG]](/icons/image2.gif) | Concepts_for_Nursing..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | Concepts_for_Nursing..> | 2023-08-17 04:49 | 17K | |
![[IMG]](/icons/image2.gif) | Concepts_for_Nursing..> | 2023-05-04 02:04 | 54K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-08-06 13:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-08-08 06:44 | 27K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-05-03 11:16 | 57K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-08-05 14:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-08-06 16:32 | 27K | |
![[IMG]](/icons/image2.gif) | Concepts_in_Strategi..> | 2023-05-03 09:53 | 57K | |
![[IMG]](/icons/image2.gif) | Conceptual-Foundatio..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | Conceptual-Foundatio..> | 2023-08-08 06:44 | 17K | |
![[IMG]](/icons/image2.gif) | Conceptual-Foundatio..> | 2023-05-03 09:51 | 39K | |
![[IMG]](/icons/image2.gif) | Conceptual_Physics_1..> | 2023-08-06 03:28 | 4.3K | |
![[IMG]](/icons/image2.gif) | Conceptual_Physics_1..> | 2023-08-06 15:35 | 25K | |
![[IMG]](/icons/image2.gif) | Conceptual_Physics_1..> | 2023-05-03 10:16 | 62K | |
![[IMG]](/icons/image2.gif) | Connect-McGraw-Hill-..> | 2023-05-03 10:32 | 9.6K | |
![[IMG]](/icons/image2.gif) | Connect-for-Allan-Me..> | 2023-05-03 10:29 | 18K | |
![[IMG]](/icons/image2.gif) | Connect-for-Feldman-..> | 2023-05-03 10:31 | 16K | |
![[IMG]](/icons/image2.gif) | Connect-for-Hoyle-Fu..> | 2023-05-03 10:31 | 14K | |
![[IMG]](/icons/image2.gif) | Connect-for-Jones-Ac..> | 2023-05-03 10:30 | 13K | |
![[IMG]](/icons/image2.gif) | Connect-for-Judson-L..> | 2023-05-03 10:24 | 16K | |
![[IMG]](/icons/image2.gif) | Connect-for-Schultz-..> | 2023-05-03 10:33 | 18K | |
![[IMG]](/icons/image2.gif) | Connect-for-Whitting..> | 2023-05-03 10:29 | 13K | |
![[IMG]](/icons/image2.gif) | Connect20for20Whitti..> | 2023-05-03 10:54 | 13K | |
![[IMG]](/icons/image2.gif) | Connect20for20Whitti..> | 2023-05-03 10:14 | 13K | |
![[ ]](/icons/compressed.gif) | Constitutional-Law-a..> | 2023-05-03 09:23 | 16K | |
![[IMG]](/icons/image2.gif) | Contemporary-Auditin..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | Contemporary-Auditin..> | 2023-08-15 01:39 | 20K | |
![[IMG]](/icons/image2.gif) | Contemporary-Auditin..> | 2023-05-04 02:20 | 48K | |
![[IMG]](/icons/image2.gif) | Contemporary-Financi..> | 2023-08-08 21:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | Contemporary-Financi..> | 2023-08-15 01:39 | 12K | |
![[IMG]](/icons/image2.gif) | Contemporary-Financi..> | 2023-05-03 09:27 | 28K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-08-06 13:12 | 2.0K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-08-16 00:25 | 9.3K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-05-03 09:39 | 22K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-08-05 06:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-08-16 00:25 | 14K | |
![[IMG]](/icons/image2.gif) | Contemporary-Marketi..> | 2023-05-03 10:34 | 34K | |
![[IMG]](/icons/image2.gif) | Contemporary_Financi..> | 2023-08-06 04:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | Contemporary_Financi..> | 2023-08-08 08:38 | 26K | |
![[IMG]](/icons/image2.gif) | Contemporary_Financi..> | 2023-05-03 10:28 | 54K | |
![[IMG]](/icons/image2.gif) | Contemporary_Financi..> | 2023-05-03 10:15 | 25K | |
![[ ]](/icons/unknown.gif) | Contents03-Solution-..> | 2023-05-03 09:31 | 40K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-08-06 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-05-03 09:57 | 42K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-08-08 06:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-08-06 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | Core_Concepts_of_Acc..> | 2023-05-03 09:56 | 42K | |
![[ ]](/icons/unknown.gif) | Corey_Chapter-1.doc | 2023-05-03 10:34 | 53K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Cost..> | 2023-08-05 05:15 | 2.9K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Cost..> | 2023-05-03 09:46 | 17K | |
![[ ]](/icons/layout.gif) | Cornerstones-of-Cost..> | 2023-05-03 11:12 | 2.1M | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Fina..> | 2023-08-08 06:27 | 2.5K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Fina..> | 2023-08-15 01:39 | 13K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Fina..> | 2023-05-03 10:14 | 37K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Mana..> | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Mana..> | 2023-05-03 11:20 | 5.6K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Mana..> | 2023-08-08 06:42 | 2.5K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Mana..> | 2023-08-12 04:39 | 13K | |
![[IMG]](/icons/image2.gif) | Cornerstones-of-Mana..> | 2023-05-04 02:14 | 37K | |
![[ ]](/icons/layout.gif) | Cornerstones_3E_FA_C..> | 2023-05-03 09:46 | 253K | |
![[IMG]](/icons/image2.gif) | Cornerstones_of_Cost..> | 2023-08-06 11:16 | 3.0K | |
![[IMG]](/icons/image2.gif) | Cornerstones_of_Cost..> | 2023-08-06 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | Cornerstones_of_Cost..> | 2023-05-03 10:51 | 37K | |
![[IMG]](/icons/image2.gif) | Corporate-Finance-3e..> | 2023-08-05 17:23 | 3.6K | |
![[IMG]](/icons/image2.gif) | Corporate-Finance-3e..> | 2023-08-14 00:56 | 20K | |
![[IMG]](/icons/image2.gif) | Corporate-Finance-3e..> | 2023-05-03 09:57 | 49K | |
![[IMG]](/icons/image2.gif) | Corporate-Partnershi..> | 2023-08-06 08:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | Corporate-Partnershi..> | 2023-08-14 19:05 | 18K | |
![[IMG]](/icons/image2.gif) | Corporate-Partnershi..> | 2023-05-03 10:08 | 43K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-08-06 02:41 | 2.3K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-08-05 01:52 | 12K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-05-03 10:18 | 21K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-08-06 11:18 | 2.3K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-08-05 01:52 | 12K | |
![[IMG]](/icons/image2.gif) | Corporate_Finance_be..> | 2023-05-03 10:35 | 21K | |
![[IMG]](/icons/image2.gif) | Cost-Accounting-14e-..> | 2023-08-05 04:34 | 4.6K | |
![[IMG]](/icons/image2.gif) | Cost-Accounting-14e-..> | 2023-05-03 10:40 | 42K | |
![[IMG]](/icons/image2.gif) | Cost-Accounting-14e-..> | 2023-08-06 08:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | Cost-Accounting-14e-..> | 2023-08-14 00:56 | 22K | |
![[IMG]](/icons/image2.gif) | Cost-Accounting-14e-..> | 2023-05-04 01:59 | 117K | |
![[ ]](/icons/unknown.gif) | Cost-Accounting-A-Ma..> | 2023-05-03 09:53 | 204K | |
![[IMG]](/icons/image2.gif) | Cost-Management-2e-E..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | Cost-Management-2e-E..> | 2023-08-12 03:36 | 15K | |
![[IMG]](/icons/image2.gif) | Cost-Management-2e-E..> | 2023-05-03 09:59 | 37K | |
![[ ]](/icons/compressed.gif) | Cost15EChapter02_Sol..> | 2023-05-03 09:43 | 201K | |
![[IMG]](/icons/image2.gif) | Cowan3_lg-100x100.jpg | 2023-08-05 01:52 | 4.7K | |
![[IMG]](/icons/image2.gif) | Cowan3_lg-300x300.jpg | 2023-08-06 17:25 | 28K | |
![[IMG]](/icons/image2.gif) | Cowan3_lg.jpg | 2023-05-04 01:48 | 66K | |
![[ ]](/icons/unknown.gif) | Cowan_Micro_Fundamen..> | 2023-05-04 02:01 | 38K | |
![[ ]](/icons/unknown.gif) | Cox-TB-Ch-2-Formatte..> | 2023-05-03 10:37 | 51K | |
![[ ]](/icons/compressed.gif) | Cox-TB-Ch-2-Formatte..> | 2023-05-03 09:42 | 11K | |
![[IMG]](/icons/image2.gif) | Creating_Literacy_In..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | Creating_Literacy_In..> | 2023-08-06 17:26 | 20K | |
![[IMG]](/icons/image2.gif) | Creating_Literacy_In..> | 2023-05-03 09:29 | 51K | |
![[ ]](/icons/unknown.gif) | Creswellrd5e_TB01.docx | 2023-05-04 02:02 | 24K | |
![[ ]](/icons/compressed.gif) | Crime-Control-in-Ame..> | 2023-05-03 11:20 | 14K | |
![[ ]](/icons/unknown.gif) | Criminal-1_version1-..> | 2023-05-04 02:11 | 20K | |
![[ ]](/icons/unknown.gif) | Criminal-Evidence-11..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/compressed.gif) | Criminological-Theor..> | 2023-05-03 10:29 | 8.1K | |
![[IMG]](/icons/image2.gif) | Criminology-Today-An..> | 2023-08-05 07:10 | 2.9K | |
![[IMG]](/icons/image2.gif) | Criminology-Today-An..> | 2023-08-05 03:41 | 14K | |
![[IMG]](/icons/image2.gif) | Criminology-Today-An..> | 2023-05-03 11:21 | 62K | |
![[IMG]](/icons/image2.gif) | Critical_Care_Nursin..> | 2023-05-04 02:04 | 17K | |
![[IMG]](/icons/image2.gif) | Crittenden-MWHs-Wate..> | 2023-08-09 11:06 | 3.5K | |
![[IMG]](/icons/image2.gif) | Crittenden-MWHs-Wate..> | 2023-05-04 02:18 | 16K | |
![[ ]](/icons/unknown.gif) | Cross-9e-TBB-Ch01.docx | 2023-05-03 10:56 | 50K | |
![[ ]](/icons/unknown.gif) | Crossan_9e_tif_ch01.doc | 2023-05-04 02:02 | 290K | |
![[ ]](/icons/unknown.gif) | Croteau4e_Chapter01_..> | 2023-05-04 02:09 | 25K | |
![[ ]](/icons/unknown.gif) | CulturalPsychology2e..> | 2023-05-03 10:12 | 130K | |
![[ ]](/icons/unknown.gif) | Cummings_HH_11e_ch01..> | 2023-05-04 01:52 | 67K | |
![[IMG]](/icons/image2.gif) | Cunningham6e_lg1-100..> | 2023-08-08 07:29 | 3.4K | |
![[IMG]](/icons/image2.gif) | Cunningham6e_lg1-300..> | 2023-08-13 15:24 | 20K | |
![[IMG]](/icons/image2.gif) | Cunningham6e_lg1.jpg | 2023-05-03 10:11 | 52K | |
![[ ]](/icons/unknown.gif) | CurryCensusTBch1.doc | 2023-05-04 02:11 | 163K | |
![[ ]](/icons/unknown.gif) | DC2017_Ch01_IM.docx | 2023-05-03 13:40 | 67K | |
![[ ]](/icons/compressed.gif) | DIAG-POST-STUDY-DIAG..> | 2023-05-03 13:41 | 6.0K | |
![[ ]](/icons/unknown.gif) | DONE_Wilson_14e_IM_c..> | 2023-05-03 10:38 | 140K | |
![[ ]](/icons/unknown.gif) | DQChapter1_3E.docx | 2023-05-03 09:47 | 49K | |
![[ ]](/icons/unknown.gif) | Daft-UM11e_CH-01_IRM..> | 2023-05-03 10:57 | 90K | |
![[ ]](/icons/unknown.gif) | Daniels_ib15_im_01.doc | 2023-05-03 09:50 | 96K | |
![[ ]](/icons/unknown.gif) | Daniels_ib15_tif_01.doc | 2023-05-03 10:19 | 94K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-08-06 09:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-08-05 14:40 | 19K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-05-03 10:03 | 145K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-08-05 16:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-08-08 07:33 | 19K | |
![[IMG]](/icons/image2.gif) | Database-Systems-Des..> | 2023-05-03 09:21 | 145K | |
![[ ]](/icons/unknown.gif) | David_13e_im_part1.doc | 2023-05-03 10:32 | 57K | |
![[ ]](/icons/unknown.gif) | David_sm15_im_01.docx | 2023-05-03 08:57 | 49K | |
![[IMG]](/icons/image2.gif) | Davidson-10th-Olds-M..> | 2023-08-05 17:20 | 3.2K | |
![[IMG]](/icons/image2.gif) | Davidson-10th-Olds-M..> | 2023-08-09 18:53 | 19K | |
![[IMG]](/icons/image2.gif) | Davidson-10th-Olds-M..> | 2023-05-03 10:11 | 51K | |
![[ ]](/icons/compressed.gif) | Davidson-2015-10th-0..> | 2023-05-03 10:11 | 17K | |
![[ ]](/icons/unknown.gif) | DeVito_EHC10e_TB_CH0..> | 2023-05-03 13:42 | 34K | |
![[ ]](/icons/compressed.gif) | DeVito_TICB_Ch01_TB.zip | 2023-05-03 10:11 | 45K | |
![[ ]](/icons/unknown.gif) | Democracy-1_version1..> | 2023-05-04 02:28 | 26K | |
![[ ]](/icons/unknown.gif) | Denhardt_5e_TB_Ch01...> | 2023-05-04 02:03 | 33K | |
![[IMG]](/icons/image2.gif) | Dental-Radiography-H..> | 2023-08-06 07:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | Dental-Radiography-H..> | 2023-08-09 20:29 | 18K | |
![[IMG]](/icons/image2.gif) | Dental-Radiography-H..> | 2023-05-03 09:36 | 44K | |
![[IMG]](/icons/image2.gif) | Deresky-Internationa..> | 2023-08-05 03:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | Deresky-Internationa..> | 2023-08-19 00:17 | 18K | |
![[IMG]](/icons/image2.gif) | Deresky-Internationa..> | 2023-05-03 10:05 | 71K | |
![[ ]](/icons/unknown.gif) | Development-1_versio..> | 2023-05-04 01:57 | 23K | |
![[IMG]](/icons/image2.gif) | Development_Through_..> | 2023-08-06 09:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | Development_Through_..> | 2023-08-08 23:01 | 24K | |
![[IMG]](/icons/image2.gif) | Development_Through_..> | 2023-05-03 10:10 | 50K | |
![[IMG]](/icons/image2.gif) | Developmental-Psycho..> | 2023-08-06 07:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | Developmental-Psycho..> | 2023-08-09 20:29 | 16K | |
![[IMG]](/icons/image2.gif) | Developmental-Psycho..> | 2023-05-03 10:34 | 41K | |
![[IMG]](/icons/image2.gif) | Digital-Signal-Proce..> | 2023-08-08 07:32 | 2.6K | |
![[IMG]](/icons/image2.gif) | Digital-Signal-Proce..> | 2023-08-05 14:40 | 18K | |
![[IMG]](/icons/image2.gif) | Digital-Signal-Proce..> | 2023-05-04 02:20 | 21K | |
![[ ]](/icons/unknown.gif) | Doane_chap001_ASBE_7..> | 2023-05-04 02:29 | 38K | |
![[ ]](/icons/unknown.gif) | Doupnik_5e_Chap001_I..> | 2023-05-04 02:18 | 40K | |
![[ ]](/icons/layout.gif) | Download-Nursing-for..> | 2023-05-03 09:35 | 127K | |
![[ ]](/icons/layout.gif) | Download-Psychiatric..> | 2023-05-03 10:03 | 327K | |
![[ ]](/icons/layout.gif) | Download-Test-Bank-f..> | 2023-05-03 09:32 | 717K | |
![[ ]](/icons/layout.gif) | Download-Test-Bank-f..> | 2023-05-03 09:22 | 896K | |
![[IMG]](/icons/image2.gif) | Downloadable-Solutio..> | 2023-08-05 03:40 | 4.8K | |
![[IMG]](/icons/image2.gif) | Downloadable-Solutio..> | 2023-08-23 22:04 | 25K | |
![[IMG]](/icons/image2.gif) | Downloadable-Solutio..> | 2023-05-03 09:41 | 33K | |
![[ ]](/icons/compressed.gif) | Downloadable-Solutio..> | 2023-05-03 09:41 | 336 | |
![[ ]](/icons/unknown.gif) | Downloadable-Solutio..> | 2023-05-03 09:59 | 218K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 01:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-08 16:42 | 14K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:40 | 18K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:40 | 650K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 07:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-07 18:53 | 20K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:41 | 26K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 02:46 | 4.1K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-07 18:53 | 24K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:39 | 31K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:39 | 46K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-08 06:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 15:35 | 15K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:40 | 19K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 06:15 | 4.2K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-25 19:44 | 28K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:39 | 33K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 16:26 | 4.1K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-15 06:50 | 20K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:38 | 18K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:38 | 24K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 19:00 | 4.4K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-15 06:50 | 18K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:38 | 25K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:38 | 34K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 03:55 | 4.9K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-15 06:50 | 23K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:39 | 28K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 03:26 | 4.4K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-15 06:50 | 22K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:37 | 30K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 05:47 | 4.8K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-19 11:51 | 22K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:38 | 26K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-19 11:51 | 12K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-04 02:28 | 17K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 01:08 | 5.7K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 37K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:37 | 61K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-08 07:18 | 4.7K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 23K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:29 | 28K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 22K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:36 | 30K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 08:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 15K | |
![[ ]](/icons/layout.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:41 | 377K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:41 | 17K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 14:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 19K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:05 | 24K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-06 07:48 | 4.0K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:05 | 12K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 16:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 19K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:44 | 24K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 16:22 | 5.5K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 32K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-04 02:14 | 48K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-04 02:14 | 69K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:44 | 132K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 13:44 | 14K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 14:35 | 4.6K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 24K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:35 | 27K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 01:12 | 4.3K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:12 | 19K | |
![[ ]](/icons/compressed.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:53 | 7.0M | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:53 | 28K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-08 22:01 | 3.2K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:54 | 13K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 09:34 | 16K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-05 03:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-08-09 09:54 | 21K | |
![[IMG]](/icons/image2.gif) | Downloadable-Test-Ba..> | 2023-05-03 10:30 | 25K | |
![[ ]](/icons/unknown.gif) | Dozois_5e_Chapter01_..> | 2023-05-03 09:52 | 175K | |
![[IMG]](/icons/image2.gif) | Duncan-Transitioning..> | 2023-08-08 07:32 | 3.5K | |
![[IMG]](/icons/image2.gif) | Duncan-Transitioning..> | 2023-05-03 09:54 | 35K | |
![[ ]](/icons/compressed.gif) | Duncan-Transitioning..> | 2023-05-03 09:54 | 73K | |
![[IMG]](/icons/image2.gif) | Durham-2nd-Edition-M..> | 2023-08-05 16:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | Durham-2nd-Edition-M..> | 2023-08-07 17:11 | 14K | |
![[IMG]](/icons/image2.gif) | Durham-2nd-Edition-M..> | 2023-05-03 09:19 | 43K | |
![[ ]](/icons/unknown.gif) | EBA-Solutions-Ch-2.docx | 2023-05-03 10:47 | 398K | |
![[ ]](/icons/compressed.gif) | ECB4_QuestionBank_Ch..> | 2023-05-03 10:10 | 671K | |
![[ ]](/icons/layout.gif) | EE4_Ch01_Solutions_M..> | 2023-05-03 09:28 | 100K | |
![[ ]](/icons/layout.gif) | EHAP10e_IG_Ch01.pdf | 2023-05-03 09:22 | 95K | |
![[IMG]](/icons/image2.gif) | EHEP002071__51526.14..> | 2023-08-08 03:47 | 4.6K | |
![[IMG]](/icons/image2.gif) | EHEP002071__51526.14..> | 2023-08-15 09:54 | 26K | |
![[IMG]](/icons/image2.gif) | EHEP002071__51526.14..> | 2023-05-03 11:10 | 27K | |
![[IMG]](/icons/image2.gif) | EHEP002075__33593.14..> | 2023-08-08 06:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | EHEP002075__33593.14..> | 2023-08-08 17:45 | 32K | |
![[IMG]](/icons/image2.gif) | EHEP002075__33593.14..> | 2023-05-04 02:13 | 32K | |
![[IMG]](/icons/image2.gif) | EHEP002486-100x100.jpg | 2023-08-05 03:41 | 9.6K | |
![[IMG]](/icons/image2.gif) | EHEP002486-300x300.jpg | 2023-08-21 10:12 | 29K | |
![[IMG]](/icons/image2.gif) | EHEP002486.jpg | 2023-05-03 09:48 | 54K | |
![[IMG]](/icons/image2.gif) | EHEP002637__12567.14..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | EHEP002637__12567.14..> | 2023-08-06 13:11 | 23K | |
![[IMG]](/icons/image2.gif) | EHEP002637__12567.14..> | 2023-05-03 09:34 | 26K | |
![[IMG]](/icons/image2.gif) | EHEP002639__73739.14..> | 2023-08-06 03:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | EHEP002639__73739.14..> | 2023-08-17 19:59 | 19K | |
![[IMG]](/icons/image2.gif) | EHEP002639__73739.14..> | 2023-05-03 09:31 | 21K | |
![[IMG]](/icons/image2.gif) | EHEP002728__57753.14..> | 2023-08-05 14:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | EHEP002728__57753.14..> | 2023-08-06 13:11 | 22K | |
![[IMG]](/icons/image2.gif) | EHEP002728__57753.14..> | 2023-05-03 11:26 | 25K | |
![[IMG]](/icons/image2.gif) | EHEP002739_V1-1-100x..> | 2023-08-06 03:45 | 23K | |
![[IMG]](/icons/image2.gif) | EHEP002739_V1-1-300x..> | 2023-08-15 16:04 | 46K | |
![[IMG]](/icons/image2.gif) | EHEP002739_V1-1.jpg | 2023-05-04 02:11 | 60K | |
![[IMG]](/icons/image2.gif) | EHEP002980-100x100.jpg | 2023-08-05 03:40 | 19K | |
![[IMG]](/icons/image2.gif) | EHEP002980-300x300.jpg | 2023-09-11 15:33 | 50K | |
![[IMG]](/icons/image2.gif) | EHEP002980.jpg | 2023-05-03 10:16 | 63K | |
![[IMG]](/icons/image2.gif) | EHEP003385-1-100x100..> | 2023-08-06 07:37 | 16K | |
![[IMG]](/icons/image2.gif) | EHEP003385-1-300x300..> | 2023-09-14 17:47 | 39K | |
![[IMG]](/icons/image2.gif) | EHEP003385-1.jpg | 2023-05-03 10:13 | 52K | |
![[IMG]](/icons/image2.gif) | EHEP003385-100x100.jpg | 2023-08-05 01:51 | 16K | |
![[IMG]](/icons/image2.gif) | EHEP003385-300x300.jpg | 2023-08-05 21:03 | 39K | |
![[IMG]](/icons/image2.gif) | EHEP003385.jpg | 2023-05-03 10:41 | 52K | |
![[ ]](/icons/unknown.gif) | EMR-1E-malhotra_im_c..> | 2023-05-03 10:17 | 56K | |
![[ ]](/icons/unknown.gif) | ESM2_TB_Ch01-173545.doc | 2023-05-03 09:47 | 65K | |
![[ ]](/icons/unknown.gif) | ESSOC7_CH01_TB_Final..> | 2023-05-04 02:19 | 47K | |
![[ ]](/icons/layout.gif) | ES_14_IM_Ch01.pdf | 2023-05-03 10:21 | 74K | |
![[ ]](/icons/compressed.gif) | Earth-Science-Tarbuc..> | 2023-05-03 10:47 | 83K | |
![[ ]](/icons/unknown.gif) | Earth6_TB_Prelude.docx | 2023-05-03 11:13 | 27K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-08-06 18:48 | 2.0K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-08-09 09:54 | 8.7K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-05-03 10:47 | 22K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-08-05 15:33 | 2.0K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-08-09 02:53 | 8.7K | |
![[IMG]](/icons/image2.gif) | Earth_Science_14_Tar..> | 2023-05-03 10:22 | 22K | |
![[ ]](/icons/compressed.gif) | Ebbing10e_CSM_CH01.zip | 2023-05-03 10:01 | 244K | |
![[ ]](/icons/compressed.gif) | Economics-of-Social-..> | 2023-05-03 10:21 | 100K | |
![[IMG]](/icons/image2.gif) | Economics2e-BookCard..> | 2023-05-04 02:02 | 59K | |
![[IMG]](/icons/image2.gif) | Edmonds3e12md_nm2-10..> | 2023-08-06 03:28 | 3.4K | |
![[IMG]](/icons/image2.gif) | Edmonds3e12md_nm2-30..> | 2023-08-05 14:41 | 21K | |
![[IMG]](/icons/image2.gif) | Edmonds3e12md_nm2.jpg | 2023-05-04 01:57 | 54K | |
![[IMG]](/icons/image2.gif) | Edmonds_FFAC_7e-100x..> | 2023-08-06 10:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | Edmonds_FFAC_7e-300x..> | 2023-08-19 07:27 | 13K | |
![[IMG]](/icons/image2.gif) | Edmonds_FFAC_7e.jpg | 2023-05-03 10:15 | 33K | |
![[ ]](/icons/compressed.gif) | Ehrhardt-ch1-6e-TB.zip | 2023-05-03 09:47 | 27K | |
![[ ]](/icons/unknown.gif) | Eitzen14E.TestBank.C..> | 2023-05-04 01:49 | 66K | |
![[IMG]](/icons/image2.gif) | Eldenburg-Cost-Manag..> | 2023-08-05 03:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | Eldenburg-Cost-Manag..> | 2023-08-16 16:54 | 20K | |
![[IMG]](/icons/image2.gif) | Eldenburg-Cost-Manag..> | 2023-05-04 02:23 | 38K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-09 11:11 | 19K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-05-03 10:36 | 46K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-05 14:36 | 3.3K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-09 11:11 | 19K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-05-03 09:37 | 46K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-06 03:49 | 3.7K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-09 11:11 | 19K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-05-03 09:57 | 39K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-06 05:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-09 11:11 | 19K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-05-03 09:47 | 39K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-06 10:20 | 4.1K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-08-09 11:11 | 22K | |
![[IMG]](/icons/image2.gif) | Elementary_Statistic..> | 2023-05-03 11:09 | 44K | |
![[ ]](/icons/unknown.gif) | Elmasri-6e_ISM-01.doc | 2023-05-03 09:55 | 45K | |
![[ ]](/icons/unknown.gif) | Ember_15e_CA_IM_Ch01..> | 2023-05-03 11:06 | 58K | |
![[ ]](/icons/compressed.gif) | Employee-Benefits-A-..> | 2023-05-03 10:28 | 22K | |
![[IMG]](/icons/image2.gif) | Employment-Law-for-H..> | 2023-08-06 12:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | Employment-Law-for-H..> | 2023-08-27 01:52 | 15K | |
![[IMG]](/icons/image2.gif) | Employment-Law-for-H..> | 2023-05-03 09:59 | 36K | |
![[ ]](/icons/layout.gif) | EncounterHG_ch01_Int..> | 2023-05-03 10:03 | 332K | |
![[IMG]](/icons/image2.gif) | Enger14e_lg-100x100.jpg | 2023-08-05 15:32 | 3.6K | |
![[IMG]](/icons/image2.gif) | Enger14e_lg-300x300.jpg | 2023-08-22 15:02 | 24K | |
![[IMG]](/icons/image2.gif) | Enger14e_lg.jpg | 2023-05-04 02:19 | 59K | |
![[IMG]](/icons/image2.gif) | Engineering_Economy_..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | Engineering_Economy_..> | 2023-08-08 08:38 | 24K | |
![[IMG]](/icons/image2.gif) | Engineering_Economy_..> | 2023-05-03 10:25 | 65K | |
![[IMG]](/icons/image2.gif) | Engineering_Economy_..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/unknown.gif) | Environment-8e-Raven..> | 2023-05-04 01:56 | 168K | |
![[ ]](/icons/compressed.gif) | EoO_11e_TB_Ch01.zip | 2023-05-03 10:34 | 1.3M | |
![[IMG]](/icons/image2.gif) | Essential-Biochemist..> | 2023-08-05 09:32 | 2.6K | |
![[IMG]](/icons/image2.gif) | Essential-Biochemist..> | 2023-08-17 04:49 | 12K | |
![[IMG]](/icons/image2.gif) | Essential-Biochemist..> | 2023-05-03 09:52 | 26K | |
![[ ]](/icons/unknown.gif) | Essentials-Chapter-0..> | 2023-05-03 09:38 | 42K | |
![[ ]](/icons/layout.gif) | Essentials-of-Accoun..> | 2023-05-03 11:09 | 230K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Econom..> | 2023-08-06 10:11 | 3.4K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Econom..> | 2023-08-09 01:54 | 19K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Econom..> | 2023-05-03 10:43 | 52K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-08-08 05:02 | 2.6K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-08-30 14:11 | 12K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-05-03 09:59 | 25K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-08-08 02:00 | 4.5K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-08-17 09:42 | 25K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Manage..> | 2023-05-03 09:59 | 54K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Market..> | 2023-08-06 13:07 | 2.9K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Market..> | 2023-08-24 00:00 | 14K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Market..> | 2023-05-03 11:04 | 32K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Psycho..> | 2023-08-06 10:19 | 3.7K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Psycho..> | 2023-09-01 03:43 | 19K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Psycho..> | 2023-05-03 09:19 | 49K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Strate..> | 2023-08-05 16:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Strate..> | 2023-08-08 22:03 | 14K | |
![[IMG]](/icons/image2.gif) | Essentials-of-Strate..> | 2023-05-04 01:49 | 41K | |
![[IMG]](/icons/image2.gif) | Essentials-of-System..> | 2023-08-05 01:12 | 5.1K | |
![[IMG]](/icons/image2.gif) | Essentials-of-System..> | 2023-08-05 02:29 | 25K | |
![[IMG]](/icons/image2.gif) | Essentials-of-System..> | 2023-05-03 10:16 | 108K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Accoun..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Accoun..> | 2023-08-05 06:17 | 16K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Accoun..> | 2023-05-03 10:59 | 29K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Nursin..> | 2023-05-04 02:04 | 23K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Sociol..> | 2023-08-07 20:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Sociol..> | 2023-08-11 11:08 | 19K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Sociol..> | 2023-05-03 10:01 | 42K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-08-05 01:12 | 3.4K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-08-11 11:08 | 18K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-05-03 10:47 | 104K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-08-05 14:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-08-11 11:08 | 18K | |
![[IMG]](/icons/image2.gif) | Essentials_of_Statis..> | 2023-05-03 10:33 | 104K | |
![[ ]](/icons/compressed.gif) | Ethics-in-Accounting..> | 2023-05-03 09:20 | 0 | |
![[IMG]](/icons/image2.gif) | Ethics-in-Accounting..> | 2023-05-03 09:20 | 79K | |
![[ ]](/icons/compressed.gif) | Ethics-in-Accounting..> | 2023-05-03 09:20 | 0 | |
![[IMG]](/icons/image2.gif) | Ethics-in-Accounting..> | 2023-05-03 09:20 | 79K | |
![[ ]](/icons/unknown.gif) | Ethics_6e_Sol_Ch01.doc | 2023-05-03 13:42 | 72K | |
![[ ]](/icons/unknown.gif) | ExamCh123-Test-Bank-..> | 2023-05-03 10:23 | 80K | |
![[ ]](/icons/layout.gif) | ExamView-Chapter-01-..> | 2023-05-03 10:15 | 15K | |
![[ ]](/icons/compressed.gif) | ExamView - Chapter_0..> | 2023-05-03 10:34 | 44K | |
![[ ]](/icons/compressed.gif) | Excel-Module-1.zip | 2023-05-03 10:59 | 51K | |
![[ ]](/icons/compressed.gif) | Excursions-in-Modern..> | 2023-05-03 10:27 | 244K | |
![[IMG]](/icons/image2.gif) | Exercise_Physiology_..> | 2023-08-05 21:05 | 4.5K | |
![[IMG]](/icons/image2.gif) | Exercise_Physiology_..> | 2023-08-08 22:03 | 28K | |
![[IMG]](/icons/image2.gif) | Exercise_Physiology_..> | 2023-05-03 09:49 | 66K | |
![[ ]](/icons/compressed.gif) | Experiencing-the-Wor..> | 2023-05-03 09:43 | 13K | |
![[IMG]](/icons/image2.gif) | Exploring-Geology-4t..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | Exploring-Geology-4t..> | 2023-08-13 20:42 | 25K | |
![[IMG]](/icons/image2.gif) | Exploring-Geology-4t..> | 2023-05-03 10:29 | 75K | |
![[ ]](/icons/layout.gif) | F01_STUD_6E_IM_TOC.pdf | 2023-05-03 10:58 | 45K | |
![[ ]](/icons/compressed.gif) | FRA_13e_Ch_01.zip | 2023-05-03 09:48 | 13K | |
![[ ]](/icons/unknown.gif) | Fabozzi_IM_CH01.doc | 2023-05-03 09:25 | 73K | |
![[IMG]](/icons/image2.gif) | Family-Life-Now-2e-W..> | 2023-08-06 08:43 | 5.3K | |
![[IMG]](/icons/image2.gif) | Family-Life-Now-2e-W..> | 2023-09-11 23:26 | 26K | |
![[IMG]](/icons/image2.gif) | Family-Life-Now-2e-W..> | 2023-05-03 10:00 | 121K | |
![[ ]](/icons/compressed.gif) | Family-Therapy-Conce..> | 2023-05-03 11:15 | 119K | |
![[ ]](/icons/unknown.gif) | Faragher_Out-of-Many..> | 2023-05-03 13:41 | 94K | |
![[ ]](/icons/unknown.gif) | Farnham_IM_3e_Ch01.doc | 2023-05-03 10:01 | 43K | |
![[IMG]](/icons/image2.gif) | Fast_and_Easy_ECGs_A..> | 2023-08-05 01:15 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fast_and_Easy_ECGs_A..> | 2023-08-14 03:16 | 18K | |
![[IMG]](/icons/image2.gif) | Fast_and_Easy_ECGs_A..> | 2023-05-04 02:05 | 38K | |
![[ ]](/icons/unknown.gif) | Federal-1_version1.docx | 2023-05-04 02:01 | 50K | |
![[IMG]](/icons/image2.gif) | Feedback_Control_of_..> | 2023-08-05 15:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | Feedback_Control_of_..> | 2023-08-10 02:14 | 15K | |
![[IMG]](/icons/image2.gif) | Feedback_Control_of_..> | 2023-05-03 10:46 | 29K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2-1-10..> | 2023-08-05 17:20 | 2.7K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2-1-30..> | 2023-08-14 14:13 | 13K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2-1.jpg | 2023-05-03 09:31 | 30K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2-100x..> | 2023-08-06 10:17 | 2.7K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2-300x..> | 2023-10-20 06:19 | 13K | |
![[IMG]](/icons/image2.gif) | Feist2e12cc_nm2.jpg | 2023-05-03 10:50 | 30K | |
![[ ]](/icons/compressed.gif) | Feline-Novelties.zip | 2023-05-03 11:19 | 100K | |
![[ ]](/icons/unknown.gif) | Ferdico-CrimPro-9781..> | 2023-05-03 13:41 | 49K | |
![[ ]](/icons/compressed.gif) | Final-Wilson_14e_TB_..> | 2023-05-03 09:52 | 34K | |
![[ ]](/icons/unknown.gif) | Final_MBS6E-Chapter-..> | 2023-05-04 02:10 | 48K | |
![[ ]](/icons/compressed.gif) | Final_exam_Number_1.zip | 2023-05-03 10:44 | 110K | |
![[IMG]](/icons/image2.gif) | Financial-ACCT2-Godw..> | 2023-08-05 02:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | Financial-ACCT2-Godw..> | 2023-08-08 17:45 | 21K | |
![[IMG]](/icons/image2.gif) | Financial-ACCT2-Godw..> | 2023-05-03 10:01 | 52K | |
![[IMG]](/icons/image2.gif) | Financial-Accounting..> | 2023-08-06 19:18 | 2.9K | |
![[IMG]](/icons/image2.gif) | Financial-Accounting..> | 2023-08-24 00:34 | 15K | |
![[IMG]](/icons/image2.gif) | Financial-Accounting..> | 2023-05-03 11:15 | 34K | |
![[IMG]](/icons/image2.gif) | Financial-Accounting..> | 2023-08-06 05:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | Financial-Accounting..> | 2023-05-03 11:15 | 15K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-08-08 17:37 | 1.8K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-08-06 12:18 | 9.8K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-05-03 10:16 | 30K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-08-05 02:46 | 1.8K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-09-15 08:58 | 9.8K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-05-03 10:43 | 30K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-08-08 15:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-09-15 08:58 | 20K | |
![[IMG]](/icons/image2.gif) | Financial-Management..> | 2023-05-03 10:10 | 110K | |
![[IMG]](/icons/image2.gif) | Financial-Markets-an..> | 2023-08-06 15:35 | 4.7K | |
![[IMG]](/icons/image2.gif) | Financial-Markets-an..> | 2023-08-06 12:18 | 28K | |
![[IMG]](/icons/image2.gif) | Financial-Markets-an..> | 2023-05-03 09:27 | 132K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-08-08 06:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-09-17 09:37 | 16K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-05-03 10:04 | 35K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-08-06 09:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-09-17 09:37 | 19K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-05-03 09:48 | 47K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-08-07 05:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-08-06 12:18 | 19K | |
![[IMG]](/icons/image2.gif) | Financial-Reporting-..> | 2023-05-03 10:40 | 47K | |
![[IMG]](/icons/image2.gif) | Financial-Statement-..> | 2023-08-08 07:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | Financial-Statement-..> | 2023-05-03 10:15 | 8.1K | |
![[ ]](/icons/unknown.gif) | Financial-and-Manage..> | 2023-05-03 10:29 | 133K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-10 02:14 | 21K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-05-03 10:17 | 44K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-08 06:39 | 3.9K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-13 14:27 | 21K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-05-03 10:17 | 44K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-05 05:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-14 13:33 | 21K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-05-04 02:12 | 35K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-05 02:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-08-14 13:33 | 23K | |
![[IMG]](/icons/image2.gif) | Financial_Accounting..> | 2023-05-03 10:01 | 55K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-08-05 14:34 | 18K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-05-03 09:21 | 156K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-08-08 18:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-08-14 00:05 | 18K | |
![[IMG]](/icons/image2.gif) | Financial_Management..> | 2023-05-03 10:40 | 156K | |
![[IMG]](/icons/image2.gif) | Financial_Managerial..> | 2023-05-03 09:57 | 16K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-05 08:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 21K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 10:34 | 45K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-05 14:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 21K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 10:36 | 45K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-06 11:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 11:06 | 44K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 19K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 09:38 | 44K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-05 05:29 | 3.4K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 23K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 10:34 | 48K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-06 07:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-08-12 06:36 | 23K | |
![[IMG]](/icons/image2.gif) | Financial_Markets_an..> | 2023-05-03 09:31 | 48K | |
![[IMG]](/icons/image2.gif) | Financial_Reporting_..> | 2023-08-05 14:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | Financial_Reporting_..> | 2023-08-12 06:36 | 17K | |
![[IMG]](/icons/image2.gif) | Financial_Reporting_..> | 2023-05-03 10:21 | 26K | |
![[IMG]](/icons/image2.gif) | Finkbeiner-Practice-..> | 2023-08-06 07:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | Finkbeiner-Practice-..> | 2023-10-29 06:30 | 22K | |
![[IMG]](/icons/image2.gif) | Finkbeiner-Practice-..> | 2023-05-03 10:38 | 49K | |
![[ ]](/icons/compressed.gif) | Finman4e_testbank_Mo..> | 2023-05-03 10:17 | 237K | |
![[ ]](/icons/unknown.gif) | Fischer11e_SMChap01_..> | 2023-05-04 02:13 | 121K | |
![[IMG]](/icons/image2.gif) | Fluid_Mechanics_Fund..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | Fluid_Mechanics_Fund..> | 2023-08-08 20:09 | 15K | |
![[IMG]](/icons/image2.gif) | Fluid_Mechanics_Fund..> | 2023-05-03 10:41 | 37K | |
![[IMG]](/icons/image2.gif) | Fontaine-6th-Edition..> | 2023-08-08 22:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | Fontaine-6th-Edition..> | 2023-08-12 04:51 | 17K | |
![[IMG]](/icons/image2.gif) | Fontaine-6th-Edition..> | 2023-05-03 09:20 | 39K | |
![[IMG]](/icons/image2.gif) | Food-Service-Organiz..> | 2023-08-08 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | Food-Service-Organiz..> | 2023-09-20 09:04 | 15K | |
![[IMG]](/icons/image2.gif) | Food-Service-Organiz..> | 2023-05-03 10:24 | 73K | |
![[ ]](/icons/compressed.gif) | Ford-Sturman-2e-IM-C..> | 2023-05-03 14:05 | 29K | |
![[IMG]](/icons/image2.gif) | Forensic-Science-Fun..> | 2023-08-05 08:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | Forensic-Science-Fun..> | 2023-08-12 22:16 | 25K | |
![[IMG]](/icons/image2.gif) | Forensic-Science-Fun..> | 2023-05-03 10:29 | 72K | |
![[IMG]](/icons/image2.gif) | Fortinash-5th-Psychi..> | 2023-08-05 01:13 | 2.3K | |
![[IMG]](/icons/image2.gif) | Fortinash-5th-Psychi..> | 2023-08-05 01:08 | 9.9K | |
![[IMG]](/icons/image2.gif) | Fortinash-5th-Psychi..> | 2023-05-03 09:49 | 26K | |
![[ ]](/icons/compressed.gif) | Fortinash-2014-5th-0..> | 2023-05-03 09:49 | 15K | |
![[ ]](/icons/unknown.gif) | Foundations-Of-Finan..> | 2023-05-03 11:23 | 42K | |
![[IMG]](/icons/image2.gif) | Foundations-in-Nursi..> | 2023-08-08 15:42 | 3.1K | |
![[IMG]](/icons/image2.gif) | Foundations-in-Nursi..> | 2023-09-18 20:17 | 16K | |
![[IMG]](/icons/image2.gif) | Foundations-in-Nursi..> | 2023-05-03 11:26 | 77K | |
![[IMG]](/icons/image2.gif) | Foundations_of_Finan..> | 2023-08-05 15:43 | 3.4K | |
![[IMG]](/icons/image2.gif) | Foundations_of_Finan..> | 2023-08-08 20:09 | 18K | |
![[IMG]](/icons/image2.gif) | Foundations_of_Finan..> | 2023-05-03 09:30 | 29K | |
![[ ]](/icons/unknown.gif) | Fox-1_version1.docx | 2023-05-04 01:52 | 20K | |
![[ ]](/icons/unknown.gif) | Frank10e_Chapter01_S..> | 2023-05-03 13:43 | 37K | |
![[IMG]](/icons/image2.gif) | FrankMICRO5e13mb_nm2..> | 2023-08-05 16:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | FrankMICRO5e13mb_nm2..> | 2023-08-11 04:33 | 20K | |
![[IMG]](/icons/image2.gif) | FrankMICRO5e13mb_nm2..> | 2023-05-03 09:38 | 49K | |
![[ ]](/icons/unknown.gif) | Frank_Prebles_12e_CH..> | 2023-05-03 13:41 | 111K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-08-21 12:24 | 21K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-05-03 09:42 | 52K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-08-05 08:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-09-27 19:58 | 21K | |
![[IMG]](/icons/image2.gif) | Fraud-Examination-4e..> | 2023-05-03 10:17 | 52K | |
![[ ]](/icons/unknown.gif) | Freberg_3e_IRM_ch01...> | 2023-05-03 09:42 | 49K | |
![[ ]](/icons/compressed.gif) | Freeman9eUpdate_SM_C..> | 2023-05-04 02:08 | 17K | |
![[ ]](/icons/unknown.gif) | Freeman10e_TIF_ch01_..> | 2023-05-03 09:33 | 26K | |
![[ ]](/icons/unknown.gif) | Fund5e-Chap01-Pbms.xlsx | 2023-05-03 11:06 | 75K | |
![[ ]](/icons/unknown.gif) | Fundamental-Accounti..> | 2023-05-03 10:40 | 1.3M | |
![[ ]](/icons/unknown.gif) | Fundamental-Accounti..> | 2023-05-03 10:46 | 1.2M | |
![[IMG]](/icons/image2.gif) | Fundamental_Accounti..> | 2023-08-05 01:12 | 2.9K | |
![[IMG]](/icons/image2.gif) | Fundamental_Accounti..> | 2023-08-08 08:38 | 22K | |
![[IMG]](/icons/image2.gif) | Fundamental_Accounti..> | 2023-05-03 09:58 | 52K | |
![[IMG]](/icons/image2.gif) | Fundamental_Nursing_..> | 2023-05-04 02:04 | 19K | |
![[IMG]](/icons/image2.gif) | Fundamentals-Nursing..> | 2023-08-08 08:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | Fundamentals-Nursing..> | 2023-05-03 10:35 | 40K | |
![[IMG]](/icons/image2.gif) | Fundamentals-Nursing..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals-Nursing..> | 2023-08-15 07:52 | 17K | |
![[ ]](/icons/unknown.gif) | Fundamentals-Nursing..> | 2023-05-03 10:31 | 79K | |
![[IMG]](/icons/image2.gif) | Fundamentals-Nursing..> | 2023-05-03 10:31 | 40K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Anat..> | 2023-08-07 23:31 | 2.6K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Anat..> | 2023-05-03 09:45 | 11K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Corp..> | 2023-08-07 05:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Corp..> | 2023-08-06 11:19 | 19K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Corp..> | 2023-05-03 10:53 | 42K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Engi..> | 2023-08-06 03:58 | 2.6K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Engi..> | 2023-08-08 14:34 | 14K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Engi..> | 2023-05-03 10:20 | 40K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Fina..> | 2023-08-05 03:40 | 2.2K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Fina..> | 2023-09-25 03:49 | 11K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Fina..> | 2023-05-03 10:25 | 26K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Gene..> | 2023-08-05 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Gene..> | 2023-08-06 10:20 | 20K | |
![[IMG]](/icons/image2.gif) | Fundamentals-of-Gene..> | 2023-05-03 09:27 | 84K | |
![[ ]](/icons/layout.gif) | Fundamentals-of-Heat..> | 2023-05-03 10:39 | 967K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-08-05 06:25 | 2.3K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-08-08 08:38 | 9.7K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-05-03 09:22 | 16K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-08-07 14:41 | 2.3K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-08-05 02:45 | 9.7K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Adva..> | 2023-05-03 09:23 | 16K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Futu..> | 2023-08-05 04:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Futu..> | 2023-08-21 02:16 | 20K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Futu..> | 2023-05-03 11:05 | 40K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Inve..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Inve..> | 2023-08-14 22:07 | 18K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Inve..> | 2023-05-03 09:34 | 28K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Mult..> | 2023-05-03 10:20 | 51K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Mult..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Mult..> | 2023-08-08 18:30 | 24K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Mult..> | 2023-05-03 11:06 | 242K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-08-05 01:12 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-08-14 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-05-03 10:59 | 34K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-08-06 21:21 | 2.7K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-08-14 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Nurs..> | 2023-05-03 10:41 | 35K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-08-06 16:29 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-08-17 05:40 | 27K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-05-03 10:58 | 81K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-08-05 22:02 | 3.4K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-08-08 18:30 | 27K | |
![[IMG]](/icons/image2.gif) | Fundamentals_of_Phys..> | 2023-05-03 09:29 | 81K | |
![[ ]](/icons/compressed.gif) | Fundamentals of Hydr..> | 2023-05-03 11:02 | 0 | |
![[ ]](/icons/compressed.gif) | GEOL_2e_TB_Ch01.zip | 2023-05-03 09:26 | 19K | |
![[ ]](/icons/unknown.gif) | GG5e_TB_CH01.doc | 2023-05-03 10:59 | 109K | |
![[ ]](/icons/unknown.gif) | GainesMiller_CJiAC_7..> | 2023-05-03 09:38 | 123K | |
![[ ]](/icons/unknown.gif) | Galotti6e_TB01.docx | 2023-05-03 13:42 | 54K | |
![[ ]](/icons/compressed.gif) | Gamble--Essentials-o..> | 2023-05-03 10:24 | 70K | |
![[ ]](/icons/layout.gif) | Garber-4e-SI-Chapter..> | 2023-05-04 02:17 | 42K | |
![[ ]](/icons/layout.gif) | Garber-5e-Chapter-01..> | 2023-05-03 10:22 | 224K | |
![[ ]](/icons/unknown.gif) | Garza_Phleb_Hdbk_9e_..> | 2023-05-03 11:00 | 45K | |
![[ ]](/icons/unknown.gif) | Gaspar2eCh1_IM.docx | 2023-05-03 10:53 | 37K | |
![[ ]](/icons/unknown.gif) | Gaudine-1e_PowerPoin..> | 2023-05-03 09:52 | 703K | |
![[IMG]](/icons/image2.gif) | Gaudine-1st-Edition-..> | 2023-08-05 01:56 | 4.0K | |
![[IMG]](/icons/image2.gif) | Gaudine-1st-Edition-..> | 2023-08-11 12:04 | 21K | |
![[IMG]](/icons/image2.gif) | Gaudine-1st-Edition-..> | 2023-05-03 09:52 | 40K | |
![[IMG]](/icons/image2.gif) | GeHart-2nd-Edition-M..> | 2023-08-05 16:26 | 2.6K | |
![[IMG]](/icons/image2.gif) | GeHart-2nd-Edition-M..> | 2023-08-12 04:51 | 14K | |
![[IMG]](/icons/image2.gif) | GeHart-2nd-Edition-M..> | 2023-05-03 10:11 | 35K | |
![[ ]](/icons/unknown.gif) | Gehart_TTPCP2e_TB_Ch..> | 2023-05-04 01:52 | 20K | |
![[ ]](/icons/unknown.gif) | Gelinas11e_SM_Ch01.doc | 2023-05-03 13:42 | 77K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-08-05 04:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-08-06 11:19 | 22K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-05-03 10:00 | 55K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-08-05 06:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-08-08 17:45 | 22K | |
![[IMG]](/icons/image2.gif) | General-Chemistry-10..> | 2023-05-03 10:01 | 55K | |
![[ ]](/icons/compressed.gif) | General-Chemistry-Th..> | 2023-05-03 09:50 | 27K | |
![[IMG]](/icons/image2.gif) | General_Chemistry__9..> | 2023-05-03 09:50 | 14K | |
![[IMG]](/icons/image2.gif) | Genetic-Analysis-1e-..> | 2023-08-06 12:12 | 2.7K | |
![[IMG]](/icons/image2.gif) | Genetic-Analysis-1e-..> | 2023-08-09 02:53 | 12K | |
![[IMG]](/icons/image2.gif) | Genetic-Analysis-1e-..> | 2023-05-03 09:26 | 48K | |
![[ ]](/icons/unknown.gif) | Gibson_12e_Ch01_sol.doc | 2023-05-03 10:46 | 168K | |
![[ ]](/icons/compressed.gif) | Gibson_Ch01_SM_13e.zip | 2023-05-03 10:40 | 33K | |
![[ ]](/icons/unknown.gif) | Gido_SPM6e_IM_Ch01.docx | 2023-05-03 10:12 | 175K | |
![[ ]](/icons/unknown.gif) | Gitman_7E_ISM_Ch01.doc | 2023-05-03 11:16 | 84K | |
![[ ]](/icons/unknown.gif) | GiveMeLiberty6e_Full..> | 2023-05-04 01:57 | 175K | |
![[ ]](/icons/compressed.gif) | GlatthornCurriculumL..> | 2023-05-03 10:50 | 23K | |
![[IMG]](/icons/image2.gif) | Global-Business-3e-P..> | 2023-08-06 07:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | Global-Business-3e-P..> | 2023-08-05 21:03 | 20K | |
![[IMG]](/icons/image2.gif) | Global-Business-3e-P..> | 2023-05-03 10:13 | 54K | |
![[IMG]](/icons/image2.gif) | Gloria-Leifer-6th-In..> | 2023-08-05 15:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | Gloria-Leifer-6th-In..> | 2023-08-05 01:08 | 14K | |
![[IMG]](/icons/image2.gif) | Gloria-Leifer-6th-In..> | 2023-05-03 10:16 | 33K | |
![[ ]](/icons/compressed.gif) | Gloria-Leifer-2011-6..> | 2023-05-03 10:16 | 293K | |
![[ ]](/icons/compressed.gif) | Gluck2eTB_Ch12.zip | 2023-05-03 09:58 | 83K | |
![[ ]](/icons/unknown.gif) | Goldstein_3e_TB_ch01..> | 2023-05-03 11:23 | 89K | |
![[IMG]](/icons/image2.gif) | Goolsby-Advanced-Ass..> | 2023-08-08 16:35 | 20K | |
![[IMG]](/icons/image2.gif) | Goolsby-Advanced-Ass..> | 2023-05-04 02:24 | 94K | |
![[IMG]](/icons/image2.gif) | Gould-Pathophysiolog..> | 2023-08-05 15:43 | 5.5K | |
![[IMG]](/icons/image2.gif) | Gould-Pathophysiolog..> | 2023-05-03 10:43 | 31K | |
![[ ]](/icons/compressed.gif) | Gould-Pathophysiolog..> | 2023-05-03 10:43 | 16K | |
![[ ]](/icons/unknown.gif) | Governmental-1_versi..> | 2023-05-04 02:28 | 24K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-08-07 23:57 | 2.6K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-08-08 14:34 | 16K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-05-04 02:08 | 91K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-08-05 14:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-08-08 14:34 | 24K | |
![[IMG]](/icons/image2.gif) | Governmental-and-Non..> | 2023-05-03 09:33 | 119K | |
![[ ]](/icons/unknown.gif) | Greene_PsychLaw8e_IM..> | 2023-05-03 10:40 | 142K | |
![[ ]](/icons/unknown.gif) | Griffin-9e-IM-Ch-1_e..> | 2023-05-03 10:55 | 63K | |
![[ ]](/icons/unknown.gif) | Griffin_ib8_im_01.doc | 2023-05-03 09:47 | 154K | |
![[ ]](/icons/unknown.gif) | Griffin_ib8_tif_01.doc | 2023-05-03 09:38 | 82K | |
![[IMG]](/icons/image2.gif) | Grove-6th-Edition-Un..> | 2023-08-05 14:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | Grove-6th-Edition-Un..> | 2023-08-09 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | Grove-6th-Edition-Un..> | 2023-05-03 10:37 | 47K | |
![[IMG]](/icons/image2.gif) | Guido-6th-Legal-and-..> | 2023-08-06 09:44 | 3.6K | |
![[IMG]](/icons/image2.gif) | Guido-6th-Legal-and-..> | 2023-08-05 01:08 | 18K | |
![[IMG]](/icons/image2.gif) | Guido-6th-Legal-and-..> | 2023-05-03 10:15 | 41K | |
![[ ]](/icons/compressed.gif) | Guido-2013-6th-01333..> | 2023-05-03 10:15 | 13K | |
![[ ]](/icons/unknown.gif) | Gurung4e_TB01.doc | 2023-05-04 02:16 | 71K | |
![[IMG]](/icons/image2.gif) | HDEV-3e-Rathus-100x1..> | 2023-08-05 16:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | HDEV-3e-Rathus-300x3..> | 2023-09-11 04:24 | 19K | |
![[IMG]](/icons/image2.gif) | HDEV-3e-Rathus.jpg | 2023-05-03 10:24 | 47K | |
![[ ]](/icons/unknown.gif) | HMCost3e_SM_Ch01.doc | 2023-05-03 10:20 | 76K | |
![[ ]](/icons/layout.gif) | HO07_TB_CH01.pdf | 2023-05-04 01:59 | 336K | |
![[ ]](/icons/unknown.gif) | HRM-Healthcare-3e-TB..> | 2023-05-04 01:50 | 62K | |
![[IMG]](/icons/image2.gif) | Hacker_Moores_Essent..> | 2023-05-04 02:05 | 25K | |
![[ ]](/icons/unknown.gif) | Hails_CrimEv_8e_IM_c..> | 2023-05-03 10:50 | 75K | |
![[IMG]](/icons/image2.gif) | Halter-1st-Canadian-..> | 2023-08-06 07:47 | 2.5K | |
![[IMG]](/icons/image2.gif) | Halter-1st-Canadian-..> | 2023-08-05 04:37 | 14K | |
![[IMG]](/icons/image2.gif) | Halter-1st-Canadian-..> | 2023-05-03 09:45 | 33K | |
![[ ]](/icons/unknown.gif) | Hanson7e_TestBank_Ch..> | 2023-05-03 10:58 | 36K | |
![[IMG]](/icons/image2.gif) | Hartwell-5th-Genetic..> | 2023-08-05 14:38 | 4.1K | |
![[IMG]](/icons/image2.gif) | Hartwell-5th-Genetic..> | 2023-08-09 18:53 | 23K | |
![[IMG]](/icons/image2.gif) | Hartwell-5th-Genetic..> | 2023-05-03 10:33 | 57K | |
![[ ]](/icons/compressed.gif) | Haviland_TB_Cultural..> | 2023-05-03 10:32 | 21K | |
![[IMG]](/icons/image2.gif) | Health-Psychology-1e..> | 2023-08-05 05:29 | 4.2K | |
![[IMG]](/icons/image2.gif) | Health-Psychology-1e..> | 2023-08-06 22:47 | 23K | |
![[IMG]](/icons/image2.gif) | Health-Psychology-1e..> | 2023-05-03 10:21 | 113K | |
![[IMG]](/icons/image2.gif) | Health_Assessment_fo..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | Health_Assessment_fo..> | 2023-08-05 23:08 | 17K | |
![[IMG]](/icons/image2.gif) | Health_Assessment_fo..> | 2023-05-04 02:08 | 56K | |
![[IMG]](/icons/image2.gif) | Health_Assessment_in..> | 2023-05-04 02:05 | 24K | |
![[IMG]](/icons/image2.gif) | Health_Psychology_An..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | Health_Psychology_An..> | 2023-08-15 06:40 | 21K | |
![[IMG]](/icons/image2.gif) | Health_Psychology_An..> | 2023-05-03 10:25 | 45K | |
![[ ]](/icons/unknown.gif) | Heintz22e_Ch01_SG-So..> | 2023-05-03 10:00 | 35K | |
![[ ]](/icons/unknown.gif) | Heintz22e_Ch01_SM_Fi..> | 2023-05-04 02:15 | 72K | |
![[ ]](/icons/unknown.gif) | Henslin_13e_Sociolog..> | 2023-05-04 01:52 | 40K | |
![[IMG]](/icons/image2.gif) | Herlihy-The-Human-Bo..> | 2023-05-03 09:18 | 50K | |
![[ ]](/icons/unknown.gif) | Hickey6e_Ch01_TB.doc | 2023-05-03 09:24 | 42K | |
![[ ]](/icons/unknown.gif) | Hickey7e_Ch01_TB.doc | 2023-05-03 10:43 | 45K | |
![[ ]](/icons/unknown.gif) | Hill_GBT11e_IM_Ch01...> | 2023-05-04 02:22 | 105K | |
![[ ]](/icons/compressed.gif) | Hill_SM_TB_Ch_01.zip | 2023-05-03 10:42 | 33K | |
![[IMG]](/icons/image2.gif) | Hillcrest-Medical-Ce..> | 2023-05-03 11:15 | 43K | |
![[IMG]](/icons/image2.gif) | Hillier5e13jl_nm2-10..> | 2023-08-06 07:47 | 2.7K | |
![[IMG]](/icons/image2.gif) | Hillier5e13jl_nm2-30..> | 2023-08-05 03:41 | 16K | |
![[IMG]](/icons/image2.gif) | Hillier5e13jl_nm2.jpg | 2023-05-03 09:36 | 38K | |
![[IMG]](/icons/image2.gif) | Hilton9e11le_nm2-100..> | 2023-08-06 15:45 | 4.4K | |
![[IMG]](/icons/image2.gif) | Hilton9e11le_nm2.jpg | 2023-05-03 09:48 | 18K | |
![[ ]](/icons/unknown.gif) | Hilton_Platt_12e_SM_..> | 2023-05-04 02:00 | 47K | |
![[IMG]](/icons/image2.gif) | Hisrich9e13jl_nm2-10..> | 2023-08-05 05:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | Hisrich9e13jl_nm2-30..> | 2023-08-09 02:53 | 16K | |
![[IMG]](/icons/image2.gif) | Hisrich9e13jl_nm2.jpg | 2023-05-03 10:12 | 42K | |
![[IMG]](/icons/image2.gif) | Hitt-Strategic-Manag..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | Hitt-Strategic-Manag..> | 2023-08-06 05:40 | 18K | |
![[IMG]](/icons/image2.gif) | Hitt-Strategic-Manag..> | 2023-05-03 09:34 | 42K | |
![[ ]](/icons/unknown.gif) | Hobbs_Ch.1_IM.doc | 2023-05-03 09:49 | 57K | |
![[IMG]](/icons/image2.gif) | Hockenberry-9th-Edit..> | 2023-08-06 10:18 | 3.6K | |
![[IMG]](/icons/image2.gif) | Hockenberry-9th-Edit..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | Hockenberry-9th-Edit..> | 2023-05-03 09:53 | 45K | |
![[IMG]](/icons/image2.gif) | Hockenberry-10th-Edi..> | 2023-08-06 05:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | Hockenberry-10th-Edi..> | 2023-08-09 18:53 | 22K | |
![[IMG]](/icons/image2.gif) | Hockenberry-10th-Edi..> | 2023-05-03 09:57 | 61K | |
![[IMG]](/icons/image2.gif) | Hockenberry-Nursing-..> | 2023-08-06 05:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | Hockenberry-Nursing-..> | 2023-08-23 23:50 | 16K | |
![[IMG]](/icons/image2.gif) | Hockenberry-Nursing-..> | 2023-05-03 09:40 | 40K | |
![[IMG]](/icons/image2.gif) | Hoefnagels_lg-100x10..> | 2023-08-09 17:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | Hoefnagels_lg-300x30..> | 2023-09-02 05:06 | 19K | |
![[IMG]](/icons/image2.gif) | Hoefnagels_lg.jpg | 2023-05-03 10:02 | 49K | |
![[IMG]](/icons/image2.gif) | Hofkin-1st-Living-in..> | 2023-08-06 09:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | Hofkin-1st-Living-in..> | 2023-08-14 03:16 | 25K | |
![[IMG]](/icons/image2.gif) | Hofkin-1st-Living-in..> | 2023-05-03 09:24 | 42K | |
![[IMG]](/icons/image2.gif) | Holes-Human-Anatomy-..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | Holes-Human-Anatomy-..> | 2023-09-06 02:57 | 19K | |
![[IMG]](/icons/image2.gif) | Holes-Human-Anatomy-..> | 2023-05-03 09:44 | 45K | |
![[ ]](/icons/layout.gif) | Holes-Human-Anatomy-..> | 2023-05-03 09:37 | 362K | |
![[ ]](/icons/layout.gif) | HootLM01-Objects.pdf | 2023-05-03 09:57 | 194K | |
![[IMG]](/icons/image2.gif) | Hopwood2e12bar_nm2-1..> | 2023-08-05 06:24 | 3.3K | |
![[IMG]](/icons/image2.gif) | Hopwood2e12bar_nm2.jpg | 2023-05-03 09:45 | 14K | |
![[ ]](/icons/unknown.gif) | Horn_Acct_9Ce_IRM_Ch..> | 2023-05-03 11:03 | 164K | |
![[IMG]](/icons/image2.gif) | Horngrens-Accounting..> | 2023-05-04 02:21 | 50K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-08-06 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-08-18 10:03 | 13K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-05-03 09:29 | 29K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-08-06 08:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-08-19 20:58 | 13K | |
![[IMG]](/icons/image2.gif) | HoyleAdAcctg11e13pv_..> | 2023-05-03 10:07 | 29K | |
![[ ]](/icons/compressed.gif) | Hughes--Leadership-8..> | 2023-05-03 10:07 | 56K | |
![[ ]](/icons/unknown.gif) | HullOFOD9eSolutionsC..> | 2023-05-03 09:18 | 339K | |
![[IMG]](/icons/image2.gif) | Human-Anatomy-Physio..> | 2023-08-06 13:07 | 3.4K | |
![[IMG]](/icons/image2.gif) | Human-Anatomy-Physio..> | 2023-05-03 10:22 | 21K | |
![[ ]](/icons/unknown.gif) | Human-Physiology-Fro..> | 2023-05-03 10:43 | 211K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-08-05 01:52 | 3.4K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-08-27 15:48 | 18K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-05-03 09:59 | 44K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-08-06 12:14 | 3.0K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-08-27 15:48 | 17K | |
![[IMG]](/icons/image2.gif) | Human-Resource-Manag..> | 2023-05-03 10:35 | 40K | |
![[IMG]](/icons/image2.gif) | Human_Anatomy_mckinl..> | 2023-08-06 13:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | Human_Anatomy_mckinl..> | 2023-08-16 08:56 | 18K | |
![[IMG]](/icons/image2.gif) | Human_Anatomy_mckinl..> | 2023-05-03 10:51 | 30K | |
![[IMG]](/icons/image2.gif) | Human_Genetics_Lewis..> | 2023-08-05 05:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | Human_Genetics_Lewis..> | 2023-08-20 22:31 | 24K | |
![[IMG]](/icons/image2.gif) | Human_Genetics_Lewis..> | 2023-05-03 10:15 | 55K | |
![[IMG]](/icons/image2.gif) | Human_Physiology_Fro..> | 2023-08-05 01:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | Human_Physiology_Fro..> | 2023-08-20 22:31 | 14K | |
![[IMG]](/icons/image2.gif) | Human_Physiology_Fro..> | 2023-05-03 10:43 | 30K | |
![[IMG]](/icons/image2.gif) | Human_Resource_Manag..> | 2023-08-08 02:38 | 2.9K | |
![[IMG]](/icons/image2.gif) | Human_Resource_Manag..> | 2023-08-17 17:25 | 15K | |
![[IMG]](/icons/image2.gif) | Human_Resource_Manag..> | 2023-05-03 10:25 | 28K | |
![[IMG]](/icons/image2.gif) | Human_Resources_Mana..> | 2023-05-03 10:36 | 29K | |
![[ ]](/icons/layout.gif) | IAPM10e_Ch_01.pdf | 2023-05-03 10:41 | 327K | |
![[ ]](/icons/unknown.gif) | ICA8_TB_ch01-236253.doc | 2023-05-03 11:08 | 168K | |
![[ ]](/icons/compressed.gif) | IFM11eAbr_TB_ch01.zip | 2023-05-03 09:27 | 18K | |
![[ ]](/icons/unknown.gif) | IFM12eAbr_Ch01.rtf | 2023-05-03 10:51 | 282K | |
![[ ]](/icons/unknown.gif) | IFM12e_IM_ch01-ALBRI..> | 2023-05-03 10:29 | 128K | |
![[ ]](/icons/unknown.gif) | IFM12e_IM_ch01.doc | 2023-05-03 10:06 | 128K | |
![[ ]](/icons/unknown.gif) | IIC-8e-TB-Chapter-1.doc | 2023-05-03 09:39 | 191K | |
![[ ]](/icons/unknown.gif) | IM-CH-01-0132729040.doc | 2023-05-03 10:12 | 94K | |
![[ ]](/icons/unknown.gif) | IM-CH1-Solution-Manu..> | 2023-05-03 10:06 | 57K | |
![[ ]](/icons/layout.gif) | IM-Ch01-8e-978013442..> | 2023-05-04 02:08 | 56K | |
![[ ]](/icons/unknown.gif) | IM-Ch01-DB-Systems-E..> | 2023-05-03 10:03 | 136K | |
![[ ]](/icons/unknown.gif) | IM-Ch01-DB-Systems-E..> | 2023-05-03 13:42 | 153K | |
![[ ]](/icons/layout.gif) | IM-Ch01PSS-7e.pdf | 2023-05-03 11:19 | 79K | |
![[ ]](/icons/unknown.gif) | IM-Chapter-1-Bank-Ma..> | 2023-05-03 11:20 | 27K | |
![[ ]](/icons/compressed.gif) | IM2_Gravetter_8e.zip | 2023-05-03 10:09 | 24K | |
![[ ]](/icons/unknown.gif) | IM3-Chapter-1.doc | 2023-05-03 10:06 | 95K | |
![[ ]](/icons/layout.gif) | IM10Chap01.pdf | 2023-05-03 09:36 | 220K | |
![[ ]](/icons/compressed.gif) | IM11-IM-CH1.zip | 2023-05-03 09:31 | 151K | |
![[ ]](/icons/unknown.gif) | IMChap001-Business-R..> | 2023-05-03 09:38 | 51K | |
![[ ]](/icons/unknown.gif) | IMChap001-Operations..> | 2023-05-03 10:08 | 47K | |
![[ ]](/icons/unknown.gif) | IMChap001-Retailing-..> | 2023-05-03 09:54 | 164K | |
![[ ]](/icons/unknown.gif) | IMChap001_10e-Soluti..> | 2023-05-04 02:00 | 135K | |
![[ ]](/icons/unknown.gif) | IM_Ch01-Solution-Man..> | 2023-05-04 02:05 | 86K | |
![[ ]](/icons/compressed.gif) | IM_SMChap001-Account..> | 2023-05-03 09:51 | 13K | |
![[ ]](/icons/unknown.gif) | IM_chapter22-16E-CE...> | 2023-05-03 09:33 | 36K | |
![[ ]](/icons/layout.gif) | IRM12e_Ch01_final.pdf | 2023-05-03 10:09 | 791K | |
![[ ]](/icons/unknown.gif) | IRM_Chapter_10e_01.doc | 2023-05-03 13:40 | 51K | |
![[ ]](/icons/layout.gif) | ISM-CLDPCMC-Chapter-..> | 2023-05-04 02:09 | 77K | |
![[ ]](/icons/layout.gif) | ISM_PSE10e_c1.pdf | 2023-05-03 10:59 | 1.2M | |
![[IMG]](/icons/image2.gif) | Ignatavicius-5th-Edi..> | 2023-08-05 01:56 | 3.0K | |
![[IMG]](/icons/image2.gif) | Ignatavicius-5th-Edi..> | 2023-08-19 02:34 | 15K | |
![[IMG]](/icons/image2.gif) | Ignatavicius-5th-Edi..> | 2023-05-03 09:45 | 34K | |
![[IMG]](/icons/image2.gif) | Ignatavicius-8th-Med..> | 2023-08-05 05:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | Ignatavicius-8th-Med..> | 2023-08-11 01:46 | 24K | |
![[IMG]](/icons/image2.gif) | Ignatavicius-8th-Med..> | 2023-05-03 10:01 | 67K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-09 01:05 | 22K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-05-03 09:47 | 41K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-05 01:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-09 01:05 | 24K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-05-03 10:40 | 55K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-06 07:47 | 4.2K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-08-17 19:58 | 24K | |
![[IMG]](/icons/image2.gif) | Income_Tax_Fundament..> | 2023-05-03 10:29 | 55K | |
![[IMG]](/icons/image2.gif) | Information-Systems-..> | 2023-08-05 04:34 | 4.5K | |
![[IMG]](/icons/image2.gif) | Information-Systems-..> | 2023-08-08 06:43 | 29K | |
![[IMG]](/icons/image2.gif) | Information-Systems-..> | 2023-05-03 09:31 | 130K | |
![[IMG]](/icons/image2.gif) | Information-Technolo..> | 2023-08-05 15:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | Information-Technolo..> | 2023-08-08 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | Information-Technolo..> | 2023-05-03 10:05 | 37K | |
![[ ]](/icons/unknown.gif) | Inst-Resource-Test-B..> | 2023-05-03 09:20 | 82K | |
![[ ]](/icons/unknown.gif) | Instructor’s-Manua..> | 2023-05-03 13:43 | 20K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-08-05 14:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-08-06 13:11 | 14K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-05-03 10:57 | 35K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-08-06 05:43 | 2.8K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-08-11 14:00 | 14K | |
![[IMG]](/icons/image2.gif) | Intermediate-Account..> | 2023-05-03 10:56 | 35K | |
![[IMG]](/icons/image2.gif) | Intermediate-Microec..> | 2023-08-06 03:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | Intermediate-Microec..> | 2023-08-06 13:11 | 23K | |
![[IMG]](/icons/image2.gif) | Intermediate-Microec..> | 2023-05-03 09:31 | 60K | |
![[IMG]](/icons/image2.gif) | Intermediate_Account..> | 2023-05-03 11:01 | 45K | |
![[IMG]](/icons/image2.gif) | Internal-Auditing-As..> | 2023-08-06 03:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | Internal-Auditing-As..> | 2023-08-05 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | Internal-Auditing-As..> | 2023-05-03 10:31 | 33K | |
![[ ]](/icons/unknown.gif) | International-1_vers..> | 2023-05-04 02:22 | 194K | |
![[IMG]](/icons/image2.gif) | International-Financ..> | 2023-08-05 14:39 | 3.5K | |
![[IMG]](/icons/image2.gif) | International-Financ..> | 2023-08-06 08:47 | 19K | |
![[IMG]](/icons/image2.gif) | International-Financ..> | 2023-05-03 10:07 | 50K | |
![[IMG]](/icons/image2.gif) | International-Human-..> | 2023-08-06 05:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | International-Human-..> | 2023-08-19 00:17 | 24K | |
![[IMG]](/icons/image2.gif) | International-Human-..> | 2023-05-03 09:54 | 59K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-08-05 01:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-08-08 20:09 | 23K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-05-03 09:21 | 48K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-08-06 12:12 | 4.0K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-08-18 04:11 | 23K | |
![[IMG]](/icons/image2.gif) | International_Accoun..> | 2023-05-03 10:12 | 48K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-08-05 02:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-08-18 04:11 | 15K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-05-03 10:54 | 27K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-08-06 09:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-08-05 01:51 | 15K | |
![[IMG]](/icons/image2.gif) | International_Busine..> | 2023-05-03 09:11 | 27K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-08-05 02:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-08-08 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-05-03 10:19 | 29K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-08-08 20:07 | 3.2K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-08-08 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | International_Econom..> | 2023-05-03 10:18 | 29K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-06 07:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-09 12:14 | 17K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-05-03 10:09 | 34K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-06 00:58 | 3.4K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-19 21:49 | 17K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-05-03 11:22 | 34K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-07 13:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-19 21:49 | 26K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-05-03 10:05 | 33K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-09 04:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-08-09 12:14 | 26K | |
![[IMG]](/icons/image2.gif) | International_Financ..> | 2023-05-03 10:25 | 33K | |
![[IMG]](/icons/image2.gif) | International_Manage..> | 2023-08-09 02:50 | 3.9K | |
![[IMG]](/icons/image2.gif) | International_Manage..> | 2023-08-19 21:49 | 22K | |
![[IMG]](/icons/image2.gif) | International_Manage..> | 2023-05-03 10:28 | 177K | |
![[IMG]](/icons/image2.gif) | Interpersonal_Commun..> | 2023-08-05 03:39 | 3.8K | |
![[IMG]](/icons/image2.gif) | Interpersonal_Commun..> | 2023-08-18 08:58 | 19K | |
![[IMG]](/icons/image2.gif) | Interpersonal_Commun..> | 2023-05-03 10:14 | 47K | |
![[ ]](/icons/unknown.gif) | Introduction-to-Clin..> | 2023-05-03 11:02 | 152K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Corp..> | 2023-08-05 15:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Corp..> | 2023-08-08 06:27 | 20K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Corp..> | 2023-05-03 10:39 | 49K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Fina..> | 2023-08-06 16:00 | 4.0K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Fina..> | 2023-08-05 04:35 | 20K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Fina..> | 2023-05-03 10:44 | 45K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Gove..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Gove..> | 2023-08-16 08:16 | 20K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Gove..> | 2023-05-03 10:20 | 88K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Risk..> | 2023-08-06 04:10 | 3.8K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Risk..> | 2023-08-17 18:22 | 22K | |
![[IMG]](/icons/image2.gif) | Introduction-to-Risk..> | 2023-05-03 09:53 | 119K | |
![[ ]](/icons/layout.gif) | Introduction-to-Stat..> | 2023-05-03 10:10 | 197K | |
![[IMG]](/icons/image2.gif) | Introduction_to_Econ..> | 2023-05-04 01:48 | 16K | |
![[IMG]](/icons/image2.gif) | Introduction_to_Econ..> | 2023-05-03 10:20 | 16K | |
![[ ]](/icons/compressed.gif) | Introduction to Biom..> | 2023-05-04 01:57 | 115K | |
![[ ]](/icons/unknown.gif) | IntroductiontoBusine..> | 2023-05-04 02:22 | 70K | |
![[ ]](/icons/compressed.gif) | Introduction to Mech..> | 2023-05-03 09:21 | 11K | |
![[IMG]](/icons/image2.gif) | Introductory-Chemist..> | 2023-08-08 01:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | Introductory-Chemist..> | 2023-08-21 10:10 | 21K | |
![[IMG]](/icons/image2.gif) | Introductory-Chemist..> | 2023-05-03 10:26 | 99K | |
![[IMG]](/icons/image2.gif) | Introductory-Econome..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | Introductory-Econome..> | 2023-08-06 08:47 | 17K | |
![[IMG]](/icons/image2.gif) | Introductory-Econome..> | 2023-05-03 09:51 | 37K | |
![[IMG]](/icons/image2.gif) | Introductory-Statist..> | 2023-08-05 02:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | Introductory-Statist..> | 2023-08-20 18:55 | 24K | |
![[IMG]](/icons/image2.gif) | Introductory-Statist..> | 2023-05-04 02:23 | 75K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-08-06 05:44 | 4.6K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-08-12 04:51 | 26K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-05-03 11:19 | 61K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-08-05 17:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-08-12 04:51 | 20K | |
![[IMG]](/icons/image2.gif) | Introductory_Chemist..> | 2023-05-03 09:18 | 47K | |
![[IMG]](/icons/image2.gif) | Introductory_Medical..> | 2023-05-04 02:05 | 31K | |
![[ ]](/icons/unknown.gif) | Investing-in-TUFS.doc | 2023-05-03 09:23 | 91K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-08-05 19:10 | 3.5K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-08-20 18:55 | 20K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-05-03 10:40 | 44K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-08-06 08:47 | 20K | |
![[IMG]](/icons/image2.gif) | Investment-Analysis-..> | 2023-05-03 10:40 | 44K | |
![[IMG]](/icons/image2.gif) | Investments-10e-Mayo..> | 2023-08-06 12:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | Investments-10e-Mayo..> | 2023-08-06 08:47 | 19K | |
![[IMG]](/icons/image2.gif) | Investments-10e-Mayo..> | 2023-05-03 09:29 | 53K | |
![[IMG]](/icons/image2.gif) | Issues-and-Ethics-in..> | 2023-08-05 14:36 | 2.8K | |
![[IMG]](/icons/image2.gif) | Issues-and-Ethics-in..> | 2023-08-21 19:15 | 17K | |
![[IMG]](/icons/image2.gif) | Issues-and-Ethics-in..> | 2023-05-03 11:17 | 45K | |
![[ ]](/icons/unknown.gif) | JK2eSMCh1.docx | 2023-05-04 02:22 | 41K | |
![[ ]](/icons/unknown.gif) | JSW11eTBChapter-02.rtf | 2023-05-03 13:40 | 153K | |
![[ ]](/icons/unknown.gif) | JUDGE_CONNECTIONS_3e..> | 2023-05-03 10:03 | 92K | |
![[IMG]](/icons/image2.gif) | Jacobsen-2nd-Edition..> | 2023-08-05 05:29 | 3.9K | |
![[IMG]](/icons/image2.gif) | Jacobsen-2nd-Edition..> | 2023-08-24 03:49 | 21K | |
![[IMG]](/icons/image2.gif) | Jacobsen-2nd-Edition..> | 2023-05-03 09:52 | 59K | |
![[IMG]](/icons/image2.gif) | James-4th-Nursing-Ca..> | 2023-08-08 07:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | James-4th-Nursing-Ca..> | 2023-08-05 01:08 | 21K | |
![[IMG]](/icons/image2.gif) | James-4th-Nursing-Ca..> | 2023-05-03 10:14 | 54K | |
![[ ]](/icons/compressed.gif) | James-2012-4th-14557..> | 2023-05-03 10:14 | 5.3K | |
![[IMG]](/icons/image2.gif) | Jarvis-7e-Physical-E..> | 2023-08-06 05:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | Jarvis-7e-Physical-E..> | 2023-08-09 18:53 | 21K | |
![[IMG]](/icons/image2.gif) | Jarvis-7e-Physical-E..> | 2023-05-03 09:34 | 60K | |
![[IMG]](/icons/image2.gif) | Joel-Advanced-Practi..> | 2023-08-08 17:39 | 2.5K | |
![[IMG]](/icons/image2.gif) | Joel-Advanced-Practi..> | 2023-05-04 02:20 | 6.7K | |
![[IMG]](/icons/image2.gif) | Johnston10e11mr_nm2-..> | 2023-08-06 07:49 | 2.3K | |
![[IMG]](/icons/image2.gif) | Johnston10e11mr_nm2-..> | 2023-08-06 15:35 | 11K | |
![[IMG]](/icons/image2.gif) | Johnston10e11mr_nm2.jpg | 2023-05-03 10:00 | 22K | |
![[IMG]](/icons/image2.gif) | Joint-Structure-Func..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | Joint-Structure-Func..> | 2023-08-05 23:08 | 22K | |
![[IMG]](/icons/image2.gif) | Joint-Structure-Func..> | 2023-05-03 10:28 | 60K | |
![[ ]](/icons/unknown.gif) | KAIL7e_IRM_01.doc | 2023-05-03 10:25 | 190K | |
![[IMG]](/icons/image2.gif) | KGrHqNrkFGVYQjLwqBRp..> | 2023-05-03 09:52 | 7.8K | |
![[ ]](/icons/layout.gif) | KJElemDifEqBVPISM_28..> | 2023-05-03 10:09 | 50K | |
![[ ]](/icons/compressed.gif) | Kail6eTIF01a.zip | 2023-05-03 09:38 | 80K | |
![[ ]](/icons/compressed.gif) | Kail_TB_Ch2.zip | 2023-05-03 10:04 | 53K | |
![[ ]](/icons/unknown.gif) | Kalat_BioPsych_12e_I..> | 2023-05-03 10:51 | 49K | |
![[ ]](/icons/compressed.gif) | Kaplan_8e_TB_Chapter..> | 2023-05-03 09:55 | 19K | |
![[IMG]](/icons/image2.gif) | Kaplan_and_Sadocks_S..> | 2023-05-04 02:04 | 41K | |
![[ ]](/icons/compressed.gif) | Karp--Cell-and-Molec..> | 2023-05-03 09:25 | 25K | |
![[ ]](/icons/compressed.gif) | Kassimali_Chapter 02..> | 2023-05-03 11:19 | 96K | |
![[ ]](/icons/unknown.gif) | Kavanagh4e_TestBank_..> | 2023-05-04 02:15 | 32K | |
![[IMG]](/icons/image2.gif) | Keatings-3rd-Edition..> | 2023-08-05 16:23 | 3.5K | |
![[IMG]](/icons/image2.gif) | Keatings-3rd-Edition..> | 2023-08-08 22:03 | 21K | |
![[IMG]](/icons/image2.gif) | Keatings-3rd-Edition..> | 2023-05-03 09:52 | 49K | |
![[IMG]](/icons/image2.gif) | Kelly-BUSN-11th-506x..> | 2023-08-05 02:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | Kelly-BUSN-11th-506x..> | 2023-08-10 04:13 | 17K | |
![[IMG]](/icons/image2.gif) | Kelly-BUSN-11th-506x..> | 2023-05-04 02:19 | 53K | |
![[ ]](/icons/compressed.gif) | Kelly Chapter 01 Sol..> | 2023-05-03 09:35 | 1.1M | |
![[ ]](/icons/compressed.gif) | Kennedy--The-America..> | 2023-05-03 10:36 | 53K | |
![[ ]](/icons/unknown.gif) | Kenrick_TB_Ch1.docx | 2023-05-04 01:51 | 69K | |
![[IMG]](/icons/image2.gif) | Kerin11e13mb_nm2_fix..> | 2023-08-08 16:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | Kerin11e13mb_nm2_fix..> | 2023-08-18 03:24 | 24K | |
![[IMG]](/icons/image2.gif) | Kerin11e13mb_nm2_fix..> | 2023-05-03 10:32 | 62K | |
![[ ]](/icons/unknown.gif) | Ketchen_MSM_2.0_TIF_..> | 2023-05-03 14:03 | 108K | |
![[IMG]](/icons/image2.gif) | King1e10cc_over_nm2-..> | 2023-08-05 02:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | King1e10cc_over_nm2-..> | 2023-09-12 12:05 | 17K | |
![[IMG]](/icons/image2.gif) | King1e10cc_over_nm2.jpg | 2023-05-03 10:17 | 39K | |
![[ ]](/icons/unknown.gif) | KingSoP3e_TB_ch01.doc | 2023-05-03 10:27 | 283K | |
![[ ]](/icons/compressed.gif) | Kinicki9e_Chapter01_..> | 2023-05-04 01:48 | 90K | |
![[IMG]](/icons/image2.gif) | Kleppners-Advertisin..> | 2023-08-08 08:35 | 4.7K | |
![[IMG]](/icons/image2.gif) | Kleppners-Advertisin..> | 2023-08-27 04:27 | 32K | |
![[IMG]](/icons/image2.gif) | Kleppners-Advertisin..> | 2023-05-03 10:33 | 178K | |
![[IMG]](/icons/image2.gif) | Klug-Essentials-of-G..> | 2023-08-05 01:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | Klug-Essentials-of-G..> | 2023-08-05 03:40 | 20K | |
![[IMG]](/icons/image2.gif) | Klug-Essentials-of-G..> | 2023-05-03 09:31 | 92K | |
![[ ]](/icons/unknown.gif) | Kornblum_16e_Test_Ba..> | 2023-05-04 01:49 | 40K | |
![[IMG]](/icons/image2.gif) | Kozier-3rd-Canadian-..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | Kozier-3rd-Canadian-..> | 2023-08-13 03:13 | 20K | |
![[IMG]](/icons/image2.gif) | Kozier-3rd-Canadian-..> | 2023-05-03 09:46 | 43K | |
![[ ]](/icons/unknown.gif) | Kraft7e_Instructor-M..> | 2023-05-04 02:21 | 29K | |
![[ ]](/icons/compressed.gif) | Krauskoph--The-Physi..> | 2023-05-03 11:24 | 12K | |
![[ ]](/icons/layout.gif) | KrugWellsECPS3e_Micr..> | 2023-05-03 10:22 | 151K | |
![[ ]](/icons/compressed.gif) | Kubasek--Dynamic-Bus..> | 2023-05-03 10:50 | 74K | |
![[ ]](/icons/unknown.gif) | L1IM2-Solution-Manua..> | 2023-05-03 10:15 | 170K | |
![[ ]](/icons/layout.gif) | Lab-1-0132989999.pdf | 2023-05-03 10:27 | 216K | |
![[IMG]](/icons/image2.gif) | Labor-Relations-10e-..> | 2023-08-05 02:03 | 4.5K | |
![[IMG]](/icons/image2.gif) | Labor-Relations-10e-..> | 2023-08-30 07:22 | 27K | |
![[IMG]](/icons/image2.gif) | Labor-Relations-10e-..> | 2023-05-03 10:39 | 139K | |
![[ ]](/icons/unknown.gif) | Ladewig_8e_TIF_Ch01.doc | 2023-05-03 09:32 | 58K | |
![[IMG]](/icons/image2.gif) | Lakeside-Company-12e..> | 2023-08-05 01:14 | 3.1K | |
![[IMG]](/icons/image2.gif) | Lakeside-Company-12e..> | 2023-08-05 15:27 | 14K | |
![[IMG]](/icons/image2.gif) | Lakeside-Company-12e..> | 2023-05-03 10:28 | 56K | |
![[ ]](/icons/layout.gif) | LambertCh01New.pdf | 2023-05-03 09:35 | 80K | |
![[ ]](/icons/unknown.gif) | Lanen_FCA_6e_App_SM...> | 2023-05-04 02:03 | 123K | |
![[IMG]](/icons/image2.gif) | Larson5e11ms_nm2-100..> | 2023-08-05 06:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | Larson5e11ms_nm2-300..> | 2023-08-19 08:10 | 13K | |
![[IMG]](/icons/image2.gif) | Larson5e11ms_nm2.jpg | 2023-05-03 09:42 | 29K | |
![[ ]](/icons/layout.gif) | Lay-Analysis-5e-Solu..> | 2023-05-03 10:44 | 689K | |
![[IMG]](/icons/image2.gif) | LeMone-6e-260x300-1-..> | 2023-08-05 16:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | LeMone-6e-260x300-1.jpg | 2023-05-03 09:50 | 26K | |
![[IMG]](/icons/image2.gif) | LeMone-Burke-5th-Edi..> | 2023-08-05 16:28 | 2.6K | |
![[IMG]](/icons/image2.gif) | LeMone-Burke-5th-Edi..> | 2023-08-19 02:34 | 13K | |
![[IMG]](/icons/image2.gif) | LeMone-Burke-5th-Edi..> | 2023-05-03 09:52 | 28K | |
![[ ]](/icons/unknown.gif) | Leadership-And-Nursi..> | 2023-05-03 10:50 | 83K | |
![[ ]](/icons/compressed.gif) | Leadership-Roles-and..> | 2023-05-03 09:50 | 6.4K | |
![[IMG]](/icons/image2.gif) | Leadership_Roles_and..> | 2023-05-04 01:52 | 32K | |
![[IMG]](/icons/image2.gif) | Learning-and-Behavio..> | 2023-08-05 01:15 | 2.8K | |
![[IMG]](/icons/image2.gif) | Learning-and-Behavio..> | 2023-08-27 02:56 | 13K | |
![[IMG]](/icons/image2.gif) | Learning-and-Behavio..> | 2023-05-03 10:41 | 32K | |
![[IMG]](/icons/image2.gif) | Lehne-6th-Edition-Ph..> | 2023-08-06 10:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | Lehne-6th-Edition-Ph..> | 2023-08-08 16:38 | 12K | |
![[IMG]](/icons/image2.gif) | Lehne-6th-Edition-Ph..> | 2023-05-03 09:56 | 34K | |
![[IMG]](/icons/image2.gif) | Leifer-6th-Edition-I..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | Leifer-6th-Edition-I..> | 2023-08-19 12:40 | 15K | |
![[IMG]](/icons/image2.gif) | Leifer-6th-Edition-I..> | 2023-05-03 10:20 | 39K | |
![[ ]](/icons/unknown.gif) | Levine2e_Activities_..> | 2023-05-04 01:59 | 23K | |
![[IMG]](/icons/image2.gif) | Lewis-Medical-Surgic..> | 2023-08-05 05:30 | 2.6K | |
![[IMG]](/icons/image2.gif) | Lewis-Medical-Surgic..> | 2023-08-12 06:52 | 15K | |
![[IMG]](/icons/image2.gif) | Lewis-Medical-Surgic..> | 2023-05-03 09:33 | 34K | |
![[ ]](/icons/unknown.gif) | Lewis_TB_Ch-1.doc | 2023-05-03 09:41 | 80K | |
![[IMG]](/icons/image2.gif) | Lewiss_Medical-Surgi..> | 2023-05-04 02:07 | 30K | |
![[ ]](/icons/compressed.gif) | Lial_TestBank_Chapte..> | 2023-05-03 09:22 | 304K | |
![[IMG]](/icons/image2.gif) | Life_Span_Developmen..> | 2023-08-05 06:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | Life_Span_Developmen..> | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | Life_Span_Developmen..> | 2023-05-03 10:31 | 40K | |
![[IMG]](/icons/image2.gif) | Life_Span_Human_Deve..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | Life_Span_Human_Deve..> | 2023-08-08 16:38 | 12K | |
![[IMG]](/icons/image2.gif) | Life_Span_Human_Deve..> | 2023-05-03 09:34 | 24K | |
![[IMG]](/icons/image2.gif) | Lilienfeld-2nd-Canad..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Lilienfeld-2nd-Canad..> | 2023-08-09 06:03 | 14K | |
![[IMG]](/icons/image2.gif) | Lilienfeld-2nd-Canad..> | 2023-05-03 10:05 | 37K | |
![[ ]](/icons/unknown.gif) | Lind6ce_ISM_Ch01_FIN..> | 2023-05-03 11:12 | 46K | |
![[IMG]](/icons/image2.gif) | Lind8e13mb_nm22-100x..> | 2023-08-05 03:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | Lind8e13mb_nm22-300x..> | 2023-08-11 21:04 | 11K | |
![[IMG]](/icons/image2.gif) | Lind8e13mb_nm22.jpg | 2023-05-03 11:19 | 23K | |
![[IMG]](/icons/image2.gif) | Living-Religions-9th..> | 2023-08-08 07:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | Living-Religions-9th..> | 2023-08-09 09:15 | 13K | |
![[IMG]](/icons/image2.gif) | Living-Religions-9th..> | 2023-05-03 10:42 | 25K | |
![[ ]](/icons/compressed.gif) | Lodish6e_ch03.zip | 2023-05-03 10:21 | 12K | |
![[ ]](/icons/layout.gif) | Lodish7Chap02.indd_.pdf | 2023-05-03 10:20 | 43K | |
![[ ]](/icons/layout.gif) | Lodish_MolecularCell..> | 2023-05-03 13:44 | 40K | |
![[ ]](/icons/unknown.gif) | Longenecker_SBM19e_I..> | 2023-05-03 13:44 | 72K | |
![[ ]](/icons/compressed.gif) | Lutgens--Essentials-..> | 2023-05-03 10:46 | 134K | |
![[IMG]](/icons/image2.gif) | Luthans8e12mr_nm2-10..> | 2023-08-05 01:54 | 2.3K | |
![[IMG]](/icons/image2.gif) | Luthans8e12mr_nm2-30..> | 2023-08-06 08:47 | 14K | |
![[IMG]](/icons/image2.gif) | Luthans8e12mr_nm2.jpg | 2023-05-03 10:25 | 35K | |
![[IMG]](/icons/image2.gif) | Lutzs_Nutrition_and_..> | 2023-08-06 11:04 | 2.9K | |
![[IMG]](/icons/image2.gif) | Lutzs_Nutrition_and_..> | 2023-08-09 09:15 | 18K | |
![[IMG]](/icons/image2.gif) | Lutzs_Nutrition_and_..> | 2023-05-04 02:06 | 62K | |
![[IMG]](/icons/image2.gif) | M-Finance-3rd-Editio..> | 2023-08-06 11:04 | 4.1K | |
![[IMG]](/icons/image2.gif) | M-Finance-3rd-Editio..> | 2023-05-03 09:21 | 70K | |
![[ ]](/icons/compressed.gif) | M-Finance-3rd-Editio..> | 2023-05-03 09:21 | 9.3M | |
![[IMG]](/icons/image2.gif) | M00554_solution-manu..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | M00554_solution-manu..> | 2023-08-08 01:24 | 21K | |
![[IMG]](/icons/image2.gif) | M00554_solution-manu..> | 2023-05-03 10:14 | 24K | |
![[ ]](/icons/layout.gif) | M01_AGRE_5632_04_C01..> | 2023-05-04 02:02 | 136K | |
![[ ]](/icons/layout.gif) | M01_BENN6959_05_ISM_..> | 2023-05-04 01:53 | 112K | |
![[ ]](/icons/layout.gif) | M01_Bucher_DC_IRM_4e..> | 2023-05-03 09:23 | 131K | |
![[ ]](/icons/layout.gif) | M01_GIAN4254_01_IM_C..> | 2023-05-03 10:45 | 378K | |
![[ ]](/icons/layout.gif) | M01_HEWI2003_06_IM_C..> | 2023-05-03 11:00 | 216K | |
![[ ]](/icons/layout.gif) | M01_KNIG2461_04_ISM_..> | 2023-05-03 13:42 | 495K | |
![[ ]](/icons/unknown.gif) | M01_KNIG9404_ISM_C01..> | 2023-05-03 13:44 | 2.6M | |
![[ ]](/icons/layout.gif) | M01_KRUG8928_9E_IM_C..> | 2023-05-03 10:08 | 32K | |
![[ ]](/icons/layout.gif) | M01_MISH4491_12_IM_P..> | 2023-05-03 13:41 | 143K | |
![[ ]](/icons/unknown.gif) | M01_Moff8174_4E_IM_C..> | 2023-05-03 10:20 | 53K | |
![[ ]](/icons/unknown.gif) | M01_PARK_1714_11_CH0..> | 2023-05-03 10:57 | 170K | |
![[ ]](/icons/unknown.gif) | M01_RAMO4048_02_IRM_..> | 2023-05-04 02:14 | 78K | |
![[ ]](/icons/unknown.gif) | M01_RITT7420_12_CH01..> | 2023-05-03 09:50 | 73K | |
![[ ]](/icons/unknown.gif) | M01_SOLN8117_06_SM_C..> | 2023-05-03 10:47 | 72K | |
![[ ]](/icons/layout.gif) | M01_SULL9906_04_ISM_..> | 2023-05-04 01:52 | 1.8M | |
![[ ]](/icons/layout.gif) | M01_SULL_9592_07_CH0..> | 2023-05-03 09:57 | 1.2M | |
![[ ]](/icons/layout.gif) | M01_TAYL1971_11_ISM_..> | 2023-05-03 10:12 | 335K | |
![[ ]](/icons/layout.gif) | M01_TRIO4268_13_OTB_..> | 2023-05-04 02:09 | 200K | |
![[ ]](/icons/unknown.gif) | M01_TRO5770_03_IRM_C..> | 2023-05-03 11:17 | 157K | |
![[ ]](/icons/layout.gif) | M01_Toda3929_11E_IM_..> | 2023-05-04 02:24 | 48K | |
![[ ]](/icons/layout.gif) | M01_WATE3433_09_IE_C..> | 2023-05-03 09:56 | 508K | |
![[ ]](/icons/compressed.gif) | M01_WILS2076_07_IM_C..> | 2023-05-03 10:56 | 232K | |
![[ ]](/icons/compressed.gif) | M01_YOUN7066_13_ISM_..> | 2023-05-03 09:56 | 532K | |
![[ ]](/icons/layout.gif) | M02_Levi_13e_TB_741X..> | 2023-05-03 09:41 | 154K | |
![[ ]](/icons/unknown.gif) | M02_MART8542_02_EOC_..> | 2023-05-03 10:07 | 65K | |
![[ ]](/icons/compressed.gif) | M03_Levi_13e_ISM_634..> | 2023-05-03 11:17 | 3.9M | |
![[ ]](/icons/unknown.gif) | M11_MishEak_8E_IM_C0..> | 2023-05-03 09:38 | 41K | |
![[ ]](/icons/compressed.gif) | MA6e Solutions Manua..> | 2023-05-03 10:06 | 1.4M | |
![[IMG]](/icons/image2.gif) | MBA-Financial-Accoun..> | 2023-08-05 15:30 | 5.1K | |
![[IMG]](/icons/image2.gif) | MBA-Financial-Accoun..> | 2023-05-03 10:10 | 12K | |
![[ ]](/icons/compressed.gif) | ME12IM01.zip | 2023-05-03 09:36 | 17K | |
![[IMG]](/icons/image2.gif) | MF_4th_Edition_Test_..> | 2023-08-05 16:23 | 3.6K | |
![[IMG]](/icons/image2.gif) | MF_4th_Edition_Test_..> | 2023-08-09 09:15 | 22K | |
![[IMG]](/icons/image2.gif) | MF_4th_Edition_Test_..> | 2023-05-04 02:07 | 60K | |
![[IMG]](/icons/image2.gif) | MIS-Cases-Miller-4e-..> | 2023-08-06 11:15 | 4.2K | |
![[IMG]](/icons/image2.gif) | MIS-Cases-Miller-4e-..> | 2023-08-16 23:57 | 31K | |
![[IMG]](/icons/image2.gif) | MIS-Cases-Miller-4e.jpg | 2023-05-03 09:40 | 180K | |
![[ ]](/icons/unknown.gif) | MS12-TB01.doc | 2023-05-04 01:50 | 75K | |
![[ ]](/icons/compressed.gif) | MS13E_chapter_01.zip | 2023-05-03 11:05 | 12K | |
![[ ]](/icons/layout.gif) | MWH3_Chap_02_HW_Solu..> | 2023-05-04 02:18 | 140K | |
![[IMG]](/icons/image2.gif) | M_Marketing_Grewal_L..> | 2023-08-06 07:48 | 4.1K | |
![[IMG]](/icons/image2.gif) | M_Marketing_Grewal_L..> | 2023-08-27 09:09 | 24K | |
![[IMG]](/icons/image2.gif) | M_Marketing_Grewal_L..> | 2023-05-03 10:30 | 52K | |
![[ ]](/icons/layout.gif) | M_ROSS_4789_09_CH01.pdf | 2023-05-03 10:51 | 66K | |
![[ ]](/icons/unknown.gif) | M_SIMO1726_05_C01_PR..> | 2023-05-03 09:57 | 120K | |
![[ ]](/icons/compressed.gif) | Machine Elements in ..> | 2023-05-03 10:45 | 46K | |
![[IMG]](/icons/image2.gif) | Macionis-5th-Edition..> | 2023-08-09 10:11 | 1.9K | |
![[IMG]](/icons/image2.gif) | Macionis-5th-Edition..> | 2023-08-15 16:37 | 9.0K | |
![[IMG]](/icons/image2.gif) | Macionis-5th-Edition..> | 2023-05-03 09:53 | 22K | |
![[IMG]](/icons/image2.gif) | Macionis-Sociology-1..> | 2023-08-06 07:48 | 5.1K | |
![[IMG]](/icons/image2.gif) | Macionis-Sociology-1..> | 2023-08-30 20:27 | 27K | |
![[IMG]](/icons/image2.gif) | Macionis-Sociology-1..> | 2023-05-03 10:25 | 142K | |
![[ ]](/icons/unknown.gif) | Macionis15e_Society_..> | 2023-05-04 01:51 | 227K | |
![[IMG]](/icons/image2.gif) | Macroeconomics-Theor..> | 2023-08-06 10:19 | 2.4K | |
![[IMG]](/icons/image2.gif) | Macroeconomics-Theor..> | 2023-08-05 01:12 | 12K | |
![[IMG]](/icons/image2.gif) | Macroeconomics-Theor..> | 2023-05-03 09:07 | 59K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_Parki..> | 2023-08-05 01:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_Parki..> | 2023-08-19 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_Parki..> | 2023-05-03 10:57 | 35K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_abel_..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_abel_..> | 2023-08-05 01:51 | 17K | |
![[IMG]](/icons/image2.gif) | Macroeconomics_abel_..> | 2023-05-03 09:11 | 35K | |
![[ ]](/icons/compressed.gif) | Mader--Human-Biology..> | 2023-05-03 11:02 | 39K | |
![[IMG]](/icons/image2.gif) | Mader-Biology-11e-10..> | 2023-08-05 16:16 | 4.1K | |
![[IMG]](/icons/image2.gif) | Mader-Biology-11e-30..> | 2023-08-29 02:09 | 21K | |
![[IMG]](/icons/image2.gif) | Mader-Biology-11e.jpg | 2023-05-03 11:00 | 44K | |
![[IMG]](/icons/image2.gif) | MaderHB12e12lbj_nm2-..> | 2023-08-05 16:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | MaderHB12e12lbj_nm2-..> | 2023-08-25 00:15 | 25K | |
![[IMG]](/icons/image2.gif) | MaderHB12e12lbj_nm2.jpg | 2023-05-03 10:48 | 75K | |
![[ ]](/icons/compressed.gif) | Magill--Motor-Learni..> | 2023-05-03 10:21 | 8.0K | |
![[IMG]](/icons/image2.gif) | Making-Hard-Decision..> | 2023-08-05 06:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | Making-Hard-Decision..> | 2023-05-03 10:43 | 8.2K | |
![[ ]](/icons/unknown.gif) | Management-1_version..> | 2023-05-04 02:27 | 27K | |
![[IMG]](/icons/image2.gif) | Management-1e-Gomez-..> | 2023-08-05 05:31 | 3.6K | |
![[IMG]](/icons/image2.gif) | Management-1e-Gomez-..> | 2023-09-08 14:47 | 17K | |
![[IMG]](/icons/image2.gif) | Management-1e-Gomez-..> | 2023-05-03 10:05 | 91K | |
![[IMG]](/icons/image2.gif) | Management-9e-Daft-1..> | 2023-08-05 03:35 | 1.8K | |
![[IMG]](/icons/image2.gif) | Management-9e-Daft-3..> | 2023-09-04 20:54 | 8.3K | |
![[IMG]](/icons/image2.gif) | Management-9e-Daft.jpg | 2023-05-03 11:25 | 19K | |
![[IMG]](/icons/image2.gif) | Management-Now-2nd-E..> | 2023-08-06 12:16 | 2.9K | |
![[IMG]](/icons/image2.gif) | Management-Now-2nd-E..> | 2023-08-20 18:35 | 12K | |
![[IMG]](/icons/image2.gif) | Management-Now-2nd-E..> | 2023-05-03 10:07 | 35K | |
![[IMG]](/icons/image2.gif) | Management_Daft_12th..> | 2023-08-07 13:26 | 3.2K | |
![[IMG]](/icons/image2.gif) | Management_Daft_12th..> | 2023-08-13 16:54 | 17K | |
![[IMG]](/icons/image2.gif) | Management_Daft_12th..> | 2023-05-03 11:21 | 39K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-08-08 08:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-08-20 18:35 | 20K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-05-03 09:57 | 47K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-08-06 10:17 | 3.6K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-08-17 20:52 | 20K | |
![[IMG]](/icons/image2.gif) | Management_Informati..> | 2023-05-03 09:23 | 47K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-08-06 08:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-08-20 18:35 | 13K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-05-03 10:20 | 26K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-08-05 03:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-08-17 20:52 | 13K | |
![[IMG]](/icons/image2.gif) | Management_Leading_a..> | 2023-05-03 10:03 | 26K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-08-05 02:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-08-12 07:35 | 14K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-05-03 10:53 | 25K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-08-05 04:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-08-12 07:35 | 14K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_1..> | 2023-05-03 10:52 | 25K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_C..> | 2023-08-05 05:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_C..> | 2023-08-12 07:35 | 18K | |
![[IMG]](/icons/image2.gif) | Management_Robbins_C..> | 2023-05-03 10:37 | 39K | |
![[ ]](/icons/unknown.gif) | Managerial-01_versio..> | 2023-05-04 01:53 | 73K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-08-06 13:06 | 3.7K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-08-08 08:38 | 21K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-05-03 11:12 | 52K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-08-08 08:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-09-08 20:36 | 21K | |
![[IMG]](/icons/image2.gif) | Managerial-ACCT2-Saw..> | 2023-05-03 11:07 | 52K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-05 14:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-05-03 10:06 | 4.3K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-06 07:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-08 08:38 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-05-03 10:14 | 45K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-05 08:50 | 3.2K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-09-08 14:47 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-05-03 09:33 | 45K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-05 13:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-08-08 08:38 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Accountin..> | 2023-05-03 10:32 | 49K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-08-05 15:32 | 4.0K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-08-08 08:38 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-05-03 11:11 | 71K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-09-08 20:36 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Decision-..> | 2023-05-03 09:28 | 71K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-08-06 05:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-09-08 20:36 | 19K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-05-03 10:12 | 47K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-08-08 06:46 | 4.4K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-08-09 09:11 | 27K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-05-03 11:26 | 130K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-08-05 02:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | Managerial-Economics..> | 2023-05-03 09:36 | 8.1K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-05-03 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-08-12 07:35 | 13K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-05-03 09:31 | 25K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-08-19 04:13 | 13K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-05-03 10:34 | 25K | |
![[IMG]](/icons/image2.gif) | Managerial_Accountin..> | 2023-05-03 10:11 | 13K | |
![[IMG]](/icons/image2.gif) | Managing-Quality-5e-..> | 2023-08-06 09:42 | 3.7K | |
![[IMG]](/icons/image2.gif) | Managing-Quality-5e-..> | 2023-08-24 16:37 | 19K | |
![[IMG]](/icons/image2.gif) | Managing-Quality-5e-..> | 2023-05-03 11:05 | 89K | |
![[IMG]](/icons/image2.gif) | Managing-for-Quality..> | 2023-08-08 06:39 | 2.4K | |
![[IMG]](/icons/image2.gif) | Managing-for-Quality..> | 2023-08-09 09:11 | 22K | |
![[IMG]](/icons/image2.gif) | Managing-for-Quality..> | 2023-05-03 09:37 | 80K | |
![[IMG]](/icons/image2.gif) | Managing_Human_Resou..> | 2023-08-06 11:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | Managing_Human_Resou..> | 2023-08-20 18:36 | 20K | |
![[IMG]](/icons/image2.gif) | Managing_Human_Resou..> | 2023-05-03 09:31 | 50K | |
![[ ]](/icons/unknown.gif) | Mankiw7e_TB_Ch01-1.docx | 2023-05-03 10:14 | 610K | |
![[ ]](/icons/unknown.gif) | Mankiw7e_TB_Ch01.docx | 2023-05-03 11:26 | 610K | |
![[ ]](/icons/unknown.gif) | Mankiw7e_TB_Ch02.docx | 2023-05-03 10:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | Mann_Business-Law_18..> | 2023-05-04 02:22 | 193K | |
![[ ]](/icons/compressed.gif) | Mann_SR16e_TB_Ch01.zip | 2023-05-03 10:19 | 61K | |
![[IMG]](/icons/image2.gif) | Manual_of_Structural..> | 2023-08-05 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | Manual_of_Structural..> | 2023-08-20 18:36 | 14K | |
![[IMG]](/icons/image2.gif) | Manual_of_Structural..> | 2023-05-03 09:40 | 25K | |
![[IMG]](/icons/image2.gif) | Marketing_Kerin_12th..> | 2023-08-06 05:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | Marketing_Kerin_12th..> | 2023-08-20 18:36 | 21K | |
![[IMG]](/icons/image2.gif) | Marketing_Kerin_12th..> | 2023-05-03 11:17 | 49K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_8..> | 2023-08-05 02:55 | 4.3K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_8..> | 2023-08-12 04:51 | 28K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_8..> | 2023-05-04 02:07 | 100K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_B..> | 2023-08-05 04:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_B..> | 2023-08-12 04:51 | 25K | |
![[IMG]](/icons/image2.gif) | Marketing_Research_B..> | 2023-05-03 10:27 | 44K | |
![[IMG]](/icons/image2.gif) | Marketing_by_Pride_2..> | 2023-08-05 01:09 | 2.4K | |
![[IMG]](/icons/image2.gif) | Marketing_by_Pride_2..> | 2023-08-20 18:36 | 15K | |
![[IMG]](/icons/image2.gif) | Marketing_by_Pride_2..> | 2023-05-03 10:26 | 30K | |
![[IMG]](/icons/image2.gif) | Marriages_and_Famili..> | 2023-08-06 12:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | Marriages_and_Famili..> | 2023-08-12 04:51 | 21K | |
![[IMG]](/icons/image2.gif) | Marriages_and_Famili..> | 2023-05-03 10:28 | 50K | |
![[ ]](/icons/unknown.gif) | Marshall12e_Chapter0..> | 2023-05-04 02:20 | 23K | |
![[ ]](/icons/unknown.gif) | Marshall_12e_IMSM_Ch..> | 2023-05-04 02:21 | 38K | |
![[IMG]](/icons/image2.gif) | Mason-6th-Policy-and..> | 2023-08-08 20:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | Mason-6th-Policy-and..> | 2023-08-05 01:08 | 16K | |
![[IMG]](/icons/image2.gif) | Mason-6th-Policy-and..> | 2023-05-03 10:14 | 42K | |
![[ ]](/icons/compressed.gif) | Mason-2013-6th-03232..> | 2023-05-03 10:14 | 10K | |
![[ ]](/icons/unknown.gif) | Mason2e_Chapter01_TB..> | 2023-05-03 13:42 | 75K | |
![[ ]](/icons/compressed.gif) | Materials for Civil ..> | 2023-05-04 02:02 | 212K | |
![[ ]](/icons/compressed.gif) | Maternal_Child_Nursi..> | 2023-05-03 11:24 | 650K | |
![[IMG]](/icons/image2.gif) | Maternal_and_Child_N..> | 2023-08-06 10:18 | 3.0K | |
![[IMG]](/icons/image2.gif) | Maternal_and_Child_N..> | 2023-08-17 17:25 | 15K | |
![[IMG]](/icons/image2.gif) | Maternal_and_Child_N..> | 2023-05-03 10:45 | 34K | |
![[IMG]](/icons/image2.gif) | Maternity_and_Pediat..> | 2023-08-05 05:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | Maternity_and_Pediat..> | 2023-08-06 16:00 | 21K | |
![[IMG]](/icons/image2.gif) | Maternity_and_Pediat..> | 2023-05-04 02:05 | 49K | |
![[ ]](/icons/compressed.gif) | Mathews_4e_TIF_ch02.zip | 2023-05-03 10:07 | 43K | |
![[IMG]](/icons/image2.gif) | Matrix-Analysis-of-S..> | 2023-08-05 06:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | Matrix-Analysis-of-S..> | 2023-08-09 10:13 | 23K | |
![[IMG]](/icons/image2.gif) | Matrix-Analysis-of-S..> | 2023-05-03 11:19 | 57K | |
![[IMG]](/icons/image2.gif) | Mauk-Gerontological-..> | 2023-05-03 10:23 | 7.9K | |
![[ ]](/icons/unknown.gif) | MazurTIF1-7e.doc | 2023-05-03 10:26 | 57K | |
![[ ]](/icons/compressed.gif) | McCance-Pathophysiol..> | 2023-05-03 10:48 | 687K | |
![[IMG]](/icons/image2.gif) | McConnell10e13jl_nm2..> | 2023-08-05 16:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | McConnell10e13jl_nm2..> | 2023-08-17 00:57 | 13K | |
![[IMG]](/icons/image2.gif) | McConnell10e13jl_nm2..> | 2023-05-03 10:49 | 29K | |
![[IMG]](/icons/image2.gif) | McConnell19e12ms_Mic..> | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | McConnell19e12ms_Mic..> | 2023-08-15 09:54 | 13K | |
![[IMG]](/icons/image2.gif) | McConnell19e12ms_Mic..> | 2023-05-03 09:41 | 32K | |
![[ ]](/icons/unknown.gif) | McInnes_4e_TIF_ch01.doc | 2023-05-03 09:42 | 118K | |
![[ ]](/icons/compressed.gif) | McKenzie_Clin_Lab_He..> | 2023-05-03 09:38 | 70K | |
![[ ]](/icons/unknown.gif) | McMahan_1ce_TIF_ch01..> | 2023-05-03 10:25 | 86K | |
![[IMG]](/icons/image2.gif) | McShane-7th-Organiza..> | 2023-08-06 12:57 | 2.3K | |
![[IMG]](/icons/image2.gif) | McShane-7th-Organiza..> | 2023-08-05 01:08 | 12K | |
![[IMG]](/icons/image2.gif) | McShane-7th-Organiza..> | 2023-05-03 10:11 | 28K | |
![[IMG]](/icons/image2.gif) | Mcshane-8th-Edition-..> | 2023-08-08 02:53 | 3.4K | |
![[IMG]](/icons/image2.gif) | Mcshane-8th-Edition-..> | 2023-08-06 13:11 | 17K | |
![[IMG]](/icons/image2.gif) | Mcshane-8th-Edition-..> | 2023-05-03 10:10 | 42K | |
![[IMG]](/icons/image2.gif) | Measuring-and-Managi..> | 2023-08-06 11:58 | 2.4K | |
![[IMG]](/icons/image2.gif) | Measuring-and-Managi..> | 2023-05-03 11:09 | 8.0K | |
![[IMG]](/icons/image2.gif) | Mechanical-Ventilati..> | 2023-08-05 03:41 | 14K | |
![[IMG]](/icons/image2.gif) | Mechanical-Ventilati..> | 2023-05-04 02:17 | 37K | |
![[IMG]](/icons/image2.gif) | Mechanical-Vibration..> | 2023-08-05 14:39 | 3.7K | |
![[IMG]](/icons/image2.gif) | Mechanical-Vibration..> | 2023-08-12 15:36 | 22K | |
![[IMG]](/icons/image2.gif) | Mechanical-Vibration..> | 2023-05-03 09:35 | 59K | |
![[IMG]](/icons/image2.gif) | Mechanics_of_Materia..> | 2023-08-06 04:51 | 4.5K | |
![[IMG]](/icons/image2.gif) | Mechanics_of_Materia..> | 2023-08-19 07:17 | 28K | |
![[IMG]](/icons/image2.gif) | Mechanics_of_Materia..> | 2023-05-03 10:24 | 64K | |
![[IMG]](/icons/image2.gif) | Medical-Assisting-Ad..> | 2023-08-05 15:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | Medical-Assisting-Ad..> | 2023-08-12 06:52 | 20K | |
![[IMG]](/icons/image2.gif) | Medical-Assisting-Ad..> | 2023-05-04 01:49 | 47K | |
![[IMG]](/icons/image2.gif) | Medical-Dosage-Calcu..> | 2023-08-05 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | Medical-Dosage-Calcu..> | 2023-08-12 06:52 | 20K | |
![[IMG]](/icons/image2.gif) | Medical-Dosage-Calcu..> | 2023-05-03 10:13 | 101K | |
![[ ]](/icons/compressed.gif) | Medical-Surgical-Nur..> | 2023-05-03 10:11 | 647K | |
![[IMG]](/icons/image2.gif) | Medical-Surgical-Nur..> | 2023-08-05 03:39 | 15K | |
![[IMG]](/icons/image2.gif) | Medical-Surgical-Nur..> | 2023-05-03 09:48 | 47K | |
![[ ]](/icons/unknown.gif) | Medical-Surgical-Nur..> | 2023-05-03 09:59 | 106K | |
![[IMG]](/icons/image2.gif) | Medical-Surgical_Nur..> | 2023-05-04 02:07 | 34K | |
![[IMG]](/icons/image2.gif) | Medical-Terminology-..> | 2023-08-08 07:32 | 3.8K | |
![[IMG]](/icons/image2.gif) | Medical-Terminology-..> | 2023-08-12 06:52 | 19K | |
![[IMG]](/icons/image2.gif) | Medical-Terminology-..> | 2023-05-03 10:50 | 100K | |
![[IMG]](/icons/image2.gif) | Medical_Surgical_Nur..> | 2023-08-05 05:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | Medical_Surgical_Nur..> | 2023-05-03 09:59 | 13K | |
![[IMG]](/icons/image2.gif) | Meiner-5th-Edition-G..> | 2023-08-09 02:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | Meiner-5th-Edition-G..> | 2023-08-09 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | Meiner-5th-Edition-G..> | 2023-05-03 10:05 | 45K | |
![[ ]](/icons/unknown.gif) | Mello_5e_CH01_IM.doc | 2023-05-03 11:16 | 1.3M | |
![[IMG]](/icons/image2.gif) | Memmlers_The_Human_B..> | 2023-05-04 02:05 | 23K | |
![[IMG]](/icons/image2.gif) | MentalHealth_2016A-3..> | 2023-05-04 01:49 | 15K | |
![[ ]](/icons/layout.gif) | MentalHealth_2016A_S..> | 2023-05-04 01:49 | 476K | |
![[IMG]](/icons/image2.gif) | MentalHealth_2016B-3..> | 2023-05-04 01:48 | 15K | |
![[ ]](/icons/layout.gif) | MentalHealth_2016B_S..> | 2023-05-04 01:48 | 445K | |
![[IMG]](/icons/image2.gif) | Merkow-Information-S..> | 2023-08-05 01:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | Merkow-Information-S..> | 2023-05-03 09:41 | 22K | |
![[ ]](/icons/compressed.gif) | Merkow-Information-S..> | 2023-05-03 09:41 | 19K | |
![[ ]](/icons/unknown.gif) | Messier11e_Chapter-0..> | 2023-05-03 11:16 | 29K | |
![[ ]](/icons/unknown.gif) | Messier_11eSM_CH_1.docx | 2023-05-03 11:17 | 34K | |
![[ ]](/icons/compressed.gif) | Micro CH01.zip | 2023-05-03 10:13 | 31K | |
![[ ]](/icons/unknown.gif) | Micro_9780135335444_..> | 2023-05-03 13:43 | 1.5M | |
![[ ]](/icons/unknown.gif) | Micro_9780135335444_..> | 2023-05-03 13:43 | 283K | |
![[IMG]](/icons/image2.gif) | Microbiology-Evolvin..> | 2023-08-05 02:45 | 4.5K | |
![[IMG]](/icons/image2.gif) | Microbiology-Evolvin..> | 2023-08-06 16:00 | 24K | |
![[IMG]](/icons/image2.gif) | Microbiology-Evolvin..> | 2023-05-03 11:13 | 53K | |
![[IMG]](/icons/image2.gif) | Microbiology-Intro-1..> | 2023-08-05 01:51 | 5.9K | |
![[IMG]](/icons/image2.gif) | Microbiology-Intro-1..> | 2023-08-06 17:25 | 39K | |
![[IMG]](/icons/image2.gif) | Microbiology-Intro-1..> | 2023-05-03 11:13 | 185K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-08-08 21:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-08-06 16:00 | 18K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-05-04 02:08 | 50K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-08-06 03:55 | 2.4K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-08-12 04:51 | 11K | |
![[IMG]](/icons/image2.gif) | Microbiology_A_Syste..> | 2023-05-03 09:58 | 18K | |
![[IMG]](/icons/image2.gif) | Microeconomics-4e-Be..> | 2023-08-05 04:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | Microeconomics-4e-Be..> | 2023-08-15 09:54 | 21K | |
![[IMG]](/icons/image2.gif) | Microeconomics-4e-Be..> | 2023-05-04 01:58 | 64K | |
![[IMG]](/icons/image2.gif) | Microeconomics-9e-Pa..> | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | Microeconomics-9e-Pa..> | 2023-08-15 05:19 | 13K | |
![[IMG]](/icons/image2.gif) | Microeconomics-9e-Pa..> | 2023-05-04 02:04 | 36K | |
![[IMG]](/icons/image2.gif) | Microeconomics_1st_G..> | 2023-08-06 09:43 | 2.6K | |
![[IMG]](/icons/image2.gif) | Microeconomics_1st_G..> | 2023-08-08 16:42 | 13K | |
![[IMG]](/icons/image2.gif) | Microeconomics_1st_G..> | 2023-05-03 10:41 | 126K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Krugm..> | 2023-08-05 04:34 | 4.7K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Krugm..> | 2023-05-03 09:19 | 31K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Krugm..> | 2023-08-05 17:17 | 4.7K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Krugm..> | 2023-05-03 10:22 | 31K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-08-06 01:47 | 2.1K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-08-20 21:43 | 13K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-05-03 09:57 | 32K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-08-06 11:18 | 2.1K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-08-08 16:42 | 13K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Perlo..> | 2023-05-03 10:24 | 32K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-08-06 07:46 | 2.5K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-08-20 21:43 | 15K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-05-03 11:10 | 30K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-08-05 01:09 | 2.5K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-08-08 16:42 | 15K | |
![[IMG]](/icons/image2.gif) | Microeconomics_Theor..> | 2023-05-03 11:10 | 30K | |
![[ ]](/icons/compressed.gif) | Miller--Business-Law..> | 2023-05-03 10:20 | 68K | |
![[IMG]](/icons/image2.gif) | Miller-The-Legal-Env..> | 2023-08-06 08:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | Miller-The-Legal-Env..> | 2023-09-14 19:34 | 22K | |
![[IMG]](/icons/image2.gif) | Miller-The-Legal-Env..> | 2023-05-04 02:22 | 68K | |
![[ ]](/icons/unknown.gif) | Miller_LITE_17e_IM_C..> | 2023-05-03 09:34 | 270K | |
![[IMG]](/icons/image2.gif) | Mintz2e11mr_nm2-100x..> | 2023-08-08 22:56 | 2.4K | |
![[IMG]](/icons/image2.gif) | Mintz2e11mr_nm2-300x..> | 2023-08-17 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | Mintz2e11mr_nm2.jpg | 2023-05-03 09:52 | 33K | |
![[ ]](/icons/compressed.gif) | Mistovich_10e_TB-ch0..> | 2023-05-03 09:55 | 21K | |
![[IMG]](/icons/image2.gif) | Modern-Database-Mana..> | 2023-08-05 01:54 | 4.7K | |
![[IMG]](/icons/image2.gif) | Modern-Database-Mana..> | 2023-10-03 21:37 | 28K | |
![[IMG]](/icons/image2.gif) | Modern-Database-Mana..> | 2023-05-03 09:57 | 115K | |
![[IMG]](/icons/image2.gif) | Modern-Systems-Analy..> | 2023-08-05 15:22 | 4.0K | |
![[IMG]](/icons/image2.gif) | Modern-Systems-Analy..> | 2023-09-25 08:34 | 18K | |
![[IMG]](/icons/image2.gif) | Modern-Systems-Analy..> | 2023-05-03 09:42 | 76K | |
![[ ]](/icons/unknown.gif) | Module_01-9780357025..> | 2023-05-04 02:09 | 28K | |
![[ ]](/icons/unknown.gif) | Module_01__Digital_C..> | 2023-05-04 02:29 | 0 | |
![[ ]](/icons/layout.gif) | Moisio_SimClaim_Case..> | 2023-05-03 09:42 | 1.3M | |
![[IMG]](/icons/image2.gif) | Molecular_Cell_Biolo..> | 2023-08-06 04:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | Molecular_Cell_Biolo..> | 2023-08-12 04:51 | 24K | |
![[IMG]](/icons/image2.gif) | Molecular_Cell_Biolo..> | 2023-05-03 10:20 | 186K | |
![[IMG]](/icons/image2.gif) | Molecular_Cell_Biolo..> | 2023-05-03 10:21 | 18K | |
![[IMG]](/icons/image2.gif) | Molloy-6th-Edition-E..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | Molloy-6th-Edition-E..> | 2023-08-13 20:42 | 18K | |
![[IMG]](/icons/image2.gif) | Molloy-6th-Edition-E..> | 2023-05-03 09:36 | 47K | |
![[IMG]](/icons/image2.gif) | Money-Banking-and-Fi..> | 2023-08-06 13:11 | 3.0K | |
![[IMG]](/icons/image2.gif) | Money-Banking-and-Fi..> | 2023-09-25 08:34 | 17K | |
![[IMG]](/icons/image2.gif) | Money-Banking-and-Fi..> | 2023-05-03 09:19 | 42K | |
![[IMG]](/icons/image2.gif) | Moore-The-Developing..> | 2023-08-07 05:32 | 13K | |
![[IMG]](/icons/image2.gif) | Moore-The-Developing..> | 2023-05-04 02:18 | 33K | |
![[IMG]](/icons/image2.gif) | Morris-6th-Edition-C..> | 2023-08-06 08:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | Morris-6th-Edition-C..> | 2023-08-08 07:33 | 16K | |
![[IMG]](/icons/image2.gif) | Morris-6th-Edition-C..> | 2023-05-03 09:59 | 43K | |
![[IMG]](/icons/image2.gif) | Motivation-6e-Petri-..> | 2023-08-05 16:16 | 2.1K | |
![[IMG]](/icons/image2.gif) | Motivation-6e-Petri-..> | 2023-09-06 23:57 | 11K | |
![[IMG]](/icons/image2.gif) | Motivation-6e-Petri.jpg | 2023-05-03 10:19 | 25K | |
![[IMG]](/icons/image2.gif) | Multinational-Busine..> | 2023-08-06 12:16 | 15K | |
![[IMG]](/icons/image2.gif) | Multinational-Busine..> | 2023-05-04 02:17 | 43K | |
![[IMG]](/icons/image2.gif) | Multinational-Busine..> | 2023-08-05 16:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | Multinational-Busine..> | 2023-09-04 21:53 | 23K | |
![[IMG]](/icons/image2.gif) | Multinational-Busine..> | 2023-05-03 09:59 | 125K | |
![[IMG]](/icons/image2.gif) | Multinational-Financ..> | 2023-08-05 14:40 | 11K | |
![[IMG]](/icons/image2.gif) | Multinational-Financ..> | 2023-05-04 02:14 | 31K | |
![[ ]](/icons/unknown.gif) | Multiple-Choice-Ques..> | 2023-05-03 10:27 | 72K | |
![[IMG]](/icons/image2.gif) | Music_An_Appreciatio..> | 2023-08-06 12:56 | 3.4K | |
![[IMG]](/icons/image2.gif) | Music_An_Appreciatio..> | 2023-08-08 17:46 | 17K | |
![[IMG]](/icons/image2.gif) | Music_An_Appreciatio..> | 2023-05-03 09:56 | 33K | |
![[IMG]](/icons/image2.gif) | NHC7cnSqTNk6O3ZhASKv..> | 2023-08-06 05:44 | 3.8K | |
![[IMG]](/icons/image2.gif) | NHC7cnSqTNk6O3ZhASKv..> | 2023-08-27 02:51 | 21K | |
![[IMG]](/icons/image2.gif) | NHC7cnSqTNk6O3ZhASKv..> | 2023-05-03 10:21 | 45K | |
![[ ]](/icons/unknown.gif) | Nelms_4e_IM_ch01.docx | 2023-05-03 10:55 | 31K | |
![[IMG]](/icons/image2.gif) | Nesters-Microbiology..> | 2023-08-07 00:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | Nesters-Microbiology..> | 2023-08-12 04:51 | 24K | |
![[IMG]](/icons/image2.gif) | Nesters-Microbiology..> | 2023-05-04 01:50 | 66K | |
![[ ]](/icons/compressed.gif) | Nevid_Concepts and A..> | 2023-05-03 10:39 | 45K | |
![[ ]](/icons/layout.gif) | Nevid_Ess_4e_TB_Ch01..> | 2023-05-03 10:34 | 179K | |
![[ ]](/icons/unknown.gif) | Nevid_ch02_TIF.docx | 2023-05-03 10:15 | 165K | |
![[ ]](/icons/unknown.gif) | New-Microsoft-Word-D..> | 2023-05-04 02:01 | 20K | |
![[ ]](/icons/unknown.gif) | NewestTestBank01-Tes..> | 2023-05-03 10:23 | 52K | |
![[IMG]](/icons/image2.gif) | Nies-6th-Edition-Com..> | 2023-08-05 15:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | Nies-6th-Edition-Com..> | 2023-08-10 13:41 | 21K | |
![[IMG]](/icons/image2.gif) | Nies-6th-Edition-Com..> | 2023-05-03 09:56 | 51K | |
![[IMG]](/icons/image2.gif) | Noe5e14imb_nm22-100x..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | Noe5e14imb_nm22-300x..> | 2023-08-06 10:20 | 21K | |
![[IMG]](/icons/image2.gif) | Noe5e14imb_nm22.jpg | 2023-05-03 09:52 | 52K | |
![[IMG]](/icons/image2.gif) | Noe7epv10_nm2-100x10..> | 2023-08-05 16:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | Noe7epv10_nm2-300x30..> | 2023-08-27 15:48 | 21K | |
![[IMG]](/icons/image2.gif) | Noe7epv10_nm2.jpg | 2023-05-03 10:21 | 48K | |
![[ ]](/icons/unknown.gif) | Noreen-1_version1.docx | 2023-05-04 02:04 | 223K | |
![[ ]](/icons/compressed.gif) | Notaros_MATLAB-Based..> | 2023-05-03 09:54 | 93K | |
![[ ]](/icons/layout.gif) | Nursing-Health-Asses..> | 2023-05-04 01:57 | 117K | |
![[IMG]](/icons/image2.gif) | Nursing-Research-Woo..> | 2023-08-06 11:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | Nursing-Research-Woo..> | 2023-08-05 01:13 | 14K | |
![[IMG]](/icons/image2.gif) | Nursing-Research-Woo..> | 2023-05-03 09:11 | 35K | |
![[IMG]](/icons/image2.gif) | Nursing_Informatics_..> | 2023-05-04 02:04 | 22K | |
![[IMG]](/icons/image2.gif) | Nursing_Now_Todays_I..> | 2023-08-05 15:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | Nursing_Now_Todays_I..> | 2023-08-11 12:04 | 16K | |
![[IMG]](/icons/image2.gif) | Nursing_Now_Todays_I..> | 2023-05-03 09:33 | 115K | |
![[IMG]](/icons/image2.gif) | Nursing_for_Wellness..> | 2023-08-07 04:10 | 2.6K | |
![[IMG]](/icons/image2.gif) | Nursing_for_Wellness..> | 2023-08-11 12:04 | 14K | |
![[IMG]](/icons/image2.gif) | Nursing_for_Wellness..> | 2023-05-03 09:35 | 31K | |
![[IMG]](/icons/image2.gif) | Nutrition-Through-th..> | 2023-08-06 03:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | Nutrition-Through-th..> | 2023-08-20 08:54 | 15K | |
![[IMG]](/icons/image2.gif) | Nutrition-Through-th..> | 2023-05-03 10:27 | 39K | |
![[IMG]](/icons/image2.gif) | Nutrition-and-You-Bl..> | 2023-08-05 16:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | Nutrition-and-You-Bl..> | 2023-08-27 09:34 | 23K | |
![[IMG]](/icons/image2.gif) | Nutrition-and-You-Bl..> | 2023-05-03 10:12 | 108K | |
![[ ]](/icons/layout.gif) | ONeil-Chapter-01.pdf | 2023-05-04 01:51 | 653K | |
![[IMG]](/icons/image2.gif) | ORGB-3-Nelson-100x10..> | 2023-08-05 01:33 | 4.0K | |
![[IMG]](/icons/image2.gif) | ORGB-3-Nelson-300x30..> | 2023-08-09 18:40 | 23K | |
![[IMG]](/icons/image2.gif) | ORGB-3-Nelson.jpg | 2023-05-04 02:12 | 52K | |
![[ ]](/icons/compressed.gif) | O_Hair_Chapter_1_TB_..> | 2023-05-03 11:09 | 19K | |
![[IMG]](/icons/image2.gif) | Operating-Systems-In..> | 2023-08-06 05:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | Operating-Systems-In..> | 2023-08-05 01:51 | 19K | |
![[IMG]](/icons/image2.gif) | Operating-Systems-In..> | 2023-05-03 09:07 | 88K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-08-05 16:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-08-24 12:35 | 17K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-05-03 09:21 | 38K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-08-06 08:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-08-18 10:49 | 20K | |
![[IMG]](/icons/image2.gif) | Operations-Managemen..> | 2023-05-03 10:10 | 110K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-08-08 21:07 | 3.2K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-08-27 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-05-03 10:17 | 44K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-08-05 05:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-08-21 08:26 | 17K | |
![[IMG]](/icons/image2.gif) | Operations-and-Suppl..> | 2023-05-03 10:37 | 44K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-05-03 10:09 | 19K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-05-03 11:24 | 19K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-05-03 09:49 | 12K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-05-03 09:30 | 12K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-08-06 03:41 | 4.5K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-08-08 07:32 | 26K | |
![[IMG]](/icons/image2.gif) | Operations_Managemen..> | 2023-05-03 10:08 | 52K | |
![[IMG]](/icons/image2.gif) | Options_Futures_and_..> | 2023-08-06 09:43 | 2.9K | |
![[IMG]](/icons/image2.gif) | Options_Futures_and_..> | 2023-08-05 01:51 | 18K | |
![[IMG]](/icons/image2.gif) | Options_Futures_and_..> | 2023-05-03 09:18 | 37K | |
![[IMG]](/icons/image2.gif) | Oral-Radiology-6e-Wh..> | 2023-08-06 11:15 | 10K | |
![[IMG]](/icons/image2.gif) | Oral-Radiology-6e-Wh..> | 2023-05-04 02:19 | 25K | |
![[IMG]](/icons/image2.gif) | Oral_Pharmacology_fo..> | 2023-08-05 16:23 | 2.5K | |
![[IMG]](/icons/image2.gif) | Oral_Pharmacology_fo..> | 2023-08-08 12:39 | 12K | |
![[IMG]](/icons/image2.gif) | Oral_Pharmacology_fo..> | 2023-05-04 02:07 | 32K | |
![[ ]](/icons/unknown.gif) | Organic-Chemistry-4t..> | 2023-05-03 10:18 | 160K | |
![[IMG]](/icons/image2.gif) | Organic-Chemistry-Br..> | 2023-08-05 02:13 | 2.2K | |
![[IMG]](/icons/image2.gif) | Organic-Chemistry-Br..> | 2023-08-20 19:01 | 12K | |
![[IMG]](/icons/image2.gif) | Organic-Chemistry-Br..> | 2023-05-03 10:20 | 73K | |
![[IMG]](/icons/image2.gif) | Organic_Chemistry_2_..> | 2023-08-06 01:47 | 2.2K | |
![[IMG]](/icons/image2.gif) | Organic_Chemistry_2_..> | 2023-08-08 07:32 | 10K | |
![[IMG]](/icons/image2.gif) | Organic_Chemistry_2_..> | 2023-05-03 09:37 | 20K | |
![[IMG]](/icons/image2.gif) | Organization-Theory-..> | 2023-08-06 12:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | Organization-Theory-..> | 2023-08-13 23:07 | 14K | |
![[IMG]](/icons/image2.gif) | Organization-Theory-..> | 2023-05-03 09:20 | 34K | |
![[IMG]](/icons/image2.gif) | Organization_Develop..> | 2023-08-08 06:38 | 3.3K | |
![[IMG]](/icons/image2.gif) | Organization_Develop..> | 2023-08-08 07:32 | 19K | |
![[IMG]](/icons/image2.gif) | Organization_Develop..> | 2023-05-03 09:20 | 42K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-08-08 10:58 | 2.0K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-08-09 12:49 | 9.9K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-05-03 09:48 | 60K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-08-05 16:24 | 4.9K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-08-09 12:49 | 34K | |
![[IMG]](/icons/image2.gif) | Organizational-Behav..> | 2023-05-03 09:21 | 169K | |
![[ ]](/icons/unknown.gif) | Organizational-Behav..> | 2023-05-04 01:55 | 123K | |
![[IMG]](/icons/image2.gif) | Organizational-Theor..> | 2023-08-06 08:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | Organizational-Theor..> | 2023-08-09 18:40 | 24K | |
![[IMG]](/icons/image2.gif) | Organizational-Theor..> | 2023-05-03 10:47 | 103K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-08-05 06:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-08-08 07:32 | 19K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-05-03 11:03 | 39K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-08-05 04:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-08-08 07:32 | 28K | |
![[IMG]](/icons/image2.gif) | Organizational_Behav..> | 2023-05-03 11:14 | 64K | |
![[IMG]](/icons/image2.gif) | Our-Sexuality-12e-Cr..> | 2023-08-09 02:50 | 3.1K | |
![[IMG]](/icons/image2.gif) | Our-Sexuality-12e-Cr..> | 2023-08-05 01:54 | 14K | |
![[IMG]](/icons/image2.gif) | Our-Sexuality-12e-Cr..> | 2023-05-03 10:45 | 30K | |
![[ ]](/icons/layout.gif) | P0201-Solution-manua..> | 2023-05-03 10:11 | 24K | |
![[ ]](/icons/compressed.gif) | P1_04TB_NCC13e.zip | 2023-05-03 10:05 | 26K | |
![[ ]](/icons/unknown.gif) | P2_01TB_NUTR1e.doc | 2023-05-03 09:38 | 62K | |
![[ ]](/icons/unknown.gif) | PC_01_Chapter_low-re..> | 2023-05-03 10:37 | 1.0M | |
![[ ]](/icons/unknown.gif) | PFM8e_IM_Chapter02_f..> | 2023-05-04 01:52 | 73K | |
![[ ]](/icons/layout.gif) | PSLS4e_ISM_Ch01_acce..> | 2023-05-04 01:53 | 458K | |
![[ ]](/icons/compressed.gif) | Pages-from-Hockenber..> | 2023-05-03 09:53 | 665K | |
![[ ]](/icons/unknown.gif) | Parkin.13e.Econ_.IM_..> | 2023-05-03 10:57 | 194K | |
![[ ]](/icons/compressed.gif) | Part-I-TIF-125773.zip | 2023-05-03 10:19 | 26K | |
![[ ]](/icons/compressed.gif) | Part002-Music-An-App..> | 2023-05-03 09:56 | 13K | |
![[ ]](/icons/unknown.gif) | Part_1_Ch_01-Test-Ba..> | 2023-05-03 10:44 | 158K | |
![[IMG]](/icons/image2.gif) | Pathology-for-Massag..> | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | Pathology-for-Massag..> | 2023-08-05 01:54 | 15K | |
![[IMG]](/icons/image2.gif) | Pathology-for-Massag..> | 2023-05-04 02:00 | 35K | |
![[IMG]](/icons/image2.gif) | Pathophysiology-100x..> | 2023-08-05 03:41 | 5.9K | |
![[IMG]](/icons/image2.gif) | Pathophysiology-300x..> | 2023-08-11 12:04 | 32K | |
![[IMG]](/icons/image2.gif) | Pathophysiology.jpg | 2023-05-03 11:22 | 69K | |
![[IMG]](/icons/image2.gif) | Pathophysiology_Intr..> | 2023-05-04 02:07 | 28K | |
![[IMG]](/icons/image2.gif) | Pathophysiology_The_..> | 2023-08-06 11:17 | 4.2K | |
![[IMG]](/icons/image2.gif) | Pathophysiology_The_..> | 2023-08-06 03:41 | 27K | |
![[IMG]](/icons/image2.gif) | Pathophysiology_The_..> | 2023-05-04 02:05 | 102K | |
![[IMG]](/icons/image2.gif) | Pathophysiology_of_D..> | 2023-05-04 02:06 | 39K | |
![[IMG]](/icons/image2.gif) | PattersonTAD10e_11js..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | PattersonTAD10e_11js..> | 2023-09-22 10:56 | 15K | |
![[IMG]](/icons/image2.gif) | PattersonTAD10e_11js..> | 2023-05-03 10:26 | 37K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-08-05 14:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-08-13 18:49 | 22K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-05-03 09:28 | 56K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-08-05 06:25 | 3.8K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-08-08 06:39 | 22K | |
![[IMG]](/icons/image2.gif) | Payroll_Accounting_2..> | 2023-05-03 11:26 | 56K | |
![[IMG]](/icons/image2.gif) | Pearce12e11jm_nm2-10..> | 2023-08-05 06:24 | 2.3K | |
![[IMG]](/icons/image2.gif) | Pearce12e11jm_nm2-30..> | 2023-08-12 04:49 | 12K | |
![[IMG]](/icons/image2.gif) | Pearce12e11jm_nm2.jpg | 2023-05-04 02:14 | 31K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-08-05 04:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-08-05 15:35 | 20K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-05-04 02:25 | 56K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-08-05 14:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-08-21 10:10 | 20K | |
![[IMG]](/icons/image2.gif) | Peck-Introduction-to..> | 2023-05-04 02:25 | 56K | |
![[IMG]](/icons/image2.gif) | Penman5e13bar_nm2-10..> | 2023-08-05 15:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | Penman5e13bar_nm2-30..> | 2023-08-06 12:18 | 15K | |
![[IMG]](/icons/image2.gif) | Penman5e13bar_nm2.jpg | 2023-05-03 09:36 | 38K | |
![[ ]](/icons/unknown.gif) | Perloff_3e_IM_Ch01.doc | 2023-05-03 11:10 | 50K | |
![[ ]](/icons/unknown.gif) | Perrin_ch01_IRM_fina..> | 2023-05-03 11:23 | 95K | |
![[IMG]](/icons/image2.gif) | Perry-6th-Nursing-In..> | 2023-08-06 09:42 | 4.5K | |
![[IMG]](/icons/image2.gif) | Perry-6th-Nursing-In..> | 2023-08-09 18:53 | 24K | |
![[IMG]](/icons/image2.gif) | Perry-6th-Nursing-In..> | 2023-05-03 10:12 | 61K | |
![[ ]](/icons/layout.gif) | Personal-Finance-Kap..> | 2023-05-03 09:59 | 400K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-08-09 02:04 | 4.5K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-08-13 18:49 | 27K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-05-03 09:56 | 68K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-08-05 01:51 | 4.5K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-08-13 18:49 | 27K | |
![[IMG]](/icons/image2.gif) | Personal_Finance_Kap..> | 2023-05-03 09:59 | 68K | |
![[IMG]](/icons/image2.gif) | Personality-5e-Fried..> | 2023-08-08 02:53 | 3.7K | |
![[IMG]](/icons/image2.gif) | Personality-5e-Fried..> | 2023-10-24 23:19 | 19K | |
![[IMG]](/icons/image2.gif) | Personality-5e-Fried..> | 2023-05-03 10:22 | 96K | |
![[ ]](/icons/compressed.gif) | Petri_6e_IM_Chapter0..> | 2023-05-03 10:04 | 814K | |
![[ ]](/icons/compressed.gif) | Petri_6e_TB_Chapter0..> | 2023-05-03 10:19 | 682K | |
![[IMG]](/icons/image2.gif) | Pharmacological-Aspe..> | 2023-08-06 08:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | Pharmacological-Aspe..> | 2023-10-17 07:23 | 19K | |
![[IMG]](/icons/image2.gif) | Pharmacological-Aspe..> | 2023-05-03 09:34 | 45K | |
![[ ]](/icons/compressed.gif) | Pharmacology-for-Nur..> | 2023-05-03 11:15 | 55K | |
![[IMG]](/icons/image2.gif) | Pharmacology_A_Patie..> | 2023-08-05 03:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | Pharmacology_A_Patie..> | 2023-08-08 16:38 | 13K | |
![[IMG]](/icons/image2.gif) | Pharmacology_A_Patie..> | 2023-05-03 11:23 | 30K | |
![[IMG]](/icons/image2.gif) | Pharmacology_and_the..> | 2023-08-06 11:18 | 3.6K | |
![[IMG]](/icons/image2.gif) | Pharmacology_and_the..> | 2023-05-03 11:06 | 11K | |
![[IMG]](/icons/image2.gif) | Pharmacology_and_the..> | 2023-05-04 02:07 | 35K | |
![[IMG]](/icons/image2.gif) | Pharmacotherapeutics..> | 2023-08-09 21:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | Pharmacotherapeutics..> | 2023-05-03 09:55 | 15K | |
![[IMG]](/icons/image2.gif) | Pharmacotherapy_A_Pa..> | 2023-05-04 01:52 | 25K | |
![[IMG]](/icons/image2.gif) | Pharmacotherapy_Prin..> | 2023-05-04 02:07 | 36K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-08-06 05:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-08-05 05:29 | 15K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-05-04 01:51 | 23K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-08-05 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-08-08 14:34 | 15K | |
![[IMG]](/icons/image2.gif) | Phillips-Fundamental..> | 2023-05-04 01:50 | 23K | |
![[IMG]](/icons/image2.gif) | Physical-Examination..> | 2023-08-05 14:43 | 2.8K | |
![[IMG]](/icons/image2.gif) | Physical-Examination..> | 2023-08-18 01:09 | 15K | |
![[IMG]](/icons/image2.gif) | Physical-Examination..> | 2023-05-03 09:33 | 38K | |
![[IMG]](/icons/image2.gif) | Physical-Examination..> | 2023-08-05 14:38 | 5.1K | |
![[IMG]](/icons/image2.gif) | Physical-Examination..> | 2023-05-03 11:24 | 34K | |
![[IMG]](/icons/image2.gif) | Physics-2e-Giambatti..> | 2023-08-07 23:57 | 4.1K | |
![[IMG]](/icons/image2.gif) | Physics-2e-Giambatti..> | 2023-08-21 02:16 | 26K | |
![[IMG]](/icons/image2.gif) | Physics-2e-Giambatti..> | 2023-05-03 10:11 | 64K | |
![[IMG]](/icons/image2.gif) | Physics-6e-Giancoli-..> | 2023-08-05 05:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Physics-6e-Giancoli-..> | 2023-08-21 07:04 | 20K | |
![[IMG]](/icons/image2.gif) | Physics-6e-Giancoli.jpg | 2023-05-03 10:00 | 77K | |
![[IMG]](/icons/image2.gif) | Physics-8e-Cutnell-1..> | 2023-08-05 02:46 | 2.6K | |
![[IMG]](/icons/image2.gif) | Physics-8e-Cutnell-3..> | 2023-08-21 02:16 | 13K | |
![[IMG]](/icons/image2.gif) | Physics-8e-Cutnell.jpg | 2023-05-03 09:41 | 32K | |
![[IMG]](/icons/image2.gif) | Physics_for_Scientis..> | 2023-05-03 10:54 | 24K | |
![[IMG]](/icons/image2.gif) | Physiology-of-Behavi..> | 2023-08-06 11:18 | 3.4K | |
![[IMG]](/icons/image2.gif) | Physiology-of-Behavi..> | 2023-10-28 14:38 | 18K | |
![[IMG]](/icons/image2.gif) | Physiology-of-Behavi..> | 2023-05-03 09:31 | 92K | |
![[IMG]](/icons/image2.gif) | Pickar-3rd-Canadian-..> | 2023-08-05 06:23 | 2.3K | |
![[IMG]](/icons/image2.gif) | Pickar-3rd-Canadian-..> | 2023-08-09 09:12 | 11K | |
![[IMG]](/icons/image2.gif) | Pickar-3rd-Canadian-..> | 2023-05-03 09:26 | 30K | |
![[IMG]](/icons/image2.gif) | Pickar-9th-Dosage-Ca..> | 2023-08-06 08:47 | 2.3K | |
![[IMG]](/icons/image2.gif) | Pickar-9th-Dosage-Ca..> | 2023-08-05 01:08 | 13K | |
![[IMG]](/icons/image2.gif) | Pickar-9th-Dosage-Ca..> | 2023-05-03 09:11 | 32K | |
![[ ]](/icons/unknown.gif) | Pierce5e_TB_ch01_Fin..> | 2023-05-03 09:30 | 59K | |
![[ ]](/icons/compressed.gif) | Pindyck_TestBank_7e.zip | 2023-05-03 13:40 | 271K | |
![[IMG]](/icons/image2.gif) | Plummer13e10BAR_nm2-..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | Plummer13e10BAR_nm2-..> | 2023-10-26 03:30 | 19K | |
![[IMG]](/icons/image2.gif) | Plummer13e10BAR_nm2.jpg | 2023-05-03 10:36 | 47K | |
![[IMG]](/icons/image2.gif) | Portfolio-Constructi..> | 2023-08-08 14:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | Portfolio-Constructi..> | 2023-08-21 07:04 | 16K | |
![[IMG]](/icons/image2.gif) | Portfolio-Constructi..> | 2023-05-03 09:32 | 40K | |
![[IMG]](/icons/image2.gif) | Potter-Perry-5th-Edi..> | 2023-08-05 06:24 | 2.6K | |
![[IMG]](/icons/image2.gif) | Potter-Perry-5th-Edi..> | 2023-08-08 15:28 | 13K | |
![[IMG]](/icons/image2.gif) | Potter-Perry-5th-Edi..> | 2023-05-03 09:55 | 29K | |
![[ ]](/icons/unknown.gif) | Powell_5e_Ch01_20160..> | 2023-05-03 09:46 | 77K | |
![[ ]](/icons/compressed.gif) | Pozzulo-4CE-TB-CH01.zip | 2023-05-03 10:19 | 25K | |
![[ ]](/icons/unknown.gif) | PreCalculus-6e-Chapt..> | 2023-05-03 10:29 | 782K | |
![[ ]](/icons/unknown.gif) | Prentice1_version1-T..> | 2023-05-04 02:01 | 24K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-05-03 09:44 | 42K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-08-06 11:14 | 3.2K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-08-06 14:42 | 19K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-05-03 10:55 | 43K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-08-08 07:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | Prentice_Halls_Feder..> | 2023-05-03 09:22 | 43K | |
![[ ]](/icons/unknown.gif) | Pressman_SEPA_9e_Ch0..> | 2023-05-04 02:23 | 25K | |
![[IMG]](/icons/image2.gif) | Principles-Of-Micro-..> | 2023-05-04 01:54 | 7.3K | |
![[ ]](/icons/unknown.gif) | Principles-of-Auditi..> | 2023-05-03 11:22 | 1.1M | |
![[IMG]](/icons/image2.gif) | Principles-of-Financ..> | 2023-08-05 15:43 | 3.4K | |
![[IMG]](/icons/image2.gif) | Principles-of-Financ..> | 2023-08-18 13:55 | 17K | |
![[IMG]](/icons/image2.gif) | Principles-of-Financ..> | 2023-05-03 09:40 | 41K | |
![[IMG]](/icons/image2.gif) | Principles-of-Human-..> | 2023-08-06 03:50 | 4.6K | |
![[IMG]](/icons/image2.gif) | Principles-of-Human-..> | 2023-08-13 15:24 | 28K | |
![[IMG]](/icons/image2.gif) | Principles-of-Human-..> | 2023-05-04 02:12 | 150K | |
![[IMG]](/icons/image2.gif) | Principles-of-Manage..> | 2023-08-09 05:08 | 2.9K | |
![[IMG]](/icons/image2.gif) | Principles-of-Manage..> | 2023-08-11 04:33 | 14K | |
![[IMG]](/icons/image2.gif) | Principles-of-Manage..> | 2023-05-03 10:11 | 82K | |
![[IMG]](/icons/image2.gif) | Principles-of-Market..> | 2023-08-08 08:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | Principles-of-Market..> | 2023-08-11 04:33 | 13K | |
![[IMG]](/icons/image2.gif) | Principles-of-Market..> | 2023-05-04 02:25 | 33K | |
![[IMG]](/icons/image2.gif) | Principles-of-Microe..> | 2023-08-05 05:23 | 3.5K | |
![[IMG]](/icons/image2.gif) | Principles-of-Microe..> | 2023-08-10 18:33 | 22K | |
![[IMG]](/icons/image2.gif) | Principles-of-Microe..> | 2023-05-03 10:13 | 57K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-08-05 15:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-10-27 14:18 | 14K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-05-03 10:42 | 32K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-08-05 04:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-08-18 13:55 | 14K | |
![[IMG]](/icons/image2.gif) | Principles-of-Supply..> | 2023-05-03 10:35 | 32K | |
![[ ]](/icons/layout.gif) | Principles_of_Econom..> | 2023-05-04 02:01 | 231K | |
![[IMG]](/icons/image2.gif) | Principles_of_Econom..> | 2023-08-07 00:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | Principles_of_Econom..> | 2023-08-05 16:29 | 17K | |
![[IMG]](/icons/image2.gif) | Principles_of_Econom..> | 2023-05-03 10:08 | 32K | |
![[IMG]](/icons/image2.gif) | Principles_of_Macroe..> | 2023-08-05 23:08 | 2.9K | |
![[IMG]](/icons/image2.gif) | Principles_of_Macroe..> | 2023-08-08 16:38 | 17K | |
![[IMG]](/icons/image2.gif) | Principles_of_Macroe..> | 2023-05-03 11:26 | 32K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-08 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-05-03 10:31 | 31K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-08 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-05-03 09:29 | 31K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-08 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-05-03 11:16 | 33K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-06 08:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-08-08 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | Principles_of_Manage..> | 2023-05-03 10:19 | 33K | |
![[IMG]](/icons/image2.gif) | Principles_of_Market..> | 2023-08-08 11:50 | 2.5K | |
![[IMG]](/icons/image2.gif) | Principles_of_Market..> | 2023-08-08 06:42 | 13K | |
![[IMG]](/icons/image2.gif) | Principles_of_Market..> | 2023-05-03 09:53 | 20K | |
![[IMG]](/icons/image2.gif) | Principles_of_Pediat..> | 2023-08-05 17:17 | 3.5K | |
![[IMG]](/icons/image2.gif) | Principles_of_Pediat..> | 2023-08-06 12:19 | 24K | |
![[IMG]](/icons/image2.gif) | Principles_of_Pediat..> | 2023-05-03 11:02 | 61K | |
![[ ]](/icons/compressed.gif) | Principles of Supply..> | 2023-05-03 10:35 | 280K | |
![[ ]](/icons/unknown.gif) | PriviteraEss2e_TB_Ch..> | 2023-05-03 13:41 | 40K | |
![[ ]](/icons/unknown.gif) | Privitera_3e_IM_01.docx | 2023-05-04 02:19 | 24K | |
![[IMG]](/icons/image2.gif) | Probability-Statisti..> | 2023-08-08 04:35 | 4.5K | |
![[IMG]](/icons/image2.gif) | Probability-Statisti..> | 2023-08-19 08:10 | 21K | |
![[IMG]](/icons/image2.gif) | Probability-Statisti..> | 2023-05-03 10:21 | 78K | |
![[IMG]](/icons/image2.gif) | Production-and-Opera..> | 2023-08-05 02:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | Production-and-Opera..> | 2023-05-03 10:10 | 10K | |
![[IMG]](/icons/image2.gif) | Professional-Nursing..> | 2023-08-06 13:09 | 4.3K | |
![[IMG]](/icons/image2.gif) | Professional-Nursing..> | 2023-05-03 10:03 | 28K | |
![[IMG]](/icons/image2.gif) | Professionalism-Skil..> | 2023-08-08 21:04 | 3.2K | |
![[IMG]](/icons/image2.gif) | Professionalism-Skil..> | 2023-05-03 09:51 | 11K | |
![[IMG]](/icons/image2.gif) | Project_Management_T..> | 2023-08-08 15:42 | 3.7K | |
![[IMG]](/icons/image2.gif) | Project_Management_T..> | 2023-08-05 21:57 | 22K | |
![[IMG]](/icons/image2.gif) | Project_Management_T..> | 2023-05-03 09:22 | 56K | |
![[IMG]](/icons/image2.gif) | Psychiatric-Mental-H..> | 2023-08-05 01:12 | 3.0K | |
![[IMG]](/icons/image2.gif) | Psychiatric-Mental-H..> | 2023-08-06 13:12 | 17K | |
![[IMG]](/icons/image2.gif) | Psychiatric-Mental-H..> | 2023-05-03 09:23 | 44K | |
![[IMG]](/icons/image2.gif) | Psychiatric_Mental_H..> | 2023-08-08 23:55 | 3.3K | |
![[IMG]](/icons/image2.gif) | Psychiatric_Mental_H..> | 2023-08-05 21:57 | 17K | |
![[IMG]](/icons/image2.gif) | Psychiatric_Mental_H..> | 2023-05-03 10:03 | 37K | |
![[IMG]](/icons/image2.gif) | Psychology-100x100.jpg | 2023-08-05 09:32 | 2.8K | |
![[IMG]](/icons/image2.gif) | Psychology-300x300.jpg | 2023-08-15 20:03 | 18K | |
![[IMG]](/icons/image2.gif) | Psychology-Concepts-..> | 2023-08-06 07:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | Psychology-Concepts-..> | 2023-10-20 06:19 | 18K | |
![[IMG]](/icons/image2.gif) | Psychology-Concepts-..> | 2023-05-03 10:39 | 40K | |
![[IMG]](/icons/image2.gif) | Psychology-Themes-an..> | 2023-08-05 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | Psychology-Themes-an..> | 2023-10-22 10:04 | 17K | |
![[IMG]](/icons/image2.gif) | Psychology-Themes-an..> | 2023-05-03 10:51 | 39K | |
![[IMG]](/icons/image2.gif) | Psychology.jpg | 2023-05-03 10:04 | 84K | |
![[IMG]](/icons/image2.gif) | Psychology_4th_Cicca..> | 2023-08-05 01:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | Psychology_4th_Cicca..> | 2023-08-06 13:12 | 12K | |
![[IMG]](/icons/image2.gif) | Psychology_4th_Cicca..> | 2023-05-03 11:03 | 25K | |
![[IMG]](/icons/image2.gif) | Psychology_Applied_t..> | 2023-08-05 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | Psychology_Applied_t..> | 2023-08-06 13:12 | 20K | |
![[IMG]](/icons/image2.gif) | Psychology_Applied_t..> | 2023-05-03 09:33 | 45K | |
![[IMG]](/icons/image2.gif) | Psychology_myers_10t..> | 2023-08-05 15:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | Psychology_myers_10t..> | 2023-08-09 06:03 | 16K | |
![[IMG]](/icons/image2.gif) | Psychology_myers_10t..> | 2023-05-03 10:24 | 202K | |
![[IMG]](/icons/image2.gif) | Public-Health-Nursin..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | Public-Health-Nursin..> | 2023-08-09 06:03 | 21K | |
![[IMG]](/icons/image2.gif) | Public-Health-Nursin..> | 2023-05-03 09:41 | 43K | |
![[IMG]](/icons/image2.gif) | Public-Health-Scienc..> | 2023-08-08 06:37 | 6.3K | |
![[IMG]](/icons/image2.gif) | Public-Health-Scienc..> | 2023-08-08 15:50 | 31K | |
![[IMG]](/icons/image2.gif) | Public-Health-Scienc..> | 2023-05-03 09:47 | 67K | |
![[ ]](/icons/unknown.gif) | Pugel-1_version1-Tes..> | 2023-05-03 13:42 | 26K | |
![[ ]](/icons/unknown.gif) | Pugel_17e_chap001_IM..> | 2023-05-04 02:29 | 33K | |
![[IMG]](/icons/image2.gif) | Purnell-4th-Transcul..> | 2023-08-06 07:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | Purnell-4th-Transcul..> | 2023-08-05 01:08 | 22K | |
![[IMG]](/icons/image2.gif) | Purnell-4th-Transcul..> | 2023-05-03 10:15 | 65K | |
![[ ]](/icons/compressed.gif) | Purnell-2013-4th-080..> | 2023-05-03 10:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | Putman-Legal-Researc..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | Putman-Legal-Researc..> | 2023-08-30 09:02 | 13K | |
![[IMG]](/icons/image2.gif) | Putman-Legal-Researc..> | 2023-05-04 02:20 | 32K | |
![[ ]](/icons/layout.gif) | Pytel-Statics-4e-SI-..> | 2023-05-03 09:35 | 1.5M | |
![[ ]](/icons/unknown.gif) | Python4e_Gaddis_ch01..> | 2023-05-03 10:52 | 18K | |
![[ ]](/icons/compressed.gif) | Q9-IM01.zip | 2023-05-03 09:37 | 87K | |
![[ ]](/icons/unknown.gif) | Q10-IM01-97813056625..> | 2023-05-03 10:05 | 99K | |
![[ ]](/icons/unknown.gif) | QMch1_solns_10jun12.doc | 2023-05-03 09:30 | 1.4M | |
![[ ]](/icons/compressed.gif) | QMch1_solns_10jun12.zip | 2023-05-03 10:12 | 188K | |
![[IMG]](/icons/image2.gif) | Quantitative_Analysi..> | 2023-08-06 11:17 | 3.0K | |
![[IMG]](/icons/image2.gif) | Quantitative_Analysi..> | 2023-08-08 15:50 | 16K | |
![[IMG]](/icons/image2.gif) | Quantitative_Analysi..> | 2023-05-03 09:37 | 36K | |
![[ ]](/icons/unknown.gif) | QuickBooks-1_version..> | 2023-05-04 02:10 | 15K | |
![[ ]](/icons/unknown.gif) | REILLYCH01-10th_edit..> | 2023-05-03 10:40 | 161K | |
![[ ]](/icons/unknown.gif) | RMChapter-1.doc | 2023-05-04 02:00 | 39K | |
![[ ]](/icons/layout.gif) | RN-Comprehensive-Pre..> | 2023-05-04 02:11 | 335K | |
![[IMG]](/icons/image2.gif) | RWJEss7e11pv_nm2-100..> | 2023-08-05 02:03 | 2.9K | |
![[IMG]](/icons/image2.gif) | RWJEss7e11pv_nm2-300..> | 2023-08-10 18:29 | 13K | |
![[IMG]](/icons/image2.gif) | RWJEss7e11pv_nm2.jpg | 2023-05-03 10:30 | 29K | |
![[IMG]](/icons/image2.gif) | Raabe-Corporations-P..> | 2023-08-06 10:14 | 3.8K | |
![[IMG]](/icons/image2.gif) | Raabe-Corporations-P..> | 2023-08-14 19:05 | 24K | |
![[IMG]](/icons/image2.gif) | Raabe-Corporations-P..> | 2023-05-04 01:57 | 71K | |
![[IMG]](/icons/image2.gif) | Raabe-Federal-Tax-Re..> | 2023-08-05 05:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | Raabe-Federal-Tax-Re..> | 2023-09-12 09:51 | 22K | |
![[IMG]](/icons/image2.gif) | Raabe-Federal-Tax-Re..> | 2023-05-03 09:32 | 53K | |
![[IMG]](/icons/image2.gif) | Racial_and_Ethnic_Gr..> | 2023-08-06 09:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | Racial_and_Ethnic_Gr..> | 2023-08-08 15:50 | 15K | |
![[IMG]](/icons/image2.gif) | Racial_and_Ethnic_Gr..> | 2023-05-03 09:21 | 33K | |
![[IMG]](/icons/image2.gif) | Radiographic-Positio..> | 2023-08-06 10:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | Radiographic-Positio..> | 2023-05-03 09:37 | 8.0K | |
![[ ]](/icons/compressed.gif) | Ragin-TB-Ch02-2nd-Ed..> | 2023-05-03 09:40 | 23K | |
![[IMG]](/icons/image2.gif) | Rathus-Longmuir-2nd-..> | 2023-08-05 16:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | Rathus-Longmuir-2nd-..> | 2023-08-12 12:45 | 16K | |
![[IMG]](/icons/image2.gif) | Rathus-Longmuir-2nd-..> | 2023-05-03 09:50 | 136K | |
![[IMG]](/icons/image2.gif) | Reading-Understandin..> | 2023-08-05 15:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | Reading-Understandin..> | 2023-08-06 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | Reading-Understandin..> | 2023-05-03 09:45 | 32K | |
![[IMG]](/icons/image2.gif) | Reading_and_Learning..> | 2023-08-05 15:22 | 4.3K | |
![[IMG]](/icons/image2.gif) | Reading_and_Learning..> | 2023-08-08 15:50 | 23K | |
![[IMG]](/icons/image2.gif) | Reading_and_Learning..> | 2023-05-03 10:10 | 52K | |
![[ ]](/icons/unknown.gif) | Reck18e_Ch01_Instruc..> | 2023-05-04 02:04 | 71K | |
![[ ]](/icons/unknown.gif) | Reck_19e_Ch001_IM.docx | 2023-05-04 02:09 | 81K | |
![[ ]](/icons/layout.gif) | Research-Methods-for..> | 2023-05-04 02:16 | 350K | |
![[ ]](/icons/compressed.gif) | Research-Methods-for..> | 2023-05-03 09:38 | 212K | |
![[IMG]](/icons/image2.gif) | Research_Methods_for..> | 2023-08-05 06:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | Research_Methods_for..> | 2023-08-08 06:42 | 19K | |
![[IMG]](/icons/image2.gif) | Research_Methods_for..> | 2023-05-03 09:39 | 43K | |
![[IMG]](/icons/image2.gif) | Retailing_Management..> | 2023-08-08 07:33 | 3.8K | |
![[IMG]](/icons/image2.gif) | Retailing_Management..> | 2023-08-08 06:42 | 19K | |
![[IMG]](/icons/image2.gif) | Retailing_Management..> | 2023-05-03 09:54 | 42K | |
![[IMG]](/icons/image2.gif) | Revsine5e12mb_nm-100..> | 2023-08-08 17:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | Revsine5e12mb_nm-300..> | 2023-08-06 12:18 | 14K | |
![[IMG]](/icons/image2.gif) | Revsine5e12mb_nm.jpg | 2023-05-03 10:17 | 34K | |
![[IMG]](/icons/image2.gif) | Rizzoni_Cover_lg-100..> | 2023-08-05 03:41 | 4.4K | |
![[IMG]](/icons/image2.gif) | Rizzoni_Cover_lg.jpg | 2023-05-03 11:11 | 23K | |
![[IMG]](/icons/image2.gif) | Robbins-Essentials-o..> | 2023-08-06 16:28 | 3.9K | |
![[IMG]](/icons/image2.gif) | Robbins-Essentials-o..> | 2023-08-09 10:08 | 22K | |
![[IMG]](/icons/image2.gif) | Robbins-Essentials-o..> | 2023-05-03 09:25 | 113K | |
![[ ]](/icons/unknown.gif) | Robbins_OB15_IM_01.docx | 2023-05-03 11:14 | 472K | |
![[IMG]](/icons/image2.gif) | Role-Development-In-..> | 2023-08-09 00:59 | 3.2K | |
![[IMG]](/icons/image2.gif) | Role-Development-In-..> | 2023-08-06 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | Role-Development-In-..> | 2023-05-03 10:36 | 37K | |
![[IMG]](/icons/image2.gif) | Romer4e12mr_nm2-100x..> | 2023-08-05 15:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | Romer4e12mr_nm2-300x..> | 2023-08-18 10:03 | 14K | |
![[IMG]](/icons/image2.gif) | Romer4e12mr_nm2.jpg | 2023-05-03 10:18 | 35K | |
![[IMG]](/icons/image2.gif) | Romney-Accounting-In..> | 2023-08-06 10:17 | 2.6K | |
![[IMG]](/icons/image2.gif) | Romney-Accounting-In..> | 2023-05-04 01:53 | 21K | |
![[ ]](/icons/compressed.gif) | Romney-Accounting-In..> | 2023-05-04 01:53 | 48K | |
![[ ]](/icons/unknown.gif) | Roskin_PSAI14ge_Inst..> | 2023-05-03 13:42 | 82K | |
![[ ]](/icons/compressed.gif) | Rothaermel4e_Chapter..> | 2023-05-04 02:02 | 65K | |
![[IMG]](/icons/image2.gif) | Russell-Hertz-2nd-Ed..> | 2023-08-06 08:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | Russell-Hertz-2nd-Ed..> | 2023-08-05 16:15 | 20K | |
![[IMG]](/icons/image2.gif) | Russell-Hertz-2nd-Ed..> | 2023-05-03 09:51 | 42K | |
![[ ]](/icons/unknown.gif) | Russell_4e_IRM_ch02...> | 2023-05-03 09:29 | 49K | |
![[ ]](/icons/unknown.gif) | S02_01-9780357109953..> | 2023-05-04 01:50 | 18K | |
![[ ]](/icons/unknown.gif) | SAMPLE-psylife3_tb_w..> | 2023-05-04 02:25 | 93K | |
![[ ]](/icons/unknown.gif) | SBE11E-Chapter-01.doc | 2023-05-03 09:39 | 115K | |
![[ ]](/icons/unknown.gif) | SBE12E-Chapter-01.docx | 2023-05-03 11:19 | 47K | |
![[ ]](/icons/compressed.gif) | SCIAM-Chapter-2-Test..> | 2023-05-03 11:13 | 33K | |
![[ ]](/icons/unknown.gif) | SCM-Fawcett-Ellram-O..> | 2023-05-04 02:09 | 0 | |
![[ ]](/icons/compressed.gif) | SFM_10e_TB_Chap_1.zip | 2023-05-03 10:00 | 23K | |
![[ ]](/icons/unknown.gif) | SF_TestBank_C01_FINA..> | 2023-05-03 10:22 | 190K | |
![[ ]](/icons/compressed.gif) | SIB-Excel-CH01-Solut..> | 2023-05-03 10:39 | 160K | |
![[ ]](/icons/compressed.gif) | SM-0078029473-Busine..> | 2023-05-03 09:35 | 16K | |
![[ ]](/icons/unknown.gif) | SM-01-Wahlen-1e-9pp-..> | 2023-05-03 10:57 | 79K | |
![[ ]](/icons/compressed.gif) | SM-0130413313-Projec..> | 2023-05-03 10:16 | 149K | |
![[ ]](/icons/compressed.gif) | SM-0132984660-Financ..> | 2023-05-03 09:53 | 20K | |
![[ ]](/icons/compressed.gif) | SM-013299044X-C-How-..> | 2023-05-03 09:06 | 764K | |
![[ ]](/icons/compressed.gif) | SM-0133061639-Macroe..> | 2023-05-03 10:28 | 30K | |
![[ ]](/icons/compressed.gif) | SM-0133251039-Introd..> | 2023-05-03 09:55 | 19K | |
![[ ]](/icons/compressed.gif) | SM-0133507335-Quanti..> | 2023-05-03 09:35 | 27K | |
![[ ]](/icons/compressed.gif) | SM-0133803805-Manage..> | 2023-05-03 09:31 | 14K | |
![[ ]](/icons/compressed.gif) | SM-032180709X-John-E..> | 2023-05-03 10:29 | 227K | |
![[ ]](/icons/compressed.gif) | SM-0321836960-Elemen..> | 2023-05-03 10:54 | 65K | |
![[ ]](/icons/compressed.gif) | SM-Auditing-Cases-An..> | 2023-05-03 10:24 | 120K | |
![[ ]](/icons/compressed.gif) | SM-Economics-of-Mone..> | 2023-05-03 10:14 | 20K | |
![[ ]](/icons/compressed.gif) | SM-Government-and-No..> | 2023-05-03 11:21 | 25K | |
![[ ]](/icons/compressed.gif) | SM-Managerial-Econom..> | 2023-05-03 09:47 | 12K | |
![[ ]](/icons/compressed.gif) | SM-Power-Electronics..> | 2023-05-03 11:22 | 405K | |
![[ ]](/icons/layout.gif) | SM15June12Ch1.pdf | 2023-05-03 09:32 | 367K | |
![[ ]](/icons/layout.gif) | SMCH-01FACMU14e-2012..> | 2023-05-03 10:32 | 278K | |
![[ ]](/icons/unknown.gif) | SMChap001-Advanced-F..> | 2023-05-03 10:38 | 138K | |
![[ ]](/icons/unknown.gif) | SMChap001-Investment..> | 2023-05-03 09:27 | 63K | |
![[ ]](/icons/unknown.gif) | SMChap001-Macroecono..> | 2023-05-03 09:35 | 169K | |
![[ ]](/icons/unknown.gif) | SMChap001-Managerial..> | 2023-05-03 10:08 | 34K | |
![[ ]](/icons/unknown.gif) | SMChap001-Principles..> | 2023-05-03 10:31 | 112K | |
![[ ]](/icons/unknown.gif) | SMChap001-Real-Estat..> | 2023-05-04 02:11 | 36K | |
![[ ]](/icons/unknown.gif) | SMChap001-Solution-m..> | 2023-05-03 10:23 | 36K | |
![[ ]](/icons/unknown.gif) | SMChap001.docx | 2023-05-03 10:28 | 259K | |
![[ ]](/icons/compressed.gif) | SMChap001.zip | 2023-05-03 10:13 | 98K | |
![[ ]](/icons/unknown.gif) | SMChap002-Solution-M..> | 2023-05-03 09:25 | 161K | |
![[ ]](/icons/unknown.gif) | SME10e_SM_ch02.docx | 2023-05-03 09:37 | 562K | |
![[ ]](/icons/unknown.gif) | SM_Cachon_Terw2e_Ch0..> | 2023-05-04 02:29 | 21K | |
![[ ]](/icons/unknown.gif) | SM_Ch1-Solution-Manu..> | 2023-05-03 10:05 | 166K | |
![[ ]](/icons/unknown.gif) | SM_Hall-10e_Ch-1.docx | 2023-05-03 10:57 | 109K | |
![[IMG]](/icons/image2.gif) | SOLUTI1-2-100x100.jpg | 2023-08-06 08:44 | 4.9K | |
![[IMG]](/icons/image2.gif) | SOLUTI1-2-300x300.jpg | 2023-08-21 08:26 | 30K | |
![[IMG]](/icons/image2.gif) | SOLUTI1-2.jpg | 2023-05-04 02:00 | 146K | |
![[ ]](/icons/unknown.gif) | SOLUTIONS_CH1_REPORT..> | 2023-05-04 02:08 | 777K | |
![[IMG]](/icons/image2.gif) | Saladin-7th-Edition-..> | 2023-08-08 07:33 | 3.1K | |
![[IMG]](/icons/image2.gif) | Saladin-7th-Edition-..> | 2023-08-08 06:42 | 15K | |
![[IMG]](/icons/image2.gif) | Saladin-7th-Edition-..> | 2023-05-03 09:56 | 35K | |
![[IMG]](/icons/image2.gif) | Saladin-7th-Edition-..> | 2023-08-06 11:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | Saladin-7th-Edition-..> | 2023-05-03 10:28 | 17K | |
![[ ]](/icons/unknown.gif) | Salkind7e_Activities..> | 2023-05-04 02:01 | 20K | |
![[ ]](/icons/compressed.gif) | Samaha--Criminal-Pro..> | 2023-05-03 13:44 | 19K | |
![[ ]](/icons/unknown.gif) | Sample-Solution-Manu..> | 2023-05-04 01:50 | 132K | |
![[ ]](/icons/layout.gif) | Sample-Solutios-Manu..> | 2023-05-03 11:13 | 40K | |
![[ ]](/icons/compressed.gif) | Sample-Test-Bank-Bus..> | 2023-05-03 11:14 | 33K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Bus..> | 2023-05-03 11:03 | 37K | |
![[ ]](/icons/layout.gif) | Sample-Test-Bank-Che..> | 2023-05-03 10:54 | 429K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Den..> | 2023-05-03 10:59 | 181K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-E-C..> | 2023-05-03 11:10 | 89K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Ess..> | 2023-05-04 02:15 | 27K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-For..> | 2023-05-04 02:23 | 32K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-For..> | 2023-05-03 09:39 | 85K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-For..> | 2023-05-04 02:14 | 17K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Hol..> | 2023-05-03 13:43 | 27K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Int..> | 2023-05-04 01:49 | 41K | |
![[ ]](/icons/compressed.gif) | Sample-Test-Bank-Pat..> | 2023-05-03 11:15 | 37K | |
![[ ]](/icons/unknown.gif) | Sample-Test-Bank-Soc..> | 2023-05-03 11:22 | 56K | |
![[ ]](/icons/compressed.gif) | Sample-Test-bank-For..> | 2023-05-04 02:21 | 126K | |
![[ ]](/icons/unknown.gif) | Sample-Test-bank-For..> | 2023-05-03 11:13 | 27K | |
![[ ]](/icons/unknown.gif) | Sample-Test-bank-For..> | 2023-05-03 13:42 | 34K | |
![[ ]](/icons/unknown.gif) | Sample-Test-bank-For..> | 2023-05-03 10:47 | 69K | |
![[ ]](/icons/compressed.gif) | Sample-Test-bank-For..> | 2023-05-03 10:12 | 1.0M | |
![[ ]](/icons/unknown.gif) | Sample-Test-bank-For..> | 2023-05-03 11:04 | 13K | |
![[ ]](/icons/layout.gif) | Sample871.pdf | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/layout.gif) | Sample3681.pdf | 2023-05-04 02:24 | 216K | |
![[ ]](/icons/unknown.gif) | Sample3694.doc | 2023-05-04 02:16 | 110K | |
![[ ]](/icons/layout.gif) | Sample3862.pdf | 2023-05-04 01:56 | 8.0K | |
![[ ]](/icons/unknown.gif) | Samples-Solution-Man..> | 2023-05-03 11:05 | 41K | |
![[ ]](/icons/layout.gif) | Samples-Solution-Man..> | 2023-05-03 09:58 | 378K | |
![[ ]](/icons/compressed.gif) | Samples-Solution-Man..> | 2023-05-03 10:07 | 260K | |
![[ ]](/icons/unknown.gif) | Samples-Solution-Man..> | 2023-05-03 09:26 | 40K | |
![[ ]](/icons/unknown.gif) | Samples-Test-Bank-Ac..> | 2023-05-03 10:56 | 26K | |
![[ ]](/icons/unknown.gif) | Samples-Test-bank-fo..> | 2023-05-03 11:23 | 421K | |
![[ ]](/icons/unknown.gif) | Samples-Testbank-Cal..> | 2023-05-04 02:19 | 2.1M | |
![[ ]](/icons/unknown.gif) | Samples-Testbank-Man..> | 2023-05-03 10:45 | 31K | |
![[ ]](/icons/unknown.gif) | Samples-Testbank-Mod..> | 2023-05-04 01:47 | 89K | |
![[ ]](/icons/unknown.gif) | Samples-Testbank-Wes..> | 2023-05-03 09:31 | 43K | |
![[ ]](/icons/unknown.gif) | Samples-of-Solution-..> | 2023-05-03 10:27 | 53K | |
![[ ]](/icons/compressed.gif) | Samples-of-Solution-..> | 2023-05-03 11:11 | 205K | |
![[ ]](/icons/unknown.gif) | Samples-of-Solution-..> | 2023-05-03 09:48 | 48K | |
![[ ]](/icons/unknown.gif) | Samples-of-Test-bank..> | 2023-05-03 10:03 | 129K | |
![[ ]](/icons/unknown.gif) | Samples-of-Test-bank..> | 2023-05-03 11:04 | 2.4M | |
![[ ]](/icons/unknown.gif) | Samples-of-Test-bank..> | 2023-05-03 10:27 | 34K | |
![[ ]](/icons/unknown.gif) | Samples-of-Test-bank..> | 2023-05-04 01:47 | 18K | |
![[IMG]](/icons/image2.gif) | Santrock-14th-Editio..> | 2023-08-05 06:25 | 2.7K | |
![[IMG]](/icons/image2.gif) | Santrock-14th-Editio..> | 2023-08-08 07:33 | 17K | |
![[IMG]](/icons/image2.gif) | Santrock-14th-Editio..> | 2023-05-03 09:50 | 34K | |
![[IMG]](/icons/image2.gif) | Santrock12e12pt_nm21..> | 2023-08-05 06:28 | 2.3K | |
![[IMG]](/icons/image2.gif) | Santrock12e12pt_nm21..> | 2023-08-07 18:53 | 11K | |
![[IMG]](/icons/image2.gif) | Santrock12e12pt_nm21..> | 2023-05-03 09:58 | 25K | |
![[ ]](/icons/unknown.gif) | SantrockESS_3e_TB_ch..> | 2023-05-03 11:27 | 163K | |
![[IMG]](/icons/image2.gif) | SantrockLSD14e2014_n..> | 2023-08-06 05:44 | 3.2K | |
![[IMG]](/icons/image2.gif) | SantrockLSD14e2014_n..> | 2023-08-17 02:38 | 16K | |
![[IMG]](/icons/image2.gif) | SantrockLSD14e2014_n..> | 2023-05-03 09:24 | 37K | |
![[IMG]](/icons/image2.gif) | Santrock_Topical5e10..> | 2023-08-06 03:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | Santrock_Topical5e10..> | 2023-08-13 16:06 | 14K | |
![[IMG]](/icons/image2.gif) | Santrock_Topical5e10..> | 2023-05-03 10:48 | 33K | |
![[ ]](/icons/compressed.gif) | Saunders_FMI_7e_Chap..> | 2023-05-03 13:42 | 20K | |
![[ ]](/icons/layout.gif) | Scarborough_esbm9z_t..> | 2023-05-03 13:42 | 134K | |
![[IMG]](/icons/image2.gif) | Schaefer-Sociology-A..> | 2023-08-06 11:13 | 3.7K | |
![[IMG]](/icons/image2.gif) | Schaefer-Sociology-A..> | 2023-05-04 02:23 | 17K | |
![[ ]](/icons/unknown.gif) | Schiff3e_TB_Unit-01_..> | 2023-05-04 02:26 | 26K | |
![[ ]](/icons/unknown.gif) | Schindler-1_version1..> | 2023-05-04 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | Schlenker-Williams-E..> | 2023-08-05 14:38 | 6.4K | |
![[IMG]](/icons/image2.gif) | Schlenker-Williams-E..> | 2023-05-03 09:28 | 28K | |
![[IMG]](/icons/image2.gif) | Schoenebeck-6e-sm-10..> | 2023-08-05 17:21 | 3.7K | |
![[IMG]](/icons/image2.gif) | Schoenebeck-6e-sm-30..> | 2023-08-05 14:40 | 21K | |
![[IMG]](/icons/image2.gif) | Schoenebeck-6e-sm.jpg | 2023-05-03 10:13 | 102K | |
![[ ]](/icons/unknown.gif) | Schwartz2e_CA01.docx | 2023-05-03 13:42 | 28K | |
![[IMG]](/icons/image2.gif) | Scientific-American-..> | 2023-08-05 15:26 | 3.2K | |
![[IMG]](/icons/image2.gif) | Scientific-American-..> | 2023-10-12 12:35 | 20K | |
![[IMG]](/icons/image2.gif) | Scientific-American-..> | 2023-05-03 11:13 | 61K | |
![[ ]](/icons/unknown.gif) | Section01-9780133076..> | 2023-05-03 13:42 | 34K | |
![[ ]](/icons/compressed.gif) | Section_1_1___Review..> | 2023-05-04 01:47 | 94K | |
![[ ]](/icons/unknown.gif) | Section_1_2___Linear..> | 2023-05-03 13:42 | 217K | |
![[IMG]](/icons/image2.gif) | Seeleys-Anatomy-Phys..> | 2023-08-06 10:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | Seeleys-Anatomy-Phys..> | 2023-09-06 23:53 | 15K | |
![[IMG]](/icons/image2.gif) | Seeleys-Anatomy-Phys..> | 2023-05-03 09:18 | 35K | |
![[ ]](/icons/unknown.gif) | Semi4FinalProbSol1.doc | 2023-05-03 13:43 | 370K | |
![[ ]](/icons/unknown.gif) | Shaffer-6e_IMTB_Chap..> | 2023-05-03 10:01 | 108K | |
![[ ]](/icons/unknown.gif) | Sharda_dss11_im_01.doc | 2023-05-04 02:03 | 155K | |
![[ ]](/icons/unknown.gif) | Shebib_Choices_6e_TB..> | 2023-05-04 02:19 | 26K | |
![[ ]](/icons/compressed.gif) | Shier15e_Chapter01_T..> | 2023-05-04 02:12 | 44K | |
![[ ]](/icons/unknown.gif) | Shier_Holes_Human_AP..> | 2023-05-03 13:43 | 79K | |
![[ ]](/icons/layout.gif) | Silberberg7eISMChapt..> | 2023-05-03 11:06 | 409K | |
![[IMG]](/icons/image2.gif) | Silvestri-Saunders-N..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | Silvestri-Saunders-N..> | 2023-05-04 02:18 | 31K | |
![[ ]](/icons/unknown.gif) | Silvestri-Saunders-N..> | 2023-05-04 02:18 | 94K | |
![[IMG]](/icons/image2.gif) | Sizer-3rd-Edition-Nu..> | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | Sizer-3rd-Edition-Nu..> | 2023-08-15 05:42 | 17K | |
![[IMG]](/icons/image2.gif) | Sizer-3rd-Edition-Nu..> | 2023-05-03 09:54 | 47K | |
![[IMG]](/icons/image2.gif) | Sizer-13th-Edition-N..> | 2023-08-08 08:16 | 3.3K | |
![[IMG]](/icons/image2.gif) | Sizer-13th-Edition-N..> | 2023-08-15 05:42 | 16K | |
![[IMG]](/icons/image2.gif) | Sizer-13th-Edition-N..> | 2023-05-03 10:05 | 38K | |
![[ ]](/icons/unknown.gif) | Slater1e_TB_chp01.docx | 2023-05-03 10:58 | 429K | |
![[IMG]](/icons/image2.gif) | Small-Business-Manag..> | 2023-08-05 06:19 | 2.7K | |
![[IMG]](/icons/image2.gif) | Small-Business-Manag..> | 2023-10-12 15:27 | 14K | |
![[IMG]](/icons/image2.gif) | Small-Business-Manag..> | 2023-05-03 10:12 | 35K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-08-12 03:57 | 21K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-05-03 10:33 | 45K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-08-06 11:13 | 3.8K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-08-12 03:57 | 21K | |
![[IMG]](/icons/image2.gif) | Small_Business_Manag..> | 2023-05-03 10:34 | 45K | |
![[IMG]](/icons/image2.gif) | Smith-2nd-Principles..> | 2023-08-05 04:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | Smith-2nd-Principles..> | 2023-08-05 01:08 | 15K | |
![[IMG]](/icons/image2.gif) | Smith-2nd-Principles..> | 2023-05-03 10:14 | 36K | |
![[ ]](/icons/layout.gif) | Smith1e_TAG_ch01.pdf | 2023-05-04 02:08 | 47K | |
![[ ]](/icons/unknown.gif) | Smith4e_Chapter01_TB..> | 2023-05-04 02:15 | 56K | |
![[IMG]](/icons/image2.gif) | Smith_and_Robersons_..> | 2023-08-05 14:41 | 1.7K | |
![[IMG]](/icons/image2.gif) | Smith_and_Robersons_..> | 2023-08-08 21:47 | 7.9K | |
![[IMG]](/icons/image2.gif) | Smith_and_Robersons_..> | 2023-05-03 10:19 | 16K | |
![[IMG]](/icons/image2.gif) | Snell-17th-Managing-..> | 2023-08-08 06:39 | 3.4K | |
![[IMG]](/icons/image2.gif) | Snell-17th-Managing-..> | 2023-08-09 18:53 | 17K | |
![[IMG]](/icons/image2.gif) | Snell-17th-Managing-..> | 2023-05-03 10:12 | 44K | |
![[ ]](/icons/compressed.gif) | Snell-2015-17th-1285..> | 2023-05-03 10:12 | 53K | |
![[ ]](/icons/unknown.gif) | Snell_18e_IM_Ch01.doc | 2023-05-04 01:50 | 67K | |
![[IMG]](/icons/image2.gif) | Society_The_Basics_M..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | Society_The_Basics_M..> | 2023-08-15 16:37 | 15K | |
![[IMG]](/icons/image2.gif) | Society_The_Basics_M..> | 2023-05-03 09:41 | 34K | |
![[IMG]](/icons/image2.gif) | Sociology-A-Brief-In..> | 2023-05-03 10:25 | 32K | |
![[IMG]](/icons/image2.gif) | Sociology-The-Essent..> | 2023-08-05 02:03 | 3.3K | |
![[IMG]](/icons/image2.gif) | Sociology-The-Essent..> | 2023-05-03 10:59 | 9.7K | |
![[IMG]](/icons/image2.gif) | Sociology_15th__6054..> | 2023-08-05 03:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | Sociology_15th__6054..> | 2023-08-16 12:29 | 22K | |
![[IMG]](/icons/image2.gif) | Sociology_15th__6054..> | 2023-05-03 10:27 | 47K | |
![[IMG]](/icons/image2.gif) | Sociology_A_Down_to_..> | 2023-08-05 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | Sociology_A_Down_to_..> | 2023-08-16 12:29 | 16K | |
![[IMG]](/icons/image2.gif) | Sociology_A_Down_to_..> | 2023-05-03 10:09 | 36K | |
![[ ]](/icons/layout.gif) | Software-Engineering..> | 2023-05-03 10:07 | 133K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-Down..> | 2023-08-06 05:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-Down..> | 2023-08-16 15:50 | 20K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-Down..> | 2023-05-04 01:59 | 44K | |
![[ ]](/icons/layout.gif) | Solution-Manual-For-..> | 2023-05-03 13:42 | 216K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-06 09:42 | 3.8K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-04 02:21 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-09 01:06 | 3.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-05 03:41 | 24K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-03 10:56 | 30K | |
![[ ]](/icons/unknown.gif) | Solution-Manual-For-..> | 2023-05-03 09:33 | 39K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-05 16:23 | 5.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-08 15:43 | 37K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-04 01:56 | 40K | |
![[ ]](/icons/unknown.gif) | Solution-Manual-For-..> | 2023-05-03 09:59 | 62K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-For-..> | 2023-05-03 10:38 | 22K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-07 22:06 | 5.3K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-04 02:21 | 23K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-05 07:19 | 2.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-04 02:19 | 9.1K | |
![[ ]](/icons/layout.gif) | Solution-Manual-For-..> | 2023-05-04 02:13 | 132K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-05 15:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-08-09 12:13 | 22K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-For-..> | 2023-05-04 01:55 | 26K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:44 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:14 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:00 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:43 | 6.8K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:19 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:55 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:10 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:35 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:52 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:14 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:38 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:58 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:33 | 19K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:20 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:14 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:34 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:10 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:51 | 13K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 11:11 | 1.3M | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:13 | 17K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 10:50 | 98K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 13:44 | 132K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:50 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:35 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:02 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:06 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:15 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:29 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:14 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:09 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:48 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:41 | 6.5K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:54 | 13K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 10:06 | 39K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:52 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:18 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:45 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:53 | 9.0K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:48 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:24 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:02 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:49 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:50 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:17 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:00 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:15 | 16K | |
![[ ]](/icons/unknown.gif) | Solution-Manual-for-..> | 2023-05-04 01:47 | 3.7M | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 13:44 | 113K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:03 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:57 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:09 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:51 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:09 | 9.2K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:03 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:38 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:15 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:50 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:24 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:43 | 18K | |
![[ ]](/icons/unknown.gif) | Solution-Manual-for-..> | 2023-05-03 13:40 | 26K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:23 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:42 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:52 | 15K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-04 02:29 | 960K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:42 | 20K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:27 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:35 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-07 04:34 | 4.5K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-12 04:49 | 23K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:58 | 25K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:54 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:49 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:23 | 20K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:36 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:10 | 8.3K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:22 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:00 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:21 | 19K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:35 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:34 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:47 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:47 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:09 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:34 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:51 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:40 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:52 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:38 | 5.1K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:49 | 9.8K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:12 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:00 | 19K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:11 | 14K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 3.7M | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:54 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:23 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:07 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:22 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:36 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:16 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:19 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:15 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:19 | 10K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:20 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:06 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:45 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-05 01:52 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:55 | 64K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:54 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:58 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:10 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:12 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:45 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:50 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:11 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:51 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:53 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:40 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:19 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:28 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:11 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:13 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:57 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:15 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:29 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:34 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:10 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:11 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:46 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-05 07:04 | 3.9K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-05 03:41 | 28K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:17 | 31K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 09:24 | 1.1M | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:33 | 12K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 10:56 | 374K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:48 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:05 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:40 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:52 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:16 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:52 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:30 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:57 | 10K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:51 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:45 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:34 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:18 | 9.4K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:37 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:51 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:56 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:29 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:23 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:39 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:13 | 8.6K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:24 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:58 | 9.4K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:33 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:40 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:51 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:05 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:21 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:42 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:29 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:51 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:59 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:26 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:25 | 13K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 10:29 | 816K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:34 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 10K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:48 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:37 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:24 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:13 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:04 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:52 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:38 | 9.3K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:34 | 9.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:52 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:52 | 14K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 11:05 | 2.7M | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:04 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:41 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:12 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:53 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-23 02:15 | 28K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:09 | 29K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:55 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:14 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:09 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:14 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:25 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:17 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:44 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:55 | 16K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 09:28 | 32K | |
![[ ]](/icons/unknown.gif) | Solution-Manual-for-..> | 2023-05-03 13:41 | 74K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:50 | 19K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:03 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-08-06 17:26 | 3.3K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:22 | 7.3K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 11:22 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:50 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:26 | 12K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 09:26 | 669K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:35 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:32 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:38 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:33 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:26 | 9.7K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:20 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:50 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:29 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:03 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:12 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:17 | 20K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:53 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:36 | 12K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 10:52 | 502K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:04 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:13 | 7.2K | |
![[ ]](/icons/layout.gif) | Solution-Manual-for-..> | 2023-05-03 10:38 | 468K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:10 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:46 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:50 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 11:20 | 19K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:41 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:26 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:49 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:41 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:12 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 11K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:11 | 12K | |
![[ ]](/icons/compressed.gif) | Solution-Manual-for-..> | 2023-05-03 10:09 | 24K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:45 | 21K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:05 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:40 | 10K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:00 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:02 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:29 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:39 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:36 | 9.3K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:51 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:13 | 12K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:47 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:11 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 01:50 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:26 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:16 | 13K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:18 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:51 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:17 | 14K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:22 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:17 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:49 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:39 | 9.5K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:23 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:38 | 5.1K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:46 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 09:33 | 15K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-03 10:37 | 18K | |
![[IMG]](/icons/image2.gif) | Solution-Manual-for-..> | 2023-05-04 02:00 | 16K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Comm..> | 2023-08-08 14:33 | 4.5K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Comm..> | 2023-08-14 19:44 | 25K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Comm..> | 2023-05-04 02:12 | 42K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Soci..> | 2023-08-08 22:57 | 3.8K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Soci..> | 2023-08-13 06:55 | 17K | |
![[IMG]](/icons/image2.gif) | Solution-manual-Soci..> | 2023-05-04 02:15 | 28K | |
![[ ]](/icons/unknown.gif) | Solution-manual-for-..> | 2023-05-03 09:30 | 68K | |
![[IMG]](/icons/image2.gif) | Solution20Manual20fo..> | 2023-05-03 10:25 | 18K | |
![[ ]](/icons/unknown.gif) | Solutions-Chapter-1-..> | 2023-05-03 11:09 | 29K | |
![[IMG]](/icons/image2.gif) | Solutions-Intermedia..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | Solutions-Intermedia..> | 2023-05-03 10:38 | 11K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-Int..> | 2023-05-03 10:57 | 360K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-Leg..> | 2023-05-03 09:56 | 12K | |
![[ ]](/icons/unknown.gif) | Solutions-Manual-Mic..> | 2023-05-03 11:10 | 232K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-Ope..> | 2023-05-03 13:43 | 215K | |
![[ ]](/icons/compressed.gif) | Solutions-Manual-Pra..> | 2023-05-03 10:04 | 2.7M | |
![[ ]](/icons/layout.gif) | Solutions-Manual-Pro..> | 2023-05-03 10:21 | 333K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-Pro..> | 2023-05-03 13:41 | 295K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-for..> | 2023-05-03 09:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Solutions-Manual-for..> | 2023-05-03 09:56 | 243K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-for..> | 2023-05-03 09:25 | 415K | |
![[ ]](/icons/layout.gif) | Solutions-Manual-for..> | 2023-05-03 09:44 | 4.3M | |
![[ ]](/icons/unknown.gif) | Solutions-final-chp0..> | 2023-05-03 09:49 | 64K | |
![[ ]](/icons/unknown.gif) | Solutions01-Solution..> | 2023-05-03 09:54 | 42K | |
![[ ]](/icons/layout.gif) | Solutions_Ch28-Solut..> | 2023-05-03 10:25 | 138K | |
![[IMG]](/icons/image2.gif) | Sorrentinotextbook-f..> | 2023-08-06 16:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | Sorrentinotextbook-f..> | 2023-09-06 23:57 | 16K | |
![[IMG]](/icons/image2.gif) | Sorrentinotextbook-f..> | 2023-05-03 10:04 | 37K | |
![[IMG]](/icons/image2.gif) | Spiceland7e_large_co..> | 2023-08-09 05:10 | 4.7K | |
![[IMG]](/icons/image2.gif) | Spiceland7e_large_co..> | 2023-05-03 10:43 | 23K | |
![[ ]](/icons/unknown.gif) | Spiceland10e_TB_Chap..> | 2023-05-03 13:41 | 149K | |
![[ ]](/icons/unknown.gif) | Spilker-1_version1.docx | 2023-05-04 02:01 | 50K | |
![[ ]](/icons/unknown.gif) | Spilker11e_Chapter01..> | 2023-05-04 02:28 | 27K | |
![[ ]](/icons/unknown.gif) | Spilker_Individuals_..> | 2023-05-04 02:01 | 123K | |
![[ ]](/icons/unknown.gif) | Spilker_TIBE_11e_Ch0..> | 2023-05-04 02:09 | 129K | |
![[ ]](/icons/unknown.gif) | Stanford-_EBA_3e_TIF..> | 2023-05-03 10:27 | 62K | |
![[ ]](/icons/compressed.gif) | Stat3e_SAM-AK-Ch02.zip | 2023-05-03 10:41 | 109K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-08-06 15:32 | 2.6K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-08-11 02:47 | 14K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-05-03 09:48 | 32K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-08-05 06:23 | 2.6K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-08-11 02:47 | 14K | |
![[IMG]](/icons/image2.gif) | Statistical_Techniqu..> | 2023-05-03 10:42 | 32K | |
![[IMG]](/icons/image2.gif) | Statistics-Agresti-2..> | 2023-08-06 08:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | Statistics-Agresti-2..> | 2023-08-05 17:23 | 17K | |
![[IMG]](/icons/image2.gif) | Statistics-Agresti-2..> | 2023-05-03 09:31 | 82K | |
![[IMG]](/icons/image2.gif) | Statistics_for_Manag..> | 2023-08-06 10:18 | 2.4K | |
![[IMG]](/icons/image2.gif) | Statistics_for_Manag..> | 2023-08-11 18:44 | 13K | |
![[IMG]](/icons/image2.gif) | Statistics_for_Manag..> | 2023-05-03 09:22 | 24K | |
![[ ]](/icons/unknown.gif) | Stephenson-1_version..> | 2023-05-04 01:53 | 18K | |
![[IMG]](/icons/image2.gif) | Stewart-7th-Single-V..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | Stewart-7th-Single-V..> | 2023-08-05 01:08 | 10K | |
![[IMG]](/icons/image2.gif) | Stewart-7th-Single-V..> | 2023-05-03 10:15 | 24K | |
![[ ]](/icons/compressed.gif) | Stewart-2011-7th-053..> | 2023-05-03 10:15 | 7.8K | |
![[IMG]](/icons/image2.gif) | Strategic-Financial-..> | 2023-08-05 01:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | Strategic-Financial-..> | 2023-08-05 17:23 | 19K | |
![[IMG]](/icons/image2.gif) | Strategic-Financial-..> | 2023-05-03 10:21 | 47K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-05 16:24 | 2.7K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-12 04:49 | 16K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-05-03 10:00 | 79K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-25 19:27 | 18K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-05-03 11:16 | 49K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-05 03:44 | 3.9K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-08-18 08:28 | 22K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-05-03 09:53 | 91K | |
![[IMG]](/icons/image2.gif) | Strategic-Management..> | 2023-05-03 10:39 | 44K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-09 09:11 | 22K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-05-03 10:49 | 46K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-06 10:20 | 2.6K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-12 20:37 | 13K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-05-03 10:43 | 21K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-05 01:52 | 2.6K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-08-09 09:11 | 13K | |
![[IMG]](/icons/image2.gif) | Strategic_Management..> | 2023-05-03 10:43 | 21K | |
![[ ]](/icons/compressed.gif) | Strauss-7ed-chp-1-IM..> | 2023-05-03 09:35 | 35K | |
![[ ]](/icons/layout.gif) | Striebig-1e-ISM-Chap..> | 2023-05-03 10:21 | 967K | |
![[ ]](/icons/compressed.gif) | Subramanyam--Financi..> | 2023-05-03 09:26 | 2.4M | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-08-05 02:46 | 4.0K | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-08-12 20:37 | 22K | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-05-03 10:12 | 51K | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-08-08 21:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-08-17 05:48 | 22K | |
![[IMG]](/icons/image2.gif) | Successful_Project_M..> | 2023-05-03 09:54 | 51K | |
![[IMG]](/icons/image2.gif) | Supply-Chain-Managem..> | 2023-08-05 05:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | Supply-Chain-Managem..> | 2023-08-08 14:29 | 15K | |
![[IMG]](/icons/image2.gif) | Supply-Chain-Managem..> | 2023-05-03 10:14 | 34K | |
![[ ]](/icons/unknown.gif) | Supply-Chain-Network..> | 2023-05-03 10:04 | 131K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm2-100x..> | 2023-08-06 11:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm2-300x..> | 2023-08-24 16:37 | 20K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm2.jpg | 2023-05-03 10:42 | 49K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm21-100..> | 2023-08-05 06:24 | 3.3K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm21-300..> | 2023-08-15 07:57 | 20K | |
![[IMG]](/icons/image2.gif) | Swink2e14mb_nm21.jpg | 2023-05-03 10:13 | 49K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-08-06 03:58 | 3.5K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-08-05 14:41 | 19K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-05-03 10:00 | 93K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-08-05 14:41 | 17K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-05-03 10:40 | 42K | |
![[IMG]](/icons/image2.gif) | Systems-Analysis-and..> | 2023-05-03 10:40 | 66K | |
![[IMG]](/icons/image2.gif) | Systems_Analysis_and..> | 2023-08-08 14:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | Systems_Analysis_and..> | 2023-08-07 09:53 | 16K | |
![[IMG]](/icons/image2.gif) | Systems_Analysis_and..> | 2023-05-04 02:00 | 29K | |
![[ ]](/icons/layout.gif) | TAYLMC01_0136064671.pdf | 2023-05-03 10:07 | 1.6M | |
![[ ]](/icons/compressed.gif) | TB-0073402745-Organi..> | 2023-05-03 10:20 | 371K | |
![[ ]](/icons/compressed.gif) | TB-0073513725-Medica..> | 2023-05-03 10:08 | 5.6K | |
![[ ]](/icons/compressed.gif) | TB-0073523534-Exerci..> | 2023-05-03 09:49 | 18K | |
![[ ]](/icons/compressed.gif) | TB-0077862228-Advanc..> | 2023-05-03 10:06 | 24K | |
![[ ]](/icons/unknown.gif) | TB-01-new-Accounting..> | 2023-05-03 09:19 | 328K | |
![[ ]](/icons/compressed.gif) | TB-013216566X-Social..> | 2023-05-03 10:31 | 14K | |
![[ ]](/icons/compressed.gif) | TB-0133046001-Matern..> | 2023-05-03 10:45 | 13K | |
![[ ]](/icons/compressed.gif) | TB-013349991X-Fundam..> | 2023-05-03 10:45 | 75K | |
![[ ]](/icons/unknown.gif) | TB-020584894X-Social..> | 2023-05-03 09:26 | 414K | |
![[ ]](/icons/compressed.gif) | TB-0321558235-Campbe..> | 2023-05-03 10:42 | 9.4K | |
![[ ]](/icons/compressed.gif) | TB-0321693620-Elemen..> | 2023-05-03 11:08 | 327K | |
![[ ]](/icons/compressed.gif) | TB-0321768418-Organi..> | 2023-05-03 10:21 | 200K | |
![[ ]](/icons/compressed.gif) | TB-0321775651-Campbe..> | 2023-05-03 09:26 | 23K | |
![[ ]](/icons/layout.gif) | TB-0321822323-Human-..> | 2023-05-03 10:33 | 398K | |
![[ ]](/icons/compressed.gif) | TB-0323073999-Basic-..> | 2023-05-03 10:14 | 14K | |
![[ ]](/icons/compressed.gif) | TB-0393913481-Cognit..> | 2023-05-03 10:24 | 109K | |
![[ ]](/icons/compressed.gif) | TB-047043774X-Forens..> | 2023-05-03 09:46 | 36K | |
![[ ]](/icons/compressed.gif) | TB-0470903597-Princi..> | 2023-05-03 09:31 | 5.9K | |
![[ ]](/icons/compressed.gif) | TB-0538733527-Probab..> | 2023-05-03 10:44 | 20K | |
![[ ]](/icons/compressed.gif) | TB-0730302121-Applyi..> | 2023-05-03 09:43 | 17K | |
![[ ]](/icons/compressed.gif) | TB-0781780586-Bates-..> | 2023-05-03 10:16 | 11K | |
![[ ]](/icons/compressed.gif) | TB-080362235X-Pharma..> | 2023-05-03 09:55 | 5.9K | |
![[ ]](/icons/compressed.gif) | TB-0803622457-The-Nu..> | 2023-05-03 09:22 | 3.3K | |
![[ ]](/icons/compressed.gif) | TB-0803627637-Nursin..> | 2023-05-03 09:33 | 3.8K | |
![[ ]](/icons/compressed.gif) | TB-0803640684-Unders..> | 2023-05-03 09:46 | 11K | |
![[ ]](/icons/compressed.gif) | TB-111823071X-Fundam..> | 2023-05-03 10:58 | 29K | |
![[ ]](/icons/compressed.gif) | TB-1118344391-Princi..> | 2023-05-03 09:31 | 26K | |
![[ ]](/icons/compressed.gif) | TB-1259186407-Projec..> | 2023-05-03 09:32 | 25K | |
![[ ]](/icons/compressed.gif) | TB-1269342819-978126..> | 2023-05-03 09:54 | 22K | |
![[ ]](/icons/compressed.gif) | TB-1285185242-Busine..> | 2023-05-03 09:07 | 35K | |
![[ ]](/icons/compressed.gif) | TB-1451146000-978-14..> | 2023-05-03 09:32 | 7.0K | |
![[ ]](/icons/compressed.gif) | TB-1464110700-World-..> | 2023-05-03 10:04 | 20K | |
![[ ]](/icons/compressed.gif) | TB-1582557241-Essent..> | 2023-05-03 11:07 | 5.0K | |
![[ ]](/icons/compressed.gif) | TB-1605476730-Burton..> | 2023-05-03 10:31 | 12K | |
![[ ]](/icons/unknown.gif) | TB-Ch-1-Walsh-5e.docx | 2023-05-03 10:42 | 26K | |
![[ ]](/icons/unknown.gif) | TB-Chapter-1-Bank-Ma..> | 2023-05-03 09:40 | 26K | |
![[ ]](/icons/unknown.gif) | TB-Chapter-1-Bank-Ma..> | 2023-05-03 11:19 | 26K | |
![[ ]](/icons/compressed.gif) | TB-Chemistry-The-Mol..> | 2023-05-03 09:44 | 31K | |
![[ ]](/icons/unknown.gif) | TBChap001-0078028949..> | 2023-05-03 09:34 | 44K | |
![[ ]](/icons/unknown.gif) | TBChap001-Accounting..> | 2023-05-03 09:50 | 42K | |
![[ ]](/icons/unknown.gif) | TBChap001-Auditing-A..> | 2023-05-03 09:28 | 77K | |
![[ ]](/icons/unknown.gif) | TBChap001-Financial-..> | 2023-05-03 09:45 | 577K | |
![[ ]](/icons/unknown.gif) | TBChap001-Financial-..> | 2023-05-03 09:31 | 67K | |
![[ ]](/icons/unknown.gif) | TBChap001-Foundation..> | 2023-05-03 09:20 | 84K | |
![[ ]](/icons/unknown.gif) | TBChap001-Fundamenta..> | 2023-05-03 10:01 | 21K | |
![[ ]](/icons/unknown.gif) | TBChap001-Fundamenta..> | 2023-05-03 09:34 | 166K | |
![[ ]](/icons/unknown.gif) | TBChap001-Human-Reso..> | 2023-05-03 10:25 | 109K | |
![[ ]](/icons/unknown.gif) | TBChap001-Operations..> | 2023-05-03 10:20 | 72K | |
![[ ]](/icons/unknown.gif) | TBChap001-Operations..> | 2023-05-03 09:59 | 61K | |
![[ ]](/icons/compressed.gif) | TBChap001-Real-Estat..> | 2023-05-03 10:55 | 40K | |
![[ ]](/icons/unknown.gif) | TBChap001-Statistica..> | 2023-05-03 09:47 | 68K | |
![[ ]](/icons/unknown.gif) | TBChap001-Test-Bank-..> | 2023-05-03 10:29 | 58K | |
![[ ]](/icons/compressed.gif) | TBChap001-Test-Bank-..> | 2023-05-03 10:10 | 10K | |
![[ ]](/icons/compressed.gif) | TBChap001.zip | 2023-05-03 10:49 | 5.0K | |
![[ ]](/icons/unknown.gif) | TBChap002-Macroecono..> | 2023-05-03 10:36 | 1.0M | |
![[ ]](/icons/unknown.gif) | TBChap002-Microecono..> | 2023-05-03 10:30 | 1.0M | |
![[ ]](/icons/unknown.gif) | TBChap002-Test-Bank-..> | 2023-05-03 09:34 | 117K | |
![[ ]](/icons/unknown.gif) | TBChap002A-Manageria..> | 2023-05-03 10:16 | 700K | |
![[ ]](/icons/unknown.gif) | TBChapter-1-Test-Ban..> | 2023-05-03 10:28 | 62K | |
![[ ]](/icons/unknown.gif) | TB_01-Test-Bank-for-..> | 2023-05-03 13:42 | 147K | |
![[ ]](/icons/unknown.gif) | TB_C1ed-Test-Bank-fo..> | 2023-05-03 09:39 | 89K | |
![[ ]](/icons/compressed.gif) | TB_CH2-RB-8th.zip | 2023-05-03 09:39 | 11K | |
![[ ]](/icons/unknown.gif) | TB_Ch01_BENO8e.docx | 2023-05-03 10:28 | 53K | |
![[ ]](/icons/compressed.gif) | TB_Chapter 01.zip | 2023-05-03 09:59 | 66K | |
![[ ]](/icons/unknown.gif) | TB_WL10_ch02revB.doc | 2023-05-03 09:33 | 182K | |
![[ ]](/icons/unknown.gif) | TB_chapter1-Test-Ban..> | 2023-05-03 11:01 | 180K | |
![[ ]](/icons/unknown.gif) | TB_chapter1-Test-Ban..> | 2023-05-03 10:39 | 174K | |
![[IMG]](/icons/image2.gif) | TEST-B1-1-506x600-1-..> | 2023-08-05 14:00 | 4.2K | |
![[IMG]](/icons/image2.gif) | TEST-B1-1-506x600-1-..> | 2023-08-27 04:27 | 28K | |
![[IMG]](/icons/image2.gif) | TEST-B1-1-506x600-1.jpg | 2023-05-04 02:22 | 108K | |
![[IMG]](/icons/image2.gif) | TEST-B1-100x100.jpg | 2023-08-05 02:08 | 6.3K | |
![[IMG]](/icons/image2.gif) | TEST-B1.jpg | 2023-05-04 02:16 | 26K | |
![[IMG]](/icons/image2.gif) | THINK-Marriages-and-..> | 2023-08-05 04:35 | 4.9K | |
![[IMG]](/icons/image2.gif) | THINK-Marriages-and-..> | 2023-09-14 18:39 | 27K | |
![[IMG]](/icons/image2.gif) | THINK-Marriages-and-..> | 2023-05-04 02:01 | 137K | |
![[ ]](/icons/unknown.gif) | TIA_16e_Ch01_Testban..> | 2023-05-03 13:41 | 24K | |
![[ ]](/icons/compressed.gif) | TIF-Ch01-ARN5.zip | 2023-05-03 11:01 | 27K | |
![[ ]](/icons/layout.gif) | TIFBUTC01.pdf | 2023-05-03 10:06 | 146K | |
![[ ]](/icons/compressed.gif) | TIF Ch 01.zip | 2023-05-03 10:39 | 14K | |
![[ ]](/icons/compressed.gif) | TIF_Ch01_10e_41912.zip | 2023-05-03 09:43 | 80K | |
![[ ]](/icons/unknown.gif) | TITM_FINA_8E_SM_C01...> | 2023-05-03 13:44 | 36K | |
![[ ]](/icons/unknown.gif) | TM_Ch01_Modern_Proje..> | 2023-05-03 09:22 | 61K | |
![[ ]](/icons/compressed.gif) | TN2_Bill_Miller_and_..> | 2023-05-03 10:54 | 48K | |
![[ ]](/icons/layout.gif) | TRO4_IRM_1.pdf | 2023-05-03 10:31 | 114K | |
![[ ]](/icons/unknown.gif) | TX.GOV_TB_Ch01.doc | 2023-05-04 02:21 | 148K | |
![[IMG]](/icons/image2.gif) | Talaro-9th-Foundatio..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | Talaro-9th-Foundatio..> | 2023-08-05 01:08 | 16K | |
![[IMG]](/icons/image2.gif) | Talaro-9th-Foundatio..> | 2023-05-03 09:12 | 40K | |
![[IMG]](/icons/image2.gif) | Taylor-7th-Edition-F..> | 2023-08-08 17:53 | 3.2K | |
![[IMG]](/icons/image2.gif) | Taylor-7th-Edition-F..> | 2023-08-17 05:40 | 16K | |
![[IMG]](/icons/image2.gif) | Taylor-7th-Edition-F..> | 2023-05-03 10:47 | 34K | |
![[ ]](/icons/compressed.gif) | Tb-0321570561-Calcul..> | 2023-05-03 10:06 | 200K | |
![[ ]](/icons/unknown.gif) | Tech-for-Success_IML..> | 2023-05-04 01:49 | 62K | |
![[IMG]](/icons/image2.gif) | Test-Bank-521x600-1-..> | 2023-08-06 01:01 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-521x600-1-..> | 2023-08-14 03:16 | 111K | |
![[IMG]](/icons/image2.gif) | Test-Bank-521x600-1.png | 2023-05-03 09:41 | 356K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Accounting..> | 2023-08-05 01:09 | 5.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Accounting..> | 2023-05-03 09:22 | 47K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Advanced-F..> | 2023-08-08 21:07 | 4.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Advanced-F..> | 2023-05-04 02:12 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Advanced-P..> | 2023-08-06 04:36 | 5.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Advanced-P..> | 2023-05-03 10:06 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Anatomy-Ph..> | 2023-08-06 08:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Anatomy-Ph..> | 2023-08-13 04:19 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Anatomy-Ph..> | 2023-05-03 10:06 | 44K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Bates-Nurs..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Bates-Nurs..> | 2023-05-03 09:34 | 22K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biological..> | 2023-08-06 07:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biological..> | 2023-09-02 05:06 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biological..> | 2023-05-04 02:13 | 106K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biology-Ha..> | 2023-08-05 04:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biology-Ha..> | 2023-08-13 04:19 | 22K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Biology-Ha..> | 2023-05-03 10:53 | 51K | |
![[ ]](/icons/compressed.gif) | Test-Bank-Chapter-2-..> | 2023-05-03 09:24 | 22K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Conceptual..> | 2023-05-03 09:27 | 526K | |
![[ ]](/icons/compressed.gif) | Test-Bank-Download-O..> | 2023-05-03 11:05 | 9.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Downloadab..> | 2023-08-06 07:48 | 2.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Downloadab..> | 2023-08-28 17:05 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Downloadab..> | 2023-05-03 11:16 | 14K | |
![[ ]](/icons/unknown.gif) | Test-Bank-E-marketin..> | 2023-05-03 10:16 | 26K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Economics-..> | 2023-08-05 04:37 | 4.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Economics-..> | 2023-08-20 21:48 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Economics-..> | 2023-05-04 02:11 | 125K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Economics-..> | 2023-05-04 02:11 | 90K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Entreprene..> | 2023-05-03 09:53 | 66K | |
![[ ]](/icons/layout.gif) | Test-Bank-Essentials..> | 2023-05-03 10:11 | 97K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Financial-..> | 2023-08-05 03:40 | 3.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Financial-..> | 2023-08-11 03:41 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Financial-..> | 2023-05-04 02:13 | 43K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-AM-GOV..> | 2023-08-05 16:27 | 4.8K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-AM-GOV..> | 2023-08-18 21:48 | 29K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-AM-GOV..> | 2023-05-04 01:49 | 35K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Accoun..> | 2023-05-04 02:12 | 65K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Admini..> | 2023-05-03 10:14 | 17K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Basic-..> | 2023-05-03 13:41 | 29K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Brain-..> | 2023-08-06 12:02 | 6.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Brain-..> | 2023-05-04 02:09 | 27K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Busine..> | 2023-08-06 05:23 | 7.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Busine..> | 2023-05-04 02:26 | 33K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Child-..> | 2023-08-05 14:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Child-..> | 2023-05-04 01:59 | 17K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Civil-..> | 2023-05-03 09:40 | 77K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Clinic..> | 2023-08-06 03:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Clinic..> | 2023-05-04 02:17 | 12K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Colleg..> | 2023-05-03 09:22 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Consum..> | 2023-08-05 14:38 | 4.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Consum..> | 2023-08-17 00:57 | 33K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Consum..> | 2023-05-04 02:06 | 42K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Crimin..> | 2023-08-06 10:18 | 4.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Crimin..> | 2023-05-04 01:54 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Econom..> | 2023-08-06 17:22 | 2.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Econom..> | 2023-08-16 22:56 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Econom..> | 2023-05-04 02:17 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Founda..> | 2023-08-05 15:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Founda..> | 2023-05-04 02:17 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Govern..> | 2023-08-05 01:51 | 6.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Govern..> | 2023-05-04 02:29 | 29K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Human-..> | 2023-05-03 09:42 | 554K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Intern..> | 2023-08-06 16:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Intern..> | 2023-08-09 01:55 | 24K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Intern..> | 2023-05-03 10:58 | 30K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Introd..> | 2023-08-05 01:08 | 3.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Introd..> | 2023-05-04 02:17 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Introd..> | 2023-08-05 17:22 | 5.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Introd..> | 2023-05-04 01:54 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Leader..> | 2023-08-05 16:26 | 2.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Leader..> | 2023-05-04 02:24 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Living..> | 2023-08-05 04:34 | 26K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Living..> | 2023-05-04 02:19 | 61K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Mktg-1..> | 2023-08-05 01:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Mktg-1..> | 2023-09-27 19:59 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Mktg-1..> | 2023-05-04 02:16 | 58K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Parent..> | 2023-08-06 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Parent..> | 2023-05-04 02:27 | 14K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Physic..> | 2023-05-03 11:24 | 227K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Pilbea..> | 2023-05-03 09:37 | 784K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Presco..> | 2023-08-05 06:25 | 4.8K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Presco..> | 2023-10-29 12:50 | 28K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Presco..> | 2023-05-04 01:51 | 36K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Princi..> | 2023-05-03 10:02 | 1.5M | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Princi..> | 2023-08-05 16:24 | 3.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Princi..> | 2023-11-01 05:03 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Princi..> | 2023-05-04 02:18 | 65K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Public..> | 2023-08-05 06:23 | 22K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Public..> | 2023-05-04 02:28 | 48K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Public..> | 2023-08-06 04:47 | 5.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Public..> | 2023-05-04 02:22 | 23K | |
![[ ]](/icons/compressed.gif) | Test-Bank-For-Python..> | 2023-05-03 11:10 | 6.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Reflec..> | 2023-08-05 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Reflec..> | 2023-05-04 01:59 | 44K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-08-09 09:06 | 4.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-05-04 02:25 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-08-10 01:21 | 2.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-05-04 02:24 | 9.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-08-06 07:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Resear..> | 2023-05-04 01:55 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-08-05 15:33 | 2.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-08-09 20:29 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-05-04 02:09 | 39K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-08-09 10:07 | 3.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-08-15 20:03 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Revel-..> | 2023-05-04 02:01 | 53K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Saunde..> | 2023-05-03 13:43 | 95K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Small-..> | 2023-08-05 06:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Small-..> | 2023-05-04 02:07 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Sport-..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Sport-..> | 2023-08-20 22:38 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-Sport-..> | 2023-05-04 02:07 | 82K | |
![[ ]](/icons/unknown.gif) | Test-Bank-For-Succee..> | 2023-05-03 10:44 | 563K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-En..> | 2023-08-05 15:30 | 5.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-En..> | 2023-05-04 02:24 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-Pr..> | 2023-08-06 13:03 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-Pr..> | 2023-05-04 02:16 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-Ps..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-For-The-Ps..> | 2023-05-04 01:47 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Forensic-P..> | 2023-08-06 00:42 | 2.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Forensic-P..> | 2023-08-17 18:14 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Forensic-P..> | 2023-05-03 09:20 | 29K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Fundamenta..> | 2023-08-05 05:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Fundamenta..> | 2023-05-03 10:33 | 13K | |
![[ ]](/icons/compressed.gif) | Test-Bank-Fundamenta..> | 2023-05-03 13:42 | 57K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Global-Mar..> | 2023-08-08 05:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Global-Mar..> | 2023-09-15 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Global-Mar..> | 2023-05-04 02:09 | 82K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Human-Nutr..> | 2023-08-06 10:15 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Human-Nutr..> | 2023-05-04 02:24 | 99K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Human-Reso..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Human-Reso..> | 2023-05-04 02:15 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Interperso..> | 2023-08-06 11:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Interperso..> | 2023-05-03 10:01 | 4.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Introducti..> | 2023-08-05 01:09 | 4.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Introducti..> | 2023-05-04 02:25 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Introducti..> | 2023-08-05 08:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Introducti..> | 2023-05-04 02:15 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Marieb-Ess..> | 2023-08-06 07:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Marieb-Ess..> | 2023-08-09 09:15 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Marieb-Ess..> | 2023-05-03 11:04 | 57K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Maternal-C..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Maternal-C..> | 2023-05-03 10:11 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Math-For-B..> | 2023-08-05 01:54 | 5.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Math-For-B..> | 2023-05-03 10:58 | 18K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Measuremen..> | 2023-05-03 11:04 | 40K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Medical-Su..> | 2023-08-05 02:47 | 2.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Medical-Su..> | 2023-05-03 10:36 | 7.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Neebs-Fund..> | 2023-08-05 03:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Neebs-Fund..> | 2023-08-06 16:00 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Neebs-Fund..> | 2023-05-03 10:09 | 46K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Nutrition-..> | 2023-08-05 02:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Nutrition-..> | 2023-08-21 05:38 | 24K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Nutrition-..> | 2023-05-03 10:56 | 45K | |
![[ ]](/icons/layout.gif) | Test-Bank-Organizati..> | 2023-05-03 10:23 | 825K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Period-1-S..> | 2023-05-04 02:06 | 415K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Priorities..> | 2023-08-05 03:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Priorities..> | 2023-05-03 09:42 | 30K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Profession..> | 2023-08-08 08:37 | 3.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Profession..> | 2023-08-06 03:41 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Profession..> | 2023-05-03 10:33 | 36K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Psychiatri..> | 2023-08-05 14:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Psychiatri..> | 2023-05-03 10:02 | 34K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Strategic-..> | 2023-05-04 02:03 | 53K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Understand..> | 2023-08-05 05:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Understand..> | 2023-05-03 09:46 | 12K | |
![[ ]](/icons/unknown.gif) | Test-Bank-Varcarolis..> | 2023-05-03 11:00 | 117K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Virtual-Cl..> | 2023-08-05 15:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Virtual-Cl..> | 2023-08-05 02:29 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-Virtual-Cl..> | 2023-05-03 09:41 | 39K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-21st-C..> | 2023-05-03 09:56 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-21st-C..> | 2023-05-03 11:01 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-21st-C..> | 2023-05-03 10:45 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-A-Hist..> | 2023-05-03 10:18 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-A-Hist..> | 2023-05-03 10:44 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-A-Hist..> | 2023-05-03 11:17 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-A-Hist..> | 2023-05-03 10:21 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-A-Peop..> | 2023-05-03 09:40 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Abnorm..> | 2023-05-03 10:40 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Accoun..> | 2023-05-03 09:45 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Accoun..> | 2023-05-03 09:44 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Advanc..> | 2023-05-03 09:19 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Advert..> | 2023-05-03 09:34 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Advert..> | 2023-05-03 11:19 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Advert..> | 2023-05-03 10:03 | 26K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Algebr..> | 2023-05-03 09:41 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:44 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 09:30 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:14 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:48 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 09:52 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:51 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:15 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:02 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:41 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-08-05 08:50 | 8.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-08-27 01:46 | 40K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-04 02:11 | 173K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:56 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Americ..> | 2023-05-03 10:24 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-An-Int..> | 2023-05-03 09:29 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-An-Int..> | 2023-05-04 02:13 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-An-Int..> | 2023-05-03 10:13 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-An-Inv..> | 2023-05-03 11:18 | 18K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Anatom..> | 2023-05-03 11:00 | 56K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Applie..> | 2023-05-03 09:50 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Astron..> | 2023-08-05 15:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Astron..> | 2023-05-03 10:10 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Basic-..> | 2023-05-03 10:43 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Basic-..> | 2023-05-03 10:17 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Beginn..> | 2023-05-04 02:14 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Behavi..> | 2023-05-03 10:47 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Bioche..> | 2023-05-03 10:59 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Biolog..> | 2023-05-03 09:21 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Biolog..> | 2023-05-03 10:52 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Biosta..> | 2023-05-03 10:03 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Brief-..> | 2023-05-03 10:14 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Busine..> | 2023-05-04 02:21 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Busine..> | 2023-05-03 11:03 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-CB7-7t..> | 2023-05-03 09:43 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-CISSP-..> | 2023-05-04 02:14 | 12K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-Campbe..> | 2023-05-03 10:10 | 404K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Case-S..> | 2023-05-03 10:31 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-04 02:06 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:54 | 9.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:30 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:52 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 10:39 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:36 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 10:47 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 10:47 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:41 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cengag..> | 2023-05-03 09:24 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Chemis..> | 2023-05-03 09:32 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Chemis..> | 2023-05-03 10:45 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Chemis..> | 2023-05-03 09:28 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Civil-..> | 2023-05-03 11:15 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cleft-..> | 2023-05-03 09:33 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Commun..> | 2023-05-03 10:33 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Commun..> | 2023-05-03 09:38 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Comput..> | 2023-05-03 10:43 | 15K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Concis..> | 2023-05-04 01:54 | 2.4M | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Connec..> | 2023-05-04 01:47 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Contem..> | 2023-05-03 10:01 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Contem..> | 2023-05-03 09:35 | 9.3K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Contem..> | 2023-05-03 11:12 | 89K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Corner..> | 2023-05-03 10:00 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Corner..> | 2023-05-03 09:29 | 8.1K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Corpor..> | 2023-05-03 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cost-A..> | 2023-05-03 10:41 | 9.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Crimin..> | 2023-05-03 09:35 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Crimin..> | 2023-05-03 11:18 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Crimin..> | 2023-05-03 10:24 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Crimin..> | 2023-05-03 10:21 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Crimin..> | 2023-05-03 09:28 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Critic..> | 2023-05-03 09:55 | 7.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cuadro..> | 2023-05-03 10:10 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cultur..> | 2023-05-03 10:07 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cultur..> | 2023-05-03 10:32 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Cultur..> | 2023-05-03 09:54 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Delmar..> | 2023-05-03 09:41 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Develo..> | 2023-05-03 09:45 | 17K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Develo..> | 2023-05-03 09:45 | 200K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Develo..> | 2023-05-03 11:00 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Discov..> | 2023-05-03 10:44 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Divers..> | 2023-05-03 10:27 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Dragon..> | 2023-05-04 02:09 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Econom..> | 2023-08-06 07:48 | 4.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Econom..> | 2023-08-16 22:56 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Econom..> | 2023-05-04 01:58 | 25K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Econom..> | 2023-05-03 09:40 | 9.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Educat..> | 2023-05-04 02:15 | 9.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Educat..> | 2023-05-03 10:16 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Electr..> | 2023-05-04 02:00 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Employ..> | 2023-05-03 10:42 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Employ..> | 2023-05-03 10:04 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Empowe..> | 2023-05-03 10:20 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Empowe..> | 2023-05-03 10:22 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Empowe..> | 2023-05-03 09:44 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Entrep..> | 2023-05-04 02:15 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Entrep..> | 2023-05-03 09:42 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Enviro..> | 2023-05-03 10:18 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Enviro..> | 2023-05-04 02:13 | 22K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Enviro..> | 2023-05-03 10:08 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-08-06 00:08 | 29K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-08-05 02:45 | 95K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-04 01:58 | 299K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-04 02:15 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-08-06 05:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-08-05 16:26 | 26K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-04 01:58 | 28K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:47 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:04 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 09:18 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 09:32 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:15 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 11:27 | 12K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Essent..> | 2023-05-03 09:35 | 49K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:35 | 429K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 09:19 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 11:17 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:34 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-04 01:50 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Essent..> | 2023-05-03 10:11 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Ethica..> | 2023-05-03 10:18 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Ethics..> | 2023-05-03 10:47 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Explor..> | 2023-05-03 09:36 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Family..> | 2023-05-03 10:08 | 16K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Financ..> | 2023-05-04 02:16 | 354K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Financ..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Financ..> | 2023-05-03 11:21 | 10K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Financ..> | 2023-05-03 11:21 | 60K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Financ..> | 2023-05-03 10:48 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Financ..> | 2023-05-03 10:04 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Food-a..> | 2023-05-03 10:42 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Food-a..> | 2023-05-03 09:29 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Forens..> | 2023-05-03 10:52 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-03 10:28 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-03 09:40 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-03 10:59 | 16K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Fundam..> | 2023-05-03 09:27 | 226K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-04 02:00 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-04 01:49 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Fundam..> | 2023-05-03 09:41 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-GEOL-2..> | 2023-05-03 11:19 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Gardne..> | 2023-05-03 10:12 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Gardne..> | 2023-05-03 10:22 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Gender..> | 2023-05-03 09:32 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Genera..> | 2023-05-03 10:42 | 15K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Genera..> | 2023-05-03 10:19 | 70K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Geogra..> | 2023-05-03 09:30 | 353K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Geogra..> | 2023-05-03 09:58 | 17K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Geront..> | 2023-05-03 10:43 | 78K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Give-M..> | 2023-05-03 10:33 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Give-M..> | 2023-05-03 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Give-M..> | 2023-05-03 09:31 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Govern..> | 2023-08-06 10:19 | 8.6K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Govern..> | 2023-08-23 20:26 | 33K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Govern..> | 2023-05-04 01:57 | 115K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Griffi..> | 2023-08-06 13:02 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Griffi..> | 2023-05-04 02:24 | 64K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Guide-..> | 2023-05-03 09:53 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Guide-..> | 2023-05-04 02:15 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Guidin..> | 2023-05-03 09:56 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-HDEV-4..> | 2023-05-03 10:32 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-HTML5-..> | 2023-05-03 10:23 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Health..> | 2023-05-03 09:31 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Health..> | 2023-05-04 01:50 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Histor..> | 2023-05-04 02:21 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Human-..> | 2023-05-04 02:22 | 19K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Human-..> | 2023-05-03 09:20 | 64K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Human-..> | 2023-05-03 11:01 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Human-..> | 2023-05-03 09:53 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-ICD-10..> | 2023-05-03 10:51 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Inform..> | 2023-05-03 09:58 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Intent..> | 2023-05-03 09:39 | 8.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Intern..> | 2023-05-03 10:30 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Intern..> | 2023-05-03 09:23 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Intern..> | 2023-05-03 10:51 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 10:39 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 10:49 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 09:41 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 09:36 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 10:33 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 11:17 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 09:44 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 10:04 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Introd..> | 2023-05-03 09:30 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Issues..> | 2023-05-03 10:50 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Java-P..> | 2023-05-03 11:25 | 11K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Java-S..> | 2023-05-03 10:41 | 67K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Judici..> | 2023-05-04 01:50 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Kaleid..> | 2023-05-03 10:29 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Libert..> | 2023-05-03 09:27 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Libert..> | 2023-05-03 11:05 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Listen..> | 2023-05-03 10:30 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Listen..> | 2023-05-03 10:32 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Living..> | 2023-05-03 09:28 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Living..> | 2023-05-03 09:51 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Macroe..> | 2023-05-03 09:59 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Majori..> | 2023-05-04 01:49 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Making..> | 2023-05-03 10:17 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Manage..> | 2023-05-03 10:55 | 9.4K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Manage..> | 2023-05-03 09:49 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Managi..> | 2023-05-03 09:30 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Market..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Market..> | 2023-08-25 22:45 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Market..> | 2023-05-04 02:23 | 31K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Masonr..> | 2023-05-03 10:12 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Matern..> | 2023-05-03 09:55 | 15K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-Matern..> | 2023-05-03 09:29 | 229K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Mathem..> | 2023-05-04 01:51 | 16K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-McKnig..> | 2023-05-03 09:39 | 164K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Media-..> | 2023-05-03 10:24 | 12K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Memmle..> | 2023-05-03 09:48 | 310K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Merril..> | 2023-05-03 09:37 | 97K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Meteor..> | 2023-05-03 10:31 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Microe..> | 2023-05-03 10:15 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Microe..> | 2023-05-03 10:35 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Micros..> | 2023-05-04 02:16 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Micros..> | 2023-05-03 10:48 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Modern..> | 2023-05-03 10:15 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Mundo-..> | 2023-05-03 10:53 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-NUTR-1..> | 2023-05-03 09:38 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Networ..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Networ..> | 2023-09-03 16:54 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Networ..> | 2023-05-03 11:22 | 47K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Networ..> | 2023-05-03 11:22 | 32K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-New-Pe..> | 2023-05-04 01:58 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-New-Pe..> | 2023-05-03 10:37 | 9.3K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Nursin..> | 2023-05-03 09:52 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Nutrit..> | 2023-05-04 02:24 | 59K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-OM-5-5..> | 2023-05-03 10:20 | 14K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-Oral-P..> | 2023-05-03 09:24 | 403K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Organi..> | 2023-05-04 01:48 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Organi..> | 2023-05-03 09:27 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Organi..> | 2023-05-03 10:43 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-PHP-Pr..> | 2023-05-03 10:54 | 15K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Parame..> | 2023-05-04 01:58 | 73K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Payrol..> | 2023-08-05 05:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Payrol..> | 2023-08-16 05:25 | 28K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Payrol..> | 2023-05-04 02:10 | 29K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Pediat..> | 2023-05-03 09:25 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Person..> | 2023-05-03 10:25 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Person..> | 2023-05-03 11:03 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Persua..> | 2023-05-03 10:34 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Philos..> | 2023-05-03 10:38 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Physic..> | 2023-05-03 10:49 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Practi..> | 2023-05-04 01:58 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Precal..> | 2023-05-03 11:08 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Precal..> | 2023-05-03 10:13 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 11:18 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 09:48 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 10:13 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 10:02 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 10:36 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Princi..> | 2023-05-03 10:32 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Proofr..> | 2023-05-04 01:59 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 10:31 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 10:31 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 09:55 | 9.7K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Psycho..> | 2023-05-03 10:00 | 424K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 09:23 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 10:20 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 09:56 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Psycho..> | 2023-05-03 09:47 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Public..> | 2023-05-04 02:18 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Purcha..> | 2023-05-04 01:54 | 8.9K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Quanti..> | 2023-05-03 10:01 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Resear..> | 2023-05-03 09:46 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Resear..> | 2023-05-03 09:18 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Reside..> | 2023-05-04 02:24 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Reside..> | 2023-05-04 02:20 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Reside..> | 2023-05-03 10:49 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Serial..> | 2023-05-03 10:43 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Single..> | 2023-05-03 10:00 | 9.0K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Single..> | 2023-05-03 09:33 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Social..> | 2023-05-03 10:22 | 17K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Social..> | 2023-05-03 10:22 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Social..> | 2023-05-03 10:18 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Social..> | 2023-05-03 10:19 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Social..> | 2023-05-03 10:41 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Sociol..> | 2023-05-03 09:59 | 15K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-Sociol..> | 2023-05-04 01:52 | 267K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-South-..> | 2023-05-03 10:38 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-South-..> | 2023-05-03 10:12 | 17K | |
![[ ]](/icons/layout.gif) | Test-Bank-for-South-..> | 2023-05-04 01:57 | 392K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Spanis..> | 2023-05-04 01:55 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Sports..> | 2023-05-03 09:37 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-State-..> | 2023-05-03 10:50 | 15K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Statis..> | 2023-05-03 09:21 | 1.8M | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Statis..> | 2023-05-03 09:20 | 1.9M | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Statis..> | 2023-05-03 09:20 | 501K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Statis..> | 2023-05-03 09:25 | 11K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Stats-..> | 2023-05-03 09:20 | 220K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Strate..> | 2023-05-03 09:19 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Strate..> | 2023-05-03 10:42 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Stress..> | 2023-05-03 09:20 | 12K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Stutte..> | 2023-05-03 09:19 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Succee..> | 2023-05-03 10:44 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Superv..> | 2023-05-03 11:19 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-TX.GOV..> | 2023-05-04 02:21 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Televi..> | 2023-05-03 10:00 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Terror..> | 2023-05-03 10:45 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Ar..> | 2023-05-03 09:35 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Bi..> | 2023-05-04 02:14 | 14K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-The-Bl..> | 2023-05-03 09:53 | 78K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Bl..> | 2023-05-03 09:53 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Br..> | 2023-05-03 09:52 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-De..> | 2023-05-03 10:40 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Ea..> | 2023-05-03 10:39 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Ea..> | 2023-05-04 02:09 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Es..> | 2023-05-03 09:22 | 6.8K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-The-Hu..> | 2023-05-03 09:49 | 118K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Ma..> | 2023-05-03 10:44 | 12K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Pe..> | 2023-05-03 10:12 | 23K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-08-05 17:22 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-09-09 10:36 | 51K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-05-04 01:54 | 66K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-08-06 03:49 | 21K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-09-09 10:36 | 51K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Re..> | 2023-05-04 02:28 | 155K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-So..> | 2023-05-03 09:28 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-The-Wo..> | 2023-05-03 10:31 | 24K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Theory..> | 2023-05-04 01:52 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Theory..> | 2023-05-03 09:25 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Those-..> | 2023-05-03 10:43 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Todays..> | 2023-05-03 09:47 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Todays..> | 2023-05-03 09:33 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Tort-L..> | 2023-05-04 01:55 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Touris..> | 2023-05-03 09:28 | 16K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Trigon..> | 2023-05-03 09:19 | 355K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Unders..> | 2023-05-03 09:44 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Unders..> | 2023-05-03 10:44 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Unders..> | 2023-05-03 10:26 | 9.5K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Unders..> | 2023-05-03 09:29 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Unders..> | 2023-05-03 11:22 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Using-..> | 2023-05-03 09:45 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Using-..> | 2023-05-03 09:55 | 17K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Visual..> | 2023-05-03 09:18 | 11K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Visual..> | 2023-05-03 09:36 | 10K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Voyage..> | 2023-05-03 10:41 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Voyage..> | 2023-05-03 11:06 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-We-the..> | 2023-05-03 09:51 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-We-the..> | 2023-05-03 09:36 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-We-the..> | 2023-05-03 10:24 | 12K | |
![[ ]](/icons/compressed.gif) | Test-Bank-for-Web-De..> | 2023-05-04 02:14 | 9.1K | |
![[ ]](/icons/unknown.gif) | Test-Bank-for-Wellne..> | 2023-05-03 09:26 | 383K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wester..> | 2023-05-03 09:31 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wester..> | 2023-05-03 10:03 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wester..> | 2023-05-03 09:55 | 14K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wester..> | 2023-05-03 10:36 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wills-..> | 2023-05-03 10:29 | 16K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 10:18 | 19K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 10:34 | 20K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 10:35 | 13K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 10:36 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-08-06 14:51 | 17K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-08-08 20:09 | 37K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-04 01:47 | 115K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 09:43 | 15K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-World-..> | 2023-05-03 09:37 | 18K | |
![[IMG]](/icons/image2.gif) | Test-Bank-for-Wright..> | 2023-05-03 10:40 | 17K | |
![[ ]](/icons/unknown.gif) | Test-bank-Chapter-1-..> | 2023-05-03 10:59 | 47K | |
![[ ]](/icons/unknown.gif) | Test-bank-Chemistry-..> | 2023-05-03 09:50 | 57K | |
![[ ]](/icons/unknown.gif) | Test-bank-Criminal-J..> | 2023-05-03 09:35 | 20K | |
![[ ]](/icons/compressed.gif) | Test-bank-Elementary..> | 2023-05-03 10:17 | 483K | |
![[ ]](/icons/unknown.gif) | Test-bank-Life-Span-..> | 2023-05-03 13:43 | 55K | |
![[ ]](/icons/compressed.gif) | Test-bank-Mundo-21-4..> | 2023-05-03 10:53 | 312K | |
![[ ]](/icons/compressed.gif) | Test-bank-Principles..> | 2023-05-03 10:32 | 95K | |
![[IMG]](/icons/image2.gif) | Test-bank-The-Leader..> | 2023-08-06 12:16 | 3.7K | |
![[IMG]](/icons/image2.gif) | Test-bank-The-Leader..> | 2023-09-16 21:24 | 21K | |
![[IMG]](/icons/image2.gif) | Test-bank-The-Leader..> | 2023-05-04 02:10 | 20K | |
![[ ]](/icons/unknown.gif) | Test-bank-for-A-Conc..> | 2023-05-03 11:03 | 33K | |
![[ ]](/icons/compressed.gif) | Test-bank-for-Calcul..> | 2023-05-03 09:48 | 2.6M | |
![[ ]](/icons/unknown.gif) | Test-bank-for-Essent..> | 2023-05-04 02:10 | 43K | |
![[ ]](/icons/unknown.gif) | Test-bank-for-Essent..> | 2023-05-04 01:50 | 115K | |
![[ ]](/icons/compressed.gif) | Test-bank-for-Introd..> | 2023-05-03 09:37 | 41K | |
![[IMG]](/icons/image2.gif) | Test-bank-for-Introd..> | 2023-08-05 05:29 | 3.1K | |
![[IMG]](/icons/image2.gif) | Test-bank-for-Introd..> | 2023-05-03 09:31 | 22K | |
![[ ]](/icons/compressed.gif) | Test-bank-for-Princi..> | 2023-05-04 02:03 | 50K | |
![[ ]](/icons/compressed.gif) | Test-bank-for-Psycho..> | 2023-05-03 10:20 | 150K | |
![[ ]](/icons/layout.gif) | Test-bank-for-Statis..> | 2023-05-04 02:01 | 251K | |
![[ ]](/icons/unknown.gif) | Test1_version1-97812..> | 2023-05-03 11:22 | 27K | |
![[ ]](/icons/unknown.gif) | Test2-Test-Bank-For-..> | 2023-05-03 13:43 | 86K | |
![[IMG]](/icons/image2.gif) | Test20Bank20for20Car..> | 2023-05-03 10:15 | 11K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Bates_Guid..> | 2023-08-05 14:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Bates_Guid..> | 2023-09-23 11:42 | 16K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Bates_Guid..> | 2023-05-04 02:05 | 36K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Evidence_B..> | 2023-08-05 16:23 | 2.9K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Evidence_B..> | 2023-08-14 03:16 | 14K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Evidence_B..> | 2023-05-04 02:06 | 40K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-08-05 14:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-08-17 04:49 | 22K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-05-04 02:06 | 66K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-08-05 19:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-09-01 03:43 | 24K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Essent..> | 2023-05-04 02:06 | 71K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Lehnes..> | 2023-05-04 02:07 | 28K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Memmle..> | 2023-08-05 04:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Memmle..> | 2023-08-06 16:00 | 17K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Memmle..> | 2023-05-04 02:05 | 53K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Organi..> | 2023-08-06 07:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Organi..> | 2023-08-20 19:01 | 14K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Organi..> | 2023-05-04 02:07 | 35K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Roachs..> | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Roachs..> | 2023-10-11 08:33 | 17K | |
![[IMG]](/icons/image2.gif) | Test_Bank_For_Roachs..> | 2023-05-04 02:05 | 47K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Fundamenta..> | 2023-08-06 04:49 | 4.1K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Fundamenta..> | 2023-08-05 01:13 | 23K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Fundamenta..> | 2023-05-04 02:05 | 46K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Maternal-N..> | 2023-08-05 05:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Maternal-N..> | 2023-08-17 17:25 | 15K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Maternal-N..> | 2023-05-04 02:06 | 46K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Seidels_Gu..> | 2023-08-06 08:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Seidels_Gu..> | 2023-08-09 19:39 | 18K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Seidels_Gu..> | 2023-05-04 02:06 | 40K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Womens_Gyn..> | 2023-08-05 19:27 | 2.5K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Womens_Gyn..> | 2023-08-05 02:29 | 14K | |
![[IMG]](/icons/image2.gif) | Test_Bank_Womens_Gyn..> | 2023-05-04 02:08 | 45K | |
![[IMG]](/icons/image2.gif) | Test_bank_Advanced_H..> | 2023-05-04 02:06 | 41K | |
![[IMG]](/icons/image2.gif) | Test_bank_Community_..> | 2023-05-04 02:04 | 19K | |
![[IMG]](/icons/image2.gif) | Test_bank_Leadership..> | 2023-08-06 13:04 | 4.2K | |
![[IMG]](/icons/image2.gif) | Test_bank_Leadership..> | 2023-08-05 23:08 | 25K | |
![[IMG]](/icons/image2.gif) | Test_bank_Leadership..> | 2023-05-04 02:05 | 89K | |
![[ ]](/icons/layout.gif) | Testing_Program_Them..> | 2023-05-03 10:29 | 307K | |
![[IMG]](/icons/image2.gif) | The-Language-of-Medi..> | 2023-08-06 01:48 | 4.0K | |
![[IMG]](/icons/image2.gif) | The-Language-of-Medi..> | 2023-09-16 21:24 | 22K | |
![[IMG]](/icons/image2.gif) | The-Language-of-Medi..> | 2023-05-03 11:06 | 51K | |
![[ ]](/icons/compressed.gif) | The-Murder-Book-Exam..> | 2023-05-03 10:19 | 33K | |
![[IMG]](/icons/image2.gif) | The_Life_Span_Human_..> | 2023-08-05 06:28 | 4.1K | |
![[IMG]](/icons/image2.gif) | The_Life_Span_Human_..> | 2023-08-08 14:34 | 32K | |
![[IMG]](/icons/image2.gif) | The_Life_Span_Human_..> | 2023-05-03 09:42 | 88K | |
![[IMG]](/icons/image2.gif) | The_New_Leadership_C..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | The_New_Leadership_C..> | 2023-08-09 19:39 | 17K | |
![[IMG]](/icons/image2.gif) | The_New_Leadership_C..> | 2023-05-04 02:06 | 42K | |
![[IMG]](/icons/image2.gif) | The_Science_of_Psych..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | The_Science_of_Psych..> | 2023-08-05 05:34 | 17K | |
![[IMG]](/icons/image2.gif) | The_Science_of_Psych..> | 2023-05-03 10:27 | 39K | |
![[IMG]](/icons/image2.gif) | Theoretical-Basis-fo..> | 2023-08-05 07:19 | 4.2K | |
![[IMG]](/icons/image2.gif) | Theoretical-Basis-fo..> | 2023-08-09 19:39 | 23K | |
![[IMG]](/icons/image2.gif) | Theoretical-Basis-fo..> | 2023-05-03 10:36 | 45K | |
![[IMG]](/icons/image2.gif) | Therapeutic-Communic..> | 2023-08-05 02:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | Therapeutic-Communic..> | 2023-08-09 19:39 | 16K | |
![[IMG]](/icons/image2.gif) | Therapeutic-Communic..> | 2023-05-04 02:28 | 35K | |
![[IMG]](/icons/image2.gif) | Thermo7th-100x100.jpg | 2023-08-08 16:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | Thermo7th.jpg | 2023-05-03 09:23 | 21K | |
![[ ]](/icons/unknown.gif) | Thermo_7e_SM_Chap01-..> | 2023-05-03 09:23 | 1.3M | |
![[ ]](/icons/compressed.gif) | Thermo_8e_SM_Chap02.zip | 2023-05-03 09:50 | 1.0M | |
![[IMG]](/icons/image2.gif) | Thermodynamics_An_En..> | 2023-08-05 14:39 | 3.8K | |
![[IMG]](/icons/image2.gif) | Thermodynamics_An_En..> | 2023-08-06 16:00 | 22K | |
![[IMG]](/icons/image2.gif) | Thermodynamics_An_En..> | 2023-05-03 09:50 | 50K | |
![[IMG]](/icons/image2.gif) | Thibodeau-The-Human-..> | 2023-08-05 05:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | Thibodeau-The-Human-..> | 2023-09-16 21:24 | 15K | |
![[IMG]](/icons/image2.gif) | Thibodeau-The-Human-..> | 2023-05-03 10:15 | 32K | |
![[IMG]](/icons/image2.gif) | Thibodeau3e11mr_nm2-..> | 2023-08-05 10:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | Thibodeau3e11mr_nm2-..> | 2023-08-12 04:49 | 17K | |
![[IMG]](/icons/image2.gif) | Thibodeau3e11mr_nm2.jpg | 2023-05-03 09:54 | 36K | |
![[ ]](/icons/compressed.gif) | Thiroux-IMTB_ch2.zip | 2023-05-04 02:09 | 17K | |
![[ ]](/icons/unknown.gif) | Thomas--Thomas-Calcu..> | 2023-05-03 10:36 | 1.0M | |
![[IMG]](/icons/image2.gif) | Thompson17e10_nm21-1..> | 2023-08-05 04:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | Thompson17e10_nm21-3..> | 2023-08-16 16:54 | 14K | |
![[IMG]](/icons/image2.gif) | Thompson17e10_nm21.jpg | 2023-05-03 09:42 | 33K | |
![[IMG]](/icons/image2.gif) | ThompsonCC19e14ch_nm..> | 2023-08-05 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | ThompsonCC19e14ch_nm..> | 2023-08-16 16:54 | 15K | |
![[IMG]](/icons/image2.gif) | ThompsonCC19e14ch_nm..> | 2023-05-03 09:34 | 33K | |
![[IMG]](/icons/image2.gif) | ThompsonCC1812ch_nm2..> | 2023-08-08 17:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | ThompsonCC1812ch_nm2..> | 2023-08-18 08:28 | 15K | |
![[IMG]](/icons/image2.gif) | ThompsonCC1812ch_nm2..> | 2023-05-03 09:43 | 33K | |
![[IMG]](/icons/image2.gif) | Timberlake-Chemistry..> | 2023-08-05 06:24 | 3.3K | |
![[IMG]](/icons/image2.gif) | Timberlake-Chemistry..> | 2023-05-03 09:35 | 27K | |
![[ ]](/icons/compressed.gif) | Timberlake-Chemistry..> | 2023-05-03 09:35 | 37K | |
![[IMG]](/icons/image2.gif) | Timberlake-General-O..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | Timberlake-General-O..> | 2023-05-03 09:37 | 22K | |
![[ ]](/icons/compressed.gif) | Timberlake-General-O..> | 2023-05-03 09:37 | 21K | |
![[ ]](/icons/unknown.gif) | Tools-Test-Bank-Chap..> | 2023-05-03 13:43 | 38K | |
![[IMG]](/icons/image2.gif) | Tortora-Principles-o..> | 2023-08-05 15:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | Tortora-Principles-o..> | 2023-05-04 02:25 | 17K | |
![[ ]](/icons/layout.gif) | Tortora-Principles-o..> | 2023-05-04 02:25 | 925K | |
![[IMG]](/icons/image2.gif) | Towle-1st-Edition-Ma..> | 2023-08-05 04:17 | 3.4K | |
![[IMG]](/icons/image2.gif) | Towle-1st-Edition-Ma..> | 2023-08-17 17:25 | 18K | |
![[IMG]](/icons/image2.gif) | Towle-1st-Edition-Ma..> | 2023-05-03 09:36 | 48K | |
![[IMG]](/icons/image2.gif) | Townsend-8th-Edition..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | Townsend-8th-Edition..> | 2023-08-05 21:57 | 18K | |
![[IMG]](/icons/image2.gif) | Townsend-8th-Edition..> | 2023-05-03 09:54 | 52K | |
![[IMG]](/icons/image2.gif) | Transcultural_Nursin..> | 2023-08-05 03:44 | 4.7K | |
![[IMG]](/icons/image2.gif) | Transcultural_Nursin..> | 2023-08-05 09:59 | 26K | |
![[IMG]](/icons/image2.gif) | Transcultural_Nursin..> | 2023-05-03 10:12 | 59K | |
![[ ]](/icons/layout.gif) | Transportation-Infra..> | 2023-05-04 02:17 | 187K | |
![[ ]](/icons/compressed.gif) | Triola--Elementary-S..> | 2023-05-03 10:37 | 145K | |
![[ ]](/icons/layout.gif) | TriolaBioStatPTB_358..> | 2023-05-03 09:50 | 52K | |
![[IMG]](/icons/image2.gif) | Tro-Fridfen-1st-Cana..> | 2023-08-05 15:47 | 4.1K | |
![[IMG]](/icons/image2.gif) | Tro-Fridfen-1st-Cana..> | 2023-08-06 13:11 | 24K | |
![[IMG]](/icons/image2.gif) | Tro-Fridfen-1st-Cana..> | 2023-05-03 10:10 | 57K | |
![[ ]](/icons/compressed.gif) | Turley--Medical-Lang..> | 2023-05-03 10:30 | 34K | |
![[ ]](/icons/compressed.gif) | Tutorial_01-Test-Ban..> | 2023-05-03 10:37 | 192K | |
![[IMG]](/icons/image2.gif) | Tymoczko-Biochemistr..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | Tymoczko-Biochemistr..> | 2023-05-04 02:18 | 28K | |
![[IMG]](/icons/image2.gif) | Tymoczko-Biochemistr..> | 2023-08-06 07:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | Tymoczko-Biochemistr..> | 2023-05-03 09:41 | 28K | |
![[ ]](/icons/layout.gif) | Tymoczko-Biochemistr..> | 2023-05-04 02:18 | 147K | |
![[IMG]](/icons/image2.gif) | Understandable_Stati..> | 2023-08-05 16:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | Understandable_Stati..> | 2023-08-05 09:59 | 16K | |
![[IMG]](/icons/image2.gif) | Understandable_Stati..> | 2023-05-03 09:21 | 31K | |
![[IMG]](/icons/image2.gif) | Understanding-Busine..> | 2023-08-06 03:43 | 2.6K | |
![[IMG]](/icons/image2.gif) | Understanding-Busine..> | 2023-08-05 09:59 | 16K | |
![[IMG]](/icons/image2.gif) | Understanding-Busine..> | 2023-05-03 10:12 | 44K | |
![[IMG]](/icons/image2.gif) | Understanding_Pharma..> | 2023-08-05 14:37 | 3.9K | |
![[IMG]](/icons/image2.gif) | Understanding_Pharma..> | 2023-08-05 02:29 | 20K | |
![[IMG]](/icons/image2.gif) | Understanding_Pharma..> | 2023-05-04 02:07 | 61K | |
![[ ]](/icons/unknown.gif) | Unit02_Section01.rtf | 2023-05-03 09:25 | 80K | |
![[ ]](/icons/unknown.gif) | Unit_1_Community_Hea..> | 2023-05-03 09:52 | 22K | |
![[ ]](/icons/unknown.gif) | Unit_1_Safety_on_the..> | 2023-05-03 10:12 | 15K | |
![[IMG]](/icons/image2.gif) | University-Physics-1..> | 2023-08-06 08:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | University-Physics-1..> | 2023-08-16 18:42 | 24K | |
![[IMG]](/icons/image2.gif) | University-Physics-1..> | 2023-05-03 09:56 | 102K | |
![[ ]](/icons/unknown.gif) | Unnamed-Test001_vers..> | 2023-05-04 01:48 | 15K | |
![[ ]](/icons/unknown.gif) | Unnamed-Test1_versio..> | 2023-05-04 01:49 | 55K | |
![[ ]](/icons/layout.gif) | Untitled1-9780134145..> | 2023-05-03 10:54 | 740K | |
![[ ]](/icons/compressed.gif) | Untitled1.zip | 2023-05-04 02:10 | 93K | |
![[ ]](/icons/unknown.gif) | VanDerbeck_15e_Chapt..> | 2023-05-03 10:15 | 245K | |
![[IMG]](/icons/image2.gif) | VanMeter-Goulds-Path..> | 2023-05-03 09:35 | 56K | |
![[ ]](/icons/compressed.gif) | VanPutte--Seeleys-An..> | 2023-05-03 09:21 | 708K | |
![[ ]](/icons/unknown.gif) | Vanderbeck-17e_Chapt..> | 2023-05-03 10:13 | 103K | |
![[IMG]](/icons/image2.gif) | Varcarolis-6th-Editi..> | 2023-08-05 17:21 | 2.8K | |
![[IMG]](/icons/image2.gif) | Varcarolis-6th-Editi..> | 2023-08-12 23:30 | 15K | |
![[IMG]](/icons/image2.gif) | Varcarolis-6th-Editi..> | 2023-05-03 09:46 | 32K | |
![[IMG]](/icons/image2.gif) | Voet-4th-Edition-Fun..> | 2023-08-06 17:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | Voet-4th-Edition-Fun..> | 2023-08-13 03:13 | 20K | |
![[IMG]](/icons/image2.gif) | Voet-4th-Edition-Fun..> | 2023-05-03 09:56 | 59K | |
![[ ]](/icons/compressed.gif) | Volume 1.zip | 2023-05-03 10:00 | 119K | |
![[ ]](/icons/compressed.gif) | WAT_CH_02_Ans.zip | 2023-05-03 09:24 | 7.3K | |
![[ ]](/icons/unknown.gif) | WEPEOPE12_TBdoc_Ch01..> | 2023-05-03 10:55 | 188K | |
![[ ]](/icons/unknown.gif) | WTWA5eTB_doc_ch01.doc | 2023-05-04 01:56 | 123K | |
![[ ]](/icons/unknown.gif) | Wagner_7e_IRM_Chapte..> | 2023-05-03 13:44 | 45K | |
![[ ]](/icons/unknown.gif) | Wahlen-8e-Chapter-01..> | 2023-05-03 10:04 | 69K | |
![[ ]](/icons/layout.gif) | Walker4_ISM_Ch01.pdf | 2023-05-03 09:46 | 179K | |
![[IMG]](/icons/image2.gif) | Ward-Hisley-1st-Edit..> | 2023-08-06 08:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | Ward-Hisley-1st-Edit..> | 2023-08-17 17:25 | 21K | |
![[IMG]](/icons/image2.gif) | Ward-Hisley-1st-Edit..> | 2023-05-03 09:46 | 45K | |
![[ ]](/icons/unknown.gif) | Wardlaw_CN_11e_IM_Ch..> | 2023-05-04 01:54 | 70K | |
![[ ]](/icons/unknown.gif) | Wardlaws-Contemporar..> | 2023-05-03 10:41 | 2.6M | |
![[IMG]](/icons/image2.gif) | Wardlaws_Contemporar..> | 2023-08-09 02:04 | 3.6K | |
![[IMG]](/icons/image2.gif) | Wardlaws_Contemporar..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | Wardlaws_Contemporar..> | 2023-05-03 10:41 | 30K | |
![[ ]](/icons/layout.gif) | Warren_CFA16e_SM_CH0..> | 2023-05-04 02:23 | 283K | |
![[ ]](/icons/unknown.gif) | Warren_FinMan15e_Ch0..> | 2023-05-04 01:53 | 155K | |
![[ ]](/icons/unknown.gif) | Weinberg_Comp_Perio_..> | 2023-05-04 02:02 | 39K | |
![[ ]](/icons/compressed.gif) | Welch_final_tb.zip | 2023-05-03 10:00 | 26K | |
![[ ]](/icons/unknown.gif) | Welsh_HumanAP_16e_Ch..> | 2023-05-04 01:53 | 28K | |
![[ ]](/icons/unknown.gif) | Whalen-9e_CH01_TB.docx | 2023-05-04 02:27 | 0 | |
![[ ]](/icons/unknown.gif) | Whetten_dms09_Ch01.doc | 2023-05-04 01:48 | 159K | |
![[IMG]](/icons/image2.gif) | Whitbourne7e13ss_nm2..> | 2023-08-05 06:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | Whitbourne7e13ss_nm2..> | 2023-08-12 23:31 | 12K | |
![[IMG]](/icons/image2.gif) | Whitbourne7e13ss_nm2..> | 2023-05-03 11:04 | 29K | |
![[ ]](/icons/layout.gif) | White9e_IM_Ch1.pdf | 2023-05-03 09:40 | 283K | |
![[ ]](/icons/unknown.gif) | Whittington_21e_Ch01..> | 2023-05-04 02:03 | 41K | |
![[ ]](/icons/layout.gif) | Wickert-3e-Ch02-v2.pdf | 2023-05-03 09:31 | 59K | |
![[ ]](/icons/layout.gif) | Wickert_4e_ISM_Ch_02..> | 2023-05-04 02:14 | 286K | |
![[ ]](/icons/compressed.gif) | Widmaier--Vanders-Hu..> | 2023-05-03 09:49 | 23K | |
![[ ]](/icons/unknown.gif) | Williams-Sawyer_TB_C..> | 2023-05-03 11:24 | 110K | |
![[IMG]](/icons/image2.gif) | Williams-Understandi..> | 2023-08-06 00:42 | 2.9K | |
![[IMG]](/icons/image2.gif) | Williams-Understandi..> | 2023-05-03 10:59 | 26K | |
![[ ]](/icons/compressed.gif) | Williams-Understandi..> | 2023-05-03 10:59 | 5.1K | |
![[IMG]](/icons/image2.gif) | WilliamsFA15e12pv_nm..> | 2023-08-06 07:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | WilliamsFA15e12pv_nm..> | 2023-08-24 00:34 | 17K | |
![[IMG]](/icons/image2.gif) | WilliamsFA15e12pv_nm..> | 2023-05-04 01:49 | 41K | |
![[ ]](/icons/compressed.gif) | Wisner_Chapter 01.zip | 2023-05-03 10:42 | 9.6K | |
![[ ]](/icons/compressed.gif) | Womble-2e-Chapter-3-..> | 2023-05-03 09:46 | 4.0K | |
![[ ]](/icons/unknown.gif) | Wong_Lifespan_TB_01...> | 2023-05-04 01:58 | 25K | |
![[ ]](/icons/unknown.gif) | Wood_IM_5e_Ex01.doc | 2023-05-03 10:30 | 82K | |
![[ ]](/icons/layout.gif) | Wood_WorldofPsycholo..> | 2023-05-03 13:44 | 198K | |
![[ ]](/icons/unknown.gif) | Wooldridge_5e_Ch01_I..> | 2023-05-03 10:48 | 25K | |
![[ ]](/icons/layout.gif) | Wooldridge_6e_Ch01_I..> | 2023-05-03 10:48 | 103K | |
![[ ]](/icons/unknown.gif) | Wooldridge_7e_Ch01_I..> | 2023-05-04 01:58 | 41K | |
![[ ]](/icons/unknown.gif) | Word-TIF-Problems-Ch..> | 2023-05-03 11:00 | 320K | |
![[IMG]](/icons/image2.gif) | You-will-purchase-of..> | 2023-08-05 04:17 | 2.4K | |
![[IMG]](/icons/image2.gif) | You-will-purchase-of..> | 2023-08-06 08:47 | 16K | |
![[IMG]](/icons/image2.gif) | You-will-purchase-of..> | 2023-05-03 11:06 | 41K | |
![[ ]](/icons/compressed.gif) | Yukl--Leadership-in-..> | 2023-05-03 09:22 | 93K | |
![[ ]](/icons/compressed.gif) | Zimmerman--Accountin..> | 2023-05-03 10:41 | 19K | |
![[IMG]](/icons/image2.gif) | Zimmerman7e11BAR_nm2..> | 2023-08-05 04:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | Zimmerman7e11BAR_nm2..> | 2023-08-21 06:52 | 13K | |
![[IMG]](/icons/image2.gif) | Zimmerman7e11BAR_nm2..> | 2023-05-04 01:53 | 30K | |
![[IMG]](/icons/image2.gif) | Zinke-Allmang-2nd-Ed..> | 2023-08-06 16:26 | 2.9K | |
![[IMG]](/icons/image2.gif) | Zinke-Allmang-2nd-Ed..> | 2023-08-12 04:48 | 14K | |
![[IMG]](/icons/image2.gif) | Zinke-Allmang-2nd-Ed..> | 2023-05-03 09:51 | 30K | |
![[ ]](/icons/unknown.gif) | Zunker_IM_Ch01.doc | 2023-05-03 10:18 | 58K | |
![[IMG]](/icons/image2.gif) | a-framework-for-mark..> | 2023-08-06 07:46 | 1.0K | |
![[IMG]](/icons/image2.gif) | a-framework-for-mark..> | 2023-05-03 09:25 | 7.3K | |
![[ ]](/icons/compressed.gif) | a-framework-for-mark..> | 2023-05-03 09:25 | 27K | |
![[IMG]](/icons/image2.gif) | a-guide-managing-mai..> | 2023-08-05 06:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | a-guide-managing-mai..> | 2023-08-06 07:38 | 18K | |
![[IMG]](/icons/image2.gif) | a-guide-managing-mai..> | 2023-05-03 10:47 | 49K | |
![[ ]](/icons/compressed.gif) | a-guide-managing-mai..> | 2023-05-03 10:47 | 217K | |
![[IMG]](/icons/image2.gif) | a-history-of-psychol..> | 2023-08-06 08:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | a-history-of-psychol..> | 2023-05-03 09:45 | 22K | |
![[ ]](/icons/compressed.gif) | a-history-of-psychol..> | 2023-05-03 09:45 | 29K | |
![[IMG]](/icons/image2.gif) | a-history-of-psychol..> | 2023-08-05 01:13 | 3.0K | |
![[IMG]](/icons/image2.gif) | a-history-of-psychol..> | 2023-05-03 09:32 | 18K | |
![[ ]](/icons/compressed.gif) | a-history-of-psychol..> | 2023-05-03 09:32 | 39K | |
![[IMG]](/icons/image2.gif) | abnormal-child-and-a..> | 2023-08-05 15:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | abnormal-child-and-a..> | 2023-05-04 01:48 | 21K | |
![[ ]](/icons/compressed.gif) | abnormal-child-and-a..> | 2023-05-04 01:48 | 15K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-05 16:27 | 3.1K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:06 | 18K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-03 10:06 | 32K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-05 06:24 | 20K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 09:20 | 60K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-06 16:28 | 2.3K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:36 | 7.0K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-05 06:25 | 2.6K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-04 02:22 | 15K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-04 02:22 | 45K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-07 17:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:06 | 11K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 09:44 | 17K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-03 09:44 | 86K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-06 10:14 | 3.5K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 09:24 | 12K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-09 07:07 | 3.8K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:45 | 24K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-05 14:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:27 | 18K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-03 10:27 | 44K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-03 10:32 | 37K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-03 10:47 | 39K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-03 10:47 | 173K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-08-05 01:52 | 3.0K | |
![[IMG]](/icons/image2.gif) | abnormal-psychology-..> | 2023-05-04 02:13 | 23K | |
![[ ]](/icons/compressed.gif) | abnormal-psychology-..> | 2023-05-04 02:13 | 40K | |
![[ ]](/icons/compressed.gif) | abrams-clinical-drug..> | 2023-05-03 11:04 | 112K | |
![[IMG]](/icons/image2.gif) | abrams-clinical-drug..> | 2023-08-08 06:43 | 13K | |
![[IMG]](/icons/image2.gif) | abrams-clinical-drug..> | 2023-05-03 11:04 | 32K | |
![[IMG]](/icons/image2.gif) | absolute-c-6th-editi..> | 2023-08-05 01:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | absolute-c-6th-editi..> | 2023-08-06 07:38 | 15K | |
![[IMG]](/icons/image2.gif) | absolute-c-6th-editi..> | 2023-05-03 10:48 | 49K | |
![[ ]](/icons/compressed.gif) | absolute-c-6th-editi..> | 2023-05-03 10:48 | 107K | |
![[IMG]](/icons/image2.gif) | absolute-java-walter..> | 2023-08-08 16:38 | 3.0K | |
![[IMG]](/icons/image2.gif) | absolute-java-walter..> | 2023-05-03 09:42 | 18K | |
![[ ]](/icons/compressed.gif) | absolute-java-walter..> | 2023-05-03 09:42 | 16K | |
![[IMG]](/icons/image2.gif) | accounting-100x100.jpg | 2023-08-06 03:36 | 2.4K | |
![[IMG]](/icons/image2.gif) | accounting-300x300.jpg | 2023-08-18 10:03 | 10K | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-08-05 16:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-08-06 07:38 | 25K | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-05-03 10:48 | 64K | |
![[ ]](/icons/compressed.gif) | accounting-decision-..> | 2023-05-03 10:48 | 1.1M | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-08-06 11:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-08-05 07:10 | 25K | |
![[IMG]](/icons/image2.gif) | accounting-decision-..> | 2023-05-03 10:49 | 64K | |
![[ ]](/icons/compressed.gif) | accounting-decision-..> | 2023-05-03 10:49 | 732K | |
![[IMG]](/icons/image2.gif) | accounting-for-gover..> | 2023-05-03 11:16 | 9.7K | |
![[IMG]](/icons/image2.gif) | accounting-governmen..> | 2023-08-05 16:24 | 4.2K | |
![[IMG]](/icons/image2.gif) | accounting-governmen..> | 2023-08-05 07:10 | 24K | |
![[IMG]](/icons/image2.gif) | accounting-governmen..> | 2023-05-03 10:49 | 63K | |
![[ ]](/icons/compressed.gif) | accounting-governmen..> | 2023-05-03 10:49 | 317K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 09:22 | 276K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-09 09:06 | 4.6K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 07:10 | 26K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 10:50 | 62K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 10:50 | 329K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 16:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 07:10 | 15K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 10:49 | 50K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 10:49 | 67K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 09:29 | 22K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 09:29 | 22K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 03:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-09 01:23 | 13K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 10:51 | 31K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 10:51 | 731K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 16:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 09:28 | 14K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 10:30 | 12K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-05 15:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 10:18 | 16K | |
![[ ]](/icons/compressed.gif) | accounting-informati..> | 2023-05-03 10:18 | 48K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-08-08 16:36 | 3.5K | |
![[IMG]](/icons/image2.gif) | accounting-informati..> | 2023-05-03 09:48 | 13K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-05 07:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-09 01:23 | 20K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-03 10:52 | 54K | |
![[ ]](/icons/compressed.gif) | accounting-principle..> | 2023-05-03 10:52 | 710K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-09 01:23 | 20K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-03 10:52 | 54K | |
![[ ]](/icons/compressed.gif) | accounting-principle..> | 2023-05-03 10:52 | 530K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-08 14:33 | 3.5K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-04 01:56 | 24K | |
![[ ]](/icons/compressed.gif) | accounting-principle..> | 2023-05-04 01:56 | 104K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-05 06:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-03 10:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-08 06:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-03 09:32 | 7.7K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-08-05 06:19 | 3.8K | |
![[IMG]](/icons/image2.gif) | accounting-principle..> | 2023-05-03 11:19 | 15K | |
![[IMG]](/icons/image2.gif) | accounting-theory-co..> | 2023-08-06 05:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | accounting-theory-co..> | 2023-08-09 01:23 | 18K | |
![[IMG]](/icons/image2.gif) | accounting-theory-co..> | 2023-05-03 10:52 | 30K | |
![[ ]](/icons/compressed.gif) | accounting-theory-co..> | 2023-05-03 10:52 | 188K | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-08-06 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-08-09 01:23 | 18K | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-05-03 10:53 | 50K | |
![[ ]](/icons/compressed.gif) | accounting-tools-bus..> | 2023-05-03 10:53 | 7.0M | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-08-05 02:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-08-17 16:42 | 18K | |
![[IMG]](/icons/image2.gif) | accounting-tools-bus..> | 2023-05-03 10:53 | 50K | |
![[ ]](/icons/compressed.gif) | accounting-tools-bus..> | 2023-05-03 10:53 | 555K | |
![[IMG]](/icons/image2.gif) | accounting-what-the-..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | accounting-what-the-..> | 2023-05-03 09:51 | 9.4K | |
![[IMG]](/icons/image2.gif) | accounting-what-the-..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | accounting-what-the-..> | 2023-05-03 09:50 | 9.4K | |
![[IMG]](/icons/image2.gif) | accounting.jpg | 2023-05-04 02:22 | 13K | |
![[IMG]](/icons/image2.gif) | administrative-manag..> | 2023-08-05 01:54 | 3.0K | |
![[IMG]](/icons/image2.gif) | administrative-manag..> | 2023-08-17 16:42 | 16K | |
![[IMG]](/icons/image2.gif) | administrative-manag..> | 2023-05-03 10:53 | 43K | |
![[ ]](/icons/compressed.gif) | administrative-manag..> | 2023-05-03 10:53 | 311K | |
![[IMG]](/icons/image2.gif) | administrative-medic..> | 2023-08-05 15:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | administrative-medic..> | 2023-08-17 16:42 | 17K | |
![[IMG]](/icons/image2.gif) | administrative-medic..> | 2023-05-03 10:54 | 42K | |
![[ ]](/icons/compressed.gif) | administrative-medic..> | 2023-05-03 10:54 | 374K | |
![[IMG]](/icons/image2.gif) | adolescence-and-emer..> | 2023-08-05 01:52 | 2.9K | |
![[IMG]](/icons/image2.gif) | adolescence-and-emer..> | 2023-05-03 10:16 | 19K | |
![[ ]](/icons/compressed.gif) | adolescence-and-emer..> | 2023-05-03 10:16 | 139K | |
![[IMG]](/icons/image2.gif) | adolescence-laurence..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | adolescence-laurence..> | 2023-05-03 10:58 | 11K | |
![[IMG]](/icons/image2.gif) | adolescence-santrock..> | 2023-08-05 03:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | adolescence-santrock..> | 2023-05-03 11:08 | 22K | |
![[ ]](/icons/compressed.gif) | adolescence-santrock..> | 2023-05-03 11:08 | 102K | |
![[IMG]](/icons/image2.gif) | adolescence-santrock..> | 2023-08-05 17:23 | 2.3K | |
![[IMG]](/icons/image2.gif) | adolescence-santrock..> | 2023-05-03 09:46 | 13K | |
![[ ]](/icons/compressed.gif) | adolescence-santrock..> | 2023-05-03 09:46 | 111K | |
![[IMG]](/icons/image2.gif) | adolescence-steinber..> | 2023-08-05 10:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | adolescence-steinber..> | 2023-05-03 10:28 | 20K | |
![[ ]](/icons/compressed.gif) | adolescence-steinber..> | 2023-05-03 10:28 | 401K | |
![[IMG]](/icons/image2.gif) | adult-development-an..> | 2023-08-05 05:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | adult-development-an..> | 2023-05-03 09:29 | 19K | |
![[ ]](/icons/compressed.gif) | adult-development-an..> | 2023-05-03 09:29 | 321K | |
![[IMG]](/icons/image2.gif) | adult-health-nursing..> | 2023-08-05 05:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | adult-health-nursing..> | 2023-05-03 11:21 | 13K | |
![[ ]](/icons/compressed.gif) | adult-health-nursing..> | 2023-05-03 11:21 | 0 | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-06 00:25 | 4.3K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-17 16:42 | 24K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 10:55 | 63K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 10:55 | 472K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-06 13:12 | 2.7K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 10:06 | 7.8K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 05:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:20 | 7.8K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 16:24 | 2.5K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-17 16:42 | 13K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 10:54 | 33K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 10:54 | 737K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 06:23 | 2.5K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-17 16:42 | 13K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 10:55 | 34K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 10:54 | 282K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:28 | 13K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 10:47 | 12K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 10:47 | 218K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-04 02:13 | 12K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-06 12:14 | 24K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:22 | 86K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 09:22 | 50K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-06 08:43 | 3.0K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:26 | 8.7K | |
![[ ]](/icons/unknown.gif) | advanced-accounting-..> | 2023-05-03 09:45 | 221K | |
![[ ]](/icons/compressed.gif) | advanced-accounting-..> | 2023-05-03 09:29 | 25K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-06 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-04 01:47 | 7.1K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:45 | 12K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | advanced-accounting-..> | 2023-05-03 09:29 | 12K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-08-05 01:11 | 3.8K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-05-03 10:38 | 27K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-05-03 09:19 | 12K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-05-03 09:19 | 12K | |
![[ ]](/icons/compressed.gif) | advanced-financial-a..> | 2023-05-03 09:56 | 952K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-08-05 15:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | advanced-financial-a..> | 2023-05-03 09:56 | 10K | |
![[ ]](/icons/compressed.gif) | advanced-financial-a..> | 2023-05-03 09:19 | 519K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-08-08 16:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-08-08 01:24 | 14K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-05-03 10:55 | 36K | |
![[ ]](/icons/compressed.gif) | advanced-nutrition-h..> | 2023-05-03 10:55 | 216K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-08-05 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-08-08 01:24 | 14K | |
![[IMG]](/icons/image2.gif) | advanced-nutrition-h..> | 2023-05-03 10:55 | 37K | |
![[ ]](/icons/compressed.gif) | advanced-nutrition-h..> | 2023-05-03 10:55 | 71K | |
![[IMG]](/icons/image2.gif) | advertising-and-inte..> | 2023-08-05 02:03 | 2.9K | |
![[IMG]](/icons/image2.gif) | advertising-and-inte..> | 2023-05-03 10:36 | 16K | |
![[ ]](/icons/compressed.gif) | advertising-and-inte..> | 2023-05-03 10:36 | 37K | |
![[ ]](/icons/compressed.gif) | advertising-and-prom..> | 2023-05-03 10:14 | 24K | |
![[ ]](/icons/unknown.gif) | advertising-and-prom..> | 2023-05-03 13:42 | 173K | |
![[IMG]](/icons/image2.gif) | advertisingpromotion..> | 2023-08-05 02:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | advertisingpromotion..> | 2023-05-03 10:02 | 31K | |
![[ ]](/icons/compressed.gif) | advocacy-and-opposit..> | 2023-05-03 10:25 | 68K | |
![[IMG]](/icons/image2.gif) | aerodynamics-enginee..> | 2023-08-05 01:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | aerodynamics-enginee..> | 2023-08-08 01:24 | 16K | |
![[IMG]](/icons/image2.gif) | aerodynamics-enginee..> | 2023-05-03 10:56 | 40K | |
![[ ]](/icons/compressed.gif) | aerodynamics-enginee..> | 2023-05-03 10:56 | 912K | |
![[IMG]](/icons/image2.gif) | aging-life-course-in..> | 2023-08-05 17:22 | 4.0K | |
![[IMG]](/icons/image2.gif) | aging-life-course-in..> | 2023-08-08 01:24 | 25K | |
![[IMG]](/icons/image2.gif) | aging-life-course-in..> | 2023-05-03 10:56 | 65K | |
![[ ]](/icons/compressed.gif) | aging-life-course-in..> | 2023-05-03 10:56 | 28K | |
![[IMG]](/icons/image2.gif) | aging-matters-1st-ed..> | 2023-08-08 21:59 | 3.5K | |
![[IMG]](/icons/image2.gif) | aging-matters-1st-ed..> | 2023-08-08 01:24 | 16K | |
![[IMG]](/icons/image2.gif) | aging-matters-1st-ed..> | 2023-05-03 10:57 | 47K | |
![[ ]](/icons/compressed.gif) | aging-matters-1st-ed..> | 2023-05-03 10:57 | 119K | |
![[IMG]](/icons/image2.gif) | aging-the-individual..> | 2023-08-05 01:11 | 3.8K | |
![[IMG]](/icons/image2.gif) | aging-the-individual..> | 2023-05-03 09:47 | 21K | |
![[ ]](/icons/compressed.gif) | aging-the-individual..> | 2023-05-03 09:47 | 31K | |
![[ ]](/icons/unknown.gif) | aguinis_pm3_im_01.doc | 2023-05-03 09:41 | 246K | |
![[ ]](/icons/unknown.gif) | ahrens_meteor_7e_IM_..> | 2023-05-03 10:39 | 48K | |
![[IMG]](/icons/image2.gif) | alexanders-surgical-..> | 2023-08-05 15:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | alexanders-surgical-..> | 2023-05-03 09:26 | 20K | |
![[IMG]](/icons/image2.gif) | algebra-college-stud..> | 2023-08-05 01:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | algebra-college-stud..> | 2023-08-31 05:17 | 24K | |
![[IMG]](/icons/image2.gif) | algebra-college-stud..> | 2023-05-03 11:00 | 80K | |
![[ ]](/icons/compressed.gif) | algebra-college-stud..> | 2023-05-03 11:00 | 6.6M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-05 14:43 | 2.9K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-31 05:17 | 21K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 61K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 2.2M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-06 07:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-31 05:17 | 15K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 49K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 11M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-07 09:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-31 05:17 | 15K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 50K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:58 | 1.0M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-08 01:24 | 17K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:57 | 41K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:57 | 9.6M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-05 15:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-31 05:17 | 14K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:59 | 41K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:59 | 1.5M | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-06 07:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-08-31 05:17 | 16K | |
![[IMG]](/icons/image2.gif) | algebra-trigonometry..> | 2023-05-03 10:59 | 59K | |
![[ ]](/icons/compressed.gif) | algebra-trigonometry..> | 2023-05-03 10:59 | 1.3M | |
![[IMG]](/icons/image2.gif) | allan3e_lg_3.jpg | 2023-05-04 02:25 | 13K | |
![[IMG]](/icons/image2.gif) | allan4e19tm_nm2.jpg | 2023-05-04 02:15 | 10K | |
![[ ]](/icons/unknown.gif) | amerele2_tb_ch01.docx | 2023-05-03 13:42 | 120K | |
![[IMG]](/icons/image2.gif) | american-corrections..> | 2023-08-08 16:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | american-corrections..> | 2023-05-03 10:07 | 17K | |
![[ ]](/icons/compressed.gif) | american-corrections..> | 2023-05-03 10:07 | 18K | |
![[IMG]](/icons/image2.gif) | american-democracy-n..> | 2023-08-06 03:28 | 2.3K | |
![[IMG]](/icons/image2.gif) | american-democracy-n..> | 2023-08-31 05:17 | 15K | |
![[IMG]](/icons/image2.gif) | american-democracy-n..> | 2023-05-03 11:00 | 44K | |
![[ ]](/icons/compressed.gif) | american-democracy-n..> | 2023-05-03 11:00 | 176K | |
![[IMG]](/icons/image2.gif) | american-government-..> | 2023-08-05 15:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | american-government-..> | 2023-08-31 05:17 | 23K | |
![[IMG]](/icons/image2.gif) | american-government-..> | 2023-05-03 11:03 | 41K | |
![[ ]](/icons/compressed.gif) | american-government-..> | 2023-05-03 11:03 | 102K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-08-31 05:17 | 13K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-05-03 11:03 | 40K | |
![[ ]](/icons/compressed.gif) | american-history-con..> | 2023-05-03 11:03 | 253K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-08-06 07:38 | 2.7K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-08-31 05:17 | 14K | |
![[IMG]](/icons/image2.gif) | american-history-con..> | 2023-05-03 11:03 | 41K | |
![[ ]](/icons/compressed.gif) | american-history-con..> | 2023-05-03 11:03 | 173K | |
![[IMG]](/icons/image2.gif) | american-pageant-16t..> | 2023-08-05 03:35 | 12K | |
![[IMG]](/icons/image2.gif) | american-pageant-16t..> | 2023-08-28 20:54 | 40K | |
![[IMG]](/icons/image2.gif) | american-pageant-16t..> | 2023-05-04 02:29 | 71K | |
![[IMG]](/icons/image2.gif) | americas-courts-and-..> | 2023-08-05 04:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | americas-courts-and-..> | 2023-05-04 01:54 | 26K | |
![[IMG]](/icons/image2.gif) | americas-courts-and-..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | americas-courts-and-..> | 2023-05-03 10:04 | 26K | |
![[ ]](/icons/compressed.gif) | americas-courts-and-..> | 2023-05-03 10:04 | 28K | |
![[IMG]](/icons/image2.gif) | americas-history-con..> | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | americas-history-con..> | 2023-08-31 05:17 | 18K | |
![[IMG]](/icons/image2.gif) | americas-history-con..> | 2023-05-03 11:04 | 30K | |
![[ ]](/icons/compressed.gif) | americas-history-con..> | 2023-05-03 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-08-08 21:06 | 2.4K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-08-12 06:54 | 14K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-05-03 11:04 | 26K | |
![[ ]](/icons/compressed.gif) | americas-history-val..> | 2023-05-03 11:04 | 76K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-08-12 06:54 | 22K | |
![[IMG]](/icons/image2.gif) | americas-history-val..> | 2023-05-03 11:04 | 36K | |
![[ ]](/icons/compressed.gif) | americas-history-val..> | 2023-05-03 11:04 | 77K | |
![[IMG]](/icons/image2.gif) | americas-history-vol..> | 2023-08-08 21:07 | 3.7K | |
![[IMG]](/icons/image2.gif) | americas-history-vol..> | 2023-08-12 06:54 | 28K | |
![[IMG]](/icons/image2.gif) | americas-history-vol..> | 2023-05-03 11:05 | 43K | |
![[ ]](/icons/compressed.gif) | americas-history-vol..> | 2023-05-03 11:05 | 76K | |
![[ ]](/icons/compressed.gif) | amnars10_ch02.zip | 2023-05-03 10:44 | 12K | |
![[ ]](/icons/compressed.gif) | amptod4_ch01-Test-Ba..> | 2023-05-03 10:24 | 13K | |
![[ ]](/icons/compressed.gif) | amptod4_ch01Test-Ban..> | 2023-05-03 10:41 | 13K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-c..> | 2023-08-05 06:25 | 4.7K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-c..> | 2023-05-03 10:05 | 31K | |
![[ ]](/icons/compressed.gif) | an-introduction-to-c..> | 2023-05-03 10:05 | 11K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-d..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-d..> | 2023-05-03 09:20 | 18K | |
![[ ]](/icons/compressed.gif) | an-introduction-to-d..> | 2023-05-03 09:20 | 21K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-g..> | 2023-05-03 11:12 | 14K | |
![[ ]](/icons/compressed.gif) | an-introduction-to-h..> | 2023-05-03 10:22 | 12K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-m..> | 2023-05-04 01:50 | 19K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-t..> | 2023-08-06 10:11 | 3.6K | |
![[IMG]](/icons/image2.gif) | an-introduction-to-t..> | 2023-05-03 09:55 | 26K | |
![[ ]](/icons/compressed.gif) | an-introduction-to-t..> | 2023-05-03 09:55 | 40K | |
![[IMG]](/icons/image2.gif) | analog-circuit-desig..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | analog-circuit-desig..> | 2023-08-12 06:54 | 13K | |
![[IMG]](/icons/image2.gif) | analog-circuit-desig..> | 2023-05-03 11:05 | 34K | |
![[ ]](/icons/compressed.gif) | analog-circuit-desig..> | 2023-05-03 11:05 | 16M | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-08-05 14:39 | 4.0K | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-05-03 09:37 | 26K | |
![[ ]](/icons/compressed.gif) | anatomy-and-physiolo..> | 2023-05-03 09:37 | 59K | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-08-05 16:29 | 3.1K | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-05-03 10:33 | 18K | |
![[ ]](/icons/compressed.gif) | anatomy-and-physiolo..> | 2023-05-03 10:33 | 114K | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-08-06 12:13 | 3.0K | |
![[IMG]](/icons/image2.gif) | anatomy-and-physiolo..> | 2023-05-03 09:29 | 20K | |
![[ ]](/icons/compressed.gif) | anatomy-and-physiolo..> | 2023-05-03 09:29 | 181K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-a..> | 2023-08-06 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-a..> | 2023-05-03 10:27 | 23K | |
![[ ]](/icons/compressed.gif) | anatomy-physiology-a..> | 2023-05-03 10:27 | 18K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-a..> | 2023-08-06 14:39 | 3.6K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-a..> | 2023-05-03 10:32 | 23K | |
![[ ]](/icons/compressed.gif) | anatomy-physiology-a..> | 2023-05-03 10:32 | 18K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-i..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-i..> | 2023-08-12 06:54 | 20K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-i..> | 2023-05-03 11:05 | 52K | |
![[ ]](/icons/compressed.gif) | anatomy-physiology-i..> | 2023-05-03 11:05 | 182K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-m..> | 2023-05-03 10:17 | 12K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-t..> | 2023-08-05 14:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | anatomy-physiology-t..> | 2023-05-03 10:55 | 19K | |
![[ ]](/icons/compressed.gif) | anatomy-physiology-t..> | 2023-05-03 10:55 | 150K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-08-08 15:50 | 3.3K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-08-12 06:54 | 19K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-05-03 11:06 | 46K | |
![[ ]](/icons/compressed.gif) | andersons-business-l..> | 2023-05-03 11:06 | 50K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-08-05 01:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-08-12 06:54 | 19K | |
![[IMG]](/icons/image2.gif) | andersons-business-l..> | 2023-05-03 11:06 | 47K | |
![[ ]](/icons/compressed.gif) | andersons-business-l..> | 2023-05-03 11:06 | 50K | |
![[ ]](/icons/compressed.gif) | andersons-nursing-le..> | 2023-05-03 09:58 | 101K | |
![[IMG]](/icons/image2.gif) | andersons-nursing-le..> | 2023-08-05 01:08 | 3.8K | |
![[IMG]](/icons/image2.gif) | andersons-nursing-le..> | 2023-05-03 09:59 | 20K | |
![[IMG]](/icons/image2.gif) | animal-diversity-7th..> | 2023-08-05 16:23 | 3.5K | |
![[IMG]](/icons/image2.gif) | animal-diversity-7th..> | 2023-08-12 06:54 | 21K | |
![[IMG]](/icons/image2.gif) | animal-diversity-7th..> | 2023-05-03 11:07 | 56K | |
![[ ]](/icons/compressed.gif) | animal-diversity-7th..> | 2023-05-03 11:07 | 35K | |
![[IMG]](/icons/image2.gif) | animal-physiology-sh..> | 2023-08-05 01:51 | 3.0K | |
![[IMG]](/icons/image2.gif) | animal-physiology-sh..> | 2023-05-03 10:10 | 19K | |
![[ ]](/icons/compressed.gif) | animal-physiology-sh..> | 2023-05-03 10:10 | 113K | |
![[ ]](/icons/unknown.gif) | anupindi_mbpf3_ism_c..> | 2023-05-03 11:00 | 29K | |
![[ ]](/icons/unknown.gif) | appG-Solution-Manual..> | 2023-05-04 01:59 | 226K | |
![[ ]](/icons/compressed.gif) | applied-behavior-ana..> | 2023-05-03 10:09 | 13K | |
![[IMG]](/icons/image2.gif) | applied-behavior-ana..> | 2023-05-03 10:09 | 6.4K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-12 20:37 | 18K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-05-03 11:07 | 45K | |
![[ ]](/icons/compressed.gif) | applied-calculus-man..> | 2023-05-03 11:07 | 172K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-06 00:58 | 2.6K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-12 20:37 | 15K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-05-03 11:07 | 38K | |
![[ ]](/icons/compressed.gif) | applied-calculus-man..> | 2023-05-03 11:07 | 529K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-05 15:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-08-12 20:37 | 15K | |
![[IMG]](/icons/image2.gif) | applied-calculus-man..> | 2023-05-03 11:08 | 40K | |
![[ ]](/icons/compressed.gif) | applied-calculus-man..> | 2023-05-03 11:08 | 749K | |
![[IMG]](/icons/image2.gif) | applied-mathematics-..> | 2023-08-06 12:08 | 2.6K | |
![[IMG]](/icons/image2.gif) | applied-mathematics-..> | 2023-08-12 20:37 | 15K | |
![[IMG]](/icons/image2.gif) | applied-mathematics-..> | 2023-05-03 11:08 | 40K | |
![[ ]](/icons/compressed.gif) | applied-mathematics-..> | 2023-05-03 11:08 | 480K | |
![[IMG]](/icons/image2.gif) | applied-partial-diff..> | 2023-08-06 12:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | applied-partial-diff..> | 2023-08-12 20:37 | 17K | |
![[IMG]](/icons/image2.gif) | applied-partial-diff..> | 2023-05-03 11:09 | 56K | |
![[ ]](/icons/compressed.gif) | applied-partial-diff..> | 2023-05-03 11:09 | 127K | |
![[IMG]](/icons/image2.gif) | applied-social-psych..> | 2023-08-08 21:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | applied-social-psych..> | 2023-08-12 20:37 | 16K | |
![[IMG]](/icons/image2.gif) | applied-social-psych..> | 2023-05-03 11:09 | 26K | |
![[ ]](/icons/compressed.gif) | applied-social-psych..> | 2023-05-03 11:09 | 87K | |
![[ ]](/icons/compressed.gif) | applied-social-resea..> | 2023-05-03 10:45 | 17K | |
![[IMG]](/icons/image2.gif) | applied-statistics-i..> | 2023-08-08 22:00 | 3.1K | |
![[IMG]](/icons/image2.gif) | applied-statistics-i..> | 2023-05-03 10:18 | 20K | |
![[ ]](/icons/compressed.gif) | applied-statistics-i..> | 2023-05-03 10:18 | 49K | |
![[IMG]](/icons/image2.gif) | applying-internation..> | 2023-08-08 11:08 | 4.7K | |
![[IMG]](/icons/image2.gif) | applying-internation..> | 2023-05-03 09:43 | 16K | |
![[IMG]](/icons/image2.gif) | archetypes-of-wisdom..> | 2023-08-06 03:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | archetypes-of-wisdom..> | 2023-05-03 10:20 | 12K | |
![[ ]](/icons/compressed.gif) | archetypes-of-wisdom..> | 2023-05-03 10:20 | 4.6K | |
![[ ]](/icons/unknown.gif) | arens_auditing_14ce_..> | 2023-05-03 11:10 | 61K | |
![[ ]](/icons/compressed.gif) | argumentation-and-cr..> | 2023-05-03 10:41 | 151K | |
![[ ]](/icons/unknown.gif) | armstrong_mai13_im_0..> | 2023-05-03 13:49 | 156K | |
![[IMG]](/icons/image2.gif) | art-leadership-5th-e..> | 2023-08-06 20:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | art-leadership-5th-e..> | 2023-08-12 20:37 | 19K | |
![[IMG]](/icons/image2.gif) | art-leadership-5th-e..> | 2023-05-03 09:45 | 52K | |
![[ ]](/icons/compressed.gif) | art-leadership-5th-e..> | 2023-05-03 09:45 | 320K | |
![[IMG]](/icons/image2.gif) | art-public-speaking-..> | 2023-08-08 06:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | art-public-speaking-..> | 2023-08-12 20:37 | 11K | |
![[IMG]](/icons/image2.gif) | art-public-speaking-..> | 2023-05-03 11:10 | 28K | |
![[ ]](/icons/compressed.gif) | art-public-speaking-..> | 2023-05-03 11:10 | 528K | |
![[IMG]](/icons/image2.gif) | art-public-speaking-..> | 2023-08-06 10:20 | 2.7K | |
![[IMG]](/icons/image2.gif) | art-public-speaking-..> | 2023-05-03 11:11 | 16K | |
![[ ]](/icons/compressed.gif) | art-public-speaking-..> | 2023-05-03 11:11 | 243K | |
![[IMG]](/icons/image2.gif) | assembly-language-fo..> | 2023-08-08 17:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | assembly-language-fo..> | 2023-08-21 00:08 | 19K | |
![[IMG]](/icons/image2.gif) | assembly-language-fo..> | 2023-05-03 10:43 | 55K | |
![[ ]](/icons/compressed.gif) | astrocos_ch02.zip | 2023-05-03 10:10 | 2.0M | |
![[IMG]](/icons/image2.gif) | astronomy-beginner-s..> | 2023-08-05 02:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | astronomy-beginner-s..> | 2023-08-14 09:10 | 20K | |
![[IMG]](/icons/image2.gif) | astronomy-beginner-s..> | 2023-05-03 11:11 | 70K | |
![[ ]](/icons/compressed.gif) | astronomy-beginner-s..> | 2023-05-03 11:11 | 199K | |
![[ ]](/icons/unknown.gif) | atkinson5esm_ch01.doc | 2023-05-03 10:57 | 221K | |
![[IMG]](/icons/image2.gif) | auditing-amp-assuran..> | 2023-05-03 09:20 | 9.2K | |
![[IMG]](/icons/image2.gif) | auditing-amp-assuran..> | 2023-05-03 09:20 | 9.2K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 14:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 09:28 | 8.1K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 01:09 | 2.4K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 09:28 | 8.1K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-07 01:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 09:47 | 12K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-06 07:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 10:52 | 11K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 09:49 | 26K | |
![[ ]](/icons/compressed.gif) | auditing-and-assuran..> | 2023-05-03 09:49 | 26K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 03:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 10:00 | 14K | |
![[ ]](/icons/compressed.gif) | auditing-and-assuran..> | 2023-05-03 10:00 | 18K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-08 02:38 | 2.5K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-04 02:21 | 8.1K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 22:02 | 2.6K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 10:40 | 15K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 11:26 | 22K | |
![[ ]](/icons/compressed.gif) | auditing-and-assuran..> | 2023-05-03 11:26 | 42K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-08-08 16:37 | 2.9K | |
![[IMG]](/icons/image2.gif) | auditing-and-assuran..> | 2023-05-03 09:21 | 18K | |
![[ ]](/icons/compressed.gif) | auditing-and-assuran..> | 2023-05-03 09:21 | 17K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 09:23 | 27K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-06 11:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-06 11:18 | 18K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 44K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 555K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-05 21:01 | 3.3K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-12 14:47 | 18K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 45K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 187K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-08 06:38 | 3.5K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-12 14:47 | 21K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:11 | 76K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:11 | 9.0M | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-06 05:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-12 14:47 | 21K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 77K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:12 | 69K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-08 16:37 | 3.4K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-12 14:47 | 20K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:13 | 50K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:13 | 2.9M | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-05 04:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-08-12 14:47 | 20K | |
![[IMG]](/icons/image2.gif) | auditing-assurance-s..> | 2023-05-03 11:13 | 50K | |
![[ ]](/icons/compressed.gif) | auditing-assurance-s..> | 2023-05-03 11:13 | 359K | |
![[IMG]](/icons/image2.gif) | auditing-canadian-7t..> | 2023-08-05 16:16 | 4.1K | |
![[IMG]](/icons/image2.gif) | auditing-canadian-7t..> | 2023-08-05 06:24 | 26K | |
![[IMG]](/icons/image2.gif) | auditing-canadian-7t..> | 2023-05-03 11:14 | 44K | |
![[ ]](/icons/compressed.gif) | auditing-canadian-7t..> | 2023-05-03 11:14 | 517K | |
![[IMG]](/icons/image2.gif) | auditing-cases-inter..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | auditing-cases-inter..> | 2023-08-07 19:18 | 19K | |
![[IMG]](/icons/image2.gif) | auditing-cases-inter..> | 2023-05-03 11:14 | 71K | |
![[ ]](/icons/compressed.gif) | auditing-cases-inter..> | 2023-05-03 11:14 | 827K | |
![[IMG]](/icons/image2.gif) | auditing-the-art-and..> | 2023-08-05 03:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | auditing-the-art-and..> | 2023-05-03 10:15 | 16K | |
![[ ]](/icons/compressed.gif) | auditing-the-art-and..> | 2023-05-03 10:15 | 116K | |
![[IMG]](/icons/image2.gif) | automation-productio..> | 2023-08-05 05:30 | 2.3K | |
![[IMG]](/icons/image2.gif) | automation-productio..> | 2023-08-12 04:49 | 14K | |
![[IMG]](/icons/image2.gif) | automation-productio..> | 2023-05-03 11:15 | 44K | |
![[ ]](/icons/compressed.gif) | automation-productio..> | 2023-05-03 11:15 | 561K | |
![[IMG]](/icons/image2.gif) | avanti-beginning-ita..> | 2023-08-06 09:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | avanti-beginning-ita..> | 2023-08-12 04:49 | 19K | |
![[IMG]](/icons/image2.gif) | avanti-beginning-ita..> | 2023-05-03 11:15 | 47K | |
![[ ]](/icons/compressed.gif) | avanti-beginning-ita..> | 2023-05-03 11:15 | 150K | |
![[IMG]](/icons/image2.gif) | bank-management-amp-..> | 2023-08-08 22:57 | 3.5K | |
![[IMG]](/icons/image2.gif) | bank-management-amp-..> | 2023-05-03 09:58 | 11K | |
![[IMG]](/icons/image2.gif) | bank-management-amp-..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | bank-management-amp-..> | 2023-05-03 10:19 | 11K | |
![[ ]](/icons/compressed.gif) | bank-management-and-..> | 2023-05-03 10:19 | 88K | |
![[IMG]](/icons/image2.gif) | bank-management-koch..> | 2023-08-06 03:50 | 3.2K | |
![[IMG]](/icons/image2.gif) | bank-management-koch..> | 2023-05-03 09:40 | 7.9K | |
![[ ]](/icons/unknown.gif) | barney_smca6_tif_01...> | 2023-05-04 02:03 | 32K | |
![[ ]](/icons/unknown.gif) | barringer_e5_im_02.doc | 2023-05-03 13:42 | 156K | |
![[ ]](/icons/unknown.gif) | barringer_ent6_tb_01..> | 2023-05-03 10:54 | 79K | |
![[ ]](/icons/compressed.gif) | basic-arrhythmias-7t..> | 2023-05-03 09:42 | 17K | |
![[IMG]](/icons/image2.gif) | basic-business-stati..> | 2023-05-03 10:19 | 11K | |
![[IMG]](/icons/image2.gif) | basic-chemistry-timb..> | 2023-08-08 06:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | basic-chemistry-timb..> | 2023-05-03 10:23 | 18K | |
![[ ]](/icons/compressed.gif) | basic-chemistry-timb..> | 2023-05-03 10:23 | 9.7K | |
![[IMG]](/icons/image2.gif) | basic-clinical-lab-c..> | 2023-08-05 16:29 | 2.2K | |
![[IMG]](/icons/image2.gif) | basic-clinical-lab-c..> | 2023-05-04 02:26 | 11K | |
![[IMG]](/icons/image2.gif) | basic-environmental-..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | basic-environmental-..> | 2023-09-05 01:19 | 24K | |
![[IMG]](/icons/image2.gif) | basic-environmental-..> | 2023-05-03 11:15 | 86K | |
![[ ]](/icons/compressed.gif) | basic-environmental-..> | 2023-05-03 11:15 | 62K | |
![[IMG]](/icons/image2.gif) | basic-geriatric-nurs..> | 2023-08-06 13:12 | 11K | |
![[IMG]](/icons/image2.gif) | basic-geriatric-nurs..> | 2023-05-03 10:17 | 27K | |
![[IMG]](/icons/image2.gif) | basic-geriatric-nurs..> | 2023-08-05 03:40 | 10K | |
![[IMG]](/icons/image2.gif) | basic-geriatric-nurs..> | 2023-05-03 10:14 | 23K | |
![[IMG]](/icons/image2.gif) | basic-immunology-fun..> | 2023-08-07 20:13 | 3.0K | |
![[IMG]](/icons/image2.gif) | basic-immunology-fun..> | 2023-05-03 09:34 | 18K | |
![[IMG]](/icons/image2.gif) | basic-marketing-a-ma..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | basic-marketing-a-ma..> | 2023-05-03 10:40 | 9.1K | |
![[ ]](/icons/compressed.gif) | basic-marketing-a-ma..> | 2023-05-03 09:54 | 81K | |
![[ ]](/icons/compressed.gif) | basic-marketing-a-st..> | 2023-05-03 10:40 | 283K | |
![[IMG]](/icons/image2.gif) | basic-marketing-perr..> | 2023-05-03 09:54 | 7.5K | |
![[IMG]](/icons/image2.gif) | basic-marketing-rese..> | 2023-08-05 02:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | basic-marketing-rese..> | 2023-05-03 10:13 | 19K | |
![[ ]](/icons/compressed.gif) | basic-marketing-rese..> | 2023-05-03 10:13 | 14K | |
![[IMG]](/icons/image2.gif) | basic-marketing-stra..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | basic-marketing-stra..> | 2023-09-05 01:19 | 15K | |
![[IMG]](/icons/image2.gif) | basic-marketing-stra..> | 2023-05-03 11:16 | 34K | |
![[ ]](/icons/compressed.gif) | basic-marketing-stra..> | 2023-05-03 11:16 | 338K | |
![[IMG]](/icons/image2.gif) | basic-medical-langua..> | 2023-08-05 16:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | basic-medical-langua..> | 2023-05-03 09:30 | 18K | |
![[ ]](/icons/compressed.gif) | basic-medical-langua..> | 2023-05-03 09:30 | 12K | |
![[ ]](/icons/compressed.gif) | basic-nursing-concep..> | 2023-05-03 10:41 | 14K | |
![[IMG]](/icons/image2.gif) | basic-nursing-essent..> | 2023-08-06 11:17 | 2.9K | |
![[IMG]](/icons/image2.gif) | basic-nursing-essent..> | 2023-05-03 10:28 | 19K | |
![[IMG]](/icons/image2.gif) | basic-nursing-patric..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | basic-nursing-patric..> | 2023-05-03 09:41 | 20K | |
![[IMG]](/icons/image2.gif) | basic-pharmacology-f..> | 2023-08-06 14:43 | 2.3K | |
![[IMG]](/icons/image2.gif) | basic-pharmacology-f..> | 2023-05-04 01:52 | 11K | |
![[IMG]](/icons/image2.gif) | basic-pharmacology-f..> | 2023-08-08 20:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | basic-pharmacology-f..> | 2023-05-03 10:33 | 17K | |
![[IMG]](/icons/image2.gif) | basic-practice-of-st..> | 2023-08-06 17:28 | 3.9K | |
![[IMG]](/icons/image2.gif) | basic-practice-of-st..> | 2023-09-23 11:42 | 25K | |
![[IMG]](/icons/image2.gif) | basic-practice-of-st..> | 2023-05-03 11:16 | 40K | |
![[ ]](/icons/compressed.gif) | basic-practice-of-st..> | 2023-05-03 11:16 | 172K | |
![[IMG]](/icons/image2.gif) | basic-statistics-for..> | 2023-08-08 08:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | basic-statistics-for..> | 2023-09-18 20:08 | 15K | |
![[IMG]](/icons/image2.gif) | basic-statistics-for..> | 2023-05-03 11:17 | 27K | |
![[ ]](/icons/compressed.gif) | basic-statistics-for..> | 2023-05-03 11:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | basic-statistics-for..> | 2023-08-08 01:56 | 2.1K | |
![[IMG]](/icons/image2.gif) | basic-statistics-for..> | 2023-05-03 09:48 | 11K | |
![[ ]](/icons/compressed.gif) | basic-statistics-for..> | 2023-05-03 09:48 | 213K | |
![[IMG]](/icons/image2.gif) | basic-technical-math..> | 2023-08-06 07:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | basic-technical-math..> | 2023-09-18 20:08 | 19K | |
![[IMG]](/icons/image2.gif) | basic-technical-math..> | 2023-05-03 11:17 | 60K | |
![[ ]](/icons/compressed.gif) | basic-technical-math..> | 2023-05-03 11:17 | 346K | |
![[IMG]](/icons/image2.gif) | basics-research-meth..> | 2023-08-06 13:03 | 4.1K | |
![[IMG]](/icons/image2.gif) | basics-research-meth..> | 2023-08-05 02:45 | 26K | |
![[IMG]](/icons/image2.gif) | basics-research-meth..> | 2023-05-03 09:19 | 74K | |
![[ ]](/icons/compressed.gif) | basics-research-meth..> | 2023-05-03 09:19 | 290K | |
![[IMG]](/icons/image2.gif) | basics-social-resear..> | 2023-08-06 09:44 | 2.9K | |
![[IMG]](/icons/image2.gif) | basics-social-resear..> | 2023-09-23 11:42 | 14K | |
![[IMG]](/icons/image2.gif) | basics-social-resear..> | 2023-05-03 11:19 | 46K | |
![[ ]](/icons/compressed.gif) | basics-social-resear..> | 2023-05-03 11:19 | 57K | |
![[IMG]](/icons/image2.gif) | bates-guide-to-physi..> | 2023-08-05 17:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | bates-guide-to-physi..> | 2023-05-03 10:16 | 8.3K | |
![[ ]](/icons/compressed.gif) | bates-guide-to-physi..> | 2023-05-03 10:08 | 6.2K | |
![[IMG]](/icons/image2.gif) | bates-guide-to-physi..> | 2023-05-03 10:08 | 16K | |
![[ ]](/icons/unknown.gif) | beams_aa13e_tb_01.doc | 2023-05-04 02:26 | 102K | |
![[IMG]](/icons/image2.gif) | beatty-legal_environ..> | 2023-05-03 10:42 | 51K | |
![[IMG]](/icons/image2.gif) | before-we-are-born-m..> | 2023-08-05 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | before-we-are-born-m..> | 2023-05-03 10:33 | 18K | |
![[IMG]](/icons/image2.gif) | beginning-algebra-7t..> | 2023-08-06 12:09 | 2.4K | |
![[IMG]](/icons/image2.gif) | beginning-algebra-7t..> | 2023-09-18 20:08 | 12K | |
![[IMG]](/icons/image2.gif) | beginning-algebra-7t..> | 2023-05-03 11:20 | 38K | |
![[ ]](/icons/compressed.gif) | beginning-algebra-7t..> | 2023-05-03 11:20 | 2.8M | |
![[IMG]](/icons/image2.gif) | beginning-and-interm..> | 2023-08-06 11:15 | 4.7K | |
![[IMG]](/icons/image2.gif) | beginning-and-interm..> | 2023-05-03 10:28 | 34K | |
![[ ]](/icons/compressed.gif) | beginning-and-interm..> | 2023-05-03 10:28 | 315K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-08-05 05:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-09-23 11:42 | 14K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-05-03 11:20 | 42K | |
![[ ]](/icons/compressed.gif) | beginning-intermedia..> | 2023-05-03 11:20 | 850K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-09-05 19:30 | 21K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 86K | |
![[ ]](/icons/compressed.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 286K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-08-08 06:37 | 3.3K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-09-05 19:30 | 20K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 71K | |
![[ ]](/icons/compressed.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 1.2M | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-08-06 01:01 | 3.3K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-09-05 19:30 | 20K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 72K | |
![[ ]](/icons/compressed.gif) | beginning-intermedia..> | 2023-05-03 11:21 | 434K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-08-09 12:05 | 2.2K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-09-05 19:30 | 11K | |
![[IMG]](/icons/image2.gif) | beginning-intermedia..> | 2023-05-03 11:22 | 40K | |
![[ ]](/icons/compressed.gif) | beginning-intermedia..> | 2023-05-03 11:22 | 387K | |
![[ ]](/icons/compressed.gif) | behavior-management-..> | 2023-05-03 13:41 | 92K | |
![[IMG]](/icons/image2.gif) | behavior-modificatio..> | 2023-08-05 22:07 | 3.1K | |
![[IMG]](/icons/image2.gif) | behavior-modificatio..> | 2023-05-03 09:43 | 20K | |
![[ ]](/icons/compressed.gif) | behavior-modificatio..> | 2023-05-03 09:43 | 19K | |
![[ ]](/icons/unknown.gif) | beresk_deviance_3e_t..> | 2023-05-04 02:27 | 85K | |
![[ ]](/icons/compressed.gif) | berne-and-levy-physi..> | 2023-05-03 10:43 | 7.6K | |
![[IMG]](/icons/image2.gif) | berne-and-levy-physi..> | 2023-08-05 02:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | berne-and-levy-physi..> | 2023-05-03 09:29 | 20K | |
![[IMG]](/icons/image2.gif) | berne-and-levy-physi..> | 2023-08-05 02:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | berne-and-levy-physi..> | 2023-05-03 10:43 | 16K | |
![[ ]](/icons/compressed.gif) | biochemistry-4th-edi..> | 2023-05-03 10:37 | 10K | |
![[IMG]](/icons/image2.gif) | biochemistry-6th-edi..> | 2023-08-05 14:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | biochemistry-6th-edi..> | 2023-08-14 08:18 | 18K | |
![[IMG]](/icons/image2.gif) | biochemistry-6th-edi..> | 2023-05-03 11:22 | 44K | |
![[ ]](/icons/compressed.gif) | biochemistry-6th-edi..> | 2023-05-03 11:22 | 134K | |
![[IMG]](/icons/image2.gif) | biochemistry-8th-edi..> | 2023-08-05 01:12 | 3.1K | |
![[IMG]](/icons/image2.gif) | biochemistry-8th-edi..> | 2023-08-05 03:40 | 17K | |
![[IMG]](/icons/image2.gif) | biochemistry-8th-edi..> | 2023-05-03 11:22 | 28K | |
![[ ]](/icons/compressed.gif) | biochemistry-8th-edi..> | 2023-05-03 11:22 | 113K | |
![[IMG]](/icons/image2.gif) | biochemistry-a-short..> | 2023-08-05 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | biochemistry-a-short..> | 2023-08-05 15:30 | 32K | |
![[IMG]](/icons/image2.gif) | biochemistry-a-short..> | 2023-05-03 11:23 | 51K | |
![[ ]](/icons/compressed.gif) | biochemistry-a-short..> | 2023-05-03 11:23 | 63K | |
![[IMG]](/icons/image2.gif) | biochemistry-berg-st..> | 2023-08-05 06:24 | 2.5K | |
![[IMG]](/icons/image2.gif) | biochemistry-berg-st..> | 2023-05-03 11:24 | 16K | |
![[IMG]](/icons/image2.gif) | biochemistry-campbel..> | 2023-08-05 05:30 | 3.7K | |
![[IMG]](/icons/image2.gif) | biochemistry-campbel..> | 2023-05-03 09:25 | 21K | |
![[ ]](/icons/compressed.gif) | biochemistry-campbel..> | 2023-05-03 09:25 | 213K | |
![[IMG]](/icons/image2.gif) | biochemistry-garrett..> | 2023-05-03 10:38 | 22K | |
![[IMG]](/icons/image2.gif) | biochemistry-jeremy-..> | 2023-08-06 07:46 | 2.3K | |
![[IMG]](/icons/image2.gif) | biochemistry-jeremy-..> | 2023-05-03 10:40 | 16K | |
![[IMG]](/icons/image2.gif) | biological-psycholog..> | 2023-05-03 10:37 | 13K | |
![[ ]](/icons/compressed.gif) | biological-psycholog..> | 2023-05-03 10:37 | 211K | |
![[IMG]](/icons/image2.gif) | biological-psycholog..> | 2023-08-05 17:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | biological-psycholog..> | 2023-05-03 10:04 | 11K | |
![[ ]](/icons/compressed.gif) | biological-psycholog..> | 2023-05-03 10:04 | 49K | |
![[ ]](/icons/compressed.gif) | biological-psycholog..> | 2023-05-03 10:28 | 51K | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-08-08 22:00 | 20K | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-05-03 11:23 | 84K | |
![[ ]](/icons/compressed.gif) | biological-science-6..> | 2023-05-03 11:23 | 1.1M | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-08-09 07:03 | 20K | |
![[IMG]](/icons/image2.gif) | biological-science-6..> | 2023-05-03 11:24 | 84K | |
![[ ]](/icons/compressed.gif) | biological-science-6..> | 2023-05-03 11:24 | 178K | |
![[IMG]](/icons/image2.gif) | biological-science-f..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | biological-science-f..> | 2023-05-03 10:48 | 19K | |
![[ ]](/icons/compressed.gif) | biological-science-f..> | 2023-05-03 10:48 | 163K | |
![[IMG]](/icons/image2.gif) | biological-science-f..> | 2023-08-06 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | biological-science-f..> | 2023-05-03 09:37 | 13K | |
![[IMG]](/icons/image2.gif) | biological-science-s..> | 2023-08-06 08:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | biological-science-s..> | 2023-05-03 10:19 | 20K | |
![[ ]](/icons/compressed.gif) | biological-science-s..> | 2023-05-03 10:19 | 31K | |
![[ ]](/icons/compressed.gif) | biology-11th-edition..> | 2023-05-03 11:00 | 2.8M | |
![[IMG]](/icons/image2.gif) | biology-11th-edition..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | biology-11th-edition..> | 2023-08-14 08:18 | 19K | |
![[IMG]](/icons/image2.gif) | biology-11th-edition..> | 2023-05-03 11:24 | 54K | |
![[ ]](/icons/compressed.gif) | biology-11th-edition..> | 2023-05-03 11:24 | 292K | |
![[ ]](/icons/compressed.gif) | biology-12th-edition..> | 2023-05-03 10:10 | 1.7M | |
![[IMG]](/icons/image2.gif) | biology-campbell-8e-..> | 2023-08-06 07:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | biology-campbell-8e-..> | 2023-05-03 10:48 | 16K | |
![[ ]](/icons/compressed.gif) | biology-campbell-8e-..> | 2023-05-03 10:48 | 577K | |
![[IMG]](/icons/image2.gif) | biology-concepts-and..> | 2023-08-08 16:42 | 2.8K | |
![[IMG]](/icons/image2.gif) | biology-concepts-and..> | 2023-05-03 10:44 | 17K | |
![[ ]](/icons/compressed.gif) | biology-concepts-and..> | 2023-05-03 10:44 | 146K | |
![[IMG]](/icons/image2.gif) | biology-concepts-and..> | 2023-05-03 11:23 | 14K | |
![[ ]](/icons/compressed.gif) | biology-concepts-and..> | 2023-05-03 11:23 | 79K | |
![[IMG]](/icons/image2.gif) | biology-how-life-wor..> | 2023-08-05 15:31 | 2.3K | |
![[IMG]](/icons/image2.gif) | biology-how-life-wor..> | 2023-08-05 16:15 | 15K | |
![[IMG]](/icons/image2.gif) | biology-how-life-wor..> | 2023-05-03 11:25 | 23K | |
![[ ]](/icons/compressed.gif) | biology-how-life-wor..> | 2023-05-03 11:25 | 257K | |
![[IMG]](/icons/image2.gif) | biology-humans-conce..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | biology-humans-conce..> | 2023-08-05 16:15 | 24K | |
![[IMG]](/icons/image2.gif) | biology-humans-conce..> | 2023-05-03 11:25 | 82K | |
![[ ]](/icons/compressed.gif) | biology-humans-conce..> | 2023-05-03 11:25 | 37K | |
![[IMG]](/icons/image2.gif) | biology-laboratory-m..> | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | biology-laboratory-m..> | 2023-08-06 05:44 | 19K | |
![[IMG]](/icons/image2.gif) | biology-laboratory-m..> | 2023-05-03 11:25 | 47K | |
![[ ]](/icons/compressed.gif) | biology-laboratory-m..> | 2023-05-03 11:25 | 796K | |
![[IMG]](/icons/image2.gif) | biology-life-on-eart..> | 2023-08-07 02:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | biology-life-on-eart..> | 2023-05-03 10:17 | 21K | |
![[ ]](/icons/compressed.gif) | biology-life-on-eart..> | 2023-05-03 10:17 | 294K | |
![[IMG]](/icons/image2.gif) | biology-mader-10th-t..> | 2023-08-05 01:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | biology-mader-10th-t..> | 2023-05-03 09:44 | 17K | |
![[IMG]](/icons/image2.gif) | biology-neil-a-campb..> | 2023-08-05 01:15 | 2.0K | |
![[IMG]](/icons/image2.gif) | biology-neil-a-campb..> | 2023-05-03 10:05 | 12K | |
![[ ]](/icons/compressed.gif) | biology-neil-a-campb..> | 2023-05-03 10:05 | 9.7K | |
![[IMG]](/icons/image2.gif) | biology-of-humans-co..> | 2023-08-05 02:45 | 2.4K | |
![[IMG]](/icons/image2.gif) | biology-of-humans-co..> | 2023-05-03 11:06 | 12K | |
![[ ]](/icons/compressed.gif) | biology-of-humans-co..> | 2023-05-03 11:06 | 391K | |
![[IMG]](/icons/image2.gif) | biology-of-plants-pe..> | 2023-08-05 16:25 | 3.7K | |
![[IMG]](/icons/image2.gif) | biology-of-plants-pe..> | 2023-05-03 09:32 | 29K | |
![[ ]](/icons/compressed.gif) | biology-of-plants-pe..> | 2023-05-03 09:31 | 6.6K | |
![[IMG]](/icons/image2.gif) | biology-peter-raven-..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | biology-peter-raven-..> | 2023-05-03 10:30 | 21K | |
![[ ]](/icons/compressed.gif) | biology-peter-raven-..> | 2023-05-03 10:30 | 14K | |
![[IMG]](/icons/image2.gif) | biology-science-for-..> | 2023-08-05 05:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | biology-science-for-..> | 2023-05-03 10:24 | 25K | |
![[ ]](/icons/compressed.gif) | biology-science-for-..> | 2023-05-03 10:24 | 17K | |
![[IMG]](/icons/image2.gif) | biology-the-essentia..> | 2023-08-06 05:46 | 2.6K | |
![[IMG]](/icons/image2.gif) | biology-the-essentia..> | 2023-05-03 10:28 | 16K | |
![[ ]](/icons/compressed.gif) | biology-the-essentia..> | 2023-05-03 10:28 | 242K | |
![[IMG]](/icons/image2.gif) | biology-today-and-to..> | 2023-08-05 03:41 | 2.5K | |
![[IMG]](/icons/image2.gif) | biology-today-and-to..> | 2023-05-03 10:52 | 13K | |
![[ ]](/icons/compressed.gif) | biology-today-and-to..> | 2023-05-03 10:52 | 755K | |
![[ ]](/icons/unknown.gif) | bionow2_tb_Chapter02..> | 2023-05-03 11:02 | 376K | |
![[IMG]](/icons/image2.gif) | biopsychology-pinel-..> | 2023-08-06 07:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | biopsychology-pinel-..> | 2023-05-03 10:30 | 9.8K | |
![[ ]](/icons/compressed.gif) | biopsychology-pinel-..> | 2023-05-03 10:30 | 104K | |
![[ ]](/icons/unknown.gif) | bj5_testbank_ch1_fin..> | 2023-05-03 13:42 | 95K | |
![[ ]](/icons/compressed.gif) | blanchard_ch01_tif.zip | 2023-05-03 10:10 | 9.2K | |
![[ ]](/icons/unknown.gif) | blau_7e_im_01.doc | 2023-05-03 09:31 | 34K | |
![[IMG]](/icons/image2.gif) | body-structures-and-..> | 2023-08-05 04:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | body-structures-and-..> | 2023-05-03 09:19 | 25K | |
![[ ]](/icons/compressed.gif) | body-structures-and-..> | 2023-05-03 09:19 | 5.5K | |
![[IMG]](/icons/image2.gif) | body-structures-and-..> | 2023-08-06 20:23 | 3.0K | |
![[IMG]](/icons/image2.gif) | body-structures-and-..> | 2023-05-03 10:40 | 20K | |
![[ ]](/icons/compressed.gif) | body-structures-and-..> | 2023-05-03 10:40 | 14K | |
![[IMG]](/icons/image2.gif) | booth5e19dh_ecg_nm2.jpg | 2023-05-04 02:16 | 10K | |
![[ ]](/icons/unknown.gif) | booth5e_chapter-01_t..> | 2023-05-03 11:01 | 22K | |
![[ ]](/icons/unknown.gif) | boyd_7ce_tb_ch01_fin..> | 2023-05-04 02:08 | 1.0M | |
![[ ]](/icons/unknown.gif) | braun_2CE_ch01_ism.doc | 2023-05-03 10:13 | 304K | |
![[IMG]](/icons/image2.gif) | brewer7e16ss_nm2_1_3..> | 2023-05-04 02:21 | 8.8K | |
![[ ]](/icons/compressed.gif) | brock-biology-of-mic..> | 2023-05-03 10:30 | 140K | |
![[IMG]](/icons/image2.gif) | brock-biology-of-mic..> | 2023-08-08 06:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | brock-biology-of-mic..> | 2023-05-03 10:30 | 21K | |
![[IMG]](/icons/image2.gif) | brodys-human-pharmac..> | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | brodys-human-pharmac..> | 2023-05-03 09:23 | 21K | |
![[ ]](/icons/unknown.gif) | brown_eaod8_tb_01.doc | 2023-05-03 09:52 | 87K | |
![[IMG]](/icons/image2.gif) | brunner-and-suddarth..> | 2023-08-05 04:19 | 3.1K | |
![[IMG]](/icons/image2.gif) | brunner-and-suddarth..> | 2023-05-03 10:03 | 21K | |
![[ ]](/icons/compressed.gif) | brunner-and-suddarth..> | 2023-05-03 10:03 | 5.4K | |
![[ ]](/icons/compressed.gif) | brunner-and-suddarth..> | 2023-05-03 10:29 | 18K | |
![[IMG]](/icons/image2.gif) | brunnstroms-clinical..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | brunnstroms-clinical..> | 2023-05-03 10:38 | 17K | |
![[ ]](/icons/compressed.gif) | brunnstroms-clinical..> | 2023-05-03 10:38 | 2.2K | |
![[IMG]](/icons/image2.gif) | bstat-keller-1st-tb-..> | 2023-08-05 02:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | bstat-keller-1st-tb.jpg | 2023-05-03 10:02 | 21K | |
![[ ]](/icons/compressed.gif) | bstat-keller-1st-tb.zip | 2023-05-03 10:02 | 12K | |
![[ ]](/icons/unknown.gif) | buckwold22e_Solution..> | 2023-05-04 02:27 | 25K | |
![[IMG]](/icons/image2.gif) | building-management-..> | 2023-08-05 10:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | building-management-..> | 2023-05-03 10:40 | 22K | |
![[ ]](/icons/compressed.gif) | building-management-..> | 2023-05-03 10:40 | 18K | |
![[IMG]](/icons/image2.gif) | building-your-dream-..> | 2023-08-05 02:46 | 4.0K | |
![[IMG]](/icons/image2.gif) | building-your-dream-..> | 2023-08-05 02:31 | 28K | |
![[IMG]](/icons/image2.gif) | building-your-dream-..> | 2023-05-03 09:36 | 67K | |
![[ ]](/icons/compressed.gif) | building-your-dream-..> | 2023-05-03 09:36 | 133K | |
![[ ]](/icons/unknown.gif) | bulliet_6e_irm_ch01...> | 2023-05-03 10:39 | 55K | |
![[ ]](/icons/unknown.gif) | burke_1.rtf | 2023-05-03 09:20 | 9.6K | |
![[IMG]](/icons/image2.gif) | burtons-microbiology..> | 2023-08-08 06:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | burtons-microbiology..> | 2023-05-03 10:31 | 18K | |
![[IMG]](/icons/image2.gif) | business-a-changing-..> | 2023-08-06 10:14 | 3.6K | |
![[IMG]](/icons/image2.gif) | business-a-changing-..> | 2023-05-03 10:11 | 22K | |
![[ ]](/icons/compressed.gif) | business-a-changing-..> | 2023-05-03 10:11 | 98K | |
![[IMG]](/icons/image2.gif) | business-a-practical..> | 2023-08-09 07:07 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-a-practical..> | 2023-05-03 10:17 | 19K | |
![[ ]](/icons/compressed.gif) | business-a-practical..> | 2023-05-03 10:17 | 42K | |
![[IMG]](/icons/image2.gif) | business-action-7th-..> | 2023-08-05 04:36 | 3.7K | |
![[IMG]](/icons/image2.gif) | business-action-7th-..> | 2023-08-08 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | business-action-7th-..> | 2023-05-04 02:25 | 50K | |
![[ ]](/icons/compressed.gif) | business-action-7th-..> | 2023-05-04 02:25 | 576K | |
![[IMG]](/icons/image2.gif) | business-action-8th-..> | 2023-08-05 14:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | business-action-8th-..> | 2023-08-08 06:43 | 19K | |
![[IMG]](/icons/image2.gif) | business-action-8th-..> | 2023-05-03 10:45 | 54K | |
![[ ]](/icons/compressed.gif) | business-action-8th-..> | 2023-05-03 10:45 | 1.4M | |
![[IMG]](/icons/image2.gif) | business-analytics-d..> | 2023-08-05 02:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | business-analytics-d..> | 2023-08-05 02:31 | 22K | |
![[IMG]](/icons/image2.gif) | business-analytics-d..> | 2023-05-03 09:36 | 60K | |
![[ ]](/icons/compressed.gif) | business-analytics-d..> | 2023-05-03 09:36 | 2.2M | |
![[IMG]](/icons/image2.gif) | business-analytics-e..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-analytics-e..> | 2023-05-03 10:34 | 13K | |
![[ ]](/icons/compressed.gif) | business-analytics-e..> | 2023-05-03 10:34 | 52K | |
![[ ]](/icons/compressed.gif) | business-and-society..> | 2023-05-03 09:49 | 242K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-08-06 11:04 | 3.7K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-05-03 09:49 | 12K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-08-08 07:25 | 3.8K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-05-03 09:33 | 23K | |
![[ ]](/icons/compressed.gif) | business-and-society..> | 2023-05-03 09:33 | 11K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-05-03 09:35 | 14K | |
![[IMG]](/icons/image2.gif) | business-and-society..> | 2023-05-03 10:16 | 14K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-06 12:11 | 3.3K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-03 09:22 | 22K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-03 09:22 | 27K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-09 09:07 | 4.5K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-08 06:43 | 34K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-03 11:02 | 166K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-03 11:02 | 211K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-08 06:43 | 16K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-03 10:02 | 79K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-03 10:02 | 102K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-05 15:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-04 01:51 | 21K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-04 01:51 | 58K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-05 05:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-08 06:43 | 23K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-03 10:04 | 88K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-03 10:04 | 298K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-communicati..> | 2023-05-03 10:03 | 19K | |
![[ ]](/icons/compressed.gif) | business-communicati..> | 2023-05-03 10:03 | 27K | |
![[IMG]](/icons/image2.gif) | business-driven-tech..> | 2023-08-06 14:42 | 1.8K | |
![[IMG]](/icons/image2.gif) | business-driven-tech..> | 2023-08-08 06:43 | 7.5K | |
![[IMG]](/icons/image2.gif) | business-driven-tech..> | 2023-05-03 10:06 | 22K | |
![[ ]](/icons/compressed.gif) | business-driven-tech..> | 2023-05-03 10:05 | 419K | |
![[IMG]](/icons/image2.gif) | business-essentials-..> | 2023-08-07 16:08 | 2.5K | |
![[IMG]](/icons/image2.gif) | business-essentials-..> | 2023-08-08 06:43 | 11K | |
![[IMG]](/icons/image2.gif) | business-essentials-..> | 2023-05-04 02:28 | 30K | |
![[ ]](/icons/compressed.gif) | business-essentials-..> | 2023-05-04 02:28 | 217K | |
![[IMG]](/icons/image2.gif) | business-ethics-a-te..> | 2023-08-05 01:51 | 3.6K | |
![[IMG]](/icons/image2.gif) | business-ethics-a-te..> | 2023-05-03 10:33 | 21K | |
![[IMG]](/icons/image2.gif) | business-ethics-deci..> | 2023-08-05 14:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | business-ethics-deci..> | 2023-05-03 09:35 | 23K | |
![[ ]](/icons/compressed.gif) | business-ethics-deci..> | 2023-05-03 09:35 | 51K | |
![[IMG]](/icons/image2.gif) | business-ethics-ethi..> | 2023-08-05 06:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | business-ethics-ethi..> | 2023-05-03 09:42 | 20K | |
![[ ]](/icons/compressed.gif) | business-ethics-ethi..> | 2023-05-03 09:42 | 124K | |
![[IMG]](/icons/image2.gif) | business-forecasting..> | 2023-08-05 02:47 | 2.5K | |
![[IMG]](/icons/image2.gif) | business-forecasting..> | 2023-05-03 11:14 | 13K | |
![[ ]](/icons/compressed.gif) | business-forecasting..> | 2023-05-03 11:14 | 11K | |
![[IMG]](/icons/image2.gif) | business-foundations..> | 2023-08-06 08:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-foundations..> | 2023-08-08 06:43 | 17K | |
![[IMG]](/icons/image2.gif) | business-foundations..> | 2023-05-03 09:37 | 28K | |
![[ ]](/icons/compressed.gif) | business-foundations..> | 2023-05-03 09:37 | 330K | |
![[IMG]](/icons/image2.gif) | business-government-..> | 2023-08-05 17:22 | 3.2K | |
![[IMG]](/icons/image2.gif) | business-government-..> | 2023-05-03 09:48 | 20K | |
![[ ]](/icons/compressed.gif) | business-government-..> | 2023-05-03 09:48 | 8.2K | |
![[IMG]](/icons/image2.gif) | business-government-..> | 2023-08-05 14:37 | 2.7K | |
![[IMG]](/icons/image2.gif) | business-government-..> | 2023-05-03 10:20 | 16K | |
![[ ]](/icons/compressed.gif) | business-government-..> | 2023-05-03 10:20 | 17K | |
![[IMG]](/icons/image2.gif) | business-in-action-b..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-in-action-b..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/compressed.gif) | business-in-action-b..> | 2023-05-03 09:19 | 24K | |
![[IMG]](/icons/image2.gif) | business-its-legal-e..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | business-its-legal-e..> | 2023-08-08 06:43 | 22K | |
![[IMG]](/icons/image2.gif) | business-its-legal-e..> | 2023-05-03 09:21 | 56K | |
![[ ]](/icons/compressed.gif) | business-its-legal-e..> | 2023-05-03 09:21 | 81K | |
![[IMG]](/icons/image2.gif) | business-law-and-the..> | 2023-08-05 16:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | business-law-and-the..> | 2023-05-03 10:06 | 19K | |
![[ ]](/icons/compressed.gif) | business-law-and-the..> | 2023-05-03 10:06 | 15K | |
![[IMG]](/icons/image2.gif) | business-law-cheesem..> | 2023-08-06 03:28 | 4.3K | |
![[IMG]](/icons/image2.gif) | business-law-cheesem..> | 2023-05-03 11:26 | 13K | |
![[IMG]](/icons/image2.gif) | business-law-ethical..> | 2023-08-05 05:29 | 2.0K | |
![[IMG]](/icons/image2.gif) | business-law-ethical..> | 2023-08-14 07:22 | 11K | |
![[IMG]](/icons/image2.gif) | business-law-ethical..> | 2023-05-03 09:28 | 33K | |
![[ ]](/icons/compressed.gif) | business-law-ethical..> | 2023-05-03 09:28 | 172K | |
![[IMG]](/icons/image2.gif) | business-law-jane-ma..> | 2023-08-06 11:19 | 1.9K | |
![[IMG]](/icons/image2.gif) | business-law-jane-ma..> | 2023-05-03 10:29 | 14K | |
![[ ]](/icons/compressed.gif) | business-law-jane-ma..> | 2023-05-03 10:29 | 81K | |
![[IMG]](/icons/image2.gif) | business-law-text-an..> | 2023-05-03 10:35 | 5.1K | |
![[IMG]](/icons/image2.gif) | business-law-text-an..> | 2023-08-06 10:16 | 1.9K | |
![[IMG]](/icons/image2.gif) | business-law-text-an..> | 2023-05-03 09:20 | 6.0K | |
![[IMG]](/icons/image2.gif) | business-law-text-an..> | 2023-08-05 09:59 | 1.9K | |
![[IMG]](/icons/image2.gif) | business-law-text-an..> | 2023-05-03 09:07 | 6.0K | |
![[IMG]](/icons/image2.gif) | business-law-texts-c..> | 2023-08-05 03:40 | 2.0K | |
![[IMG]](/icons/image2.gif) | business-law-texts-c..> | 2023-08-14 07:22 | 9.7K | |
![[IMG]](/icons/image2.gif) | business-law-texts-c..> | 2023-05-03 10:16 | 26K | |
![[ ]](/icons/compressed.gif) | business-law-texts-c..> | 2023-05-03 10:16 | 1.4M | |
![[IMG]](/icons/image2.gif) | business-law-the-eth..> | 2023-08-05 14:34 | 1.7K | |
![[IMG]](/icons/image2.gif) | business-law-the-eth..> | 2023-05-03 09:55 | 9.7K | |
![[ ]](/icons/compressed.gif) | business-law-the-eth..> | 2023-05-03 09:55 | 69K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-05 17:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-14 07:22 | 17K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-05-03 10:31 | 45K | |
![[ ]](/icons/compressed.gif) | business-law-today-c..> | 2023-05-03 10:31 | 2.0M | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-05 04:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-09 08:49 | 18K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-05-04 02:20 | 45K | |
![[ ]](/icons/compressed.gif) | business-law-today-c..> | 2023-05-04 02:20 | 59K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-08 06:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-05-03 09:30 | 11K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-06 05:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-05-03 09:30 | 10K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-08-05 01:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | business-law-today-c..> | 2023-05-03 09:47 | 10K | |
![[IMG]](/icons/image2.gif) | business-law-with-uc..> | 2023-08-05 17:20 | 1.9K | |
![[IMG]](/icons/image2.gif) | business-law-with-uc..> | 2023-05-03 09:30 | 11K | |
![[ ]](/icons/compressed.gif) | business-law-with-uc..> | 2023-05-03 09:30 | 59K | |
![[IMG]](/icons/image2.gif) | business-law-with-uc..> | 2023-08-05 04:34 | 1.9K | |
![[IMG]](/icons/image2.gif) | business-law-with-uc..> | 2023-05-03 10:08 | 5.6K | |
![[IMG]](/icons/image2.gif) | business-math-10th-e..> | 2023-08-08 07:31 | 3.4K | |
![[IMG]](/icons/image2.gif) | business-math-10th-e..> | 2023-08-05 15:35 | 15K | |
![[IMG]](/icons/image2.gif) | business-math-10th-e..> | 2023-05-03 10:22 | 54K | |
![[IMG]](/icons/image2.gif) | business-pride-11th-..> | 2023-08-05 17:17 | 3.0K | |
![[IMG]](/icons/image2.gif) | business-pride-11th-..> | 2023-05-03 10:43 | 16K | |
![[ ]](/icons/compressed.gif) | business-pride-11th-..> | 2023-05-03 10:43 | 54K | |
![[IMG]](/icons/image2.gif) | business-pride-12th-..> | 2023-08-06 07:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | business-pride-12th-..> | 2023-05-03 09:57 | 20K | |
![[ ]](/icons/compressed.gif) | business-pride-12th-..> | 2023-05-03 09:57 | 127K | |
![[IMG]](/icons/image2.gif) | business-society-eth..> | 2023-08-05 02:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | business-society-eth..> | 2023-08-05 02:31 | 18K | |
![[IMG]](/icons/image2.gif) | business-society-eth..> | 2023-05-03 11:10 | 44K | |
![[ ]](/icons/compressed.gif) | business-society-eth..> | 2023-05-03 11:10 | 1.2M | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 09:59 | 4.3K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:35 | 23K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-04 02:10 | 70K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-04 02:10 | 573K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-08 06:37 | 4.3K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:35 | 23K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 09:48 | 76K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 09:48 | 267K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-08 06:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:35 | 26K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 09:56 | 81K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 09:56 | 1.2M | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-06 13:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:35 | 30K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 10:08 | 106K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 10:08 | 156K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-06 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:35 | 16K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 11:12 | 46K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 11:12 | 537K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 13:40 | 20K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 10:43 | 27K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-06 01:48 | 3.0K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 10:43 | 10K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-06 09:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 09:43 | 19K | |
![[ ]](/icons/compressed.gif) | business-statistics-..> | 2023-05-03 09:43 | 9.7K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-08-05 15:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | business-statistics-..> | 2023-05-03 09:56 | 22K | |
![[IMG]](/icons/image2.gif) | c-programming-from-p..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | c-programming-from-p..> | 2023-08-08 07:33 | 15K | |
![[IMG]](/icons/image2.gif) | c-programming-from-p..> | 2023-05-03 09:33 | 40K | |
![[ ]](/icons/compressed.gif) | c-programming-from-p..> | 2023-05-03 09:33 | 98K | |
![[ ]](/icons/unknown.gif) | c01-Sociology-A-Down..> | 2023-05-03 10:09 | 164K | |
![[ ]](/icons/layout.gif) | c01-Solution-Manual-..> | 2023-05-03 10:47 | 218K | |
![[ ]](/icons/compressed.gif) | c1-2015-Nursing-Inte..> | 2023-05-03 10:12 | 5.7K | |
![[ ]](/icons/unknown.gif) | c1-2015-Understandin..> | 2023-05-03 10:37 | 153K | |
![[ ]](/icons/compressed.gif) | c1-9780323416375.zip | 2023-05-03 13:42 | 0 | |
![[ ]](/icons/unknown.gif) | c1-9780323485258.rtf | 2023-05-04 01:50 | 304K | |
![[ ]](/icons/unknown.gif) | c1-9780323547581.rtf | 2023-05-04 01:48 | 67K | |
![[ ]](/icons/unknown.gif) | c1-9780323566681.rtf | 2023-05-04 02:09 | 182K | |
![[ ]](/icons/compressed.gif) | c1-9781111825911.zip | 2023-05-03 13:41 | 5.0K | |
![[ ]](/icons/unknown.gif) | c1-Abnormal-Psycholo..> | 2023-05-03 10:36 | 107K | |
![[ ]](/icons/compressed.gif) | c1-Basic-Pharmacolog..> | 2023-05-04 01:52 | 5.8K | |
![[ ]](/icons/unknown.gif) | c1-CommunityPublic-H..> | 2023-05-03 09:56 | 88K | |
![[ ]](/icons/unknown.gif) | c1-Downloadable-Test..> | 2023-05-03 10:36 | 134K | |
![[ ]](/icons/compressed.gif) | c1-Essentials-of-Acc..> | 2023-05-03 09:30 | 15K | |
![[ ]](/icons/unknown.gif) | c1-Financial-Theory-..> | 2023-05-03 09:25 | 58K | |
![[ ]](/icons/compressed.gif) | c1-Fundamentals-Nurs..> | 2023-05-03 10:35 | 13K | |
![[ ]](/icons/compressed.gif) | c1-Introduction-to-M..> | 2023-05-03 09:20 | 6.8K | |
![[ ]](/icons/unknown.gif) | c1-Maternal-Child-Nu..> | 2023-05-03 10:19 | 162K | |
![[ ]](/icons/compressed.gif) | c1-Pharmacology-A-Pa..> | 2023-05-03 11:23 | 6.9K | |
![[ ]](/icons/unknown.gif) | c1-Small-Business-Ma..> | 2023-05-03 10:34 | 59K | |
![[ ]](/icons/unknown.gif) | c1-Sociology-The-Cor..> | 2023-05-04 01:47 | 226K | |
![[ ]](/icons/unknown.gif) | c1-Solution-Manual-f..> | 2023-05-03 10:50 | 109K | |
![[ ]](/icons/unknown.gif) | c1-Solutions-Manual-..> | 2023-05-03 10:48 | 58K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-Claywel..> | 2023-05-04 01:53 | 4.2K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Essenti..> | 2023-05-03 09:49 | 46K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Ethics-..> | 2023-05-03 10:37 | 31K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-For-Adv..> | 2023-05-04 02:24 | 32K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-For-Den..> | 2023-05-04 01:48 | 59K | |
![[ ]](/icons/layout.gif) | c1-Test-Bank-For-Int..> | 2023-05-03 10:14 | 594K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-For-Res..> | 2023-05-04 01:49 | 89K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Health-..> | 2023-05-03 09:27 | 104K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Interpe..> | 2023-05-03 10:01 | 56K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-Priorit..> | 2023-05-03 09:42 | 4.8K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Psychia..> | 2023-05-03 10:02 | 81K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Virtual..> | 2023-05-03 13:43 | 87K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-Wongs-N..> | 2023-05-03 09:57 | 115K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Abn..> | 2023-05-03 10:40 | 42K | |
![[ ]](/icons/layout.gif) | c1-Test-Bank-for-Bas..> | 2023-05-03 10:19 | 1.4M | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Cri..> | 2023-05-03 09:32 | 42K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Hea..> | 2023-05-03 09:41 | 11K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Int..> | 2023-05-04 01:54 | 1.9K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Med..> | 2023-05-04 01:49 | 65K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Neo..> | 2023-05-03 10:46 | 18K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Nur..> | 2023-05-03 09:11 | 121K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Nur..> | 2023-05-03 09:41 | 8.7K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-PHP..> | 2023-05-03 10:54 | 6.0K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Phy..> | 2023-05-03 09:33 | 8.4K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Pro..> | 2023-05-04 01:59 | 1.6K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Res..> | 2023-05-03 10:49 | 3.3K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Spo..> | 2023-05-03 09:37 | 27K | |
![[ ]](/icons/compressed.gif) | c1-Test-Bank-for-Tex..> | 2023-05-04 01:52 | 16K | |
![[ ]](/icons/unknown.gif) | c1-Test-Bank-for-Wor..> | 2023-05-03 10:17 | 100K | |
![[ ]](/icons/compressed.gif) | c1-Test-bank-Burns-a..> | 2023-05-04 02:04 | 7.1K | |
![[ ]](/icons/compressed.gif) | c1-Test-bank-Health-..> | 2023-05-04 02:08 | 4.9K | |
![[ ]](/icons/unknown.gif) | c1-Understanding-Pha..> | 2023-05-03 09:48 | 115K | |
![[ ]](/icons/unknown.gif) | c2-Calculate-with-Co..> | 2023-05-03 09:59 | 53K | |
![[ ]](/icons/compressed.gif) | c2-Test-Bank-for-Nuc..> | 2023-05-03 10:24 | 8.9K | |
![[ ]](/icons/compressed.gif) | c2-Test-Bank-for-Tod..> | 2023-05-03 09:33 | 4.5K | |
![[ ]](/icons/compressed.gif) | c5-1.zip | 2023-05-03 09:36 | 42K | |
![[ ]](/icons/compressed.gif) | c5-2.zip | 2023-05-03 09:35 | 49K | |
![[ ]](/icons/compressed.gif) | c5.zip | 2023-05-03 09:57 | 11K | |
![[ ]](/icons/compressed.gif) | c7-3.zip | 2023-05-03 09:55 | 6.2K | |
![[ ]](/icons/compressed.gif) | c14.zip | 2023-05-03 09:34 | 11K | |
![[IMG]](/icons/image2.gif) | c9780134255163-100x1..> | 2023-08-06 08:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | c9780134255163-300x3..> | 2023-10-17 07:23 | 20K | |
![[IMG]](/icons/image2.gif) | c9780134255163.jpg | 2023-05-03 10:03 | 125K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-08-10 04:13 | 15K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-05-03 10:07 | 91K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-08-05 05:17 | 3.3K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-08-24 02:13 | 15K | |
![[IMG]](/icons/image2.gif) | c_plus_plus_programm..> | 2023-05-03 10:07 | 91K | |
![[IMG]](/icons/image2.gif) | calculate-with-confi..> | 2023-08-05 06:17 | 2.8K | |
![[IMG]](/icons/image2.gif) | calculate-with-confi..> | 2023-05-03 09:31 | 15K | |
![[ ]](/icons/compressed.gif) | calculate-with-confi..> | 2023-05-03 09:31 | 6.9K | |
![[IMG]](/icons/image2.gif) | calculation-of-drug-..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | calculation-of-drug-..> | 2023-05-03 10:29 | 21K | |
![[IMG]](/icons/image2.gif) | calculus-applied-app..> | 2023-08-05 01:08 | 4.6K | |
![[IMG]](/icons/image2.gif) | calculus-applied-app..> | 2023-08-08 07:33 | 25K | |
![[IMG]](/icons/image2.gif) | calculus-applied-app..> | 2023-05-03 11:22 | 65K | |
![[ ]](/icons/compressed.gif) | calculus-applied-app..> | 2023-05-03 11:22 | 1.6M | |
![[IMG]](/icons/image2.gif) | calculus-early-trans..> | 2023-05-04 02:19 | 18K | |
![[IMG]](/icons/image2.gif) | calculus-early-trans..> | 2023-05-03 10:06 | 15K | |
![[IMG]](/icons/image2.gif) | calculus-for-busines..> | 2023-08-09 00:58 | 3.6K | |
![[IMG]](/icons/image2.gif) | calculus-for-busines..> | 2023-05-03 10:05 | 25K | |
![[ ]](/icons/compressed.gif) | calculus-for-busines..> | 2023-05-03 10:05 | 166K | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-08-06 10:15 | 4.7K | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-08-08 07:33 | 31K | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-05-03 09:22 | 114K | |
![[ ]](/icons/compressed.gif) | calculus-its-applica..> | 2023-05-03 09:21 | 2.8M | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-08-08 08:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-08-08 07:33 | 14K | |
![[IMG]](/icons/image2.gif) | calculus-its-applica..> | 2023-05-04 02:23 | 57K | |
![[ ]](/icons/compressed.gif) | calculus-its-applica..> | 2023-05-04 02:23 | 2.2M | |
![[IMG]](/icons/image2.gif) | calculus-larson-edwa..> | 2023-08-07 16:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | calculus-larson-edwa..> | 2023-05-03 09:19 | 11K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-08-08 07:33 | 16K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-05-03 09:49 | 47K | |
![[ ]](/icons/compressed.gif) | calculus-single-vari..> | 2023-05-03 09:49 | 699K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-08-05 04:37 | 3.5K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | calculus-single-vari..> | 2023-05-03 09:26 | 49K | |
![[ ]](/icons/compressed.gif) | calculus-single-vari..> | 2023-05-03 09:26 | 4.7M | |
![[IMG]](/icons/image2.gif) | campbell-biology-11t..> | 2023-08-06 07:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | campbell-biology-11t..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | campbell-biology-11t..> | 2023-05-03 10:05 | 59K | |
![[ ]](/icons/compressed.gif) | campbell-biology-11t..> | 2023-05-03 10:05 | 245K | |
![[IMG]](/icons/image2.gif) | campbell-biology-can..> | 2023-08-05 06:28 | 3.5K | |
![[IMG]](/icons/image2.gif) | campbell-biology-can..> | 2023-08-08 07:33 | 18K | |
![[IMG]](/icons/image2.gif) | campbell-biology-can..> | 2023-05-03 10:18 | 72K | |
![[ ]](/icons/compressed.gif) | campbell-biology-can..> | 2023-05-03 10:18 | 378K | |
![[IMG]](/icons/image2.gif) | campbell-biology-con..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | campbell-biology-con..> | 2023-05-03 09:42 | 22K | |
![[ ]](/icons/compressed.gif) | campbell-biology-con..> | 2023-05-03 09:42 | 167K | |
![[IMG]](/icons/image2.gif) | campbell-biology-con..> | 2023-08-06 01:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | campbell-biology-con..> | 2023-08-12 04:50 | 20K | |
![[IMG]](/icons/image2.gif) | campbell-biology-con..> | 2023-05-03 10:01 | 71K | |
![[ ]](/icons/compressed.gif) | campbell-biology-con..> | 2023-05-03 10:01 | 622K | |
![[IMG]](/icons/image2.gif) | campbell-biology-in-..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | campbell-biology-in-..> | 2023-05-03 10:28 | 23K | |
![[ ]](/icons/compressed.gif) | campbell-biology-in-..> | 2023-05-03 10:28 | 41K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-05-03 09:56 | 8.2K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-05-03 10:42 | 8.2K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-08-05 03:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-05-03 10:01 | 8.6K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-08-05 03:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | campbell-biology-ree..> | 2023-05-03 09:26 | 8.6K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-06 13:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-08 15:28 | 16K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-05-03 10:22 | 65K | |
![[ ]](/icons/compressed.gif) | campbell-essential-b..> | 2023-05-03 10:22 | 388K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-05 16:16 | 3.0K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-05-03 11:14 | 19K | |
![[ ]](/icons/compressed.gif) | campbell-essential-b..> | 2023-05-03 11:13 | 968K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-06 08:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-08 15:28 | 21K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-05-03 10:04 | 105K | |
![[ ]](/icons/compressed.gif) | campbell-essential-b..> | 2023-05-03 10:04 | 388K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-08-08 08:16 | 16K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-05-03 09:52 | 45K | |
![[ ]](/icons/compressed.gif) | campbell-essential-b..> | 2023-05-03 09:52 | 344K | |
![[IMG]](/icons/image2.gif) | campbell-essential-b..> | 2023-05-03 10:22 | 20K | |
![[IMG]](/icons/image2.gif) | canadian-business-an..> | 2023-08-05 04:35 | 1.9K | |
![[IMG]](/icons/image2.gif) | canadian-business-an..> | 2023-05-03 09:59 | 11K | |
![[ ]](/icons/compressed.gif) | canadian-business-an..> | 2023-05-03 09:59 | 19K | |
![[ ]](/icons/compressed.gif) | canadian-business-la..> | 2023-05-03 13:43 | 0 | |
![[IMG]](/icons/image2.gif) | canadian-business-so..> | 2023-08-06 07:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | canadian-business-so..> | 2023-08-12 04:50 | 26K | |
![[IMG]](/icons/image2.gif) | canadian-business-so..> | 2023-05-04 02:17 | 70K | |
![[ ]](/icons/compressed.gif) | canadian-business-so..> | 2023-05-04 02:17 | 377K | |
![[ ]](/icons/compressed.gif) | canadian-criminology..> | 2023-05-03 09:41 | 15K | |
![[IMG]](/icons/image2.gif) | canadian-human-resou..> | 2023-08-07 22:47 | 4.9K | |
![[IMG]](/icons/image2.gif) | canadian-human-resou..> | 2023-08-08 15:28 | 29K | |
![[IMG]](/icons/image2.gif) | canadian-human-resou..> | 2023-05-03 10:39 | 71K | |
![[ ]](/icons/compressed.gif) | canadian-human-resou..> | 2023-05-03 10:39 | 125K | |
![[IMG]](/icons/image2.gif) | canadian-organizatio..> | 2023-08-05 15:32 | 2.9K | |
![[IMG]](/icons/image2.gif) | canadian-organizatio..> | 2023-05-03 11:17 | 15K | |
![[ ]](/icons/compressed.gif) | canadian-organizatio..> | 2023-05-03 11:17 | 98K | |
![[IMG]](/icons/image2.gif) | canadian-organizatio..> | 2023-08-08 14:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | canadian-organizatio..> | 2023-05-03 09:22 | 15K | |
![[ ]](/icons/compressed.gif) | canadian-organizatio..> | 2023-05-03 09:22 | 112K | |
![[IMG]](/icons/image2.gif) | caproni-management_s..> | 2023-05-04 02:21 | 46K | |
![[IMG]](/icons/image2.gif) | carbaugh-internation..> | 2023-05-03 10:27 | 52K | |
![[ ]](/icons/unknown.gif) | carp_concepts_ce_tif..> | 2023-05-03 10:38 | 202K | |
![[ ]](/icons/compressed.gif) | carpenter_im_ch01.zip | 2023-05-03 10:00 | 40K | |
![[ ]](/icons/unknown.gif) | carpenter_tif_ch01.doc | 2023-05-03 10:32 | 413K | |
![[ ]](/icons/compressed.gif) | case-study-answers-f..> | 2023-05-04 02:23 | 25K | |
![[ ]](/icons/compressed.gif) | case01-Solution-Manu..> | 2023-05-04 02:21 | 45K | |
![[ ]](/icons/compressed.gif) | case1-Solution-Manua..> | 2023-05-03 10:38 | 25K | |
![[ ]](/icons/compressed.gif) | case1-Solution-manua..> | 2023-05-03 13:40 | 632K | |
![[IMG]](/icons/image2.gif) | cases-finance-3rd-ed..> | 2023-08-06 05:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | cases-finance-3rd-ed..> | 2023-08-06 13:11 | 19K | |
![[IMG]](/icons/image2.gif) | cases-finance-3rd-ed..> | 2023-05-03 10:08 | 39K | |
![[ ]](/icons/compressed.gif) | cases-finance-3rd-ed..> | 2023-05-03 10:08 | 50K | |
![[IMG]](/icons/image2.gif) | cb-babin-3rd-tb-100x..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | cb-babin-3rd-tb.jpg | 2023-05-03 11:26 | 20K | |
![[ ]](/icons/compressed.gif) | cb-babin-3rd-tb.zip | 2023-05-03 11:26 | 30K | |
![[ ]](/icons/unknown.gif) | ccd6e_testbank_ch01.doc | 2023-05-03 10:15 | 45K | |
![[IMG]](/icons/image2.gif) | cch-federal-taxation..> | 2023-08-05 04:35 | 2.1K | |
![[IMG]](/icons/image2.gif) | cch-federal-taxation..> | 2023-05-03 10:16 | 6.0K | |
![[ ]](/icons/compressed.gif) | cch-federal-taxation..> | 2023-05-03 10:33 | 100K | |
![[IMG]](/icons/image2.gif) | cch-federal-taxation..> | 2023-05-03 10:33 | 31K | |
![[IMG]](/icons/image2.gif) | cdn-ed-psychology-th..> | 2023-08-06 08:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | cdn-ed-psychology-th..> | 2023-08-06 13:11 | 13K | |
![[IMG]](/icons/image2.gif) | cdn-ed-psychology-th..> | 2023-05-03 11:14 | 151K | |
![[ ]](/icons/compressed.gif) | cdn-ed-psychology-th..> | 2023-05-03 11:14 | 270K | |
![[IMG]](/icons/image2.gif) | cdn-ed-strategic-hum..> | 2023-08-06 12:13 | 2.7K | |
![[IMG]](/icons/image2.gif) | cdn-ed-strategic-hum..> | 2023-05-03 09:21 | 19K | |
![[ ]](/icons/compressed.gif) | cdn-ed-strategic-hum..> | 2023-05-03 09:20 | 124K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-am..> | 2023-08-05 17:15 | 3.1K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-am..> | 2023-08-06 13:11 | 17K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-am..> | 2023-05-03 10:49 | 46K | |
![[ ]](/icons/compressed.gif) | cengage-advantage-am..> | 2023-05-03 10:49 | 264K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-06 13:11 | 17K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-05-03 11:15 | 44K | |
![[ ]](/icons/compressed.gif) | cengage-advantage-bo..> | 2023-05-03 11:15 | 169K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-05 16:24 | 3.8K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-06 13:11 | 23K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-05-03 11:21 | 203K | |
![[ ]](/icons/compressed.gif) | cengage-advantage-bo..> | 2023-05-03 11:21 | 118K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-05 05:31 | 3.8K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-08-06 13:11 | 18K | |
![[IMG]](/icons/image2.gif) | cengage-advantage-bo..> | 2023-05-03 09:18 | 48K | |
![[ ]](/icons/compressed.gif) | cengage-advantage-bo..> | 2023-05-03 09:18 | 61K | |
![[ ]](/icons/unknown.gif) | certo_mm12_im_01.doc | 2023-05-03 09:38 | 73K | |
![[ ]](/icons/unknown.gif) | certo_mm14_tb_01.doc | 2023-05-04 02:14 | 88K | |
![[IMG]](/icons/image2.gif) | cfin-3-besley-3rd-tb..> | 2023-08-05 14:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | cfin-3-besley-3rd-tb..> | 2023-05-03 10:03 | 23K | |
![[ ]](/icons/compressed.gif) | cfin-3-besley-3rd-tb..> | 2023-05-03 10:03 | 35K | |
![[ ]](/icons/unknown.gif) | ch-1-Test-Bank-for-C..> | 2023-05-03 10:34 | 60K | |
![[ ]](/icons/compressed.gif) | ch-1-form-A.zip | 2023-05-03 10:13 | 591K | |
![[ ]](/icons/unknown.gif) | ch01-0133073777.rtf | 2023-05-03 09:22 | 66K | |
![[ ]](/icons/unknown.gif) | ch01-4.doc | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/unknown.gif) | ch01-6.docx | 2023-05-03 10:54 | 80K | |
![[ ]](/icons/compressed.gif) | ch01-9780471739326.zip | 2023-05-03 13:44 | 1.4M | |
![[ ]](/icons/unknown.gif) | ch01-9781118742976.doc | 2023-05-04 02:06 | 115K | |
![[ ]](/icons/unknown.gif) | ch01-9781118883846.docx | 2023-05-03 11:19 | 52K | |
![[ ]](/icons/unknown.gif) | ch01-9781119369110.docx | 2023-05-03 13:40 | 53K | |
![[ ]](/icons/unknown.gif) | ch01-9781119411017.doc | 2023-05-03 13:42 | 610K | |
![[ ]](/icons/unknown.gif) | ch01-9781119497721.docx | 2023-05-04 02:19 | 61K | |
![[ ]](/icons/unknown.gif) | ch01-9781119502227.doc | 2023-05-03 13:42 | 775K | |
![[ ]](/icons/unknown.gif) | ch01-9781119561170.doc | 2023-05-04 02:07 | 90K | |
![[ ]](/icons/unknown.gif) | ch01-Accounting-Info..> | 2023-05-03 09:48 | 76K | |
![[ ]](/icons/unknown.gif) | ch01-Accounting-Prin..> | 2023-05-03 10:08 | 467K | |
![[ ]](/icons/unknown.gif) | ch01-Concepts-For-Nu..> | 2023-05-03 09:29 | 24K | |
![[ ]](/icons/unknown.gif) | ch01-Financial-Accou..> | 2023-05-03 10:08 | 246K | |
![[ ]](/icons/unknown.gif) | ch01-Financial-Accou..> | 2023-05-03 09:35 | 441K | |
![[ ]](/icons/unknown.gif) | ch01-Financial-Accou..> | 2023-05-03 09:56 | 441K | |
![[ ]](/icons/compressed.gif) | ch01-Government-and-..> | 2023-05-03 09:30 | 76K | |
![[ ]](/icons/unknown.gif) | ch01-Managerial-Acco..> | 2023-05-03 10:02 | 90K | |
![[ ]](/icons/unknown.gif) | ch01-Maternal-Newbor..> | 2023-05-03 09:19 | 93K | |
![[ ]](/icons/unknown.gif) | ch01-Pharmacology-Cl..> | 2023-05-03 09:44 | 34K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 11:19 | 52K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-04 02:13 | 18K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 11:04 | 195K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 09:07 | 101K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 09:33 | 537K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-04 02:04 | 396K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 13:44 | 60K | |
![[ ]](/icons/layout.gif) | ch01-Solution-Manual..> | 2023-05-04 01:59 | 111K | |
![[ ]](/icons/layout.gif) | ch01-Solution-Manual..> | 2023-05-03 13:44 | 370K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-Manual..> | 2023-05-03 14:08 | 31K | |
![[ ]](/icons/layout.gif) | ch01-Solution-manual..> | 2023-05-04 01:56 | 82K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-manual..> | 2023-05-03 09:21 | 48K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-manual..> | 2023-05-03 10:18 | 141K | |
![[ ]](/icons/layout.gif) | ch01-Solution-manual..> | 2023-05-03 10:46 | 74K | |
![[ ]](/icons/layout.gif) | ch01-Solution-manual..> | 2023-05-03 11:07 | 18K | |
![[ ]](/icons/unknown.gif) | ch01-Solution-manual..> | 2023-05-04 02:21 | 44K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-Essen..> | 2023-05-03 09:52 | 38K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-A..> | 2023-05-03 09:20 | 48K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-B..> | 2023-05-03 13:41 | 113K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-C..> | 2023-05-03 13:43 | 96K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-E..> | 2023-05-03 10:29 | 50K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-F..> | 2023-05-03 11:14 | 95K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-I..> | 2023-05-03 09:23 | 255K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-For-P..> | 2023-05-03 09:33 | 86K | |
![[ ]](/icons/layout.gif) | ch01-Test-Bank-For-P..> | 2023-05-03 10:40 | 190K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-Intro..> | 2023-05-03 09:52 | 20K | |
![[ ]](/icons/layout.gif) | ch01-Test-Bank-for-A..> | 2023-05-03 10:48 | 157K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-A..> | 2023-05-04 02:04 | 45K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-B..> | 2023-05-03 11:24 | 103K | |
![[ ]](/icons/layout.gif) | ch01-Test-Bank-for-B..> | 2023-05-03 10:11 | 145K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-C..> | 2023-05-03 10:31 | 46K | |
![[ ]](/icons/compressed.gif) | ch01-Test-Bank-for-D..> | 2023-05-04 02:09 | 19K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-E..> | 2023-05-03 10:16 | 30K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-E..> | 2023-05-03 09:18 | 177K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-F..> | 2023-05-03 13:41 | 69K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-H..> | 2023-05-03 13:41 | 52K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-H..> | 2023-05-03 13:41 | 21K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-I..> | 2023-05-03 10:49 | 59K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-I..> | 2023-05-04 02:07 | 44K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-M..> | 2023-05-04 01:53 | 503K | |
![[ ]](/icons/compressed.gif) | ch01-Test-Bank-for-M..> | 2023-05-03 10:39 | 30K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-N..> | 2023-05-03 13:43 | 211K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-O..> | 2023-05-03 09:30 | 179K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-P..> | 2023-05-03 09:21 | 36K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-R..> | 2023-05-03 09:38 | 77K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-S..> | 2023-05-03 10:16 | 53K | |
![[ ]](/icons/unknown.gif) | ch01-Test-Bank-for-T..> | 2023-05-03 10:40 | 59K | |
![[ ]](/icons/unknown.gif) | ch01-Test-bank-for-F..> | 2023-05-03 11:00 | 677K | |
![[ ]](/icons/compressed.gif) | ch01.zip | 2023-05-03 10:43 | 135K | |
![[ ]](/icons/unknown.gif) | ch01_Beams12e_SM.doc | 2023-05-03 09:53 | 189K | |
![[ ]](/icons/unknown.gif) | ch01_drake-Test-Bank..> | 2023-05-03 13:43 | 21K | |
![[ ]](/icons/unknown.gif) | ch01_hill15_testbank..> | 2023-05-03 11:16 | 136K | |
![[ ]](/icons/compressed.gif) | ch01_keat6e.zip | 2023-05-03 11:26 | 8.5K | |
![[ ]](/icons/unknown.gif) | ch01_sm_10e.docx | 2023-05-03 10:17 | 204K | |
![[ ]](/icons/unknown.gif) | ch01_tb_carlon_6e.doc | 2023-05-04 02:27 | 185K | |
![[ ]](/icons/layout.gif) | ch02-Accounting-Prin..> | 2023-05-03 11:19 | 302K | |
![[ ]](/icons/unknown.gif) | ch02-Physics-Cutnell..> | 2023-05-03 10:30 | 318K | |
![[ ]](/icons/unknown.gif) | ch02-Principles-Of-F..> | 2023-05-03 09:18 | 27K | |
![[ ]](/icons/unknown.gif) | ch02-Solution-Manual..> | 2023-05-04 02:21 | 553K | |
![[ ]](/icons/compressed.gif) | ch02-Solution-Manual..> | 2023-05-04 02:03 | 2.0K | |
![[ ]](/icons/unknown.gif) | ch02-Test-Bank-for-H..> | 2023-05-03 10:58 | 120K | |
![[ ]](/icons/compressed.gif) | ch06.zip | 2023-05-03 09:54 | 202K | |
![[ ]](/icons/unknown.gif) | ch1-Accounting-for-G..> | 2023-05-03 10:24 | 98K | |
![[ ]](/icons/unknown.gif) | ch1-Auditing-A-Risk-..> | 2023-05-03 09:11 | 136K | |
![[ ]](/icons/unknown.gif) | ch1-Operations-Manag..> | 2023-05-03 10:55 | 165K | |
![[ ]](/icons/compressed.gif) | ch1-TB.zip | 2023-05-03 10:02 | 24K | |
![[ ]](/icons/layout.gif) | ch1-Test-Bank-for-Mo..> | 2023-05-03 09:19 | 849K | |
![[ ]](/icons/unknown.gif) | ch1.doc | 2023-05-04 02:15 | 164K | |
![[ ]](/icons/compressed.gif) | ch1.zip | 2023-05-03 10:11 | 16K | |
![[ ]](/icons/unknown.gif) | ch1_Evans_BA1e.xlsx | 2023-05-03 09:27 | 38K | |
![[ ]](/icons/layout.gif) | ch2-Solution-Manual-..> | 2023-05-03 11:02 | 249K | |
![[ ]](/icons/unknown.gif) | ch3-Solution-Manual-..> | 2023-05-03 09:25 | 314K | |
![[ ]](/icons/unknown.gif) | ch12-Solution-Manual..> | 2023-05-03 09:07 | 50K | |
![[ ]](/icons/compressed.gif) | ch16.zip | 2023-05-03 09:56 | 36K | |
![[ ]](/icons/compressed.gif) | ch30.zip | 2023-05-03 09:46 | 8.5K | |
![[ ]](/icons/compressed.gif) | ch_02_test_bank_fap1..> | 2023-05-03 09:44 | 24K | |
![[ ]](/icons/compressed.gif) | ch_03_test_bank_bbm1..> | 2023-05-03 09:33 | 17K | |
![[ ]](/icons/layout.gif) | chap-1-11pt-Solution..> | 2023-05-04 02:11 | 560K | |
![[ ]](/icons/unknown.gif) | chap001-Managerial-A..> | 2023-05-03 10:11 | 90K | |
![[ ]](/icons/unknown.gif) | chap001-Solutions-ma..> | 2023-05-03 13:44 | 87K | |
![[ ]](/icons/layout.gif) | chap01-EOS-9e.pdf | 2023-05-03 11:12 | 1.3M | |
![[ ]](/icons/compressed.gif) | chapt_1-Solution-Man..> | 2023-05-03 10:43 | 3.0M | |
![[ ]](/icons/unknown.gif) | chapter-01-Test-Bank..> | 2023-05-03 11:25 | 61K | |
![[ ]](/icons/unknown.gif) | chapter-01-Test-Bank..> | 2023-05-03 11:07 | 645K | |
![[ ]](/icons/unknown.gif) | chapter-01-Test-Bank..> | 2023-05-03 10:31 | 143K | |
![[ ]](/icons/unknown.gif) | chapter-01-Test-Bank..> | 2023-05-03 13:43 | 90K | |
![[ ]](/icons/compressed.gif) | chapter-01-Test-Bank..> | 2023-05-03 10:37 | 13K | |
![[ ]](/icons/unknown.gif) | chapter-012777.doc | 2023-05-04 02:17 | 41K | |
![[ ]](/icons/unknown.gif) | chapter-1-013325092X..> | 2023-05-03 10:27 | 66K | |
![[ ]](/icons/unknown.gif) | chapter-1-0133545172..> | 2023-05-03 10:01 | 171K | |
![[ ]](/icons/unknown.gif) | chapter-1-0133763536..> | 2023-05-03 09:26 | 119K | |
![[ ]](/icons/layout.gif) | chapter-1-1.pdf | 2023-05-04 02:13 | 0 | |
![[ ]](/icons/unknown.gif) | chapter-1-9.doc | 2023-05-03 10:56 | 65K | |
![[ ]](/icons/unknown.gif) | chapter-1-9780134709..> | 2023-05-03 13:42 | 39K | |
![[ ]](/icons/unknown.gif) | chapter-1-9780135199..> | 2023-05-04 02:02 | 85K | |
![[ ]](/icons/unknown.gif) | chapter-1-9780321811..> | 2023-05-03 10:14 | 377K | |
![[ ]](/icons/unknown.gif) | chapter-1-9780321926..> | 2023-05-03 13:42 | 93K | |
![[ ]](/icons/unknown.gif) | chapter-1-9780321971..> | 2023-05-04 01:56 | 1.0M | |
![[ ]](/icons/unknown.gif) | chapter-1-Accounting..> | 2023-05-03 10:09 | 92K | |
![[ ]](/icons/unknown.gif) | chapter-1-Anatomy-an..> | 2023-05-03 09:38 | 195K | |
![[ ]](/icons/unknown.gif) | chapter-1-Biochemist..> | 2023-05-03 09:28 | 27K | |
![[ ]](/icons/unknown.gif) | chapter-1-Chemistry-..> | 2023-05-03 09:22 | 239K | |
![[ ]](/icons/unknown.gif) | chapter-1-Corporate-..> | 2023-05-03 10:35 | 54K | |
![[ ]](/icons/unknown.gif) | chapter-1-Discussion..> | 2023-05-04 02:04 | 1.6M | |
![[ ]](/icons/unknown.gif) | chapter-1-Financial-..> | 2023-05-03 11:06 | 50K | |
![[ ]](/icons/unknown.gif) | chapter-1-Fundamenta..> | 2023-05-03 11:09 | 31K | |
![[ ]](/icons/unknown.gif) | chapter-1-Fundamenta..> | 2023-05-03 11:05 | 31K | |
![[ ]](/icons/unknown.gif) | chapter-1-Introducto..> | 2023-05-03 09:18 | 40K | |
![[ ]](/icons/unknown.gif) | chapter-1-Management..> | 2023-05-03 09:57 | 72K | |
![[ ]](/icons/unknown.gif) | chapter-1-Management..> | 2023-05-03 10:37 | 88K | |
![[ ]](/icons/unknown.gif) | chapter-1-Managerial..> | 2023-05-03 10:34 | 786K | |
![[ ]](/icons/unknown.gif) | chapter-1-Microbiolo..> | 2023-05-03 10:45 | 55K | |
![[ ]](/icons/unknown.gif) | chapter-1-Microecono..> | 2023-05-03 10:07 | 145K | |
![[ ]](/icons/unknown.gif) | chapter-1-PEC2_Quest..> | 2023-05-03 13:43 | 14K | |
![[ ]](/icons/unknown.gif) | chapter-1-Principles..> | 2023-05-03 09:29 | 227K | |
![[ ]](/icons/layout.gif) | chapter-1-Psychology..> | 2023-05-03 09:44 | 915K | |
![[ ]](/icons/layout.gif) | chapter-1-Solution-M..> | 2023-05-03 11:25 | 280K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 13:42 | 175K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 10:20 | 97K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 01:52 | 18K | |
![[ ]](/icons/layout.gif) | chapter-1-Test-Bank-..> | 2023-05-03 10:21 | 1.2M | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:02 | 67K | |
![[ ]](/icons/layout.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:21 | 264K | |
![[ ]](/icons/layout.gif) | chapter-1-Test-Bank-..> | 2023-05-04 01:51 | 149K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 11:07 | 77K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:24 | 495K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 11:00 | 76K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:11 | 66K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 10:04 | 85K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:05 | 112K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 10:55 | 57K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-04 02:25 | 65K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 10:02 | 364K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-Bank-..> | 2023-05-03 11:02 | 110K | |
![[ ]](/icons/layout.gif) | chapter-1-Test-Bank-..> | 2023-05-03 11:11 | 524K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-03 10:20 | 126K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-03 09:26 | 85K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-03 09:21 | 64K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-03 10:15 | 964K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-04 02:10 | 86K | |
![[ ]](/icons/unknown.gif) | chapter-1-Test-bank-..> | 2023-05-03 09:46 | 110K | |
![[ ]](/icons/unknown.gif) | chapter-1-Understand..> | 2023-05-03 10:26 | 82K | |
![[ ]](/icons/unknown.gif) | chapter-1_version1-9..> | 2023-05-03 11:17 | 23K | |
![[ ]](/icons/unknown.gif) | chapter-1_version1-9..> | 2023-05-03 11:14 | 106K | |
![[ ]](/icons/unknown.gif) | chapter-1_version1-T..> | 2023-05-03 11:10 | 38K | |
![[ ]](/icons/unknown.gif) | chapter-1v2-Manageme..> | 2023-05-03 09:25 | 99K | |
![[ ]](/icons/unknown.gif) | chapter-2-Test-Bank-..> | 2023-05-03 11:13 | 417K | |
![[ ]](/icons/compressed.gif) | chapter-4.zip | 2023-05-03 10:10 | 59K | |
![[ ]](/icons/layout.gif) | chapter-15-978013489..> | 2023-05-03 10:57 | 760K | |
![[ ]](/icons/compressed.gif) | chapter-15.zip | 2023-05-03 09:46 | 20K | |
![[ ]](/icons/compressed.gif) | chapter-141.zip | 2023-05-03 10:36 | 19K | |
![[ ]](/icons/unknown.gif) | chapter01-General-Ch..> | 2023-05-03 09:50 | 154K | |
![[ ]](/icons/compressed.gif) | chapter01-Solution-M..> | 2023-05-03 10:03 | 284K | |
![[ ]](/icons/compressed.gif) | chapter 01.zip | 2023-05-03 10:33 | 20K | |
![[ ]](/icons/compressed.gif) | chapter01.zip | 2023-05-03 10:20 | 260K | |
![[ ]](/icons/unknown.gif) | chapter1-Physics-Wal..> | 2023-05-03 11:02 | 131K | |
![[ ]](/icons/compressed.gif) | chapter1-Solution-Ma..> | 2023-05-03 09:22 | 3.4K | |
![[ ]](/icons/unknown.gif) | chapter1-Test-Bank-F..> | 2023-05-03 10:34 | 131K | |
![[ ]](/icons/compressed.gif) | chapter 1.zip | 2023-05-04 02:01 | 26K | |
![[ ]](/icons/compressed.gif) | chapter1.zip | 2023-05-04 02:12 | 16K | |
![[ ]](/icons/compressed.gif) | chapter_01-978013460..> | 2023-05-04 02:08 | 43K | |
![[ ]](/icons/layout.gif) | chapter_01_new_world..> | 2023-05-04 02:15 | 155K | |
![[ ]](/icons/compressed.gif) | chapter_01_solution.zip | 2023-05-03 13:42 | 47K | |
![[ ]](/icons/unknown.gif) | chapter_02_013400401..> | 2023-05-03 13:42 | 73K | |
![[ ]](/icons/layout.gif) | chapter_1-9780321908..> | 2023-05-03 11:14 | 24K | |
![[ ]](/icons/unknown.gif) | chapter_1-Test-Bank-..> | 2023-05-03 13:44 | 34K | |
![[ ]](/icons/unknown.gif) | chapter_1-Test-Bank-..> | 2023-05-03 13:44 | 24K | |
![[ ]](/icons/unknown.gif) | chapter_1-Test-Bank-..> | 2023-05-03 13:42 | 14K | |
![[ ]](/icons/unknown.gif) | chapter_1-Test-bank-..> | 2023-05-03 09:46 | 104K | |
![[ ]](/icons/compressed.gif) | chapter_1.zip | 2023-05-03 10:15 | 20K | |
![[ ]](/icons/unknown.gif) | chapter_2-9781337612..> | 2023-05-04 02:09 | 66K | |
![[ ]](/icons/unknown.gif) | cheeseman_leb8e_im_0..> | 2023-05-04 02:00 | 88K | |
![[ ]](/icons/unknown.gif) | cheeseman_leb9e_im_0..> | 2023-05-03 13:42 | 87K | |
![[IMG]](/icons/image2.gif) | chemical-dependency-..> | 2023-08-05 01:15 | 4.7K | |
![[IMG]](/icons/image2.gif) | chemical-dependency-..> | 2023-08-06 13:11 | 29K | |
![[IMG]](/icons/image2.gif) | chemical-dependency-..> | 2023-05-03 09:38 | 48K | |
![[ ]](/icons/compressed.gif) | chemical-dependency-..> | 2023-05-03 09:38 | 156K | |
![[IMG]](/icons/image2.gif) | chemistry-4th-editio..> | 2023-08-08 16:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | chemistry-4th-editio..> | 2023-08-06 13:11 | 19K | |
![[IMG]](/icons/image2.gif) | chemistry-4th-editio..> | 2023-05-04 02:19 | 57K | |
![[ ]](/icons/compressed.gif) | chemistry-4th-editio..> | 2023-05-04 02:19 | 358K | |
![[ ]](/icons/compressed.gif) | chemistry-12th-editi..> | 2023-05-03 13:41 | 234K | |
![[IMG]](/icons/image2.gif) | chemistry-a-molecula..> | 2023-05-03 11:26 | 16K | |
![[ ]](/icons/compressed.gif) | chemistry-a-molecula..> | 2023-05-03 11:26 | 170K | |
![[IMG]](/icons/image2.gif) | chemistry-a-molecula..> | 2023-08-06 11:13 | 3.6K | |
![[IMG]](/icons/image2.gif) | chemistry-a-molecula..> | 2023-05-03 09:22 | 13K | |
![[IMG]](/icons/image2.gif) | chemistry-an-introdu..> | 2023-08-06 08:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | chemistry-an-introdu..> | 2023-05-03 10:38 | 18K | |
![[ ]](/icons/compressed.gif) | chemistry-an-introdu..> | 2023-05-03 10:38 | 23K | |
![[IMG]](/icons/image2.gif) | chemistry-and-chemic..> | 2023-08-08 16:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | chemistry-and-chemic..> | 2023-05-03 09:34 | 24K | |
![[ ]](/icons/compressed.gif) | chemistry-and-chemic..> | 2023-05-03 09:33 | 8.8K | |
![[IMG]](/icons/image2.gif) | chemistry-atoms-firs..> | 2023-08-05 15:29 | 3.4K | |
![[IMG]](/icons/image2.gif) | chemistry-atoms-firs..> | 2023-08-06 13:11 | 19K | |
![[IMG]](/icons/image2.gif) | chemistry-atoms-firs..> | 2023-05-03 11:09 | 52K | |
![[ ]](/icons/compressed.gif) | chemistry-atoms-firs..> | 2023-05-03 11:09 | 151K | |
![[IMG]](/icons/image2.gif) | chemistry-atoms-firs..> | 2023-08-09 01:57 | 3.7K | |
![[IMG]](/icons/image2.gif) | chemistry-atoms-firs..> | 2023-05-03 10:21 | 21K | |
![[ ]](/icons/compressed.gif) | chemistry-atoms-firs..> | 2023-05-03 10:21 | 78K | |
![[IMG]](/icons/image2.gif) | chemistry-central-sc..> | 2023-08-05 16:23 | 4.6K | |
![[IMG]](/icons/image2.gif) | chemistry-central-sc..> | 2023-08-08 22:06 | 22K | |
![[IMG]](/icons/image2.gif) | chemistry-central-sc..> | 2023-05-03 09:52 | 84K | |
![[ ]](/icons/compressed.gif) | chemistry-central-sc..> | 2023-05-03 09:52 | 542K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-10th..> | 2023-08-06 11:05 | 3.4K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-10th..> | 2023-05-03 09:50 | 11K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-10th..> | 2023-08-05 16:26 | 3.5K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-10th..> | 2023-05-04 01:52 | 21K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-gold..> | 2023-08-05 10:49 | 3.4K | |
![[IMG]](/icons/image2.gif) | chemistry-chang-gold..> | 2023-05-03 11:09 | 11K | |
![[ ]](/icons/compressed.gif) | chemistry-changing-t..> | 2023-05-03 09:52 | 20K | |
![[IMG]](/icons/image2.gif) | chemistry-for-changi..> | 2023-08-05 16:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | chemistry-for-changi..> | 2023-05-03 09:54 | 18K | |
![[ ]](/icons/compressed.gif) | chemistry-for-changi..> | 2023-05-03 09:54 | 22K | |
![[IMG]](/icons/image2.gif) | chemistry-in-context..> | 2023-08-05 14:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | chemistry-in-context..> | 2023-05-03 10:17 | 30K | |
![[ ]](/icons/compressed.gif) | chemistry-in-context..> | 2023-05-03 10:17 | 232K | |
![[ ]](/icons/compressed.gif) | chemistry-mcmurry-6t..> | 2023-05-03 09:24 | 826K | |
![[IMG]](/icons/image2.gif) | chemistry-mcmurry-fa..> | 2023-08-05 15:35 | 4.2K | |
![[IMG]](/icons/image2.gif) | chemistry-mcmurry-fa..> | 2023-05-03 09:24 | 17K | |
![[ ]](/icons/compressed.gif) | chemistry-raymond-ch..> | 2023-05-04 01:52 | 42K | |
![[ ]](/icons/compressed.gif) | chemistry-raymond-ch..> | 2023-05-03 11:09 | 24K | |
![[IMG]](/icons/image2.gif) | chemistry-the-centra..> | 2023-08-05 15:33 | 1.4K | |
![[IMG]](/icons/image2.gif) | chemistry-the-centra..> | 2023-05-03 10:41 | 7.3K | |
![[ ]](/icons/compressed.gif) | chemistry-the-centra..> | 2023-05-03 10:41 | 130K | |
![[IMG]](/icons/image2.gif) | chemistry-the-centra..> | 2023-05-03 10:20 | 3.4K | |
![[IMG]](/icons/image2.gif) | chemistry-the-centra..> | 2023-05-03 10:08 | 12K | |
![[ ]](/icons/compressed.gif) | chemistry-the-centra..> | 2023-05-03 10:08 | 128K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-08-05 01:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-05-03 11:06 | 11K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-08-06 07:47 | 3.3K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-05-03 09:44 | 11K | |
![[ ]](/icons/compressed.gif) | chemistry-the-molecu..> | 2023-05-03 10:42 | 34K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-08-06 09:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | chemistry-the-molecu..> | 2023-05-03 10:42 | 10K | |
![[IMG]](/icons/image2.gif) | chemistry-today-gene..> | 2023-08-08 07:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | chemistry-today-gene..> | 2023-08-12 04:50 | 15K | |
![[IMG]](/icons/image2.gif) | chemistry-today-gene..> | 2023-05-03 10:53 | 39K | |
![[ ]](/icons/compressed.gif) | chemistry-today-gene..> | 2023-05-03 10:53 | 823K | |
![[IMG]](/icons/image2.gif) | child-and-adolescent..> | 2023-08-06 10:16 | 3.1K | |
![[IMG]](/icons/image2.gif) | child-and-adolescent..> | 2023-05-03 10:29 | 17K | |
![[ ]](/icons/compressed.gif) | child-and-adolescent..> | 2023-05-03 10:29 | 25K | |
![[IMG]](/icons/image2.gif) | child-development-9t..> | 2023-08-06 13:07 | 4.2K | |
![[IMG]](/icons/image2.gif) | child-development-9t..> | 2023-08-08 07:33 | 24K | |
![[IMG]](/icons/image2.gif) | child-development-9t..> | 2023-05-03 10:11 | 61K | |
![[ ]](/icons/compressed.gif) | child-development-9t..> | 2023-05-03 10:11 | 123K | |
![[ ]](/icons/compressed.gif) | child-development-an..> | 2023-05-03 10:43 | 493K | |
![[IMG]](/icons/image2.gif) | child-development-be..> | 2023-08-06 05:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | child-development-be..> | 2023-05-03 10:46 | 26K | |
![[ ]](/icons/compressed.gif) | child-development-be..> | 2023-05-03 10:46 | 38K | |
![[IMG]](/icons/image2.gif) | child-development-fe..> | 2023-08-05 02:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | child-development-fe..> | 2023-05-03 10:41 | 21K | |
![[ ]](/icons/compressed.gif) | child-development-fe..> | 2023-05-03 10:41 | 716K | |
![[IMG]](/icons/image2.gif) | child-health-nursing..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | child-health-nursing..> | 2023-05-03 09:49 | 31K | |
![[ ]](/icons/compressed.gif) | child-health-nursing..> | 2023-05-03 09:49 | 20K | |
![[IMG]](/icons/image2.gif) | child-maltreatment-a..> | 2023-08-07 17:58 | 14K | |
![[IMG]](/icons/image2.gif) | child-maltreatment-a..> | 2023-05-03 09:23 | 35K | |
![[IMG]](/icons/image2.gif) | child-psychology-a-c..> | 2023-08-05 06:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | child-psychology-a-c..> | 2023-05-03 10:33 | 19K | |
![[IMG]](/icons/image2.gif) | childhood-and-adoles..> | 2023-08-05 04:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | childhood-and-adoles..> | 2023-05-03 09:23 | 28K | |
![[ ]](/icons/compressed.gif) | childhood-and-adoles..> | 2023-05-03 09:23 | 46K | |
![[IMG]](/icons/image2.gif) | children-13th-editio..> | 2023-08-05 03:40 | 2.3K | |
![[IMG]](/icons/image2.gif) | children-13th-editio..> | 2023-08-08 07:33 | 13K | |
![[IMG]](/icons/image2.gif) | children-13th-editio..> | 2023-05-03 09:32 | 21K | |
![[ ]](/icons/compressed.gif) | children-13th-editio..> | 2023-05-03 09:32 | 202K | |
![[IMG]](/icons/image2.gif) | choices-and-connecti..> | 2023-08-06 08:44 | 4.6K | |
![[IMG]](/icons/image2.gif) | choices-and-connecti..> | 2023-08-08 07:33 | 27K | |
![[IMG]](/icons/image2.gif) | choices-and-connecti..> | 2023-05-03 10:18 | 43K | |
![[ ]](/icons/compressed.gif) | choices-and-connecti..> | 2023-05-03 10:18 | 364K | |
![[IMG]](/icons/image2.gif) | choosing-health-lync..> | 2023-08-08 21:04 | 3.4K | |
![[IMG]](/icons/image2.gif) | choosing-health-lync..> | 2023-05-03 09:49 | 22K | |
![[ ]](/icons/compressed.gif) | choosing-health-lync..> | 2023-05-03 09:49 | 18K | |
![[ ]](/icons/unknown.gif) | chp-1-Test-Bank-for-..> | 2023-05-04 02:07 | 75K | |
![[IMG]](/icons/image2.gif) | churchill-ford-walke..> | 2023-08-05 14:38 | 2.3K | |
![[IMG]](/icons/image2.gif) | churchill-ford-walke..> | 2023-05-03 11:04 | 17K | |
![[ ]](/icons/compressed.gif) | churchill-ford-walke..> | 2023-05-03 11:04 | 18K | |
![[IMG]](/icons/image2.gif) | cj2-gaines-2nd-tb-10..> | 2023-08-05 15:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | cj2-gaines-2nd-tb.jpg | 2023-05-03 10:44 | 29K | |
![[ ]](/icons/compressed.gif) | cj2-gaines-2nd-tb.zip | 2023-05-03 10:44 | 18K | |
![[ ]](/icons/unknown.gif) | clawson_leadership5_..> | 2023-05-03 10:51 | 200K | |
![[IMG]](/icons/image2.gif) | clinical-application..> | 2023-08-05 14:00 | 2.6K | |
![[IMG]](/icons/image2.gif) | clinical-application..> | 2023-05-03 09:28 | 17K | |
![[ ]](/icons/compressed.gif) | clinical-application..> | 2023-05-03 09:28 | 8.6K | |
![[IMG]](/icons/image2.gif) | clinical-assessment-..> | 2023-08-05 16:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | clinical-assessment-..> | 2023-05-03 10:51 | 16K | |
![[IMG]](/icons/image2.gif) | clinical-chemistry-k..> | 2023-08-06 11:17 | 3.4K | |
![[IMG]](/icons/image2.gif) | clinical-chemistry-k..> | 2023-05-03 09:58 | 21K | |
![[ ]](/icons/compressed.gif) | clinical-chemistry-k..> | 2023-05-03 09:58 | 14K | |
![[IMG]](/icons/image2.gif) | clinical-drug-therap..> | 2023-08-06 08:34 | 15K | |
![[IMG]](/icons/image2.gif) | clinical-drug-therap..> | 2023-05-03 10:39 | 40K | |
![[IMG]](/icons/image2.gif) | clinical-hematology-..> | 2023-08-08 08:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | clinical-hematology-..> | 2023-05-03 09:27 | 18K | |
![[ ]](/icons/compressed.gif) | clinical-hematology-..> | 2023-05-03 09:27 | 8.6K | |
![[ ]](/icons/compressed.gif) | clinical-immunology-..> | 2023-05-03 09:11 | 15K | |
![[IMG]](/icons/image2.gif) | clinical-laboratory-..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | clinical-laboratory-..> | 2023-05-03 09:18 | 15K | |
![[ ]](/icons/compressed.gif) | clinical-laboratory-..> | 2023-05-03 09:18 | 17K | |
![[IMG]](/icons/image2.gif) | clinical-laboratory-..> | 2023-08-05 16:26 | 3.7K | |
![[IMG]](/icons/image2.gif) | clinical-laboratory-..> | 2023-05-03 11:25 | 23K | |
![[ ]](/icons/compressed.gif) | clinical-laboratory-..> | 2023-05-03 11:25 | 41K | |
![[IMG]](/icons/image2.gif) | clinical-manifestati..> | 2023-08-06 05:44 | 2.9K | |
![[IMG]](/icons/image2.gif) | clinical-manifestati..> | 2023-05-03 11:08 | 19K | |
![[ ]](/icons/compressed.gif) | clinical-manifestati..> | 2023-05-03 11:08 | 8.1K | |
![[IMG]](/icons/image2.gif) | clinical-manifestati..> | 2023-08-05 05:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | clinical-manifestati..> | 2023-05-03 10:09 | 20K | |
![[ ]](/icons/compressed.gif) | clinical-manifestati..> | 2023-05-03 10:09 | 9.9K | |
![[IMG]](/icons/image2.gif) | clinical-medical-ass..> | 2023-08-05 16:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | clinical-medical-ass..> | 2023-08-08 07:33 | 22K | |
![[IMG]](/icons/image2.gif) | clinical-medical-ass..> | 2023-05-04 02:10 | 54K | |
![[ ]](/icons/compressed.gif) | clinical-medical-ass..> | 2023-05-04 02:10 | 346K | |
![[IMG]](/icons/image2.gif) | clinical-nursing-ski..> | 2023-08-06 04:20 | 3.2K | |
![[IMG]](/icons/image2.gif) | clinical-nursing-ski..> | 2023-05-03 09:23 | 20K | |
![[ ]](/icons/compressed.gif) | clinical-nursing-ski..> | 2023-05-03 09:23 | 14K | |
![[IMG]](/icons/image2.gif) | clinical-nursing-ski..> | 2023-08-05 01:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | clinical-nursing-ski..> | 2023-05-03 10:11 | 18K | |
![[ ]](/icons/compressed.gif) | clinical-nursing-ski..> | 2023-05-03 10:11 | 13K | |
![[ ]](/icons/compressed.gif) | clinical-nursing-ski..> | 2023-05-03 09:07 | 53K | |
![[IMG]](/icons/image2.gif) | clinical-psychology-..> | 2023-08-06 14:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | clinical-psychology-..> | 2023-05-03 09:52 | 14K | |
![[ ]](/icons/compressed.gif) | clinical-psychology-..> | 2023-05-03 09:52 | 28K | |
![[IMG]](/icons/image2.gif) | close-relations-an-i..> | 2023-08-05 16:28 | 2.5K | |
![[IMG]](/icons/image2.gif) | close-relations-an-i..> | 2023-05-03 09:54 | 14K | |
![[ ]](/icons/compressed.gif) | close-relations-an-i..> | 2023-05-03 09:54 | 18K | |
![[IMG]](/icons/image2.gif) | cognition-matlin-7th..> | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | cognition-matlin-7th..> | 2023-05-03 09:30 | 22K | |
![[ ]](/icons/compressed.gif) | cognition-matlin-7th..> | 2023-05-03 09:30 | 19K | |
![[IMG]](/icons/image2.gif) | cognition-theories-a..> | 2023-08-05 04:35 | 2.4K | |
![[IMG]](/icons/image2.gif) | cognition-theories-a..> | 2023-05-03 11:19 | 17K | |
![[ ]](/icons/compressed.gif) | cognition-theories-a..> | 2023-05-03 11:19 | 15K | |
![[IMG]](/icons/image2.gif) | cognition-theory-and..> | 2023-08-06 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | cognition-theory-and..> | 2023-05-03 09:26 | 16K | |
![[ ]](/icons/compressed.gif) | cognition-theory-and..> | 2023-05-03 09:26 | 179K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-05-03 11:15 | 23K | |
![[ ]](/icons/compressed.gif) | cognitive-psychology..> | 2023-05-03 11:15 | 28K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-08-05 05:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-05-03 10:19 | 18K | |
![[ ]](/icons/compressed.gif) | cognitive-psychology..> | 2023-05-03 10:19 | 18K | |
![[ ]](/icons/compressed.gif) | cognitive-psychology..> | 2023-05-03 11:04 | 18K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-08-05 07:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-05-03 09:40 | 23K | |
![[ ]](/icons/compressed.gif) | cognitive-psychology..> | 2023-05-03 09:40 | 307K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-08-06 08:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | cognitive-psychology..> | 2023-05-03 10:01 | 26K | |
![[ ]](/icons/compressed.gif) | cognitive-psychology..> | 2023-05-03 10:01 | 50K | |
![[IMG]](/icons/image2.gif) | college-accounting-1..> | 2023-08-06 03:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | college-accounting-1..> | 2023-08-08 07:33 | 13K | |
![[IMG]](/icons/image2.gif) | college-accounting-1..> | 2023-05-03 11:13 | 31K | |
![[ ]](/icons/compressed.gif) | college-accounting-1..> | 2023-05-03 11:13 | 873K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-05 06:24 | 2.8K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-05 14:40 | 16K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-05-04 02:25 | 38K | |
![[ ]](/icons/compressed.gif) | college-accounting-c..> | 2023-05-04 02:24 | 1.1M | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-05 02:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-05 14:40 | 15K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-05-04 02:11 | 34K | |
![[ ]](/icons/compressed.gif) | college-accounting-c..> | 2023-05-04 02:11 | 204K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-06 09:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-08-05 14:40 | 15K | |
![[IMG]](/icons/image2.gif) | college-accounting-c..> | 2023-05-03 09:44 | 39K | |
![[ ]](/icons/compressed.gif) | college-accounting-c..> | 2023-05-03 09:43 | 1.0M | |
![[IMG]](/icons/image2.gif) | college-accounting-s..> | 2023-05-03 10:18 | 9.6K | |
![[IMG]](/icons/image2.gif) | college-algebra-7th-..> | 2023-08-05 06:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | college-algebra-7th-..> | 2023-08-05 14:40 | 14K | |
![[IMG]](/icons/image2.gif) | college-algebra-7th-..> | 2023-05-03 09:27 | 44K | |
![[ ]](/icons/compressed.gif) | college-algebra-7th-..> | 2023-05-03 09:27 | 11M | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-08-05 16:27 | 3.6K | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-08-05 14:40 | 19K | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-05-03 11:18 | 47K | |
![[ ]](/icons/compressed.gif) | college-algebra-10th..> | 2023-05-03 11:18 | 8.9M | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-08-08 15:42 | 1.7K | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-08-05 14:40 | 6.9K | |
![[IMG]](/icons/image2.gif) | college-algebra-10th..> | 2023-05-03 10:49 | 29K | |
![[ ]](/icons/compressed.gif) | college-algebra-10th..> | 2023-05-03 10:49 | 1.0M | |
![[IMG]](/icons/image2.gif) | college-algebra-12th..> | 2023-08-05 15:33 | 4.6K | |
![[IMG]](/icons/image2.gif) | college-algebra-12th..> | 2023-08-05 14:40 | 32K | |
![[IMG]](/icons/image2.gif) | college-algebra-12th..> | 2023-05-04 02:13 | 129K | |
![[ ]](/icons/compressed.gif) | college-algebra-12th..> | 2023-05-04 02:13 | 4.1M | |
![[IMG]](/icons/image2.gif) | college-algebra-blit..> | 2023-08-05 01:56 | 1.2K | |
![[IMG]](/icons/image2.gif) | college-algebra-blit..> | 2023-05-03 10:47 | 3.0K | |
![[IMG]](/icons/image2.gif) | college-algebra-cont..> | 2023-08-06 03:44 | 5.3K | |
![[IMG]](/icons/image2.gif) | college-algebra-cont..> | 2023-08-05 14:40 | 33K | |
![[IMG]](/icons/image2.gif) | college-algebra-cont..> | 2023-05-03 10:22 | 139K | |
![[ ]](/icons/compressed.gif) | college-algebra-cont..> | 2023-05-03 10:22 | 379K | |
![[IMG]](/icons/image2.gif) | college-algebra-lial..> | 2023-08-08 20:02 | 4.9K | |
![[IMG]](/icons/image2.gif) | college-algebra-lial..> | 2023-05-03 09:48 | 19K | |
![[IMG]](/icons/image2.gif) | college-algebra-trig..> | 2023-08-06 08:45 | 5.0K | |
![[IMG]](/icons/image2.gif) | college-algebra-trig..> | 2023-08-05 14:40 | 35K | |
![[IMG]](/icons/image2.gif) | college-algebra-trig..> | 2023-05-03 09:39 | 188K | |
![[ ]](/icons/compressed.gif) | college-algebra-trig..> | 2023-05-03 09:39 | 4.2M | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-08-06 16:32 | 21K | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-05-03 11:11 | 81K | |
![[ ]](/icons/compressed.gif) | college-mathematics-..> | 2023-05-03 11:11 | 401K | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-08-05 01:52 | 4.3K | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-08-10 13:41 | 21K | |
![[IMG]](/icons/image2.gif) | college-mathematics-..> | 2023-05-04 02:06 | 81K | |
![[ ]](/icons/compressed.gif) | college-mathematics-..> | 2023-05-04 02:06 | 220K | |
![[ ]](/icons/compressed.gif) | college-physics-10th..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/compressed.gif) | college-physics-10th..> | 2023-05-03 13:42 | 236K | |
![[IMG]](/icons/image2.gif) | college-physics-a-st..> | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | college-physics-a-st..> | 2023-05-03 10:17 | 15K | |
![[ ]](/icons/compressed.gif) | college-physics-a-st..> | 2023-05-03 10:17 | 14K | |
![[IMG]](/icons/image2.gif) | college-physics-alan..> | 2023-08-05 05:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | college-physics-alan..> | 2023-05-03 09:19 | 27K | |
![[ ]](/icons/compressed.gif) | college-physics-alan..> | 2023-05-03 09:19 | 69K | |
![[IMG]](/icons/image2.gif) | college-physics-hugh..> | 2023-08-05 04:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | college-physics-hugh..> | 2023-05-03 10:07 | 17K | |
![[ ]](/icons/compressed.gif) | college-physics-hugh..> | 2023-05-03 10:07 | 73K | |
![[IMG]](/icons/image2.gif) | college-physics-jerr..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | college-physics-jerr..> | 2023-05-03 10:39 | 18K | |
![[ ]](/icons/compressed.gif) | college-physics-jerr..> | 2023-05-03 10:39 | 39K | |
![[IMG]](/icons/image2.gif) | college-physics-stra..> | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | college-physics-stra..> | 2023-08-10 13:41 | 19K | |
![[IMG]](/icons/image2.gif) | college-physics-stra..> | 2023-05-03 09:41 | 83K | |
![[ ]](/icons/compressed.gif) | college-physics-stra..> | 2023-05-03 09:40 | 316K | |
![[IMG]](/icons/image2.gif) | college-physics-youn..> | 2023-08-06 03:49 | 2.7K | |
![[IMG]](/icons/image2.gif) | college-physics-youn..> | 2023-05-03 09:59 | 15K | |
![[ ]](/icons/compressed.gif) | college-physics-youn..> | 2023-05-03 09:59 | 148K | |
![[IMG]](/icons/image2.gif) | college-writing-skil..> | 2023-08-05 01:52 | 14K | |
![[IMG]](/icons/image2.gif) | college-writing-skil..> | 2023-05-03 09:55 | 35K | |
![[IMG]](/icons/image2.gif) | college-writing-skil..> | 2023-08-05 13:12 | 14K | |
![[IMG]](/icons/image2.gif) | college-writing-skil..> | 2023-05-03 09:22 | 36K | |
![[IMG]](/icons/image2.gif) | color-textbook-of-hi..> | 2023-08-09 08:01 | 4.0K | |
![[IMG]](/icons/image2.gif) | color-textbook-of-hi..> | 2023-05-03 09:45 | 28K | |
![[ ]](/icons/compressed.gif) | color-textbook-of-hi..> | 2023-05-03 09:45 | 2.6M | |
![[ ]](/icons/compressed.gif) | comer9e_instructorsm..> | 2023-05-03 10:19 | 27K | |
![[IMG]](/icons/image2.gif) | commercial-refrigera..> | 2023-08-06 12:08 | 3.5K | |
![[IMG]](/icons/image2.gif) | commercial-refrigera..> | 2023-08-06 16:32 | 21K | |
![[IMG]](/icons/image2.gif) | commercial-refrigera..> | 2023-05-04 02:19 | 53K | |
![[ ]](/icons/compressed.gif) | commercial-refrigera..> | 2023-05-04 02:19 | 9.4K | |
![[IMG]](/icons/image2.gif) | commsyst-100x100.jpg | 2023-08-05 16:24 | 3.4K | |
![[IMG]](/icons/image2.gif) | commsyst.jpg | 2023-05-03 11:09 | 18K | |
![[ ]](/icons/compressed.gif) | community-and-public..> | 2023-05-03 09:51 | 11K | |
![[IMG]](/icons/image2.gif) | community-and-public..> | 2023-08-05 16:16 | 2.9K | |
![[IMG]](/icons/image2.gif) | community-and-public..> | 2023-05-03 09:51 | 7.4K | |
![[IMG]](/icons/image2.gif) | community-based-nurs..> | 2023-08-05 04:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | community-based-nurs..> | 2023-05-03 11:18 | 24K | |
![[ ]](/icons/compressed.gif) | community-based-nurs..> | 2023-05-03 11:18 | 12K | |
![[IMG]](/icons/image2.gif) | community-health-nur..> | 2023-08-06 09:42 | 4.3K | |
![[IMG]](/icons/image2.gif) | community-health-nur..> | 2023-05-03 09:55 | 26K | |
![[ ]](/icons/compressed.gif) | community-health-nur..> | 2023-05-03 09:55 | 3.8K | |
![[IMG]](/icons/image2.gif) | community-health-nur..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | community-health-nur..> | 2023-05-03 09:41 | 17K | |
![[ ]](/icons/compressed.gif) | community-health-nur..> | 2023-05-03 09:41 | 15K | |
![[IMG]](/icons/image2.gif) | community-nutrition-..> | 2023-08-05 14:36 | 4.7K | |
![[IMG]](/icons/image2.gif) | community-nutrition-..> | 2023-08-10 13:41 | 28K | |
![[IMG]](/icons/image2.gif) | community-nutrition-..> | 2023-05-03 10:03 | 63K | |
![[ ]](/icons/compressed.gif) | community-nutrition-..> | 2023-05-03 10:03 | 88K | |
![[IMG]](/icons/image2.gif) | community-oral-healt..> | 2023-08-05 17:21 | 3.7K | |
![[IMG]](/icons/image2.gif) | community-oral-healt..> | 2023-05-03 11:13 | 20K | |
![[ ]](/icons/compressed.gif) | community-oral-healt..> | 2023-05-03 11:13 | 14K | |
![[IMG]](/icons/image2.gif) | community-policing-p..> | 2023-08-06 00:57 | 4.5K | |
![[IMG]](/icons/image2.gif) | community-policing-p..> | 2023-05-03 10:32 | 31K | |
![[ ]](/icons/compressed.gif) | community-policing-p..> | 2023-05-03 10:32 | 15K | |
![[ ]](/icons/compressed.gif) | community-public-hea..> | 2023-05-03 13:40 | 19K | |
![[IMG]](/icons/image2.gif) | community-public-hea..> | 2023-08-08 10:58 | 3.8K | |
![[IMG]](/icons/image2.gif) | community-public-hea..> | 2023-05-03 10:37 | 24K | |
![[ ]](/icons/compressed.gif) | community-public-hea..> | 2023-05-03 10:37 | 20K | |
![[IMG]](/icons/image2.gif) | community-public-hea..> | 2023-08-06 05:45 | 16K | |
![[IMG]](/icons/image2.gif) | community-public-hea..> | 2023-05-03 09:32 | 43K | |
![[IMG]](/icons/image2.gif) | compensation-managem..> | 2023-08-06 12:56 | 3.6K | |
![[IMG]](/icons/image2.gif) | compensation-managem..> | 2023-05-03 09:43 | 24K | |
![[ ]](/icons/compressed.gif) | compensation-managem..> | 2023-05-03 09:43 | 65K | |
![[IMG]](/icons/image2.gif) | compensation-milkovi..> | 2023-08-05 02:03 | 2.0K | |
![[IMG]](/icons/image2.gif) | compensation-milkovi..> | 2023-05-03 10:01 | 19K | |
![[ ]](/icons/compressed.gif) | compensation-milkovi..> | 2023-05-03 10:01 | 47K | |
![[IMG]](/icons/image2.gif) | competing-for-advant..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | competing-for-advant..> | 2023-05-03 10:17 | 20K | |
![[ ]](/icons/compressed.gif) | competing-for-advant..> | 2023-05-03 10:17 | 17K | |
![[IMG]](/icons/image2.gif) | complete-comptia-a-g..> | 2023-08-05 01:52 | 4.3K | |
![[IMG]](/icons/image2.gif) | complete-comptia-a-g..> | 2023-08-10 13:41 | 20K | |
![[IMG]](/icons/image2.gif) | complete-comptia-a-g..> | 2023-05-03 10:48 | 49K | |
![[ ]](/icons/compressed.gif) | complete-comptia-a-g..> | 2023-05-03 10:47 | 533K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-08-05 06:25 | 3.8K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-08-06 16:32 | 22K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-05-03 09:58 | 56K | |
![[ ]](/icons/compressed.gif) | comprehensive-medica..> | 2023-05-03 09:58 | 902K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-08-05 16:16 | 3.8K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-08-10 13:41 | 22K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-05-03 10:11 | 57K | |
![[ ]](/icons/compressed.gif) | comprehensive-medica..> | 2023-05-03 10:11 | 30K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-08-05 01:15 | 2.5K | |
![[IMG]](/icons/image2.gif) | comprehensive-medica..> | 2023-05-03 10:24 | 14K | |
![[ ]](/icons/compressed.gif) | comprehensive-medica..> | 2023-05-03 10:24 | 5.1K | |
![[IMG]](/icons/image2.gif) | comprehensive-radiog..> | 2023-08-08 01:04 | 2.9K | |
![[IMG]](/icons/image2.gif) | comprehensive-radiog..> | 2023-05-03 10:49 | 16K | |
![[IMG]](/icons/image2.gif) | computed-tomography-..> | 2023-08-06 09:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | computed-tomography-..> | 2023-05-03 10:34 | 18K | |
![[IMG]](/icons/image2.gif) | computer-accounting-..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | computer-accounting-..> | 2023-08-08 06:44 | 14K | |
![[IMG]](/icons/image2.gif) | computer-accounting-..> | 2023-05-03 10:56 | 35K | |
![[ ]](/icons/compressed.gif) | computer-accounting-..> | 2023-05-03 10:56 | 224K | |
![[IMG]](/icons/image2.gif) | computer-networking-..> | 2023-08-05 15:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | computer-networking-..> | 2023-08-06 16:32 | 16K | |
![[IMG]](/icons/image2.gif) | computer-networking-..> | 2023-05-03 10:57 | 79K | |
![[ ]](/icons/compressed.gif) | computer-networking-..> | 2023-05-03 10:57 | 3.7M | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-08-05 04:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-08-06 16:32 | 26K | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-05-04 02:27 | 81K | |
![[ ]](/icons/compressed.gif) | computer-organizatio..> | 2023-05-04 02:27 | 1.3M | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-08-05 06:24 | 4.4K | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-08-08 06:44 | 26K | |
![[IMG]](/icons/image2.gif) | computer-organizatio..> | 2023-05-03 10:03 | 105K | |
![[ ]](/icons/compressed.gif) | computer-organizatio..> | 2023-05-03 10:03 | 125K | |
![[IMG]](/icons/image2.gif) | computer-security-fu..> | 2023-08-08 14:31 | 3.0K | |
![[IMG]](/icons/image2.gif) | computer-security-fu..> | 2023-05-03 10:02 | 17K | |
![[ ]](/icons/unknown.gif) | concept-1-Test-Bank-..> | 2023-05-03 10:13 | 75K | |
![[IMG]](/icons/image2.gif) | concept-100x100.jpg | 2023-08-05 15:31 | 4.3K | |
![[IMG]](/icons/image2.gif) | concept.jpg | 2023-05-03 09:53 | 31K | |
![[IMG]](/icons/image2.gif) | concepts-for-nursing..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | concepts-for-nursing..> | 2023-05-03 09:29 | 11K | |
![[IMG]](/icons/image2.gif) | concepts-genetics-2n..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | concepts-genetics-2n..> | 2023-08-06 15:35 | 20K | |
![[IMG]](/icons/image2.gif) | concepts-genetics-2n..> | 2023-05-03 09:27 | 56K | |
![[ ]](/icons/compressed.gif) | concepts-genetics-2n..> | 2023-05-03 09:27 | 4.1M | |
![[IMG]](/icons/image2.gif) | concepts-in-federal-..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | concepts-in-federal-..> | 2023-05-03 10:26 | 16K | |
![[IMG]](/icons/image2.gif) | concepts-in-federal-..> | 2023-08-05 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | concepts-in-federal-..> | 2023-05-03 10:27 | 16K | |
![[IMG]](/icons/image2.gif) | concepts-in-strategi..> | 2023-08-06 09:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | concepts-in-strategi..> | 2023-05-03 11:17 | 15K | |
![[ ]](/icons/compressed.gif) | concepts-in-strategi..> | 2023-05-03 11:17 | 19K | |
![[IMG]](/icons/image2.gif) | concepts-of-biology-..> | 2023-08-08 22:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | concepts-of-biology-..> | 2023-05-03 09:33 | 18K | |
![[ ]](/icons/compressed.gif) | concepts-of-biology-..> | 2023-05-03 09:33 | 14K | |
![[IMG]](/icons/image2.gif) | concepts-of-genetics..> | 2023-08-05 05:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | concepts-of-genetics..> | 2023-05-03 09:18 | 35K | |
![[ ]](/icons/compressed.gif) | concepts-of-genetics..> | 2023-05-03 09:18 | 22K | |
![[IMG]](/icons/image2.gif) | conceptual-chemistry..> | 2023-08-05 03:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | conceptual-chemistry..> | 2023-05-04 02:14 | 20K | |
![[ ]](/icons/compressed.gif) | conceptual-chemistry..> | 2023-05-04 02:14 | 197K | |
![[IMG]](/icons/image2.gif) | conceptual-foundatio..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | conceptual-foundatio..> | 2023-05-03 10:39 | 17K | |
![[ ]](/icons/compressed.gif) | conceptual-foundatio..> | 2023-05-03 10:39 | 0 | |
![[IMG]](/icons/image2.gif) | conceptual-physical-..> | 2023-08-06 13:07 | 2.2K | |
![[IMG]](/icons/image2.gif) | conceptual-physical-..> | 2023-05-03 10:05 | 15K | |
![[ ]](/icons/compressed.gif) | conceptual-physical-..> | 2023-05-03 10:05 | 102K | |
![[IMG]](/icons/image2.gif) | conceptual-physical-..> | 2023-08-08 22:02 | 3.0K | |
![[IMG]](/icons/image2.gif) | conceptual-physical-..> | 2023-05-03 10:27 | 19K | |
![[ ]](/icons/compressed.gif) | conceptual-physical-..> | 2023-05-03 10:27 | 17K | |
![[IMG]](/icons/image2.gif) | conceptual-physics-p..> | 2023-08-06 03:43 | 3.7K | |
![[IMG]](/icons/image2.gif) | conceptual-physics-p..> | 2023-05-03 10:33 | 26K | |
![[ ]](/icons/compressed.gif) | conceptual-physics-p..> | 2023-05-03 10:33 | 8.2K | |
![[IMG]](/icons/image2.gif) | conducting-research-..> | 2023-08-06 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | conducting-research-..> | 2023-05-03 11:02 | 17K | |
![[ ]](/icons/compressed.gif) | conducting-research-..> | 2023-05-03 11:02 | 40K | |
![[IMG]](/icons/image2.gif) | construction-jobsite..> | 2023-08-05 01:15 | 4.4K | |
![[IMG]](/icons/image2.gif) | construction-jobsite..> | 2023-08-08 08:38 | 24K | |
![[IMG]](/icons/image2.gif) | construction-jobsite..> | 2023-05-03 09:43 | 58K | |
![[ ]](/icons/compressed.gif) | construction-jobsite..> | 2023-05-03 09:43 | 10K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-08-06 05:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-05-03 09:45 | 20K | |
![[ ]](/icons/compressed.gif) | consumer-behavior-bu..> | 2023-05-03 09:45 | 21K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-05-03 10:29 | 23K | |
![[ ]](/icons/compressed.gif) | consumer-behavior-bu..> | 2023-05-03 10:29 | 95K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-08-05 06:25 | 4.7K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-08-08 08:38 | 28K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-bu..> | 2023-05-03 10:21 | 118K | |
![[ ]](/icons/compressed.gif) | consumer-behavior-bu..> | 2023-05-03 10:21 | 77K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-ho..> | 2023-08-05 15:34 | 4.3K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-ho..> | 2023-05-03 11:21 | 24K | |
![[ ]](/icons/compressed.gif) | consumer-behavior-ho..> | 2023-05-03 11:21 | 12K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-ma..> | 2023-08-06 12:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | consumer-behavior-ma..> | 2023-05-03 10:43 | 25K | |
![[ ]](/icons/compressed.gif) | consumer-behavior-ma..> | 2023-05-03 10:43 | 18K | |
![[IMG]](/icons/image2.gif) | consumer-behaviour-b..> | 2023-08-08 07:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | consumer-behaviour-b..> | 2023-05-03 10:37 | 19K | |
![[ ]](/icons/compressed.gif) | consumer-behaviour-b..> | 2023-05-03 10:36 | 196K | |
![[IMG]](/icons/image2.gif) | consumer-behaviour-b..> | 2023-08-09 07:05 | 4.1K | |
![[IMG]](/icons/image2.gif) | consumer-behaviour-b..> | 2023-08-08 08:38 | 21K | |
![[IMG]](/icons/image2.gif) | consumer-behaviour-b..> | 2023-05-03 10:17 | 82K | |
![[ ]](/icons/compressed.gif) | consumer-behaviour-b..> | 2023-05-03 10:17 | 125K | |
![[IMG]](/icons/image2.gif) | consumer-health-a-gu..> | 2023-08-06 08:43 | 3.0K | |
![[IMG]](/icons/image2.gif) | consumer-health-a-gu..> | 2023-05-03 10:41 | 19K | |
![[ ]](/icons/compressed.gif) | consumer-health-a-gu..> | 2023-05-03 10:41 | 11K | |
![[IMG]](/icons/image2.gif) | contemporary-adverti..> | 2023-08-05 05:30 | 2.2K | |
![[IMG]](/icons/image2.gif) | contemporary-adverti..> | 2023-05-03 09:47 | 10K | |
![[ ]](/icons/compressed.gif) | contemporary-adverti..> | 2023-05-03 09:46 | 91K | |
![[IMG]](/icons/image2.gif) | contemporary-auditin..> | 2023-08-05 19:13 | 4.4K | |
![[IMG]](/icons/image2.gif) | contemporary-auditin..> | 2023-08-06 15:35 | 23K | |
![[IMG]](/icons/image2.gif) | contemporary-auditin..> | 2023-05-03 10:21 | 56K | |
![[ ]](/icons/compressed.gif) | contemporary-auditin..> | 2023-05-03 10:21 | 1.4M | |
![[IMG]](/icons/image2.gif) | contemporary-auditin..> | 2023-05-03 09:25 | 16K | |
![[IMG]](/icons/image2.gif) | contemporary-busines..> | 2023-08-06 03:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | contemporary-busines..> | 2023-08-08 08:38 | 17K | |
![[IMG]](/icons/image2.gif) | contemporary-busines..> | 2023-05-03 09:57 | 26K | |
![[ ]](/icons/compressed.gif) | contemporary-busines..> | 2023-05-03 09:57 | 526K | |
![[IMG]](/icons/image2.gif) | contemporary-clinica..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | contemporary-clinica..> | 2023-05-03 09:47 | 22K | |
![[ ]](/icons/compressed.gif) | contemporary-clinica..> | 2023-05-03 09:47 | 400K | |
![[IMG]](/icons/image2.gif) | contemporary-financi..> | 2023-08-06 07:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | contemporary-financi..> | 2023-05-03 11:12 | 15K | |
![[IMG]](/icons/image2.gif) | contemporary-labor-e..> | 2023-08-05 06:24 | 2.5K | |
![[IMG]](/icons/image2.gif) | contemporary-labor-e..> | 2023-05-03 10:48 | 15K | |
![[ ]](/icons/compressed.gif) | contemporary-labor-e..> | 2023-05-03 10:48 | 18K | |
![[IMG]](/icons/image2.gif) | contemporary-managem..> | 2023-08-05 14:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | contemporary-managem..> | 2023-08-08 08:38 | 17K | |
![[IMG]](/icons/image2.gif) | contemporary-managem..> | 2023-05-04 02:10 | 41K | |
![[ ]](/icons/compressed.gif) | contemporary-managem..> | 2023-05-04 02:10 | 280K | |
![[ ]](/icons/compressed.gif) | contemporary-managem..> | 2023-05-03 13:41 | 29K | |
![[ ]](/icons/compressed.gif) | contemporary-managem..> | 2023-05-03 10:00 | 96K | |
![[IMG]](/icons/image2.gif) | contemporary-managem..> | 2023-08-06 07:37 | 2.3K | |
![[IMG]](/icons/image2.gif) | contemporary-managem..> | 2023-05-03 10:00 | 6.9K | |
![[IMG]](/icons/image2.gif) | contemporary-marketi..> | 2023-08-06 19:38 | 3.8K | |
![[IMG]](/icons/image2.gif) | contemporary-marketi..> | 2023-05-03 09:18 | 18K | |
![[ ]](/icons/compressed.gif) | contemporary-marketi..> | 2023-05-03 09:18 | 40K | |
![[IMG]](/icons/image2.gif) | contemporary-materna..> | 2023-08-05 01:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | contemporary-materna..> | 2023-05-03 10:22 | 10K | |
![[ ]](/icons/compressed.gif) | contemporary-materna..> | 2023-05-03 10:22 | 19K | |
![[IMG]](/icons/image2.gif) | contemporary-medical..> | 2023-08-05 02:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | contemporary-medical..> | 2023-05-03 10:32 | 15K | |
![[ ]](/icons/compressed.gif) | contemporary-medical..> | 2023-05-03 10:32 | 13K | |
![[IMG]](/icons/image2.gif) | contemporary-nursing..> | 2023-08-05 14:39 | 2.8K | |
![[IMG]](/icons/image2.gif) | contemporary-nursing..> | 2023-05-03 10:47 | 9.0K | |
![[ ]](/icons/compressed.gif) | contemporary-nursing..> | 2023-05-03 09:28 | 19K | |
![[IMG]](/icons/image2.gif) | contemporary-nutriti..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | contemporary-nutriti..> | 2023-05-03 09:41 | 24K | |
![[ ]](/icons/compressed.gif) | contemporary-nutriti..> | 2023-05-03 09:41 | 207K | |
![[IMG]](/icons/image2.gif) | contemporary-project..> | 2023-08-09 04:59 | 3.4K | |
![[IMG]](/icons/image2.gif) | contemporary-project..> | 2023-08-06 11:18 | 17K | |
![[IMG]](/icons/image2.gif) | contemporary-project..> | 2023-05-03 09:58 | 45K | |
![[ ]](/icons/compressed.gif) | contemporary-project..> | 2023-05-03 09:58 | 362K | |
![[IMG]](/icons/image2.gif) | contemporary-psychia..> | 2023-08-08 05:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | contemporary-psychia..> | 2023-05-03 10:46 | 20K | |
![[ ]](/icons/compressed.gif) | contemporary-psychia..> | 2023-05-03 10:46 | 20K | |
![[IMG]](/icons/image2.gif) | contemporary-world-r..> | 2023-08-06 11:13 | 4.0K | |
![[IMG]](/icons/image2.gif) | contemporary-world-r..> | 2023-05-03 10:48 | 30K | |
![[ ]](/icons/compressed.gif) | contemporary-world-r..> | 2023-05-03 10:48 | 36K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-hea..> | 2023-08-08 10:57 | 3.1K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-hea..> | 2023-05-03 09:39 | 18K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-pha..> | 2023-08-05 04:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-pha..> | 2023-05-03 09:30 | 21K | |
![[ ]](/icons/compressed.gif) | core-concepts-in-pha..> | 2023-05-03 09:30 | 5.4K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-pha..> | 2023-08-05 03:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | core-concepts-in-pha..> | 2023-05-03 10:01 | 25K | |
![[ ]](/icons/compressed.gif) | core-concepts-in-pha..> | 2023-05-03 10:01 | 32K | |
![[IMG]](/icons/image2.gif) | coremicroeconomics-s..> | 2023-08-05 02:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | coremicroeconomics-s..> | 2023-05-03 09:47 | 15K | |
![[ ]](/icons/compressed.gif) | cornerstones-of-cost..> | 2023-05-03 09:46 | 48K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-cost..> | 2023-08-08 19:14 | 3.0K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-cost..> | 2023-05-03 09:24 | 12K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-fina..> | 2023-08-06 13:05 | 2.4K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-fina..> | 2023-05-03 11:19 | 12K | |
![[ ]](/icons/compressed.gif) | cornerstones-of-fina..> | 2023-05-03 11:19 | 42K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-mana..> | 2023-08-08 20:04 | 10K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-mana..> | 2023-08-05 01:13 | 25K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-mana..> | 2023-05-04 02:29 | 41K | |
![[ ]](/icons/compressed.gif) | cornerstones-of-mana..> | 2023-05-03 10:02 | 0 | |
![[IMG]](/icons/image2.gif) | cornerstones-of-mana..> | 2023-08-05 05:30 | 2.2K | |
![[IMG]](/icons/image2.gif) | cornerstones-of-mana..> | 2023-05-03 10:02 | 6.6K | |
![[IMG]](/icons/image2.gif) | corporate-computer-s..> | 2023-08-07 13:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | corporate-computer-s..> | 2023-05-04 02:10 | 31K | |
![[ ]](/icons/compressed.gif) | corporate-computer-s..> | 2023-05-04 02:10 | 16K | |
![[IMG]](/icons/image2.gif) | corporate-finance-11..> | 2023-08-08 16:36 | 3.3K | |
![[IMG]](/icons/image2.gif) | corporate-finance-11..> | 2023-08-06 11:18 | 19K | |
![[IMG]](/icons/image2.gif) | corporate-finance-11..> | 2023-05-04 02:15 | 35K | |
![[ ]](/icons/compressed.gif) | corporate-finance-11..> | 2023-05-04 02:15 | 415K | |
![[ ]](/icons/compressed.gif) | corporate-finance-a-..> | 2023-05-03 09:53 | 22K | |
![[IMG]](/icons/image2.gif) | corporate-finance-a-..> | 2023-05-03 11:04 | 11K | |
![[IMG]](/icons/image2.gif) | corporate-finance-a-..> | 2023-08-08 09:20 | 3.0K | |
![[IMG]](/icons/image2.gif) | corporate-finance-a-..> | 2023-05-03 09:53 | 9.1K | |
![[IMG]](/icons/image2.gif) | corporate-finance-be..> | 2023-08-05 15:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | corporate-finance-be..> | 2023-05-03 11:14 | 18K | |
![[ ]](/icons/compressed.gif) | corporate-finance-be..> | 2023-05-03 11:14 | 11K | |
![[IMG]](/icons/image2.gif) | corporate-finance-co..> | 2023-08-08 15:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | corporate-finance-co..> | 2023-08-05 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | corporate-finance-co..> | 2023-05-03 09:44 | 79K | |
![[ ]](/icons/compressed.gif) | corporate-finance-co..> | 2023-05-03 09:44 | 532K | |
![[IMG]](/icons/image2.gif) | corporate-finance-eh..> | 2023-05-03 11:05 | 11K | |
![[IMG]](/icons/image2.gif) | corporate-finance-jo..> | 2023-08-08 16:36 | 2.6K | |
![[IMG]](/icons/image2.gif) | corporate-finance-jo..> | 2023-05-03 10:15 | 15K | |
![[ ]](/icons/compressed.gif) | corporate-finance-jo..> | 2023-05-03 10:15 | 12K | |
![[IMG]](/icons/image2.gif) | corporate-finance-li..> | 2023-08-07 18:02 | 3.9K | |
![[IMG]](/icons/image2.gif) | corporate-finance-li..> | 2023-05-03 11:10 | 21K | |
![[ ]](/icons/compressed.gif) | corporate-finance-li..> | 2023-05-03 11:10 | 13K | |
![[ ]](/icons/compressed.gif) | corporate-finance-ro..> | 2023-05-03 10:57 | 259K | |
![[IMG]](/icons/image2.gif) | corporate-finance-ro..> | 2023-08-05 15:43 | 2.9K | |
![[IMG]](/icons/image2.gif) | corporate-finance-ro..> | 2023-05-03 10:57 | 9.0K | |
![[IMG]](/icons/image2.gif) | corporate-finance-st..> | 2023-08-07 23:03 | 3.1K | |
![[IMG]](/icons/image2.gif) | corporate-finance-st..> | 2023-05-03 10:04 | 26K | |
![[ ]](/icons/compressed.gif) | corporate-finance-st..> | 2023-05-03 10:04 | 16K | |
![[IMG]](/icons/image2.gif) | corporate-financial-..> | 2023-05-03 09:53 | 12K | |
![[IMG]](/icons/image2.gif) | corrections-today-si..> | 2023-08-05 16:27 | 3.3K | |
![[IMG]](/icons/image2.gif) | corrections-today-si..> | 2023-05-03 09:27 | 23K | |
![[ ]](/icons/compressed.gif) | corrections-today-si..> | 2023-05-03 09:27 | 24K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-08-05 15:29 | 2.8K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-08-05 01:52 | 20K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-05-03 10:20 | 88K | |
![[ ]](/icons/compressed.gif) | cosmic-perspective-7..> | 2023-05-03 10:20 | 155K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-08-08 05:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-08-05 01:52 | 20K | |
![[IMG]](/icons/image2.gif) | cosmic-perspective-7..> | 2023-05-04 01:53 | 111K | |
![[ ]](/icons/compressed.gif) | cost-accounting-14th..> | 2023-05-03 10:40 | 245K | |
![[IMG]](/icons/image2.gif) | cost-accounting-horn..> | 2023-08-05 01:33 | 3.3K | |
![[IMG]](/icons/image2.gif) | cost-accounting-horn..> | 2023-05-03 10:35 | 11K | |
![[IMG]](/icons/image2.gif) | cost-accounting-horn..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | cost-accounting-horn..> | 2023-05-03 09:43 | 11K | |
![[IMG]](/icons/image2.gif) | cost-accounting-mana..> | 2023-08-05 04:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | cost-accounting-mana..> | 2023-08-05 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | cost-accounting-mana..> | 2023-05-03 11:07 | 105K | |
![[ ]](/icons/compressed.gif) | cost-accounting-mana..> | 2023-05-03 11:07 | 375K | |
![[IMG]](/icons/image2.gif) | cost-accounting-ndas..> | 2023-05-03 09:53 | 9.0K | |
![[IMG]](/icons/image2.gif) | cost-management-a-st..> | 2023-05-03 11:24 | 9.5K | |
![[IMG]](/icons/image2.gif) | cost-management-a-st..> | 2023-05-03 10:29 | 9.5K | |
![[IMG]](/icons/image2.gif) | cost-management-meas..> | 2023-08-06 05:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | cost-management-meas..> | 2023-05-03 10:07 | 17K | |
![[ ]](/icons/compressed.gif) | cost-management-meas..> | 2023-05-03 10:07 | 63K | |
![[IMG]](/icons/image2.gif) | cost-management-stra..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | cost-management-stra..> | 2023-08-06 17:26 | 17K | |
![[IMG]](/icons/image2.gif) | cost-management-stra..> | 2023-05-03 11:01 | 42K | |
![[ ]](/icons/compressed.gif) | cost-management-stra..> | 2023-05-03 11:01 | 1.5M | |
![[IMG]](/icons/image2.gif) | cost-management-stra..> | 2023-05-03 09:51 | 11K | |
![[IMG]](/icons/image2.gif) | costaccounting-100x1..> | 2023-08-06 07:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | costaccounting-300x3..> | 2023-08-14 00:56 | 19K | |
![[IMG]](/icons/image2.gif) | costaccounting.jpg | 2023-05-03 09:50 | 25K | |
![[ ]](/icons/compressed.gif) | coulter_smia6e_im_01..> | 2023-05-03 13:43 | 34K | |
![[IMG]](/icons/image2.gif) | counseling-and-psych..> | 2023-08-06 03:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | counseling-and-psych..> | 2023-05-03 10:22 | 13K | |
![[IMG]](/icons/image2.gif) | counseling-the-cultu..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | counseling-the-cultu..> | 2023-05-03 10:15 | 14K | |
![[ ]](/icons/layout.gif) | cpphtp7_01_IM.pdf | 2023-05-04 01:57 | 461K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-08-05 16:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-05-03 09:36 | 8.8K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-08-07 20:13 | 3.0K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-05-03 09:53 | 8.8K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-08-05 01:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | crafting-and-executi..> | 2023-05-03 09:46 | 16K | |
![[ ]](/icons/compressed.gif) | crafting-and-executi..> | 2023-05-03 09:46 | 26K | |
![[ ]](/icons/compressed.gif) | crafting-and-executi..> | 2023-05-03 09:53 | 178K | |
![[ ]](/icons/compressed.gif) | crafting-executing-s..> | 2023-05-03 13:43 | 2.7M | |
![[IMG]](/icons/image2.gif) | crafting-executing-s..> | 2023-08-05 01:56 | 3.3K | |
![[IMG]](/icons/image2.gif) | crafting-executing-s..> | 2023-05-03 09:26 | 21K | |
![[ ]](/icons/compressed.gif) | crafting-executing-s..> | 2023-05-03 09:26 | 35K | |
![[IMG]](/icons/image2.gif) | crafting-executing-s..> | 2023-08-06 11:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | crafting-executing-s..> | 2023-05-04 02:06 | 21K | |
![[IMG]](/icons/image2.gif) | criminal-behavior-a-..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | criminal-behavior-a-..> | 2023-05-03 10:23 | 15K | |
![[IMG]](/icons/image2.gif) | criminal-investigati..> | 2023-08-05 03:39 | 3.7K | |
![[IMG]](/icons/image2.gif) | criminal-investigati..> | 2023-05-03 11:19 | 23K | |
![[ ]](/icons/compressed.gif) | criminal-investigati..> | 2023-05-03 11:19 | 86K | |
![[IMG]](/icons/image2.gif) | criminal-justice-eth..> | 2023-08-08 21:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | criminal-justice-eth..> | 2023-08-06 17:26 | 22K | |
![[IMG]](/icons/image2.gif) | criminal-justice-eth..> | 2023-05-04 01:48 | 37K | |
![[ ]](/icons/compressed.gif) | criminal-justice-eth..> | 2023-05-04 01:48 | 26K | |
![[IMG]](/icons/image2.gif) | criminal-justice-in-..> | 2023-08-06 13:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | criminal-justice-in-..> | 2023-05-03 10:12 | 22K | |
![[ ]](/icons/compressed.gif) | criminal-justice-in-..> | 2023-05-03 10:12 | 29K | |
![[IMG]](/icons/image2.gif) | criminal-justice-tod..> | 2023-08-05 16:23 | 2.2K | |
![[IMG]](/icons/image2.gif) | criminal-justice-tod..> | 2023-05-03 10:38 | 13K | |
![[ ]](/icons/compressed.gif) | criminal-justice-tod..> | 2023-05-03 10:37 | 13K | |
![[IMG]](/icons/image2.gif) | criminal-law-and-pro..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | criminal-law-and-pro..> | 2023-05-03 10:43 | 20K | |
![[ ]](/icons/compressed.gif) | criminal-law-and-pro..> | 2023-05-03 10:43 | 22K | |
![[IMG]](/icons/image2.gif) | criminal-law-joel-sa..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | criminal-law-joel-sa..> | 2023-05-03 09:39 | 21K | |
![[ ]](/icons/compressed.gif) | criminal-law-joel-sa..> | 2023-05-03 09:39 | 31K | |
![[IMG]](/icons/image2.gif) | criminal-law-john-l-..> | 2023-08-06 13:08 | 4.4K | |
![[IMG]](/icons/image2.gif) | criminal-law-john-l-..> | 2023-05-03 10:47 | 28K | |
![[ ]](/icons/compressed.gif) | criminal-law-john-l-..> | 2023-05-03 10:47 | 105K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-3..> | 2023-08-06 08:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-3..> | 2023-08-06 08:44 | 16K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-3..> | 2023-05-03 09:29 | 27K | |
![[ ]](/icons/compressed.gif) | criminal-procedure-3..> | 2023-05-03 09:29 | 24K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-f..> | 2023-08-05 04:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-f..> | 2023-05-03 09:54 | 18K | |
![[ ]](/icons/compressed.gif) | criminal-procedure-f..> | 2023-05-03 09:53 | 14K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-l..> | 2023-08-05 17:22 | 2.6K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-l..> | 2023-05-03 09:24 | 16K | |
![[ ]](/icons/compressed.gif) | criminal-procedure-l..> | 2023-05-03 09:24 | 40K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-z..> | 2023-08-05 17:19 | 2.6K | |
![[IMG]](/icons/image2.gif) | criminal-procedure-z..> | 2023-05-03 10:31 | 17K | |
![[ ]](/icons/compressed.gif) | criminal-procedure-z..> | 2023-05-03 10:31 | 85K | |
![[IMG]](/icons/image2.gif) | criminological-theor..> | 2023-08-06 17:22 | 3.3K | |
![[IMG]](/icons/image2.gif) | criminological-theor..> | 2023-08-06 17:26 | 23K | |
![[IMG]](/icons/image2.gif) | criminological-theor..> | 2023-05-03 09:22 | 91K | |
![[ ]](/icons/compressed.gif) | criminological-theor..> | 2023-05-03 09:22 | 22K | |
![[IMG]](/icons/image2.gif) | criminology-john-e-c..> | 2023-08-05 14:39 | 2.2K | |
![[IMG]](/icons/image2.gif) | criminology-john-e-c..> | 2023-05-04 02:21 | 13K | |
![[ ]](/icons/compressed.gif) | criminology-john-e-c..> | 2023-05-04 02:21 | 94K | |
![[IMG]](/icons/image2.gif) | criminology-sociolog..> | 2023-08-06 08:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | criminology-sociolog..> | 2023-08-05 01:52 | 14K | |
![[IMG]](/icons/image2.gif) | criminology-sociolog..> | 2023-05-03 10:24 | 68K | |
![[ ]](/icons/compressed.gif) | criminology-sociolog..> | 2023-05-03 10:24 | 29K | |
![[IMG]](/icons/image2.gif) | criminology-today-in..> | 2023-08-06 07:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | criminology-today-in..> | 2023-08-05 01:52 | 22K | |
![[IMG]](/icons/image2.gif) | criminology-today-in..> | 2023-05-04 01:55 | 93K | |
![[ ]](/icons/compressed.gif) | criminology-today-in..> | 2023-05-04 01:55 | 49K | |
![[ ]](/icons/compressed.gif) | critical-care-nursin..> | 2023-05-03 10:33 | 4.7K | |
![[IMG]](/icons/image2.gif) | critical-care-nursin..> | 2023-08-06 04:20 | 2.8K | |
![[IMG]](/icons/image2.gif) | critical-care-nursin..> | 2023-05-03 11:16 | 18K | |
![[ ]](/icons/compressed.gif) | critical-care-nursin..> | 2023-05-03 11:16 | 11K | |
![[IMG]](/icons/image2.gif) | critical-care-nursin..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | critical-care-nursin..> | 2023-05-03 10:19 | 20K | |
![[ ]](/icons/compressed.gif) | critical-care-nursin..> | 2023-05-03 10:19 | 5.2K | |
![[ ]](/icons/layout.gif) | cshtp6_01.pdf | 2023-05-04 02:01 | 1.6M | |
![[ ]](/icons/compressed.gif) | cultant2_ch01.zip | 2023-05-04 02:05 | 1.7M | |
![[IMG]](/icons/image2.gif) | cultural-anthropolog..> | 2023-08-05 03:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | cultural-anthropolog..> | 2023-05-03 10:35 | 30K | |
![[ ]](/icons/compressed.gif) | cultural-anthropolog..> | 2023-05-03 10:35 | 14K | |
![[IMG]](/icons/image2.gif) | cultural-diversity-h..> | 2023-08-05 15:43 | 5.3K | |
![[IMG]](/icons/image2.gif) | cultural-diversity-h..> | 2023-08-05 01:52 | 33K | |
![[IMG]](/icons/image2.gif) | cultural-diversity-h..> | 2023-05-03 09:37 | 124K | |
![[ ]](/icons/compressed.gif) | cultural-diversity-h..> | 2023-05-03 09:37 | 45K | |
![[IMG]](/icons/image2.gif) | cultural-diversity-i..> | 2023-08-05 14:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | cultural-diversity-i..> | 2023-05-03 11:23 | 25K | |
![[ ]](/icons/compressed.gif) | cultural-diversity-i..> | 2023-05-03 11:23 | 20K | |
![[IMG]](/icons/image2.gif) | cultural-psychology-..> | 2023-08-05 02:03 | 4.4K | |
![[IMG]](/icons/image2.gif) | cultural-psychology-..> | 2023-05-03 10:12 | 27K | |
![[ ]](/icons/compressed.gif) | culture-and-psycholo..> | 2023-05-03 13:40 | 16K | |
![[IMG]](/icons/image2.gif) | culture-and-psycholo..> | 2023-08-06 09:43 | 3.7K | |
![[IMG]](/icons/image2.gif) | culture-and-psycholo..> | 2023-05-03 09:24 | 28K | |
![[ ]](/icons/compressed.gif) | culture-and-psycholo..> | 2023-05-03 09:24 | 22K | |
![[IMG]](/icons/image2.gif) | customer-service-ski..> | 2023-08-05 04:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | customer-service-ski..> | 2023-08-05 01:52 | 18K | |
![[IMG]](/icons/image2.gif) | customer-service-ski..> | 2023-05-03 10:31 | 43K | |
![[ ]](/icons/compressed.gif) | customer-service-ski..> | 2023-05-03 10:31 | 282K | |
![[IMG]](/icons/image2.gif) | cyberspace-cybersecu..> | 2023-08-05 03:41 | 4.3K | |
![[IMG]](/icons/image2.gif) | cyberspace-cybersecu..> | 2023-08-05 01:52 | 29K | |
![[IMG]](/icons/image2.gif) | cyberspace-cybersecu..> | 2023-05-03 09:42 | 51K | |
![[ ]](/icons/compressed.gif) | cyberspace-cybersecu..> | 2023-05-03 09:42 | 29K | |
![[IMG]](/icons/image2.gif) | database-concepts-kr..> | 2023-08-06 11:17 | 2.9K | |
![[IMG]](/icons/image2.gif) | database-concepts-kr..> | 2023-05-03 10:01 | 16K | |
![[ ]](/icons/compressed.gif) | database-concepts-kr..> | 2023-05-03 10:01 | 13K | |
![[IMG]](/icons/image2.gif) | database-concepts-kr..> | 2023-08-05 14:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | database-concepts-kr..> | 2023-05-03 10:20 | 21K | |
![[ ]](/icons/compressed.gif) | database-concepts-kr..> | 2023-05-03 10:20 | 14K | |
![[IMG]](/icons/image2.gif) | database-systems-pra..> | 2023-08-05 15:31 | 4.1K | |
![[IMG]](/icons/image2.gif) | database-systems-pra..> | 2023-08-05 01:52 | 19K | |
![[IMG]](/icons/image2.gif) | database-systems-pra..> | 2023-05-03 09:46 | 76K | |
![[ ]](/icons/compressed.gif) | database-systems-pra..> | 2023-05-03 09:46 | 29K | |
![[ ]](/icons/unknown.gif) | david_sm17_case_im_0..> | 2023-05-04 02:02 | 1.3M | |
![[ ]](/icons/compressed.gif) | decision-support-and..> | 2023-05-03 09:07 | 15K | |
![[IMG]](/icons/image2.gif) | dental-hygiene-theor..> | 2023-08-06 12:09 | 2.9K | |
![[IMG]](/icons/image2.gif) | dental-hygiene-theor..> | 2023-05-03 10:53 | 16K | |
![[IMG]](/icons/image2.gif) | dental-instruments-a..> | 2023-08-09 04:09 | 12K | |
![[IMG]](/icons/image2.gif) | dental-instruments-a..> | 2023-05-03 09:33 | 25K | |
![[IMG]](/icons/image2.gif) | dental-materials-pro..> | 2023-08-05 15:29 | 3.1K | |
![[IMG]](/icons/image2.gif) | dental-materials-pro..> | 2023-05-04 02:22 | 17K | |
![[IMG]](/icons/image2.gif) | dental-radiography-p..> | 2023-08-05 03:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | dental-radiography-p..> | 2023-05-03 10:00 | 18K | |
![[ ]](/icons/compressed.gif) | dental-radiography-p..> | 2023-05-03 10:00 | 11K | |
![[ ]](/icons/unknown.gif) | despelder11e_chapter..> | 2023-05-03 13:41 | 24K | |
![[IMG]](/icons/image2.gif) | desscover1-100x100.jpg | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | desscover1-300x300.jpg | 2023-08-12 04:49 | 19K | |
![[IMG]](/icons/image2.gif) | desscover1.jpg | 2023-05-03 10:35 | 44K | |
![[ ]](/icons/compressed.gif) | dessler_fhrm7_tif_01..> | 2023-05-03 10:11 | 17K | |
![[ ]](/icons/unknown.gif) | dessler_fhrm_7e_im_0..> | 2023-05-03 10:09 | 117K | |
![[ ]](/icons/unknown.gif) | deveaux_stats_1ce_TI..> | 2023-05-03 09:43 | 63K | |
![[IMG]](/icons/image2.gif) | developing-managemen..> | 2023-08-06 08:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | developing-managemen..> | 2023-05-03 09:33 | 22K | |
![[ ]](/icons/compressed.gif) | developing-managemen..> | 2023-05-03 09:33 | 46K | |
![[IMG]](/icons/image2.gif) | developing-person-th..> | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | developing-person-th..> | 2023-08-05 01:52 | 24K | |
![[IMG]](/icons/image2.gif) | developing-person-th..> | 2023-05-04 02:06 | 37K | |
![[ ]](/icons/compressed.gif) | developing-person-th..> | 2023-05-04 02:06 | 87K | |
![[IMG]](/icons/image2.gif) | development-across-t..> | 2023-08-05 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | development-across-t..> | 2023-05-03 09:21 | 10K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-08-08 15:35 | 5.0K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-08-05 16:23 | 36K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-05-03 09:23 | 121K | |
![[ ]](/icons/compressed.gif) | development-through-..> | 2023-05-03 09:23 | 80K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-08-05 04:34 | 5.0K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-08-08 23:01 | 36K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-05-03 10:03 | 122K | |
![[ ]](/icons/compressed.gif) | development-through-..> | 2023-05-03 10:03 | 421K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-08-06 07:46 | 4.9K | |
![[IMG]](/icons/image2.gif) | development-through-..> | 2023-05-03 10:37 | 18K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-08-05 02:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-08-08 14:34 | 17K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-05-04 02:13 | 67K | |
![[ ]](/icons/compressed.gif) | developmental-mathem..> | 2023-05-04 02:13 | 207K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-08-05 16:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-08-08 23:01 | 23K | |
![[IMG]](/icons/image2.gif) | developmental-mathem..> | 2023-05-04 02:21 | 62K | |
![[ ]](/icons/compressed.gif) | developmental-mathem..> | 2023-05-04 02:21 | 302K | |
![[IMG]](/icons/image2.gif) | developmental-psycho..> | 2023-08-05 02:03 | 2.9K | |
![[IMG]](/icons/image2.gif) | developmental-psycho..> | 2023-05-03 09:43 | 15K | |
![[ ]](/icons/compressed.gif) | developmental-psycho..> | 2023-05-03 09:43 | 413K | |
![[IMG]](/icons/image2.gif) | deviant-behavior-ale..> | 2023-08-05 02:03 | 3.5K | |
![[IMG]](/icons/image2.gif) | deviant-behavior-ale..> | 2023-05-03 09:58 | 22K | |
![[ ]](/icons/compressed.gif) | deviant-behavior-ale..> | 2023-05-03 09:58 | 41K | |
![[IMG]](/icons/image2.gif) | diagnostic-microbiol..> | 2023-08-05 15:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | diagnostic-microbiol..> | 2023-05-03 09:27 | 21K | |
![[ ]](/icons/compressed.gif) | diagnostic-microbiol..> | 2023-05-03 09:27 | 22K | |
![[ ]](/icons/compressed.gif) | digital-control-syst..> | 2023-05-03 13:42 | 4.9M | |
![[IMG]](/icons/image2.gif) | digital-radiography-..> | 2023-08-07 04:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | digital-radiography-..> | 2023-05-03 10:44 | 20K | |
![[IMG]](/icons/image2.gif) | dimensional-analysis..> | 2023-08-05 16:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | dimensional-analysis..> | 2023-05-03 09:26 | 18K | |
![[ ]](/icons/compressed.gif) | dimensional-analysis..> | 2023-05-03 09:26 | 10K | |
![[IMG]](/icons/image2.gif) | discovering-lifespan..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | discovering-lifespan..> | 2023-08-08 23:01 | 19K | |
![[IMG]](/icons/image2.gif) | discovering-lifespan..> | 2023-05-03 10:17 | 56K | |
![[ ]](/icons/compressed.gif) | discovering-lifespan..> | 2023-05-03 10:17 | 236K | |
![[ ]](/icons/compressed.gif) | discovering-psycholo..> | 2023-05-03 13:44 | 359K | |
![[IMG]](/icons/image2.gif) | discovering-psycholo..> | 2023-08-06 00:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | discovering-psycholo..> | 2023-05-03 10:13 | 27K | |
![[IMG]](/icons/image2.gif) | discovering-psycholo..> | 2023-08-06 11:05 | 2.2K | |
![[IMG]](/icons/image2.gif) | discovering-psycholo..> | 2023-05-03 10:13 | 14K | |
![[ ]](/icons/compressed.gif) | discovering-psycholo..> | 2023-05-03 10:13 | 36K | |
![[ ]](/icons/compressed.gif) | discovering-statisti..> | 2023-05-03 10:07 | 42K | |
![[IMG]](/icons/image2.gif) | discovering-statisti..> | 2023-08-05 15:33 | 2.8K | |
![[IMG]](/icons/image2.gif) | discovering-statisti..> | 2023-05-03 10:07 | 7.2K | |
![[IMG]](/icons/image2.gif) | discovering-the-life..> | 2023-08-05 05:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | discovering-the-life..> | 2023-05-03 09:43 | 23K | |
![[ ]](/icons/compressed.gif) | discovering-the-life..> | 2023-05-03 09:43 | 43K | |
![[IMG]](/icons/image2.gif) | discovering-the-scie..> | 2023-08-05 16:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | discovering-the-scie..> | 2023-08-08 23:01 | 17K | |
![[IMG]](/icons/image2.gif) | discovering-the-scie..> | 2023-05-03 09:46 | 23K | |
![[ ]](/icons/compressed.gif) | discovering-the-scie..> | 2023-05-03 09:46 | 97K | |
![[IMG]](/icons/image2.gif) | discovery-series-int..> | 2023-05-03 10:38 | 15K | |
![[ ]](/icons/compressed.gif) | discovery-series-int..> | 2023-05-03 10:38 | 25K | |
![[IMG]](/icons/image2.gif) | diversity-in-familie..> | 2023-08-05 19:00 | 3.0K | |
![[IMG]](/icons/image2.gif) | diversity-in-familie..> | 2023-05-03 09:41 | 13K | |
![[ ]](/icons/compressed.gif) | dosage-calculations-..> | 2023-05-03 13:44 | 23K | |
![[IMG]](/icons/image2.gif) | download-2-100x100.jpg | 2023-08-06 10:20 | 2.5K | |
![[IMG]](/icons/image2.gif) | download-2.jpg | 2023-05-03 10:57 | 9.5K | |
![[IMG]](/icons/image2.gif) | download-8-100x100.jpg | 2023-08-08 16:36 | 2.8K | |
![[IMG]](/icons/image2.gif) | download-8.jpg | 2023-05-03 10:29 | 11K | |
![[IMG]](/icons/image2.gif) | download-10-100x100.jpg | 2023-08-06 09:43 | 3.8K | |
![[IMG]](/icons/image2.gif) | download-10.jpg | 2023-05-03 09:42 | 17K | |
![[IMG]](/icons/image2.gif) | download-12-100x100.jpg | 2023-08-06 08:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | download-12.jpg | 2023-05-03 10:29 | 16K | |
![[IMG]](/icons/image2.gif) | download-13-100x100.jpg | 2023-08-06 09:42 | 4.0K | |
![[IMG]](/icons/image2.gif) | download-13.jpg | 2023-05-03 09:41 | 18K | |
![[IMG]](/icons/image2.gif) | download-15-100x100.jpg | 2023-08-06 16:00 | 2.9K | |
![[IMG]](/icons/image2.gif) | download-15.jpg | 2023-05-03 09:30 | 12K | |
![[IMG]](/icons/image2.gif) | download-20-100x100.jpg | 2023-08-07 17:58 | 4.1K | |
![[IMG]](/icons/image2.gif) | download-20.jpg | 2023-05-03 09:23 | 15K | |
![[IMG]](/icons/image2.gif) | download-25-100x100.jpg | 2023-08-05 01:09 | 2.5K | |
![[IMG]](/icons/image2.gif) | download-25.jpg | 2023-05-03 10:11 | 11K | |
![[IMG]](/icons/image2.gif) | download-36-100x100.jpg | 2023-08-06 16:00 | 3.6K | |
![[IMG]](/icons/image2.gif) | download-36.jpg | 2023-05-03 09:26 | 16K | |
![[IMG]](/icons/image2.gif) | download-37-100x100.jpg | 2023-08-05 02:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | download-37.jpg | 2023-05-03 10:42 | 19K | |
![[IMG]](/icons/image2.gif) | download-38-100x100.jpg | 2023-08-06 12:10 | 3.4K | |
![[IMG]](/icons/image2.gif) | download-38.jpg | 2023-05-03 10:24 | 17K | |
![[IMG]](/icons/image2.gif) | download-39-1-100x10..> | 2023-08-05 05:29 | 2.4K | |
![[IMG]](/icons/image2.gif) | download-39-1.jpg | 2023-05-03 11:02 | 12K | |
![[IMG]](/icons/image2.gif) | download-39-100x100.jpg | 2023-08-08 07:31 | 3.5K | |
![[IMG]](/icons/image2.gif) | download-39.jpg | 2023-05-03 09:32 | 14K | |
![[IMG]](/icons/image2.gif) | download-40-100x100.jpg | 2023-08-05 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | download-40.jpg | 2023-05-03 09:31 | 15K | |
![[IMG]](/icons/image2.gif) | download-42-100x100.jpg | 2023-08-05 15:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | download-42.jpg | 2023-05-03 10:41 | 17K | |
![[IMG]](/icons/image2.gif) | download-44-100x100.jpg | 2023-08-05 16:23 | 3.9K | |
![[IMG]](/icons/image2.gif) | download-44.jpg | 2023-05-03 10:26 | 19K | |
![[IMG]](/icons/image2.gif) | download-47-100x100.jpg | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | download-47.jpg | 2023-05-03 10:16 | 14K | |
![[IMG]](/icons/image2.gif) | download-50-100x100.jpg | 2023-08-06 05:47 | 3.8K | |
![[IMG]](/icons/image2.gif) | download-50.jpg | 2023-05-03 09:58 | 22K | |
![[IMG]](/icons/image2.gif) | download-51-100x100.jpg | 2023-08-05 17:17 | 2.7K | |
![[IMG]](/icons/image2.gif) | download-51.jpg | 2023-05-03 10:19 | 11K | |
![[IMG]](/icons/image2.gif) | download-52-100x100.jpg | 2023-08-05 02:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | download-52.jpg | 2023-05-03 10:37 | 11K | |
![[IMG]](/icons/image2.gif) | download-54-100x100.jpg | 2023-08-05 02:47 | 4.8K | |
![[IMG]](/icons/image2.gif) | download-54.jpg | 2023-05-03 10:30 | 23K | |
![[IMG]](/icons/image2.gif) | download-57-100x100.jpg | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | download-57.jpg | 2023-05-03 09:26 | 14K | |
![[IMG]](/icons/image2.gif) | download-58-100x100.jpg | 2023-08-05 03:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | download-58.jpg | 2023-05-03 10:11 | 15K | |
![[IMG]](/icons/image2.gif) | download-59-100x100.jpg | 2023-08-06 16:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | download-59.jpg | 2023-05-03 10:12 | 13K | |
![[IMG]](/icons/image2.gif) | download-62-100x100.jpg | 2023-08-05 04:35 | 2.5K | |
![[IMG]](/icons/image2.gif) | download-62.jpg | 2023-05-03 09:11 | 13K | |
![[IMG]](/icons/image2.gif) | download-100x100.jpg | 2023-08-05 15:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | download.jpg | 2023-05-03 10:32 | 12K | |
![[IMG]](/icons/image2.gif) | download2-100x100.jpg | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | download2.jpg | 2023-05-03 10:11 | 20K | |
![[IMG]](/icons/image2.gif) | drug-calculations-ra..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | drug-calculations-ra..> | 2023-05-03 10:15 | 16K | |
![[ ]](/icons/compressed.gif) | drug-calculations-ra..> | 2023-05-03 10:15 | 23K | |
![[IMG]](/icons/image2.gif) | drug-therapy-in-nurs..> | 2023-08-05 05:29 | 13K | |
![[IMG]](/icons/image2.gif) | drug-therapy-in-nurs..> | 2023-05-03 10:14 | 32K | |
![[ ]](/icons/compressed.gif) | drug-therapy-in-nurs..> | 2023-05-03 10:14 | 92K | |
![[IMG]](/icons/image2.gif) | drugs-and-behavior-i..> | 2023-08-06 12:18 | 3.1K | |
![[IMG]](/icons/image2.gif) | drugs-and-behavior-i..> | 2023-05-03 09:38 | 21K | |
![[ ]](/icons/compressed.gif) | drugs-and-behavior-i..> | 2023-05-03 09:37 | 290K | |
![[IMG]](/icons/image2.gif) | drugs-and-the-neuros..> | 2023-08-05 14:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | drugs-and-the-neuros..> | 2023-08-09 09:54 | 20K | |
![[IMG]](/icons/image2.gif) | drugs-and-the-neuros..> | 2023-05-03 09:57 | 33K | |
![[ ]](/icons/compressed.gif) | drugs-and-the-neuros..> | 2023-05-03 09:57 | 74K | |
![[ ]](/icons/layout.gif) | dubrin4ce_IM_01.pdf | 2023-05-03 13:41 | 40K | |
![[IMG]](/icons/image2.gif) | dynamics-structures-..> | 2023-08-05 01:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | dynamics-structures-..> | 2023-08-08 14:34 | 19K | |
![[IMG]](/icons/image2.gif) | dynamics-structures-..> | 2023-05-03 10:21 | 64K | |
![[ ]](/icons/compressed.gif) | dynamics-structures-..> | 2023-05-03 10:21 | 1.8M | |
![[IMG]](/icons/image2.gif) | e-commerce-2017-13th..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | e-commerce-2017-13th..> | 2023-08-08 14:34 | 18K | |
![[IMG]](/icons/image2.gif) | e-commerce-2017-13th..> | 2023-05-03 09:59 | 73K | |
![[ ]](/icons/compressed.gif) | e-commerce-2017-13th..> | 2023-05-03 09:58 | 328K | |
![[IMG]](/icons/image2.gif) | earth-an-introductio..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | earth-an-introductio..> | 2023-05-03 10:34 | 13K | |
![[IMG]](/icons/image2.gif) | earth-system-history..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | earth-system-history..> | 2023-08-09 09:54 | 32K | |
![[IMG]](/icons/image2.gif) | earth-system-history..> | 2023-05-03 09:40 | 50K | |
![[ ]](/icons/compressed.gif) | earth-system-history..> | 2023-05-03 09:40 | 12K | |
![[ ]](/icons/compressed.gif) | earth-thompson-1st-t..> | 2023-05-03 13:40 | 11K | |
![[ ]](/icons/unknown.gif) | easttom_netd_tb_01.doc | 2023-05-03 13:44 | 52K | |
![[IMG]](/icons/image2.gif) | ebersole-and-hess-ge..> | 2023-08-06 17:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | ebersole-and-hess-ge..> | 2023-05-03 09:58 | 15K | |
![[ ]](/icons/compressed.gif) | ebersole-and-hess-ge..> | 2023-05-03 09:58 | 21K | |
![[IMG]](/icons/image2.gif) | ebersole-and-hess-ge..> | 2023-08-08 07:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | ebersole-and-hess-ge..> | 2023-05-03 11:16 | 23K | |
![[ ]](/icons/compressed.gif) | ebersole-and-hess-ge..> | 2023-05-03 11:16 | 21K | |
![[IMG]](/icons/image2.gif) | ebersole-hess-toward..> | 2023-08-07 15:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | ebersole-hess-toward..> | 2023-05-03 11:00 | 20K | |
![[ ]](/icons/compressed.gif) | ebersole-hess-toward..> | 2023-05-03 11:00 | 14K | |
![[ ]](/icons/unknown.gif) | ebert_be10_tb01.doc | 2023-05-03 10:36 | 137K | |
![[ ]](/icons/unknown.gif) | ebert_be10e_im00.doc | 2023-05-03 09:41 | 51K | |
![[IMG]](/icons/image2.gif) | ebusiness-a-canadian..> | 2023-08-05 14:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | ebusiness-a-canadian..> | 2023-05-03 09:54 | 21K | |
![[ ]](/icons/compressed.gif) | ebusiness-a-canadian..> | 2023-05-03 09:54 | 16K | |
![[IMG]](/icons/image2.gif) | ecgs-made-easy-aehle..> | 2023-08-08 21:06 | 3.6K | |
![[IMG]](/icons/image2.gif) | ecgs-made-easy-aehle..> | 2023-05-03 10:09 | 19K | |
![[ ]](/icons/compressed.gif) | ecgs-made-easy-aehle..> | 2023-05-03 10:09 | 23K | |
![[IMG]](/icons/image2.gif) | ecgs-made-easy-barba..> | 2023-08-05 02:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | ecgs-made-easy-barba..> | 2023-05-03 09:46 | 20K | |
![[ ]](/icons/compressed.gif) | ecgs-made-easy-barba..> | 2023-05-03 09:46 | 19K | |
![[IMG]](/icons/image2.gif) | ecology-concepts-and..> | 2023-08-05 22:02 | 4.1K | |
![[IMG]](/icons/image2.gif) | ecology-concepts-and..> | 2023-05-03 11:25 | 28K | |
![[ ]](/icons/compressed.gif) | ecology-concepts-and..> | 2023-05-03 11:25 | 147K | |
![[IMG]](/icons/image2.gif) | econ-for-macroeconom..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | econ-for-macroeconom..> | 2023-05-03 10:50 | 22K | |
![[IMG]](/icons/image2.gif) | econ-macroeconomics-..> | 2023-08-05 05:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | econ-macroeconomics-..> | 2023-08-08 20:08 | 20K | |
![[IMG]](/icons/image2.gif) | econ-macroeconomics-..> | 2023-05-03 10:28 | 168K | |
![[ ]](/icons/compressed.gif) | econ-macroeconomics-..> | 2023-05-03 10:28 | 422K | |
![[IMG]](/icons/image2.gif) | econ-micro-mceachern..> | 2023-08-05 05:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | econ-micro-mceachern..> | 2023-05-04 01:59 | 24K | |
![[ ]](/icons/compressed.gif) | econ-micro-mceachern..> | 2023-05-04 01:59 | 37K | |
![[IMG]](/icons/image2.gif) | economic-development..> | 2023-08-05 02:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | economic-development..> | 2023-05-03 10:29 | 25K | |
![[IMG]](/icons/image2.gif) | economics-1st-editio..> | 2023-08-05 03:43 | 1.9K | |
![[IMG]](/icons/image2.gif) | economics-1st-editio..> | 2023-08-08 20:08 | 7.7K | |
![[IMG]](/icons/image2.gif) | economics-1st-editio..> | 2023-05-03 10:25 | 14K | |
![[ ]](/icons/compressed.gif) | economics-1st-editio..> | 2023-05-03 10:25 | 895K | |
![[IMG]](/icons/image2.gif) | economics-12th-editi..> | 2023-08-05 02:03 | 2.4K | |
![[IMG]](/icons/image2.gif) | economics-12th-editi..> | 2023-08-08 20:08 | 12K | |
![[IMG]](/icons/image2.gif) | economics-12th-editi..> | 2023-05-04 01:49 | 53K | |
![[ ]](/icons/compressed.gif) | economics-12th-editi..> | 2023-05-04 01:49 | 270K | |
![[IMG]](/icons/image2.gif) | economics-21st-editi..> | 2023-08-06 03:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | economics-21st-editi..> | 2023-08-08 20:08 | 23K | |
![[IMG]](/icons/image2.gif) | economics-21st-editi..> | 2023-05-03 09:31 | 66K | |
![[ ]](/icons/compressed.gif) | economics-21st-editi..> | 2023-05-03 09:31 | 692K | |
![[IMG]](/icons/image2.gif) | economics-canada-glo..> | 2023-08-05 01:12 | 2.4K | |
![[IMG]](/icons/image2.gif) | economics-canada-glo..> | 2023-08-08 20:08 | 13K | |
![[IMG]](/icons/image2.gif) | economics-canada-glo..> | 2023-05-03 10:47 | 29K | |
![[ ]](/icons/compressed.gif) | economics-canada-glo..> | 2023-05-03 10:47 | 4.2M | |
![[IMG]](/icons/image2.gif) | economics-mcconnell-..> | 2023-05-03 09:38 | 9.1K | |
![[IMG]](/icons/image2.gif) | economics-money-bank..> | 2023-08-08 06:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | economics-money-bank..> | 2023-08-08 20:08 | 24K | |
![[IMG]](/icons/image2.gif) | economics-money-bank..> | 2023-05-03 10:02 | 103K | |
![[ ]](/icons/compressed.gif) | economics-money-bank..> | 2023-05-03 10:02 | 92K | |
![[IMG]](/icons/image2.gif) | economics-principles..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | economics-principles..> | 2023-08-08 20:08 | 16K | |
![[IMG]](/icons/image2.gif) | economics-principles..> | 2023-05-04 02:28 | 49K | |
![[ ]](/icons/compressed.gif) | economics-principles..> | 2023-05-04 02:28 | 240K | |
![[IMG]](/icons/image2.gif) | economics-principles..> | 2023-08-06 08:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | economics-principles..> | 2023-05-03 10:04 | 8.3K | |
![[ ]](/icons/compressed.gif) | economics-principles..> | 2023-05-03 09:38 | 1.9M | |
![[ ]](/icons/compressed.gif) | economics-principles..> | 2023-05-03 10:04 | 965K | |
![[IMG]](/icons/image2.gif) | economics-r-glenn-hu..> | 2023-08-06 10:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | economics-r-glenn-hu..> | 2023-05-03 09:24 | 14K | |
![[ ]](/icons/compressed.gif) | economics-r-glenn-hu..> | 2023-05-03 09:24 | 450K | |
![[IMG]](/icons/image2.gif) | economics-strategy-7..> | 2023-08-06 11:15 | 3.4K | |
![[IMG]](/icons/image2.gif) | economics-strategy-7..> | 2023-08-08 20:08 | 19K | |
![[IMG]](/icons/image2.gif) | economics-strategy-7..> | 2023-05-04 02:21 | 29K | |
![[ ]](/icons/compressed.gif) | economics-strategy-7..> | 2023-05-04 02:21 | 145K | |
![[IMG]](/icons/image2.gif) | economics-thirteenth..> | 2023-08-06 09:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | economics-thirteenth..> | 2023-05-03 11:16 | 23K | |
![[IMG]](/icons/image2.gif) | economics-today-the-..> | 2023-08-06 08:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | economics-today-the-..> | 2023-05-03 09:49 | 19K | |
![[ ]](/icons/compressed.gif) | economics-today-the-..> | 2023-05-03 09:49 | 48K | |
![[ ]](/icons/unknown.gif) | edmonds1e_chapter01_..> | 2023-05-04 02:29 | 738K | |
![[ ]](/icons/compressed.gif) | edmonds_ffac_10e_wor..> | 2023-05-04 02:02 | 110K | |
![[IMG]](/icons/image2.gif) | educating-exceptiona..> | 2023-08-06 05:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | educating-exceptiona..> | 2023-05-03 10:25 | 17K | |
![[ ]](/icons/compressed.gif) | educating-exceptiona..> | 2023-05-03 10:25 | 22K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-08-07 10:43 | 4.8K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-05-03 10:26 | 19K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-08-05 14:38 | 4.8K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-05-03 10:23 | 19K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-08-08 23:55 | 4.3K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-05-03 10:21 | 22K | |
![[ ]](/icons/compressed.gif) | educational-psycholo..> | 2023-05-03 10:21 | 140K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-08-05 16:16 | 3.0K | |
![[IMG]](/icons/image2.gif) | educational-psycholo..> | 2023-05-03 10:44 | 17K | |
![[ ]](/icons/compressed.gif) | educational-psycholo..> | 2023-05-03 10:44 | 94K | |
![[ ]](/icons/compressed.gif) | educational-research..> | 2023-05-03 10:47 | 17K | |
![[IMG]](/icons/image2.gif) | educational-research..> | 2023-08-05 01:52 | 3.3K | |
![[IMG]](/icons/image2.gif) | educational-research..> | 2023-05-03 10:47 | 12K | |
![[IMG]](/icons/image2.gif) | educational-research..> | 2023-08-05 04:37 | 3.7K | |
![[IMG]](/icons/image2.gif) | educational-research..> | 2023-08-05 01:51 | 23K | |
![[IMG]](/icons/image2.gif) | educational-research..> | 2023-05-03 09:19 | 38K | |
![[ ]](/icons/compressed.gif) | educational-research..> | 2023-05-03 09:19 | 1.5M | |
![[IMG]](/icons/image2.gif) | effective-human-rela..> | 2023-08-05 14:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | effective-human-rela..> | 2023-08-09 09:12 | 18K | |
![[IMG]](/icons/image2.gif) | effective-human-rela..> | 2023-05-03 09:36 | 47K | |
![[ ]](/icons/compressed.gif) | effective-human-rela..> | 2023-05-03 09:36 | 59K | |
![[IMG]](/icons/image2.gif) | effective-leadership..> | 2023-08-06 12:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | effective-leadership..> | 2023-05-03 10:45 | 11K | |
![[ ]](/icons/compressed.gif) | effective-leadership..> | 2023-05-03 10:45 | 20K | |
![[IMG]](/icons/image2.gif) | effective-training-s..> | 2023-08-05 15:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | effective-training-s..> | 2023-05-03 11:26 | 29K | |
![[ ]](/icons/compressed.gif) | effective-training-s..> | 2023-05-03 11:26 | 15K | |
![[IMG]](/icons/image2.gif) | effective-training-s..> | 2023-08-06 13:05 | 2.4K | |
![[IMG]](/icons/image2.gif) | effective-training-s..> | 2023-05-03 10:13 | 17K | |
![[ ]](/icons/compressed.gif) | effective-training-s..> | 2023-05-03 10:13 | 16K | |
![[IMG]](/icons/image2.gif) | egans-fundamentals-o..> | 2023-08-06 13:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | egans-fundamentals-o..> | 2023-05-03 10:05 | 15K | |
![[ ]](/icons/compressed.gif) | egans-fundamentals-o..> | 2023-05-03 10:05 | 14K | |
![[IMG]](/icons/image2.gif) | egans-fundamentals-o..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | egans-fundamentals-o..> | 2023-05-03 09:29 | 21K | |
![[ ]](/icons/compressed.gif) | egans-fundamentals-o..> | 2023-05-03 09:29 | 14K | |
![[IMG]](/icons/image2.gif) | ekg-plain-and-simple..> | 2023-08-06 07:48 | 2.5K | |
![[IMG]](/icons/image2.gif) | ekg-plain-and-simple..> | 2023-05-03 10:48 | 15K | |
![[ ]](/icons/compressed.gif) | ekg-plain-and-simple..> | 2023-05-03 10:48 | 9.5K | |
![[IMG]](/icons/image2.gif) | electric-circuits-10..> | 2023-08-05 01:52 | 4.0K | |
![[IMG]](/icons/image2.gif) | electric-circuits-10..> | 2023-08-09 02:53 | 25K | |
![[IMG]](/icons/image2.gif) | electric-circuits-10..> | 2023-05-03 09:47 | 99K | |
![[ ]](/icons/compressed.gif) | electric-circuits-10..> | 2023-05-03 09:47 | 344K | |
![[IMG]](/icons/image2.gif) | electrical-control-m..> | 2023-08-05 14:35 | 4.4K | |
![[IMG]](/icons/image2.gif) | electrical-control-m..> | 2023-08-09 02:53 | 23K | |
![[IMG]](/icons/image2.gif) | electrical-control-m..> | 2023-05-03 09:47 | 53K | |
![[ ]](/icons/compressed.gif) | electrical-control-m..> | 2023-05-03 09:47 | 180K | |
![[IMG]](/icons/image2.gif) | electrocardiography-..> | 2023-08-05 03:40 | 2.3K | |
![[IMG]](/icons/image2.gif) | electrocardiography-..> | 2023-05-03 09:51 | 15K | |
![[ ]](/icons/compressed.gif) | electrocardiography-..> | 2023-05-03 09:51 | 189K | |
![[IMG]](/icons/image2.gif) | electronic-commerce-..> | 2023-08-08 07:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | electronic-commerce-..> | 2023-05-03 10:14 | 14K | |
![[ ]](/icons/compressed.gif) | electronic-commerce-..> | 2023-05-03 10:14 | 8.3K | |
![[IMG]](/icons/image2.gif) | electronic-devices-c..> | 2023-08-06 09:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | electronic-devices-c..> | 2023-08-09 02:53 | 19K | |
![[IMG]](/icons/image2.gif) | electronic-devices-c..> | 2023-05-04 02:09 | 62K | |
![[ ]](/icons/compressed.gif) | electronic-devices-c..> | 2023-05-04 02:09 | 716K | |
![[IMG]](/icons/image2.gif) | electronic-health-re..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | electronic-health-re..> | 2023-05-03 10:08 | 21K | |
![[ ]](/icons/compressed.gif) | electronic-health-re..> | 2023-05-03 10:08 | 20K | |
![[IMG]](/icons/image2.gif) | elementary-algebra-1..> | 2023-08-06 09:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | elementary-algebra-1..> | 2023-08-09 09:12 | 14K | |
![[IMG]](/icons/image2.gif) | elementary-algebra-1..> | 2023-05-03 10:16 | 38K | |
![[ ]](/icons/compressed.gif) | elementary-algebra-1..> | 2023-05-03 10:16 | 18K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-08-06 12:17 | 3.6K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-08-09 02:53 | 19K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-05-04 02:29 | 49K | |
![[ ]](/icons/compressed.gif) | elementary-linear-al..> | 2023-05-04 02:29 | 490K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-08-05 17:19 | 4.0K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-08-09 02:53 | 23K | |
![[IMG]](/icons/image2.gif) | elementary-linear-al..> | 2023-05-04 01:51 | 86K | |
![[ ]](/icons/compressed.gif) | elementary-linear-al..> | 2023-05-04 01:51 | 108K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 02:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-09 09:12 | 15K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 10:11 | 29K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 10:11 | 1.6M | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-08 07:32 | 2.8K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-09 11:11 | 15K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 09:40 | 49K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 09:40 | 313K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 02:45 | 2.6K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-09 11:11 | 15K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 10:27 | 71K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 10:27 | 683K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-06 07:45 | 3.1K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-09 09:12 | 14K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 09:59 | 63K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 09:59 | 1.6M | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 05:34 | 2.9K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 10:12 | 9.4K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 10:12 | 11K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-06 07:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 11:08 | 9.5K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 09:31 | 4.7K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 03:40 | 2.2K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-04 02:15 | 5.9K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-06 08:36 | 2.2K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 10:17 | 5.9K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 06:24 | 2.6K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 09:47 | 7.6K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-08-05 04:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | elementary-statistic..> | 2023-05-03 11:10 | 16K | |
![[ ]](/icons/compressed.gif) | elementary-statistic..> | 2023-05-03 11:10 | 1.9M | |
![[IMG]](/icons/image2.gif) | elements-ecology-9th..> | 2023-08-09 23:27 | 2.8K | |
![[IMG]](/icons/image2.gif) | elements-ecology-9th..> | 2023-08-08 08:38 | 17K | |
![[IMG]](/icons/image2.gif) | elements-ecology-9th..> | 2023-05-04 02:19 | 65K | |
![[ ]](/icons/compressed.gif) | elements-ecology-9th..> | 2023-05-04 02:19 | 421K | |
![[ ]](/icons/compressed.gif) | ember 01.zip | 2023-05-03 11:20 | 12K | |
![[ ]](/icons/compressed.gif) | emergency-care-12e-l..> | 2023-05-03 09:07 | 166K | |
![[IMG]](/icons/image2.gif) | employee-training-an..> | 2023-08-05 01:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | employee-training-an..> | 2023-05-03 09:50 | 17K | |
![[ ]](/icons/compressed.gif) | employee-training-an..> | 2023-05-03 09:50 | 31K | |
![[ ]](/icons/compressed.gif) | employment-law-busin..> | 2023-05-03 13:42 | 637K | |
![[IMG]](/icons/image2.gif) | employment-law-busin..> | 2023-08-05 01:51 | 2.7K | |
![[IMG]](/icons/image2.gif) | employment-law-busin..> | 2023-08-08 08:38 | 13K | |
![[IMG]](/icons/image2.gif) | employment-law-busin..> | 2023-05-03 10:55 | 37K | |
![[ ]](/icons/compressed.gif) | employment-law-busin..> | 2023-05-03 10:55 | 290K | |
![[IMG]](/icons/image2.gif) | employment-law-for-h..> | 2023-08-08 23:00 | 3.6K | |
![[IMG]](/icons/image2.gif) | employment-law-for-h..> | 2023-05-03 09:56 | 20K | |
![[ ]](/icons/compressed.gif) | employment-law-for-h..> | 2023-05-03 09:56 | 14K | |
![[IMG]](/icons/image2.gif) | employment-law-moran..> | 2023-08-06 08:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | employment-law-moran..> | 2023-05-03 10:26 | 16K | |
![[ ]](/icons/compressed.gif) | employment-law-moran..> | 2023-05-03 10:26 | 9.4K | |
![[IMG]](/icons/image2.gif) | enduring-vision-hist..> | 2023-08-06 07:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | enduring-vision-hist..> | 2023-08-08 08:38 | 16K | |
![[IMG]](/icons/image2.gif) | enduring-vision-hist..> | 2023-05-04 02:16 | 44K | |
![[ ]](/icons/compressed.gif) | enduring-vision-hist..> | 2023-05-04 02:16 | 240K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-08-05 01:12 | 4.3K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-08-08 08:38 | 25K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-05-04 01:48 | 40K | |
![[ ]](/icons/compressed.gif) | engineering-economy-..> | 2023-05-04 01:48 | 246K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-08-08 08:38 | 26K | |
![[IMG]](/icons/image2.gif) | engineering-economy-..> | 2023-05-04 01:56 | 135K | |
![[ ]](/icons/compressed.gif) | engineering-economy-..> | 2023-05-04 01:56 | 92K | |
![[IMG]](/icons/image2.gif) | engineering-electrom..> | 2023-08-06 10:18 | 3.3K | |
![[IMG]](/icons/image2.gif) | engineering-electrom..> | 2023-08-08 08:38 | 17K | |
![[IMG]](/icons/image2.gif) | engineering-electrom..> | 2023-05-03 10:01 | 76K | |
![[ ]](/icons/compressed.gif) | engineering-electrom..> | 2023-05-03 10:01 | 11M | |
![[IMG]](/icons/image2.gif) | engineering-mechanic..> | 2023-08-06 10:18 | 3.2K | |
![[IMG]](/icons/image2.gif) | engineering-mechanic..> | 2023-05-04 01:47 | 7.4K | |
![[IMG]](/icons/image2.gif) | engineering-mechanic..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | engineering-mechanic..> | 2023-08-08 08:38 | 20K | |
![[IMG]](/icons/image2.gif) | engineering-mechanic..> | 2023-05-03 11:21 | 100K | |
![[ ]](/icons/compressed.gif) | engineering-mechanic..> | 2023-05-03 11:21 | 11M | |
![[IMG]](/icons/image2.gif) | entrepreneurial-fina..> | 2023-05-03 09:53 | 42K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-200..> | 2023-08-08 06:43 | 4.2K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-200..> | 2023-08-08 08:38 | 25K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-200..> | 2023-05-03 11:00 | 38K | |
![[ ]](/icons/compressed.gif) | entrepreneurship-200..> | 2023-05-03 11:00 | 110K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-sma..> | 2023-08-05 14:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-sma..> | 2023-08-08 08:38 | 19K | |
![[IMG]](/icons/image2.gif) | entrepreneurship-sma..> | 2023-05-03 10:05 | 98K | |
![[ ]](/icons/compressed.gif) | entrepreneurship-sma..> | 2023-05-03 10:04 | 281K | |
![[IMG]](/icons/image2.gif) | environment-and-you-..> | 2023-08-06 08:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | environment-and-you-..> | 2023-05-03 09:23 | 26K | |
![[ ]](/icons/compressed.gif) | environment-and-you-..> | 2023-05-03 09:23 | 109K | |
![[IMG]](/icons/image2.gif) | environment-the-scie..> | 2023-08-08 02:00 | 2.8K | |
![[IMG]](/icons/image2.gif) | environment-the-scie..> | 2023-05-03 09:35 | 15K | |
![[ ]](/icons/compressed.gif) | environment-the-scie..> | 2023-05-03 09:35 | 52K | |
![[IMG]](/icons/image2.gif) | environmental-econom..> | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | environmental-econom..> | 2023-05-03 11:04 | 19K | |
![[ ]](/icons/compressed.gif) | environmental-econom..> | 2023-05-03 11:04 | 26K | |
![[IMG]](/icons/image2.gif) | environmental-geolog..> | 2023-08-05 15:30 | 15K | |
![[IMG]](/icons/image2.gif) | environmental-geolog..> | 2023-05-03 09:20 | 44K | |
![[ ]](/icons/compressed.gif) | environmental-geolog..> | 2023-05-03 09:20 | 109K | |
![[ ]](/icons/compressed.gif) | environmental-scienc..> | 2023-05-03 13:44 | 410K | |
![[IMG]](/icons/image2.gif) | environmental-scienc..> | 2023-08-06 08:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | environmental-scienc..> | 2023-05-03 09:39 | 28K | |
![[ ]](/icons/compressed.gif) | environmental-scienc..> | 2023-05-03 09:39 | 95K | |
![[IMG]](/icons/image2.gif) | essential-calculus-e..> | 2023-05-03 10:49 | 10K | |
![[ ]](/icons/compressed.gif) | essential-calculus-e..> | 2023-05-03 10:49 | 482K | |
![[IMG]](/icons/image2.gif) | essential-cell-biolo..> | 2023-08-06 04:19 | 7.6K | |
![[IMG]](/icons/image2.gif) | essential-cell-biolo..> | 2023-05-03 10:35 | 28K | |
![[ ]](/icons/compressed.gif) | essential-cell-biolo..> | 2023-05-03 10:34 | 162K | |
![[IMG]](/icons/image2.gif) | essential-college-ph..> | 2023-08-06 12:11 | 3.1K | |
![[IMG]](/icons/image2.gif) | essential-college-ph..> | 2023-05-03 09:52 | 20K | |
![[ ]](/icons/compressed.gif) | essential-college-ph..> | 2023-05-03 09:52 | 12K | |
![[IMG]](/icons/image2.gif) | essential-environmen..> | 2023-08-06 11:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | essential-environmen..> | 2023-05-03 10:07 | 16K | |
![[ ]](/icons/compressed.gif) | essential-environmen..> | 2023-05-03 10:06 | 152K | |
![[ ]](/icons/compressed.gif) | essential-organic-ch..> | 2023-05-03 09:20 | 538K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-08-07 08:54 | 4.9K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-08-05 06:17 | 28K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-05-04 01:56 | 53K | |
![[ ]](/icons/compressed.gif) | essential-statistics..> | 2023-05-04 01:56 | 134K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-08-05 06:17 | 22K | |
![[IMG]](/icons/image2.gif) | essential-statistics..> | 2023-05-03 10:30 | 36K | |
![[ ]](/icons/compressed.gif) | essential-statistics..> | 2023-05-03 10:30 | 1.3M | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-08-06 07:49 | 3.6K | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-08-05 06:17 | 17K | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-05-03 09:23 | 46K | |
![[ ]](/icons/compressed.gif) | essentials-accountin..> | 2023-05-03 09:23 | 378K | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-08-06 13:11 | 3.6K | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-08-05 06:17 | 17K | |
![[IMG]](/icons/image2.gif) | essentials-accountin..> | 2023-05-03 10:54 | 46K | |
![[ ]](/icons/compressed.gif) | essentials-accountin..> | 2023-05-03 10:54 | 222K | |
![[ ]](/icons/compressed.gif) | essentials-business-..> | 2023-05-03 13:44 | 310K | |
![[IMG]](/icons/image2.gif) | essentials-business-..> | 2023-08-06 11:14 | 4.1K | |
![[IMG]](/icons/image2.gif) | essentials-business-..> | 2023-08-05 06:17 | 24K | |
![[IMG]](/icons/image2.gif) | essentials-business-..> | 2023-05-04 02:19 | 61K | |
![[ ]](/icons/compressed.gif) | essentials-business-..> | 2023-05-04 02:19 | 151K | |
![[ ]](/icons/compressed.gif) | essentials-contempor..> | 2023-05-03 13:43 | 295K | |
![[IMG]](/icons/image2.gif) | essentials-database-..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | essentials-database-..> | 2023-08-17 07:51 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-database-..> | 2023-05-04 01:53 | 79K | |
![[ ]](/icons/compressed.gif) | essentials-database-..> | 2023-05-04 01:53 | 2.1M | |
![[IMG]](/icons/image2.gif) | essentials-economics..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | essentials-economics..> | 2023-08-17 07:51 | 17K | |
![[IMG]](/icons/image2.gif) | essentials-economics..> | 2023-05-04 02:27 | 47K | |
![[ ]](/icons/compressed.gif) | essentials-economics..> | 2023-05-04 02:27 | 1.8M | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-08-05 02:08 | 3.8K | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-08-17 07:51 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-05-04 02:18 | 67K | |
![[ ]](/icons/compressed.gif) | essentials-entrepren..> | 2023-05-04 02:18 | 777K | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-08-05 05:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-08-17 07:51 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-entrepren..> | 2023-05-03 09:29 | 67K | |
![[ ]](/icons/compressed.gif) | essentials-entrepren..> | 2023-05-03 09:29 | 155K | |
![[IMG]](/icons/image2.gif) | essentials-federal-t..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-federal-t..> | 2023-08-17 07:51 | 16K | |
![[IMG]](/icons/image2.gif) | essentials-federal-t..> | 2023-05-04 02:04 | 41K | |
![[ ]](/icons/compressed.gif) | essentials-federal-t..> | 2023-05-04 02:04 | 396K | |
![[IMG]](/icons/image2.gif) | essentials-fire-figh..> | 2023-05-03 10:07 | 59K | |
![[ ]](/icons/compressed.gif) | essentials-fire-figh..> | 2023-05-03 10:07 | 144K | |
![[IMG]](/icons/image2.gif) | essentials-genetics-..> | 2023-08-06 00:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | essentials-genetics-..> | 2023-08-17 07:51 | 23K | |
![[IMG]](/icons/image2.gif) | essentials-genetics-..> | 2023-05-04 02:17 | 88K | |
![[ ]](/icons/compressed.gif) | essentials-genetics-..> | 2023-05-04 02:17 | 1.9M | |
![[IMG]](/icons/image2.gif) | essentials-human-ana..> | 2023-08-06 11:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | essentials-human-ana..> | 2023-08-17 07:51 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-human-ana..> | 2023-05-03 09:30 | 75K | |
![[ ]](/icons/compressed.gif) | essentials-human-ana..> | 2023-05-03 09:30 | 240K | |
![[IMG]](/icons/image2.gif) | essentials-marketing..> | 2023-08-05 15:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | essentials-marketing..> | 2023-08-11 11:08 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-marketing..> | 2023-05-03 09:44 | 54K | |
![[ ]](/icons/compressed.gif) | essentials-marketing..> | 2023-05-03 09:44 | 204K | |
![[IMG]](/icons/image2.gif) | essentials-of-abnorm..> | 2023-08-07 10:36 | 2.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-abnorm..> | 2023-05-03 09:34 | 14K | |
![[ ]](/icons/compressed.gif) | essentials-of-abnorm..> | 2023-05-03 09:34 | 31K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-08-06 02:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-05-03 11:24 | 8.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-08-08 17:39 | 3.3K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-05-03 09:30 | 7.7K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-08-05 06:19 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-accoun..> | 2023-05-03 11:09 | 8.9K | |
![[IMG]](/icons/image2.gif) | essentials-of-anatom..> | 2023-08-05 01:51 | 3.6K | |
![[IMG]](/icons/image2.gif) | essentials-of-anatom..> | 2023-05-03 11:25 | 22K | |
![[ ]](/icons/compressed.gif) | essentials-of-anatom..> | 2023-05-03 11:25 | 25K | |
![[IMG]](/icons/image2.gif) | essentials-of-anatom..> | 2023-08-08 11:50 | 2.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-anatom..> | 2023-05-03 10:05 | 16K | |
![[ ]](/icons/compressed.gif) | essentials-of-anatom..> | 2023-05-03 10:05 | 738K | |
![[IMG]](/icons/image2.gif) | essentials-of-biolog..> | 2023-08-05 05:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | essentials-of-biolog..> | 2023-05-03 10:01 | 24K | |
![[ ]](/icons/compressed.gif) | essentials-of-biolog..> | 2023-05-03 10:01 | 740K | |
![[ ]](/icons/compressed.gif) | essentials-of-busine..> | 2023-05-03 09:12 | 20K | |
![[IMG]](/icons/image2.gif) | essentials-of-contem..> | 2023-08-06 07:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-contem..> | 2023-05-03 10:19 | 18K | |
![[ ]](/icons/compressed.gif) | essentials-of-contem..> | 2023-05-03 10:19 | 87K | |
![[ ]](/icons/compressed.gif) | essentials-of-corpor..> | 2023-05-03 09:44 | 78K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-08-05 02:13 | 4.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-05-03 09:29 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-08-05 06:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-05-03 09:44 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-08-06 10:17 | 1.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-corpor..> | 2023-05-03 09:18 | 12K | |
![[ ]](/icons/compressed.gif) | essentials-of-corpor..> | 2023-05-03 09:18 | 40K | |
![[IMG]](/icons/image2.gif) | essentials-of-dental..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-dental..> | 2023-05-03 09:43 | 21K | |
![[ ]](/icons/compressed.gif) | essentials-of-dental..> | 2023-05-03 09:43 | 10K | |
![[IMG]](/icons/image2.gif) | essentials-of-econom..> | 2023-08-08 22:02 | 2.3K | |
![[IMG]](/icons/image2.gif) | essentials-of-econom..> | 2023-05-03 09:34 | 12K | |
![[ ]](/icons/unknown.gif) | essentials-of-genera..> | 2023-05-03 13:44 | 1.1M | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-05-03 09:43 | 23K | |
![[ ]](/icons/compressed.gif) | essentials-of-human-..> | 2023-05-03 09:43 | 160K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-08-05 01:13 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-05-03 09:59 | 39K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-08-05 02:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-05-04 02:20 | 19K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-08-05 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-05-03 09:54 | 19K | |
![[ ]](/icons/compressed.gif) | essentials-of-human-..> | 2023-05-03 09:54 | 12K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-08-06 05:44 | 4.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-human-..> | 2023-05-03 10:31 | 24K | |
![[ ]](/icons/compressed.gif) | essentials-of-human-..> | 2023-05-03 10:31 | 13K | |
![[IMG]](/icons/image2.gif) | essentials-of-invest..> | 2023-08-06 09:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-invest..> | 2023-05-03 10:47 | 15K | |
![[ ]](/icons/compressed.gif) | essentials-of-invest..> | 2023-05-03 10:47 | 65K | |
![[IMG]](/icons/image2.gif) | essentials-of-invest..> | 2023-08-05 17:20 | 3.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-invest..> | 2023-05-03 10:14 | 18K | |
![[ ]](/icons/compressed.gif) | essentials-of-invest..> | 2023-05-03 10:14 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-08-05 14:34 | 5.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-08-17 07:51 | 28K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-05-03 10:26 | 47K | |
![[ ]](/icons/compressed.gif) | essentials-of-life-s..> | 2023-05-03 10:26 | 291K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-08-05 14:36 | 4.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-05-03 11:27 | 25K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-08-05 06:23 | 4.3K | |
![[IMG]](/icons/image2.gif) | essentials-of-life-s..> | 2023-05-03 10:33 | 26K | |
![[ ]](/icons/compressed.gif) | essentials-of-life-s..> | 2023-05-03 10:33 | 151K | |
![[IMG]](/icons/image2.gif) | essentials-of-market..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-market..> | 2023-05-03 10:52 | 22K | |
![[ ]](/icons/compressed.gif) | essentials-of-market..> | 2023-05-03 10:52 | 26K | |
![[IMG]](/icons/image2.gif) | essentials-of-market..> | 2023-08-06 10:17 | 3.9K | |
![[IMG]](/icons/image2.gif) | essentials-of-market..> | 2023-05-03 09:40 | 25K | |
![[ ]](/icons/compressed.gif) | essentials-of-market..> | 2023-05-03 09:40 | 17K | |
![[ ]](/icons/compressed.gif) | essentials-of-market..> | 2023-05-03 09:46 | 11K | |
![[IMG]](/icons/image2.gif) | essentials-of-meteor..> | 2023-08-05 05:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | essentials-of-meteor..> | 2023-05-03 10:33 | 16K | |
![[ ]](/icons/compressed.gif) | essentials-of-meteor..> | 2023-05-03 10:33 | 20K | |
![[IMG]](/icons/image2.gif) | essentials-of-modern..> | 2023-08-05 05:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | essentials-of-modern..> | 2023-05-03 11:27 | 17K | |
![[ ]](/icons/compressed.gif) | essentials-of-modern..> | 2023-05-03 11:27 | 26K | |
![[IMG]](/icons/image2.gif) | essentials-of-negoti..> | 2023-08-05 14:35 | 1.9K | |
![[IMG]](/icons/image2.gif) | essentials-of-negoti..> | 2023-05-03 11:17 | 11K | |
![[ ]](/icons/compressed.gif) | essentials-of-negoti..> | 2023-05-03 11:17 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-05-03 09:35 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-08-05 02:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-05-03 10:23 | 20K | |
![[ ]](/icons/compressed.gif) | essentials-of-nursin..> | 2023-05-03 10:23 | 7.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-08-08 14:32 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-nursin..> | 2023-05-03 09:58 | 42K | |
![[IMG]](/icons/image2.gif) | essentials-of-oceano..> | 2023-08-06 11:15 | 1.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-oceano..> | 2023-05-03 09:36 | 11K | |
![[ ]](/icons/compressed.gif) | essentials-of-oceano..> | 2023-05-03 09:36 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-08-05 06:25 | 4.6K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-08-08 21:47 | 20K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-05-03 10:21 | 56K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-05-03 11:07 | 28K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-08-05 03:40 | 11K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-08-05 01:13 | 32K | |
![[IMG]](/icons/image2.gif) | essentials-of-pathop..> | 2023-05-04 02:29 | 67K | |
![[ ]](/icons/compressed.gif) | essentials-of-pediat..> | 2023-05-03 10:37 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-of-pediat..> | 2023-08-05 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | essentials-of-pediat..> | 2023-05-03 11:10 | 20K | |
![[ ]](/icons/compressed.gif) | essentials-of-pediat..> | 2023-05-03 11:10 | 3.1K | |
![[IMG]](/icons/image2.gif) | essentials-of-pediat..> | 2023-08-05 14:33 | 3.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-pediat..> | 2023-05-03 10:37 | 20K | |
![[IMG]](/icons/image2.gif) | essentials-of-pharma..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | essentials-of-pharma..> | 2023-05-03 10:35 | 22K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-08-05 22:02 | 17K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-05-03 10:08 | 46K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-08-06 07:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-05-03 10:26 | 12K | |
![[ ]](/icons/compressed.gif) | essentials-of-psychi..> | 2023-05-03 10:26 | 142K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-08-08 03:59 | 3.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-psychi..> | 2023-05-03 10:01 | 19K | |
![[ ]](/icons/compressed.gif) | essentials-of-psychi..> | 2023-05-03 10:01 | 7.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-08-06 13:05 | 3.2K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-05-03 11:27 | 18K | |
![[ ]](/icons/compressed.gif) | essentials-of-psycho..> | 2023-05-03 11:27 | 730K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-08-05 17:21 | 2.5K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-05-03 10:09 | 16K | |
![[ ]](/icons/compressed.gif) | essentials-of-psycho..> | 2023-05-03 10:09 | 54K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | essentials-of-psycho..> | 2023-05-04 01:53 | 24K | |
![[ ]](/icons/compressed.gif) | essentials-of-psycho..> | 2023-05-04 01:53 | 49K | |
![[IMG]](/icons/image2.gif) | essentials-of-sociol..> | 2023-08-05 09:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | essentials-of-sociol..> | 2023-05-03 09:57 | 10K | |
![[IMG]](/icons/image2.gif) | essentials-of-sociol..> | 2023-08-05 05:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | essentials-of-sociol..> | 2023-05-03 10:38 | 20K | |
![[ ]](/icons/compressed.gif) | essentials-of-sociol..> | 2023-05-03 10:38 | 36K | |
![[IMG]](/icons/image2.gif) | essentials-of-sonogr..> | 2023-05-03 09:21 | 32K | |
![[ ]](/icons/compressed.gif) | essentials-of-sonogr..> | 2023-05-03 09:21 | 12K | |
![[IMG]](/icons/image2.gif) | essentials-of-statis..> | 2023-08-06 05:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | essentials-of-statis..> | 2023-08-11 11:08 | 29K | |
![[IMG]](/icons/image2.gif) | essentials-of-statis..> | 2023-05-03 09:35 | 49K | |
![[ ]](/icons/compressed.gif) | essentials-of-statis..> | 2023-05-03 09:35 | 84K | |
![[IMG]](/icons/image2.gif) | essentials-of-statis..> | 2023-05-03 10:16 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-statis..> | 2023-05-03 10:09 | 15K | |
![[IMG]](/icons/image2.gif) | essentials-of-the-le..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | essentials-of-the-le..> | 2023-05-04 01:57 | 21K | |
![[ ]](/icons/compressed.gif) | essentials-of-the-le..> | 2023-05-04 01:57 | 18K | |
![[IMG]](/icons/image2.gif) | essentials-of-unders..> | 2023-08-05 15:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | essentials-of-unders..> | 2023-05-03 10:59 | 22K | |
![[ ]](/icons/compressed.gif) | essentials-of-unders..> | 2023-05-03 10:59 | 32K | |
![[IMG]](/icons/image2.gif) | essentials-statistic..> | 2023-08-05 14:38 | 2.7K | |
![[IMG]](/icons/image2.gif) | essentials-statistic..> | 2023-08-11 11:08 | 14K | |
![[IMG]](/icons/image2.gif) | essentials-statistic..> | 2023-05-03 10:42 | 45K | |
![[ ]](/icons/compressed.gif) | essentials-statistic..> | 2023-05-03 10:42 | 768K | |
![[ ]](/icons/compressed.gif) | essgeo4_Chapter01.zip | 2023-05-03 09:32 | 9.2M | |
![[ ]](/icons/unknown.gif) | essphys3_ch01.rtf | 2023-05-03 09:19 | 84K | |
![[IMG]](/icons/image2.gif) | ethical-decision-mak..> | 2023-08-06 17:28 | 3.8K | |
![[IMG]](/icons/image2.gif) | ethical-decision-mak..> | 2023-08-05 14:38 | 24K | |
![[IMG]](/icons/image2.gif) | ethical-decision-mak..> | 2023-05-03 11:12 | 38K | |
![[ ]](/icons/compressed.gif) | ethical-decision-mak..> | 2023-05-03 11:12 | 69K | |
![[IMG]](/icons/image2.gif) | ethics-and-issues-in..> | 2023-08-05 03:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | ethics-and-issues-in..> | 2023-05-03 09:51 | 29K | |
![[ ]](/icons/compressed.gif) | ethics-and-issues-in..> | 2023-05-03 09:51 | 11K | |
![[ ]](/icons/compressed.gif) | ethics-and-issues-in..> | 2023-05-03 13:40 | 2.3K | |
![[ ]](/icons/compressed.gif) | ethics-information-a..> | 2023-05-03 13:41 | 423K | |
![[ ]](/icons/layout.gif) | evans_ba2_tif_ch01.pdf | 2023-05-03 10:46 | 343K | |
![[ ]](/icons/unknown.gif) | evans_sdadm5_ism_ch0..> | 2023-05-03 10:46 | 904K | |
![[ ]](/icons/layout.gif) | ex1-Test-Bank-For-Hu..> | 2023-05-03 10:48 | 398K | |
![[ ]](/icons/unknown.gif) | ex4-2-Solution-Manua..> | 2023-05-03 11:10 | 16K | |
![[IMG]](/icons/image2.gif) | exercise-physiology-..> | 2023-08-05 01:12 | 2.9K | |
![[IMG]](/icons/image2.gif) | exercise-physiology-..> | 2023-05-03 10:32 | 19K | |
![[ ]](/icons/compressed.gif) | exercise-physiology-..> | 2023-05-03 10:32 | 17K | |
![[ ]](/icons/compressed.gif) | experience-human-dev..> | 2023-05-03 09:26 | 44K | |
![[IMG]](/icons/image2.gif) | experience-human-dev..> | 2023-08-06 05:46 | 3.2K | |
![[IMG]](/icons/image2.gif) | experience-human-dev..> | 2023-05-03 09:26 | 9.3K | |
![[IMG]](/icons/image2.gif) | experiencing-mis-kro..> | 2023-08-08 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | experiencing-mis-kro..> | 2023-05-03 09:19 | 19K | |
![[ ]](/icons/compressed.gif) | experiencing-mis-kro..> | 2023-05-03 09:19 | 15K | |
![[IMG]](/icons/image2.gif) | experiencing-mis-kro..> | 2023-08-06 03:28 | 3.4K | |
![[IMG]](/icons/image2.gif) | experiencing-mis-kro..> | 2023-05-03 09:49 | 11K | |
![[ ]](/icons/compressed.gif) | experiencing-mis-kro..> | 2023-05-03 09:48 | 13K | |
![[IMG]](/icons/image2.gif) | experiencing-the-lif..> | 2023-08-09 08:02 | 3.6K | |
![[IMG]](/icons/image2.gif) | experiencing-the-lif..> | 2023-08-08 22:03 | 23K | |
![[IMG]](/icons/image2.gif) | experiencing-the-lif..> | 2023-05-03 09:35 | 39K | |
![[ ]](/icons/compressed.gif) | experiencing-the-lif..> | 2023-05-03 09:35 | 77K | |
![[IMG]](/icons/image2.gif) | exploring-economics-..> | 2023-08-05 01:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | exploring-economics-..> | 2023-08-13 20:42 | 18K | |
![[IMG]](/icons/image2.gif) | exploring-economics-..> | 2023-05-03 09:32 | 44K | |
![[ ]](/icons/compressed.gif) | exploring-economics-..> | 2023-05-03 09:31 | 180K | |
![[ ]](/icons/compressed.gif) | exploring-geology-4t..> | 2023-05-03 10:29 | 3.8M | |
![[IMG]](/icons/image2.gif) | exploring-geology-re..> | 2023-08-05 03:39 | 19K | |
![[IMG]](/icons/image2.gif) | exploring-geology-re..> | 2023-05-03 11:14 | 53K | |
![[IMG]](/icons/image2.gif) | exploring-lifespan-d..> | 2023-08-05 15:27 | 3.9K | |
![[IMG]](/icons/image2.gif) | exploring-lifespan-d..> | 2023-05-03 09:38 | 28K | |
![[ ]](/icons/compressed.gif) | exploring-lifespan-d..> | 2023-05-03 09:37 | 32K | |
![[IMG]](/icons/image2.gif) | exploring-medical-la..> | 2023-08-06 05:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | exploring-medical-la..> | 2023-05-03 10:03 | 16K | |
![[ ]](/icons/compressed.gif) | exploring-medical-la..> | 2023-05-03 10:03 | 9.3K | |
![[IMG]](/icons/image2.gif) | exploring-microecono..> | 2023-08-06 13:03 | 3.8K | |
![[IMG]](/icons/image2.gif) | exploring-microecono..> | 2023-08-13 20:42 | 18K | |
![[IMG]](/icons/image2.gif) | exploring-microecono..> | 2023-05-03 09:52 | 43K | |
![[ ]](/icons/compressed.gif) | exploring-microecono..> | 2023-05-03 09:52 | 189K | |
![[IMG]](/icons/image2.gif) | exploring-microsoft-..> | 2023-08-06 11:17 | 16K | |
![[IMG]](/icons/image2.gif) | exploring-microsoft-..> | 2023-05-03 10:28 | 44K | |
![[IMG]](/icons/image2.gif) | exploring-microsoft-..> | 2023-08-06 03:41 | 16K | |
![[IMG]](/icons/image2.gif) | exploring-microsoft-..> | 2023-05-03 10:29 | 44K | |
![[IMG]](/icons/image2.gif) | exploring-sociology-..> | 2023-08-05 02:03 | 3.3K | |
![[IMG]](/icons/image2.gif) | exploring-sociology-..> | 2023-08-10 02:14 | 19K | |
![[IMG]](/icons/image2.gif) | exploring-sociology-..> | 2023-05-03 10:21 | 67K | |
![[ ]](/icons/compressed.gif) | exploring-sociology-..> | 2023-05-03 10:21 | 322K | |
![[IMG]](/icons/image2.gif) | family-therapy-conce..> | 2023-08-08 08:23 | 2.5K | |
![[IMG]](/icons/image2.gif) | family-therapy-conce..> | 2023-05-03 11:15 | 8.8K | |
![[ ]](/icons/unknown.gif) | fap11-ch01-im.doc | 2023-05-03 10:55 | 116K | |
![[IMG]](/icons/image2.gif) | federal-tax-research..> | 2023-08-08 18:24 | 4.1K | |
![[IMG]](/icons/image2.gif) | federal-tax-research..> | 2023-08-10 02:14 | 22K | |
![[IMG]](/icons/image2.gif) | federal-tax-research..> | 2023-05-03 09:33 | 61K | |
![[ ]](/icons/compressed.gif) | federal-tax-research..> | 2023-05-03 09:32 | 142K | |
![[IMG]](/icons/image2.gif) | federal-taxation-201..> | 2023-08-05 01:51 | 3.4K | |
![[IMG]](/icons/image2.gif) | federal-taxation-201..> | 2023-05-03 09:21 | 12K | |
![[ ]](/icons/compressed.gif) | final-01-05sp.zip | 2023-05-04 01:56 | 27K | |
![[IMG]](/icons/image2.gif) | finance-applications..> | 2023-08-05 02:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | finance-applications..> | 2023-08-13 14:27 | 13K | |
![[IMG]](/icons/image2.gif) | finance-applications..> | 2023-05-03 10:44 | 33K | |
![[ ]](/icons/compressed.gif) | finance-applications..> | 2023-05-03 10:44 | 417K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:45 | 13K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:04 | 445K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-07 10:36 | 2.9K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-04 02:17 | 19K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-04 02:17 | 1.4M | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 05:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 11:09 | 15K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 11:09 | 136K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 14:38 | 5.5K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:57 | 13K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:57 | 27K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 01:51 | 3.0K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:32 | 9.6K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 11:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-09 02:53 | 21K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 11:19 | 35K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 11:19 | 1.2M | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 01:01 | 3.5K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-13 14:27 | 21K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:15 | 35K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:15 | 1.6M | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 05:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-13 14:27 | 20K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 11:03 | 30K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 11:03 | 390K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 06:25 | 3.7K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-10 02:14 | 20K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 11:17 | 47K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 11:17 | 2.6M | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 05:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-13 14:27 | 20K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:46 | 48K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 09:46 | 364K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 03:41 | 2.5K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:00 | 18K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:00 | 92K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 13:43 | 135K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 05:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-10 02:14 | 29K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:29 | 84K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:29 | 142K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 22:02 | 4.4K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-14 13:33 | 24K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 11:20 | 55K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 11:20 | 1.0M | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 10:22 | 1.4M | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:34 | 14K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:34 | 14K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 02:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:22 | 12K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 09:34 | 478K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-04 02:13 | 14K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 13:05 | 4.2K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:35 | 28K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 09:35 | 85K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-05 01:12 | 4.3K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:44 | 19K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 13:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:08 | 11K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-08 22:01 | 3.3K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:35 | 11K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 13:41 | 84K | |
![[ ]](/icons/compressed.gif) | financial-accounting..> | 2023-05-03 09:56 | 120K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:56 | 11K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-08-06 10:15 | 3.5K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 10:04 | 12K | |
![[IMG]](/icons/image2.gif) | financial-accounting..> | 2023-05-03 09:56 | 12K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-08-09 06:03 | 3.2K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-05-03 09:39 | 21K | |
![[ ]](/icons/compressed.gif) | financial-and-manage..> | 2023-05-03 09:39 | 91K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-08-07 10:38 | 3.5K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-05-03 10:46 | 25K | |
![[ ]](/icons/compressed.gif) | financial-and-manage..> | 2023-05-03 10:45 | 604K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-08-06 05:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | financial-and-manage..> | 2023-05-03 09:46 | 23K | |
![[ ]](/icons/compressed.gif) | financial-and-manage..> | 2023-05-03 09:46 | 632K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-05-03 10:27 | 24K | |
![[ ]](/icons/compressed.gif) | financial-institutio..> | 2023-05-03 10:27 | 0 | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-08-05 01:52 | 3.1K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-05-03 09:23 | 7.8K | |
![[ ]](/icons/compressed.gif) | financial-institutio..> | 2023-05-03 09:23 | 26K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-08-05 01:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-08-14 00:05 | 19K | |
![[IMG]](/icons/image2.gif) | financial-institutio..> | 2023-05-03 09:32 | 49K | |
![[ ]](/icons/compressed.gif) | financial-institutio..> | 2023-05-03 09:32 | 300K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-08-05 02:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-05-03 09:41 | 18K | |
![[ ]](/icons/compressed.gif) | financial-management..> | 2023-05-03 09:41 | 89K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-08-08 07:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-05-03 10:06 | 17K | |
![[ ]](/icons/compressed.gif) | financial-management..> | 2023-05-03 10:06 | 16K | |
![[ ]](/icons/compressed.gif) | financial-management..> | 2023-05-03 10:40 | 64K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-08-06 07:49 | 3.1K | |
![[IMG]](/icons/image2.gif) | financial-management..> | 2023-05-03 09:24 | 7.6K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-05 05:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-14 00:05 | 19K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-05-03 10:27 | 31K | |
![[ ]](/icons/compressed.gif) | financial-managerial..> | 2023-05-03 10:27 | 532K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-05 23:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-14 00:05 | 24K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-05-03 09:28 | 53K | |
![[ ]](/icons/compressed.gif) | financial-managerial..> | 2023-05-03 09:28 | 465K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-05-03 10:05 | 30K | |
![[ ]](/icons/compressed.gif) | financial-managerial..> | 2023-05-03 10:05 | 416K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-06 05:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-14 00:05 | 22K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-05-03 09:32 | 55K | |
![[ ]](/icons/compressed.gif) | financial-managerial..> | 2023-05-03 09:32 | 1.1M | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-08-06 09:43 | 2.8K | |
![[IMG]](/icons/image2.gif) | financial-managerial..> | 2023-05-03 10:17 | 14K | |
![[IMG]](/icons/image2.gif) | financial-markets-an..> | 2023-08-06 05:44 | 4.1K | |
![[IMG]](/icons/image2.gif) | financial-markets-an..> | 2023-05-03 10:10 | 27K | |
![[ ]](/icons/compressed.gif) | financial-markets-an..> | 2023-05-03 10:10 | 12K | |
![[IMG]](/icons/image2.gif) | financial-markets-an..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | financial-markets-an..> | 2023-05-03 09:42 | 15K | |
![[IMG]](/icons/image2.gif) | financial-markets-in..> | 2023-08-06 13:10 | 4.5K | |
![[IMG]](/icons/image2.gif) | financial-markets-in..> | 2023-08-14 00:05 | 26K | |
![[IMG]](/icons/image2.gif) | financial-markets-in..> | 2023-05-03 09:47 | 114K | |
![[ ]](/icons/compressed.gif) | financial-markets-in..> | 2023-05-03 09:47 | 689K | |
![[IMG]](/icons/image2.gif) | financial-reporting-..> | 2023-08-05 14:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | financial-reporting-..> | 2023-08-12 06:36 | 18K | |
![[IMG]](/icons/image2.gif) | financial-reporting-..> | 2023-05-03 11:24 | 37K | |
![[ ]](/icons/compressed.gif) | financial-reporting-..> | 2023-05-03 11:24 | 324K | |
![[IMG]](/icons/image2.gif) | financial-reporting-..> | 2023-08-08 06:38 | 3.3K | |
![[IMG]](/icons/image2.gif) | financial-reporting-..> | 2023-05-03 10:34 | 11K | |
![[IMG]](/icons/image2.gif) | financial-statement-..> | 2023-08-08 18:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | financial-statement-..> | 2023-05-03 11:12 | 9.4K | |
![[IMG]](/icons/image2.gif) | financial-statement-..> | 2023-08-06 10:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | financial-statement-..> | 2023-05-03 10:16 | 17K | |
![[ ]](/icons/compressed.gif) | financial-statement-..> | 2023-05-03 10:16 | 43K | |
![[IMG]](/icons/image2.gif) | financial-theory-and..> | 2023-05-03 09:25 | 11K | |
![[IMG]](/icons/image2.gif) | finite-mathematics-1..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | finite-mathematics-1..> | 2023-08-15 01:38 | 17K | |
![[IMG]](/icons/image2.gif) | finite-mathematics-1..> | 2023-05-04 01:50 | 77K | |
![[ ]](/icons/compressed.gif) | finite-mathematics-1..> | 2023-05-04 01:50 | 331K | |
![[IMG]](/icons/image2.gif) | firstprob-100x100.jpg | 2023-08-06 07:46 | 2.5K | |
![[IMG]](/icons/image2.gif) | firstprob-300x300.jpg | 2023-08-12 04:49 | 12K | |
![[IMG]](/icons/image2.gif) | firstprob.jpg | 2023-05-03 10:51 | 13K | |
![[IMG]](/icons/image2.gif) | fiscal-administratio..> | 2023-08-05 05:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | fiscal-administratio..> | 2023-08-08 20:09 | 19K | |
![[IMG]](/icons/image2.gif) | fiscal-administratio..> | 2023-05-03 09:52 | 47K | |
![[ ]](/icons/compressed.gif) | fiscal-administratio..> | 2023-05-03 09:52 | 142K | |
![[IMG]](/icons/image2.gif) | flashback-a-brief-fi..> | 2023-08-08 16:37 | 3.8K | |
![[IMG]](/icons/image2.gif) | flashback-a-brief-fi..> | 2023-05-03 09:20 | 19K | |
![[ ]](/icons/layout.gif) | fleras_unequal_7e_ch..> | 2023-05-03 10:08 | 23K | |
![[IMG]](/icons/image2.gif) | flood-100x100.jpg | 2023-08-05 15:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | flood-300x300.jpg | 2023-08-05 04:35 | 19K | |
![[IMG]](/icons/image2.gif) | flood.jpg | 2023-05-03 11:10 | 22K | |
![[IMG]](/icons/image2.gif) | fluency-information-..> | 2023-08-05 01:52 | 3.5K | |
![[IMG]](/icons/image2.gif) | fluency-information-..> | 2023-08-08 20:09 | 17K | |
![[IMG]](/icons/image2.gif) | fluency-information-..> | 2023-05-03 09:34 | 48K | |
![[ ]](/icons/compressed.gif) | fluency-information-..> | 2023-05-03 09:34 | 142K | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-1st-..> | 2023-08-06 11:16 | 3.4K | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-1st-..> | 2023-08-08 20:09 | 20K | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-1st-..> | 2023-05-04 02:26 | 71K | |
![[ ]](/icons/compressed.gif) | fluid-mechanics-1st-..> | 2023-05-04 02:26 | 12M | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-fund..> | 2023-08-05 23:58 | 3.9K | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-fund..> | 2023-08-08 20:09 | 26K | |
![[IMG]](/icons/image2.gif) | fluid-mechanics-fund..> | 2023-05-03 09:38 | 41K | |
![[ ]](/icons/compressed.gif) | fluid-mechanics-fund..> | 2023-05-03 09:38 | 906K | |
![[IMG]](/icons/image2.gif) | focus-on-adult-healt..> | 2023-08-05 17:20 | 3.6K | |
![[IMG]](/icons/image2.gif) | focus-on-adult-healt..> | 2023-05-03 10:20 | 11K | |
![[ ]](/icons/compressed.gif) | focus-on-adult-healt..> | 2023-05-03 10:20 | 14K | |
![[IMG]](/icons/image2.gif) | focus-on-health-dale..> | 2023-08-06 12:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | focus-on-health-dale..> | 2023-05-03 10:39 | 29K | |
![[ ]](/icons/compressed.gif) | focus-on-health-dale..> | 2023-05-03 10:39 | 15K | |
![[IMG]](/icons/image2.gif) | focus-on-nursing-pha..> | 2023-08-05 16:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | focus-on-nursing-pha..> | 2023-05-03 09:27 | 8.5K | |
![[IMG]](/icons/image2.gif) | focus-on-nursing-pha..> | 2023-08-06 10:16 | 4.6K | |
![[IMG]](/icons/image2.gif) | focus-on-nursing-pha..> | 2023-05-03 09:46 | 10K | |
![[ ]](/icons/compressed.gif) | focus-on-nursing-pha..> | 2023-05-03 09:46 | 22K | |
![[IMG]](/icons/image2.gif) | focus-on-personal-fi..> | 2023-08-07 23:03 | 3.8K | |
![[IMG]](/icons/image2.gif) | focus-on-personal-fi..> | 2023-08-08 05:43 | 19K | |
![[IMG]](/icons/image2.gif) | focus-on-personal-fi..> | 2023-05-04 02:08 | 48K | |
![[ ]](/icons/compressed.gif) | focus-on-personal-fi..> | 2023-05-04 02:08 | 52K | |
![[ ]](/icons/compressed.gif) | focus-on-pharmacolog..> | 2023-05-03 09:23 | 307K | |
![[IMG]](/icons/image2.gif) | forensic-accounting-..> | 2023-08-06 01:53 | 17K | |
![[IMG]](/icons/image2.gif) | forensic-accounting-..> | 2023-05-03 09:46 | 48K | |
![[ ]](/icons/compressed.gif) | forensic-science-fun..> | 2023-05-03 10:29 | 15K | |
![[ ]](/icons/unknown.gif) | forsyth7e_tb_ch01.docx | 2023-05-03 10:56 | 43K | |
![[IMG]](/icons/image2.gif) | foundation-design-pr..> | 2023-08-05 01:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | foundation-design-pr..> | 2023-08-08 20:09 | 19K | |
![[IMG]](/icons/image2.gif) | foundation-design-pr..> | 2023-05-03 09:31 | 59K | |
![[ ]](/icons/compressed.gif) | foundation-design-pr..> | 2023-05-03 09:31 | 114K | |
![[IMG]](/icons/image2.gif) | foundations-and-adul..> | 2023-08-05 16:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | foundations-and-adul..> | 2023-05-03 10:27 | 17K | |
![[ ]](/icons/compressed.gif) | foundations-and-adul..> | 2023-05-03 10:27 | 14K | |
![[IMG]](/icons/image2.gif) | foundations-and-adul..> | 2023-08-05 02:31 | 3.0K | |
![[IMG]](/icons/image2.gif) | foundations-and-adul..> | 2023-05-03 09:44 | 17K | |
![[ ]](/icons/compressed.gif) | foundations-and-adul..> | 2023-05-03 09:44 | 16K | |
![[IMG]](/icons/image2.gif) | foundations-astronom..> | 2023-08-05 03:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | foundations-astronom..> | 2023-08-08 20:09 | 18K | |
![[IMG]](/icons/image2.gif) | foundations-astronom..> | 2023-05-03 10:14 | 49K | |
![[ ]](/icons/compressed.gif) | foundations-astronom..> | 2023-05-03 10:14 | 182K | |
![[IMG]](/icons/image2.gif) | foundations-business..> | 2023-08-08 14:31 | 2.7K | |
![[IMG]](/icons/image2.gif) | foundations-business..> | 2023-08-08 20:09 | 16K | |
![[IMG]](/icons/image2.gif) | foundations-business..> | 2023-05-03 09:42 | 40K | |
![[ ]](/icons/compressed.gif) | foundations-business..> | 2023-05-03 09:42 | 3.8M | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-08-05 01:33 | 2.6K | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-08-08 20:09 | 11K | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-05-03 09:49 | 51K | |
![[ ]](/icons/compressed.gif) | foundations-finance-..> | 2023-05-03 09:49 | 930K | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-08-05 01:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-08-12 22:16 | 12K | |
![[IMG]](/icons/image2.gif) | foundations-finance-..> | 2023-05-03 09:35 | 40K | |
![[ ]](/icons/compressed.gif) | foundations-finance-..> | 2023-05-03 09:35 | 407K | |
![[IMG]](/icons/image2.gif) | foundations-in-micro..> | 2023-08-05 14:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | foundations-in-micro..> | 2023-05-03 10:32 | 23K | |
![[ ]](/icons/compressed.gif) | foundations-in-micro..> | 2023-05-03 10:32 | 207K | |
![[IMG]](/icons/image2.gif) | foundations-microbio..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | foundations-microbio..> | 2023-08-08 20:09 | 17K | |
![[IMG]](/icons/image2.gif) | foundations-microbio..> | 2023-05-03 10:32 | 43K | |
![[ ]](/icons/compressed.gif) | foundations-microbio..> | 2023-05-03 10:32 | 144K | |
![[IMG]](/icons/image2.gif) | foundations-microeco..> | 2023-08-06 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | foundations-microeco..> | 2023-08-12 23:30 | 15K | |
![[IMG]](/icons/image2.gif) | foundations-microeco..> | 2023-05-03 09:55 | 47K | |
![[ ]](/icons/compressed.gif) | foundations-microeco..> | 2023-05-03 09:55 | 658K | |
![[IMG]](/icons/image2.gif) | foundations-of-basic..> | 2023-08-05 19:00 | 2.6K | |
![[IMG]](/icons/image2.gif) | foundations-of-basic..> | 2023-05-03 10:38 | 13K | |
![[ ]](/icons/compressed.gif) | foundations-of-basic..> | 2023-05-03 10:38 | 15K | |
![[IMG]](/icons/image2.gif) | foundations-of-behav..> | 2023-08-05 15:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | foundations-of-behav..> | 2023-05-03 09:30 | 16K | |
![[ ]](/icons/compressed.gif) | foundations-of-behav..> | 2023-05-03 09:30 | 40K | |
![[IMG]](/icons/image2.gif) | foundations-of-behav..> | 2023-08-06 10:18 | 2.5K | |
![[IMG]](/icons/image2.gif) | foundations-of-behav..> | 2023-05-03 11:12 | 14K | |
![[ ]](/icons/compressed.gif) | foundations-of-behav..> | 2023-05-03 11:12 | 35K | |
![[IMG]](/icons/image2.gif) | foundations-of-econo..> | 2023-08-09 02:52 | 2.0K | |
![[IMG]](/icons/image2.gif) | foundations-of-econo..> | 2023-05-03 09:35 | 11K | |
![[ ]](/icons/compressed.gif) | foundations-of-econo..> | 2023-05-03 09:35 | 1.0M | |
![[IMG]](/icons/image2.gif) | foundations-of-educa..> | 2023-08-06 04:17 | 3.2K | |
![[IMG]](/icons/image2.gif) | foundations-of-educa..> | 2023-05-04 02:21 | 22K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-03 11:23 | 15K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-08-05 05:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-03 10:40 | 9.7K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-03 10:40 | 9.7K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-08-06 10:11 | 3.9K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-08-08 08:38 | 29K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-03 10:19 | 46K | |
![[ ]](/icons/compressed.gif) | foundations-of-finan..> | 2023-05-03 10:19 | 1.5M | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-04 02:29 | 51K | |
![[ ]](/icons/compressed.gif) | foundations-of-finan..> | 2023-05-03 13:41 | 11K | |
![[IMG]](/icons/image2.gif) | foundations-of-finan..> | 2023-05-03 09:20 | 26K | |
![[IMG]](/icons/image2.gif) | foundations-of-macro..> | 2023-08-05 14:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | foundations-of-macro..> | 2023-05-03 10:51 | 16K | |
![[ ]](/icons/compressed.gif) | foundations-of-macro..> | 2023-05-03 10:51 | 1.0M | |
![[IMG]](/icons/image2.gif) | foundations-of-marke..> | 2023-08-05 06:24 | 2.7K | |
![[IMG]](/icons/image2.gif) | foundations-of-marke..> | 2023-05-03 11:19 | 15K | |
![[ ]](/icons/compressed.gif) | foundations-of-marke..> | 2023-05-03 11:19 | 36K | |
![[IMG]](/icons/image2.gif) | foundations-of-mater..> | 2023-08-05 14:36 | 2.9K | |
![[IMG]](/icons/image2.gif) | foundations-of-mater..> | 2023-05-03 10:09 | 15K | |
![[ ]](/icons/compressed.gif) | foundations-of-mater..> | 2023-05-03 10:09 | 14K | |
![[IMG]](/icons/image2.gif) | foundations-of-mater..> | 2023-08-05 21:05 | 3.3K | |
![[IMG]](/icons/image2.gif) | foundations-of-mater..> | 2023-05-03 09:21 | 11K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-08-05 01:51 | 2.7K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-05-03 09:40 | 16K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-08-05 04:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-05-03 09:39 | 20K | |
![[ ]](/icons/compressed.gif) | foundations-of-menta..> | 2023-05-03 09:39 | 9.2K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-08-06 13:10 | 2.7K | |
![[IMG]](/icons/image2.gif) | foundations-of-menta..> | 2023-05-03 10:08 | 8.1K | |
![[ ]](/icons/compressed.gif) | foundations-of-menta..> | 2023-05-03 10:08 | 15K | |
![[IMG]](/icons/image2.gif) | foundations-of-micro..> | 2023-08-06 11:14 | 2.2K | |
![[IMG]](/icons/image2.gif) | foundations-of-micro..> | 2023-05-03 11:00 | 13K | |
![[ ]](/icons/compressed.gif) | foundations-of-micro..> | 2023-05-03 11:00 | 1.0M | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-08-06 09:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-05-03 10:13 | 15K | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-08-05 05:30 | 3.5K | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-05-03 09:39 | 12K | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-08-05 02:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | foundations-of-nursi..> | 2023-05-03 10:42 | 18K | |
![[ ]](/icons/compressed.gif) | foundations-of-nursi..> | 2023-05-03 10:42 | 8.6K | |
![[IMG]](/icons/image2.gif) | foundations-of-respi..> | 2023-08-05 04:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | foundations-of-respi..> | 2023-05-03 09:42 | 16K | |
![[IMG]](/icons/image2.gif) | foundations-of-respi..> | 2023-08-08 22:01 | 2.8K | |
![[IMG]](/icons/image2.gif) | foundations-of-respi..> | 2023-05-03 10:35 | 16K | |
![[ ]](/icons/compressed.gif) | foundations-of-respi..> | 2023-05-03 10:35 | 6.2K | |
![[IMG]](/icons/image2.gif) | foundations-of-strat..> | 2023-08-06 10:17 | 4.2K | |
![[IMG]](/icons/image2.gif) | foundations-of-strat..> | 2023-05-03 09:29 | 21K | |
![[IMG]](/icons/image2.gif) | foundationsofnursing..> | 2023-08-05 14:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | foundationsofnursing..> | 2023-08-12 23:30 | 16K | |
![[IMG]](/icons/image2.gif) | foundationsofnursing..> | 2023-05-03 10:13 | 71K | |
![[ ]](/icons/compressed.gif) | fox_and_mcdonalds_in..> | 2023-05-03 13:41 | 798K | |
![[ ]](/icons/unknown.gif) | franklin9_tb_ch01.doc | 2023-05-04 02:25 | 71K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-08-05 01:56 | 4.6K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-08-08 08:38 | 29K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-05-03 09:51 | 73K | |
![[ ]](/icons/compressed.gif) | fraud-examination-5t..> | 2023-05-03 09:51 | 580K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-08-07 09:49 | 4.6K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-08-12 23:30 | 29K | |
![[IMG]](/icons/image2.gif) | fraud-examination-5t..> | 2023-05-03 09:58 | 73K | |
![[ ]](/icons/compressed.gif) | fraud-examination-5t..> | 2023-05-03 09:58 | 105K | |
![[IMG]](/icons/image2.gif) | freedom-on-my-mind-v..> | 2023-08-06 12:09 | 3.2K | |
![[IMG]](/icons/image2.gif) | freedom-on-my-mind-v..> | 2023-08-12 23:30 | 17K | |
![[IMG]](/icons/image2.gif) | freedom-on-my-mind-v..> | 2023-05-04 02:18 | 28K | |
![[ ]](/icons/compressed.gif) | freedom-on-my-mind-v..> | 2023-05-04 02:18 | 65K | |
![[ ]](/icons/compressed.gif) | friedland-relyea-env..> | 2023-05-03 09:11 | 216K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-06 10:17 | 3.6K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:42 | 21K | |
![[ ]](/icons/compressed.gif) | fundamental-accounti..> | 2023-05-03 10:42 | 98K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-08 23:53 | 5.1K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-15 07:52 | 30K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:27 | 75K | |
![[ ]](/icons/compressed.gif) | fundamental-accounti..> | 2023-05-03 10:27 | 4.0M | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-05 06:24 | 5.2K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-15 07:52 | 30K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:17 | 76K | |
![[ ]](/icons/compressed.gif) | fundamental-accounti..> | 2023-05-03 10:17 | 3.4M | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:46 | 9.8K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:46 | 9.8K | |
![[ ]](/icons/compressed.gif) | fundamental-accounti..> | 2023-05-03 10:46 | 2.1M | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-08-06 22:47 | 3.5K | |
![[IMG]](/icons/image2.gif) | fundamental-accounti..> | 2023-05-03 10:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | fundamental-concepts..> | 2023-08-06 10:18 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamental-concepts..> | 2023-05-03 10:24 | 14K | |
![[IMG]](/icons/image2.gif) | fundamental-concepts..> | 2023-08-06 11:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | fundamental-concepts..> | 2023-05-03 11:22 | 17K | |
![[ ]](/icons/compressed.gif) | fundamental-concepts..> | 2023-05-03 11:21 | 17K | |
![[IMG]](/icons/image2.gif) | fundamental-financia..> | 2023-08-05 01:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | fundamental-financia..> | 2023-05-03 10:12 | 21K | |
![[ ]](/icons/compressed.gif) | fundamental-financia..> | 2023-05-03 10:12 | 1.7M | |
![[IMG]](/icons/image2.gif) | fundamental-manageri..> | 2023-08-06 11:17 | 3.9K | |
![[IMG]](/icons/image2.gif) | fundamental-manageri..> | 2023-08-08 08:38 | 24K | |
![[IMG]](/icons/image2.gif) | fundamental-manageri..> | 2023-05-03 10:07 | 64K | |
![[ ]](/icons/compressed.gif) | fundamental-manageri..> | 2023-05-03 10:06 | 5.1M | |
![[IMG]](/icons/image2.gif) | fundamental-manageri..> | 2023-08-06 12:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | fundamental-manageri..> | 2023-05-03 11:01 | 21K | |
![[ ]](/icons/compressed.gif) | fundamental-manageri..> | 2023-05-03 11:01 | 4.9M | |
![[IMG]](/icons/image2.gif) | fundamental-nursing-..> | 2023-08-05 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | fundamental-nursing-..> | 2023-05-03 09:48 | 20K | |
![[ ]](/icons/compressed.gif) | fundamental-nursing-..> | 2023-05-03 09:48 | 5.2K | |
![[IMG]](/icons/image2.gif) | fundamental-nursing-..> | 2023-08-06 05:46 | 15K | |
![[IMG]](/icons/image2.gif) | fundamental-nursing-..> | 2023-05-03 09:34 | 36K | |
![[IMG]](/icons/image2.gif) | fundamental-orthoped..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | fundamental-orthoped..> | 2023-05-03 09:29 | 22K | |
![[ ]](/icons/compressed.gif) | fundamental-orthoped..> | 2023-05-03 09:28 | 0 | |
![[IMG]](/icons/image2.gif) | fundamentals-advance..> | 2023-08-05 07:19 | 2.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-advance..> | 2023-08-05 14:34 | 13K | |
![[IMG]](/icons/image2.gif) | fundamentals-advance..> | 2023-05-03 09:25 | 32K | |
![[ ]](/icons/compressed.gif) | fundamentals-advance..> | 2023-05-03 09:25 | 282K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-08 08:38 | 21K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-05-03 09:35 | 53K | |
![[ ]](/icons/compressed.gif) | fundamentals-anatomy..> | 2023-05-03 09:35 | 150K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-06 13:03 | 4.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-13 03:13 | 21K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-05-04 02:02 | 54K | |
![[ ]](/icons/compressed.gif) | fundamentals-anatomy..> | 2023-05-04 02:02 | 29K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-05 05:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-08-08 08:38 | 13K | |
![[IMG]](/icons/image2.gif) | fundamentals-anatomy..> | 2023-05-04 01:55 | 68K | |
![[ ]](/icons/compressed.gif) | fundamentals-anatomy..> | 2023-05-04 01:55 | 153K | |
![[IMG]](/icons/image2.gif) | fundamentals-biostat..> | 2023-08-07 11:32 | 3.2K | |
![[IMG]](/icons/image2.gif) | fundamentals-biostat..> | 2023-08-08 18:30 | 18K | |
![[IMG]](/icons/image2.gif) | fundamentals-biostat..> | 2023-05-03 09:42 | 43K | |
![[ ]](/icons/compressed.gif) | fundamentals-biostat..> | 2023-05-03 09:42 | 165K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-05 01:09 | 3.9K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-21 02:16 | 21K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-05-03 09:58 | 35K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-03 09:58 | 210K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-05 06:24 | 2.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-21 02:16 | 14K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-05-03 10:10 | 36K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-03 10:10 | 108K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-09 02:05 | 4.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-08 18:30 | 23K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-05-04 02:23 | 474K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-04 02:23 | 239K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-05 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-21 02:16 | 18K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-05-03 10:04 | 44K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-03 10:04 | 145K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-03 13:41 | 373K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-06 10:20 | 3.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-08-21 02:16 | 16K | |
![[IMG]](/icons/image2.gif) | fundamentals-corpora..> | 2023-05-03 10:01 | 43K | |
![[ ]](/icons/compressed.gif) | fundamentals-corpora..> | 2023-05-03 10:01 | 5.5M | |
![[ ]](/icons/compressed.gif) | fundamentals-cost-ac..> | 2023-05-03 13:41 | 2.1M | |
![[IMG]](/icons/image2.gif) | fundamentals-cost-ac..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | fundamentals-cost-ac..> | 2023-08-21 02:16 | 19K | |
![[IMG]](/icons/image2.gif) | fundamentals-cost-ac..> | 2023-05-03 09:27 | 50K | |
![[ ]](/icons/compressed.gif) | fundamentals-cost-ac..> | 2023-05-03 09:27 | 1.0M | |
![[IMG]](/icons/image2.gif) | fundamentals-financi..> | 2023-08-06 09:45 | 3.8K | |
![[IMG]](/icons/image2.gif) | fundamentals-financi..> | 2023-08-08 18:30 | 20K | |
![[IMG]](/icons/image2.gif) | fundamentals-financi..> | 2023-05-03 10:23 | 47K | |
![[ ]](/icons/compressed.gif) | fundamentals-financi..> | 2023-05-03 10:23 | 841K | |
![[IMG]](/icons/image2.gif) | fundamentals-general..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-general..> | 2023-08-08 07:30 | 28K | |
![[IMG]](/icons/image2.gif) | fundamentals-general..> | 2023-05-03 09:22 | 102K | |
![[ ]](/icons/compressed.gif) | fundamentals-general..> | 2023-05-03 09:22 | 131K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-05 01:51 | 3.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-08 18:30 | 17K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-05-03 10:44 | 42K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-05 14:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-14 22:07 | 17K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-05-03 09:43 | 42K | |
![[ ]](/icons/compressed.gif) | fundamentals-human-r..> | 2023-05-03 09:43 | 399K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-05 03:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-08-14 22:07 | 31K | |
![[IMG]](/icons/image2.gif) | fundamentals-human-r..> | 2023-05-03 10:32 | 47K | |
![[ ]](/icons/compressed.gif) | fundamentals-human-r..> | 2023-05-03 10:32 | 171K | |
![[ ]](/icons/compressed.gif) | fundamentals-nursing..> | 2023-05-03 10:33 | 13K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-abno..> | 2023-08-05 14:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-abno..> | 2023-08-15 07:52 | 30K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-abno..> | 2023-05-03 09:26 | 48K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-abno..> | 2023-05-03 09:26 | 109K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-abno..> | 2023-08-05 19:19 | 11K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-abno..> | 2023-05-03 10:21 | 27K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-adva..> | 2023-05-03 09:30 | 9.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-anat..> | 2023-08-08 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-anat..> | 2023-05-03 11:19 | 24K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-anat..> | 2023-05-03 11:19 | 6.7K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-anat..> | 2023-08-05 04:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-anat..> | 2023-05-03 10:42 | 7.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-busi..> | 2023-05-03 10:15 | 11K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-chem..> | 2023-08-05 01:52 | 3.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-chem..> | 2023-05-03 11:26 | 16K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-chem..> | 2023-05-03 11:25 | 72K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-08-06 17:51 | 2.4K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-05-03 09:22 | 13K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-corp..> | 2023-05-03 09:22 | 24K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-05-03 09:45 | 17K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-corp..> | 2023-05-03 09:45 | 159K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-corp..> | 2023-05-03 09:39 | 18K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-08-05 16:28 | 2.8K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-corp..> | 2023-05-03 09:39 | 11K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-cost..> | 2023-08-08 03:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-cost..> | 2023-05-03 10:01 | 9.7K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-econ..> | 2023-08-07 18:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-econ..> | 2023-05-03 09:34 | 20K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-econ..> | 2023-05-03 09:34 | 27K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-elec..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-elec..> | 2023-08-08 18:30 | 16K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-elec..> | 2023-05-03 09:51 | 27K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-elec..> | 2023-05-03 09:51 | 961K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-08-06 07:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-05-03 10:27 | 24K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-fina..> | 2023-05-03 10:27 | 4.8M | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-08-05 15:31 | 3.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-05-03 09:29 | 20K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-fina..> | 2023-05-03 09:29 | 923K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-08-06 03:36 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-fina..> | 2023-05-03 09:40 | 7.5K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-fina..> | 2023-05-03 09:40 | 31K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-futu..> | 2023-08-05 01:52 | 3.4K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-futu..> | 2023-05-03 11:09 | 17K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-heat..> | 2023-05-03 10:39 | 11K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-huma..> | 2023-08-07 09:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-huma..> | 2023-05-03 10:35 | 20K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-huma..> | 2023-05-03 10:35 | 6.7K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-inve..> | 2023-05-03 10:51 | 161K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-05-03 10:51 | 10K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-08-06 11:14 | 2.7K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-05-04 02:13 | 18K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-inve..> | 2023-05-04 02:13 | 238K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-08-08 00:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-inve..> | 2023-05-03 09:57 | 18K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-inve..> | 2023-05-03 09:57 | 47K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-mana..> | 2023-08-05 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-mana..> | 2023-05-03 09:21 | 19K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-mana..> | 2023-05-03 09:21 | 73K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-ment..> | 2023-08-06 14:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-ment..> | 2023-05-03 09:22 | 17K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-ment..> | 2023-05-03 09:22 | 11K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-nurs..> | 2023-05-03 09:23 | 20K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-nurs..> | 2023-05-03 09:23 | 672K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-nurs..> | 2023-08-06 08:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-nurs..> | 2023-05-03 10:30 | 19K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-nurs..> | 2023-05-03 10:30 | 26K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-phys..> | 2023-08-08 22:00 | 4.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-phys..> | 2023-05-03 09:29 | 31K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-phys..> | 2023-05-03 09:29 | 10K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-rese..> | 2023-08-09 03:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-rese..> | 2023-08-17 05:40 | 30K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-rese..> | 2023-05-03 10:35 | 50K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-rese..> | 2023-05-03 10:35 | 151K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-sell..> | 2023-08-06 08:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-sell..> | 2023-05-03 11:05 | 15K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-sell..> | 2023-05-03 11:05 | 79K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-stat..> | 2023-05-03 10:38 | 461K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-stat..> | 2023-08-05 16:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-stat..> | 2023-05-03 10:15 | 13K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-stat..> | 2023-08-05 15:31 | 3.0K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-stat..> | 2023-05-03 10:38 | 13K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-urin..> | 2023-08-05 15:34 | 2.4K | |
![[IMG]](/icons/image2.gif) | fundamentals-of-urin..> | 2023-05-03 10:22 | 14K | |
![[ ]](/icons/compressed.gif) | fundamentals-of-urin..> | 2023-05-03 10:22 | 0 | |
![[IMG]](/icons/image2.gif) | fundamentals-organiz..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | fundamentals-organiz..> | 2023-08-12 00:54 | 22K | |
![[IMG]](/icons/image2.gif) | fundamentals-organiz..> | 2023-05-04 01:48 | 83K | |
![[ ]](/icons/compressed.gif) | fundamentals-organiz..> | 2023-05-04 01:48 | 150K | |
![[IMG]](/icons/image2.gif) | fundamentals-statist..> | 2023-08-05 01:13 | 3.1K | |
![[IMG]](/icons/image2.gif) | fundamentals-statist..> | 2023-08-17 05:40 | 17K | |
![[IMG]](/icons/image2.gif) | fundamentals-statist..> | 2023-05-03 09:44 | 62K | |
![[ ]](/icons/compressed.gif) | fundamentals-statist..> | 2023-05-03 09:44 | 357K | |
![[IMG]](/icons/image2.gif) | fundamentals-taxatio..> | 2023-08-06 09:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | fundamentals-taxatio..> | 2023-08-17 05:40 | 21K | |
![[IMG]](/icons/image2.gif) | fundamentals-taxatio..> | 2023-05-04 02:09 | 51K | |
![[ ]](/icons/compressed.gif) | fundamentals-taxatio..> | 2023-05-04 02:09 | 224K | |
![[IMG]](/icons/image2.gif) | gamble-essentials_of..> | 2023-05-03 10:24 | 45K | |
![[IMG]](/icons/image2.gif) | games-strategies-and..> | 2023-08-05 03:41 | 4.7K | |
![[IMG]](/icons/image2.gif) | games-strategies-and..> | 2023-08-08 18:30 | 40K | |
![[IMG]](/icons/image2.gif) | games-strategies-and..> | 2023-05-03 09:32 | 65K | |
![[ ]](/icons/compressed.gif) | games-strategies-and..> | 2023-05-03 09:32 | 2.7M | |
![[IMG]](/icons/image2.gif) | gender-race-and-clas..> | 2023-08-06 05:44 | 4.8K | |
![[IMG]](/icons/image2.gif) | gender-race-and-clas..> | 2023-08-17 05:40 | 22K | |
![[IMG]](/icons/image2.gif) | gender-race-and-clas..> | 2023-05-04 01:51 | 41K | |
![[ ]](/icons/compressed.gif) | gender-race-and-clas..> | 2023-05-04 01:51 | 134K | |
![[IMG]](/icons/image2.gif) | general-chemistry-at..> | 2023-08-05 06:17 | 3.2K | |
![[IMG]](/icons/image2.gif) | general-chemistry-at..> | 2023-05-03 09:37 | 18K | |
![[ ]](/icons/compressed.gif) | general-chemistry-at..> | 2023-05-03 09:37 | 365K | |
![[IMG]](/icons/image2.gif) | general-organic-and-..> | 2023-08-05 16:23 | 3.9K | |
![[IMG]](/icons/image2.gif) | general-organic-and-..> | 2023-05-03 09:42 | 27K | |
![[ ]](/icons/compressed.gif) | general-organic-and-..> | 2023-05-03 09:42 | 14K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-08-08 22:03 | 4.0K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-08-14 00:55 | 21K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-05-03 10:10 | 55K | |
![[ ]](/icons/compressed.gif) | general-organic-biol..> | 2023-05-03 10:10 | 159K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-08-06 13:03 | 2.9K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-08-14 00:55 | 15K | |
![[IMG]](/icons/image2.gif) | general-organic-biol..> | 2023-05-04 02:29 | 56K | |
![[ ]](/icons/compressed.gif) | general-organic-biol..> | 2023-05-04 02:29 | 222K | |
![[IMG]](/icons/image2.gif) | genetic-analysis-int..> | 2023-08-06 16:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | genetic-analysis-int..> | 2023-08-14 00:55 | 21K | |
![[IMG]](/icons/image2.gif) | genetic-analysis-int..> | 2023-05-03 10:54 | 89K | |
![[ ]](/icons/compressed.gif) | genetic-analysis-int..> | 2023-05-03 10:54 | 240K | |
![[IMG]](/icons/image2.gif) | genetics-a-conceptua..> | 2023-08-08 06:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | genetics-a-conceptua..> | 2023-05-03 10:09 | 15K | |
![[ ]](/icons/compressed.gif) | genetics-analysis-an..> | 2023-05-03 11:00 | 315K | |
![[IMG]](/icons/image2.gif) | genetics-analysis-an..> | 2023-08-06 05:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | genetics-analysis-an..> | 2023-05-03 10:12 | 12K | |
![[IMG]](/icons/image2.gif) | genetics-and-genomic..> | 2023-08-05 05:30 | 2.1K | |
![[IMG]](/icons/image2.gif) | genetics-and-genomic..> | 2023-05-03 09:25 | 11K | |
![[ ]](/icons/compressed.gif) | genetics-and-genomic..> | 2023-05-03 09:25 | 13K | |
![[IMG]](/icons/image2.gif) | genetics-essentials-..> | 2023-08-08 07:19 | 4.4K | |
![[IMG]](/icons/image2.gif) | genetics-essentials-..> | 2023-08-14 00:55 | 30K | |
![[IMG]](/icons/image2.gif) | genetics-essentials-..> | 2023-05-03 09:20 | 47K | |
![[ ]](/icons/compressed.gif) | genetics-essentials-..> | 2023-05-03 09:20 | 68K | |
![[IMG]](/icons/image2.gif) | genetics-essentials-..> | 2023-08-05 04:37 | 3.8K | |
![[IMG]](/icons/image2.gif) | genetics-essentials-..> | 2023-05-03 09:35 | 25K | |
![[IMG]](/icons/image2.gif) | geography-realms-reg..> | 2023-08-05 14:39 | 4.7K | |
![[IMG]](/icons/image2.gif) | geography-realms-reg..> | 2023-05-03 09:30 | 29K | |
![[IMG]](/icons/image2.gif) | geometry-1st-edition..> | 2023-08-05 05:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | geometry-1st-edition..> | 2023-08-08 18:30 | 15K | |
![[IMG]](/icons/image2.gif) | geometry-1st-edition..> | 2023-05-03 10:24 | 54K | |
![[ ]](/icons/compressed.gif) | geometry-1st-edition..> | 2023-05-03 10:24 | 393K | |
![[ ]](/icons/unknown.gif) | george_umob6_im_ch01..> | 2023-05-03 10:38 | 189K | |
![[IMG]](/icons/image2.gif) | gerontologic-nursing..> | 2023-08-05 03:41 | 4.6K | |
![[ ]](/icons/compressed.gif) | gerontologic-nursing..> | 2023-05-03 10:21 | 655K | |
![[IMG]](/icons/image2.gif) | gerontologic-nursing..> | 2023-05-03 10:21 | 35K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-08-05 20:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-05-03 11:05 | 14K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-08-06 15:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-05-03 10:41 | 19K | |
![[ ]](/icons/compressed.gif) | gerontological-nursi..> | 2023-05-03 10:41 | 104K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-08-05 01:09 | 15K | |
![[IMG]](/icons/image2.gif) | gerontological-nursi..> | 2023-05-03 10:43 | 42K | |
![[ ]](/icons/unknown.gif) | glackin_esosp5_im_00..> | 2023-05-03 10:55 | 27K | |
![[IMG]](/icons/image2.gif) | global-business-4th-..> | 2023-08-05 06:19 | 3.0K | |
![[IMG]](/icons/image2.gif) | global-business-4th-..> | 2023-08-14 00:55 | 18K | |
![[IMG]](/icons/image2.gif) | global-business-4th-..> | 2023-05-03 10:08 | 46K | |
![[ ]](/icons/compressed.gif) | global-business-4th-..> | 2023-05-03 10:08 | 59K | |
![[IMG]](/icons/image2.gif) | global-business-peng..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | global-business-peng..> | 2023-05-03 09:21 | 24K | |
![[ ]](/icons/compressed.gif) | global-business-peng..> | 2023-05-03 09:21 | 19K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-06 09:43 | 4.1K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-08 14:31 | 18K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-05-03 09:20 | 42K | |
![[ ]](/icons/compressed.gif) | global-business-toda..> | 2023-05-03 09:20 | 329K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-05-03 09:49 | 14K | |
![[ ]](/icons/compressed.gif) | global-business-toda..> | 2023-05-03 09:49 | 247K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-06 12:08 | 3.8K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-12 12:45 | 23K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-05-03 11:11 | 40K | |
![[ ]](/icons/compressed.gif) | global-business-toda..> | 2023-05-03 11:11 | 1.8M | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-08-05 05:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | global-business-toda..> | 2023-05-03 10:50 | 16K | |
![[ ]](/icons/compressed.gif) | global-business-toda..> | 2023-05-03 10:50 | 56K | |
![[IMG]](/icons/image2.gif) | global-marketing-con..> | 2023-08-05 01:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | global-marketing-con..> | 2023-05-03 09:51 | 29K | |
![[ ]](/icons/compressed.gif) | global-marketing-con..> | 2023-05-03 09:51 | 37K | |
![[IMG]](/icons/image2.gif) | global-marketing-gil..> | 2023-08-05 06:23 | 4.0K | |
![[IMG]](/icons/image2.gif) | global-marketing-gil..> | 2023-05-03 09:46 | 24K | |
![[ ]](/icons/compressed.gif) | global-marketing-gil..> | 2023-05-03 09:46 | 8.7K | |
![[IMG]](/icons/image2.gif) | global-marketing-man..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | global-marketing-man..> | 2023-08-12 12:45 | 22K | |
![[IMG]](/icons/image2.gif) | global-marketing-man..> | 2023-05-03 09:45 | 34K | |
![[ ]](/icons/compressed.gif) | global-marketing-man..> | 2023-05-03 09:45 | 156K | |
![[IMG]](/icons/image2.gif) | global-strategy-peng..> | 2023-08-08 06:38 | 3.5K | |
![[IMG]](/icons/image2.gif) | global-strategy-peng..> | 2023-05-03 10:16 | 27K | |
![[ ]](/icons/compressed.gif) | global-strategy-peng..> | 2023-05-03 10:16 | 18K | |
![[ ]](/icons/unknown.gif) | gomez-mejia_mhr9e_im..> | 2023-05-04 01:53 | 53K | |
![[ ]](/icons/compressed.gif) | gomez_mgmt_tb_01.zip | 2023-05-03 10:05 | 16K | |
![[IMG]](/icons/image2.gif) | goulds-pathophysiolo..> | 2023-08-05 14:00 | 13K | |
![[IMG]](/icons/image2.gif) | goulds-pathophysiolo..> | 2023-05-03 11:14 | 35K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-08-08 15:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-05-03 09:34 | 28K | |
![[ ]](/icons/compressed.gif) | government-and-not-f..> | 2023-05-03 09:34 | 19K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-08-08 16:42 | 4.0K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-05-03 09:30 | 14K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | government-and-not-f..> | 2023-05-03 11:21 | 8.4K | |
![[ ]](/icons/compressed.gif) | government-not-profi..> | 2023-05-03 10:13 | 28K | |
![[IMG]](/icons/image2.gif) | govt-5th-edition-sid..> | 2023-05-03 10:24 | 65K | |
![[ ]](/icons/compressed.gif) | govt-5th-edition-sid..> | 2023-05-03 10:24 | 244K | |
![[ ]](/icons/unknown.gif) | greene_tb_01.doc | 2023-05-03 10:46 | 49K | |
![[IMG]](/icons/image2.gif) | group-counseling-str..> | 2023-08-05 03:41 | 2.6K | |
![[IMG]](/icons/image2.gif) | group-counseling-str..> | 2023-05-04 02:08 | 15K | |
![[IMG]](/icons/image2.gif) | group-dynamics-forsy..> | 2023-08-05 15:35 | 4.0K | |
![[IMG]](/icons/image2.gif) | group-dynamics-forsy..> | 2023-05-03 09:58 | 19K | |
![[ ]](/icons/compressed.gif) | group-dynamics-forsy..> | 2023-05-03 09:58 | 61K | |
![[IMG]](/icons/image2.gif) | groups-process-and-p..> | 2023-08-05 16:26 | 2.1K | |
![[IMG]](/icons/image2.gif) | groups-process-and-p..> | 2023-05-03 09:47 | 6.8K | |
![[IMG]](/icons/image2.gif) | groups-process-and-p..> | 2023-08-06 12:18 | 2.1K | |
![[IMG]](/icons/image2.gif) | groups-process-and-p..> | 2023-05-03 10:34 | 6.8K | |
![[IMG]](/icons/image2.gif) | guide-to-oracle-10g-..> | 2023-08-05 02:47 | 2.3K | |
![[IMG]](/icons/image2.gif) | guide-to-oracle-10g-..> | 2023-05-03 09:24 | 12K | |
![[ ]](/icons/compressed.gif) | guide-to-oracle-10g-..> | 2023-05-03 09:24 | 17K | |
![[IMG]](/icons/image2.gif) | guyton-and-hall-text..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | guyton-and-hall-text..> | 2023-05-03 09:55 | 8.4K | |
![[ ]](/icons/compressed.gif) | guyton-and-hall-text..> | 2023-05-03 09:55 | 13K | |
![[IMG]](/icons/image2.gif) | half-the-human-exper..> | 2023-08-08 06:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | half-the-human-exper..> | 2023-05-03 09:32 | 22K | |
![[ ]](/icons/compressed.gif) | half-the-human-exper..> | 2023-05-03 09:32 | 26K | |
![[IMG]](/icons/image2.gif) | halliday-resnick-fun..> | 2023-05-03 10:58 | 97K | |
![[IMG]](/icons/image2.gif) | handbook-of-informat..> | 2023-08-07 01:58 | 4.2K | |
![[IMG]](/icons/image2.gif) | handbook-of-informat..> | 2023-05-03 10:23 | 15K | |
![[IMG]](/icons/image2.gif) | harkness-100x100.jpg | 2023-08-05 04:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | harkness-300x300.jpg | 2023-08-10 13:41 | 17K | |
![[IMG]](/icons/image2.gif) | harkness.jpg | 2023-05-03 10:07 | 36K | |
![[ ]](/icons/compressed.gif) | hca14_SM_CH01.zip | 2023-05-04 01:59 | 27K | |
![[IMG]](/icons/image2.gif) | health-and-physical-..> | 2023-08-06 15:32 | 4.1K | |
![[IMG]](/icons/image2.gif) | health-and-physical-..> | 2023-05-03 11:04 | 30K | |
![[IMG]](/icons/image2.gif) | health-assessment-fo..> | 2023-08-06 11:14 | 3.4K | |
![[IMG]](/icons/image2.gif) | health-assessment-fo..> | 2023-05-03 09:40 | 17K | |
![[ ]](/icons/compressed.gif) | health-assessment-fo..> | 2023-05-03 09:40 | 13K | |
![[ ]](/icons/layout.gif) | health-assessment-fo..> | 2023-05-03 09:51 | 675K | |
![[IMG]](/icons/image2.gif) | health-assessment-fo..> | 2023-05-03 09:51 | 33K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-08-06 10:11 | 13K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-05-03 10:03 | 35K | |
![[ ]](/icons/compressed.gif) | health-assessment-in..> | 2023-05-04 02:15 | 101K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-08-05 16:26 | 3.2K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-05-03 09:22 | 9.0K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-08-06 12:19 | 3.2K | |
![[IMG]](/icons/image2.gif) | health-assessment-in..> | 2023-05-04 02:15 | 10K | |
![[IMG]](/icons/image2.gif) | health-economics-1st..> | 2023-08-05 01:51 | 2.8K | |
![[IMG]](/icons/image2.gif) | health-economics-1st..> | 2023-08-14 13:35 | 15K | |
![[IMG]](/icons/image2.gif) | health-economics-1st..> | 2023-05-03 10:19 | 26K | |
![[ ]](/icons/compressed.gif) | health-economics-1st..> | 2023-05-03 10:19 | 203K | |
![[IMG]](/icons/image2.gif) | health-information-t..> | 2023-08-05 05:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | health-information-t..> | 2023-05-03 10:22 | 22K | |
![[ ]](/icons/compressed.gif) | health-information-t..> | 2023-05-03 10:22 | 8.8K | |
![[ ]](/icons/compressed.gif) | health-physical-asse..> | 2023-05-03 11:04 | 25K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-08-05 14:35 | 4.7K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-08-07 04:39 | 26K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-05-04 02:15 | 63K | |
![[ ]](/icons/compressed.gif) | health-physical-asse..> | 2023-05-04 02:15 | 92K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-08-05 06:25 | 4.7K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-08-15 06:40 | 26K | |
![[IMG]](/icons/image2.gif) | health-physical-asse..> | 2023-05-03 09:40 | 63K | |
![[ ]](/icons/compressed.gif) | health-physical-asse..> | 2023-05-03 09:40 | 102K | |
![[ ]](/icons/compressed.gif) | health-promotion-thr..> | 2023-05-03 09:59 | 4.0K | |
![[IMG]](/icons/image2.gif) | health-psychology-an..> | 2023-08-05 16:23 | 4.1K | |
![[IMG]](/icons/image2.gif) | health-psychology-an..> | 2023-05-03 11:12 | 22K | |
![[ ]](/icons/compressed.gif) | health-psychology-an..> | 2023-05-03 11:12 | 72K | |
![[IMG]](/icons/image2.gif) | health-psychology-ta..> | 2023-08-06 05:43 | 3.0K | |
![[IMG]](/icons/image2.gif) | health-psychology-ta..> | 2023-05-03 10:54 | 16K | |
![[ ]](/icons/compressed.gif) | health-psychology-ta..> | 2023-05-03 10:54 | 177K | |
![[IMG]](/icons/image2.gif) | health-the-basics-do..> | 2023-08-05 04:34 | 2.4K | |
![[IMG]](/icons/image2.gif) | health-the-basics-do..> | 2023-05-03 09:29 | 14K | |
![[ ]](/icons/compressed.gif) | health-the-basics-do..> | 2023-05-03 09:29 | 162K | |
![[IMG]](/icons/image2.gif) | hedl9780170362030.jpg | 2023-05-04 02:22 | 11K | |
![[ ]](/icons/unknown.gif) | heizer_om10_tif_ch01..> | 2023-05-03 10:12 | 159K | |
![[IMG]](/icons/image2.gif) | hesi-rn-exit-main-ph..> | 2023-05-04 02:12 | 360K | |
![[IMG]](/icons/image2.gif) | hesi-rn-patho-main-1..> | 2023-08-05 01:52 | 20K | |
![[IMG]](/icons/image2.gif) | hesi-rn-patho-main-3..> | 2023-08-15 06:40 | 143K | |
![[IMG]](/icons/image2.gif) | hesi-rn-patho-main.png | 2023-05-04 01:48 | 3.9M | |
![[ ]](/icons/compressed.gif) | hho9e_ch01_tif_testg..> | 2023-05-04 02:02 | 168K | |
![[IMG]](/icons/image2.gif) | hickman-zoology-14th..> | 2023-08-05 21:01 | 2.7K | |
![[IMG]](/icons/image2.gif) | hickman-zoology-14th..> | 2023-08-05 23:08 | 14K | |
![[IMG]](/icons/image2.gif) | hickman-zoology-14th..> | 2023-05-04 01:52 | 37K | |
![[IMG]](/icons/image2.gif) | high-acuity-nursing-..> | 2023-08-05 03:41 | 2.5K | |
![[ ]](/icons/compressed.gif) | high-acuity-nursing-..> | 2023-05-03 10:26 | 144K | |
![[IMG]](/icons/image2.gif) | high-acuity-nursing-..> | 2023-05-03 10:26 | 9.5K | |
![[IMG]](/icons/image2.gif) | high-acuity-nursing-..> | 2023-08-05 02:03 | 2.3K | |
![[IMG]](/icons/image2.gif) | high-acuity-nursing-..> | 2023-05-03 10:47 | 13K | |
![[ ]](/icons/compressed.gif) | high-acuity-nursing-..> | 2023-05-03 10:47 | 15K | |
![[ ]](/icons/compressed.gif) | hillier6e_chapter01_..> | 2023-05-03 11:01 | 198K | |
![[IMG]](/icons/image2.gif) | hilton-8ce-500x500-2..> | 2023-05-04 01:47 | 57K | |
![[ ]](/icons/unknown.gif) | hima16_sm_01.doc | 2023-05-03 10:39 | 152K | |
![[IMG]](/icons/image2.gif) | hist-volume-1-us-his..> | 2023-08-08 18:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | hist-volume-1-us-his..> | 2023-05-03 09:56 | 21K | |
![[ ]](/icons/compressed.gif) | hist-volume-1-us-his..> | 2023-05-03 09:56 | 16K | |
![[IMG]](/icons/image2.gif) | histology-and-cell-b..> | 2023-08-06 12:10 | 3.1K | |
![[IMG]](/icons/image2.gif) | histology-and-cell-b..> | 2023-05-04 01:50 | 17K | |
![[ ]](/icons/compressed.gif) | histology-and-cell-b..> | 2023-05-04 01:50 | 13K | |
![[IMG]](/icons/image2.gif) | histology-and-cell-b..> | 2023-08-05 03:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | histology-and-cell-b..> | 2023-05-03 10:14 | 20K | |
![[ ]](/icons/compressed.gif) | histology-and-cell-b..> | 2023-05-03 10:14 | 11K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-08-06 13:03 | 2.6K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-08-16 08:56 | 17K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-05-03 10:07 | 32K | |
![[ ]](/icons/compressed.gif) | history-of-western-s..> | 2023-05-03 10:07 | 79K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-08-06 13:11 | 2.8K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-08-16 08:56 | 15K | |
![[IMG]](/icons/image2.gif) | history-of-western-s..> | 2023-05-03 09:54 | 27K | |
![[ ]](/icons/compressed.gif) | history-of-western-s..> | 2023-05-03 09:54 | 79K | |
![[ ]](/icons/unknown.gif) | hitt_Strat_Mgmt_10e_..> | 2023-05-03 10:30 | 160K | |
![[ ]](/icons/unknown.gif) | hitt_inst_manual_13e..> | 2023-05-04 02:03 | 72K | |
![[ ]](/icons/compressed.gif) | hoefnagels_bte_3e_wo..> | 2023-05-03 11:02 | 39K | |
![[ ]](/icons/unknown.gif) | hoffer_mdm11e_tif_ch..> | 2023-05-03 11:20 | 148K | |
![[IMG]](/icons/image2.gif) | hola-amigos-8th-edit..> | 2023-08-05 14:37 | 4.9K | |
![[IMG]](/icons/image2.gif) | hola-amigos-8th-edit..> | 2023-08-16 08:56 | 24K | |
![[IMG]](/icons/image2.gif) | hola-amigos-8th-edit..> | 2023-05-03 09:55 | 60K | |
![[ ]](/icons/compressed.gif) | hola-amigos-8th-edit..> | 2023-05-03 09:54 | 198K | |
![[IMG]](/icons/image2.gif) | holes-human-anatomy-..> | 2023-08-08 17:37 | 3.4K | |
![[IMG]](/icons/image2.gif) | holes-human-anatomy-..> | 2023-05-03 10:31 | 19K | |
![[ ]](/icons/compressed.gif) | holes-human-anatomy-..> | 2023-05-03 10:31 | 11K | |
![[IMG]](/icons/image2.gif) | holes-human-anatomy-..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | holes-human-anatomy-..> | 2023-05-03 09:37 | 11K | |
![[IMG]](/icons/image2.gif) | horizons-exploring-t..> | 2023-08-08 16:37 | 2.1K | |
![[IMG]](/icons/image2.gif) | horizons-exploring-t..> | 2023-05-03 09:37 | 12K | |
![[ ]](/icons/compressed.gif) | horizons-exploring-t..> | 2023-05-03 09:37 | 9.2K | |
![[IMG]](/icons/image2.gif) | how-children-develop..> | 2023-08-06 15:59 | 3.5K | |
![[IMG]](/icons/image2.gif) | how-children-develop..> | 2023-08-16 08:56 | 23K | |
![[IMG]](/icons/image2.gif) | how-children-develop..> | 2023-05-03 11:02 | 37K | |
![[ ]](/icons/compressed.gif) | how-children-develop..> | 2023-05-03 11:02 | 87K | |
![[ ]](/icons/layout.gif) | hr_om12_ism_ch02.pdf | 2023-05-03 13:40 | 210K | |
![[IMG]](/icons/image2.gif) | hughes-leadership_8e..> | 2023-05-03 10:07 | 50K | |
![[ ]](/icons/unknown.gif) | hughes9e_chapter01_t..> | 2023-05-04 01:48 | 21K | |
![[IMG]](/icons/image2.gif) | human-anatomy-8th-ed..> | 2023-08-05 14:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | human-anatomy-8th-ed..> | 2023-08-16 08:56 | 17K | |
![[IMG]](/icons/image2.gif) | human-anatomy-8th-ed..> | 2023-05-03 11:16 | 79K | |
![[ ]](/icons/compressed.gif) | human-anatomy-8th-ed..> | 2023-05-03 11:16 | 1.1M | |
![[IMG]](/icons/image2.gif) | human-anatomy-and-ph..> | 2023-08-05 05:29 | 12K | |
![[IMG]](/icons/image2.gif) | human-anatomy-and-ph..> | 2023-05-03 09:42 | 32K | |
![[ ]](/icons/compressed.gif) | human-anatomy-and-ph..> | 2023-05-03 11:02 | 87K | |
![[IMG]](/icons/image2.gif) | human-anatomy-and-ph..> | 2023-05-03 11:02 | 11K | |
![[ ]](/icons/compressed.gif) | human-anatomy-freder..> | 2023-05-03 09:36 | 737K | |
![[IMG]](/icons/image2.gif) | human-anatomy-marieb..> | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | human-anatomy-marieb..> | 2023-05-03 09:58 | 6.4K | |
![[ ]](/icons/compressed.gif) | human-anatomy-marieb..> | 2023-05-03 09:58 | 221K | |
![[IMG]](/icons/image2.gif) | human-anatomy-marieb..> | 2023-08-06 13:06 | 3.1K | |
![[IMG]](/icons/image2.gif) | human-anatomy-marieb..> | 2023-05-03 10:56 | 17K | |
![[ ]](/icons/compressed.gif) | human-anatomy-marieb..> | 2023-05-03 10:56 | 172K | |
![[IMG]](/icons/image2.gif) | human-anatomy-martin..> | 2023-08-05 03:40 | 13K | |
![[IMG]](/icons/image2.gif) | human-anatomy-martin..> | 2023-05-03 09:59 | 33K | |
![[ ]](/icons/compressed.gif) | human-anatomy-martin..> | 2023-05-03 09:59 | 420K | |
![[IMG]](/icons/image2.gif) | human-anatomy-mckinl..> | 2023-05-03 10:08 | 10K | |
![[IMG]](/icons/image2.gif) | human-anatomy-media-..> | 2023-08-05 16:26 | 2.4K | |
![[IMG]](/icons/image2.gif) | human-anatomy-media-..> | 2023-05-03 10:43 | 17K | |
![[ ]](/icons/compressed.gif) | human-anatomy-media-..> | 2023-05-03 10:43 | 172K | |
![[ ]](/icons/compressed.gif) | human-anatomy-michae..> | 2023-05-03 10:08 | 1.2M | |
![[ ]](/icons/compressed.gif) | human-anatomy-physio..> | 2023-05-03 10:22 | 165K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-06 03:41 | 3.3K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-05-03 09:55 | 24K | |
![[ ]](/icons/compressed.gif) | human-anatomy-physio..> | 2023-05-03 09:55 | 375K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-05 05:30 | 14K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-05-03 10:48 | 35K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-06 05:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-14 13:35 | 20K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-05-03 10:26 | 56K | |
![[ ]](/icons/compressed.gif) | human-anatomy-physio..> | 2023-05-03 10:26 | 128K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-08-16 08:56 | 20K | |
![[IMG]](/icons/image2.gif) | human-anatomy-physio..> | 2023-05-03 10:57 | 55K | |
![[ ]](/icons/compressed.gif) | human-anatomy-physio..> | 2023-05-03 10:57 | 163K | |
![[IMG]](/icons/image2.gif) | human-anatomy-saladi..> | 2023-08-05 06:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | human-anatomy-saladi..> | 2023-05-03 11:07 | 24K | |
![[ ]](/icons/compressed.gif) | human-anatomy-saladi..> | 2023-05-03 11:07 | 128K | |
![[ ]](/icons/compressed.gif) | human-biology-11th-e..> | 2023-05-04 02:00 | 66K | |
![[IMG]](/icons/image2.gif) | human-biology-concep..> | 2023-08-05 02:55 | 2.7K | |
![[IMG]](/icons/image2.gif) | human-biology-concep..> | 2023-05-03 09:38 | 13K | |
![[ ]](/icons/compressed.gif) | human-biology-concep..> | 2023-05-03 09:38 | 115K | |
![[IMG]](/icons/image2.gif) | human-biology-starr-..> | 2023-08-05 07:10 | 3.1K | |
![[IMG]](/icons/image2.gif) | human-biology-starr-..> | 2023-05-03 10:33 | 16K | |
![[ ]](/icons/compressed.gif) | human-biology-starr-..> | 2023-05-03 10:33 | 19K | |
![[IMG]](/icons/image2.gif) | human-development-a-..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | human-development-a-..> | 2023-05-03 10:20 | 18K | |
![[ ]](/icons/compressed.gif) | human-development-a-..> | 2023-05-03 10:20 | 209K | |
![[IMG]](/icons/image2.gif) | human-development-ac..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | human-development-ac..> | 2023-05-03 09:52 | 25K | |
![[ ]](/icons/compressed.gif) | human-development-ac..> | 2023-05-03 09:52 | 49K | |
![[IMG]](/icons/image2.gif) | human-development-cr..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | human-development-cr..> | 2023-05-03 10:01 | 18K | |
![[ ]](/icons/compressed.gif) | human-development-cr..> | 2023-05-03 10:01 | 287K | |
![[IMG]](/icons/image2.gif) | human-development-pa..> | 2023-08-05 01:12 | 2.8K | |
![[IMG]](/icons/image2.gif) | human-development-pa..> | 2023-05-03 10:04 | 17K | |
![[ ]](/icons/compressed.gif) | human-development-pa..> | 2023-05-03 10:04 | 30K | |
![[IMG]](/icons/image2.gif) | human-diseases-neigh..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | human-diseases-neigh..> | 2023-05-03 11:21 | 19K | |
![[ ]](/icons/compressed.gif) | human-diseases-neigh..> | 2023-05-03 11:21 | 4.7K | |
![[IMG]](/icons/image2.gif) | human-embryology-and..> | 2023-08-05 05:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | human-embryology-and..> | 2023-05-03 11:26 | 25K | |
![[ ]](/icons/compressed.gif) | human-embryology-and..> | 2023-05-03 11:26 | 8.3K | |
![[IMG]](/icons/image2.gif) | human-genetics-and-s..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | human-genetics-and-s..> | 2023-05-03 10:27 | 24K | |
![[ ]](/icons/compressed.gif) | human-genetics-and-s..> | 2023-05-03 10:27 | 99K | |
![[ ]](/icons/compressed.gif) | human-genetics-conce..> | 2023-05-03 13:43 | 6.4K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-08-06 13:10 | 4.3K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-08-05 01:51 | 24K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-05-03 09:19 | 63K | |
![[ ]](/icons/compressed.gif) | human-genetics-conce..> | 2023-05-03 09:19 | 172K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-08-05 01:52 | 4.3K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-08-20 22:31 | 24K | |
![[IMG]](/icons/image2.gif) | human-genetics-conce..> | 2023-05-03 09:52 | 63K | |
![[ ]](/icons/compressed.gif) | human-genetics-conce..> | 2023-05-03 09:52 | 47K | |
![[IMG]](/icons/image2.gif) | human-genetics-ricki..> | 2023-08-05 02:13 | 4.2K | |
![[IMG]](/icons/image2.gif) | human-genetics-ricki..> | 2023-05-03 09:20 | 21K | |
![[IMG]](/icons/image2.gif) | human-heredity-cummi..> | 2023-08-05 19:19 | 2.6K | |
![[IMG]](/icons/image2.gif) | human-heredity-cummi..> | 2023-05-03 10:54 | 14K | |
![[ ]](/icons/compressed.gif) | human-heredity-cummi..> | 2023-05-03 10:54 | 12K | |
![[ ]](/icons/compressed.gif) | human-learning-7th-e..> | 2023-05-03 10:25 | 16K | |
![[IMG]](/icons/image2.gif) | human-nutrition-scie..> | 2023-08-05 14:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | human-nutrition-scie..> | 2023-08-20 22:31 | 24K | |
![[IMG]](/icons/image2.gif) | human-nutrition-scie..> | 2023-05-03 09:51 | 65K | |
![[ ]](/icons/compressed.gif) | human-nutrition-scie..> | 2023-05-03 09:51 | 224K | |
![[IMG]](/icons/image2.gif) | human-physiology-2nd..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | human-physiology-2nd..> | 2023-08-20 22:31 | 19K | |
![[IMG]](/icons/image2.gif) | human-physiology-2nd..> | 2023-05-03 10:27 | 1.2M | |
![[ ]](/icons/compressed.gif) | human-physiology-2nd..> | 2023-05-03 10:27 | 173K | |
![[ ]](/icons/compressed.gif) | human-physiology-an-..> | 2023-05-03 09:59 | 520K | |
![[IMG]](/icons/image2.gif) | human-physiology-fox..> | 2023-08-05 04:37 | 4.3K | |
![[IMG]](/icons/image2.gif) | human-physiology-fox..> | 2023-05-03 10:50 | 29K | |
![[ ]](/icons/compressed.gif) | human-physiology-fox..> | 2023-05-03 10:50 | 55K | |
![[IMG]](/icons/image2.gif) | human-physiology-fro..> | 2023-08-06 13:11 | 3.0K | |
![[IMG]](/icons/image2.gif) | human-physiology-fro..> | 2023-08-05 01:52 | 13K | |
![[IMG]](/icons/image2.gif) | human-physiology-fro..> | 2023-05-03 09:19 | 30K | |
![[ ]](/icons/compressed.gif) | human-physiology-fro..> | 2023-05-03 09:19 | 6.7M | |
![[IMG]](/icons/image2.gif) | human-physiology-fro..> | 2023-08-05 04:35 | 2.2K | |
![[IMG]](/icons/image2.gif) | human-physiology-fro..> | 2023-05-03 11:06 | 12K | |
![[ ]](/icons/compressed.gif) | human-physiology-fro..> | 2023-05-03 11:06 | 208K | |
![[ ]](/icons/compressed.gif) | human-physiology-fro..> | 2023-05-03 13:43 | 139K | |
![[ ]](/icons/compressed.gif) | human-physiology-int..> | 2023-05-03 09:55 | 55K | |
![[IMG]](/icons/image2.gif) | human-relations-in-o..> | 2023-08-05 01:09 | 2.5K | |
![[IMG]](/icons/image2.gif) | human-relations-in-o..> | 2023-05-03 10:21 | 14K | |
![[ ]](/icons/compressed.gif) | human-relations-in-o..> | 2023-05-03 10:21 | 71K | |
![[IMG]](/icons/image2.gif) | human-resource-devel..> | 2023-08-08 06:39 | 2.8K | |
![[IMG]](/icons/image2.gif) | human-resource-devel..> | 2023-05-03 10:16 | 15K | |
![[ ]](/icons/compressed.gif) | human-resource-devel..> | 2023-05-03 10:16 | 29K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-06 13:05 | 2.9K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-14 13:35 | 23K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-04 02:23 | 39K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-04 02:23 | 423K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 14:39 | 3.5K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:25 | 11K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 13:42 | 1.0M | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-06 03:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 09:38 | 25K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 09:38 | 24K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-06 10:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:44 | 22K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 10:44 | 34K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 15:33 | 3.0K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-09 01:05 | 15K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-04 02:26 | 35K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-04 02:26 | 661K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 17:22 | 3.6K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 09:40 | 30K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 09:40 | 30K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-09 02:53 | 3.8K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:25 | 22K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 10:25 | 0 | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 06:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:33 | 14K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 10:33 | 32K | |
![[ ]](/icons/compressed.gif) | human-resource-manag..> | 2023-05-03 10:25 | 858K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 03:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:44 | 8.8K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-08-05 04:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | human-resource-manag..> | 2023-05-03 10:44 | 8.8K | |
![[IMG]](/icons/image2.gif) | human-resource-selec..> | 2023-08-08 07:31 | 2.6K | |
![[IMG]](/icons/image2.gif) | human-resource-selec..> | 2023-08-17 17:25 | 11K | |
![[IMG]](/icons/image2.gif) | human-resource-selec..> | 2023-05-03 10:17 | 28K | |
![[ ]](/icons/compressed.gif) | human-resource-selec..> | 2023-05-03 10:17 | 126K | |
![[IMG]](/icons/image2.gif) | human-sexuality-dive..> | 2023-08-05 01:52 | 3.1K | |
![[IMG]](/icons/image2.gif) | human-sexuality-dive..> | 2023-05-03 10:20 | 15K | |
![[ ]](/icons/compressed.gif) | human-sexuality-dive..> | 2023-05-03 10:20 | 96K | |
![[IMG]](/icons/image2.gif) | human-sexuality-hock..> | 2023-08-06 01:53 | 3.6K | |
![[IMG]](/icons/image2.gif) | human-sexuality-hock..> | 2023-05-03 09:42 | 21K | |
![[ ]](/icons/compressed.gif) | human-sexuality-hock..> | 2023-05-03 09:42 | 36K | |
![[IMG]](/icons/image2.gif) | human-sexuality-in-a..> | 2023-08-05 14:37 | 2.5K | |
![[IMG]](/icons/image2.gif) | human-sexuality-in-a..> | 2023-05-03 10:23 | 16K | |
![[ ]](/icons/compressed.gif) | human-sexuality-in-a..> | 2023-05-03 10:22 | 51K | |
![[IMG]](/icons/image2.gif) | human-sexuality-worl..> | 2023-08-09 03:28 | 1.9K | |
![[IMG]](/icons/image2.gif) | human-sexuality-worl..> | 2023-08-17 17:25 | 9.0K | |
![[IMG]](/icons/image2.gif) | human-sexuality-worl..> | 2023-05-04 01:52 | 29K | |
![[ ]](/icons/compressed.gif) | human-sexuality-worl..> | 2023-05-04 01:52 | 211K | |
![[ ]](/icons/unknown.gif) | hyde14_im_ch01.docx | 2023-05-04 02:26 | 81K | |
![[IMG]](/icons/image2.gif) | i-never-knew-i-had-a..> | 2023-08-06 09:37 | 4.5K | |
![[IMG]](/icons/image2.gif) | i-never-knew-i-had-a..> | 2023-05-03 09:47 | 28K | |
![[ ]](/icons/compressed.gif) | i-never-knew-i-had-a..> | 2023-05-03 09:47 | 135K | |
![[IMG]](/icons/image2.gif) | icon.png | 2023-05-05 22:59 | 8.2K | |
![[IMG]](/icons/image2.gif) | identities-and-inequ..> | 2023-08-05 15:33 | 2.7K | |
![[IMG]](/icons/image2.gif) | identities-and-inequ..> | 2023-08-17 17:25 | 13K | |
![[IMG]](/icons/image2.gif) | identities-and-inequ..> | 2023-05-03 10:49 | 26K | |
![[ ]](/icons/compressed.gif) | identities-and-inequ..> | 2023-05-03 10:49 | 26K | |
![[IMG]](/icons/image2.gif) | igenetics-a-molecula..> | 2023-08-05 16:28 | 3.3K | |
![[IMG]](/icons/image2.gif) | igenetics-a-molecula..> | 2023-05-03 10:12 | 21K | |
![[ ]](/icons/compressed.gif) | igenetics-a-molecula..> | 2023-05-03 10:12 | 12K | |
![[IMG]](/icons/image2.gif) | il_794xN.2654527636_..> | 2023-05-04 02:07 | 34K | |
![[IMG]](/icons/image2.gif) | il_794xN.2702165907_..> | 2023-05-04 02:07 | 35K | |
![[IMG]](/icons/image2.gif) | illustrated-microsof..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | illustrated-microsof..> | 2023-08-17 17:25 | 18K | |
![[IMG]](/icons/image2.gif) | illustrated-microsof..> | 2023-05-03 10:59 | 50K | |
![[ ]](/icons/compressed.gif) | illustrated-microsof..> | 2023-05-03 10:59 | 42K | |
![[ ]](/icons/compressed.gif) | im-1483372243-correc..> | 2023-05-03 11:22 | 19K | |
![[ ]](/icons/unknown.gif) | im_ch01-Solution-Man..> | 2023-05-03 09:30 | 121K | |
![[IMG]](/icons/image2.gif) | imageServlet__33506...> | 2023-08-05 02:03 | 2.5K | |
![[IMG]](/icons/image2.gif) | imageServlet__33506...> | 2023-05-03 10:05 | 6.1K | |
![[IMG]](/icons/image2.gif) | imageServlet__49376...> | 2023-08-05 01:51 | 4.4K | |
![[IMG]](/icons/image2.gif) | imageServlet__49376...> | 2023-05-03 10:57 | 10K | |
![[IMG]](/icons/image2.gif) | image__00244.1414245..> | 2023-08-06 11:04 | 1.8K | |
![[IMG]](/icons/image2.gif) | image__00244.1414245..> | 2023-05-03 09:57 | 10K | |
![[IMG]](/icons/image2.gif) | image__00785.1412865..> | 2023-08-05 14:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | image__00785.1412865..> | 2023-05-03 09:22 | 13K | |
![[IMG]](/icons/image2.gif) | image__02246.1413219..> | 2023-08-06 11:17 | 2.6K | |
![[IMG]](/icons/image2.gif) | image__02246.1413219..> | 2023-05-03 09:45 | 10K | |
![[IMG]](/icons/image2.gif) | image__04854.1413046..> | 2023-08-05 04:34 | 3.3K | |
![[IMG]](/icons/image2.gif) | image__04854.1413046..> | 2023-05-03 09:30 | 17K | |
![[IMG]](/icons/image2.gif) | image__05149.1413039..> | 2023-08-05 15:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | image__05149.1413039..> | 2023-05-03 10:48 | 18K | |
![[IMG]](/icons/image2.gif) | image__09149.1413639..> | 2023-08-06 12:08 | 3.5K | |
![[IMG]](/icons/image2.gif) | image__09149.1413639..> | 2023-05-03 09:22 | 22K | |
![[IMG]](/icons/image2.gif) | image__13983.1413639..> | 2023-08-05 14:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | image__13983.1413639..> | 2023-05-03 10:26 | 29K | |
![[IMG]](/icons/image2.gif) | image__16130.1412780..> | 2023-08-06 04:21 | 4.5K | |
![[IMG]](/icons/image2.gif) | image__16130.1412780..> | 2023-05-03 09:35 | 24K | |
![[IMG]](/icons/image2.gif) | image__16341.1413042..> | 2023-08-08 14:33 | 3.3K | |
![[IMG]](/icons/image2.gif) | image__16341.1413042..> | 2023-05-03 09:38 | 15K | |
![[IMG]](/icons/image2.gif) | image__16678.1412781..> | 2023-08-06 03:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | image__16678.1412781..> | 2023-05-03 10:46 | 15K | |
![[IMG]](/icons/image2.gif) | image__18644.1413218..> | 2023-08-08 16:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | image__18644.1413218..> | 2023-05-03 10:25 | 14K | |
![[IMG]](/icons/image2.gif) | image__18954.1412867..> | 2023-08-05 05:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | image__18954.1412867..> | 2023-08-16 16:05 | 12K | |
![[IMG]](/icons/image2.gif) | image__18954.1412867..> | 2023-05-03 10:14 | 32K | |
![[IMG]](/icons/image2.gif) | image__19792.1412097..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | image__19792.1412097..> | 2023-05-03 10:11 | 13K | |
![[IMG]](/icons/image2.gif) | image__21494.1412706..> | 2023-08-05 14:39 | 2.6K | |
![[IMG]](/icons/image2.gif) | image__21494.1412706..> | 2023-05-03 09:52 | 10K | |
![[IMG]](/icons/image2.gif) | image__22361.1413217..> | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | image__22361.1413217..> | 2023-05-03 10:22 | 17K | |
![[IMG]](/icons/image2.gif) | image__25539.1413216..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | image__25539.1413216..> | 2023-05-03 10:48 | 17K | |
![[IMG]](/icons/image2.gif) | image__25816.1413218..> | 2023-08-05 14:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | image__25816.1413218..> | 2023-05-03 10:08 | 13K | |
![[IMG]](/icons/image2.gif) | image__26057.1412702..> | 2023-08-05 14:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | image__26057.1412702..> | 2023-05-03 10:42 | 14K | |
![[IMG]](/icons/image2.gif) | image__26736.1413220..> | 2023-05-03 10:25 | 21K | |
![[IMG]](/icons/image2.gif) | image__28943.1413046..> | 2023-08-06 07:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | image__28943.1413046..> | 2023-05-03 10:31 | 20K | |
![[IMG]](/icons/image2.gif) | image__30962.1413038..> | 2023-08-06 10:14 | 3.8K | |
![[IMG]](/icons/image2.gif) | image__30962.1413038..> | 2023-05-03 09:20 | 12K | |
![[IMG]](/icons/image2.gif) | image__36203.1413046..> | 2023-08-06 11:13 | 4.2K | |
![[IMG]](/icons/image2.gif) | image__36203.1413046..> | 2023-05-03 10:21 | 20K | |
![[IMG]](/icons/image2.gif) | image__37241.1412779..> | 2023-08-06 08:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | image__37241.1412779..> | 2023-05-04 01:58 | 17K | |
![[IMG]](/icons/image2.gif) | image__40317.1413640..> | 2023-08-05 02:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | image__40317.1413640..> | 2023-05-03 10:45 | 18K | |
![[IMG]](/icons/image2.gif) | image__40398.1412097..> | 2023-08-05 17:22 | 2.8K | |
![[IMG]](/icons/image2.gif) | image__40398.1412097..> | 2023-05-03 10:08 | 12K | |
![[IMG]](/icons/image2.gif) | image__44425.1412020..> | 2023-08-06 10:18 | 2.5K | |
![[IMG]](/icons/image2.gif) | image__44425.1412020..> | 2023-05-03 09:56 | 11K | |
![[IMG]](/icons/image2.gif) | image__45787.1412700..> | 2023-08-06 05:46 | 3.4K | |
![[IMG]](/icons/image2.gif) | image__45787.1412700..> | 2023-05-03 10:01 | 4.4K | |
![[IMG]](/icons/image2.gif) | image__46672.1413043..> | 2023-08-05 03:39 | 3.8K | |
![[IMG]](/icons/image2.gif) | image__46672.1413043..> | 2023-05-03 09:40 | 17K | |
![[IMG]](/icons/image2.gif) | image__49488.1413219..> | 2023-08-08 09:18 | 4.1K | |
![[IMG]](/icons/image2.gif) | image__49488.1413219..> | 2023-05-03 10:34 | 18K | |
![[IMG]](/icons/image2.gif) | image__49943.1412095..> | 2023-08-08 07:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | image__49943.1412095..> | 2023-05-03 09:31 | 16K | |
![[IMG]](/icons/image2.gif) | image__57606.1413222..> | 2023-08-05 14:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | image__57606.1413222..> | 2023-05-03 09:24 | 15K | |
![[IMG]](/icons/image2.gif) | image__59305.1413217..> | 2023-08-05 05:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | image__59305.1413217..> | 2023-05-03 11:24 | 19K | |
![[IMG]](/icons/image2.gif) | image__59320.1412696..> | 2023-08-05 06:17 | 4.3K | |
![[IMG]](/icons/image2.gif) | image__59320.1412696..> | 2023-05-03 10:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image__66926.1412696..> | 2023-08-06 03:28 | 4.3K | |
![[IMG]](/icons/image2.gif) | image__66926.1412696..> | 2023-05-03 10:38 | 8.5K | |
![[IMG]](/icons/image2.gif) | image__78095.1413039..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | image__78095.1413039..> | 2023-05-03 10:48 | 18K | |
![[IMG]](/icons/image2.gif) | image__79705.1413638..> | 2023-05-03 10:25 | 9.1K | |
![[IMG]](/icons/image2.gif) | image__80544.1412780..> | 2023-08-05 03:40 | 4.5K | |
![[IMG]](/icons/image2.gif) | image__80544.1412780..> | 2023-05-03 10:06 | 24K | |
![[IMG]](/icons/image2.gif) | image__81341.1414341..> | 2023-08-05 05:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | image__81341.1414341..> | 2023-05-03 09:25 | 11K | |
![[IMG]](/icons/image2.gif) | image__83169.1412785..> | 2023-08-05 14:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | image__83169.1412785..> | 2023-05-03 11:17 | 13K | |
![[IMG]](/icons/image2.gif) | image__83453.1413639..> | 2023-08-06 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | image__83453.1413639..> | 2023-05-03 09:25 | 21K | |
![[IMG]](/icons/image2.gif) | image__84317.1412785..> | 2023-08-06 08:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | image__84317.1412785..> | 2023-05-03 11:18 | 13K | |
![[IMG]](/icons/image2.gif) | image__86772.1412699..> | 2023-08-06 07:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | image__86772.1412699..> | 2023-05-03 09:44 | 14K | |
![[IMG]](/icons/image2.gif) | image__87290.1413044..> | 2023-08-05 14:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | image__87290.1413044..> | 2023-05-03 10:37 | 15K | |
![[IMG]](/icons/image2.gif) | image__90780.1413045..> | 2023-08-06 08:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | image__90780.1413045..> | 2023-08-11 11:53 | 16K | |
![[IMG]](/icons/image2.gif) | image__90780.1413045..> | 2023-05-03 10:29 | 126K | |
![[IMG]](/icons/image2.gif) | image__92903.1413043..> | 2023-08-05 01:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | image__92903.1413043..> | 2023-05-03 10:38 | 16K | |
![[IMG]](/icons/image2.gif) | image__92908.1413217..> | 2023-08-06 11:15 | 3.6K | |
![[IMG]](/icons/image2.gif) | image__92908.1413217..> | 2023-05-03 09:49 | 20K | |
![[IMG]](/icons/image2.gif) | image__93095.1413039..> | 2023-08-05 15:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | image__93095.1413039..> | 2023-05-03 10:25 | 21K | |
![[IMG]](/icons/image2.gif) | image__95448.1413219..> | 2023-08-06 09:42 | 2.6K | |
![[IMG]](/icons/image2.gif) | image__95448.1413219..> | 2023-05-03 09:48 | 9.9K | |
![[IMG]](/icons/image2.gif) | image__95710.1413047..> | 2023-08-05 01:08 | 2.8K | |
![[IMG]](/icons/image2.gif) | image__95710.1413047..> | 2023-05-03 09:28 | 13K | |
![[IMG]](/icons/image2.gif) | image__96426.1412697..> | 2023-08-05 01:08 | 5.0K | |
![[IMG]](/icons/image2.gif) | image__96426.1412697..> | 2023-05-03 09:26 | 8.8K | |
![[IMG]](/icons/image2.gif) | image__98721.1413224..> | 2023-08-05 06:24 | 4.3K | |
![[IMG]](/icons/image2.gif) | image__98721.1413224..> | 2023-05-03 09:48 | 18K | |
![[IMG]](/icons/image2.gif) | immunology-and-serol..> | 2023-08-06 03:24 | 2.7K | |
![[IMG]](/icons/image2.gif) | immunology-and-serol..> | 2023-05-03 10:05 | 16K | |
![[IMG]](/icons/image2.gif) | immunology-and-serol..> | 2023-08-06 12:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | immunology-and-serol..> | 2023-05-03 09:27 | 16K | |
![[IMG]](/icons/image2.gif) | in-conflict-and-orde..> | 2023-08-06 13:06 | 3.6K | |
![[IMG]](/icons/image2.gif) | in-conflict-and-orde..> | 2023-05-03 10:28 | 23K | |
![[ ]](/icons/compressed.gif) | in-conflict-and-orde..> | 2023-05-03 10:28 | 82K | |
![[IMG]](/icons/image2.gif) | income-tax-fundament..> | 2023-05-03 09:22 | 6.2K | |
![[IMG]](/icons/image2.gif) | income-tax-fundament..> | 2023-05-03 09:22 | 6.2K | |
![[IMG]](/icons/image2.gif) | income-tax-fundament..> | 2023-08-06 16:00 | 3.8K | |
![[IMG]](/icons/image2.gif) | income-tax-fundament..> | 2023-05-03 09:45 | 13K | |
![[IMG]](/icons/image2.gif) | index-100x100.jpg | 2023-08-05 01:52 | 3.9K | |
![[IMG]](/icons/image2.gif) | index.jpg | 2023-05-03 10:02 | 19K | |
![[IMG]](/icons/image2.gif) | index__02251.1413649..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | index__02251.1413649..> | 2023-05-03 10:03 | 19K | |
![[IMG]](/icons/image2.gif) | index__02564.1413640..> | 2023-08-06 09:41 | 1.6K | |
![[IMG]](/icons/image2.gif) | index__02564.1413640..> | 2023-05-04 02:08 | 11K | |
![[IMG]](/icons/image2.gif) | index__09317.1413642..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | index__09317.1413642..> | 2023-05-03 10:06 | 28K | |
![[IMG]](/icons/image2.gif) | index__15332.1413640..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | index__15332.1413640..> | 2023-05-03 10:19 | 39K | |
![[IMG]](/icons/image2.gif) | index__15851.1413645..> | 2023-08-08 15:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | index__15851.1413645..> | 2023-05-03 09:28 | 25K | |
![[IMG]](/icons/image2.gif) | index__16655.1413642..> | 2023-08-06 12:13 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__16655.1413642..> | 2023-05-03 09:46 | 24K | |
![[IMG]](/icons/image2.gif) | index__21114.1413646..> | 2023-08-05 16:23 | 4.6K | |
![[IMG]](/icons/image2.gif) | index__21114.1413646..> | 2023-05-03 10:42 | 35K | |
![[IMG]](/icons/image2.gif) | index__32247.1413647..> | 2023-08-05 14:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | index__32247.1413647..> | 2023-05-03 10:03 | 24K | |
![[IMG]](/icons/image2.gif) | index__47165.1413647..> | 2023-08-05 04:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | index__47165.1413647..> | 2023-05-03 11:15 | 30K | |
![[IMG]](/icons/image2.gif) | index__53846.1413647..> | 2023-08-08 07:32 | 4.1K | |
![[IMG]](/icons/image2.gif) | index__53846.1413647..> | 2023-05-03 09:46 | 26K | |
![[IMG]](/icons/image2.gif) | index__59210.1413650..> | 2023-08-05 04:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__59210.1413650..> | 2023-05-03 10:02 | 24K | |
![[IMG]](/icons/image2.gif) | index__62517.1413648..> | 2023-08-09 05:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__62517.1413648..> | 2023-05-03 10:50 | 24K | |
![[IMG]](/icons/image2.gif) | index__67983.1413642..> | 2023-08-05 14:37 | 3.3K | |
![[IMG]](/icons/image2.gif) | index__67983.1413642..> | 2023-05-03 09:32 | 18K | |
![[IMG]](/icons/image2.gif) | index__83818.1413640..> | 2023-08-05 01:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__83818.1413640..> | 2023-05-03 09:56 | 23K | |
![[IMG]](/icons/image2.gif) | index__85287.1413648..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | index__85287.1413648..> | 2023-05-03 11:14 | 30K | |
![[IMG]](/icons/image2.gif) | index__85496.1413640..> | 2023-08-06 13:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__85496.1413640..> | 2023-05-03 11:23 | 20K | |
![[IMG]](/icons/image2.gif) | index__87967.1413641..> | 2023-08-05 14:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | index__87967.1413641..> | 2023-05-03 09:46 | 24K | |
![[IMG]](/icons/image2.gif) | individual-taxation-..> | 2023-08-05 15:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | individual-taxation-..> | 2023-05-03 09:20 | 9.5K | |
![[IMG]](/icons/image2.gif) | individual-taxation-..> | 2023-08-05 03:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | individual-taxation-..> | 2023-05-03 09:20 | 9.5K | |
![[IMG]](/icons/image2.gif) | industrial-organizat..> | 2023-08-08 15:43 | 4.1K | |
![[IMG]](/icons/image2.gif) | industrial-organizat..> | 2023-08-15 20:03 | 26K | |
![[IMG]](/icons/image2.gif) | industrial-organizat..> | 2023-05-03 10:22 | 38K | |
![[ ]](/icons/compressed.gif) | industrial-organizat..> | 2023-05-03 10:22 | 52K | |
![[IMG]](/icons/image2.gif) | infants-and-children..> | 2023-08-05 02:45 | 5.1K | |
![[IMG]](/icons/image2.gif) | infants-and-children..> | 2023-05-03 10:02 | 34K | |
![[ ]](/icons/compressed.gif) | infants-and-children..> | 2023-05-03 10:02 | 50K | |
![[IMG]](/icons/image2.gif) | infants-toddlers-and..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | infants-toddlers-and..> | 2023-08-17 19:58 | 24K | |
![[IMG]](/icons/image2.gif) | infants-toddlers-and..> | 2023-05-03 11:15 | 40K | |
![[ ]](/icons/compressed.gif) | infants-toddlers-and..> | 2023-05-03 11:15 | 32K | |
![[IMG]](/icons/image2.gif) | information-systems-..> | 2023-08-05 02:46 | 2.2K | |
![[IMG]](/icons/image2.gif) | information-systems-..> | 2023-05-03 09:19 | 16K | |
![[ ]](/icons/compressed.gif) | information-systems-..> | 2023-05-03 09:19 | 24K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-05 05:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 10:02 | 16K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 10:02 | 27K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 11:05 | 23K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-06 07:45 | 4.1K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 09:37 | 21K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 09:37 | 12K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-08 06:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-08 14:34 | 24K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 09:20 | 40K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 09:20 | 342K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-09 02:03 | 3.7K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-08 14:34 | 20K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 09:54 | 52K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 09:54 | 387K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-05 01:51 | 4.4K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-08 14:34 | 31K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 09:30 | 84K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 09:30 | 459K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 13:44 | 353K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-05 01:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-04 02:08 | 18K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-04 02:08 | 103K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-08-05 01:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | information-technolo..> | 2023-05-03 11:09 | 18K | |
![[ ]](/icons/compressed.gif) | information-technolo..> | 2023-05-03 11:09 | 16K | |
![[ ]](/icons/compressed.gif) | intderiv_Chapter01.zip | 2023-05-04 01:58 | 4.2K | |
![[IMG]](/icons/image2.gif) | integrated-advertisi..> | 2023-08-06 16:32 | 2.3K | |
![[IMG]](/icons/image2.gif) | integrated-advertisi..> | 2023-05-03 10:08 | 11K | |
![[ ]](/icons/compressed.gif) | integrated-advertisi..> | 2023-05-03 10:08 | 23K | |
![[ ]](/icons/compressed.gif) | integrated-advertisi..> | 2023-05-03 11:08 | 17K | |
![[IMG]](/icons/image2.gif) | integrated-advertisi..> | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | integrated-advertisi..> | 2023-05-03 11:08 | 10K | |
![[ ]](/icons/compressed.gif) | integrated-advertisi..> | 2023-05-03 13:42 | 623K | |
![[IMG]](/icons/image2.gif) | integrated-cardiopul..> | 2023-08-06 10:20 | 3.4K | |
![[IMG]](/icons/image2.gif) | integrated-cardiopul..> | 2023-05-03 10:14 | 21K | |
![[ ]](/icons/compressed.gif) | integrated-cardiopul..> | 2023-05-03 10:14 | 16K | |
![[IMG]](/icons/image2.gif) | intercultural-commun..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | intercultural-commun..> | 2023-05-03 10:44 | 23K | |
![[ ]](/icons/compressed.gif) | intercultural-commun..> | 2023-05-03 10:44 | 98K | |
![[IMG]](/icons/image2.gif) | intercultural-compet..> | 2023-08-05 06:25 | 3.7K | |
![[IMG]](/icons/image2.gif) | intercultural-compet..> | 2023-08-06 07:46 | 20K | |
![[IMG]](/icons/image2.gif) | intercultural-compet..> | 2023-05-04 01:49 | 31K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 13:11 | 19K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:36 | 30K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-08 22:59 | 4.0K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-08 16:38 | 21K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:51 | 51K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 09:51 | 513K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 10:38 | 773K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-04 01:49 | 16K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-05 01:27 | 3.0K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-08 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:51 | 44K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 09:51 | 517K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 13:12 | 3.9K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-04 01:55 | 29K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-04 01:55 | 31K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-05 04:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:21 | 22K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 09:21 | 32K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-05 21:01 | 3.5K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:24 | 11K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 17:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 10:11 | 39K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-05 15:27 | 2.7K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 10:38 | 8.9K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 03:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 11:06 | 16K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 11:06 | 59K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 06:45 | 4.2K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 10:18 | 20K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:26 | 11K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-08 16:37 | 1.9K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:27 | 6.3K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-06 13:12 | 1.9K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 09:45 | 6.3K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-09 01:55 | 3.3K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | intermediate-account..> | 2023-05-03 10:25 | 44K | |
![[ ]](/icons/compressed.gif) | intermediate-account..> | 2023-05-03 10:25 | 1.6M | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-08-08 22:02 | 4.3K | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-08-08 20:09 | 28K | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-05-03 11:04 | 153K | |
![[ ]](/icons/compressed.gif) | intermediate-algebra..> | 2023-05-03 11:04 | 3.4M | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-08-05 17:15 | 4.3K | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-08-18 04:11 | 28K | |
![[IMG]](/icons/image2.gif) | intermediate-algebra..> | 2023-05-03 10:06 | 152K | |
![[ ]](/icons/compressed.gif) | intermediate-algebra..> | 2023-05-03 10:06 | 2.6M | |
![[IMG]](/icons/image2.gif) | intermediate-financi..> | 2023-05-03 09:24 | 14K | |
![[IMG]](/icons/image2.gif) | intermediate-financi..> | 2023-05-03 09:39 | 14K | |
![[IMG]](/icons/image2.gif) | intermediate-microec..> | 2023-08-08 11:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | intermediate-microec..> | 2023-08-18 04:11 | 20K | |
![[IMG]](/icons/image2.gif) | intermediate-microec..> | 2023-05-03 11:14 | 49K | |
![[ ]](/icons/compressed.gif) | intermediate-microec..> | 2023-05-03 11:14 | 156K | |
![[IMG]](/icons/image2.gif) | intermediate-microec..> | 2023-08-06 17:28 | 3.3K | |
![[IMG]](/icons/image2.gif) | intermediate-microec..> | 2023-05-03 10:18 | 17K | |
![[ ]](/icons/compressed.gif) | intermediate-microec..> | 2023-05-03 10:18 | 24K | |
![[ ]](/icons/compressed.gif) | international-accoun..> | 2023-05-03 09:21 | 20K | |
![[ ]](/icons/compressed.gif) | international-accoun..> | 2023-05-03 10:12 | 54K | |
![[IMG]](/icons/image2.gif) | international-accoun..> | 2023-05-03 10:56 | 11K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-08-05 01:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 10:13 | 19K | |
![[ ]](/icons/compressed.gif) | international-busine..> | 2023-05-03 10:13 | 540K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 09:51 | 8.8K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 11:12 | 8.8K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 11:03 | 18K | |
![[ ]](/icons/compressed.gif) | international-busine..> | 2023-05-03 11:03 | 14K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-08-05 02:46 | 2.6K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 10:36 | 20K | |
![[ ]](/icons/compressed.gif) | international-busine..> | 2023-05-03 10:36 | 109K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-08-09 02:50 | 3.5K | |
![[IMG]](/icons/image2.gif) | international-busine..> | 2023-05-03 11:08 | 11K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 07:31 | 3.8K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-03 09:57 | 19K | |
![[ ]](/icons/compressed.gif) | international-econom..> | 2023-05-03 09:57 | 324K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 16:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-04 02:04 | 67K | |
![[ ]](/icons/compressed.gif) | international-econom..> | 2023-05-04 02:04 | 546K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-05 06:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 16:38 | 16K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-03 09:39 | 69K | |
![[ ]](/icons/compressed.gif) | international-econom..> | 2023-05-03 09:39 | 42K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-05 16:23 | 4.7K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 16:38 | 30K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-03 09:38 | 75K | |
![[ ]](/icons/compressed.gif) | international-econom..> | 2023-05-03 09:38 | 400K | |
![[ ]](/icons/compressed.gif) | international-econom..> | 2023-05-03 13:46 | 140K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-05 03:41 | 11K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-04 02:15 | 27K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-08-08 08:23 | 15K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-03 10:40 | 39K | |
![[IMG]](/icons/image2.gif) | international-econom..> | 2023-05-03 10:08 | 8.9K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-05 01:51 | 4.7K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-08 16:38 | 32K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 11:20 | 80K | |
![[ ]](/icons/compressed.gif) | international-financ..> | 2023-05-03 11:20 | 1.0M | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-09 12:14 | 23K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 10:22 | 58K | |
![[ ]](/icons/compressed.gif) | international-financ..> | 2023-05-03 10:22 | 130K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 11:02 | 9.0K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-08 04:48 | 3.3K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 11:26 | 9.6K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-05 04:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 09:34 | 18K | |
![[ ]](/icons/compressed.gif) | international-financ..> | 2023-05-03 09:34 | 8.7K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-06 11:14 | 3.7K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 10:06 | 13K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-08-05 03:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | international-financ..> | 2023-05-03 10:06 | 11K | |
![[IMG]](/icons/image2.gif) | international-logist..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | international-logist..> | 2023-05-03 11:11 | 19K | |
![[ ]](/icons/compressed.gif) | international-logist..> | 2023-05-03 11:11 | 45K | |
![[IMG]](/icons/image2.gif) | international-macroe..> | 2023-08-08 21:59 | 3.5K | |
![[IMG]](/icons/image2.gif) | international-macroe..> | 2023-08-19 21:49 | 22K | |
![[IMG]](/icons/image2.gif) | international-macroe..> | 2023-05-03 10:25 | 36K | |
![[ ]](/icons/compressed.gif) | international-macroe..> | 2023-05-03 10:25 | 304K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-05 04:35 | 2.4K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-05-03 10:39 | 17K | |
![[ ]](/icons/compressed.gif) | international-manage..> | 2023-05-03 10:39 | 21K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-05-03 09:53 | 85K | |
![[ ]](/icons/compressed.gif) | international-manage..> | 2023-05-03 09:53 | 94K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-05 06:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-05-03 09:21 | 8.6K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-05 03:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-09 12:14 | 19K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-05-04 01:52 | 73K | |
![[ ]](/icons/compressed.gif) | international-manage..> | 2023-05-04 01:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-06 05:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-08-18 08:58 | 19K | |
![[IMG]](/icons/image2.gif) | international-manage..> | 2023-05-04 02:15 | 59K | |
![[ ]](/icons/compressed.gif) | international-manage..> | 2023-05-04 02:15 | 103K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-08-05 16:23 | 3.0K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-05-03 10:04 | 16K | |
![[ ]](/icons/compressed.gif) | international-market..> | 2023-05-03 10:04 | 333K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-08-05 22:07 | 3.4K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-05-03 11:12 | 23K | |
![[ ]](/icons/compressed.gif) | international-market..> | 2023-05-03 11:11 | 97K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-08-09 09:11 | 3.9K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-05-03 10:10 | 13K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-08-06 09:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | international-market..> | 2023-05-03 10:34 | 21K | |
![[ ]](/icons/compressed.gif) | international-market..> | 2023-05-03 10:34 | 8.7K | |
![[ ]](/icons/compressed.gif) | international-market..> | 2023-05-03 10:10 | 39K | |
![[IMG]](/icons/image2.gif) | international-trade-..> | 2023-08-06 05:44 | 2.7K | |
![[IMG]](/icons/image2.gif) | international-trade-..> | 2023-08-09 12:14 | 13K | |
![[IMG]](/icons/image2.gif) | international-trade-..> | 2023-05-03 09:22 | 45K | |
![[ ]](/icons/compressed.gif) | international-trade-..> | 2023-05-03 09:22 | 638K | |
![[ ]](/icons/compressed.gif) | interpersonal-relati..> | 2023-05-03 10:31 | 115K | |
![[IMG]](/icons/image2.gif) | interpersonal-relati..> | 2023-08-05 04:35 | 13K | |
![[IMG]](/icons/image2.gif) | interpersonal-relati..> | 2023-05-03 10:31 | 37K | |
![[IMG]](/icons/image2.gif) | intimate-relationshi..> | 2023-05-03 09:19 | 55K | |
![[ ]](/icons/compressed.gif) | intimate-relationshi..> | 2023-05-03 09:19 | 140K | |
![[IMG]](/icons/image2.gif) | introduction-chemist..> | 2023-08-05 03:39 | 3.9K | |
![[IMG]](/icons/image2.gif) | introduction-chemist..> | 2023-08-18 08:58 | 22K | |
![[IMG]](/icons/image2.gif) | introduction-chemist..> | 2023-05-03 09:33 | 57K | |
![[ ]](/icons/compressed.gif) | introduction-chemist..> | 2023-05-03 09:33 | 90K | |
![[IMG]](/icons/image2.gif) | introduction-environ..> | 2023-08-05 03:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | introduction-environ..> | 2023-08-23 21:15 | 22K | |
![[IMG]](/icons/image2.gif) | introduction-environ..> | 2023-05-03 10:25 | 58K | |
![[ ]](/icons/compressed.gif) | introduction-environ..> | 2023-05-03 10:25 | 275K | |
![[IMG]](/icons/image2.gif) | introduction-health-..> | 2023-08-05 04:31 | 4.2K | |
![[IMG]](/icons/image2.gif) | introduction-health-..> | 2023-08-24 03:49 | 20K | |
![[IMG]](/icons/image2.gif) | introduction-health-..> | 2023-05-03 09:23 | 49K | |
![[ ]](/icons/compressed.gif) | introduction-health-..> | 2023-05-03 09:23 | 43K | |
![[IMG]](/icons/image2.gif) | introduction-history..> | 2023-08-06 00:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | introduction-history..> | 2023-08-12 04:51 | 21K | |
![[IMG]](/icons/image2.gif) | introduction-history..> | 2023-05-04 02:22 | 58K | |
![[ ]](/icons/compressed.gif) | introduction-history..> | 2023-05-04 02:22 | 469K | |
![[IMG]](/icons/image2.gif) | introduction-informa..> | 2023-08-06 03:41 | 2.2K | |
![[IMG]](/icons/image2.gif) | introduction-informa..> | 2023-08-24 03:49 | 11K | |
![[IMG]](/icons/image2.gif) | introduction-informa..> | 2023-05-03 10:21 | 21K | |
![[ ]](/icons/compressed.gif) | introduction-informa..> | 2023-05-03 10:21 | 152K | |
![[IMG]](/icons/image2.gif) | introduction-java-pr..> | 2023-08-05 01:12 | 3.7K | |
![[IMG]](/icons/image2.gif) | introduction-java-pr..> | 2023-08-24 03:49 | 27K | |
![[IMG]](/icons/image2.gif) | introduction-java-pr..> | 2023-05-03 09:43 | 102K | |
![[ ]](/icons/compressed.gif) | introduction-java-pr..> | 2023-05-03 09:43 | 84K | |
![[IMG]](/icons/image2.gif) | introduction-manager..> | 2023-08-05 05:29 | 3.5K | |
![[IMG]](/icons/image2.gif) | introduction-manager..> | 2023-08-19 12:40 | 19K | |
![[IMG]](/icons/image2.gif) | introduction-manager..> | 2023-05-03 09:31 | 49K | |
![[ ]](/icons/compressed.gif) | introduction-manager..> | 2023-05-03 09:31 | 1.3M | |
![[IMG]](/icons/image2.gif) | introduction-operati..> | 2023-08-06 13:04 | 3.9K | |
![[IMG]](/icons/image2.gif) | introduction-operati..> | 2023-08-19 12:40 | 22K | |
![[IMG]](/icons/image2.gif) | introduction-operati..> | 2023-05-04 02:26 | 85K | |
![[ ]](/icons/compressed.gif) | introduction-operati..> | 2023-05-04 02:25 | 329K | |
![[IMG]](/icons/image2.gif) | introduction-physica..> | 2023-08-05 15:31 | 2.1K | |
![[IMG]](/icons/image2.gif) | introduction-physica..> | 2023-08-19 12:40 | 10K | |
![[IMG]](/icons/image2.gif) | introduction-physica..> | 2023-05-03 11:26 | 34K | |
![[ ]](/icons/compressed.gif) | introduction-physica..> | 2023-05-03 11:26 | 138K | |
![[IMG]](/icons/image2.gif) | introduction-to-abno..> | 2023-08-05 17:20 | 4.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-abno..> | 2023-08-18 08:58 | 28K | |
![[IMG]](/icons/image2.gif) | introduction-to-abno..> | 2023-05-03 09:57 | 48K | |
![[ ]](/icons/compressed.gif) | introduction-to-abno..> | 2023-05-03 09:57 | 107K | |
![[IMG]](/icons/image2.gif) | introduction-to-brai..> | 2023-08-05 16:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-brai..> | 2023-08-18 08:58 | 20K | |
![[IMG]](/icons/image2.gif) | introduction-to-brai..> | 2023-05-03 09:53 | 32K | |
![[ ]](/icons/compressed.gif) | introduction-to-brai..> | 2023-05-03 09:53 | 32K | |
![[IMG]](/icons/image2.gif) | introduction-to-busi..> | 2023-08-05 01:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | introduction-to-busi..> | 2023-05-03 10:40 | 17K | |
![[ ]](/icons/compressed.gif) | introduction-to-busi..> | 2023-05-03 10:40 | 14K | |
![[IMG]](/icons/image2.gif) | introduction-to-chem..> | 2023-08-09 07:05 | 3.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-chem..> | 2023-08-18 08:58 | 20K | |
![[IMG]](/icons/image2.gif) | introduction-to-chem..> | 2023-05-04 01:49 | 32K | |
![[ ]](/icons/compressed.gif) | introduction-to-chem..> | 2023-05-04 01:49 | 3.8M | |
![[IMG]](/icons/image2.gif) | introduction-to-clin..> | 2023-08-05 21:57 | 2.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-clin..> | 2023-05-03 10:29 | 16K | |
![[ ]](/icons/compressed.gif) | introduction-to-clin..> | 2023-05-03 10:29 | 16K | |
![[IMG]](/icons/image2.gif) | introduction-to-corp..> | 2023-08-05 16:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | introduction-to-corp..> | 2023-05-03 11:09 | 22K | |
![[ ]](/icons/compressed.gif) | introduction-to-corp..> | 2023-05-03 11:09 | 27K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-05-03 10:04 | 29K | |
![[ ]](/icons/compressed.gif) | introduction-to-crim..> | 2023-05-03 10:04 | 29K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-08-06 04:49 | 4.1K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-05-03 09:36 | 24K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-08-05 01:52 | 5.3K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-08-24 03:49 | 33K | |
![[IMG]](/icons/image2.gif) | introduction-to-crim..> | 2023-05-03 11:27 | 56K | |
![[ ]](/icons/compressed.gif) | introduction-to-crim..> | 2023-05-03 11:27 | 102K | |
![[IMG]](/icons/image2.gif) | introduction-to-crit..> | 2023-08-05 01:52 | 2.7K | |
![[IMG]](/icons/image2.gif) | introduction-to-crit..> | 2023-05-03 11:21 | 16K | |
![[ ]](/icons/compressed.gif) | introduction-to-crit..> | 2023-05-03 11:21 | 13K | |
![[IMG]](/icons/image2.gif) | introduction-to-crit..> | 2023-08-05 02:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | introduction-to-crit..> | 2023-05-03 09:25 | 16K | |
![[IMG]](/icons/image2.gif) | introduction-to-deri..> | 2023-08-06 08:46 | 4.1K | |
![[IMG]](/icons/image2.gif) | introduction-to-deri..> | 2023-05-03 10:41 | 15K | |
![[IMG]](/icons/image2.gif) | introduction-to-deri..> | 2023-08-06 10:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | introduction-to-deri..> | 2023-05-03 10:40 | 15K | |
![[IMG]](/icons/image2.gif) | introduction-to-envi..> | 2023-08-06 13:10 | 2.1K | |
![[IMG]](/icons/image2.gif) | introduction-to-envi..> | 2023-05-03 09:27 | 12K | |
![[ ]](/icons/compressed.gif) | introduction-to-envi..> | 2023-05-03 09:27 | 11K | |
![[IMG]](/icons/image2.gif) | introduction-to-fina..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-fina..> | 2023-05-03 09:30 | 21K | |
![[ ]](/icons/compressed.gif) | introduction-to-fina..> | 2023-05-03 09:30 | 31K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-08-05 03:40 | 4.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-05-03 10:10 | 23K | |
![[ ]](/icons/compressed.gif) | introduction-to-gene..> | 2023-05-03 10:10 | 288K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-08-05 17:22 | 3.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-08-09 20:35 | 19K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-05-03 09:25 | 33K | |
![[ ]](/icons/compressed.gif) | introduction-to-gene..> | 2023-05-03 09:25 | 363K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-08-06 09:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-05-03 10:18 | 21K | |
![[ ]](/icons/compressed.gif) | introduction-to-gene..> | 2023-05-03 10:18 | 65K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-08-05 16:28 | 16K | |
![[IMG]](/icons/image2.gif) | introduction-to-gene..> | 2023-05-03 09:33 | 42K | |
![[IMG]](/icons/image2.gif) | introduction-to-glob..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | introduction-to-glob..> | 2023-05-03 10:08 | 19K | |
![[ ]](/icons/compressed.gif) | introduction-to-glob..> | 2023-05-03 10:08 | 26K | |
![[IMG]](/icons/image2.gif) | introduction-to-heal..> | 2023-08-05 01:14 | 3.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-heal..> | 2023-05-03 10:03 | 17K | |
![[ ]](/icons/compressed.gif) | introduction-to-heal..> | 2023-05-03 10:03 | 18K | |
![[IMG]](/icons/image2.gif) | introduction-to-info..> | 2023-08-06 11:16 | 3.0K | |
![[IMG]](/icons/image2.gif) | introduction-to-info..> | 2023-05-04 02:15 | 19K | |
![[ ]](/icons/compressed.gif) | introduction-to-info..> | 2023-05-04 02:15 | 22K | |
![[IMG]](/icons/image2.gif) | introduction-to-info..> | 2023-08-06 16:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | introduction-to-info..> | 2023-05-03 10:00 | 26K | |
![[IMG]](/icons/image2.gif) | introduction-to-law-..> | 2023-08-05 01:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | introduction-to-law-..> | 2023-05-03 11:16 | 20K | |
![[ ]](/icons/compressed.gif) | introduction-to-law-..> | 2023-05-03 11:16 | 95K | |
![[IMG]](/icons/image2.gif) | introduction-to-lead..> | 2023-08-05 01:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | introduction-to-lead..> | 2023-08-24 03:49 | 19K | |
![[IMG]](/icons/image2.gif) | introduction-to-lead..> | 2023-05-03 09:41 | 32K | |
![[ ]](/icons/compressed.gif) | introduction-to-lead..> | 2023-05-03 09:41 | 47K | |
![[IMG]](/icons/image2.gif) | introduction-to-lear..> | 2023-08-05 15:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | introduction-to-lear..> | 2023-05-03 09:53 | 20K | |
![[ ]](/icons/compressed.gif) | introduction-to-lear..> | 2023-05-03 09:53 | 44K | |
![[ ]](/icons/compressed.gif) | introduction-to-mana..> | 2023-05-03 09:07 | 24K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-08-08 16:36 | 4.3K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-03 10:39 | 12K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-08-05 14:00 | 2.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-03 10:07 | 6.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-08-05 03:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-03 10:04 | 6.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-03 10:12 | 9.2K | |
![[ ]](/icons/compressed.gif) | introduction-to-mana..> | 2023-05-03 13:41 | 1.0M | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-04 01:58 | 9.4K | |
![[IMG]](/icons/image2.gif) | introduction-to-mana..> | 2023-05-04 02:16 | 5.2K | |
![[ ]](/icons/compressed.gif) | introduction-to-mana..> | 2023-05-04 02:16 | 1.9M | |
![[ ]](/icons/layout.gif) | introduction-to-mate..> | 2023-05-03 10:20 | 1.1M | |
![[IMG]](/icons/image2.gif) | introduction-to-mate..> | 2023-08-06 10:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | introduction-to-mate..> | 2023-05-03 09:20 | 10K | |
![[IMG]](/icons/image2.gif) | introduction-to-medi..> | 2023-08-06 11:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-medi..> | 2023-05-03 09:54 | 14K | |
![[IMG]](/icons/image2.gif) | introduction-to-medi..> | 2023-08-05 16:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | introduction-to-medi..> | 2023-05-03 10:31 | 13K | |
![[IMG]](/icons/image2.gif) | introduction-to-orga..> | 2023-08-05 02:03 | 2.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-orga..> | 2023-05-03 10:47 | 12K | |
![[ ]](/icons/compressed.gif) | introduction-to-orga..> | 2023-05-03 10:47 | 66K | |
![[IMG]](/icons/image2.gif) | introduction-to-phar..> | 2023-08-05 05:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | introduction-to-phar..> | 2023-05-04 02:09 | 16K | |
![[ ]](/icons/compressed.gif) | introduction-to-phar..> | 2023-05-04 02:09 | 0 | |
![[IMG]](/icons/image2.gif) | introduction-to-phys..> | 2023-08-05 01:08 | 3.5K | |
![[IMG]](/icons/image2.gif) | introduction-to-phys..> | 2023-05-03 09:39 | 19K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-08-08 15:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-05-03 10:04 | 18K | |
![[ ]](/icons/compressed.gif) | introduction-to-psyc..> | 2023-05-03 10:04 | 261K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-08-05 04:34 | 4.1K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-05-03 09:28 | 27K | |
![[ ]](/icons/compressed.gif) | introduction-to-psyc..> | 2023-05-03 09:28 | 431K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-08-06 05:49 | 2.9K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-05-03 10:35 | 20K | |
![[ ]](/icons/compressed.gif) | introduction-to-psyc..> | 2023-05-03 10:35 | 10K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-08-06 10:18 | 3.9K | |
![[IMG]](/icons/image2.gif) | introduction-to-psyc..> | 2023-05-03 09:52 | 21K | |
![[ ]](/icons/compressed.gif) | introduction-to-psyc..> | 2023-05-03 09:52 | 706K | |
![[IMG]](/icons/image2.gif) | introduction-to-radi..> | 2023-08-05 01:54 | 3.2K | |
![[IMG]](/icons/image2.gif) | introduction-to-radi..> | 2023-05-03 09:25 | 16K | |
![[ ]](/icons/compressed.gif) | introduction-to-radi..> | 2023-05-03 09:25 | 10K | |
![[IMG]](/icons/image2.gif) | introduction-to-soci..> | 2023-08-06 09:20 | 4.3K | |
![[IMG]](/icons/image2.gif) | introduction-to-soci..> | 2023-08-19 12:40 | 26K | |
![[IMG]](/icons/image2.gif) | introduction-to-soci..> | 2023-05-03 10:26 | 39K | |
![[ ]](/icons/compressed.gif) | introduction-to-soci..> | 2023-05-03 10:26 | 29K | |
![[IMG]](/icons/image2.gif) | introduction-to-soci..> | 2023-08-05 01:52 | 4.6K | |
![[IMG]](/icons/image2.gif) | introduction-to-soci..> | 2023-05-03 09:33 | 32K | |
![[ ]](/icons/compressed.gif) | introduction-to-soci..> | 2023-05-03 09:33 | 13K | |
![[IMG]](/icons/image2.gif) | introductory-chemist..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | introductory-chemist..> | 2023-08-12 04:51 | 18K | |
![[IMG]](/icons/image2.gif) | introductory-chemist..> | 2023-05-03 10:16 | 50K | |
![[ ]](/icons/compressed.gif) | introductory-chemist..> | 2023-05-03 10:16 | 330K | |
![[IMG]](/icons/image2.gif) | introductory-chemist..> | 2023-08-08 02:00 | 4.5K | |
![[IMG]](/icons/image2.gif) | introductory-chemist..> | 2023-05-03 09:24 | 27K | |
![[ ]](/icons/compressed.gif) | introductory-chemist..> | 2023-05-03 09:24 | 12K | |
![[IMG]](/icons/image2.gif) | introductory-clinica..> | 2023-08-09 10:07 | 3.5K | |
![[IMG]](/icons/image2.gif) | introductory-clinica..> | 2023-05-03 10:47 | 21K | |
![[ ]](/icons/compressed.gif) | introductory-clinica..> | 2023-05-03 10:47 | 119K | |
![[IMG]](/icons/image2.gif) | introductory-econome..> | 2023-08-05 14:28 | 4.2K | |
![[IMG]](/icons/image2.gif) | introductory-econome..> | 2023-05-03 10:48 | 13K | |
![[IMG]](/icons/image2.gif) | introductory-mathema..> | 2023-08-05 04:34 | 3.5K | |
![[IMG]](/icons/image2.gif) | introductory-mathema..> | 2023-05-03 09:42 | 24K | |
![[ ]](/icons/compressed.gif) | introductory-mathema..> | 2023-05-03 09:42 | 230K | |
![[IMG]](/icons/image2.gif) | introductory-medical..> | 2023-08-05 02:55 | 3.4K | |
![[IMG]](/icons/image2.gif) | introductory-medical..> | 2023-05-03 11:17 | 9.8K | |
![[IMG]](/icons/image2.gif) | introductory-medical..> | 2023-08-05 06:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | introductory-medical..> | 2023-05-03 09:31 | 22K | |
![[ ]](/icons/compressed.gif) | introductory-medical..> | 2023-05-03 09:31 | 12K | |
![[IMG]](/icons/image2.gif) | introductory-statist..> | 2023-08-05 01:52 | 3.8K | |
![[IMG]](/icons/image2.gif) | introductory-statist..> | 2023-08-12 04:51 | 20K | |
![[IMG]](/icons/image2.gif) | introductory-statist..> | 2023-05-03 10:03 | 32K | |
![[ ]](/icons/compressed.gif) | introductory-statist..> | 2023-05-03 10:03 | 156K | |
![[IMG]](/icons/image2.gif) | investigating-astron..> | 2023-08-06 11:58 | 3.7K | |
![[IMG]](/icons/image2.gif) | investigating-astron..> | 2023-08-12 04:51 | 22K | |
![[IMG]](/icons/image2.gif) | investigating-astron..> | 2023-05-03 11:15 | 33K | |
![[ ]](/icons/compressed.gif) | investigating-astron..> | 2023-05-03 11:15 | 68K | |
![[IMG]](/icons/image2.gif) | investigating-oceano..> | 2023-08-05 14:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | investigating-oceano..> | 2023-08-12 04:51 | 18K | |
![[IMG]](/icons/image2.gif) | investigating-oceano..> | 2023-05-03 10:08 | 46K | |
![[ ]](/icons/compressed.gif) | investigating-oceano..> | 2023-05-03 10:08 | 430K | |
![[IMG]](/icons/image2.gif) | investment-analysis-..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | investment-analysis-..> | 2023-05-03 10:40 | 9.6K | |
![[IMG]](/icons/image2.gif) | investment-analysis-..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | investment-analysis-..> | 2023-05-03 10:41 | 9.6K | |
![[ ]](/icons/compressed.gif) | investments-10e-bodi..> | 2023-05-03 10:15 | 271K | |
![[IMG]](/icons/image2.gif) | investments-11th-edi..> | 2023-08-06 08:46 | 2.0K | |
![[IMG]](/icons/image2.gif) | investments-11th-edi..> | 2023-08-21 04:21 | 10K | |
![[IMG]](/icons/image2.gif) | investments-11th-edi..> | 2023-05-03 09:23 | 27K | |
![[ ]](/icons/compressed.gif) | investments-11th-edi..> | 2023-05-03 09:23 | 725K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-08-06 04:21 | 2.7K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-05-03 09:35 | 15K | |
![[ ]](/icons/compressed.gif) | investments-analysis..> | 2023-05-03 09:35 | 26K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-08-06 07:47 | 2.8K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-05-03 09:37 | 19K | |
![[ ]](/icons/compressed.gif) | investments-analysis..> | 2023-05-03 09:37 | 24K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-05-03 09:30 | 19K | |
![[ ]](/icons/compressed.gif) | investments-analysis..> | 2023-05-03 09:30 | 17K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-08-05 16:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-08-21 04:21 | 18K | |
![[IMG]](/icons/image2.gif) | investments-analysis..> | 2023-05-03 10:07 | 52K | |
![[ ]](/icons/compressed.gif) | investments-analysis..> | 2023-05-03 10:07 | 147K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-05-03 10:49 | 8.3K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-05-03 10:49 | 8.3K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-08-05 01:51 | 2.2K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-05-03 09:28 | 7.8K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-08-05 15:30 | 2.2K | |
![[IMG]](/icons/image2.gif) | investments-bodie-ka..> | 2023-05-03 10:15 | 7.8K | |
![[IMG]](/icons/image2.gif) | investments-canadian..> | 2023-08-08 06:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | investments-canadian..> | 2023-08-21 04:21 | 26K | |
![[IMG]](/icons/image2.gif) | investments-canadian..> | 2023-05-03 09:23 | 66K | |
![[ ]](/icons/compressed.gif) | investments-canadian..> | 2023-05-03 09:23 | 583K | |
![[ ]](/icons/compressed.gif) | investments-zvi-bodi..> | 2023-05-03 10:49 | 14K | |
![[IMG]](/icons/image2.gif) | invitation-health-17..> | 2023-08-05 15:47 | 4.0K | |
![[IMG]](/icons/image2.gif) | invitation-health-17..> | 2023-08-21 04:21 | 20K | |
![[IMG]](/icons/image2.gif) | invitation-health-17..> | 2023-05-03 10:05 | 48K | |
![[ ]](/icons/compressed.gif) | invitation-health-17..> | 2023-05-03 10:05 | 60K | |
![[IMG]](/icons/image2.gif) | invitation-to-the-li..> | 2023-08-08 06:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | invitation-to-the-li..> | 2023-05-03 09:25 | 21K | |
![[ ]](/icons/compressed.gif) | jansons-history-of-a..> | 2023-05-03 09:48 | 14K | |
![[IMG]](/icons/image2.gif) | java-100x100.jpg | 2023-08-05 16:16 | 3.4K | |
![[IMG]](/icons/image2.gif) | java-programming-8th..> | 2023-08-05 06:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | java-programming-8th..> | 2023-08-21 04:21 | 17K | |
![[IMG]](/icons/image2.gif) | java-programming-8th..> | 2023-05-03 09:25 | 49K | |
![[ ]](/icons/compressed.gif) | java-programming-8th..> | 2023-05-03 09:25 | 85K | |
![[IMG]](/icons/image2.gif) | java.jpg | 2023-05-03 10:45 | 20K | |
![[IMG]](/icons/image2.gif) | jhjjuuuyuuyuyhhjjhjh..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | jhjjuuuyuuyuyhhjjhjh..> | 2023-08-18 01:09 | 22K | |
![[IMG]](/icons/image2.gif) | jhjjuuuyuuyuyhhjjhjh..> | 2023-05-04 02:06 | 76K | |
![[ ]](/icons/layout.gif) | jhtp_01_Intro.pdf | 2023-05-04 02:01 | 2.9M | |
![[IMG]](/icons/image2.gif) | jonesaml2e19tlm_nm2.jpg | 2023-05-04 02:15 | 11K | |
![[ ]](/icons/compressed.gif) | journey-across-the-l..> | 2023-05-03 09:11 | 14K | |
![[IMG]](/icons/image2.gif) | journey-of-adulthood..> | 2023-08-09 09:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | journey-of-adulthood..> | 2023-05-03 10:44 | 25K | |
![[ ]](/icons/compressed.gif) | journey-of-adulthood..> | 2023-05-03 10:44 | 52K | |
![[IMG]](/icons/image2.gif) | juvenile-delinquency..> | 2023-08-08 20:05 | 4.6K | |
![[IMG]](/icons/image2.gif) | juvenile-delinquency..> | 2023-05-03 10:46 | 33K | |
![[ ]](/icons/compressed.gif) | juvenile-delinquency..> | 2023-05-03 10:46 | 33K | |
![[IMG]](/icons/image2.gif) | juvenile-justice-a-g..> | 2023-08-05 01:51 | 4.1K | |
![[IMG]](/icons/image2.gif) | juvenile-justice-a-g..> | 2023-08-21 04:21 | 23K | |
![[IMG]](/icons/image2.gif) | juvenile-justice-a-g..> | 2023-05-03 10:18 | 40K | |
![[ ]](/icons/compressed.gif) | juvenile-justice-a-g..> | 2023-05-03 10:18 | 28K | |
![[IMG]](/icons/image2.gif) | juvenile-justice-hes..> | 2023-08-05 15:33 | 3.7K | |
![[IMG]](/icons/image2.gif) | juvenile-justice-hes..> | 2023-05-03 09:41 | 24K | |
![[ ]](/icons/compressed.gif) | juvenile-justice-hes..> | 2023-05-03 09:41 | 19K | |
![[ ]](/icons/unknown.gif) | karakowsky-guriel_1e..> | 2023-05-03 10:29 | 105K | |
![[ ]](/icons/unknown.gif) | keegan_gm8_im_01.doc | 2023-05-03 10:45 | 157K | |
![[ ]](/icons/unknown.gif) | keegan_gm9_im_01.doc | 2023-05-03 10:06 | 161K | |
![[IMG]](/icons/image2.gif) | keeping-the-republic..> | 2023-08-06 11:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | keeping-the-republic..> | 2023-08-21 04:21 | 23K | |
![[IMG]](/icons/image2.gif) | keeping-the-republic..> | 2023-05-04 02:09 | 42K | |
![[ ]](/icons/compressed.gif) | keeping-the-republic..> | 2023-05-04 02:09 | 90K | |
![[ ]](/icons/unknown.gif) | kendall_sad9_tif_01.doc | 2023-05-04 02:15 | 48K | |
![[ ]](/icons/unknown.gif) | kennedy_brief_9e_TB_..> | 2023-05-03 09:52 | 50K | |
![[ ]](/icons/unknown.gif) | kieso15e_testbank_ch..> | 2023-05-03 10:38 | 171K | |
![[IMG]](/icons/image2.gif) | kinns-the-medical-as..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | kinns-the-medical-as..> | 2023-05-03 09:36 | 17K | |
![[ ]](/icons/compressed.gif) | kinns-the-medical-as..> | 2023-05-03 09:36 | 6.3K | |
![[ ]](/icons/unknown.gif) | kotler_mm14_tif01.doc | 2023-05-03 10:42 | 106K | |
![[ ]](/icons/unknown.gif) | kotler_pom15_im_01.docx | 2023-05-03 09:53 | 77K | |
![[IMG]](/icons/image2.gif) | kozier-and-erbs-fund..> | 2023-08-05 01:09 | 2.7K | |
![[IMG]](/icons/image2.gif) | kozier-and-erbs-fund..> | 2023-05-03 09:45 | 16K | |
![[ ]](/icons/compressed.gif) | kozier-and-erbs-fund..> | 2023-05-03 09:45 | 22K | |
![[ ]](/icons/unknown.gif) | kroenke_dbp13e_tif_0..> | 2023-05-03 10:17 | 60K | |
![[ ]](/icons/unknown.gif) | kroenke_exp7e_im_ce0..> | 2023-05-03 09:38 | 25K | |
![[IMG]](/icons/image2.gif) | kubasek-dynamic_busi..> | 2023-05-03 10:50 | 32K | |
![[ ]](/icons/compressed.gif) | kuby-immunology-7th-..> | 2023-05-03 09:19 | 51K | |
![[IMG]](/icons/image2.gif) | kuby-immunology-judy..> | 2023-08-05 17:20 | 3.8K | |
![[IMG]](/icons/image2.gif) | kuby-immunology-judy..> | 2023-05-03 09:19 | 22K | |
![[IMG]](/icons/image2.gif) | labor-economics-7th-..> | 2023-08-05 16:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | labor-economics-7th-..> | 2023-08-20 07:59 | 16K | |
![[IMG]](/icons/image2.gif) | labor-economics-7th-..> | 2023-05-03 09:28 | 44K | |
![[ ]](/icons/compressed.gif) | labor-economics-7th-..> | 2023-05-03 09:28 | 252K | |
![[IMG]](/icons/image2.gif) | labor-relations-deve..> | 2023-08-05 01:56 | 4.4K | |
![[IMG]](/icons/image2.gif) | labor-relations-deve..> | 2023-05-03 09:22 | 34K | |
![[ ]](/icons/compressed.gif) | labor-relations-deve..> | 2023-05-03 09:22 | 26K | |
![[IMG]](/icons/image2.gif) | labor-relations-stri..> | 2023-08-05 16:24 | 2.2K | |
![[IMG]](/icons/image2.gif) | labor-relations-stri..> | 2023-05-03 10:00 | 12K | |
![[ ]](/icons/compressed.gif) | labor-relations-stri..> | 2023-05-03 10:00 | 42K | |
![[ ]](/icons/compressed.gif) | laboratory-manual-an..> | 2023-05-03 13:43 | 365K | |
![[ ]](/icons/compressed.gif) | larsens-human-embryo..> | 2023-05-03 11:05 | 12K | |
![[ ]](/icons/unknown.gif) | laudon-traver_ec10_t..> | 2023-05-03 09:31 | 68K | |
![[ ]](/icons/compressed.gif) | laudon7ce_tif_02.zip | 2023-05-03 11:03 | 28K | |
![[ ]](/icons/unknown.gif) | laudon_EMIS10_tif_1.doc | 2023-05-03 09:57 | 75K | |
![[ ]](/icons/unknown.gif) | laudon_emis14e_im_01..> | 2023-05-04 01:48 | 290K | |
![[IMG]](/icons/image2.gif) | launching-new-ventur..> | 2023-08-08 14:32 | 3.6K | |
![[IMG]](/icons/image2.gif) | launching-new-ventur..> | 2023-05-03 10:16 | 22K | |
![[ ]](/icons/compressed.gif) | launching-new-ventur..> | 2023-05-03 10:16 | 15K | |
![[IMG]](/icons/image2.gif) | law-and-ethics-for-m..> | 2023-08-06 11:16 | 3.3K | |
![[IMG]](/icons/image2.gif) | law-and-ethics-for-m..> | 2023-05-03 10:26 | 20K | |
![[ ]](/icons/compressed.gif) | law-and-ethics-for-m..> | 2023-05-03 10:26 | 162K | |
![[IMG]](/icons/image2.gif) | law-business-society..> | 2023-08-06 07:46 | 4.0K | |
![[IMG]](/icons/image2.gif) | law-business-society..> | 2023-08-20 07:59 | 27K | |
![[IMG]](/icons/image2.gif) | law-business-society..> | 2023-05-03 10:19 | 78K | |
![[ ]](/icons/compressed.gif) | law-business-society..> | 2023-05-03 10:19 | 469K | |
![[IMG]](/icons/image2.gif) | leadership-and-manag..> | 2023-08-05 05:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | leadership-and-manag..> | 2023-05-03 10:18 | 20K | |
![[ ]](/icons/compressed.gif) | leadership-and-manag..> | 2023-05-03 10:18 | 18K | |
![[IMG]](/icons/image2.gif) | leadership-and-manag..> | 2023-08-05 07:04 | 4.3K | |
![[IMG]](/icons/image2.gif) | leadership-and-manag..> | 2023-05-03 10:13 | 28K | |
![[ ]](/icons/compressed.gif) | leadership-and-manag..> | 2023-05-03 10:13 | 14K | |
![[IMG]](/icons/image2.gif) | leadership-and-nursi..> | 2023-08-05 15:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | leadership-and-nursi..> | 2023-05-03 10:50 | 11K | |
![[IMG]](/icons/image2.gif) | leadership-and-nursi..> | 2023-08-06 08:33 | 2.6K | |
![[IMG]](/icons/image2.gif) | leadership-and-nursi..> | 2023-05-03 10:37 | 9.5K | |
![[IMG]](/icons/image2.gif) | leadership-experienc..> | 2023-08-05 03:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | leadership-experienc..> | 2023-08-20 07:59 | 21K | |
![[IMG]](/icons/image2.gif) | leadership-experienc..> | 2023-05-04 02:20 | 51K | |
![[ ]](/icons/compressed.gif) | leadership-experienc..> | 2023-05-04 02:20 | 1.0M | |
![[IMG]](/icons/image2.gif) | leadership-roles-and..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | leadership-roles-and..> | 2023-05-03 09:50 | 9.1K | |
![[IMG]](/icons/image2.gif) | leadership-roles-and..> | 2023-08-05 01:12 | 3.5K | |
![[IMG]](/icons/image2.gif) | leadership-roles-and..> | 2023-05-03 10:52 | 9.8K | |
![[ ]](/icons/compressed.gif) | leadership-roles-and..> | 2023-05-03 10:51 | 72K | |
![[IMG]](/icons/image2.gif) | leading-and-managing..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | leading-and-managing..> | 2023-05-03 11:02 | 11K | |
![[IMG]](/icons/image2.gif) | learning-and-memory-..> | 2023-08-05 15:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | learning-and-memory-..> | 2023-05-03 09:58 | 14K | |
![[IMG]](/icons/image2.gif) | learning-and-memory-..> | 2023-08-05 04:34 | 2.9K | |
![[IMG]](/icons/image2.gif) | learning-and-memory-..> | 2023-05-03 11:08 | 19K | |
![[IMG]](/icons/image2.gif) | legal-and-ethical-as..> | 2023-08-06 08:43 | 3.1K | |
![[IMG]](/icons/image2.gif) | legal-and-ethical-as..> | 2023-05-03 09:43 | 21K | |
![[ ]](/icons/compressed.gif) | legal-and-ethical-as..> | 2023-05-03 09:43 | 5.2K | |
![[IMG]](/icons/image2.gif) | legal-environment-bu..> | 2023-08-06 05:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | legal-environment-bu..> | 2023-08-08 16:38 | 20K | |
![[IMG]](/icons/image2.gif) | legal-environment-bu..> | 2023-05-03 10:39 | 56K | |
![[ ]](/icons/compressed.gif) | legal-environment-bu..> | 2023-05-03 10:39 | 1.1M | |
![[IMG]](/icons/image2.gif) | legal-fundamentals-f..> | 2023-08-08 12:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | legal-fundamentals-f..> | 2023-05-03 10:16 | 17K | |
![[ ]](/icons/compressed.gif) | legal-fundamentals-f..> | 2023-05-03 10:16 | 35K | |
![[IMG]](/icons/image2.gif) | legal-regulatory-env..> | 2023-08-06 08:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | legal-regulatory-env..> | 2023-08-08 16:38 | 20K | |
![[IMG]](/icons/image2.gif) | legal-regulatory-env..> | 2023-05-03 10:06 | 51K | |
![[ ]](/icons/compressed.gif) | legal-regulatory-env..> | 2023-05-03 10:06 | 377K | |
![[ ]](/icons/compressed.gif) | legal-regulatory-env..> | 2023-05-03 13:44 | 344K | |
![[ ]](/icons/compressed.gif) | lehninger-principles..> | 2023-05-03 13:42 | 578K | |
![[ ]](/icons/layout.gif) | les5e_ptb_01.pdf | 2023-05-03 10:28 | 343K | |
![[ ]](/icons/unknown.gif) | levine_smume7_ism_01..> | 2023-05-03 10:16 | 81K | |
![[ ]](/icons/unknown.gif) | levine_smume7_tif_01..> | 2023-05-03 10:15 | 155K | |
![[IMG]](/icons/image2.gif) | life-in-the-universe..> | 2023-08-05 01:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | life-in-the-universe..> | 2023-05-03 10:22 | 16K | |
![[ ]](/icons/compressed.gif) | life-in-the-universe..> | 2023-05-03 10:22 | 10K | |
![[ ]](/icons/compressed.gif) | life-span-developmen..> | 2023-05-03 11:20 | 157K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-08 15:26 | 2.4K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-05-03 10:31 | 14K | |
![[ ]](/icons/compressed.gif) | life-span-developmen..> | 2023-05-03 10:31 | 363K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-06 07:47 | 2.0K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-05-04 02:15 | 14K | |
![[ ]](/icons/compressed.gif) | life-span-developmen..> | 2023-05-04 02:15 | 110K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-05 01:51 | 1.9K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-05-03 11:20 | 7.0K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-08 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-05-03 10:28 | 61K | |
![[ ]](/icons/compressed.gif) | life-span-developmen..> | 2023-05-03 10:28 | 214K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-05 06:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-08-08 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | life-span-developmen..> | 2023-05-03 09:54 | 48K | |
![[ ]](/icons/compressed.gif) | life-span-developmen..> | 2023-05-03 09:54 | 168K | |
![[IMG]](/icons/image2.gif) | life-span-human-deve..> | 2023-08-05 06:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | life-span-human-deve..> | 2023-05-03 10:35 | 10K | |
![[ ]](/icons/compressed.gif) | life-span-human-deve..> | 2023-05-03 10:35 | 40K | |
![[IMG]](/icons/image2.gif) | life-the-science-of-..> | 2023-08-08 08:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | life-the-science-of-..> | 2023-08-08 16:38 | 32K | |
![[IMG]](/icons/image2.gif) | life-the-science-of-..> | 2023-05-03 10:16 | 52K | |
![[ ]](/icons/compressed.gif) | life-the-science-of-..> | 2023-05-03 10:16 | 1.7M | |
![[IMG]](/icons/image2.gif) | life-the-science-of-..> | 2023-08-05 05:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | life-the-science-of-..> | 2023-05-03 10:26 | 18K | |
![[IMG]](/icons/image2.gif) | lifesmart-fiore-1st-..> | 2023-08-06 08:45 | 3.6K | |
![[IMG]](/icons/image2.gif) | lifesmart-fiore-1st-..> | 2023-05-04 01:50 | 25K | |
![[ ]](/icons/compressed.gif) | lifesmart-fiore-1st-..> | 2023-05-04 01:50 | 294K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-08-07 23:09 | 4.9K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-05-03 09:56 | 36K | |
![[ ]](/icons/compressed.gif) | lifespan-development..> | 2023-05-03 09:56 | 33K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-08-06 04:21 | 4.8K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-05-03 10:47 | 35K | |
![[ ]](/icons/compressed.gif) | lifespan-development..> | 2023-05-03 10:47 | 31K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-08-06 03:28 | 4.5K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-08-27 09:09 | 29K | |
![[IMG]](/icons/image2.gif) | lifespan-development..> | 2023-05-03 10:19 | 48K | |
![[ ]](/icons/compressed.gif) | lifespan-development..> | 2023-05-03 10:19 | 88K | |
![[IMG]](/icons/image2.gif) | linear-algebra-its-a..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | linear-algebra-its-a..> | 2023-08-27 09:09 | 19K | |
![[IMG]](/icons/image2.gif) | linear-algebra-its-a..> | 2023-05-03 09:38 | 86K | |
![[ ]](/icons/compressed.gif) | linear-algebra-its-a..> | 2023-05-03 09:38 | 162K | |
![[ ]](/icons/compressed.gif) | linear-algebra-moder..> | 2023-05-03 13:44 | 466K | |
![[IMG]](/icons/image2.gif) | living-in-the-enviro..> | 2023-08-06 11:14 | 2.9K | |
![[IMG]](/icons/image2.gif) | living-in-the-enviro..> | 2023-05-03 10:37 | 19K | |
![[ ]](/icons/compressed.gif) | living-in-the-enviro..> | 2023-05-03 10:37 | 519K | |
![[IMG]](/icons/image2.gif) | living-in-the-enviro..> | 2023-08-05 01:15 | 3.9K | |
![[IMG]](/icons/image2.gif) | living-in-the-enviro..> | 2023-05-04 02:23 | 23K | |
![[IMG]](/icons/image2.gif) | living-with-art-getl..> | 2023-08-05 01:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | living-with-art-getl..> | 2023-05-03 09:26 | 10K | |
![[ ]](/icons/unknown.gif) | lo_intacct_v2_1e_tif..> | 2023-05-03 13:43 | 430K | |
![[IMG]](/icons/image2.gif) | local-anesthesia-for..> | 2023-08-05 01:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | local-anesthesia-for..> | 2023-05-03 09:42 | 18K | |
![[ ]](/icons/compressed.gif) | local-anesthesia-for..> | 2023-05-03 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | logo.png | 2023-05-05 21:36 | 24K | |
![[IMG]](/icons/image2.gif) | m-advertising-3rd-ed..> | 2023-08-06 12:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | m-advertising-3rd-ed..> | 2023-08-27 06:42 | 20K | |
![[IMG]](/icons/image2.gif) | m-advertising-3rd-ed..> | 2023-05-04 02:16 | 54K | |
![[ ]](/icons/compressed.gif) | m-advertising-3rd-ed..> | 2023-05-04 02:16 | 1.4M | |
![[IMG]](/icons/image2.gif) | m-business-5th-editi..> | 2023-08-06 11:15 | 4.3K | |
![[IMG]](/icons/image2.gif) | m-business-5th-editi..> | 2023-08-27 09:09 | 28K | |
![[IMG]](/icons/image2.gif) | m-business-5th-editi..> | 2023-05-03 10:42 | 81K | |
![[ ]](/icons/compressed.gif) | m-business-5th-editi..> | 2023-05-03 10:42 | 219K | |
![[IMG]](/icons/image2.gif) | m-economics-basics-3..> | 2023-08-06 07:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | m-economics-basics-3..> | 2023-08-27 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | m-economics-basics-3..> | 2023-05-04 02:01 | 104K | |
![[ ]](/icons/compressed.gif) | m-economics-basics-3..> | 2023-05-04 02:01 | 306K | |
![[IMG]](/icons/image2.gif) | m-finance-applicatio..> | 2023-08-05 14:34 | 3.6K | |
![[IMG]](/icons/image2.gif) | m-finance-applicatio..> | 2023-05-03 10:46 | 22K | |
![[ ]](/icons/compressed.gif) | m-finance-applicatio..> | 2023-05-03 10:46 | 10K | |
![[IMG]](/icons/image2.gif) | m-international-busi..> | 2023-08-05 01:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | m-international-busi..> | 2023-05-03 09:49 | 25K | |
![[ ]](/icons/compressed.gif) | m-international-busi..> | 2023-05-03 09:49 | 22K | |
![[IMG]](/icons/image2.gif) | m-management-bateman..> | 2023-08-05 21:03 | 3.6K | |
![[IMG]](/icons/image2.gif) | m-management-bateman..> | 2023-05-03 09:20 | 25K | |
![[ ]](/icons/compressed.gif) | m-management-bateman..> | 2023-05-03 09:20 | 105K | |
![[IMG]](/icons/image2.gif) | m-marketing-5th-edit..> | 2023-08-06 02:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | m-marketing-5th-edit..> | 2023-08-27 09:09 | 19K | |
![[IMG]](/icons/image2.gif) | m-marketing-5th-edit..> | 2023-05-03 09:50 | 50K | |
![[ ]](/icons/compressed.gif) | m-marketing-5th-edit..> | 2023-05-03 09:50 | 560K | |
![[ ]](/icons/compressed.gif) | m-marketing-grewal-3..> | 2023-05-03 09:56 | 148K | |
![[ ]](/icons/compressed.gif) | m-marketing-grewal-4..> | 2023-05-03 10:30 | 137K | |
![[IMG]](/icons/image2.gif) | m-marketing-grewal-l..> | 2023-08-07 19:33 | 3.2K | |
![[IMG]](/icons/image2.gif) | m-marketing-grewal-l..> | 2023-05-03 09:56 | 13K | |
![[ ]](/icons/unknown.gif) | macionis_7ce_tif_ch0..> | 2023-05-04 01:55 | 359K | |
![[ ]](/icons/compressed.gif) | macionis_soc_5ce_tif..> | 2023-05-03 09:53 | 32K | |
![[IMG]](/icons/image2.gif) | macro-economy-today-..> | 2023-08-06 07:47 | 3.0K | |
![[IMG]](/icons/image2.gif) | macro-economy-today-..> | 2023-08-27 09:09 | 13K | |
![[IMG]](/icons/image2.gif) | macro-economy-today-..> | 2023-05-03 11:13 | 33K | |
![[ ]](/icons/compressed.gif) | macro-economy-today-..> | 2023-05-03 11:13 | 291K | |
![[ ]](/icons/unknown.gif) | macro4_ch01.rtf | 2023-05-03 11:04 | 172K | |
![[IMG]](/icons/image2.gif) | macroeconomics-6th-e..> | 2023-08-06 06:37 | 2.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-6th-e..> | 2023-08-27 09:09 | 13K | |
![[IMG]](/icons/image2.gif) | macroeconomics-6th-e..> | 2023-05-03 10:30 | 49K | |
![[ ]](/icons/compressed.gif) | macroeconomics-6th-e..> | 2023-05-03 10:30 | 1.1M | |
![[ ]](/icons/compressed.gif) | macroeconomics-6th-e..> | 2023-05-03 13:43 | 125K | |
![[IMG]](/icons/image2.gif) | macroeconomics-7th-e..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | macroeconomics-7th-e..> | 2023-08-27 06:42 | 14K | |
![[IMG]](/icons/image2.gif) | macroeconomics-7th-e..> | 2023-05-03 10:23 | 45K | |
![[ ]](/icons/compressed.gif) | macroeconomics-7th-e..> | 2023-05-03 10:23 | 510K | |
![[IMG]](/icons/image2.gif) | macroeconomics-9th-e..> | 2023-08-08 01:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-9th-e..> | 2023-08-06 08:43 | 21K | |
![[IMG]](/icons/image2.gif) | macroeconomics-9th-e..> | 2023-05-03 09:23 | 35K | |
![[ ]](/icons/compressed.gif) | macroeconomics-9th-e..> | 2023-05-03 09:23 | 71K | |
![[IMG]](/icons/image2.gif) | macroeconomics-a-con..> | 2023-08-05 06:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | macroeconomics-a-con..> | 2023-05-03 09:54 | 19K | |
![[ ]](/icons/compressed.gif) | macroeconomics-a-con..> | 2023-05-03 09:54 | 37K | |
![[IMG]](/icons/image2.gif) | macroeconomics-abel-..> | 2023-08-05 14:38 | 2.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-abel-..> | 2023-05-03 11:11 | 13K | |
![[ ]](/icons/compressed.gif) | macroeconomics-abel-..> | 2023-05-03 11:11 | 15K | |
![[IMG]](/icons/image2.gif) | macroeconomics-abel-..> | 2023-08-05 03:40 | 2.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-abel-..> | 2023-05-03 09:24 | 18K | |
![[ ]](/icons/compressed.gif) | macroeconomics-abel-..> | 2023-05-03 09:24 | 71K | |
![[ ]](/icons/compressed.gif) | macroeconomics-abel-..> | 2023-05-03 09:11 | 37K | |
![[IMG]](/icons/image2.gif) | macroeconomics-arnol..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | macroeconomics-arnol..> | 2023-05-03 10:38 | 20K | |
![[ ]](/icons/compressed.gif) | macroeconomics-arnol..> | 2023-05-03 10:38 | 95K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-05 16:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-19 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-05-03 09:24 | 58K | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 09:24 | 3.5M | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 13:42 | 406K | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 13:41 | 1.0M | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-05 05:29 | 4.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-19 16:38 | 41K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-05-03 10:44 | 66K | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 10:44 | 57K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-05 02:03 | 2.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-19 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-05-03 10:29 | 23K | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 10:29 | 1.8M | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-05 01:54 | 4.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-08-06 08:47 | 25K | |
![[IMG]](/icons/image2.gif) | macroeconomics-canad..> | 2023-05-03 09:20 | 94K | |
![[ ]](/icons/compressed.gif) | macroeconomics-canad..> | 2023-05-03 09:20 | 589K | |
![[IMG]](/icons/image2.gif) | macroeconomics-colan..> | 2023-08-06 07:49 | 2.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-colan..> | 2023-05-03 11:15 | 12K | |
![[ ]](/icons/compressed.gif) | macroeconomics-colan..> | 2023-05-03 11:15 | 424K | |
![[IMG]](/icons/image2.gif) | macroeconomics-krugm..> | 2023-08-05 02:45 | 4.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-krugm..> | 2023-05-03 09:48 | 17K | |
![[IMG]](/icons/image2.gif) | macroeconomics-krugm..> | 2023-08-06 04:21 | 4.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-krugm..> | 2023-05-03 09:48 | 17K | |
![[ ]](/icons/compressed.gif) | macroeconomics-manki..> | 2023-05-03 11:23 | 951K | |
![[IMG]](/icons/image2.gif) | macroeconomics-manki..> | 2023-08-05 15:32 | 3.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-manki..> | 2023-05-03 09:36 | 13K | |
![[IMG]](/icons/image2.gif) | macroeconomics-manki..> | 2023-08-06 08:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-manki..> | 2023-05-03 11:23 | 13K | |
![[IMG]](/icons/image2.gif) | macroeconomics-parki..> | 2023-08-06 08:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-parki..> | 2023-05-03 10:37 | 13K | |
![[ ]](/icons/compressed.gif) | macroeconomics-parki..> | 2023-05-03 10:37 | 1.4M | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-08-06 12:15 | 3.7K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-05-03 10:43 | 23K | |
![[ ]](/icons/compressed.gif) | macroeconomics-polic..> | 2023-05-03 10:43 | 114K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-08-05 15:30 | 2.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-05-03 09:43 | 14K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-08-05 14:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-08-19 16:38 | 14K | |
![[IMG]](/icons/image2.gif) | macroeconomics-polic..> | 2023-05-03 10:00 | 70K | |
![[ ]](/icons/compressed.gif) | macroeconomics-polic..> | 2023-05-03 10:00 | 519K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-08-05 05:29 | 2.9K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-05-03 10:58 | 19K | |
![[ ]](/icons/compressed.gif) | macroeconomics-princ..> | 2023-05-03 10:58 | 41K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-08-05 21:57 | 2.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-05-03 10:36 | 8.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-08-05 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-princ..> | 2023-05-03 09:35 | 8.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-publi..> | 2023-08-05 01:13 | 2.4K | |
![[IMG]](/icons/image2.gif) | macroeconomics-publi..> | 2023-05-03 11:13 | 18K | |
![[ ]](/icons/compressed.gif) | macroeconomics-publi..> | 2023-05-03 11:13 | 37K | |
![[ ]](/icons/compressed.gif) | macroeconomics-theor..> | 2023-05-03 09:07 | 8.1K | |
![[IMG]](/icons/image2.gif) | macroeconomics-willi..> | 2023-08-05 01:51 | 1.8K | |
![[IMG]](/icons/image2.gif) | macroeconomics-willi..> | 2023-05-03 10:22 | 11K | |
![[ ]](/icons/compressed.gif) | macroeconomics-willi..> | 2023-05-03 10:22 | 20K | |
![[IMG]](/icons/image2.gif) | macroeconomics-willi..> | 2023-08-05 01:51 | 2.5K | |
![[IMG]](/icons/image2.gif) | macroeconomics-willi..> | 2023-05-04 02:26 | 9.1K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-08-08 23:00 | 3.2K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-08-24 01:19 | 16K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-05-04 02:12 | 41K | |
![[ ]](/icons/compressed.gif) | maders-understanding..> | 2023-05-04 02:12 | 565K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-08-06 13:10 | 3.1K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-08-24 01:19 | 16K | |
![[IMG]](/icons/image2.gif) | maders-understanding..> | 2023-05-03 09:45 | 43K | |
![[ ]](/icons/compressed.gif) | maders-understanding..> | 2023-05-03 09:45 | 190K | |
![[IMG]](/icons/image2.gif) | main-photo-mental-he..> | 2023-08-08 16:34 | 19K | |
![[IMG]](/icons/image2.gif) | main-photo-mental-he..> | 2023-08-15 06:40 | 126K | |
![[IMG]](/icons/image2.gif) | main-photo-mental-he..> | 2023-05-04 02:14 | 3.7M | |
![[IMG]](/icons/image2.gif) | making-a-difference-..> | 2023-08-06 15:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | making-a-difference-..> | 2023-05-03 10:46 | 23K | |
![[ ]](/icons/compressed.gif) | making-a-difference-..> | 2023-05-03 10:46 | 10K | |
![[ ]](/icons/compressed.gif) | making-of-the-west-p..> | 2023-05-03 13:42 | 72K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-08-06 04:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-08-24 01:19 | 20K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-05-03 10:15 | 76K | |
![[ ]](/icons/compressed.gif) | making-team-guide-ma..> | 2023-05-03 10:15 | 822K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-08-08 23:56 | 3.6K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-08-24 01:19 | 20K | |
![[IMG]](/icons/image2.gif) | making-team-guide-ma..> | 2023-05-03 11:16 | 77K | |
![[ ]](/icons/compressed.gif) | making-team-guide-ma..> | 2023-05-03 11:16 | 35K | |
![[ ]](/icons/compressed.gif) | management-8th-editi..> | 2023-05-03 13:42 | 604K | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-08-06 07:49 | 3.6K | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-08-24 01:19 | 17K | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-05-04 02:07 | 45K | |
![[ ]](/icons/compressed.gif) | management-12th-edit..> | 2023-05-04 02:07 | 13M | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-08-06 08:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-08-17 20:52 | 17K | |
![[IMG]](/icons/image2.gif) | management-12th-edit..> | 2023-05-03 10:18 | 43K | |
![[ ]](/icons/compressed.gif) | management-12th-edit..> | 2023-05-03 10:18 | 1.0M | |
![[IMG]](/icons/image2.gif) | management-13th-edit..> | 2023-08-05 14:38 | 3.0K | |
![[IMG]](/icons/image2.gif) | management-13th-edit..> | 2023-08-24 01:19 | 16K | |
![[IMG]](/icons/image2.gif) | management-13th-edit..> | 2023-05-03 09:49 | 28K | |
![[ ]](/icons/compressed.gif) | management-13th-edit..> | 2023-05-03 09:49 | 207K | |
![[ ]](/icons/compressed.gif) | management-a-practic..> | 2023-05-03 10:41 | 121K | |
![[IMG]](/icons/image2.gif) | management-a-practic..> | 2023-08-08 07:33 | 3.2K | |
![[IMG]](/icons/image2.gif) | management-a-practic..> | 2023-05-03 09:39 | 5.9K | |
![[IMG]](/icons/image2.gif) | management-a-practic..> | 2023-08-05 02:29 | 3.2K | |
![[IMG]](/icons/image2.gif) | management-a-practic..> | 2023-05-03 10:41 | 5.9K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-05-03 10:57 | 9.6K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-08-06 17:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-05-03 10:23 | 22K | |
![[ ]](/icons/compressed.gif) | management-accountin..> | 2023-05-03 10:23 | 17K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-08-05 06:24 | 3.0K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-05-03 09:25 | 8.6K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-08-08 22:02 | 3.0K | |
![[IMG]](/icons/image2.gif) | management-accountin..> | 2023-05-03 09:25 | 8.6K | |
![[IMG]](/icons/image2.gif) | management-daft-10th..> | 2023-08-05 15:31 | 2.8K | |
![[IMG]](/icons/image2.gif) | management-daft-10th..> | 2023-05-03 10:50 | 11K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-05 16:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-17 20:52 | 26K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-05-03 10:58 | 114K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 10:58 | 1.1M | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-06 05:43 | 3.9K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-20 18:35 | 26K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-05-03 09:56 | 115K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 09:56 | 157K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 10:55 | 19K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-06 07:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-05-03 10:06 | 21K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 10:06 | 32K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-06 15:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-05-03 09:19 | 17K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 09:19 | 407K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-08-05 04:34 | 2.2K | |
![[IMG]](/icons/image2.gif) | management-informati..> | 2023-05-03 09:23 | 14K | |
![[ ]](/icons/compressed.gif) | management-informati..> | 2023-05-03 09:23 | 72K | |
![[IMG]](/icons/image2.gif) | management-kreitner-..> | 2023-08-05 14:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | management-kreitner-..> | 2023-05-03 10:14 | 18K | |
![[ ]](/icons/compressed.gif) | management-kreitner-..> | 2023-05-03 10:14 | 35K | |
![[ ]](/icons/compressed.gif) | management-now-2nd-e..> | 2023-05-03 10:07 | 30K | |
![[IMG]](/icons/image2.gif) | management-ricky-w-g..> | 2023-08-05 09:59 | 2.9K | |
![[IMG]](/icons/image2.gif) | management-ricky-w-g..> | 2023-05-03 10:11 | 21K | |
![[ ]](/icons/compressed.gif) | management-ricky-w-g..> | 2023-05-03 10:11 | 63K | |
![[IMG]](/icons/image2.gif) | management-robbins-1..> | 2023-08-05 05:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | management-robbins-1..> | 2023-05-03 10:45 | 15K | |
![[ ]](/icons/compressed.gif) | management-robbins-1..> | 2023-05-03 10:45 | 37K | |
![[IMG]](/icons/image2.gif) | management-robbins-c..> | 2023-05-03 09:36 | 6.8K | |
![[IMG]](/icons/image2.gif) | management-schermerh..> | 2023-08-09 05:57 | 2.5K | |
![[IMG]](/icons/image2.gif) | management-schermerh..> | 2023-05-03 10:09 | 14K | |
![[ ]](/icons/compressed.gif) | management-schermerh..> | 2023-05-03 10:09 | 45K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 14:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-12 07:35 | 17K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-04 02:08 | 45K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-04 02:08 | 227K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 05:29 | 4.3K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-12 07:35 | 23K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-04 02:20 | 53K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-04 02:20 | 3.7M | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-08 21:05 | 4.3K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-12 07:35 | 23K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:44 | 54K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 09:44 | 195K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 03:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:28 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:27 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-12 07:35 | 15K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:29 | 39K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 10:29 | 4.4M | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 10:10 | 378K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 16:16 | 2.5K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:10 | 9.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 09:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-04 01:47 | 22K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 13:04 | 2.8K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-19 04:13 | 15K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-04 02:03 | 773K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-04 02:03 | 4.3M | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 07:47 | 3.0K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-19 04:13 | 16K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:53 | 40K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 09:53 | 1.8M | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:34 | 12K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 17:17 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:18 | 9.8K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-08 06:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 11:16 | 9.8K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 07:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:32 | 19K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 10:32 | 363K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-08 01:04 | 1.9K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:50 | 11K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 09:50 | 26K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 13:12 | 3.6K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:08 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 15:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:17 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 16:28 | 2.8K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:26 | 12K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 01:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 09:27 | 12K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-08 15:42 | 3.5K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:02 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 11:01 | 11K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 11:01 | 67K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 09:27 | 2.5M | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-08 07:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-18 11:36 | 17K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-04 02:11 | 27K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-04 02:11 | 366K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 13:41 | 520K | |
![[ ]](/icons/compressed.gif) | managerial-accountin..> | 2023-05-03 10:05 | 1.5M | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-05 14:40 | 2.9K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:02 | 10K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-08-06 10:20 | 2.9K | |
![[IMG]](/icons/image2.gif) | managerial-accountin..> | 2023-05-03 10:05 | 10K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-05 02:45 | 3.0K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-18 11:36 | 20K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:38 | 30K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 09:38 | 526K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-05 16:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 10:48 | 19K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 10:48 | 264K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-06 05:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:48 | 19K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-05 17:21 | 2.6K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-18 11:36 | 12K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:49 | 23K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 09:49 | 1.2M | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-06 05:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:20 | 21K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 09:20 | 43K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-06 05:44 | 2.5K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 10:17 | 15K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 10:17 | 37K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-05 05:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:47 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-06 08:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 10:45 | 11K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-08 07:30 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 11:05 | 21K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 11:05 | 6.6K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-06 03:25 | 3.1K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-18 11:36 | 14K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:50 | 66K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 09:50 | 218K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-08-05 03:40 | 2.6K | |
![[ ]](/icons/compressed.gif) | managerial-economics..> | 2023-05-03 09:24 | 28K | |
![[IMG]](/icons/image2.gif) | managerial-economics..> | 2023-05-03 09:24 | 17K | |
![[IMG]](/icons/image2.gif) | managerial-statistic..> | 2023-08-05 14:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | managerial-statistic..> | 2023-05-03 10:17 | 15K | |
![[ ]](/icons/compressed.gif) | managerial-statistic..> | 2023-05-03 10:17 | 43K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-08-08 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-05-03 09:27 | 29K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-08-09 09:15 | 4.5K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-08-18 11:36 | 22K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-05-03 10:20 | 87K | |
![[ ]](/icons/compressed.gif) | managing-human-resou..> | 2023-05-03 10:20 | 304K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-08-06 15:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-05-03 10:51 | 17K | |
![[ ]](/icons/compressed.gif) | managing-human-resou..> | 2023-05-03 10:51 | 166K | |
![[ ]](/icons/compressed.gif) | managing-human-resou..> | 2023-05-03 09:27 | 28K | |
![[ ]](/icons/compressed.gif) | managing-human-resou..> | 2023-05-03 13:42 | 20K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-08-06 07:45 | 3.5K | |
![[IMG]](/icons/image2.gif) | managing-human-resou..> | 2023-05-03 09:37 | 22K | |
![[ ]](/icons/compressed.gif) | managing-human-resou..> | 2023-05-03 09:36 | 18K | |
![[IMG]](/icons/image2.gif) | managing-information..> | 2023-08-05 21:03 | 3.0K | |
![[IMG]](/icons/image2.gif) | managing-information..> | 2023-05-03 10:26 | 22K | |
![[ ]](/icons/compressed.gif) | managing-information..> | 2023-05-03 10:26 | 8.5K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-08-06 10:16 | 3.7K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-05-03 10:53 | 26K | |
![[ ]](/icons/compressed.gif) | managing-organizatio..> | 2023-05-03 10:53 | 67K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-08-06 07:47 | 2.5K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-05-03 09:48 | 14K | |
![[ ]](/icons/compressed.gif) | managing-organizatio..> | 2023-05-03 09:48 | 6.1K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-08-07 21:41 | 4.8K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-08-20 18:36 | 31K | |
![[IMG]](/icons/image2.gif) | managing-organizatio..> | 2023-05-03 09:33 | 87K | |
![[ ]](/icons/compressed.gif) | managing-organizatio..> | 2023-05-03 09:33 | 283K | |
![[IMG]](/icons/image2.gif) | managing-performance..> | 2023-08-08 22:58 | 2.7K | |
![[IMG]](/icons/image2.gif) | managing-performance..> | 2023-05-04 01:47 | 19K | |
![[ ]](/icons/compressed.gif) | managing-performance..> | 2023-05-04 01:47 | 162K | |
![[IMG]](/icons/image2.gif) | managing-supply-chai..> | 2023-08-05 05:29 | 4.0K | |
![[IMG]](/icons/image2.gif) | managing-supply-chai..> | 2023-08-20 18:36 | 26K | |
![[IMG]](/icons/image2.gif) | managing-supply-chai..> | 2023-05-03 09:24 | 88K | |
![[ ]](/icons/compressed.gif) | managing-supply-chai..> | 2023-05-03 09:24 | 713K | |
![[IMG]](/icons/image2.gif) | marketing-2nd-editio..> | 2023-08-05 06:24 | 4.3K | |
![[IMG]](/icons/image2.gif) | marketing-2nd-editio..> | 2023-08-20 18:36 | 22K | |
![[IMG]](/icons/image2.gif) | marketing-2nd-editio..> | 2023-05-03 11:23 | 55K | |
![[ ]](/icons/compressed.gif) | marketing-2nd-editio..> | 2023-05-03 11:23 | 293K | |
![[IMG]](/icons/image2.gif) | marketing-6th-editio..> | 2023-08-06 12:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | marketing-6th-editio..> | 2023-08-20 18:36 | 16K | |
![[IMG]](/icons/image2.gif) | marketing-6th-editio..> | 2023-05-03 10:19 | 39K | |
![[ ]](/icons/compressed.gif) | marketing-6th-editio..> | 2023-05-03 10:19 | 214K | |
![[IMG]](/icons/image2.gif) | marketing-2014-pride..> | 2023-08-06 11:13 | 2.3K | |
![[IMG]](/icons/image2.gif) | marketing-2014-pride..> | 2023-05-03 10:27 | 12K | |
![[ ]](/icons/compressed.gif) | marketing-2014-pride..> | 2023-05-03 10:27 | 38K | |
![[IMG]](/icons/image2.gif) | marketing-an-introdu..> | 2023-08-05 05:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | marketing-an-introdu..> | 2023-05-03 10:51 | 12K | |
![[ ]](/icons/compressed.gif) | marketing-an-introdu..> | 2023-05-03 10:51 | 35K | |
![[IMG]](/icons/image2.gif) | marketing-canadian-1..> | 2023-08-05 02:45 | 3.3K | |
![[IMG]](/icons/image2.gif) | marketing-canadian-1..> | 2023-08-20 18:36 | 22K | |
![[IMG]](/icons/image2.gif) | marketing-canadian-1..> | 2023-05-03 09:48 | 38K | |
![[ ]](/icons/compressed.gif) | marketing-canadian-1..> | 2023-05-03 09:48 | 796K | |
![[IMG]](/icons/image2.gif) | marketing-dhruv-grew..> | 2023-08-05 04:37 | 2.5K | |
![[IMG]](/icons/image2.gif) | marketing-dhruv-grew..> | 2023-05-03 09:24 | 13K | |
![[ ]](/icons/compressed.gif) | marketing-dhruv-grew..> | 2023-05-03 09:24 | 52K | |
![[IMG]](/icons/image2.gif) | marketing-grewal-lev..> | 2023-08-05 06:24 | 1.8K | |
![[IMG]](/icons/image2.gif) | marketing-grewal-lev..> | 2023-05-03 11:15 | 4.7K | |
![[ ]](/icons/compressed.gif) | marketing-introducti..> | 2023-05-03 13:42 | 82K | |
![[ ]](/icons/compressed.gif) | marketing-kerin-12th..> | 2023-05-03 11:17 | 7.7M | |
![[IMG]](/icons/image2.gif) | marketing-lamb-12th-..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | marketing-lamb-12th-..> | 2023-05-03 10:04 | 18K | |
![[ ]](/icons/compressed.gif) | marketing-lamb-12th-..> | 2023-05-03 10:04 | 33K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-05 15:32 | 3.3K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-12 04:51 | 17K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 10:32 | 47K | |
![[ ]](/icons/compressed.gif) | marketing-management..> | 2023-05-03 10:32 | 819K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-05 04:36 | 2.7K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-20 18:36 | 20K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 09:28 | 59K | |
![[ ]](/icons/compressed.gif) | marketing-management..> | 2023-05-03 09:28 | 473K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-06 10:14 | 2.7K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-12 04:51 | 20K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 09:29 | 61K | |
![[ ]](/icons/compressed.gif) | marketing-management..> | 2023-05-03 09:29 | 340K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-08 22:58 | 1.6K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 11:23 | 9.7K | |
![[ ]](/icons/compressed.gif) | marketing-management..> | 2023-05-03 11:23 | 190K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-08-05 01:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 10:18 | 13K | |
![[ ]](/icons/compressed.gif) | marketing-management..> | 2023-05-03 10:18 | 37K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 10:25 | 3.9K | |
![[IMG]](/icons/image2.gif) | marketing-management..> | 2023-05-03 10:42 | 3.9K | |
![[IMG]](/icons/image2.gif) | marketing-real-peopl..> | 2023-08-06 04:17 | 4.5K | |
![[IMG]](/icons/image2.gif) | marketing-real-peopl..> | 2023-05-03 09:50 | 29K | |
![[ ]](/icons/compressed.gif) | marketing-real-peopl..> | 2023-05-03 09:49 | 53K | |
![[IMG]](/icons/image2.gif) | marketing-research-1..> | 2023-08-05 03:41 | 2.6K | |
![[IMG]](/icons/image2.gif) | marketing-research-1..> | 2023-08-12 04:51 | 14K | |
![[IMG]](/icons/image2.gif) | marketing-research-1..> | 2023-05-03 09:41 | 25K | |
![[ ]](/icons/compressed.gif) | marketing-research-1..> | 2023-05-03 09:41 | 340K | |
![[IMG]](/icons/image2.gif) | marketing-strategy-f..> | 2023-08-05 03:44 | 2.7K | |
![[IMG]](/icons/image2.gif) | marketing-strategy-f..> | 2023-05-03 09:39 | 13K | |
![[ ]](/icons/compressed.gif) | marketing-strategy-f..> | 2023-05-03 09:39 | 14K | |
![[IMG]](/icons/image2.gif) | marketing-strategy-f..> | 2023-08-05 14:38 | 3.6K | |
![[IMG]](/icons/image2.gif) | marketing-strategy-f..> | 2023-05-03 10:03 | 20K | |
![[ ]](/icons/compressed.gif) | marketing-strategy-f..> | 2023-05-03 10:03 | 7.8K | |
![[IMG]](/icons/image2.gif) | marriages-and-famili..> | 2023-08-09 02:01 | 5.1K | |
![[IMG]](/icons/image2.gif) | marriages-and-famili..> | 2023-05-03 09:25 | 40K | |
![[ ]](/icons/compressed.gif) | marriages-and-famili..> | 2023-05-03 09:25 | 30K | |
![[IMG]](/icons/image2.gif) | marriages-families-a..> | 2023-08-08 16:38 | 15K | |
![[IMG]](/icons/image2.gif) | marriages-families-a..> | 2023-05-03 10:33 | 42K | |
![[ ]](/icons/layout.gif) | martoc_hrm15_im_01.pdf | 2023-05-03 13:43 | 378K | |
![[IMG]](/icons/image2.gif) | mastering-the-world-..> | 2023-08-05 06:23 | 2.2K | |
![[IMG]](/icons/image2.gif) | mastering-the-world-..> | 2023-05-03 10:17 | 14K | |
![[ ]](/icons/compressed.gif) | mastering-the-world-..> | 2023-05-03 10:17 | 81K | |
![[ ]](/icons/compressed.gif) | masters3ch2.zip | 2023-05-03 10:36 | 5.3K | |
![[IMG]](/icons/image2.gif) | materials-science-an..> | 2023-08-05 01:14 | 3.2K | |
![[IMG]](/icons/image2.gif) | materials-science-an..> | 2023-05-04 02:15 | 11K | |
![[IMG]](/icons/image2.gif) | maternal-and-child-h..> | 2023-08-05 02:46 | 2.2K | |
![[IMG]](/icons/image2.gif) | maternal-and-child-h..> | 2023-05-03 09:26 | 6.5K | |
![[IMG]](/icons/image2.gif) | maternal-and-child-h..> | 2023-08-06 05:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | maternal-and-child-h..> | 2023-05-03 09:38 | 7.8K | |
![[ ]](/icons/compressed.gif) | maternal-and-child-h..> | 2023-05-03 09:38 | 9.7K | |
![[ ]](/icons/compressed.gif) | maternal-child-nursi..> | 2023-05-03 11:26 | 141K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-08-06 07:48 | 3.5K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-05-03 11:26 | 22K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-08-06 21:21 | 3.0K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-05-03 09:32 | 9.3K | |
![[ ]](/icons/compressed.gif) | maternal-child-nursi..> | 2023-05-03 09:32 | 20K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-05-03 11:25 | 25K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-08-06 05:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | maternal-child-nursi..> | 2023-05-03 10:19 | 12K | |
![[IMG]](/icons/image2.gif) | maternity-and-pediat..> | 2023-08-05 03:37 | 3.5K | |
![[IMG]](/icons/image2.gif) | maternity-and-pediat..> | 2023-05-03 10:44 | 22K | |
![[ ]](/icons/compressed.gif) | maternity-and-pediat..> | 2023-05-03 10:44 | 6.1K | |
![[ ]](/icons/compressed.gif) | maternity-and-womens..> | 2023-05-03 09:24 | 15K | |
![[IMG]](/icons/image2.gif) | maternity-lowedermil..> | 2023-08-05 01:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | maternity-lowedermil..> | 2023-05-03 09:24 | 13K | |
![[IMG]](/icons/image2.gif) | maternity-nursing-an..> | 2023-08-05 01:08 | 2.1K | |
![[IMG]](/icons/image2.gif) | maternity-nursing-an..> | 2023-05-03 10:59 | 11K | |
![[ ]](/icons/compressed.gif) | maternity-nursing-an..> | 2023-05-03 10:59 | 16K | |
![[ ]](/icons/compressed.gif) | maternity-nursing-lo..> | 2023-05-03 10:53 | 18K | |
![[IMG]](/icons/image2.gif) | maternity-nursing-lo..> | 2023-08-05 04:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | maternity-nursing-lo..> | 2023-05-03 10:54 | 9.0K | |
![[IMG]](/icons/image2.gif) | math-and-dosage-calc..> | 2023-08-05 03:35 | 2.9K | |
![[IMG]](/icons/image2.gif) | math-and-dosage-calc..> | 2023-05-03 10:19 | 18K | |
![[ ]](/icons/compressed.gif) | math-and-dosage-calc..> | 2023-05-03 10:19 | 81K | |
![[IMG]](/icons/image2.gif) | mathematical-ideas-1..> | 2023-08-05 02:46 | 4.0K | |
![[IMG]](/icons/image2.gif) | mathematical-ideas-1..> | 2023-08-19 07:17 | 30K | |
![[IMG]](/icons/image2.gif) | mathematical-ideas-1..> | 2023-05-03 10:09 | 108K | |
![[ ]](/icons/compressed.gif) | mathematical-ideas-1..> | 2023-05-03 10:09 | 1.3M | |
![[IMG]](/icons/image2.gif) | mathematics-elementa..> | 2023-08-08 16:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | mathematics-elementa..> | 2023-08-08 23:54 | 25K | |
![[IMG]](/icons/image2.gif) | mathematics-elementa..> | 2023-05-03 09:21 | 85K | |
![[ ]](/icons/compressed.gif) | mathematics-elementa..> | 2023-05-03 09:21 | 715K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-essenti..> | 2023-08-05 14:36 | 3.3K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-essenti..> | 2023-05-03 11:23 | 16K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-08-06 05:47 | 3.4K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-05-03 10:22 | 9.6K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-08-07 13:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-05-03 10:25 | 9.6K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | mcgraw-hills-taxatio..> | 2023-05-03 10:31 | 10K | |
![[ ]](/icons/layout.gif) | mcinnes_managinglaw4..> | 2023-05-03 09:21 | 640K | |
![[ ]](/icons/unknown.gif) | mckee_mgmt2_im01.doc | 2023-05-03 09:23 | 108K | |
![[IMG]](/icons/image2.gif) | mechanical-ventilati..> | 2023-08-05 03:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | mechanical-ventilati..> | 2023-05-03 10:43 | 18K | |
![[ ]](/icons/compressed.gif) | mechanical-ventilati..> | 2023-05-03 10:43 | 18K | |
![[IMG]](/icons/image2.gif) | med-surg-main-photo-..> | 2023-05-04 02:12 | 647K | |
![[IMG]](/icons/image2.gif) | medical-genetics-lyn..> | 2023-08-05 02:31 | 3.5K | |
![[IMG]](/icons/image2.gif) | medical-genetics-lyn..> | 2023-05-03 09:59 | 22K | |
![[ ]](/icons/compressed.gif) | medical-genetics-lyn..> | 2023-05-03 09:59 | 56K | |
![[IMG]](/icons/image2.gif) | medical-law-ethics-a..> | 2023-08-06 03:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | medical-law-ethics-a..> | 2023-05-03 10:19 | 17K | |
![[ ]](/icons/compressed.gif) | medical-law-ethics-a..> | 2023-05-03 10:19 | 5.5K | |
![[IMG]](/icons/image2.gif) | medical-microbiology..> | 2023-08-08 07:19 | 2.8K | |
![[IMG]](/icons/image2.gif) | medical-microbiology..> | 2023-05-03 11:03 | 17K | |
![[IMG]](/icons/image2.gif) | medical-parasitology..> | 2023-08-06 13:02 | 3.3K | |
![[IMG]](/icons/image2.gif) | medical-parasitology..> | 2023-05-03 09:43 | 20K | |
![[ ]](/icons/compressed.gif) | medical-parasitology..> | 2023-05-03 09:43 | 1.7M | |
![[IMG]](/icons/image2.gif) | medical-sociology-13..> | 2023-08-08 07:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | medical-sociology-13..> | 2023-08-19 07:17 | 19K | |
![[IMG]](/icons/image2.gif) | medical-sociology-13..> | 2023-05-03 11:04 | 87K | |
![[ ]](/icons/compressed.gif) | medical-sociology-13..> | 2023-05-03 11:04 | 24K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-08 00:56 | 3.3K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:24 | 18K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 10:24 | 11K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-06 13:03 | 3.8K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-06 11:18 | 4.1K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 09:37 | 13K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 09:47 | 20K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 09:47 | 14K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:11 | 26K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 09:48 | 93K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 02:55 | 4.2K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-19 02:34 | 23K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:29 | 97K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 10:29 | 106K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-06 10:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-19 02:34 | 23K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 09:20 | 76K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 14:34 | 3.0K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 09:49 | 20K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 09:49 | 15K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-08 06:38 | 2.5K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 09:07 | 14K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-06 05:44 | 13K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-04 01:52 | 31K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 15:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-04 02:22 | 13K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-06 08:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:36 | 21K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 10:36 | 17K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 16:20 | 3.3K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:15 | 21K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-08-05 01:13 | 3.7K | |
![[IMG]](/icons/image2.gif) | medical-surgical-nur..> | 2023-05-03 10:38 | 28K | |
![[ ]](/icons/compressed.gif) | medical-surgical-nur..> | 2023-05-03 10:38 | 12K | |
![[ ]](/icons/compressed.gif) | medical-terminology-..> | 2023-05-03 09:46 | 21K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-08-05 19:00 | 3.7K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-05-03 09:46 | 13K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-08-08 14:32 | 4.0K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-05-03 09:27 | 22K | |
![[ ]](/icons/compressed.gif) | medical-terminology-..> | 2023-05-03 09:27 | 20K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-08-07 13:23 | 18K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-05-03 10:20 | 55K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-08-05 04:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | medical-terminology-..> | 2023-05-03 09:49 | 20K | |
![[ ]](/icons/compressed.gif) | medical-terminology-..> | 2023-05-03 09:49 | 362K | |
![[IMG]](/icons/image2.gif) | meeting-the-ethical-..> | 2023-08-05 15:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | meeting-the-ethical-..> | 2023-08-19 02:34 | 22K | |
![[IMG]](/icons/image2.gif) | meeting-the-ethical-..> | 2023-05-03 10:21 | 36K | |
![[ ]](/icons/compressed.gif) | meeting-the-ethical-..> | 2023-05-03 10:21 | 104K | |
![[IMG]](/icons/image2.gif) | memmlers-structure-a..> | 2023-08-05 16:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | memmlers-structure-a..> | 2023-05-03 09:48 | 21K | |
![[IMG]](/icons/image2.gif) | memmlers-structure-a..> | 2023-08-05 06:24 | 3.1K | |
![[IMG]](/icons/image2.gif) | memmlers-structure-a..> | 2023-05-03 09:24 | 21K | |
![[ ]](/icons/compressed.gif) | memmlers-structure-a..> | 2023-05-03 09:24 | 16K | |
![[ ]](/icons/compressed.gif) | memmlers-the-human-b..> | 2023-05-03 10:18 | 111K | |
![[IMG]](/icons/image2.gif) | memmlers-the-human-b..> | 2023-08-05 03:40 | 14K | |
![[IMG]](/icons/image2.gif) | memmlers-the-human-b..> | 2023-05-03 10:18 | 37K | |
![[IMG]](/icons/image2.gif) | merrills-atlas-of-ra..> | 2023-08-06 09:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | merrills-atlas-of-ra..> | 2023-05-03 10:35 | 18K | |
![[ ]](/icons/compressed.gif) | merrills-atlas-of-ra..> | 2023-05-03 10:35 | 12K | |
![[IMG]](/icons/image2.gif) | meteorology-today-an..> | 2023-08-06 06:37 | 3.1K | |
![[IMG]](/icons/image2.gif) | meteorology-today-an..> | 2023-05-03 10:42 | 23K | |
![[ ]](/icons/compressed.gif) | meteorology-today-an..> | 2023-05-03 10:42 | 48K | |
![[IMG]](/icons/image2.gif) | methods-behavioral-r..> | 2023-08-05 14:41 | 2.7K | |
![[IMG]](/icons/image2.gif) | methods-behavioral-r..> | 2023-08-12 04:51 | 14K | |
![[IMG]](/icons/image2.gif) | methods-behavioral-r..> | 2023-05-03 10:12 | 436K | |
![[ ]](/icons/compressed.gif) | methods-behavioral-r..> | 2023-05-03 10:12 | 68K | |
![[IMG]](/icons/image2.gif) | methods-in-behaviour..> | 2023-08-06 09:42 | 4.1K | |
![[IMG]](/icons/image2.gif) | methods-in-behaviour..> | 2023-08-06 03:27 | 33K | |
![[IMG]](/icons/image2.gif) | methods-in-behaviour..> | 2023-05-03 09:26 | 54K | |
![[ ]](/icons/compressed.gif) | methods-in-behaviour..> | 2023-05-03 09:26 | 812K | |
![[ ]](/icons/layout.gif) | mfcs11e_tif_01.pdf | 2023-05-03 09:57 | 489K | |
![[IMG]](/icons/image2.gif) | microbiology-1st-edi..> | 2023-08-06 16:25 | 3.7K | |
![[IMG]](/icons/image2.gif) | microbiology-1st-edi..> | 2023-08-12 04:51 | 22K | |
![[IMG]](/icons/image2.gif) | microbiology-1st-edi..> | 2023-05-04 02:05 | 64K | |
![[ ]](/icons/compressed.gif) | microbiology-1st-edi..> | 2023-05-04 02:05 | 143K | |
![[IMG]](/icons/image2.gif) | microbiology-a-clini..> | 2023-08-05 04:19 | 3.3K | |
![[IMG]](/icons/image2.gif) | microbiology-a-clini..> | 2023-05-03 09:22 | 19K | |
![[ ]](/icons/compressed.gif) | microbiology-a-clini..> | 2023-05-03 09:22 | 12K | |
![[IMG]](/icons/image2.gif) | microbiology-a-syste..> | 2023-08-05 16:25 | 3.5K | |
![[IMG]](/icons/image2.gif) | microbiology-a-syste..> | 2023-05-03 09:33 | 11K | |
![[ ]](/icons/compressed.gif) | microbiology-a-syste..> | 2023-05-03 09:33 | 48K | |
![[IMG]](/icons/image2.gif) | microbiology-an-evol..> | 2023-08-05 06:19 | 4.1K | |
![[IMG]](/icons/image2.gif) | microbiology-an-evol..> | 2023-05-03 09:30 | 24K | |
![[ ]](/icons/compressed.gif) | microbiology-an-evol..> | 2023-05-03 09:30 | 235K | |
![[ ]](/icons/compressed.gif) | microbiology-an-intr..> | 2023-05-04 02:09 | 107K | |
![[IMG]](/icons/image2.gif) | microbiology-an-intr..> | 2023-08-05 16:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | microbiology-an-intr..> | 2023-05-03 10:20 | 26K | |
![[ ]](/icons/compressed.gif) | microbiology-an-intr..> | 2023-05-03 10:20 | 133K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-08-05 14:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-08-12 04:51 | 15K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-05-03 09:38 | 78K | |
![[ ]](/icons/compressed.gif) | microbiology-disease..> | 2023-05-03 09:38 | 153K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-08-05 06:24 | 4.0K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-08-17 08:45 | 23K | |
![[IMG]](/icons/image2.gif) | microbiology-disease..> | 2023-05-03 11:22 | 109K | |
![[ ]](/icons/compressed.gif) | microbiology-disease..> | 2023-05-03 11:22 | 249K | |
![[IMG]](/icons/image2.gif) | microbiology-fundame..> | 2023-08-06 07:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | microbiology-fundame..> | 2023-05-03 11:01 | 23K | |
![[ ]](/icons/compressed.gif) | microbiology-fundame..> | 2023-05-03 11:01 | 406K | |
![[IMG]](/icons/image2.gif) | microbiology-fundame..> | 2023-08-05 15:30 | 3.9K | |
![[IMG]](/icons/image2.gif) | microbiology-fundame..> | 2023-08-12 04:51 | 21K | |
![[IMG]](/icons/image2.gif) | microbiology-fundame..> | 2023-05-03 10:09 | 58K | |
![[ ]](/icons/compressed.gif) | microbiology-fundame..> | 2023-05-03 10:09 | 324K | |
![[IMG]](/icons/image2.gif) | microbiology-princip..> | 2023-08-05 02:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | microbiology-princip..> | 2023-05-03 09:20 | 13K | |
![[ ]](/icons/compressed.gif) | microbiology-princip..> | 2023-05-03 09:20 | 369K | |
![[IMG]](/icons/image2.gif) | microbiology-princip..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | microbiology-princip..> | 2023-08-12 04:51 | 21K | |
![[IMG]](/icons/image2.gif) | microbiology-princip..> | 2023-05-03 11:03 | 31K | |
![[ ]](/icons/compressed.gif) | microbiology-princip..> | 2023-05-03 11:03 | 183K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-08-07 13:27 | 18K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-05-03 09:43 | 53K | |
![[ ]](/icons/compressed.gif) | microbiology-with-di..> | 2023-05-03 09:43 | 140K | |
![[ ]](/icons/compressed.gif) | microbiology-with-di..> | 2023-05-04 01:57 | 61K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-08-08 14:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-05-03 10:30 | 22K | |
![[ ]](/icons/compressed.gif) | microbiology-with-di..> | 2023-05-03 10:30 | 153K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | microbiology-with-di..> | 2023-05-03 10:46 | 18K | |
![[ ]](/icons/compressed.gif) | microbiology-with-di..> | 2023-05-03 10:46 | 84K | |
![[IMG]](/icons/image2.gif) | microeconomic-theory..> | 2023-08-05 15:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | microeconomic-theory..> | 2023-08-17 08:45 | 17K | |
![[IMG]](/icons/image2.gif) | microeconomic-theory..> | 2023-05-03 10:28 | 45K | |
![[ ]](/icons/compressed.gif) | microeconomic-theory..> | 2023-05-03 10:28 | 31K | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-08-06 11:18 | 2.9K | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-08-17 08:45 | 13K | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-05-03 10:24 | 50K | |
![[ ]](/icons/compressed.gif) | microeconomics-6th-e..> | 2023-05-03 10:24 | 2.4M | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-08-09 10:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-08-08 16:42 | 13K | |
![[IMG]](/icons/image2.gif) | microeconomics-6th-e..> | 2023-05-03 09:29 | 40K | |
![[ ]](/icons/compressed.gif) | microeconomics-6th-e..> | 2023-05-03 09:29 | 1.0M | |
![[IMG]](/icons/image2.gif) | microeconomics-8th-e..> | 2023-08-05 06:25 | 2.4K | |
![[IMG]](/icons/image2.gif) | microeconomics-8th-e..> | 2023-08-17 08:45 | 20K | |
![[IMG]](/icons/image2.gif) | microeconomics-8th-e..> | 2023-05-03 10:04 | 85K | |
![[ ]](/icons/compressed.gif) | microeconomics-8th-e..> | 2023-05-03 10:04 | 4.5M | |
![[IMG]](/icons/image2.gif) | microeconomics-21st-..> | 2023-08-05 04:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | microeconomics-21st-..> | 2023-05-04 02:02 | 20K | |
![[ ]](/icons/compressed.gif) | microeconomics-21st-..> | 2023-05-04 02:02 | 692K | |
![[IMG]](/icons/image2.gif) | microeconomics-100x1..> | 2023-08-05 01:52 | 2.4K | |
![[IMG]](/icons/image2.gif) | microeconomics-300x3..> | 2023-09-27 19:59 | 11K | |
![[IMG]](/icons/image2.gif) | microeconomics-boyes..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | microeconomics-boyes..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/compressed.gif) | microeconomics-boyes..> | 2023-05-03 09:19 | 25K | |
![[IMG]](/icons/image2.gif) | microeconomics-canad..> | 2023-08-06 01:47 | 3.7K | |
![[IMG]](/icons/image2.gif) | microeconomics-canad..> | 2023-08-08 16:42 | 18K | |
![[IMG]](/icons/image2.gif) | microeconomics-canad..> | 2023-05-03 10:23 | 57K | |
![[ ]](/icons/compressed.gif) | microeconomics-canad..> | 2023-05-03 10:23 | 406K | |
![[IMG]](/icons/image2.gif) | microeconomics-canad..> | 2023-08-05 20:19 | 2.5K | |
![[IMG]](/icons/image2.gif) | microeconomics-canad..> | 2023-05-03 09:57 | 17K | |
![[ ]](/icons/compressed.gif) | microeconomics-canad..> | 2023-05-03 09:57 | 383K | |
![[IMG]](/icons/image2.gif) | microeconomics-colan..> | 2023-08-05 05:29 | 2.2K | |
![[IMG]](/icons/image2.gif) | microeconomics-colan..> | 2023-05-03 09:35 | 11K | |
![[ ]](/icons/compressed.gif) | microeconomics-colan..> | 2023-05-03 09:35 | 424K | |
![[IMG]](/icons/image2.gif) | microeconomics-conte..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | microeconomics-conte..> | 2023-08-08 16:42 | 22K | |
![[IMG]](/icons/image2.gif) | microeconomics-conte..> | 2023-05-03 11:00 | 54K | |
![[IMG]](/icons/image2.gif) | microeconomics-hubba..> | 2023-08-07 21:41 | 2.1K | |
![[IMG]](/icons/image2.gif) | microeconomics-hubba..> | 2023-05-04 01:53 | 9.8K | |
![[ ]](/icons/compressed.gif) | microeconomics-hubba..> | 2023-05-04 01:53 | 238K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-08-05 02:31 | 3.9K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-08-17 08:45 | 21K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-05-03 10:17 | 53K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-08-08 16:42 | 21K | |
![[IMG]](/icons/image2.gif) | microeconomics-intui..> | 2023-05-03 11:08 | 54K | |
![[ ]](/icons/compressed.gif) | microeconomics-intui..> | 2023-05-03 11:08 | 49K | |
![[IMG]](/icons/image2.gif) | microeconomics-james..> | 2023-08-05 05:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | microeconomics-james..> | 2023-05-03 10:37 | 20K | |
![[ ]](/icons/compressed.gif) | microeconomics-james..> | 2023-05-03 10:37 | 151K | |
![[ ]](/icons/compressed.gif) | microeconomics-krugm..> | 2023-05-03 09:19 | 1.5M | |
![[IMG]](/icons/image2.gif) | microeconomics-mccon..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | microeconomics-mccon..> | 2023-05-03 11:17 | 19K | |
![[ ]](/icons/compressed.gif) | microeconomics-mccon..> | 2023-05-03 11:17 | 1.0M | |
![[IMG]](/icons/image2.gif) | microeconomics-parki..> | 2023-08-05 01:56 | 2.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-parki..> | 2023-05-03 10:43 | 15K | |
![[ ]](/icons/compressed.gif) | microeconomics-parki..> | 2023-05-03 10:43 | 1.4M | |
![[IMG]](/icons/image2.gif) | microeconomics-pindy..> | 2023-05-03 10:13 | 9.7K | |
![[IMG]](/icons/image2.gif) | microeconomics-pindy..> | 2023-05-03 10:07 | 9.7K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-08-06 08:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-05-03 10:02 | 19K | |
![[ ]](/icons/compressed.gif) | microeconomics-princ..> | 2023-05-03 10:02 | 45K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-08-05 03:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-08-08 16:42 | 14K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-05-03 09:42 | 37K | |
![[ ]](/icons/compressed.gif) | microeconomics-princ..> | 2023-05-03 09:41 | 508K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-08-08 22:02 | 2.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-05-03 10:26 | 9.0K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-08-05 14:37 | 2.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-princ..> | 2023-05-03 10:30 | 9.0K | |
![[IMG]](/icons/image2.gif) | microeconomics-publi..> | 2023-08-06 07:48 | 2.2K | |
![[IMG]](/icons/image2.gif) | microeconomics-publi..> | 2023-05-03 11:09 | 17K | |
![[ ]](/icons/compressed.gif) | microeconomics-publi..> | 2023-05-03 11:09 | 37K | |
![[IMG]](/icons/image2.gif) | microeconomics-ragan..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | microeconomics-ragan..> | 2023-05-03 10:38 | 28K | |
![[ ]](/icons/compressed.gif) | microeconomics-ragan..> | 2023-05-03 10:38 | 308K | |
![[IMG]](/icons/image2.gif) | microeconomics-the-p..> | 2023-08-05 21:05 | 3.0K | |
![[IMG]](/icons/image2.gif) | microeconomics-the-p..> | 2023-05-03 11:18 | 14K | |
![[IMG]](/icons/image2.gif) | microeconomics-today..> | 2023-08-08 10:02 | 2.9K | |
![[IMG]](/icons/image2.gif) | microeconomics-today..> | 2023-08-17 08:45 | 14K | |
![[IMG]](/icons/image2.gif) | microeconomics-today..> | 2023-05-03 10:58 | 38K | |
![[ ]](/icons/compressed.gif) | microeconomics-today..> | 2023-05-03 10:58 | 3.1M | |
![[IMG]](/icons/image2.gif) | microeconomics.jpg | 2023-05-03 10:21 | 41K | |
![[IMG]](/icons/image2.gif) | miller-business_law_..> | 2023-05-03 10:20 | 40K | |
![[ ]](/icons/compressed.gif) | mirror-for-humanity-..> | 2023-05-03 09:37 | 148K | |
![[IMG]](/icons/image2.gif) | mirror-for-humanity-..> | 2023-08-05 16:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | mirror-for-humanity-..> | 2023-05-03 09:37 | 20K | |
![[IMG]](/icons/image2.gif) | mis-essentials-kroen..> | 2023-08-05 14:38 | 2.4K | |
![[IMG]](/icons/image2.gif) | mis-essentials-kroen..> | 2023-05-03 10:49 | 13K | |
![[ ]](/icons/compressed.gif) | mis-essentials-kroen..> | 2023-05-03 10:49 | 11K | |
![[ ]](/icons/unknown.gif) | mishkin_economics_7c..> | 2023-05-04 02:20 | 115K | |
![[ ]](/icons/unknown.gif) | mishkin_economics_7c..> | 2023-05-04 02:08 | 115K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-08-05 03:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-08-20 21:43 | 21K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-05-03 09:40 | 56K | |
![[ ]](/icons/compressed.gif) | mktg-9th-edition-lam..> | 2023-05-03 09:40 | 454K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-08-06 07:07 | 4.1K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-08-08 16:42 | 21K | |
![[IMG]](/icons/image2.gif) | mktg-9th-edition-lam..> | 2023-05-03 09:53 | 56K | |
![[ ]](/icons/compressed.gif) | mktg-9th-edition-lam..> | 2023-05-03 09:53 | 875K | |
![[IMG]](/icons/image2.gif) | mktg-lamb-2nd-canadi..> | 2023-08-08 15:50 | 3.4K | |
![[IMG]](/icons/image2.gif) | mktg-lamb-2nd-canadi..> | 2023-05-03 10:37 | 21K | |
![[ ]](/icons/compressed.gif) | mktg-lamb-2nd-canadi..> | 2023-05-03 10:36 | 46K | |
![[ ]](/icons/compressed.gif) | mktg-lamb-4th-tb.zip | 2023-05-03 13:44 | 46K | |
![[IMG]](/icons/image2.gif) | mktg-lamb-7th-tb-100..> | 2023-08-06 03:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | mktg-lamb-7th-tb.jpg | 2023-05-03 10:35 | 21K | |
![[ ]](/icons/compressed.gif) | mktg-lamb-7th-tb.zip | 2023-05-03 10:35 | 10K | |
![[IMG]](/icons/image2.gif) | mm-iacobucci-4th-tb-..> | 2023-08-05 02:08 | 3.0K | |
![[IMG]](/icons/image2.gif) | mm-iacobucci-4th-tb.jpg | 2023-05-03 09:52 | 16K | |
![[ ]](/icons/compressed.gif) | mm-iacobucci-4th-tb.zip | 2023-05-03 09:52 | 21K | |
![[IMG]](/icons/image2.gif) | mobility-in-context-..> | 2023-08-06 12:18 | 3.2K | |
![[IMG]](/icons/image2.gif) | mobility-in-context-..> | 2023-05-03 10:58 | 18K | |
![[ ]](/icons/compressed.gif) | mobility-in-context-..> | 2023-05-03 10:58 | 6.9K | |
![[IMG]](/icons/image2.gif) | modern-advanced-acco..> | 2023-08-06 13:04 | 3.8K | |
![[IMG]](/icons/image2.gif) | modern-advanced-acco..> | 2023-08-08 17:46 | 22K | |
![[IMG]](/icons/image2.gif) | modern-advanced-acco..> | 2023-05-03 10:14 | 52K | |
![[ ]](/icons/compressed.gif) | modern-advanced-acco..> | 2023-05-03 10:14 | 255K | |
![[IMG]](/icons/image2.gif) | modern-control-syste..> | 2023-08-08 07:31 | 2.3K | |
![[IMG]](/icons/image2.gif) | modern-control-syste..> | 2023-08-12 04:51 | 12K | |
![[IMG]](/icons/image2.gif) | modern-control-syste..> | 2023-05-03 09:37 | 41K | |
![[ ]](/icons/compressed.gif) | modern-control-syste..> | 2023-05-03 09:37 | 899K | |
![[IMG]](/icons/image2.gif) | modern-dental-assist..> | 2023-08-08 06:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | modern-dental-assist..> | 2023-05-03 10:27 | 17K | |
![[IMG]](/icons/image2.gif) | modern-management-co..> | 2023-08-05 03:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | modern-management-co..> | 2023-05-03 10:31 | 15K | |
![[ ]](/icons/compressed.gif) | modern-management-co..> | 2023-05-03 10:31 | 21K | |
![[IMG]](/icons/image2.gif) | modern-marketing-res..> | 2023-08-05 15:35 | 2.5K | |
![[IMG]](/icons/image2.gif) | modern-marketing-res..> | 2023-08-12 04:51 | 16K | |
![[IMG]](/icons/image2.gif) | modern-marketing-res..> | 2023-05-03 11:07 | 47K | |
![[ ]](/icons/compressed.gif) | modern-marketing-res..> | 2023-05-03 11:07 | 364K | |
![[IMG]](/icons/image2.gif) | modern-marketing-res..> | 2023-08-05 09:32 | 2.3K | |
![[IMG]](/icons/image2.gif) | modern-marketing-res..> | 2023-05-03 10:40 | 15K | |
![[ ]](/icons/compressed.gif) | modern-marketing-res..> | 2023-05-03 10:40 | 24K | |
![[IMG]](/icons/image2.gif) | modern-principles-mi..> | 2023-08-06 01:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | modern-principles-mi..> | 2023-05-03 10:13 | 19K | |
![[IMG]](/icons/image2.gif) | molecular-biology-of..> | 2023-08-05 02:47 | 2.7K | |
![[IMG]](/icons/image2.gif) | molecular-biology-of..> | 2023-05-03 10:44 | 19K | |
![[ ]](/icons/compressed.gif) | molecular-biology-of..> | 2023-05-03 10:44 | 144K | |
![[IMG]](/icons/image2.gif) | molecular-biology-pr..> | 2023-08-05 03:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | molecular-biology-pr..> | 2023-05-03 09:42 | 27K | |
![[IMG]](/icons/image2.gif) | molecular-biology-ro..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | molecular-biology-ro..> | 2023-05-03 10:36 | 28K | |
![[ ]](/icons/compressed.gif) | molecular-biology-ro..> | 2023-05-03 10:36 | 11K | |
![[ ]](/icons/compressed.gif) | molecular-cell-biolo..> | 2023-05-03 09:18 | 17K | |
![[IMG]](/icons/image2.gif) | molecular-diagnostic..> | 2023-08-05 06:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | molecular-diagnostic..> | 2023-05-03 09:43 | 18K | |
![[ ]](/icons/compressed.gif) | molecular-diagnostic..> | 2023-05-03 09:43 | 8.8K | |
![[IMG]](/icons/image2.gif) | money-banking-and-fi..> | 2023-08-09 07:04 | 2.2K | |
![[IMG]](/icons/image2.gif) | money-banking-and-fi..> | 2023-05-03 09:20 | 14K | |
![[ ]](/icons/compressed.gif) | money-banking-and-fi..> | 2023-05-03 09:20 | 10K | |
![[ ]](/icons/compressed.gif) | money-banking-and-th..> | 2023-05-03 09:28 | 16K | |
![[IMG]](/icons/image2.gif) | money-banking-financ..> | 2023-08-06 11:16 | 4.2K | |
![[IMG]](/icons/image2.gif) | money-banking-financ..> | 2023-08-08 17:46 | 26K | |
![[IMG]](/icons/image2.gif) | money-banking-financ..> | 2023-05-03 10:18 | 67K | |
![[ ]](/icons/compressed.gif) | money-banking-financ..> | 2023-05-03 10:18 | 70K | |
![[IMG]](/icons/image2.gif) | mosby-s-guide-to-phy..> | 2023-08-05 02:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | mosby-s-guide-to-phy..> | 2023-05-03 10:44 | 16K | |
![[IMG]](/icons/image2.gif) | mosbys-guide-to-phys..> | 2023-08-07 05:29 | 2.6K | |
![[IMG]](/icons/image2.gif) | mosbys-guide-to-phys..> | 2023-05-03 10:45 | 14K | |
![[ ]](/icons/compressed.gif) | mosbys-guide-to-phys..> | 2023-05-03 10:45 | 21K | |
![[ ]](/icons/compressed.gif) | mosbys-guide-to-phys..> | 2023-05-03 10:44 | 694K | |
![[IMG]](/icons/image2.gif) | mosbys-paramedic-tex..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | mosbys-paramedic-tex..> | 2023-05-03 10:41 | 22K | |
![[ ]](/icons/compressed.gif) | mosbys-paramedic-tex..> | 2023-05-03 10:41 | 18K | |
![[IMG]](/icons/image2.gif) | mosbys-paramedic-tex..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | mosbys-paramedic-tex..> | 2023-05-03 09:44 | 16K | |
![[ ]](/icons/compressed.gif) | mosbys-paramedic-tex..> | 2023-05-03 09:43 | 17K | |
![[IMG]](/icons/image2.gif) | mosbys-pharmacology-..> | 2023-08-05 06:25 | 2.7K | |
![[IMG]](/icons/image2.gif) | mosbys-pharmacology-..> | 2023-05-03 10:08 | 15K | |
![[ ]](/icons/compressed.gif) | motiwalla_esm2e_tif_..> | 2023-05-03 10:17 | 16K | |
![[IMG]](/icons/image2.gif) | mpVdDcF3YLEllQ2tQRiS..> | 2023-08-05 14:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | mpVdDcF3YLEllQ2tQRiS..> | 2023-09-04 21:53 | 25K | |
![[IMG]](/icons/image2.gif) | mpVdDcF3YLEllQ2tQRiS..> | 2023-05-03 10:39 | 61K | |
![[IMG]](/icons/image2.gif) | mr-brown-2nd-tb-100x..> | 2023-08-06 09:44 | 3.1K | |
![[IMG]](/icons/image2.gif) | mr-brown-2nd-tb.jpg | 2023-05-03 10:37 | 15K | |
![[ ]](/icons/compressed.gif) | mr-brown-2nd-tb.zip | 2023-05-03 10:37 | 4.7K | |
![[IMG]](/icons/image2.gif) | mr11-100x100.jpg | 2023-08-05 01:27 | 75K | |
![[IMG]](/icons/image2.gif) | mr11-300x300.jpg | 2023-08-18 03:24 | 89K | |
![[IMG]](/icons/image2.gif) | mr11.jpg | 2023-05-03 10:39 | 311K | |
![[IMG]](/icons/image2.gif) | multinational-busine..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | multinational-busine..> | 2023-08-08 17:46 | 21K | |
![[IMG]](/icons/image2.gif) | multinational-busine..> | 2023-05-03 10:23 | 82K | |
![[ ]](/icons/compressed.gif) | multinational-busine..> | 2023-05-03 10:23 | 55K | |
![[IMG]](/icons/image2.gif) | multinational-busine..> | 2023-05-03 10:08 | 11K | |
![[IMG]](/icons/image2.gif) | multinational-financ..> | 2023-08-06 05:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | multinational-financ..> | 2023-08-12 04:51 | 22K | |
![[IMG]](/icons/image2.gif) | multinational-financ..> | 2023-05-03 09:24 | 33K | |
![[ ]](/icons/compressed.gif) | multinational-financ..> | 2023-05-03 09:24 | 329K | |
![[IMG]](/icons/image2.gif) | multinational-manage..> | 2023-08-05 06:25 | 14K | |
![[IMG]](/icons/image2.gif) | multinational-manage..> | 2023-05-03 11:22 | 39K | |
![[IMG]](/icons/image2.gif) | multivariable-calcul..> | 2023-08-05 16:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | multivariable-calcul..> | 2023-05-03 10:28 | 6.2K | |
![[IMG]](/icons/image2.gif) | multivariable-calcul..> | 2023-08-05 04:17 | 2.7K | |
![[IMG]](/icons/image2.gif) | multivariable-calcul..> | 2023-05-03 09:51 | 6.2K | |
![[ ]](/icons/unknown.gif) | murphy01_im.doc | 2023-05-03 09:25 | 66K | |
![[ ]](/icons/compressed.gif) | music-an-appreciatio..> | 2023-05-03 10:36 | 148K | |
![[ ]](/icons/compressed.gif) | music-an-appreciatio..> | 2023-05-03 09:24 | 113K | |
![[IMG]](/icons/image2.gif) | music-an-appreciatio..> | 2023-08-05 16:24 | 2.7K | |
![[IMG]](/icons/image2.gif) | music-an-appreciatio..> | 2023-05-03 09:24 | 8.1K | |
![[IMG]](/icons/image2.gif) | music-an-appreciatio..> | 2023-08-05 08:50 | 2.6K | |
![[IMG]](/icons/image2.gif) | music-an-appreciatio..> | 2023-05-03 10:36 | 7.8K | |
![[ ]](/icons/compressed.gif) | myers-psychology-for..> | 2023-05-03 10:37 | 340K | |
![[IMG]](/icons/image2.gif) | myers-psychology-for..> | 2023-08-05 01:54 | 3.3K | |
![[IMG]](/icons/image2.gif) | myers-psychology-for..> | 2023-05-03 10:37 | 23K | |
![[ ]](/icons/layout.gif) | nT1Answers_Solutions..> | 2023-05-03 09:40 | 145K | |
![[ ]](/icons/unknown.gif) | nash_8e_tb_ch01.doc | 2023-05-04 01:49 | 77K | |
![[ ]](/icons/unknown.gif) | nash_im_ch14.doc | 2023-05-03 13:44 | 50K | |
![[IMG]](/icons/image2.gif) | nature-mathematics-1..> | 2023-08-05 02:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | nature-mathematics-1..> | 2023-08-12 04:51 | 16K | |
![[IMG]](/icons/image2.gif) | nature-mathematics-1..> | 2023-05-03 11:19 | 39K | |
![[ ]](/icons/compressed.gif) | nature-mathematics-1..> | 2023-05-03 11:19 | 1.2M | |
![[IMG]](/icons/image2.gif) | negotiation-7th-edit..> | 2023-08-05 01:27 | 1.8K | |
![[IMG]](/icons/image2.gif) | negotiation-7th-edit..> | 2023-08-12 04:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | negotiation-7th-edit..> | 2023-05-03 10:34 | 25K | |
![[ ]](/icons/compressed.gif) | negotiation-7th-edit..> | 2023-05-03 10:34 | 269K | |
![[ ]](/icons/unknown.gif) | nester4e_case1.doc | 2023-05-04 01:50 | 26K | |
![[ ]](/icons/compressed.gif) | neuroscience-explori..> | 2023-05-03 09:32 | 7.9K | |
![[IMG]](/icons/image2.gif) | new-perspectives-on-..> | 2023-08-05 01:09 | 2.2K | |
![[IMG]](/icons/image2.gif) | new-perspectives-on-..> | 2023-05-03 09:40 | 11K | |
![[IMG]](/icons/image2.gif) | new-society-brym-6th..> | 2023-08-05 19:00 | 4.1K | |
![[IMG]](/icons/image2.gif) | new-society-brym-6th..> | 2023-05-03 09:28 | 24K | |
![[ ]](/icons/compressed.gif) | new-society-brym-6th..> | 2023-05-03 09:28 | 29K | |
![[ ]](/icons/compressed.gif) | new-venture-creation..> | 2023-05-03 13:42 | 426K | |
![[ ]](/icons/compressed.gif) | nick_6ce_tif_ch02.zip | 2023-05-03 10:50 | 16K | |
![[ ]](/icons/unknown.gif) | nintphil2_Ch01.docx | 2023-05-03 13:42 | 30K | |
![[IMG]](/icons/image2.gif) | nm2.jpg | 2023-05-04 02:19 | 7.7K | |
![[ ]](/icons/unknown.gif) | nobles_acct10_tif_01..> | 2023-05-03 09:34 | 182K | |
![[ ]](/icons/unknown.gif) | nobles_acctg10_Ch01_..> | 2023-05-03 10:35 | 402K | |
![[ ]](/icons/unknown.gif) | nobles_finman6e_sm_C..> | 2023-05-03 11:07 | 308K | |
![[ ]](/icons/compressed.gif) | noe_fhrm_8e_word_fil..> | 2023-05-03 14:00 | 73K | |
![[IMG]](/icons/image2.gif) | nonprofit4th-100x100..> | 2023-08-05 05:30 | 3.8K | |
![[IMG]](/icons/image2.gif) | nonprofit4th.jpg | 2023-05-03 10:41 | 31K | |
![[IMG]](/icons/image2.gif) | novel-approach-to-po..> | 2023-08-05 16:28 | 4.5K | |
![[IMG]](/icons/image2.gif) | novel-approach-to-po..> | 2023-08-11 12:04 | 23K | |
![[IMG]](/icons/image2.gif) | novel-approach-to-po..> | 2023-05-03 09:55 | 36K | |
![[ ]](/icons/compressed.gif) | novel-approach-to-po..> | 2023-05-03 09:55 | 31K | |
![[IMG]](/icons/image2.gif) | nuclear-medicine-and..> | 2023-08-08 08:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | nuclear-medicine-and..> | 2023-05-03 10:24 | 17K | |
![[ ]](/icons/compressed.gif) | nursing-a-concept-ba..> | 2023-05-03 13:40 | 20K | |
![[IMG]](/icons/image2.gif) | nursing-a-conceptbas..> | 2023-08-06 10:17 | 15K | |
![[IMG]](/icons/image2.gif) | nursing-a-conceptbas..> | 2023-05-03 10:13 | 43K | |
![[IMG]](/icons/image2.gif) | nursing-assistant-a-..> | 2023-08-05 06:23 | 3.2K | |
![[IMG]](/icons/image2.gif) | nursing-assistant-a-..> | 2023-05-03 09:45 | 16K | |
![[ ]](/icons/compressed.gif) | nursing-assistant-a-..> | 2023-05-03 09:45 | 7.2K | |
![[IMG]](/icons/image2.gif) | nursing-care-at-the-..> | 2023-08-05 17:22 | 2.1K | |
![[IMG]](/icons/image2.gif) | nursing-care-at-the-..> | 2023-05-03 10:42 | 12K | |
![[ ]](/icons/compressed.gif) | nursing-care-at-the-..> | 2023-05-03 10:42 | 17K | |
![[IMG]](/icons/image2.gif) | nursing-care-of-chil..> | 2023-08-05 04:35 | 2.5K | |
![[IMG]](/icons/image2.gif) | nursing-care-of-chil..> | 2023-05-03 09:23 | 16K | |
![[ ]](/icons/compressed.gif) | nursing-care-of-chil..> | 2023-05-03 09:23 | 95K | |
![[IMG]](/icons/image2.gif) | nursing-for-wellness..> | 2023-08-05 03:41 | 13K | |
![[IMG]](/icons/image2.gif) | nursing-for-wellness..> | 2023-05-03 10:41 | 34K | |
![[IMG]](/icons/image2.gif) | nursing-for-wellness..> | 2023-08-06 15:32 | 12K | |
![[IMG]](/icons/image2.gif) | nursing-for-wellness..> | 2023-05-03 10:19 | 31K | |
![[IMG]](/icons/image2.gif) | nursing-health-asses..> | 2023-08-06 03:58 | 3.7K | |
![[IMG]](/icons/image2.gif) | nursing-health-asses..> | 2023-05-03 10:24 | 24K | |
![[ ]](/icons/compressed.gif) | nursing-health-asses..> | 2023-05-03 10:24 | 4.5K | |
![[IMG]](/icons/image2.gif) | nursing-in-todays-wo..> | 2023-08-05 05:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | nursing-in-todays-wo..> | 2023-05-03 10:32 | 11K | |
![[IMG]](/icons/image2.gif) | nursing-leadership-a..> | 2023-08-05 14:40 | 3.6K | |
![[IMG]](/icons/image2.gif) | nursing-leadership-a..> | 2023-05-03 11:23 | 12K | |
![[ ]](/icons/compressed.gif) | nursing-leadership-a..> | 2023-05-03 11:23 | 19K | |
![[IMG]](/icons/image2.gif) | nursing-research-gen..> | 2023-08-05 14:37 | 12K | |
![[IMG]](/icons/image2.gif) | nursing-research-gen..> | 2023-05-03 10:15 | 30K | |
![[IMG]](/icons/image2.gif) | nursing-research-in-..> | 2023-08-06 07:49 | 2.6K | |
![[IMG]](/icons/image2.gif) | nursing-research-in-..> | 2023-05-03 10:27 | 17K | |
![[IMG]](/icons/image2.gif) | nursing-research-in-..> | 2023-08-06 07:48 | 3.2K | |
![[IMG]](/icons/image2.gif) | nursing-research-in-..> | 2023-05-03 09:41 | 20K | |
![[IMG]](/icons/image2.gif) | nursing-research-met..> | 2023-08-05 05:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | nursing-research-met..> | 2023-05-04 02:21 | 16K | |
![[IMG]](/icons/image2.gif) | nursing-test-bank-in..> | 2023-08-06 15:32 | 3.2K | |
![[IMG]](/icons/image2.gif) | nursing-test-bank-in..> | 2023-08-11 12:04 | 15K | |
![[IMG]](/icons/image2.gif) | nursing-test-bank-in..> | 2023-05-03 09:46 | 29K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks-4..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks-4..> | 2023-08-14 03:16 | 16K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks-4..> | 2023-05-03 10:33 | 60K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks24..> | 2023-08-07 13:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks24..> | 2023-08-13 04:19 | 12K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks24..> | 2023-05-04 01:53 | 30K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks38..> | 2023-08-05 01:08 | 3.1K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks38..> | 2023-05-03 10:03 | 3.5K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks61..> | 2023-08-05 05:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | nursing-test-banks61..> | 2023-05-03 09:24 | 7.9K | |
![[IMG]](/icons/image2.gif) | nursing-today-transi..> | 2023-08-05 04:35 | 3.1K | |
![[IMG]](/icons/image2.gif) | nursing-today-transi..> | 2023-05-03 10:43 | 7.5K | |
![[IMG]](/icons/image2.gif) | nutr-mcguire-1st-tb-..> | 2023-08-06 08:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | nutr-mcguire-1st-tb.jpg | 2023-05-04 02:05 | 27K | |
![[ ]](/icons/compressed.gif) | nutr-mcguire-1st-tb.zip | 2023-05-04 02:05 | 12K | |
![[ ]](/icons/compressed.gif) | nutrition-and-diet-t..> | 2023-05-03 10:14 | 22K | |
![[IMG]](/icons/image2.gif) | nutrition-and-diet-t..> | 2023-08-05 01:51 | 4.2K | |
![[IMG]](/icons/image2.gif) | nutrition-and-diet-t..> | 2023-05-03 10:31 | 29K | |
![[ ]](/icons/compressed.gif) | nutrition-and-diet-t..> | 2023-05-03 10:31 | 17K | |
![[IMG]](/icons/image2.gif) | nutrition-and-diet-t..> | 2023-08-05 04:44 | 3.7K | |
![[IMG]](/icons/image2.gif) | nutrition-and-diet-t..> | 2023-05-03 10:23 | 23K | |
![[ ]](/icons/compressed.gif) | nutrition-and-diet-t..> | 2023-05-03 10:23 | 16K | |
![[IMG]](/icons/image2.gif) | nutrition-applied-ap..> | 2023-08-06 08:44 | 3.5K | |
![[IMG]](/icons/image2.gif) | nutrition-applied-ap..> | 2023-08-11 12:04 | 21K | |
![[IMG]](/icons/image2.gif) | nutrition-applied-ap..> | 2023-05-04 02:01 | 97K | |
![[ ]](/icons/compressed.gif) | nutrition-applied-ap..> | 2023-05-04 02:01 | 325K | |
![[IMG]](/icons/image2.gif) | nutrition-diet-thera..> | 2023-08-05 03:39 | 3.5K | |
![[IMG]](/icons/image2.gif) | nutrition-diet-thera..> | 2023-08-11 12:04 | 17K | |
![[IMG]](/icons/image2.gif) | nutrition-diet-thera..> | 2023-05-03 11:06 | 42K | |
![[ ]](/icons/compressed.gif) | nutrition-diet-thera..> | 2023-05-03 11:06 | 57K | |
![[IMG]](/icons/image2.gif) | nutrition-diet-thera..> | 2023-08-06 20:55 | 4.7K | |
![[IMG]](/icons/image2.gif) | nutrition-diet-thera..> | 2023-05-03 10:00 | 31K | |
![[ ]](/icons/compressed.gif) | nutrition-diet-thera..> | 2023-05-03 09:59 | 10K | |
![[IMG]](/icons/image2.gif) | nutrition-essentials..> | 2023-08-06 05:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | nutrition-essentials..> | 2023-05-03 11:11 | 17K | |
![[ ]](/icons/compressed.gif) | nutrition-essentials..> | 2023-05-03 10:22 | 654K | |
![[IMG]](/icons/image2.gif) | nutrition-essentials..> | 2023-08-05 16:24 | 2.9K | |
![[IMG]](/icons/image2.gif) | nutrition-essentials..> | 2023-05-03 10:22 | 14K | |
![[IMG]](/icons/image2.gif) | nutrition-for-health..> | 2023-08-06 08:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | nutrition-for-health..> | 2023-05-03 10:00 | 17K | |
![[ ]](/icons/compressed.gif) | nutrition-for-health..> | 2023-05-03 10:00 | 17K | |
![[IMG]](/icons/image2.gif) | nutrition-for-life-j..> | 2023-08-06 13:03 | 3.3K | |
![[IMG]](/icons/image2.gif) | nutrition-for-life-j..> | 2023-05-03 10:31 | 20K | |
![[ ]](/icons/compressed.gif) | nutrition-for-life-j..> | 2023-05-03 10:31 | 16K | |
![[IMG]](/icons/image2.gif) | nutrition-from-scien..> | 2023-08-06 13:05 | 3.1K | |
![[IMG]](/icons/image2.gif) | nutrition-from-scien..> | 2023-05-03 09:41 | 17K | |
![[ ]](/icons/compressed.gif) | nutrition-from-scien..> | 2023-05-03 09:41 | 19K | |
![[IMG]](/icons/image2.gif) | nutrition-through-th..> | 2023-08-05 03:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | nutrition-through-th..> | 2023-05-03 09:35 | 14K | |
![[ ]](/icons/compressed.gif) | nutrition-through-th..> | 2023-05-03 09:35 | 22K | |
![[IMG]](/icons/image2.gif) | nutrition-your-life-..> | 2023-08-05 14:39 | 4.1K | |
![[IMG]](/icons/image2.gif) | nutrition-your-life-..> | 2023-05-03 09:34 | 25K | |
![[ ]](/icons/compressed.gif) | nutrition-your-life-..> | 2023-05-03 09:34 | 51K | |
![[IMG]](/icons/image2.gif) | nutritional-foundati..> | 2023-08-05 02:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | nutritional-foundati..> | 2023-05-03 11:04 | 20K | |
![[IMG]](/icons/image2.gif) | nutritional-sciences..> | 2023-08-06 10:16 | 4.4K | |
![[IMG]](/icons/image2.gif) | nutritional-sciences..> | 2023-05-03 09:52 | 30K | |
![[ ]](/icons/compressed.gif) | nutritional-sciences..> | 2023-05-03 09:52 | 90K | |
![[IMG]](/icons/image2.gif) | occupational-therapy..> | 2023-08-06 10:15 | 3.8K | |
![[IMG]](/icons/image2.gif) | occupational-therapy..> | 2023-05-03 11:23 | 18K | |
![[IMG]](/icons/image2.gif) | oceanography-invitat..> | 2023-08-05 01:52 | 2.3K | |
![[IMG]](/icons/image2.gif) | oceanography-invitat..> | 2023-08-15 05:42 | 11K | |
![[IMG]](/icons/image2.gif) | oceanography-invitat..> | 2023-05-03 10:26 | 27K | |
![[ ]](/icons/compressed.gif) | oceanography-invitat..> | 2023-05-03 10:26 | 144K | |
![[IMG]](/icons/image2.gif) | olds-maternal-newbor..> | 2023-08-06 05:46 | 2.9K | |
![[IMG]](/icons/image2.gif) | olds-maternal-newbor..> | 2023-05-03 09:43 | 8.7K | |
![[IMG]](/icons/image2.gif) | olds-maternal-newbor..> | 2023-08-06 05:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | olds-maternal-newbor..> | 2023-05-04 01:47 | 24K | |
![[ ]](/icons/compressed.gif) | olds-maternal-newbor..> | 2023-05-04 01:47 | 91K | |
![[ ]](/icons/compressed.gif) | olds-maternal-newbor..> | 2023-05-03 09:43 | 26K | |
![[IMG]](/icons/image2.gif) | om-6th-edition-colli..> | 2023-08-05 14:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | om-6th-edition-colli..> | 2023-08-15 05:42 | 14K | |
![[IMG]](/icons/image2.gif) | om-6th-edition-colli..> | 2023-05-03 10:00 | 36K | |
![[ ]](/icons/compressed.gif) | om-6th-edition-colli..> | 2023-05-03 10:00 | 35K | |
![[IMG]](/icons/image2.gif) | om-collier-3rd-tb-10..> | 2023-08-06 11:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | om-collier-3rd-tb.jpg | 2023-05-04 01:47 | 21K | |
![[ ]](/icons/compressed.gif) | om-collier-3rd-tb.zip | 2023-05-04 01:47 | 21K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-08-05 04:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-08-16 00:25 | 18K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-05-03 10:58 | 50K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-08-06 12:09 | 3.3K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-08-15 01:39 | 18K | |
![[IMG]](/icons/image2.gif) | ontemporary-project-..> | 2023-05-03 10:58 | 50K | |
![[ ]](/icons/compressed.gif) | operating-systems-in..> | 2023-05-03 09:06 | 9.7K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-08-05 16:23 | 3.1K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-05-03 10:31 | 19K | |
![[ ]](/icons/compressed.gif) | operations-and-suppl..> | 2023-05-03 10:31 | 16K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-08-05 14:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-05-03 10:25 | 7.5K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-08-08 07:18 | 3.2K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-05-03 09:59 | 7.5K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-08-06 08:46 | 3.1K | |
![[IMG]](/icons/image2.gif) | operations-and-suppl..> | 2023-05-03 09:52 | 19K | |
![[ ]](/icons/compressed.gif) | operations-and-suppl..> | 2023-05-03 09:52 | 54K | |
![[ ]](/icons/layout.gif) | operations-managemen..> | 2023-05-04 02:20 | 87K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-06 05:47 | 3.1K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-15 05:42 | 21K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 09:56 | 36K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 09:56 | 103K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-06 08:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 09:19 | 18K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 09:19 | 17K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:00 | 9.9K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:12 | 9.9K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 09:37 | 12K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 16:23 | 2.7K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:48 | 8.9K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-06 15:35 | 2.7K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 09:37 | 8.9K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 10:55 | 46K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 02:46 | 3.3K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-15 19:49 | 15K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 11:18 | 28K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 11:18 | 4.0M | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-06 09:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-15 19:49 | 15K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:57 | 29K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 10:57 | 236K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 01:13 | 12K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-15 19:49 | 38K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-04 02:29 | 70K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 04:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-15 19:49 | 26K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:10 | 87K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 10:10 | 276K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:56 | 11K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:55 | 11K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 15:29 | 4.5K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-08 07:32 | 26K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:20 | 52K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-05 03:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-08-08 07:32 | 21K | |
![[IMG]](/icons/image2.gif) | operations-managemen..> | 2023-05-03 10:55 | 76K | |
![[ ]](/icons/compressed.gif) | operations-managemen..> | 2023-05-03 10:55 | 729K | |
![[IMG]](/icons/image2.gif) | operations-research-..> | 2023-08-05 01:15 | 3.0K | |
![[IMG]](/icons/image2.gif) | operations-research-..> | 2023-08-08 07:32 | 17K | |
![[IMG]](/icons/image2.gif) | operations-research-..> | 2023-05-03 09:34 | 54K | |
![[ ]](/icons/compressed.gif) | operations-research-..> | 2023-05-03 09:34 | 1.2M | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-08-06 07:45 | 4.8K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-08-08 07:32 | 26K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-05-03 11:13 | 62K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-8t..> | 2023-05-03 11:13 | 740K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-08-05 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-08-08 07:32 | 19K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-8t..> | 2023-05-03 10:40 | 76K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-8t..> | 2023-05-03 10:40 | 179K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-9t..> | 2023-05-03 10:43 | 121K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-08-05 04:19 | 3.5K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-05-03 10:22 | 20K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-br..> | 2023-05-03 10:22 | 513K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-08-05 06:25 | 2.2K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-05-03 09:28 | 6.8K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-08-05 14:38 | 2.6K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-br..> | 2023-05-03 09:48 | 7.6K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-br..> | 2023-05-03 09:48 | 198K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ca..> | 2023-08-07 05:49 | 3.9K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ca..> | 2023-05-03 10:20 | 16K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-cr..> | 2023-08-09 02:51 | 14K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-cr..> | 2023-05-03 09:21 | 39K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ja..> | 2023-08-05 06:19 | 2.9K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ja..> | 2023-05-03 10:56 | 18K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-ja..> | 2023-05-03 10:56 | 111K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ja..> | 2023-08-07 03:48 | 18K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-ja..> | 2023-05-03 10:18 | 46K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-kl..> | 2023-05-03 10:38 | 15K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-kl..> | 2023-05-03 10:38 | 298K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-kl..> | 2023-05-03 09:37 | 619K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-mc..> | 2023-08-08 21:06 | 2.3K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-mc..> | 2023-05-03 11:13 | 9.9K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-mc..> | 2023-05-03 11:13 | 238K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-so..> | 2023-08-05 04:35 | 2.0K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-so..> | 2023-05-03 10:33 | 14K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-so..> | 2023-05-03 10:33 | 163K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-st..> | 2023-05-03 09:18 | 253K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-wa..> | 2023-05-04 02:07 | 673K | |
![[IMG]](/icons/image2.gif) | organic-chemistry-wa..> | 2023-05-03 10:21 | 12K | |
![[ ]](/icons/compressed.gif) | organic-chemistry-wi..> | 2023-05-03 09:28 | 149K | |
![[IMG]](/icons/image2.gif) | organisational-behav..> | 2023-08-08 07:30 | 13K | |
![[IMG]](/icons/image2.gif) | organisational-behav..> | 2023-05-03 09:20 | 32K | |
![[ ]](/icons/compressed.gif) | organisational-behav..> | 2023-05-03 09:20 | 85K | |
![[IMG]](/icons/image2.gif) | organisational-chang..> | 2023-08-05 17:22 | 2.1K | |
![[IMG]](/icons/image2.gif) | organisational-chang..> | 2023-05-03 10:45 | 12K | |
![[ ]](/icons/compressed.gif) | organisational-chang..> | 2023-05-03 10:45 | 16K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 15:22 | 3.2K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:52 | 16K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 09:52 | 19K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 15:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:33 | 21K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 09:33 | 19K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 12:56 | 2.4K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-08 07:32 | 12K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 11:09 | 29K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 11:09 | 490K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 02:45 | 2.1K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-04 02:07 | 7.7K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-04 02:07 | 154K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 01:11 | 4.2K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-08 07:32 | 17K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:30 | 42K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 10:30 | 158K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 08:36 | 3.8K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:30 | 22K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 15:33 | 2.6K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:42 | 18K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 10:42 | 81K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-08 15:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:50 | 19K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 10:50 | 24K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 08:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:11 | 7.9K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 09:43 | 2.5K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:44 | 7.9K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 21:01 | 3.8K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:47 | 24K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 09:47 | 45K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 20:55 | 3.4K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:41 | 20K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 09:41 | 37K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-06 11:17 | 2.0K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 11:14 | 13K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 11:14 | 40K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 04:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-08 07:32 | 15K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 10:29 | 54K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 10:29 | 87K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 15:32 | 3.5K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-04 02:12 | 18K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-04 02:12 | 134K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-05 06:23 | 4.1K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-08-08 07:32 | 23K | |
![[IMG]](/icons/image2.gif) | organizational-behav..> | 2023-05-03 09:39 | 86K | |
![[ ]](/icons/compressed.gif) | organizational-behav..> | 2023-05-03 09:39 | 130K | |
![[IMG]](/icons/image2.gif) | organizational-ethic..> | 2023-08-05 01:12 | 4.0K | |
![[IMG]](/icons/image2.gif) | organizational-ethic..> | 2023-08-11 12:04 | 28K | |
![[IMG]](/icons/image2.gif) | organizational-ethic..> | 2023-05-04 02:22 | 44K | |
![[ ]](/icons/compressed.gif) | organizational-ethic..> | 2023-05-04 02:22 | 26K | |
![[IMG]](/icons/image2.gif) | organizational-theor..> | 2023-05-03 10:46 | 10K | |
![[ ]](/icons/compressed.gif) | organizational-theor..> | 2023-05-03 10:46 | 15K | |
![[IMG]](/icons/image2.gif) | organizations-behavi..> | 2023-08-05 02:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | organizations-behavi..> | 2023-05-03 09:32 | 23K | |
![[ ]](/icons/compressed.gif) | organizations-behavi..> | 2023-05-03 09:32 | 22K | |
![[IMG]](/icons/image2.gif) | orgb-5th-edition-nel..> | 2023-08-06 08:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | orgb-5th-edition-nel..> | 2023-08-11 12:04 | 20K | |
![[IMG]](/icons/image2.gif) | orgb-5th-edition-nel..> | 2023-05-04 01:56 | 51K | |
![[ ]](/icons/compressed.gif) | orgb-5th-edition-nel..> | 2023-05-04 01:56 | 56K | |
![[ ]](/icons/unknown.gif) | ormrod_2ce_tif_ch01.doc | 2023-05-04 01:47 | 67K | |
![[ ]](/icons/compressed.gif) | osp_macro8_im_01.zip | 2023-05-03 09:35 | 169K | |
![[IMG]](/icons/image2.gif) | paralegal-today-lega..> | 2023-08-05 01:51 | 4.4K | |
![[IMG]](/icons/image2.gif) | paralegal-today-lega..> | 2023-08-11 12:04 | 23K | |
![[IMG]](/icons/image2.gif) | paralegal-today-lega..> | 2023-05-03 09:43 | 52K | |
![[ ]](/icons/compressed.gif) | paralegal-today-lega..> | 2023-05-03 09:43 | 67K | |
![[ ]](/icons/compressed.gif) | passer1e_TB_Word_ch1..> | 2023-05-03 11:12 | 127K | |
![[IMG]](/icons/image2.gif) | pathophysiology-a-cl..> | 2023-08-05 06:25 | 14K | |
![[IMG]](/icons/image2.gif) | pathophysiology-a-cl..> | 2023-05-03 09:56 | 39K | |
![[ ]](/icons/compressed.gif) | pathophysiology-a-pr..> | 2023-05-03 10:38 | 11K | |
![[ ]](/icons/compressed.gif) | pathophysiology-conc..> | 2023-05-03 10:20 | 25K | |
![[IMG]](/icons/image2.gif) | pathophysiology-conc..> | 2023-08-07 23:57 | 3.6K | |
![[IMG]](/icons/image2.gif) | pathophysiology-conc..> | 2023-05-03 10:20 | 12K | |
![[IMG]](/icons/image2.gif) | pathophysiology-cops..> | 2023-08-08 06:38 | 3.4K | |
![[IMG]](/icons/image2.gif) | pathophysiology-cops..> | 2023-05-03 10:57 | 17K | |
![[ ]](/icons/compressed.gif) | pathophysiology-cops..> | 2023-05-03 10:57 | 10K | |
![[IMG]](/icons/image2.gif) | pathophysiology-cops..> | 2023-08-05 06:25 | 4.3K | |
![[IMG]](/icons/image2.gif) | pathophysiology-cops..> | 2023-05-03 09:48 | 28K | |
![[ ]](/icons/compressed.gif) | pathophysiology-cops..> | 2023-05-03 09:48 | 8.0K | |
![[IMG]](/icons/image2.gif) | pathophysiology-the-..> | 2023-08-06 05:49 | 3.9K | |
![[IMG]](/icons/image2.gif) | pathophysiology-the-..> | 2023-05-03 10:48 | 28K | |
![[IMG]](/icons/image2.gif) | patient-care-in-radi..> | 2023-08-05 07:19 | 3.2K | |
![[IMG]](/icons/image2.gif) | patient-care-in-radi..> | 2023-05-03 09:36 | 18K | |
![[IMG]](/icons/image2.gif) | patterns-of-entrepre..> | 2023-08-07 21:16 | 3.8K | |
![[IMG]](/icons/image2.gif) | patterns-of-entrepre..> | 2023-05-03 09:50 | 28K | |
![[ ]](/icons/unknown.gif) | patterson13_im_ch01.doc | 2023-05-04 01:55 | 67K | |
![[IMG]](/icons/image2.gif) | payment-gateway.png | 2023-05-06 09:45 | 10K | |
![[IMG]](/icons/image2.gif) | payroll-accounting-2..> | 2023-05-03 10:08 | 12K | |
![[IMG]](/icons/image2.gif) | payroll-accounting-2..> | 2023-05-03 10:07 | 12K | |
![[IMG]](/icons/image2.gif) | peak-performance-suc..> | 2023-08-06 07:47 | 2.6K | |
![[IMG]](/icons/image2.gif) | peak-performance-suc..> | 2023-08-13 18:49 | 13K | |
![[IMG]](/icons/image2.gif) | peak-performance-suc..> | 2023-05-03 10:28 | 35K | |
![[ ]](/icons/compressed.gif) | peak-performance-suc..> | 2023-05-03 10:28 | 68K | |
![[IMG]](/icons/image2.gif) | pearsons-federal-tax..> | 2023-08-05 05:30 | 3.4K | |
![[IMG]](/icons/image2.gif) | pearsons-federal-tax..> | 2023-08-13 18:49 | 22K | |
![[IMG]](/icons/image2.gif) | pearsons-federal-tax..> | 2023-05-03 09:59 | 72K | |
![[ ]](/icons/compressed.gif) | pearsons-federal-tax..> | 2023-05-03 09:59 | 1.8M | |
![[IMG]](/icons/image2.gif) | pediatric-nursing-an..> | 2023-08-07 19:47 | 2.4K | |
![[IMG]](/icons/image2.gif) | pediatric-nursing-an..> | 2023-05-03 09:30 | 13K | |
![[IMG]](/icons/image2.gif) | pediatric-nursing-ca..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | pediatric-nursing-ca..> | 2023-05-03 09:18 | 23K | |
![[ ]](/icons/compressed.gif) | pediatric-nursing-ca..> | 2023-05-03 09:18 | 43K | |
![[IMG]](/icons/image2.gif) | performance-manageme..> | 2023-08-06 00:58 | 4.0K | |
![[IMG]](/icons/image2.gif) | performance-manageme..> | 2023-05-03 09:24 | 23K | |
![[ ]](/icons/compressed.gif) | performance-manageme..> | 2023-05-03 09:24 | 22K | |
![[IMG]](/icons/image2.gif) | perinatal-and-pediat..> | 2023-08-06 11:13 | 3.4K | |
![[IMG]](/icons/image2.gif) | perinatal-and-pediat..> | 2023-05-03 10:23 | 18K | |
![[IMG]](/icons/image2.gif) | periodontology-for-t..> | 2023-08-07 07:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | periodontology-for-t..> | 2023-05-03 10:02 | 19K | |
![[ ]](/icons/compressed.gif) | periodontology-for-t..> | 2023-05-03 10:02 | 11K | |
![[ ]](/icons/unknown.gif) | perpuzz7_ch02.rtf | 2023-05-03 10:12 | 215K | |
![[IMG]](/icons/image2.gif) | personal-finance-e-t..> | 2023-08-05 16:26 | 4.2K | |
![[IMG]](/icons/image2.gif) | personal-finance-e-t..> | 2023-05-03 09:51 | 24K | |
![[IMG]](/icons/image2.gif) | personal-finance-e-t..> | 2023-08-05 05:30 | 4.2K | |
![[IMG]](/icons/image2.gif) | personal-finance-e-t..> | 2023-05-03 09:49 | 24K | |
![[ ]](/icons/compressed.gif) | personal-finance-mad..> | 2023-05-03 13:42 | 128K | |
![[IMG]](/icons/image2.gif) | personal-finance-tur..> | 2023-08-05 16:29 | 2.4K | |
![[IMG]](/icons/image2.gif) | personal-finance-tur..> | 2023-08-13 18:49 | 12K | |
![[IMG]](/icons/image2.gif) | personal-finance-tur..> | 2023-05-03 11:03 | 43K | |
![[ ]](/icons/compressed.gif) | personal-finance-tur..> | 2023-05-03 11:03 | 229K | |
![[IMG]](/icons/image2.gif) | personal-finance-tur..> | 2023-05-03 09:36 | 12K | |
![[ ]](/icons/compressed.gif) | personal-finance-tur..> | 2023-05-03 09:36 | 15K | |
![[IMG]](/icons/image2.gif) | personal-financial-p..> | 2023-08-06 09:42 | 3.3K | |
![[IMG]](/icons/image2.gif) | personal-financial-p..> | 2023-08-13 18:49 | 16K | |
![[IMG]](/icons/image2.gif) | personal-financial-p..> | 2023-05-03 09:46 | 42K | |
![[ ]](/icons/compressed.gif) | personal-financial-p..> | 2023-05-03 09:46 | 564K | |
![[IMG]](/icons/image2.gif) | personal-financial-p..> | 2023-08-05 01:13 | 2.8K | |
![[IMG]](/icons/image2.gif) | personal-financial-p..> | 2023-05-03 09:18 | 16K | |
![[ ]](/icons/compressed.gif) | personal-financial-p..> | 2023-05-03 09:18 | 11K | |
![[IMG]](/icons/image2.gif) | personal-nutrition-b..> | 2023-08-05 04:34 | 3.8K | |
![[IMG]](/icons/image2.gif) | personal-nutrition-b..> | 2023-05-03 10:25 | 21K | |
![[ ]](/icons/compressed.gif) | personal-nutrition-b..> | 2023-05-03 10:25 | 166K | |
![[IMG]](/icons/image2.gif) | personality-classic-..> | 2023-08-08 06:24 | 3.2K | |
![[IMG]](/icons/image2.gif) | personality-classic-..> | 2023-05-03 09:55 | 20K | |
![[ ]](/icons/compressed.gif) | personality-classic-..> | 2023-05-03 09:55 | 12K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-06 07:46 | 4.4K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-13 18:49 | 27K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-05-03 09:26 | 44K | |
![[ ]](/icons/compressed.gif) | personality-psycholo..> | 2023-05-03 09:26 | 61K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-05 14:33 | 3.7K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-13 18:49 | 23K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-05-03 10:20 | 38K | |
![[ ]](/icons/compressed.gif) | personality-psycholo..> | 2023-05-03 10:20 | 274K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-08 07:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-05-03 10:45 | 21K | |
![[ ]](/icons/compressed.gif) | personality-psycholo..> | 2023-05-03 10:45 | 182K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-08-05 16:24 | 2.4K | |
![[IMG]](/icons/image2.gif) | personality-psycholo..> | 2023-05-03 09:44 | 14K | |
![[ ]](/icons/compressed.gif) | personality-psycholo..> | 2023-05-03 09:44 | 18K | |
![[IMG]](/icons/image2.gif) | personality-theories..> | 2023-08-06 09:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | personality-theories..> | 2023-05-03 09:26 | 19K | |
![[ ]](/icons/compressed.gif) | personality-theories..> | 2023-05-03 09:26 | 24K | |
![[IMG]](/icons/image2.gif) | perspectives-on-pers..> | 2023-08-05 03:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | perspectives-on-pers..> | 2023-05-03 10:18 | 22K | |
![[ ]](/icons/compressed.gif) | perspectives-on-pers..> | 2023-05-03 10:18 | 19K | |
![[IMG]](/icons/image2.gif) | pfaller-100x100.jpg | 2023-08-05 01:40 | 9.8K | |
![[IMG]](/icons/image2.gif) | pfaller-300x300.jpg | 2023-08-06 16:00 | 23K | |
![[IMG]](/icons/image2.gif) | pfaller.jpg | 2023-05-03 11:03 | 45K | |
![[ ]](/icons/layout.gif) | pfes01h_solns_ch1.pdf | 2023-05-03 10:36 | 25K | |
![[IMG]](/icons/image2.gif) | pfin-6th-edition-bil..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | pfin-6th-edition-bil..> | 2023-08-13 18:49 | 16K | |
![[IMG]](/icons/image2.gif) | pfin-6th-edition-bil..> | 2023-05-03 09:29 | 43K | |
![[ ]](/icons/compressed.gif) | pfin-6th-edition-bil..> | 2023-05-03 09:29 | 56K | |
![[IMG]](/icons/image2.gif) | pharm-sample-01.png | 2023-05-04 01:48 | 7.1M | |
![[IMG]](/icons/image2.gif) | pharmacological-aspe..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | pharmacological-aspe..> | 2023-05-04 02:13 | 20K | |
![[ ]](/icons/compressed.gif) | pharmacological-aspe..> | 2023-05-04 02:13 | 34K | |
![[IMG]](/icons/image2.gif) | pharmacology-a-nursi..> | 2023-08-05 02:47 | 2.8K | |
![[IMG]](/icons/image2.gif) | pharmacology-a-nursi..> | 2023-05-03 09:55 | 18K | |
![[ ]](/icons/compressed.gif) | pharmacology-a-nursi..> | 2023-05-03 09:55 | 13K | |
![[ ]](/icons/compressed.gif) | pharmacology-a-nursi..> | 2023-05-03 10:13 | 15K | |
![[IMG]](/icons/image2.gif) | pharmacology-a-nursi..> | 2023-08-09 02:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | pharmacology-a-nursi..> | 2023-05-03 10:13 | 10K | |
![[IMG]](/icons/image2.gif) | pharmacology-an-intr..> | 2023-08-06 03:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | pharmacology-an-intr..> | 2023-05-03 10:45 | 21K | |
![[ ]](/icons/compressed.gif) | pharmacology-an-intr..> | 2023-05-03 10:45 | 43K | |
![[IMG]](/icons/image2.gif) | pharmacology-and-the..> | 2023-08-06 13:05 | 3.4K | |
![[IMG]](/icons/image2.gif) | pharmacology-and-the..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/compressed.gif) | pharmacology-and-the..> | 2023-05-03 09:19 | 11K | |
![[IMG]](/icons/image2.gif) | pharmacology-connect..> | 2023-08-05 04:35 | 3.4K | |
![[IMG]](/icons/image2.gif) | pharmacology-connect..> | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | pharmacology-connect..> | 2023-05-03 11:09 | 77K | |
![[ ]](/icons/compressed.gif) | pharmacology-connect..> | 2023-05-03 11:09 | 219K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-can..> | 2023-08-05 16:23 | 4.4K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-can..> | 2023-05-03 09:18 | 26K | |
![[ ]](/icons/compressed.gif) | pharmacology-for-can..> | 2023-05-03 09:18 | 10K | |
![[ ]](/icons/compressed.gif) | pharmacology-for-nur..> | 2023-05-03 10:03 | 32K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-08-05 01:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-05-04 02:13 | 9.7K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-08-06 17:28 | 3.2K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-05-03 10:47 | 11K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-08-05 04:34 | 3.2K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-05-03 10:58 | 11K | |
![[ ]](/icons/compressed.gif) | pharmacology-for-nur..> | 2023-05-03 10:58 | 187K | |
![[ ]](/icons/compressed.gif) | pharmacology-for-nur..> | 2023-05-04 02:13 | 14K | |
![[ ]](/icons/unknown.gif) | pharmacology-for-nur..> | 2023-05-03 09:34 | 61K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-08-05 15:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-nur..> | 2023-05-03 09:34 | 8.2K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-pha..> | 2023-08-05 01:12 | 4.0K | |
![[IMG]](/icons/image2.gif) | pharmacology-for-pha..> | 2023-05-03 09:27 | 23K | |
![[IMG]](/icons/image2.gif) | pharmacology-princip..> | 2023-08-08 06:44 | 2.4K | |
![[IMG]](/icons/image2.gif) | pharmacology-princip..> | 2023-05-03 10:25 | 15K | |
![[ ]](/icons/compressed.gif) | pharmacology-princip..> | 2023-05-03 10:25 | 17K | |
![[IMG]](/icons/image2.gif) | pharmacotherapeutics..> | 2023-08-06 20:07 | 3.1K | |
![[IMG]](/icons/image2.gif) | pharmacotherapeutics..> | 2023-05-03 09:33 | 23K | |
![[IMG]](/icons/image2.gif) | pharmacy-technician-..> | 2023-08-06 03:48 | 4.1K | |
![[IMG]](/icons/image2.gif) | pharmacy-technician-..> | 2023-05-03 10:08 | 21K | |
![[ ]](/icons/compressed.gif) | pharmacy-technician-..> | 2023-05-03 10:08 | 12K | |
![[ ]](/icons/unknown.gif) | phelan3e_testbank_ch..> | 2023-05-03 09:54 | 168K | |
![[IMG]](/icons/image2.gif) | philosophy-text-read..> | 2023-08-05 03:41 | 3.7K | |
![[IMG]](/icons/image2.gif) | philosophy-text-read..> | 2023-08-12 04:48 | 22K | |
![[IMG]](/icons/image2.gif) | philosophy-text-read..> | 2023-05-03 10:13 | 62K | |
![[ ]](/icons/compressed.gif) | philosophy-text-read..> | 2023-05-03 10:13 | 113K | |
![[IMG]](/icons/image2.gif) | physical-chemistry-2..> | 2023-08-06 11:14 | 1.8K | |
![[IMG]](/icons/image2.gif) | physical-chemistry-2..> | 2023-08-08 21:04 | 10K | |
![[IMG]](/icons/image2.gif) | physical-chemistry-2..> | 2023-05-03 09:27 | 27K | |
![[ ]](/icons/compressed.gif) | physical-chemistry-2..> | 2023-05-03 09:27 | 209K | |
![[ ]](/icons/compressed.gif) | physical-chemistry-t..> | 2023-05-04 01:48 | 129K | |
![[IMG]](/icons/image2.gif) | physical-examination..> | 2023-08-05 15:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | physical-examination..> | 2023-05-03 09:19 | 16K | |
![[ ]](/icons/compressed.gif) | physical-examination..> | 2023-05-03 09:19 | 17K | |
![[IMG]](/icons/image2.gif) | physical-geography-p..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | physical-geography-p..> | 2023-05-03 10:32 | 23K | |
![[ ]](/icons/compressed.gif) | physical-geography-p..> | 2023-05-03 10:32 | 143K | |
![[IMG]](/icons/image2.gif) | physical-rehabilitat..> | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | physical-rehabilitat..> | 2023-05-03 09:45 | 14K | |
![[ ]](/icons/compressed.gif) | physical-rehabilitat..> | 2023-05-03 09:45 | 2.3K | |
![[IMG]](/icons/image2.gif) | physical-science-10t..> | 2023-05-03 10:56 | 71K | |
![[ ]](/icons/compressed.gif) | physical-science-10t..> | 2023-05-03 10:56 | 89K | |
![[IMG]](/icons/image2.gif) | physical-science-bil..> | 2023-08-05 15:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | physical-science-bil..> | 2023-05-03 10:28 | 28K | |
![[ ]](/icons/compressed.gif) | physical-science-bil..> | 2023-05-03 10:28 | 6.8K | |
![[IMG]](/icons/image2.gif) | physics-5th-edition-..> | 2023-08-06 07:46 | 4.4K | |
![[IMG]](/icons/image2.gif) | physics-5th-edition-..> | 2023-08-12 04:48 | 26K | |
![[IMG]](/icons/image2.gif) | physics-5th-edition-..> | 2023-05-04 01:57 | 128K | |
![[ ]](/icons/compressed.gif) | physics-5th-edition-..> | 2023-05-04 01:57 | 311K | |
![[IMG]](/icons/image2.gif) | physics-10th-edition..> | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | physics-10th-edition..> | 2023-08-12 04:48 | 16K | |
![[IMG]](/icons/image2.gif) | physics-10th-edition..> | 2023-05-03 10:33 | 45K | |
![[ ]](/icons/compressed.gif) | physics-10th-edition..> | 2023-05-03 10:33 | 291K | |
![[IMG]](/icons/image2.gif) | physics-cutnell-john..> | 2023-08-05 14:34 | 2.7K | |
![[IMG]](/icons/image2.gif) | physics-cutnell-john..> | 2023-05-03 10:06 | 8.1K | |
![[IMG]](/icons/image2.gif) | physics-cutnell-john..> | 2023-08-05 05:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | physics-cutnell-john..> | 2023-05-03 10:31 | 8.1K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-08-05 16:23 | 3.0K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-08-12 04:48 | 16K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-05-03 10:23 | 43K | |
![[ ]](/icons/compressed.gif) | physics-everyday-phe..> | 2023-05-03 10:23 | 129K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-08-05 14:28 | 3.0K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-08-09 01:01 | 16K | |
![[IMG]](/icons/image2.gif) | physics-everyday-phe..> | 2023-05-04 02:04 | 43K | |
![[ ]](/icons/compressed.gif) | physics-everyday-phe..> | 2023-05-04 02:04 | 214K | |
![[IMG]](/icons/image2.gif) | physics-for-scientis..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | physics-for-scientis..> | 2023-05-03 10:41 | 18K | |
![[ ]](/icons/compressed.gif) | physics-for-scientis..> | 2023-05-03 10:41 | 25K | |
![[IMG]](/icons/image2.gif) | physics-principles-w..> | 2023-08-07 04:28 | 3.1K | |
![[IMG]](/icons/image2.gif) | physics-principles-w..> | 2023-05-03 09:30 | 19K | |
![[ ]](/icons/compressed.gif) | physics-principles-w..> | 2023-05-03 09:30 | 77K | |
![[IMG]](/icons/image2.gif) | physics-walker-4th-t..> | 2023-05-03 11:02 | 9.4K | |
![[IMG]](/icons/image2.gif) | physiology-of-behavi..> | 2023-08-05 02:47 | 2.8K | |
![[IMG]](/icons/image2.gif) | physiology-of-behavi..> | 2023-05-03 10:32 | 16K | |
![[ ]](/icons/compressed.gif) | physiology-of-behavi..> | 2023-05-03 10:31 | 106K | |
![[IMG]](/icons/image2.gif) | pilbeams-mechanical-..> | 2023-08-06 11:18 | 3.0K | |
![[IMG]](/icons/image2.gif) | pilbeams-mechanical-..> | 2023-05-03 09:37 | 16K | |
![[ ]](/icons/unknown.gif) | pinto_pm5_tif_01.doc | 2023-05-04 02:12 | 108K | |
![[IMG]](/icons/image2.gif) | police-operations-th..> | 2023-08-05 01:51 | 3.9K | |
![[IMG]](/icons/image2.gif) | police-operations-th..> | 2023-05-03 10:01 | 22K | |
![[ ]](/icons/compressed.gif) | police-operations-th..> | 2023-05-03 10:01 | 16K | |
![[IMG]](/icons/image2.gif) | population-community..> | 2023-08-06 10:16 | 3.5K | |
![[IMG]](/icons/image2.gif) | population-community..> | 2023-08-05 01:13 | 22K | |
![[IMG]](/icons/image2.gif) | population-community..> | 2023-05-04 02:29 | 77K | |
![[ ]](/icons/compressed.gif) | population-community..> | 2023-05-04 02:29 | 34K | |
![[IMG]](/icons/image2.gif) | portfolio-constructi..> | 2023-08-05 17:21 | 3.0K | |
![[IMG]](/icons/image2.gif) | portfolio-constructi..> | 2023-05-03 10:32 | 17K | |
![[ ]](/icons/compressed.gif) | portfolio-constructi..> | 2023-05-03 10:32 | 8.6K | |
![[IMG]](/icons/image2.gif) | porth-pathophysiolog..> | 2023-08-06 11:15 | 2.9K | |
![[IMG]](/icons/image2.gif) | porth-pathophysiolog..> | 2023-05-03 10:09 | 19K | |
![[ ]](/icons/compressed.gif) | porth-pathophysiolog..> | 2023-05-03 10:09 | 25K | |
![[IMG]](/icons/image2.gif) | porths-pathophysiolo..> | 2023-08-08 18:24 | 3.7K | |
![[IMG]](/icons/image2.gif) | porths-pathophysiolo..> | 2023-05-03 09:32 | 13K | |
![[IMG]](/icons/image2.gif) | power-learning-strat..> | 2023-08-06 13:04 | 3.5K | |
![[IMG]](/icons/image2.gif) | power-learning-strat..> | 2023-08-09 01:01 | 17K | |
![[IMG]](/icons/image2.gif) | power-learning-strat..> | 2023-05-03 11:08 | 43K | |
![[ ]](/icons/compressed.gif) | power-learning-strat..> | 2023-05-03 11:08 | 119K | |
![[ ]](/icons/unknown.gif) | pozzulo_3e_tif_CH01.doc | 2023-05-03 10:01 | 120K | |
![[ ]](/icons/unknown.gif) | pozzulo_forensic-psy..> | 2023-05-03 09:20 | 98K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-08-05 16:28 | 2.7K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-08-09 01:01 | 13K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-05-03 09:47 | 31K | |
![[ ]](/icons/compressed.gif) | practical-econometri..> | 2023-05-03 09:47 | 146K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-08-08 07:33 | 2.7K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-08-09 01:01 | 13K | |
![[IMG]](/icons/image2.gif) | practical-econometri..> | 2023-05-03 10:31 | 32K | |
![[ ]](/icons/compressed.gif) | practical-econometri..> | 2023-05-03 10:31 | 119K | |
![[IMG]](/icons/image2.gif) | practical-law-archit..> | 2023-08-06 17:28 | 2.2K | |
![[IMG]](/icons/image2.gif) | practical-law-archit..> | 2023-08-09 01:01 | 13K | |
![[IMG]](/icons/image2.gif) | practical-law-archit..> | 2023-05-03 10:20 | 60K | |
![[ ]](/icons/compressed.gif) | practical-law-archit..> | 2023-05-03 10:20 | 138K | |
![[IMG]](/icons/image2.gif) | practical-pharmacolo..> | 2023-08-05 04:35 | 3.5K | |
![[IMG]](/icons/image2.gif) | practical-pharmacolo..> | 2023-08-09 01:01 | 17K | |
![[IMG]](/icons/image2.gif) | practical-pharmacolo..> | 2023-05-04 02:22 | 41K | |
![[ ]](/icons/compressed.gif) | practical-pharmacolo..> | 2023-05-04 02:22 | 11K | |
![[IMG]](/icons/image2.gif) | practical-research-p..> | 2023-08-05 02:46 | 3.7K | |
![[IMG]](/icons/image2.gif) | practical-research-p..> | 2023-05-03 10:41 | 13K | |
![[ ]](/icons/compressed.gif) | prebles-artforms-11t..> | 2023-05-03 10:02 | 227K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-06 07:46 | 3.5K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-05 14:40 | 17K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-05-03 09:21 | 57K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-05 03:41 | 3.5K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-05 14:40 | 17K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-05-04 02:21 | 58K | |
![[ ]](/icons/compressed.gif) | precalculus-6th-edit..> | 2023-05-04 02:21 | 751K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-06 08:47 | 4.9K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-08-05 14:40 | 38K | |
![[IMG]](/icons/image2.gif) | precalculus-6th-edit..> | 2023-05-03 09:37 | 201K | |
![[ ]](/icons/compressed.gif) | precalculus-6th-edit..> | 2023-05-03 09:37 | 8.7M | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-08-09 01:01 | 22K | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-05-03 10:10 | 54K | |
![[ ]](/icons/compressed.gif) | precalculus-10th-edi..> | 2023-05-03 10:10 | 4.6M | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-08-05 17:21 | 1.8K | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-08-05 14:40 | 7.7K | |
![[IMG]](/icons/image2.gif) | precalculus-10th-edi..> | 2023-05-03 09:28 | 25K | |
![[ ]](/icons/compressed.gif) | precalculus-10th-edi..> | 2023-05-03 09:27 | 1.4M | |
![[IMG]](/icons/image2.gif) | precalculus-enhanced..> | 2023-08-05 05:29 | 3.8K | |
![[IMG]](/icons/image2.gif) | precalculus-enhanced..> | 2023-08-05 14:40 | 20K | |
![[IMG]](/icons/image2.gif) | precalculus-enhanced..> | 2023-05-04 02:03 | 84K | |
![[ ]](/icons/compressed.gif) | precalculus-enhanced..> | 2023-05-04 02:03 | 1.8M | |
![[IMG]](/icons/image2.gif) | precalculus-graphs-m..> | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | precalculus-graphs-m..> | 2023-08-05 14:40 | 14K | |
![[IMG]](/icons/image2.gif) | precalculus-graphs-m..> | 2023-05-03 09:21 | 44K | |
![[ ]](/icons/compressed.gif) | precalculus-graphs-m..> | 2023-05-03 09:21 | 1.5M | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-08-05 05:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-08-05 14:40 | 26K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-05-03 10:14 | 66K | |
![[ ]](/icons/compressed.gif) | precalculus-mathemat..> | 2023-05-03 10:14 | 1.1M | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-08-06 02:48 | 4.1K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-08-05 14:40 | 26K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-05-03 09:19 | 67K | |
![[ ]](/icons/compressed.gif) | precalculus-mathemat..> | 2023-05-03 09:19 | 330K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-08-06 13:10 | 3.0K | |
![[IMG]](/icons/image2.gif) | precalculus-mathemat..> | 2023-05-03 10:29 | 9.6K | |
![[IMG]](/icons/image2.gif) | precalculus-unit-cir..> | 2023-08-05 20:19 | 3.4K | |
![[IMG]](/icons/image2.gif) | precalculus-unit-cir..> | 2023-08-05 14:40 | 23K | |
![[IMG]](/icons/image2.gif) | precalculus-unit-cir..> | 2023-05-04 02:02 | 59K | |
![[ ]](/icons/compressed.gif) | precalculus-unit-cir..> | 2023-05-04 02:02 | 2.6M | |
![[IMG]](/icons/image2.gif) | preface-to-marketing..> | 2023-08-05 16:26 | 2.8K | |
![[IMG]](/icons/image2.gif) | preface-to-marketing..> | 2023-05-03 09:58 | 17K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-08-06 13:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-05-04 01:48 | 11K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-08-05 03:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-08-06 14:42 | 19K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-05-03 09:24 | 51K | |
![[ ]](/icons/compressed.gif) | prentice-halls-feder..> | 2023-05-03 09:24 | 540K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-08-05 06:23 | 3.4K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-08-08 16:38 | 18K | |
![[IMG]](/icons/image2.gif) | prentice-halls-feder..> | 2023-05-04 02:05 | 83K | |
![[ ]](/icons/compressed.gif) | prentice-halls-feder..> | 2023-05-04 02:05 | 198K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-08-05 01:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-05-03 10:13 | 51K | |
![[ ]](/icons/compressed.gif) | preschool-appropriat..> | 2023-05-03 10:13 | 526K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-08-08 07:24 | 4.1K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-08-06 14:42 | 21K | |
![[IMG]](/icons/image2.gif) | preschool-appropriat..> | 2023-05-03 10:34 | 55K | |
![[ ]](/icons/compressed.gif) | preschool-appropriat..> | 2023-05-03 10:34 | 197K | |
![[IMG]](/icons/image2.gif) | prescotts-microbiolo..> | 2023-08-05 04:34 | 4.5K | |
![[IMG]](/icons/image2.gif) | prescotts-microbiolo..> | 2023-05-03 10:01 | 29K | |
![[ ]](/icons/compressed.gif) | prescotts-microbiolo..> | 2023-05-03 10:01 | 129K | |
![[ ]](/icons/compressed.gif) | prescotts-microbiolo..> | 2023-05-03 11:08 | 255K | |
![[IMG]](/icons/image2.gif) | prescotts-microbiolo..> | 2023-08-06 11:13 | 4.1K | |
![[IMG]](/icons/image2.gif) | prescotts-microbiolo..> | 2023-05-03 11:08 | 15K | |
![[IMG]](/icons/image2.gif) | price-theory-applica..> | 2023-08-05 14:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | price-theory-applica..> | 2023-05-04 02:27 | 28K | |
![[ ]](/icons/compressed.gif) | price-theory-applica..> | 2023-05-04 02:26 | 363K | |
![[ ]](/icons/compressed.gif) | price-theory-applica..> | 2023-05-03 13:41 | 149K | |
![[IMG]](/icons/image2.gif) | primary-care-art-and..> | 2023-08-07 12:31 | 3.5K | |
![[IMG]](/icons/image2.gif) | primary-care-art-and..> | 2023-05-03 10:33 | 18K | |
![[ ]](/icons/compressed.gif) | primary-care-art-and..> | 2023-05-03 10:33 | 3.8K | |
![[IMG]](/icons/image2.gif) | principles-and-found..> | 2023-08-07 14:41 | 4.8K | |
![[IMG]](/icons/image2.gif) | principles-and-found..> | 2023-05-03 09:58 | 30K | |
![[ ]](/icons/compressed.gif) | principles-and-found..> | 2023-05-03 09:58 | 13K | |
![[IMG]](/icons/image2.gif) | principles-and-labs-..> | 2023-08-05 01:12 | 4.2K | |
![[IMG]](/icons/image2.gif) | principles-and-labs-..> | 2023-05-03 10:42 | 25K | |
![[IMG]](/icons/image2.gif) | principles-and-pract..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-and-pract..> | 2023-05-03 10:16 | 20K | |
![[IMG]](/icons/image2.gif) | principles-animal-ph..> | 2023-08-05 01:56 | 2.8K | |
![[IMG]](/icons/image2.gif) | principles-animal-ph..> | 2023-08-06 14:42 | 18K | |
![[IMG]](/icons/image2.gif) | principles-animal-ph..> | 2023-05-03 11:26 | 76K | |
![[ ]](/icons/compressed.gif) | principles-animal-ph..> | 2023-05-03 11:26 | 176K | |
![[IMG]](/icons/image2.gif) | principles-biology-1..> | 2023-08-07 03:42 | 3.8K | |
![[IMG]](/icons/image2.gif) | principles-biology-1..> | 2023-08-05 16:29 | 19K | |
![[IMG]](/icons/image2.gif) | principles-biology-1..> | 2023-05-03 11:00 | 48K | |
![[ ]](/icons/compressed.gif) | principles-biology-1..> | 2023-05-03 11:00 | 149K | |
![[IMG]](/icons/image2.gif) | principles-corporate..> | 2023-08-05 03:41 | 3.8K | |
![[IMG]](/icons/image2.gif) | principles-corporate..> | 2023-08-05 16:29 | 23K | |
![[IMG]](/icons/image2.gif) | principles-corporate..> | 2023-05-03 10:26 | 66K | |
![[ ]](/icons/compressed.gif) | principles-corporate..> | 2023-05-03 10:26 | 94K | |
![[IMG]](/icons/image2.gif) | principles-electroni..> | 2023-08-08 08:32 | 4.5K | |
![[IMG]](/icons/image2.gif) | principles-electroni..> | 2023-08-08 16:38 | 26K | |
![[IMG]](/icons/image2.gif) | principles-electroni..> | 2023-05-03 10:48 | 65K | |
![[ ]](/icons/compressed.gif) | principles-electroni..> | 2023-05-03 10:48 | 4.3M | |
![[IMG]](/icons/image2.gif) | principles-informati..> | 2023-08-06 04:51 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-informati..> | 2023-08-05 16:29 | 19K | |
![[IMG]](/icons/image2.gif) | principles-informati..> | 2023-05-04 01:50 | 46K | |
![[ ]](/icons/compressed.gif) | principles-informati..> | 2023-05-04 01:50 | 47K | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-08-06 07:45 | 3.9K | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-08-08 16:38 | 20K | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-05-03 10:34 | 52K | |
![[ ]](/icons/compressed.gif) | principles-macroecon..> | 2023-05-03 10:34 | 379K | |
![[ ]](/icons/compressed.gif) | principles-macroecon..> | 2023-05-03 13:43 | 1.5M | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-08-05 16:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-08-05 16:29 | 25K | |
![[IMG]](/icons/image2.gif) | principles-macroecon..> | 2023-05-03 10:12 | 60K | |
![[ ]](/icons/compressed.gif) | principles-macroecon..> | 2023-05-03 10:12 | 241K | |
![[IMG]](/icons/image2.gif) | principles-marketing..> | 2023-08-05 06:23 | 4.5K | |
![[IMG]](/icons/image2.gif) | principles-marketing..> | 2023-08-08 06:42 | 20K | |
![[IMG]](/icons/image2.gif) | principles-marketing..> | 2023-05-03 09:39 | 58K | |
![[ ]](/icons/compressed.gif) | principles-marketing..> | 2023-05-03 09:39 | 355K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-08-05 04:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-08-08 06:42 | 25K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-05-03 10:43 | 69K | |
![[ ]](/icons/compressed.gif) | principles-microecon..> | 2023-05-03 10:43 | 732K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-08-08 14:32 | 3.1K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-08-08 06:42 | 12K | |
![[IMG]](/icons/image2.gif) | principles-microecon..> | 2023-05-03 10:08 | 52K | |
![[ ]](/icons/compressed.gif) | principles-microecon..> | 2023-05-03 10:08 | 807K | |
![[IMG]](/icons/image2.gif) | principles-of-accoun..> | 2023-08-05 15:33 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-accoun..> | 2023-05-03 10:51 | 7.5K | |
![[IMG]](/icons/image2.gif) | principles-of-accoun..> | 2023-08-05 04:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-accoun..> | 2023-05-03 09:35 | 7.5K | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-08-05 01:12 | 2.8K | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-05-03 09:31 | 15K | |
![[ ]](/icons/compressed.gif) | principles-of-anatom..> | 2023-05-03 10:26 | 0 | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-08-05 01:51 | 2.6K | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-05-03 09:33 | 14K | |
![[ ]](/icons/compressed.gif) | principles-of-anatom..> | 2023-05-03 09:33 | 633K | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-08-08 07:30 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-of-anatom..> | 2023-05-03 10:26 | 8.8K | |
![[IMG]](/icons/image2.gif) | principles-of-animal..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | principles-of-animal..> | 2023-05-03 09:54 | 21K | |
![[ ]](/icons/compressed.gif) | principles-of-animal..> | 2023-05-03 09:54 | 17K | |
![[ ]](/icons/compressed.gif) | principles-of-athlet..> | 2023-05-03 09:20 | 20K | |
![[IMG]](/icons/image2.gif) | principles-of-athlet..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | principles-of-athlet..> | 2023-05-03 09:20 | 9.6K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-08-06 13:04 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-05-03 09:39 | 22K | |
![[ ]](/icons/compressed.gif) | principles-of-auditi..> | 2023-05-03 09:39 | 20K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-08-05 01:51 | 3.0K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-05-03 10:15 | 19K | |
![[ ]](/icons/compressed.gif) | principles-of-auditi..> | 2023-05-03 10:15 | 18K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-08-06 17:25 | 2.7K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-05-03 10:31 | 9.9K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-08-05 06:25 | 2.7K | |
![[IMG]](/icons/image2.gif) | principles-of-auditi..> | 2023-05-03 11:22 | 9.9K | |
![[IMG]](/icons/image2.gif) | principles-of-behavi..> | 2023-08-06 11:17 | 2.5K | |
![[IMG]](/icons/image2.gif) | principles-of-behavi..> | 2023-05-03 09:21 | 11K | |
![[IMG]](/icons/image2.gif) | principles-of-bioche..> | 2023-08-05 01:56 | 3.6K | |
![[IMG]](/icons/image2.gif) | principles-of-bioche..> | 2023-05-03 09:49 | 27K | |
![[ ]](/icons/compressed.gif) | principles-of-bioche..> | 2023-05-03 09:49 | 155K | |
![[IMG]](/icons/image2.gif) | principles-of-chemis..> | 2023-08-05 03:35 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-chemis..> | 2023-05-03 09:57 | 23K | |
![[ ]](/icons/compressed.gif) | principles-of-chemis..> | 2023-05-03 09:57 | 108K | |
![[ ]](/icons/compressed.gif) | principles-of-corpor..> | 2023-05-03 11:03 | 47K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-08-05 04:35 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-05-03 10:23 | 11K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-08-05 06:24 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-05-03 11:03 | 11K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-08-05 01:08 | 2.7K | |
![[IMG]](/icons/image2.gif) | principles-of-corpor..> | 2023-05-04 02:12 | 20K | |
![[ ]](/icons/compressed.gif) | principles-of-corpor..> | 2023-05-04 02:12 | 5.9K | |
![[IMG]](/icons/image2.gif) | principles-of-cost-a..> | 2023-08-06 17:36 | 2.5K | |
![[IMG]](/icons/image2.gif) | principles-of-cost-a..> | 2023-05-03 10:15 | 7.6K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-08-06 13:07 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-05-03 10:05 | 15K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-08-05 01:09 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-05-03 10:09 | 15K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-08-05 02:03 | 3.0K | |
![[IMG]](/icons/image2.gif) | principles-of-econom..> | 2023-05-03 09:55 | 10K | |
![[ ]](/icons/compressed.gif) | principles-of-econom..> | 2023-05-03 10:09 | 78K | |
![[IMG]](/icons/image2.gif) | principles-of-fraud-..> | 2023-08-05 16:26 | 3.6K | |
![[IMG]](/icons/image2.gif) | principles-of-fraud-..> | 2023-05-03 09:18 | 13K | |
![[IMG]](/icons/image2.gif) | principles-of-genera..> | 2023-08-06 12:10 | 3.9K | |
![[IMG]](/icons/image2.gif) | principles-of-genera..> | 2023-05-03 11:13 | 24K | |
![[ ]](/icons/compressed.gif) | principles-of-genera..> | 2023-05-03 11:13 | 65K | |
![[IMG]](/icons/image2.gif) | principles-of-geneti..> | 2023-08-05 05:30 | 16K | |
![[IMG]](/icons/image2.gif) | principles-of-geneti..> | 2023-05-03 09:31 | 40K | |
![[IMG]](/icons/image2.gif) | principles-of-human-..> | 2023-08-08 21:07 | 3.1K | |
![[IMG]](/icons/image2.gif) | principles-of-human-..> | 2023-05-03 11:11 | 24K | |
![[ ]](/icons/compressed.gif) | principles-of-human-..> | 2023-05-03 11:11 | 164K | |
![[IMG]](/icons/image2.gif) | principles-of-inform..> | 2023-08-08 15:36 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-inform..> | 2023-05-03 09:58 | 19K | |
![[ ]](/icons/compressed.gif) | principles-of-inform..> | 2023-05-03 09:57 | 15K | |
![[IMG]](/icons/image2.gif) | principles-of-life-d..> | 2023-08-05 01:13 | 3.8K | |
![[IMG]](/icons/image2.gif) | principles-of-life-d..> | 2023-05-03 09:40 | 31K | |
![[ ]](/icons/compressed.gif) | principles-of-macroe..> | 2023-05-03 10:52 | 503K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-08-08 18:00 | 3.3K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-05-03 10:52 | 9.7K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-08-05 03:43 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-05-03 09:46 | 12K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-08-08 06:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | principles-of-macroe..> | 2023-05-03 09:42 | 10K | |
![[ ]](/icons/compressed.gif) | principles-of-macroe..> | 2023-05-03 09:46 | 78K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 01:09 | 4.0K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-08 06:42 | 22K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 10:30 | 38K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 10:30 | 38K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 01:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-08 06:42 | 22K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 09:21 | 38K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 09:21 | 1.1M | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 17:22 | 3.9K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-18 13:55 | 23K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 11:01 | 75K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-06 13:04 | 2.1K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 10:30 | 20K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 09:44 | 22K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 09:44 | 344K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 10:30 | 295K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 02:45 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 11:00 | 15K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 03:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 09:49 | 10K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 02:47 | 2.9K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 10:34 | 10K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 11:00 | 78K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-microe..> | 2023-05-03 10:37 | 23K | |
![[ ]](/icons/compressed.gif) | principles-of-microe..> | 2023-05-03 10:37 | 71K | |
![[IMG]](/icons/image2.gif) | principles-of-money-..> | 2023-05-03 09:50 | 6.2K | |
![[IMG]](/icons/image2.gif) | principles-of-pediat..> | 2023-08-05 15:31 | 3.7K | |
![[IMG]](/icons/image2.gif) | principles-of-pediat..> | 2023-05-03 11:02 | 14K | |
![[ ]](/icons/compressed.gif) | principles-of-pediat..> | 2023-05-03 11:02 | 16K | |
![[IMG]](/icons/image2.gif) | principles-of-radiog..> | 2023-08-06 13:03 | 3.4K | |
![[IMG]](/icons/image2.gif) | principles-of-radiog..> | 2023-05-03 09:19 | 20K | |
![[ ]](/icons/compressed.gif) | principles-of-radiog..> | 2023-05-03 09:19 | 12K | |
![[IMG]](/icons/image2.gif) | principles-of-taxati..> | 2023-08-05 14:37 | 1.7K | |
![[IMG]](/icons/image2.gif) | principles-of-taxati..> | 2023-05-03 10:34 | 5.5K | |
![[ ]](/icons/compressed.gif) | principles-of-taxati..> | 2023-05-03 10:34 | 104K | |
![[IMG]](/icons/image2.gif) | priorities-in-critic..> | 2023-08-06 03:28 | 2.5K | |
![[IMG]](/icons/image2.gif) | priorities-in-critic..> | 2023-05-03 09:19 | 14K | |
![[IMG]](/icons/image2.gif) | priorities-in-critic..> | 2023-08-05 16:28 | 3.3K | |
![[IMG]](/icons/image2.gif) | priorities-in-critic..> | 2023-05-03 10:12 | 18K | |
![[IMG]](/icons/image2.gif) | proactive-police-man..> | 2023-08-05 03:40 | 14K | |
![[IMG]](/icons/image2.gif) | proactive-police-man..> | 2023-05-03 09:33 | 34K | |
![[IMG]](/icons/image2.gif) | probability-and-stat..> | 2023-05-03 10:17 | 6.0K | |
![[IMG]](/icons/image2.gif) | probability-and-stat..> | 2023-08-06 08:31 | 2.8K | |
![[IMG]](/icons/image2.gif) | probability-and-stat..> | 2023-05-03 10:44 | 7.1K | |
![[IMG]](/icons/image2.gif) | probability-statisti..> | 2023-08-05 06:19 | 3.6K | |
![[IMG]](/icons/image2.gif) | probability-statisti..> | 2023-08-09 03:54 | 18K | |
![[IMG]](/icons/image2.gif) | probability-statisti..> | 2023-05-03 09:32 | 43K | |
![[ ]](/icons/compressed.gif) | probability-statisti..> | 2023-05-03 09:32 | 551K | |
![[IMG]](/icons/image2.gif) | procedures-in-phlebo..> | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | procedures-in-phlebo..> | 2023-05-03 10:36 | 17K | |
![[ ]](/icons/compressed.gif) | professional-nursing..> | 2023-05-03 10:03 | 673K | |
![[IMG]](/icons/image2.gif) | professional-nursing..> | 2023-08-06 10:15 | 3.1K | |
![[IMG]](/icons/image2.gif) | professional-nursing..> | 2023-05-03 10:44 | 20K | |
![[ ]](/icons/compressed.gif) | professional-nursing..> | 2023-05-03 10:44 | 16K | |
![[ ]](/icons/compressed.gif) | professional-nursing..> | 2023-05-03 10:02 | 22K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-08-06 10:18 | 3.8K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-08-09 03:54 | 21K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-05-03 10:07 | 51K | |
![[ ]](/icons/compressed.gif) | programmable-logic-c..> | 2023-05-03 10:07 | 704K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-08-09 07:03 | 3.8K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-08-06 12:19 | 21K | |
![[IMG]](/icons/image2.gif) | programmable-logic-c..> | 2023-05-03 10:49 | 52K | |
![[ ]](/icons/compressed.gif) | programmable-logic-c..> | 2023-05-03 10:49 | 206K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-08-09 18:40 | 2.1K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-05-03 10:44 | 7.5K | |
![[ ]](/icons/compressed.gif) | project-management-a..> | 2023-05-03 10:44 | 15K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-08-06 10:14 | 3.1K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-05-03 09:56 | 17K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-08-08 08:38 | 4.0K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-05-03 10:26 | 13K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-08-05 03:40 | 4.0K | |
![[IMG]](/icons/image2.gif) | project-management-a..> | 2023-05-03 09:28 | 13K | |
![[ ]](/icons/compressed.gif) | project-management-a..> | 2023-05-03 09:28 | 107K | |
![[IMG]](/icons/image2.gif) | project-management-m..> | 2023-08-05 01:12 | 3.1K | |
![[IMG]](/icons/image2.gif) | project-management-m..> | 2023-08-05 21:57 | 18K | |
![[IMG]](/icons/image2.gif) | project-management-m..> | 2023-05-03 09:57 | 27K | |
![[ ]](/icons/compressed.gif) | project-management-m..> | 2023-05-03 09:57 | 137K | |
![[IMG]](/icons/image2.gif) | project-management-p..> | 2023-08-08 21:06 | 2.8K | |
![[IMG]](/icons/image2.gif) | project-management-p..> | 2023-08-05 21:57 | 19K | |
![[IMG]](/icons/image2.gif) | project-management-p..> | 2023-05-04 02:28 | 32K | |
![[ ]](/icons/compressed.gif) | project-management-p..> | 2023-05-04 02:28 | 727K | |
![[IMG]](/icons/image2.gif) | project-management-t..> | 2023-08-05 03:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | project-management-t..> | 2023-05-03 09:48 | 16K | |
![[ ]](/icons/compressed.gif) | project-management-t..> | 2023-05-03 09:48 | 18K | |
![[IMG]](/icons/image2.gif) | project-management-t..> | 2023-08-05 15:34 | 3.7K | |
![[IMG]](/icons/image2.gif) | project-management-t..> | 2023-05-03 09:32 | 23K | |
![[IMG]](/icons/image2.gif) | promo-oguinn-1st-tb-..> | 2023-08-05 15:34 | 4.5K | |
![[IMG]](/icons/image2.gif) | promo-oguinn-1st-tb.jpg | 2023-05-04 02:11 | 27K | |
![[ ]](/icons/compressed.gif) | promo-oguinn-1st-tb.zip | 2023-05-04 02:11 | 25K | |
![[IMG]](/icons/image2.gif) | promo-oguinn-2nd-tb-..> | 2023-08-06 12:16 | 3.8K | |
![[IMG]](/icons/image2.gif) | promo-oguinn-2nd-tb.jpg | 2023-05-03 10:29 | 20K | |
![[ ]](/icons/compressed.gif) | promo-oguinn-2nd-tb.zip | 2023-05-03 10:29 | 25K | |
![[IMG]](/icons/image2.gif) | psych-rathus-3rd-tb-..> | 2023-08-05 03:41 | 4.0K | |
![[IMG]](/icons/image2.gif) | psych-rathus-3rd-tb.jpg | 2023-05-03 09:55 | 27K | |
![[ ]](/icons/compressed.gif) | psych-rathus-3rd-tb.zip | 2023-05-03 09:55 | 46K | |
![[IMG]](/icons/image2.gif) | psych-sample-4.png | 2023-05-04 02:14 | 1.3M | |
![[IMG]](/icons/image2.gif) | psychiatric-and-ment..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | psychiatric-and-ment..> | 2023-05-03 09:52 | 15K | |
![[ ]](/icons/compressed.gif) | psychiatric-and-ment..> | 2023-05-03 09:51 | 113K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-08-06 19:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-05-03 11:14 | 19K | |
![[ ]](/icons/compressed.gif) | psychiatric-mental-h..> | 2023-05-03 11:14 | 9.5K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-08-05 04:35 | 3.2K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-05-03 10:45 | 10K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-08-06 13:11 | 2.0K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-05-03 10:34 | 6.5K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-08-06 07:07 | 2.6K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-05-03 09:22 | 19K | |
![[ ]](/icons/compressed.gif) | psychiatric-mental-h..> | 2023-05-03 09:22 | 18K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-08-05 01:52 | 12K | |
![[IMG]](/icons/image2.gif) | psychiatric-mental-h..> | 2023-05-03 10:44 | 31K | |
![[IMG]](/icons/image2.gif) | psychiatric-nursing-..> | 2023-08-05 14:34 | 2.5K | |
![[IMG]](/icons/image2.gif) | psychiatric-nursing-..> | 2023-05-03 09:45 | 9.2K | |
![[ ]](/icons/compressed.gif) | psychiatric-nursing-..> | 2023-05-03 09:45 | 118K | |
![[IMG]](/icons/image2.gif) | psychiatric-nursing-..> | 2023-08-05 03:44 | 2.7K | |
![[IMG]](/icons/image2.gif) | psychiatric-nursing-..> | 2023-05-03 09:28 | 8.5K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-08-05 01:27 | 2.9K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-05-03 09:50 | 17K | |
![[ ]](/icons/compressed.gif) | psychological-testin..> | 2023-05-03 09:50 | 62K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-08-05 16:24 | 3.5K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-08-06 13:12 | 20K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-05-03 09:50 | 53K | |
![[ ]](/icons/compressed.gif) | psychological-testin..> | 2023-05-03 09:50 | 93K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-08-05 05:29 | 2.5K | |
![[IMG]](/icons/image2.gif) | psychological-testin..> | 2023-05-03 10:26 | 11K | |
![[ ]](/icons/compressed.gif) | psychological-testin..> | 2023-05-03 10:26 | 19K | |
![[IMG]](/icons/image2.gif) | psychology-1st-editi..> | 2023-08-07 05:25 | 2.9K | |
![[IMG]](/icons/image2.gif) | psychology-1st-editi..> | 2023-08-06 13:12 | 13K | |
![[IMG]](/icons/image2.gif) | psychology-1st-editi..> | 2023-05-03 09:50 | 41K | |
![[ ]](/icons/compressed.gif) | psychology-1st-editi..> | 2023-05-03 09:50 | 224K | |
![[IMG]](/icons/image2.gif) | psychology-5e-tb-Nai..> | 2023-08-05 03:40 | 3.2K | |
![[IMG]](/icons/image2.gif) | psychology-5e-tb-Nai..> | 2023-10-25 07:07 | 15K | |
![[IMG]](/icons/image2.gif) | psychology-5e-tb-Nai..> | 2023-05-03 10:26 | 38K | |
![[ ]](/icons/compressed.gif) | psychology-9th-editi..> | 2023-05-03 10:12 | 29K | |
![[IMG]](/icons/image2.gif) | psychology-a-concise..> | 2023-08-05 01:52 | 4.2K | |
![[IMG]](/icons/image2.gif) | psychology-a-concise..> | 2023-08-06 13:12 | 25K | |
![[IMG]](/icons/image2.gif) | psychology-a-concise..> | 2023-05-04 02:11 | 42K | |
![[ ]](/icons/compressed.gif) | psychology-a-concise..> | 2023-05-04 02:11 | 104K | |
![[IMG]](/icons/image2.gif) | psychology-a-journey..> | 2023-08-06 10:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | psychology-a-journey..> | 2023-05-03 10:21 | 16K | |
![[ ]](/icons/compressed.gif) | psychology-a-journey..> | 2023-05-03 10:21 | 137K | |
![[IMG]](/icons/image2.gif) | psychology-a-journey..> | 2023-08-09 04:11 | 3.5K | |
![[IMG]](/icons/image2.gif) | psychology-a-journey..> | 2023-05-03 09:59 | 20K | |
![[ ]](/icons/compressed.gif) | psychology-a-journey..> | 2023-05-03 09:59 | 154K | |
![[IMG]](/icons/image2.gif) | psychology-an-explor..> | 2023-08-06 10:17 | 4.8K | |
![[IMG]](/icons/image2.gif) | psychology-an-explor..> | 2023-05-03 10:32 | 35K | |
![[ ]](/icons/compressed.gif) | psychology-an-explor..> | 2023-05-03 10:31 | 21K | |
![[IMG]](/icons/image2.gif) | psychology-an-introd..> | 2023-08-05 03:41 | 15K | |
![[IMG]](/icons/image2.gif) | psychology-an-introd..> | 2023-05-03 10:20 | 38K | |
![[IMG]](/icons/image2.gif) | psychology-an-introd..> | 2023-08-05 16:25 | 14K | |
![[IMG]](/icons/image2.gif) | psychology-an-introd..> | 2023-05-03 10:40 | 37K | |
![[IMG]](/icons/image2.gif) | psychology-and-life-..> | 2023-08-07 23:09 | 2.3K | |
![[IMG]](/icons/image2.gif) | psychology-and-life-..> | 2023-05-03 09:21 | 14K | |
![[ ]](/icons/compressed.gif) | psychology-and-life-..> | 2023-05-03 09:21 | 37K | |
![[IMG]](/icons/image2.gif) | psychology-applied-t..> | 2023-05-03 11:07 | 10K | |
![[IMG]](/icons/image2.gif) | psychology-carole-wa..> | 2023-08-05 01:14 | 3.3K | |
![[IMG]](/icons/image2.gif) | psychology-carole-wa..> | 2023-05-03 10:39 | 27K | |
![[ ]](/icons/compressed.gif) | psychology-carole-wa..> | 2023-05-03 10:39 | 63K | |
![[ ]](/icons/compressed.gif) | psychology-ciccarell..> | 2023-05-03 09:35 | 70K | |
![[ ]](/icons/compressed.gif) | psychology-ciccarell..> | 2023-05-03 11:03 | 60K | |
![[IMG]](/icons/image2.gif) | psychology-ciccarell..> | 2023-05-03 09:35 | 9.1K | |
![[IMG]](/icons/image2.gif) | psychology-concepts-..> | 2023-08-06 07:49 | 3.3K | |
![[IMG]](/icons/image2.gif) | psychology-concepts-..> | 2023-05-03 09:37 | 20K | |
![[ ]](/icons/compressed.gif) | psychology-concepts-..> | 2023-05-03 09:37 | 59K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-08-05 01:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-08-11 08:21 | 22K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-05-04 02:24 | 66K | |
![[ ]](/icons/compressed.gif) | psychology-core-conc..> | 2023-05-04 02:24 | 267K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-08-05 05:30 | 3.6K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-08-09 13:58 | 22K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-05-04 02:19 | 84K | |
![[ ]](/icons/compressed.gif) | psychology-core-conc..> | 2023-05-04 02:18 | 63K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-08-05 06:28 | 2.8K | |
![[IMG]](/icons/image2.gif) | psychology-core-conc..> | 2023-05-03 09:27 | 20K | |
![[ ]](/icons/compressed.gif) | psychology-core-conc..> | 2023-05-03 09:27 | 62K | |
![[IMG]](/icons/image2.gif) | psychology-criminal-..> | 2023-08-05 02:46 | 4.2K | |
![[IMG]](/icons/image2.gif) | psychology-criminal-..> | 2023-08-09 06:03 | 22K | |
![[IMG]](/icons/image2.gif) | psychology-criminal-..> | 2023-05-03 10:26 | 71K | |
![[ ]](/icons/compressed.gif) | psychology-criminal-..> | 2023-05-03 10:26 | 37K | |
![[IMG]](/icons/image2.gif) | psychology-don-hocke..> | 2023-08-06 04:17 | 3.6K | |
![[IMG]](/icons/image2.gif) | psychology-don-hocke..> | 2023-05-03 10:28 | 26K | |
![[IMG]](/icons/image2.gif) | psychology-from-inqu..> | 2023-08-08 18:23 | 3.5K | |
![[IMG]](/icons/image2.gif) | psychology-from-inqu..> | 2023-05-03 11:14 | 24K | |
![[ ]](/icons/compressed.gif) | psychology-from-inqu..> | 2023-05-03 11:14 | 60K | |
![[IMG]](/icons/image2.gif) | psychology-frontiers..> | 2023-08-06 10:16 | 3.9K | |
![[IMG]](/icons/image2.gif) | psychology-frontiers..> | 2023-08-09 13:58 | 23K | |
![[IMG]](/icons/image2.gif) | psychology-frontiers..> | 2023-05-03 10:12 | 37K | |
![[ ]](/icons/compressed.gif) | psychology-frontiers..> | 2023-05-03 10:12 | 1.2M | |
![[IMG]](/icons/image2.gif) | psychology-frontiers..> | 2023-08-05 01:09 | 3.8K | |
![[IMG]](/icons/image2.gif) | psychology-frontiers..> | 2023-05-03 10:54 | 19K | |
![[IMG]](/icons/image2.gif) | psychology-hockenbur..> | 2023-08-05 14:38 | 2.8K | |
![[IMG]](/icons/image2.gif) | psychology-hockenbur..> | 2023-05-03 10:35 | 20K | |
![[IMG]](/icons/image2.gif) | psychology-in-action..> | 2023-08-05 16:16 | 3.2K | |
![[IMG]](/icons/image2.gif) | psychology-in-action..> | 2023-05-03 10:25 | 12K | |
![[IMG]](/icons/image2.gif) | psychology-in-everyd..> | 2023-08-08 07:30 | 2.9K | |
![[IMG]](/icons/image2.gif) | psychology-in-everyd..> | 2023-05-03 09:44 | 11K | |
![[IMG]](/icons/image2.gif) | psychology-in-module..> | 2023-08-05 06:24 | 4.0K | |
![[IMG]](/icons/image2.gif) | psychology-in-module..> | 2023-08-09 06:03 | 22K | |
![[IMG]](/icons/image2.gif) | psychology-in-module..> | 2023-05-03 10:02 | 36K | |
![[ ]](/icons/compressed.gif) | psychology-in-module..> | 2023-05-03 10:02 | 93K | |
![[IMG]](/icons/image2.gif) | psychology-in-module..> | 2023-08-05 01:52 | 3.6K | |
![[IMG]](/icons/image2.gif) | psychology-in-module..> | 2023-05-03 11:08 | 25K | |
![[IMG]](/icons/image2.gif) | psychology-nairne-6t..> | 2023-08-06 11:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | psychology-nairne-6t..> | 2023-05-03 09:46 | 20K | |
![[ ]](/icons/compressed.gif) | psychology-nairne-6t..> | 2023-05-03 09:46 | 54K | |
![[IMG]](/icons/image2.gif) | psychology-of-gender..> | 2023-08-05 03:39 | 3.2K | |
![[IMG]](/icons/image2.gif) | psychology-of-gender..> | 2023-05-03 10:54 | 19K | |
![[ ]](/icons/compressed.gif) | psychology-of-gender..> | 2023-05-03 10:54 | 20K | |
![[IMG]](/icons/image2.gif) | psychology-the-scien..> | 2023-08-07 05:28 | 3.0K | |
![[IMG]](/icons/image2.gif) | psychology-the-scien..> | 2023-05-03 11:07 | 20K | |
![[ ]](/icons/compressed.gif) | psychology-the-scien..> | 2023-05-03 11:07 | 135K | |
![[IMG]](/icons/image2.gif) | psychology-the-scien..> | 2023-08-05 02:45 | 3.7K | |
![[IMG]](/icons/image2.gif) | psychology-the-scien..> | 2023-05-03 10:40 | 23K | |
![[ ]](/icons/compressed.gif) | psychology-the-scien..> | 2023-05-03 10:40 | 155K | |
![[IMG]](/icons/image2.gif) | psychology-themes-an..> | 2023-08-05 15:32 | 3.5K | |
![[IMG]](/icons/image2.gif) | psychology-themes-an..> | 2023-05-03 09:19 | 25K | |
![[ ]](/icons/compressed.gif) | psychology-themes-an..> | 2023-05-03 09:19 | 50K | |
![[IMG]](/icons/image2.gif) | psychology-themes-an..> | 2023-08-06 05:44 | 2.4K | |
![[IMG]](/icons/image2.gif) | psychology-themes-an..> | 2023-05-03 11:24 | 16K | |
![[ ]](/icons/compressed.gif) | psychology-themes-an..> | 2023-05-03 11:24 | 71K | |
![[IMG]](/icons/image2.gif) | psychology-your-life..> | 2023-08-06 11:13 | 3.8K | |
![[IMG]](/icons/image2.gif) | psychology-your-life..> | 2023-08-06 13:12 | 18K | |
![[IMG]](/icons/image2.gif) | psychology-your-life..> | 2023-05-04 01:54 | 46K | |
![[ ]](/icons/compressed.gif) | psychology-your-life..> | 2023-05-04 01:54 | 129K | |
![[IMG]](/icons/image2.gif) | psychopharmacology-e..> | 2023-08-06 06:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | psychopharmacology-e..> | 2023-05-03 09:21 | 22K | |
![[ ]](/icons/compressed.gif) | psychopharmacology-e..> | 2023-05-03 09:21 | 0 | |
![[IMG]](/icons/image2.gif) | public-finance-a-con..> | 2023-08-05 01:11 | 2.8K | |
![[IMG]](/icons/image2.gif) | public-finance-a-con..> | 2023-05-03 10:59 | 14K | |
![[IMG]](/icons/image2.gif) | public-finance-and-p..> | 2023-08-08 08:38 | 3.9K | |
![[IMG]](/icons/image2.gif) | public-finance-and-p..> | 2023-08-09 06:03 | 28K | |
![[IMG]](/icons/image2.gif) | public-finance-and-p..> | 2023-05-03 09:48 | 43K | |
![[ ]](/icons/compressed.gif) | public-finance-and-p..> | 2023-05-03 09:48 | 1.7M | |
![[IMG]](/icons/image2.gif) | public-finance-rosen..> | 2023-08-05 14:38 | 3.2K | |
![[IMG]](/icons/image2.gif) | public-finance-rosen..> | 2023-05-03 10:56 | 19K | |
![[ ]](/icons/compressed.gif) | public-finance-rosen..> | 2023-05-03 10:56 | 11K | |
![[IMG]](/icons/image2.gif) | public-health-nursin..> | 2023-08-06 03:41 | 3.4K | |
![[IMG]](/icons/image2.gif) | public-health-nursin..> | 2023-05-03 10:03 | 12K | |
![[IMG]](/icons/image2.gif) | public-speaking-find..> | 2023-08-05 03:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | public-speaking-find..> | 2023-05-03 10:58 | 14K | |
![[IMG]](/icons/image2.gif) | purchasing-and-suppl..> | 2023-08-06 11:14 | 2.4K | |
![[IMG]](/icons/image2.gif) | purchasing-and-suppl..> | 2023-05-03 10:01 | 12K | |
![[IMG]](/icons/image2.gif) | quality-management-i..> | 2023-08-05 05:17 | 2.6K | |
![[IMG]](/icons/image2.gif) | quality-management-i..> | 2023-05-03 10:35 | 15K | |
![[IMG]](/icons/image2.gif) | quality-performance-..> | 2023-08-05 15:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | quality-performance-..> | 2023-08-09 06:03 | 16K | |
![[IMG]](/icons/image2.gif) | quality-performance-..> | 2023-05-03 10:01 | 40K | |
![[ ]](/icons/compressed.gif) | quality-performance-..> | 2023-05-03 10:01 | 1.3M | |
![[IMG]](/icons/image2.gif) | quantitative-methods..> | 2023-08-05 03:37 | 3.0K | |
![[IMG]](/icons/image2.gif) | quantitative-methods..> | 2023-05-04 02:10 | 15K | |
![[ ]](/icons/compressed.gif) | quantitative-methods..> | 2023-05-04 02:10 | 21K | |
![[IMG]](/icons/image2.gif) | quantum-mechanics-1s..> | 2023-08-09 04:59 | 2.6K | |
![[IMG]](/icons/image2.gif) | quantum-mechanics-1s..> | 2023-08-09 10:13 | 13K | |
![[IMG]](/icons/image2.gif) | quantum-mechanics-1s..> | 2023-05-03 09:30 | 38K | |
![[IMG]](/icons/image2.gif) | quick-and-easy-medic..> | 2023-08-05 04:44 | 2.6K | |
![[IMG]](/icons/image2.gif) | quick-and-easy-medic..> | 2023-05-03 10:20 | 12K | |
![[IMG]](/icons/image2.gif) | qwr-100x100.jpg | 2023-08-05 02:45 | 4.0K | |
![[IMG]](/icons/image2.gif) | qwr-300x300.jpg | 2023-08-13 04:19 | 20K | |
![[IMG]](/icons/image2.gif) | qwr.jpg | 2023-05-03 10:07 | 39K | |
![[IMG]](/icons/image2.gif) | radiation-protection..> | 2023-08-06 05:43 | 2.5K | |
![[IMG]](/icons/image2.gif) | radiation-protection..> | 2023-05-03 09:18 | 14K | |
![[IMG]](/icons/image2.gif) | radiographic-image-a..> | 2023-08-06 04:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | radiographic-image-a..> | 2023-05-03 09:24 | 17K | |
![[ ]](/icons/compressed.gif) | radiographic-image-a..> | 2023-05-03 09:24 | 17K | |
![[IMG]](/icons/image2.gif) | radiographic-imaging..> | 2023-08-06 07:44 | 2.9K | |
![[IMG]](/icons/image2.gif) | radiographic-imaging..> | 2023-05-03 09:32 | 17K | |
![[IMG]](/icons/image2.gif) | radiographic-patholo..> | 2023-08-06 11:15 | 2.8K | |
![[IMG]](/icons/image2.gif) | radiographic-patholo..> | 2023-05-03 09:53 | 17K | |
![[ ]](/icons/unknown.gif) | rais13_SM_CH_01.docx | 2023-05-03 10:36 | 60K | |
![[ ]](/icons/unknown.gif) | ramont2e_rev_TIF_ch0..> | 2023-05-04 02:14 | 161K | |
![[IMG]](/icons/image2.gif) | ratio-proportion-dos..> | 2023-08-05 01:12 | 3.1K | |
![[IMG]](/icons/image2.gif) | ratio-proportion-dos..> | 2023-05-03 10:14 | 19K | |
![[ ]](/icons/compressed.gif) | ratio-proportion-dos..> | 2023-05-03 10:14 | 23K | |
![[IMG]](/icons/image2.gif) | raus-respiratory-car..> | 2023-08-06 10:15 | 3.9K | |
![[IMG]](/icons/image2.gif) | raus-respiratory-car..> | 2023-05-03 10:28 | 22K | |
![[ ]](/icons/compressed.gif) | raus-respiratory-car..> | 2023-05-03 10:28 | 16K | |
![[IMG]](/icons/image2.gif) | raven-biology-of-pla..> | 2023-08-06 09:42 | 3.2K | |
![[IMG]](/icons/image2.gif) | raven-biology-of-pla..> | 2023-05-03 09:35 | 31K | |
![[IMG]](/icons/image2.gif) | real-communication-a..> | 2023-08-05 04:37 | 4.6K | |
![[IMG]](/icons/image2.gif) | real-communication-a..> | 2023-05-03 09:49 | 31K | |
![[ ]](/icons/compressed.gif) | real-communication-a..> | 2023-05-03 09:49 | 79K | |
![[IMG]](/icons/image2.gif) | real-estate-finance-..> | 2023-08-08 16:37 | 3.8K | |
![[IMG]](/icons/image2.gif) | real-estate-finance-..> | 2023-08-08 06:42 | 20K | |
![[IMG]](/icons/image2.gif) | real-estate-finance-..> | 2023-05-03 10:30 | 55K | |
![[ ]](/icons/compressed.gif) | real-estate-finance-..> | 2023-05-03 10:30 | 118K | |
![[IMG]](/icons/image2.gif) | real-estate-principl..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | real-estate-principl..> | 2023-05-04 02:11 | 15K | |
![[IMG]](/icons/image2.gif) | real-estate-principl..> | 2023-08-05 05:29 | 4.1K | |
![[IMG]](/icons/image2.gif) | real-estate-principl..> | 2023-05-03 10:55 | 15K | |
![[ ]](/icons/unknown.gif) | reck18e_chapter01_tb..> | 2023-05-04 02:04 | 29K | |
![[IMG]](/icons/image2.gif) | recruitment-and-sele..> | 2023-08-05 14:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | recruitment-and-sele..> | 2023-05-03 09:19 | 14K | |
![[ ]](/icons/compressed.gif) | recruitment-and-sele..> | 2023-05-03 09:19 | 184K | |
![[IMG]](/icons/image2.gif) | refrigeration-air-co..> | 2023-08-06 13:11 | 3.5K | |
![[IMG]](/icons/image2.gif) | refrigeration-air-co..> | 2023-08-08 06:42 | 20K | |
![[IMG]](/icons/image2.gif) | refrigeration-air-co..> | 2023-05-03 10:35 | 52K | |
![[ ]](/icons/compressed.gif) | refrigeration-air-co..> | 2023-05-03 10:35 | 25K | |
![[ ]](/icons/compressed.gif) | reimers_finacct03_im..> | 2023-05-03 09:50 | 20K | |
![[ ]](/icons/unknown.gif) | rejda_rmi12_im01.docx | 2023-05-04 01:47 | 37K | |
![[IMG]](/icons/image2.gif) | religion-in-sociolog..> | 2023-08-06 05:44 | 4.2K | |
![[IMG]](/icons/image2.gif) | religion-in-sociolog..> | 2023-08-08 06:42 | 23K | |
![[IMG]](/icons/image2.gif) | religion-in-sociolog..> | 2023-05-03 09:41 | 37K | |
![[ ]](/icons/compressed.gif) | religion-in-sociolog..> | 2023-05-03 09:41 | 59K | |
![[IMG]](/icons/image2.gif) | religions-of-the-wor..> | 2023-08-06 13:09 | 3.5K | |
![[IMG]](/icons/image2.gif) | religions-of-the-wor..> | 2023-05-03 09:39 | 23K | |
![[IMG]](/icons/image2.gif) | research-methods-and..> | 2023-08-05 03:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | research-methods-and..> | 2023-05-04 01:55 | 16K | |
![[IMG]](/icons/image2.gif) | research-methods-des..> | 2023-08-05 01:51 | 4.5K | |
![[IMG]](/icons/image2.gif) | research-methods-des..> | 2023-05-03 09:46 | 28K | |
![[ ]](/icons/compressed.gif) | research-methods-des..> | 2023-05-03 09:46 | 22K | |
![[IMG]](/icons/image2.gif) | research-methods-psy..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | research-methods-psy..> | 2023-08-08 06:42 | 16K | |
![[IMG]](/icons/image2.gif) | research-methods-psy..> | 2023-05-03 11:17 | 39K | |
![[ ]](/icons/compressed.gif) | research-methods-psy..> | 2023-05-03 11:17 | 495K | |
![[IMG]](/icons/image2.gif) | respiratory-care-ana..> | 2023-08-08 09:18 | 3.4K | |
![[IMG]](/icons/image2.gif) | respiratory-care-ana..> | 2023-05-04 01:49 | 18K | |
![[IMG]](/icons/image2.gif) | respiratory-care-ana..> | 2023-08-05 01:56 | 3.4K | |
![[IMG]](/icons/image2.gif) | respiratory-care-ana..> | 2023-05-03 10:04 | 21K | |
![[ ]](/icons/compressed.gif) | respiratory-care-ana..> | 2023-05-03 10:04 | 16K | |
![[IMG]](/icons/image2.gif) | respiratory-disease-..> | 2023-08-05 01:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | respiratory-disease-..> | 2023-05-03 11:10 | 18K | |
![[ ]](/icons/compressed.gif) | respiratory-disease-..> | 2023-05-03 11:10 | 10K | |
![[ ]](/icons/compressed.gif) | retail-management-a-..> | 2023-05-03 13:40 | 17K | |
![[IMG]](/icons/image2.gif) | retail-management-a-..> | 2023-08-06 10:13 | 2.6K | |
![[IMG]](/icons/image2.gif) | retail-management-a-..> | 2023-05-03 09:52 | 14K | |
![[ ]](/icons/compressed.gif) | retail-management-a-..> | 2023-05-03 09:52 | 34K | |
![[IMG]](/icons/image2.gif) | retailing-dunne-7th-..> | 2023-08-09 01:58 | 3.9K | |
![[IMG]](/icons/image2.gif) | retailing-dunne-7th-..> | 2023-05-03 10:15 | 21K | |
![[ ]](/icons/compressed.gif) | retailing-dunne-7th-..> | 2023-05-03 10:15 | 21K | |
![[IMG]](/icons/image2.gif) | retailing-management..> | 2023-08-05 04:31 | 4.5K | |
![[IMG]](/icons/image2.gif) | retailing-management..> | 2023-05-03 09:27 | 26K | |
![[ ]](/icons/compressed.gif) | retailing-management..> | 2023-05-03 09:27 | 102K | |
![[IMG]](/icons/image2.gif) | risk-management-and-..> | 2023-08-05 01:13 | 3.2K | |
![[IMG]](/icons/image2.gif) | risk-management-and-..> | 2023-05-04 02:22 | 20K | |
![[ ]](/icons/compressed.gif) | risk-management-and-..> | 2023-05-04 02:22 | 9.5K | |
![[IMG]](/icons/image2.gif) | roachs-introductory-..> | 2023-08-06 04:19 | 3.5K | |
![[IMG]](/icons/image2.gif) | roachs-introductory-..> | 2023-05-03 10:30 | 16K | |
![[IMG]](/icons/image2.gif) | robbins-and-cotran-p..> | 2023-08-05 06:23 | 2.8K | |
![[IMG]](/icons/image2.gif) | robbins-and-cotran-p..> | 2023-05-03 11:19 | 18K | |
![[ ]](/icons/compressed.gif) | robbins-and-cotran-p..> | 2023-05-03 11:19 | 12K | |
![[ ]](/icons/unknown.gif) | robbins_mgmt11_tb01.doc | 2023-05-03 09:36 | 119K | |
![[ ]](/icons/unknown.gif) | robbins_mgmt12_im00.doc | 2023-05-03 10:53 | 124K | |
![[ ]](/icons/unknown.gif) | robbins_mgmt12_tb01.doc | 2023-05-03 10:52 | 98K | |
![[ ]](/icons/compressed.gif) | robbins_ob14_tif01.zip | 2023-05-03 09:48 | 36K | |
![[ ]](/icons/unknown.gif) | robbins_ob16_im_01.docx | 2023-05-03 09:59 | 130K | |
![[ ]](/icons/unknown.gif) | rsh_qam11_ism_ch01.doc | 2023-05-03 09:30 | 66K | |
![[ ]](/icons/unknown.gif) | rsh_qam11_tif_01.doc | 2023-05-03 09:29 | 46K | |
![[ ]](/icons/layout.gif) | rubenstein-12e-IRM-c..> | 2023-05-03 10:36 | 294K | |
![[IMG]](/icons/image2.gif) | ruppels-manual-of-pu..> | 2023-08-05 02:45 | 2.9K | |
![[IMG]](/icons/image2.gif) | ruppels-manual-of-pu..> | 2023-05-03 10:28 | 16K | |
![[IMG]](/icons/image2.gif) | s100744232698534581_..> | 2023-08-06 09:40 | 2.7K | |
![[IMG]](/icons/image2.gif) | s100744232698534581_..> | 2023-05-03 10:46 | 13K | |
![[IMG]](/icons/image2.gif) | s100744232698534581_..> | 2023-08-08 07:33 | 2.7K | |
![[IMG]](/icons/image2.gif) | s100744232698534581_..> | 2023-05-03 10:45 | 13K | |
![[IMG]](/icons/image2.gif) | safianlci_1e19tlm_nm..> | 2023-05-04 02:14 | 15K | |
![[ ]](/icons/compressed.gif) | saladin-7e-anatomy-p..> | 2023-05-03 09:56 | 13K | |
![[ ]](/icons/layout.gif) | samle-9789812548832.pdf | 2023-05-03 09:21 | 61K | |
![[ ]](/icons/unknown.gif) | sample-01_Test_Bank.doc | 2023-05-03 11:20 | 559K | |
![[ ]](/icons/layout.gif) | sample-0130859559.pdf | 2023-05-04 02:12 | 55K | |
![[ ]](/icons/layout.gif) | sample-0131194046.pdf | 2023-05-04 02:14 | 296K | |
![[ ]](/icons/compressed.gif) | sample-0131465325.zip | 2023-05-03 09:58 | 972 | |
![[ ]](/icons/layout.gif) | sample-0132145189.pdf | 2023-05-03 09:57 | 1.8M | |
![[ ]](/icons/layout.gif) | sample-0132916525.pdf | 2023-05-03 10:37 | 260K | |
![[ ]](/icons/layout.gif) | sample-0133805913.pdf | 2023-05-03 09:45 | 207K | |
![[ ]](/icons/layout.gif) | sample-0133864979.pdf | 2023-05-03 10:09 | 108K | |
![[ ]](/icons/layout.gif) | sample-0134093410-ts..> | 2023-05-03 11:21 | 123K | |
![[ ]](/icons/layout.gif) | sample-0136072240.pdf | 2023-05-03 10:23 | 944K | |
![[ ]](/icons/layout.gif) | sample-0321545893.pdf | 2023-05-03 09:41 | 370K | |
![[ ]](/icons/layout.gif) | sample-0321577442.pdf | 2023-05-03 10:21 | 301K | |
![[ ]](/icons/layout.gif) | sample-0321637739.pdf | 2023-05-03 11:04 | 669K | |
![[ ]](/icons/layout.gif) | sample-0321640772.pdf | 2023-05-03 09:44 | 306K | |
![[ ]](/icons/layout.gif) | sample-0321953312.pdf | 2023-05-04 02:29 | 1.1M | |
![[ ]](/icons/layout.gif) | sample-0393918297-ts..> | 2023-05-03 10:21 | 161K | |
![[ ]](/icons/layout.gif) | sample-2019-TEAS-SCI..> | 2023-05-04 02:12 | 276K | |
![[ ]](/icons/layout.gif) | sample-1412967643-ts..> | 2023-05-03 09:40 | 84K | |
![[ ]](/icons/layout.gif) | sample-9780060000387..> | 2023-05-03 10:58 | 251K | |
![[ ]](/icons/layout.gif) | sample-9780072424430..> | 2023-05-03 10:49 | 1.1M | |
![[ ]](/icons/layout.gif) | sample-9780130402684..> | 2023-05-03 09:28 | 3.1M | |
![[ ]](/icons/layout.gif) | sample-9780131118928..> | 2023-05-04 01:53 | 484K | |
![[ ]](/icons/layout.gif) | sample-9780131186552..> | 2023-05-03 09:47 | 116K | |
![[ ]](/icons/unknown.gif) | sample-9780132064187..> | 2023-05-03 10:48 | 18K | |
![[ ]](/icons/compressed.gif) | sample-9780133773927..> | 2023-05-03 11:04 | 29K | |
![[ ]](/icons/layout.gif) | sample-9780133976892..> | 2023-05-03 13:41 | 708K | |
![[ ]](/icons/unknown.gif) | sample-9780134548685..> | 2023-05-03 11:11 | 26K | |
![[ ]](/icons/layout.gif) | sample-9780134684901..> | 2023-05-03 10:55 | 118K | |
![[ ]](/icons/layout.gif) | sample-9780134697024..> | 2023-05-03 10:52 | 164K | |
![[ ]](/icons/unknown.gif) | sample-9780134802763..> | 2023-05-04 02:04 | 20K | |
![[ ]](/icons/layout.gif) | sample-9780137099818..> | 2023-05-03 13:44 | 1.9M | |
![[ ]](/icons/layout.gif) | sample-9780137128426..> | 2023-05-03 13:41 | 583K | |
![[ ]](/icons/unknown.gif) | sample-9780205626076..> | 2023-05-04 01:48 | 24K | |
![[ ]](/icons/layout.gif) | sample-9780205638000..> | 2023-05-04 01:51 | 115K | |
![[ ]](/icons/layout.gif) | sample-9780321149015..> | 2023-05-03 14:04 | 198K | |
![[ ]](/icons/layout.gif) | sample-9780321738639..> | 2023-05-03 10:13 | 305K | |
![[ ]](/icons/layout.gif) | sample-9780321747730..> | 2023-05-03 10:01 | 571K | |
![[ ]](/icons/unknown.gif) | sample-9780393668179..> | 2023-05-03 13:43 | 719K | |
![[ ]](/icons/layout.gif) | sample-9780805304022..> | 2023-05-04 02:10 | 83K | |
![[ ]](/icons/unknown.gif) | sample-9781119392200..> | 2023-05-04 02:03 | 18K | |
![[ ]](/icons/layout.gif) | sample-9781119497110..> | 2023-05-04 02:02 | 654K | |
![[ ]](/icons/unknown.gif) | sample-9781259654657..> | 2023-05-04 02:17 | 23K | |
![[ ]](/icons/unknown.gif) | sample-9781260247824..> | 2023-05-04 01:49 | 21K | |
![[ ]](/icons/unknown.gif) | sample-9781260247978..> | 2023-05-04 02:16 | 19K | |
![[ ]](/icons/layout.gif) | sample-9781292127606..> | 2023-05-04 01:52 | 197K | |
![[ ]](/icons/layout.gif) | sample-9781305266636..> | 2023-05-03 13:42 | 331K | |
![[ ]](/icons/layout.gif) | sample-9781337625340..> | 2023-05-03 13:44 | 569K | |
![[ ]](/icons/layout.gif) | sample-ATI-Rn-Matern..> | 2023-05-04 02:07 | 206K | |
![[ ]](/icons/layout.gif) | sample-ATI-Rn-Med-Su..> | 2023-05-04 02:07 | 1.1M | |
![[ ]](/icons/compressed.gif) | sample-Abnormal-Psyc..> | 2023-05-03 11:01 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Adventures-in..> | 2023-05-03 10:06 | 19K | |
![[ ]](/icons/layout.gif) | sample-Business-Law-..> | 2023-05-03 09:30 | 152K | |
![[ ]](/icons/layout.gif) | sample-Calculus-Lars..> | 2023-05-03 09:19 | 2.1M | |
![[ ]](/icons/unknown.gif) | sample-Campbell-Biol..> | 2023-05-03 09:58 | 278K | |
![[ ]](/icons/layout.gif) | sample-Campbell-Biol..> | 2023-05-03 10:01 | 404K | |
![[ ]](/icons/unknown.gif) | sample-Case-Studies-..> | 2023-05-03 10:45 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Chemistry-The..> | 2023-05-03 10:23 | 748K | |
![[ ]](/icons/layout.gif) | sample-Cosmic-Perspe..> | 2023-05-04 01:53 | 1.1M | |
![[ ]](/icons/unknown.gif) | sample-Cost-Accounti..> | 2023-05-03 10:35 | 16K | |
![[ ]](/icons/unknown.gif) | sample-Diversity-in-..> | 2023-05-03 10:05 | 19K | |
![[ ]](/icons/unknown.gif) | sample-Educational-P..> | 2023-05-03 10:26 | 22K | |
![[ ]](/icons/layout.gif) | sample-Eiteman_MBF_1..> | 2023-05-04 02:02 | 110K | |
![[ ]](/icons/compressed.gif) | sample-Elementary-St..> | 2023-05-03 10:36 | 20K | |
![[ ]](/icons/layout.gif) | sample-Elementary-St..> | 2023-05-03 09:47 | 343K | |
![[ ]](/icons/layout.gif) | sample-Elementary-St..> | 2023-05-03 09:57 | 88K | |
![[ ]](/icons/layout.gif) | sample-Elementary-St..> | 2023-05-03 09:47 | 46K | |
![[ ]](/icons/layout.gif) | sample-Elementary-St..> | 2023-05-03 11:09 | 124K | |
![[ ]](/icons/unknown.gif) | sample-End_of_Book_Q..> | 2023-05-04 02:14 | 17K | |
![[ ]](/icons/layout.gif) | sample-Engineering-M..> | 2023-05-04 01:47 | 210K | |
![[ ]](/icons/layout.gif) | sample-Essentials-of..> | 2023-05-04 01:49 | 188K | |
![[ ]](/icons/layout.gif) | sample-Family-Intera..> | 2023-05-03 10:04 | 286K | |
![[ ]](/icons/layout.gif) | sample-Financial-Acc..> | 2023-05-03 09:34 | 409K | |
![[ ]](/icons/unknown.gif) | sample-Financial-Sta..> | 2023-05-03 11:12 | 36K | |
![[ ]](/icons/unknown.gif) | sample-Fundamental-A..> | 2023-05-03 13:44 | 17K | |
![[ ]](/icons/layout.gif) | sample-Fundamentals-..> | 2023-05-03 10:44 | 316K | |
![[ ]](/icons/layout.gif) | sample-HB_C11_ISM_01..> | 2023-05-03 10:45 | 368K | |
![[ ]](/icons/layout.gif) | sample-Hesi-RN-Med-S..> | 2023-05-04 02:12 | 370K | |
![[ ]](/icons/unknown.gif) | sample-IMHolesEssenL..> | 2023-05-04 01:53 | 73K | |
![[ ]](/icons/unknown.gif) | sample-Instructor-Ma..> | 2023-05-03 09:28 | 17K | |
![[ ]](/icons/compressed.gif) | sample-Instructor-Ma..> | 2023-05-03 09:48 | 31K | |
![[ ]](/icons/unknown.gif) | sample-Instructor-Ma..> | 2023-05-03 09:24 | 322K | |
![[ ]](/icons/layout.gif) | sample-Intermediate-..> | 2023-05-03 09:24 | 202K | |
![[ ]](/icons/layout.gif) | sample-Interpersonal..> | 2023-05-03 10:14 | 75K | |
![[ ]](/icons/unknown.gif) | sample-Introduction-..> | 2023-05-04 01:48 | 40K | |
![[ ]](/icons/layout.gif) | sample-Macroeconomic..> | 2023-05-03 09:48 | 298K | |
![[ ]](/icons/layout.gif) | sample-Macroeconomic..> | 2023-05-04 02:26 | 718K | |
![[ ]](/icons/unknown.gif) | sample-Managerial-Ac..> | 2023-05-03 09:47 | 15K | |
![[ ]](/icons/unknown.gif) | sample-Managerial-Ac..> | 2023-05-03 09:28 | 1.7M | |
![[ ]](/icons/unknown.gif) | sample-Mathematics-w..> | 2023-05-03 09:33 | 38K | |
![[ ]](/icons/layout.gif) | sample-Mechanics-of-..> | 2023-05-03 10:24 | 131K | |
![[ ]](/icons/layout.gif) | sample-Microeconomic..> | 2023-05-03 10:17 | 647K | |
![[ ]](/icons/unknown.gif) | sample-Microeconomic..> | 2023-05-03 09:57 | 183K | |
![[ ]](/icons/unknown.gif) | sample-Microeconomic..> | 2023-05-03 10:24 | 15K | |
![[ ]](/icons/layout.gif) | sample-NCLEX-RN-ACTU..> | 2023-05-04 02:20 | 64K | |
![[ ]](/icons/unknown.gif) | sample-Operations-Ma..> | 2023-05-03 10:09 | 117K | |
![[ ]](/icons/unknown.gif) | sample-Operations-Ma..> | 2023-05-04 02:29 | 419K | |
![[ ]](/icons/layout.gif) | sample-Personal-Fina..> | 2023-05-03 09:56 | 1.4M | |
![[ ]](/icons/compressed.gif) | sample-Pharmacology-..> | 2023-05-03 11:06 | 4.5K | |
![[ ]](/icons/layout.gif) | sample-Physics-for-S..> | 2023-05-03 10:54 | 140K | |
![[ ]](/icons/layout.gif) | sample-Precalculus-6..> | 2023-05-03 09:20 | 137K | |
![[ ]](/icons/layout.gif) | sample-Principles-of..> | 2023-05-03 10:31 | 164K | |
![[ ]](/icons/compressed.gif) | sample-Problem-Solut..> | 2023-05-03 11:14 | 40K | |
![[ ]](/icons/unknown.gif) | sample-Professionali..> | 2023-05-03 09:51 | 19K | |
![[ ]](/icons/unknown.gif) | sample-Quantitative-..> | 2023-05-03 09:37 | 46K | |
![[ ]](/icons/unknown.gif) | sample-Simchi-Levi3E..> | 2023-05-03 10:03 | 78K | |
![[ ]](/icons/layout.gif) | sample-Small-Group-a..> | 2023-05-03 10:04 | 428K | |
![[ ]](/icons/unknown.gif) | sample-Social-Geront..> | 2023-05-03 09:36 | 20K | |
![[ ]](/icons/compressed.gif) | sample-Solution-Manu..> | 2023-05-03 11:01 | 106K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:51 | 681K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:20 | 2.4M | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 09:21 | 19K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:10 | 291K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:48 | 21K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:24 | 149K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:39 | 1.0M | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:52 | 16K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:16 | 248K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:02 | 1.7M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:41 | 662K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 01:50 | 18K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:06 | 388K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:13 | 1.4M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:14 | 668K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:18 | 166K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:53 | 1.3M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:52 | 458K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:24 | 1.2M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:30 | 1.1M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:36 | 749K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 01:50 | 84K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:02 | 114K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 100K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:55 | 338K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:59 | 591K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 09:52 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 101K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:22 | 161K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:50 | 509K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:50 | 281K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:16 | 316K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:46 | 298K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 95K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:51 | 448K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:24 | 23K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:13 | 101K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 11:20 | 17K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 1.2M | |
![[ ]](/icons/compressed.gif) | sample-Solution-Manu..> | 2023-05-03 11:13 | 45K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 11:03 | 16K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 01:58 | 19K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 02:28 | 28K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 364K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 11:08 | 19K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:45 | 364K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:36 | 242K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:50 | 403K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:36 | 241K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 01:49 | 130K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:30 | 462K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:52 | 454K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:21 | 238K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:15 | 1.3M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:44 | 73K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:14 | 95K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:32 | 148K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:54 | 15K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:49 | 422K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:33 | 595K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 109K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:04 | 1.4M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:32 | 779K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:09 | 105K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 11:06 | 19K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:20 | 477K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:51 | 286K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:16 | 75K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:27 | 426K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:13 | 1.6M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:02 | 1.8M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:12 | 665K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:15 | 2.3M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:28 | 98K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 02:13 | 26K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:13 | 315K | |
![[ ]](/icons/compressed.gif) | sample-Solution-Manu..> | 2023-05-03 10:17 | 2.3K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:24 | 624K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:49 | 296K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:44 | 296K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:23 | 357K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:10 | 82K | |
![[ ]](/icons/compressed.gif) | sample-Solution-Manu..> | 2023-05-04 02:07 | 14K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:11 | 87K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:20 | 2.1M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:27 | 421K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 09:54 | 721K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:27 | 700K | |
![[ ]](/icons/compressed.gif) | sample-Solution-Manu..> | 2023-05-03 10:03 | 51K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 51K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:37 | 706K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 01:52 | 23K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 02:03 | 87K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 09:59 | 15K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:25 | 73K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:11 | 175K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:44 | 683K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:43 | 2.2M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:21 | 376K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:33 | 1.8M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:48 | 950K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:37 | 301K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:04 | 414K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:25 | 2.0M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 11:09 | 303K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 13:42 | 972K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:46 | 2.1M | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 13:43 | 307K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 09:58 | 22K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 01:56 | 70K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-04 02:10 | 16K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:44 | 273K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 09:26 | 130K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:12 | 212K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 11:17 | 18K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:12 | 480K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:13 | 107K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:41 | 1.3M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:49 | 133K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:24 | 23K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:45 | 605K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:18 | 167K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:35 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Solution-Manu..> | 2023-05-03 10:01 | 22K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 13:44 | 153K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:02 | 382K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:13 | 1.0M | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 14:06 | 183K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:00 | 630K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-03 10:35 | 700K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:18 | 357K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:15 | 176K | |
![[ ]](/icons/layout.gif) | sample-Solution-Manu..> | 2023-05-04 02:00 | 117K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 09:38 | 669K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 13:42 | 2.2M | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 09:52 | 347K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 13:44 | 2.6M | |
![[ ]](/icons/compressed.gif) | sample-Solution-manu..> | 2023-05-03 11:01 | 377K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-04 01:56 | 1.2M | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-04 02:20 | 528K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 10:05 | 428K | |
![[ ]](/icons/unknown.gif) | sample-Solution-manu..> | 2023-05-03 11:26 | 23K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 09:22 | 1.7M | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 10:34 | 400K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 09:49 | 348K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 09:52 | 276K | |
![[ ]](/icons/layout.gif) | sample-Solution-manu..> | 2023-05-03 10:36 | 321K | |
![[ ]](/icons/unknown.gif) | sample-Solutions-Man..> | 2023-05-03 10:26 | 25K | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 09:21 | 74K | |
![[ ]](/icons/compressed.gif) | sample-Solutions-Man..> | 2023-05-03 09:27 | 495K | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 10:19 | 61K | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-04 01:47 | 247K | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 09:39 | 91K | |
![[ ]](/icons/unknown.gif) | sample-Solutions-Man..> | 2023-05-03 09:57 | 109K | |
![[ ]](/icons/unknown.gif) | sample-Solutions-Man..> | 2023-05-03 10:14 | 611K | |
![[ ]](/icons/compressed.gif) | sample-Solutions-Man..> | 2023-05-04 01:48 | 4.7M | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-04 01:51 | 1.9M | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-04 01:54 | 1.4M | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 09:33 | 1.8M | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 10:06 | 196K | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-03 10:41 | 1.6M | |
![[ ]](/icons/layout.gif) | sample-Solutions-Man..> | 2023-05-04 02:27 | 134K | |
![[ ]](/icons/layout.gif) | sample-Statistics-fo..> | 2023-05-03 09:43 | 60K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-Cal..> | 2023-05-03 09:57 | 432K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 11:01 | 944K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 10:25 | 145K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 13:44 | 23K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 13:43 | 107K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 09:49 | 19K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 09:44 | 63K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-04 02:06 | 17K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 13:42 | 1.6M | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-04 02:22 | 333K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-04 02:05 | 23K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-04 01:50 | 17K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 09:37 | 111K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 09:41 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 09:34 | 19K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-For..> | 2023-05-04 02:22 | 77K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 10:59 | 15K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-03 10:23 | 343K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-For..> | 2023-05-04 01:54 | 133K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-04 02:22 | 32K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-For..> | 2023-05-03 09:36 | 16K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-Gou..> | 2023-05-03 09:35 | 281K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-Sei..> | 2023-05-04 02:06 | 7.1K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-Sup..> | 2023-05-03 13:44 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-Und..> | 2023-05-03 10:01 | 14K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 01:58 | 398K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:38 | 439K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:24 | 16K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 01:50 | 375K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:25 | 86K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-03 13:42 | 62K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:33 | 15K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:31 | 16K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:01 | 37K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:41 | 174K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:19 | 17K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:38 | 15K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:11 | 19K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:23 | 317K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:24 | 65K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:31 | 21K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-03 09:42 | 7.7K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:10 | 30K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 13:42 | 757K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:31 | 17K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:36 | 133K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:20 | 109K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 01:58 | 20K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:24 | 23K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:09 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:08 | 17K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:20 | 23K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:24 | 19K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-04 02:15 | 7.8K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 11:18 | 159K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-03 09:44 | 48K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:16 | 16K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:13 | 249K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:22 | 21K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:22 | 3.3M | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:06 | 19K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:58 | 28K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:07 | 85K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:23 | 18K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:39 | 211K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 01:48 | 22K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:07 | 25K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:25 | 409K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:34 | 127K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:40 | 62K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 01:50 | 16K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:25 | 732K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 11:08 | 144K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-03 11:16 | 45K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:37 | 16K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:15 | 17K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:56 | 392K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:04 | 135K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 11:15 | 207K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 11:18 | 212K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:50 | 16K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:08 | 58K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:05 | 316K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:27 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:45 | 21K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 11:08 | 303K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 01:53 | 175K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-04 01:52 | 40K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 13:44 | 1.1M | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-04 02:22 | 24K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:47 | 21K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:59 | 428K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:18 | 354K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:22 | 381K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:20 | 266K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-04 02:19 | 60K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:37 | 19K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:33 | 389K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:08 | 307K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 09:38 | 301K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:06 | 22K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:18 | 155K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 10:48 | 22K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 11:11 | 17K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:28 | 22K | |
![[ ]](/icons/unknown.gif) | sample-Test-Bank-for..> | 2023-05-03 09:36 | 21K | |
![[ ]](/icons/layout.gif) | sample-Test-Bank-for..> | 2023-05-03 10:29 | 125K | |
![[ ]](/icons/compressed.gif) | sample-Test-Bank-for..> | 2023-05-04 02:10 | 7.2K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Adv..> | 2023-05-04 01:52 | 81K | |
![[IMG]](/icons/image2.gif) | sample-Test-bank-Bec..> | 2023-05-04 02:06 | 86K | |
![[IMG]](/icons/image2.gif) | sample-Test-bank-Bec..> | 2023-05-04 01:52 | 86K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-CUR..> | 2023-05-04 02:07 | 449K | |
![[ ]](/icons/unknown.gif) | sample-Test-bank-Com..> | 2023-05-04 02:04 | 11K | |
![[ ]](/icons/unknown.gif) | sample-Test-bank-Fun..> | 2023-05-04 02:04 | 15K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Hac..> | 2023-05-04 02:05 | 2.8M | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Hea..> | 2023-05-04 02:05 | 207K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Kap..> | 2023-05-04 02:04 | 119K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Nur..> | 2023-05-04 02:04 | 1.2M | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Pat..> | 2023-05-04 02:06 | 205K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Pha..> | 2023-05-04 01:52 | 123K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-Pha..> | 2023-05-04 02:07 | 460K | |
![[ ]](/icons/unknown.gif) | sample-Test-bank-for..> | 2023-05-03 09:42 | 21K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-for..> | 2023-05-03 10:27 | 364K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-for..> | 2023-05-03 10:44 | 56K | |
![[ ]](/icons/layout.gif) | sample-Test-bank-for..> | 2023-05-03 11:21 | 400K | |
![[ ]](/icons/unknown.gif) | sample-Test-bank-for..> | 2023-05-03 10:09 | 18K | |
![[ ]](/icons/unknown.gif) | sample-Test-bank-for..> | 2023-05-03 13:42 | 19K | |
![[ ]](/icons/unknown.gif) | sample-Theory-and-Pr..> | 2023-05-03 09:21 | 19K | |
![[ ]](/icons/unknown.gif) | sample-UB11e.doc | 2023-05-03 10:12 | 112K | |
![[ ]](/icons/layout.gif) | sample-Womens-Gyneco..> | 2023-05-03 13:41 | 0 | |
![[ ]](/icons/layout.gif) | sample-acctg12e_sm_C..> | 2023-05-03 11:18 | 440K | |
![[ ]](/icons/layout.gif) | sample-business-math..> | 2023-05-03 10:22 | 116K | |
![[ ]](/icons/compressed.gif) | sample-elementary-st..> | 2023-05-03 09:33 | 1.5M | |
![[ ]](/icons/compressed.gif) | sample-for-psycholog..> | 2023-05-03 11:07 | 424K | |
![[ ]](/icons/layout.gif) | sample-sm-0137134738..> | 2023-05-03 09:57 | 309K | |
![[ ]](/icons/layout.gif) | sample-sm-0321748999..> | 2023-05-03 10:28 | 659K | |
![[ ]](/icons/unknown.gif) | sample-solution-manu..> | 2023-05-03 10:05 | 749K | |
![[ ]](/icons/compressed.gif) | sample-test-bank-for..> | 2023-05-04 02:01 | 60K | |
![[ ]](/icons/layout.gif) | sample-test-bank-for..> | 2023-05-03 09:34 | 158K | |
![[ ]](/icons/layout.gif) | sample-the-art-of-se..> | 2023-05-04 01:49 | 133K | |
![[ ]](/icons/unknown.gif) | sample-williams-basi..> | 2023-05-03 09:46 | 83K | |
![[ ]](/icons/unknown.gif) | sanderson3e_TB_ch01...> | 2023-05-03 13:44 | 33K | |
![[ ]](/icons/unknown.gif) | sanple-Test-Bank-for..> | 2023-05-03 11:18 | 109K | |
![[IMG]](/icons/image2.gif) | santrockado8e19mb_nm..> | 2023-05-04 02:21 | 16K | |
![[ ]](/icons/compressed.gif) | saunders-comprehensi..> | 2023-05-03 09:20 | 13K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-08-06 07:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-05-03 09:20 | 17K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-08-07 05:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-05-03 10:23 | 25K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-08-08 21:59 | 4.8K | |
![[ ]](/icons/layout.gif) | saunders-comprehensi..> | 2023-05-03 10:30 | 655K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-08-08 19:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-05-04 01:53 | 11K | |
![[IMG]](/icons/image2.gif) | saunders-comprehensi..> | 2023-05-03 10:30 | 33K | |
![[ ]](/icons/unknown.gif) | scarb_eesbm11_tb01.doc | 2023-05-03 11:06 | 73K | |
![[ ]](/icons/unknown.gif) | schaefer9ebrief_tb_c..> | 2023-05-03 10:25 | 99K | |
![[IMG]](/icons/image2.gif) | science-of-nutrition..> | 2023-08-05 05:30 | 4.4K | |
![[IMG]](/icons/image2.gif) | science-of-nutrition..> | 2023-05-03 09:44 | 29K | |
![[ ]](/icons/compressed.gif) | science-of-nutrition..> | 2023-05-03 09:44 | 15K | |
![[IMG]](/icons/image2.gif) | scientific-american-..> | 2023-08-08 22:59 | 4.7K | |
![[IMG]](/icons/image2.gif) | scientific-american-..> | 2023-08-08 20:08 | 32K | |
![[IMG]](/icons/image2.gif) | scientific-american-..> | 2023-05-03 10:43 | 52K | |
![[ ]](/icons/compressed.gif) | scientific-american-..> | 2023-05-03 10:43 | 1.7M | |
![[IMG]](/icons/image2.gif) | scutchfield-kecks-pr..> | 2023-08-05 14:38 | 4.2K | |
![[IMG]](/icons/image2.gif) | scutchfield-kecks-pr..> | 2023-08-06 07:46 | 19K | |
![[IMG]](/icons/image2.gif) | scutchfield-kecks-pr..> | 2023-05-03 11:24 | 48K | |
![[ ]](/icons/compressed.gif) | scutchfield-kecks-pr..> | 2023-05-03 11:24 | 8.2K | |
![[IMG]](/icons/image2.gif) | sectional-anatomy-fo..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | sectional-anatomy-fo..> | 2023-05-03 09:23 | 15K | |
![[IMG]](/icons/image2.gif) | seeing-sociology-an-..> | 2023-08-05 14:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | seeing-sociology-an-..> | 2023-05-03 11:09 | 19K | |
![[ ]](/icons/compressed.gif) | seeing-sociology-an-..> | 2023-05-03 11:09 | 34K | |
![[IMG]](/icons/image2.gif) | seeing-through-stati..> | 2023-08-05 01:51 | 3.3K | |
![[IMG]](/icons/image2.gif) | seeing-through-stati..> | 2023-08-08 20:08 | 17K | |
![[IMG]](/icons/image2.gif) | seeing-through-stati..> | 2023-05-03 09:41 | 46K | |
![[ ]](/icons/compressed.gif) | seeing-through-stati..> | 2023-05-03 09:41 | 228K | |
![[IMG]](/icons/image2.gif) | seeleys-anatomy-and-..> | 2023-08-05 17:19 | 3.1K | |
![[IMG]](/icons/image2.gif) | seeleys-anatomy-and-..> | 2023-05-03 10:43 | 17K | |
![[ ]](/icons/compressed.gif) | seeleys-anatomy-and-..> | 2023-05-03 10:43 | 104K | |
![[IMG]](/icons/image2.gif) | seeleys-anatomy-phys..> | 2023-08-05 15:30 | 4.0K | |
![[IMG]](/icons/image2.gif) | seeleys-anatomy-phys..> | 2023-08-08 20:08 | 24K | |
![[IMG]](/icons/image2.gif) | seeleys-anatomy-phys..> | 2023-05-03 09:49 | 68K | |
![[ ]](/icons/compressed.gif) | seeleys-anatomy-phys..> | 2023-05-03 09:49 | 210K | |
![[IMG]](/icons/image2.gif) | seeleys-essentials-a..> | 2023-08-05 15:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | seeleys-essentials-a..> | 2023-08-08 20:08 | 16K | |
![[IMG]](/icons/image2.gif) | seeleys-essentials-a..> | 2023-05-04 02:12 | 45K | |
![[ ]](/icons/compressed.gif) | seeleys-essentials-a..> | 2023-05-04 02:12 | 90K | |
![[IMG]](/icons/image2.gif) | seeleys-principles-o..> | 2023-08-06 04:21 | 2.4K | |
![[IMG]](/icons/image2.gif) | seeleys-principles-o..> | 2023-05-03 09:28 | 14K | |
![[ ]](/icons/compressed.gif) | seeleys-principles-o..> | 2023-05-03 09:28 | 159K | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-08-05 14:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-08-08 20:08 | 20K | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-05-03 09:20 | 49K | |
![[ ]](/icons/compressed.gif) | sell-4-4th-edition-i..> | 2023-05-03 09:20 | 1.1M | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-08-06 04:11 | 3.8K | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-08-08 20:08 | 20K | |
![[IMG]](/icons/image2.gif) | sell-4-4th-edition-i..> | 2023-05-03 10:28 | 50K | |
![[ ]](/icons/compressed.gif) | sell-4-4th-edition-i..> | 2023-05-03 10:28 | 253K | |
![[IMG]](/icons/image2.gif) | selling-building-par..> | 2023-08-05 15:30 | 2.8K | |
![[IMG]](/icons/image2.gif) | selling-building-par..> | 2023-08-08 20:08 | 14K | |
![[IMG]](/icons/image2.gif) | selling-building-par..> | 2023-05-03 10:41 | 35K | |
![[ ]](/icons/compressed.gif) | selling-building-par..> | 2023-05-03 10:41 | 323K | |
![[ ]](/icons/compressed.gif) | selling-building-par..> | 2023-05-03 13:42 | 13K | |
![[IMG]](/icons/image2.gif) | selling-building-par..> | 2023-08-05 15:34 | 3.4K | |
![[IMG]](/icons/image2.gif) | selling-building-par..> | 2023-05-03 10:01 | 20K | |
![[ ]](/icons/compressed.gif) | selling-building-par..> | 2023-05-03 10:01 | 78K | |
![[IMG]](/icons/image2.gif) | sensation-and-percep..> | 2023-08-08 21:06 | 3.1K | |
![[IMG]](/icons/image2.gif) | sensation-and-percep..> | 2023-05-03 10:19 | 16K | |
![[ ]](/icons/compressed.gif) | sensation-and-percep..> | 2023-05-03 10:19 | 150K | |
![[IMG]](/icons/image2.gif) | sensation-and-percep..> | 2023-08-06 13:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | sensation-and-percep..> | 2023-05-03 11:01 | 24K | |
![[ ]](/icons/compressed.gif) | sensation-and-percep..> | 2023-05-03 11:01 | 16K | |
![[IMG]](/icons/image2.gif) | separation-100x100.jpg | 2023-08-05 14:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | separation.jpg | 2023-05-03 09:26 | 15K | |
![[IMG]](/icons/image2.gif) | serial-murderers-and..> | 2023-08-06 07:45 | 4.1K | |
![[IMG]](/icons/image2.gif) | serial-murderers-and..> | 2023-05-03 09:24 | 23K | |
![[IMG]](/icons/image2.gif) | service-management-j..> | 2023-08-06 11:14 | 2.8K | |
![[IMG]](/icons/image2.gif) | service-management-j..> | 2023-05-03 09:28 | 16K | |
![[ ]](/icons/compressed.gif) | service-management-j..> | 2023-05-03 09:28 | 13K | |
![[IMG]](/icons/image2.gif) | services-marketing-7..> | 2023-08-05 16:23 | 4.8K | |
![[IMG]](/icons/image2.gif) | services-marketing-7..> | 2023-08-08 20:08 | 26K | |
![[IMG]](/icons/image2.gif) | services-marketing-7..> | 2023-05-03 10:49 | 63K | |
![[ ]](/icons/compressed.gif) | services-marketing-7..> | 2023-05-03 10:49 | 82K | |
![[IMG]](/icons/image2.gif) | services-marketing-z..> | 2023-08-05 15:30 | 3.7K | |
![[IMG]](/icons/image2.gif) | services-marketing-z..> | 2023-05-03 10:06 | 22K | |
![[ ]](/icons/compressed.gif) | services-marketing-z..> | 2023-05-03 10:06 | 23K | |
![[IMG]](/icons/image2.gif) | shelly-cashman-serie..> | 2023-08-05 04:35 | 3.0K | |
![[IMG]](/icons/image2.gif) | shelly-cashman-serie..> | 2023-08-08 20:08 | 19K | |
![[IMG]](/icons/image2.gif) | shelly-cashman-serie..> | 2023-05-03 10:33 | 56K | |
![[ ]](/icons/compressed.gif) | shelly-cashman-serie..> | 2023-05-03 10:33 | 65K | |
![[ ]](/icons/unknown.gif) | siegel_ECJ_10e_IM_ch..> | 2023-05-03 10:09 | 53K | |
![[IMG]](/icons/image2.gif) | signals-systems-anal..> | 2023-08-05 03:40 | 3.8K | |
![[IMG]](/icons/image2.gif) | signals-systems-anal..> | 2023-08-12 03:57 | 23K | |
![[IMG]](/icons/image2.gif) | signals-systems-anal..> | 2023-05-03 10:01 | 58K | |
![[ ]](/icons/compressed.gif) | signals-systems-anal..> | 2023-05-03 10:00 | 462K | |
![[IMG]](/icons/image2.gif) | skills-clinical-nurs..> | 2023-08-05 02:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | skills-clinical-nurs..> | 2023-08-12 03:57 | 13K | |
![[IMG]](/icons/image2.gif) | skills-clinical-nurs..> | 2023-05-03 10:23 | 47K | |
![[ ]](/icons/compressed.gif) | skills-clinical-nurs..> | 2023-05-03 10:23 | 235K | |
![[IMG]](/icons/image2.gif) | slack-operations_man..> | 2023-05-04 02:20 | 41K | |
![[ ]](/icons/unknown.gif) | slater12e_ch01_sm.doc | 2023-05-03 10:18 | 1.2M | |
![[ ]](/icons/compressed.gif) | slater_CA14_sm_01.zip | 2023-05-03 13:43 | 165K | |
![[ ]](/icons/compressed.gif) | sm-0077422406-fundam..> | 2023-05-03 09:51 | 126K | |
![[ ]](/icons/compressed.gif) | sm-0077862279-fundam..> | 2023-05-03 09:58 | 30K | |
![[ ]](/icons/compressed.gif) | sm-013061792x-advanc..> | 2023-05-03 09:45 | 535K | |
![[ ]](/icons/compressed.gif) | sm-0131848682-introd..> | 2023-05-03 09:57 | 101K | |
![[ ]](/icons/compressed.gif) | sm-0132624788-soluti..> | 2023-05-03 09:30 | 833K | |
![[ ]](/icons/compressed.gif) | sm-0132871696-engine..> | 2023-05-03 10:00 | 2.5M | |
![[ ]](/icons/compressed.gif) | sm-0132951509-microe..> | 2023-05-03 10:13 | 23K | |
![[ ]](/icons/compressed.gif) | sm-0133354857-fundam..> | 2023-05-03 11:09 | 140K | |
![[ ]](/icons/compressed.gif) | sm-013496456x-signal..> | 2023-05-03 11:10 | 392K | |
![[ ]](/icons/compressed.gif) | sm-0205968082-master..> | 2023-05-03 10:43 | 54K | |
![[ ]](/icons/compressed.gif) | sm-0321780655-vector..> | 2023-05-03 10:11 | 249K | |
![[ ]](/icons/compressed.gif) | sm-0321782283-colleg..> | 2023-05-03 10:47 | 634K | |
![[ ]](/icons/compressed.gif) | sm-0321890132-statis..> | 2023-05-03 10:32 | 97K | |
![[ ]](/icons/compressed.gif) | sm-0321924304-busine..> | 2023-05-03 09:27 | 708K | |
![[ ]](/icons/compressed.gif) | sm-0321965175-single..> | 2023-05-03 10:10 | 194K | |
![[ ]](/icons/compressed.gif) | sm-0324379056-advanc..> | 2023-05-03 11:05 | 19K | |
![[ ]](/icons/compressed.gif) | sm-0324655223-busine..> | 2023-05-03 10:53 | 294K | |
![[ ]](/icons/compressed.gif) | sm-0538453052-princi..> | 2023-05-03 10:05 | 61K | |
![[ ]](/icons/compressed.gif) | sm-080802972x-cch-fe..> | 2023-05-03 10:16 | 70K | |
![[ ]](/icons/compressed.gif) | sm-113362698x-princi..> | 2023-05-03 10:51 | 107K | |
![[ ]](/icons/compressed.gif) | sm-1118022270-projec..> | 2023-05-03 10:26 | 45K | |
![[ ]](/icons/compressed.gif) | sm-9780321501110-pre..> | 2023-05-03 10:49 | 137K | |
![[ ]](/icons/compressed.gif) | sm-9780324224726-pri..> | 2023-05-03 10:09 | 41K | |
![[ ]](/icons/compressed.gif) | sm-9780471487357-des..> | 2023-05-03 09:55 | 86K | |
![[ ]](/icons/compressed.gif) | sm-applied-numerical..> | 2023-05-03 10:57 | 165K | |
![[ ]](/icons/compressed.gif) | sm-applied-statics-a..> | 2023-05-03 10:38 | 0 | |
![[ ]](/icons/compressed.gif) | sm-auditing-and-assu..> | 2023-05-03 11:02 | 0 | |
![[ ]](/icons/compressed.gif) | sm-basic-econometric..> | 2023-05-03 10:45 | 136K | |
![[ ]](/icons/unknown.gif) | sm-case-1-Solution-m..> | 2023-05-03 11:24 | 25K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Operations-a..> | 2023-05-03 10:25 | 46K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-Man..> | 2023-05-03 10:16 | 44K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-man..> | 2023-05-03 09:26 | 76K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-man..> | 2023-05-03 11:20 | 36K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-man..> | 2023-05-03 10:46 | 49K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-man..> | 2023-05-03 09:34 | 174K | |
![[ ]](/icons/unknown.gif) | sm-ch-1-Solution-man..> | 2023-05-03 10:03 | 65K | |
![[ ]](/icons/unknown.gif) | sm-ch-2-Solution-Man..> | 2023-05-03 10:57 | 97K | |
![[ ]](/icons/unknown.gif) | sm-ch-Solutions-Manu..> | 2023-05-03 10:39 | 36K | |
![[ ]](/icons/compressed.gif) | sm-ch01-juvinall-5.zip | 2023-05-03 10:16 | 2.8M | |
![[ ]](/icons/compressed.gif) | sm-fox-and-mcdonald-..> | 2023-05-03 10:23 | 11K | |
![[ ]](/icons/compressed.gif) | sm-hydrology-and-flo..> | 2023-05-03 11:10 | 670K | |
![[ ]](/icons/compressed.gif) | sm-intermediate-acco..> | 2023-05-03 09:26 | 134K | |
![[ ]](/icons/compressed.gif) | sm-international-fin..> | 2023-05-03 10:17 | 40K | |
![[ ]](/icons/compressed.gif) | sm-materials-enginee..> | 2023-05-03 11:20 | 83K | |
![[ ]](/icons/compressed.gif) | sm-reinforced-concre..> | 2023-05-03 09:52 | 679K | |
![[ ]](/icons/compressed.gif) | sm-supply-chain-logi..> | 2023-05-03 10:39 | 41K | |
![[ ]](/icons/unknown.gif) | sm01-Solution-Manual..> | 2023-05-04 01:59 | 225K | |
![[ ]](/icons/unknown.gif) | sm01-Solution-manual..> | 2023-05-03 09:31 | 632K | |
![[IMG]](/icons/image2.gif) | small-business-an-en..> | 2023-08-07 03:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | small-business-an-en..> | 2023-05-03 11:20 | 22K | |
![[ ]](/icons/compressed.gif) | small-business-an-en..> | 2023-05-03 11:20 | 13K | |
![[IMG]](/icons/image2.gif) | small-business-manag..> | 2023-08-05 03:43 | 3.7K | |
![[IMG]](/icons/image2.gif) | small-business-manag..> | 2023-08-12 03:57 | 19K | |
![[IMG]](/icons/image2.gif) | small-business-manag..> | 2023-05-03 09:58 | 50K | |
![[ ]](/icons/compressed.gif) | small-business-manag..> | 2023-05-03 09:58 | 129K | |
![[IMG]](/icons/image2.gif) | small-business-manag..> | 2023-08-05 03:40 | 2.5K | |
![[IMG]](/icons/image2.gif) | small-business-manag..> | 2023-05-04 02:18 | 8.5K | |
![[ ]](/icons/unknown.gif) | smbp14_caseim_sectio..> | 2023-05-03 09:53 | 80K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-08-06 10:15 | 1.9K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-08-09 02:01 | 8.0K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-05-04 01:54 | 23K | |
![[ ]](/icons/compressed.gif) | smith-robersons-busi..> | 2023-05-04 01:54 | 565K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-08-06 08:44 | 2.1K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-08-08 21:47 | 9.7K | |
![[IMG]](/icons/image2.gif) | smith-robersons-busi..> | 2023-05-04 01:54 | 26K | |
![[ ]](/icons/compressed.gif) | smith-robersons-busi..> | 2023-05-04 01:54 | 62K | |
![[ ]](/icons/unknown.gif) | smple-Solution-Manua..> | 2023-05-03 10:39 | 22K | |
![[IMG]](/icons/image2.gif) | soc-benokraitis-2nd-..> | 2023-08-05 16:25 | 4.0K | |
![[IMG]](/icons/image2.gif) | soc-benokraitis-2nd-..> | 2023-05-03 09:47 | 27K | |
![[ ]](/icons/compressed.gif) | soc-benokraitis-2nd-..> | 2023-05-03 09:47 | 28K | |
![[IMG]](/icons/image2.gif) | social-100x100.jpg | 2023-08-05 14:35 | 4.5K | |
![[IMG]](/icons/image2.gif) | social-300x300.jpg | 2023-08-29 06:04 | 32K | |
![[IMG]](/icons/image2.gif) | social-and-personali..> | 2023-08-08 02:00 | 3.4K | |
![[IMG]](/icons/image2.gif) | social-and-personali..> | 2023-05-03 10:01 | 17K | |
![[IMG]](/icons/image2.gif) | social-gerontology-a..> | 2023-05-03 09:36 | 15K | |
![[IMG]](/icons/image2.gif) | social-problems-7th-..> | 2023-08-05 01:15 | 4.2K | |
![[IMG]](/icons/image2.gif) | social-problems-7th-..> | 2023-08-08 21:47 | 25K | |
![[IMG]](/icons/image2.gif) | social-problems-7th-..> | 2023-05-03 09:34 | 84K | |
![[ ]](/icons/compressed.gif) | social-problems-7th-..> | 2023-05-03 09:34 | 111K | |
![[IMG]](/icons/image2.gif) | social-problems-dive..> | 2023-08-05 02:45 | 5.4K | |
![[IMG]](/icons/image2.gif) | social-problems-dive..> | 2023-08-15 16:37 | 40K | |
![[IMG]](/icons/image2.gif) | social-problems-dive..> | 2023-05-04 01:53 | 174K | |
![[ ]](/icons/compressed.gif) | social-problems-dive..> | 2023-05-04 01:53 | 655K | |
![[IMG]](/icons/image2.gif) | social-psychology-an..> | 2023-08-05 01:12 | 2.4K | |
![[IMG]](/icons/image2.gif) | social-psychology-an..> | 2023-05-03 11:06 | 13K | |
![[ ]](/icons/compressed.gif) | social-psychology-an..> | 2023-05-03 11:06 | 55K | |
![[IMG]](/icons/image2.gif) | social-psychology-ar..> | 2023-08-06 13:02 | 3.3K | |
![[IMG]](/icons/image2.gif) | social-psychology-ar..> | 2023-05-04 02:11 | 22K | |
![[ ]](/icons/compressed.gif) | social-psychology-ar..> | 2023-05-04 02:11 | 931K | |
![[IMG]](/icons/image2.gif) | social-psychology-ar..> | 2023-08-05 01:09 | 4.3K | |
![[IMG]](/icons/image2.gif) | social-psychology-ar..> | 2023-05-03 10:38 | 31K | |
![[ ]](/icons/compressed.gif) | social-psychology-ar..> | 2023-05-03 10:38 | 52K | |
![[IMG]](/icons/image2.gif) | social-psychology-ba..> | 2023-08-05 06:25 | 3.6K | |
![[IMG]](/icons/image2.gif) | social-psychology-ba..> | 2023-05-03 11:13 | 23K | |
![[ ]](/icons/compressed.gif) | social-psychology-ba..> | 2023-05-03 11:13 | 51K | |
![[IMG]](/icons/image2.gif) | social-psychology-de..> | 2023-08-05 03:40 | 4.3K | |
![[IMG]](/icons/image2.gif) | social-psychology-de..> | 2023-05-03 09:21 | 25K | |
![[ ]](/icons/compressed.gif) | social-psychology-de..> | 2023-05-03 09:21 | 154K | |
![[IMG]](/icons/image2.gif) | social-psychology-fr..> | 2023-08-05 17:22 | 4.0K | |
![[IMG]](/icons/image2.gif) | social-psychology-fr..> | 2023-05-03 10:42 | 24K | |
![[ ]](/icons/compressed.gif) | social-psychology-fr..> | 2023-05-03 10:42 | 100K | |
![[IMG]](/icons/image2.gif) | social-psychology-gi..> | 2023-08-05 16:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | social-psychology-gi..> | 2023-05-03 10:37 | 18K | |
![[ ]](/icons/compressed.gif) | social-psychology-gi..> | 2023-05-03 10:36 | 11K | |
![[ ]](/icons/compressed.gif) | social-psychology-ka..> | 2023-05-03 09:56 | 38K | |
![[IMG]](/icons/image2.gif) | social-psychology-ka..> | 2023-08-08 21:07 | 3.3K | |
![[IMG]](/icons/image2.gif) | social-psychology-ka..> | 2023-05-03 09:56 | 11K | |
![[IMG]](/icons/image2.gif) | social-psychology-my..> | 2023-08-05 14:33 | 1.8K | |
![[IMG]](/icons/image2.gif) | social-psychology-my..> | 2023-05-03 09:53 | 11K | |
![[ ]](/icons/compressed.gif) | social-psychology-my..> | 2023-05-03 09:53 | 86K | |
![[IMG]](/icons/image2.gif) | social-psychology-my..> | 2023-05-03 11:09 | 8.6K | |
![[ ]](/icons/compressed.gif) | social-psychology-my..> | 2023-05-03 11:09 | 380K | |
![[IMG]](/icons/image2.gif) | social-psychology-my..> | 2023-08-05 03:40 | 4.8K | |
![[IMG]](/icons/image2.gif) | social-psychology-my..> | 2023-05-03 10:07 | 16K | |
![[ ]](/icons/compressed.gif) | social-psychology-my..> | 2023-05-03 10:07 | 102K | |
![[IMG]](/icons/image2.gif) | social-science-an-in..> | 2023-08-05 03:39 | 3.0K | |
![[IMG]](/icons/image2.gif) | social-science-an-in..> | 2023-05-03 10:00 | 22K | |
![[ ]](/icons/compressed.gif) | social-science-an-in..> | 2023-05-03 10:00 | 132K | |
![[IMG]](/icons/image2.gif) | social.jpg | 2023-05-03 10:21 | 136K | |
![[IMG]](/icons/image2.gif) | society-and-technolo..> | 2023-08-08 06:39 | 4.4K | |
![[IMG]](/icons/image2.gif) | society-and-technolo..> | 2023-08-08 21:47 | 33K | |
![[IMG]](/icons/image2.gif) | society-and-technolo..> | 2023-05-03 09:53 | 59K | |
![[ ]](/icons/compressed.gif) | society-and-technolo..> | 2023-05-03 09:53 | 224K | |
![[IMG]](/icons/image2.gif) | society-in-focus-an-..> | 2023-08-08 22:58 | 3.2K | |
![[IMG]](/icons/image2.gif) | society-in-focus-an-..> | 2023-05-03 09:53 | 19K | |
![[ ]](/icons/compressed.gif) | society-in-focus-an-..> | 2023-05-03 09:53 | 22K | |
![[IMG]](/icons/image2.gif) | society-the-basics-m..> | 2023-08-05 19:13 | 3.9K | |
![[IMG]](/icons/image2.gif) | society-the-basics-m..> | 2023-05-04 01:52 | 24K | |
![[ ]](/icons/compressed.gif) | society-the-basics-m..> | 2023-05-04 01:52 | 108K | |
![[IMG]](/icons/image2.gif) | society-the-basics-m..> | 2023-08-05 01:52 | 4.5K | |
![[IMG]](/icons/image2.gif) | society-the-basics-m..> | 2023-05-03 09:43 | 19K | |
![[ ]](/icons/compressed.gif) | society-the-basics-m..> | 2023-05-03 09:43 | 45K | |
![[IMG]](/icons/image2.gif) | sociology-a-down-to-..> | 2023-08-06 05:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | sociology-a-down-to-..> | 2023-05-03 09:42 | 17K | |
![[ ]](/icons/compressed.gif) | sociology-a-down-to-..> | 2023-05-03 09:42 | 153K | |
![[IMG]](/icons/image2.gif) | sociology-in-a-chang..> | 2023-08-05 02:45 | 4.4K | |
![[IMG]](/icons/image2.gif) | sociology-in-a-chang..> | 2023-05-03 09:37 | 27K | |
![[ ]](/icons/compressed.gif) | sociology-in-a-chang..> | 2023-05-03 09:37 | 117K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-08-06 08:31 | 2.1K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-05-03 09:21 | 11K | |
![[ ]](/icons/compressed.gif) | sociology-in-our-tim..> | 2023-05-03 09:21 | 52K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-08-06 03:36 | 3.1K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-05-03 09:29 | 15K | |
![[ ]](/icons/compressed.gif) | sociology-in-our-tim..> | 2023-05-03 09:29 | 38K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-08-08 08:32 | 4.4K | |
![[IMG]](/icons/image2.gif) | sociology-in-our-tim..> | 2023-05-03 10:00 | 29K | |
![[ ]](/icons/compressed.gif) | sociology-in-our-tim..> | 2023-05-03 10:00 | 38K | |
![[IMG]](/icons/image2.gif) | sociology-schaefer-1..> | 2023-08-05 03:41 | 4.4K | |
![[IMG]](/icons/image2.gif) | sociology-schaefer-1..> | 2023-05-03 10:17 | 27K | |
![[ ]](/icons/compressed.gif) | sociology-schaefer-1..> | 2023-05-03 10:16 | 49K | |
![[IMG]](/icons/image2.gif) | sociology-shepard-11..> | 2023-05-03 09:37 | 20K | |
![[ ]](/icons/compressed.gif) | sociology-shepard-11..> | 2023-05-03 09:37 | 27K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-c..> | 2023-08-09 04:10 | 19K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-c..> | 2023-05-03 09:34 | 54K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-h..> | 2023-08-05 04:35 | 2.2K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-h..> | 2023-05-04 01:47 | 8.3K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-m..> | 2023-08-05 02:03 | 14K | |
![[IMG]](/icons/image2.gif) | sociology-the-core-m..> | 2023-05-04 02:26 | 35K | |
![[IMG]](/icons/image2.gif) | sociology-the-essent..> | 2023-08-05 04:35 | 4.9K | |
![[IMG]](/icons/image2.gif) | sociology-the-essent..> | 2023-05-03 10:27 | 39K | |
![[ ]](/icons/compressed.gif) | sociology-the-essent..> | 2023-05-03 10:27 | 29K | |
![[IMG]](/icons/image2.gif) | sociology-your-life-..> | 2023-08-05 17:17 | 4.5K | |
![[IMG]](/icons/image2.gif) | sociology-your-life-..> | 2023-08-16 12:29 | 23K | |
![[IMG]](/icons/image2.gif) | sociology-your-life-..> | 2023-05-04 02:27 | 55K | |
![[ ]](/icons/compressed.gif) | sociology-your-life-..> | 2023-05-04 02:27 | 103K | |
![[IMG]](/icons/image2.gif) | software-engineering..> | 2023-08-05 06:24 | 4.1K | |
![[IMG]](/icons/image2.gif) | software-engineering..> | 2023-08-18 08:28 | 28K | |
![[IMG]](/icons/image2.gif) | software-engineering..> | 2023-05-03 10:10 | 142K | |
![[ ]](/icons/compressed.gif) | software-engineering..> | 2023-05-03 10:10 | 241K | |
![[IMG]](/icons/image2.gif) | software-testing-a-c..> | 2023-08-06 11:16 | 5.0K | |
![[IMG]](/icons/image2.gif) | software-testing-a-c..> | 2023-08-18 08:28 | 29K | |
![[IMG]](/icons/image2.gif) | software-testing-a-c..> | 2023-05-04 02:29 | 63K | |
![[IMG]](/icons/image2.gif) | soil-and-water-chemi..> | 2023-08-05 06:25 | 4.6K | |
![[IMG]](/icons/image2.gif) | soil-and-water-chemi..> | 2023-08-18 08:28 | 23K | |
![[IMG]](/icons/image2.gif) | soil-and-water-chemi..> | 2023-05-04 02:29 | 50K | |
![[ ]](/icons/unknown.gif) | sol1-Statistics-for-..> | 2023-05-04 01:51 | 34K | |
![[ ]](/icons/unknown.gif) | sol1.01-Contemporary..> | 2023-05-03 09:25 | 63K | |
![[ ]](/icons/unknown.gif) | sol1_Gravetter_8e.doc | 2023-05-03 10:16 | 34K | |
![[ ]](/icons/compressed.gif) | sols_3e_chp2.zip | 2023-05-03 11:20 | 57K | |
![[ ]](/icons/compressed.gif) | solution-manual-and-..> | 2023-05-03 09:53 | 30K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:23 | 1.0M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:43 | 5.9M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:29 | 706K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:58 | 37K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:37 | 36K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:23 | 28K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:29 | 67K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:45 | 126K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:22 | 32K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:19 | 13K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:47 | 22K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 07:48 | 3.0K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-22 20:06 | 18K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:47 | 165K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 02:45 | 2.8K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-21 19:12 | 16K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:57 | 41K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 01:52 | 2.8K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-25 19:27 | 15K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:32 | 32K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:16 | 40K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 15:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-16 10:25 | 18K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:42 | 44K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:38 | 383K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-04 02:20 | 15K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:27 | 7.7K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:20 | 20K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 01:51 | 4.0K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-15 01:39 | 26K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:20 | 62K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:08 | 90K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:14 | 116K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:05 | 176K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:45 | 18K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:33 | 382K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:46 | 742K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:07 | 81K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 19:27 | 3.4K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-12 04:49 | 20K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:21 | 40K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 13:43 | 203K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:46 | 10K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 01:52 | 3.2K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 04:34 | 17K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:22 | 38K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:52 | 25K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:41 | 230K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:03 | 29K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:15 | 80K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:56 | 215K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:01 | 23K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:27 | 11K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 13:43 | 42K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:45 | 25K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:42 | 20K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:10 | 22K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 01:12 | 2.8K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-08 17:45 | 17K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:10 | 44K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:13 | 90K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:33 | 18K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:45 | 21K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 09:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-08 14:34 | 19K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:45 | 145K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:46 | 38K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:07 | 84K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:18 | 214K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 13:43 | 0 | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:38 | 71K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:06 | 33K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:19 | 3.6M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-04 02:23 | 79K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:44 | 27K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:40 | 121K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:33 | 5.3M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:24 | 293K | |
![[ ]](/icons/unknown.gif) | solution-manual-for-..> | 2023-05-03 10:40 | 67K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 15:29 | 2.7K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 15:27 | 13K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:53 | 30K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:55 | 55K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:28 | 6.3K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:31 | 66K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 02:46 | 2.7K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 07:49 | 14K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:31 | 33K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:21 | 37K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:43 | 89K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:32 | 41K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:14 | 68K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:12 | 12K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:11 | 11K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:23 | 75K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 03:40 | 3.5K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-15 07:57 | 21K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:53 | 50K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 12:08 | 3.4K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-12 14:44 | 21K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:43 | 44K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:26 | 155K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:46 | 48K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-04 01:58 | 103K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:41 | 91K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:21 | 25K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 11:25 | 539K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:49 | 1.1M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:11 | 228K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:11 | 167K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:32 | 5.5K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:35 | 106K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:40 | 40K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:42 | 13K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 17:22 | 2.3K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-10 20:26 | 12K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:22 | 27K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:26 | 2.3M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:04 | 16K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 15:30 | 2.5K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 01:51 | 19K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:19 | 52K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:50 | 2.5M | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:21 | 18K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 03:41 | 4.2K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-09 12:13 | 27K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:45 | 63K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-04 01:57 | 120K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 13:06 | 4.0K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 14:41 | 24K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:55 | 56K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-08 22:57 | 2.7K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 14:41 | 13K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 09:54 | 26K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:00 | 15K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-06 08:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-09 09:14 | 22K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:00 | 50K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 16:23 | 4.2K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 19:10 | 20K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 10:47 | 44K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:44 | 144K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-08 22:01 | 4.9K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 19:10 | 30K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-04 02:15 | 69K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 09:50 | 547K | |
![[ ]](/icons/compressed.gif) | solution-manual-for-..> | 2023-05-03 10:16 | 4.2K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-05 02:46 | 2.4K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-08-16 18:42 | 12K | |
![[IMG]](/icons/image2.gif) | solution-manual-for-..> | 2023-05-03 11:11 | 28K | |
![[ ]](/icons/compressed.gif) | solution-manual-gove..> | 2023-05-03 10:41 | 89K | |
![[ ]](/icons/compressed.gif) | solution-manual-mcgr..> | 2023-05-03 10:54 | 25K | |
![[ ]](/icons/compressed.gif) | solution_manual_for_..> | 2023-05-04 01:50 | 2.6M | |
![[ ]](/icons/compressed.gif) | solution_manual_for_..> | 2023-05-03 11:12 | 240K | |
![[ ]](/icons/compressed.gif) | solutions-manual-to-..> | 2023-05-03 10:39 | 20K | |
![[ ]](/icons/unknown.gif) | solutions_ch01_4e_al..> | 2023-05-03 13:41 | 4.1M | |
![[IMG]](/icons/image2.gif) | sonography-introduct..> | 2023-08-07 01:44 | 2.9K | |
![[IMG]](/icons/image2.gif) | sonography-introduct..> | 2023-05-03 09:37 | 15K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-05 04:17 | 2.8K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-04 01:51 | 8.7K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-05 14:41 | 3.6K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 10:15 | 18K | |
![[ ]](/icons/compressed.gif) | south-western-federa..> | 2023-05-03 10:15 | 227K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-06 16:28 | 3.6K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 10:16 | 13K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-05 02:31 | 2.9K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-04 02:00 | 11K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 09:54 | 9.4K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 09:53 | 9.4K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 10:43 | 15K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 10:02 | 29K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-06 05:47 | 4.7K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-09 02:52 | 27K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-04 02:14 | 64K | |
![[ ]](/icons/compressed.gif) | south-western-federa..> | 2023-05-04 02:14 | 400K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-06 08:45 | 4.6K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-09 02:52 | 26K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-03 10:59 | 64K | |
![[ ]](/icons/compressed.gif) | south-western-federa..> | 2023-05-03 10:59 | 11M | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-06 08:36 | 4.6K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-08-09 02:52 | 27K | |
![[IMG]](/icons/image2.gif) | south-western-federa..> | 2023-05-04 02:25 | 65K | |
![[ ]](/icons/compressed.gif) | south-western-federa..> | 2023-05-04 02:25 | 2.0M | |
![[IMG]](/icons/image2.gif) | special-education-in..> | 2023-08-07 22:47 | 3.2K | |
![[IMG]](/icons/image2.gif) | special-education-in..> | 2023-08-11 02:47 | 18K | |
![[IMG]](/icons/image2.gif) | special-education-in..> | 2023-05-03 10:18 | 31K | |
![[ ]](/icons/compressed.gif) | special-education-in..> | 2023-05-03 10:18 | 106K | |
![[IMG]](/icons/image2.gif) | sport-and-exercise-p..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | sport-and-exercise-p..> | 2023-05-03 09:32 | 21K | |
![[ ]](/icons/compressed.gif) | sport-and-exercise-p..> | 2023-05-03 09:32 | 141K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-08-05 02:31 | 3.5K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-05-03 09:57 | 19K | |
![[ ]](/icons/compressed.gif) | spreadsheet-modeling..> | 2023-05-03 09:57 | 18K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-08-05 01:52 | 3.0K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-08-11 02:47 | 16K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-05-04 02:16 | 42K | |
![[ ]](/icons/compressed.gif) | spreadsheet-modeling..> | 2023-05-04 02:16 | 367K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-08-05 05:30 | 3.0K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-08-11 02:47 | 15K | |
![[IMG]](/icons/image2.gif) | spreadsheet-modeling..> | 2023-05-03 10:01 | 35K | |
![[ ]](/icons/compressed.gif) | spreadsheet-modeling..> | 2023-05-03 10:01 | 829K | |
![[IMG]](/icons/image2.gif) | staffing-organizatio..> | 2023-08-05 08:50 | 2.7K | |
![[IMG]](/icons/image2.gif) | staffing-organizatio..> | 2023-05-03 09:48 | 21K | |
![[ ]](/icons/compressed.gif) | staffing-organizatio..> | 2023-05-03 09:48 | 13K | |
![[ ]](/icons/compressed.gif) | starting-out-java-fr..> | 2023-05-03 13:43 | 29K | |
![[IMG]](/icons/image2.gif) | startvb-100x100.jpg | 2023-08-06 07:46 | 2.5K | |
![[IMG]](/icons/image2.gif) | startvb-300x300.jpg | 2023-08-20 22:38 | 11K | |
![[IMG]](/icons/image2.gif) | startvb.jpg | 2023-05-03 10:29 | 15K | |
![[IMG]](/icons/image2.gif) | startvb1-100x100.jpg | 2023-08-06 09:42 | 2.5K | |
![[IMG]](/icons/image2.gif) | startvb1-300x300.jpg | 2023-08-10 16:04 | 11K | |
![[IMG]](/icons/image2.gif) | startvb1.jpg | 2023-05-03 10:29 | 15K | |
![[IMG]](/icons/image2.gif) | statistical-methods-..> | 2023-08-06 11:15 | 3.5K | |
![[IMG]](/icons/image2.gif) | statistical-methods-..> | 2023-08-11 02:47 | 21K | |
![[IMG]](/icons/image2.gif) | statistical-methods-..> | 2023-05-03 10:15 | 66K | |
![[ ]](/icons/compressed.gif) | statistical-methods-..> | 2023-05-03 10:15 | 627K | |
![[IMG]](/icons/image2.gif) | statistical-reasonin..> | 2023-08-05 13:12 | 4.5K | |
![[IMG]](/icons/image2.gif) | statistical-reasonin..> | 2023-08-11 02:47 | 28K | |
![[IMG]](/icons/image2.gif) | statistical-reasonin..> | 2023-05-03 09:26 | 94K | |
![[ ]](/icons/compressed.gif) | statistical-reasonin..> | 2023-05-03 09:26 | 171K | |
![[ ]](/icons/compressed.gif) | statistical-techniqu..> | 2023-05-03 10:42 | 487K | |
![[IMG]](/icons/image2.gif) | statistics-13th-edit..> | 2023-08-05 17:22 | 3.4K | |
![[IMG]](/icons/image2.gif) | statistics-13th-edit..> | 2023-08-11 02:47 | 19K | |
![[IMG]](/icons/image2.gif) | statistics-13th-edit..> | 2023-05-03 10:11 | 84K | |
![[ ]](/icons/compressed.gif) | statistics-13th-edit..> | 2023-05-03 10:11 | 1.4M | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-08 15:29 | 2.1K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-06 03:51 | 9.9K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-05-03 09:34 | 34K | |
![[ ]](/icons/compressed.gif) | statistics-business-..> | 2023-05-03 09:34 | 279K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-06 07:45 | 3.2K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-11 02:47 | 17K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-05-03 09:59 | 48K | |
![[ ]](/icons/compressed.gif) | statistics-business-..> | 2023-05-03 09:59 | 282K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-05 04:34 | 3.9K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-11 02:47 | 26K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-05-04 02:26 | 92K | |
![[ ]](/icons/compressed.gif) | statistics-business-..> | 2023-05-04 02:26 | 649K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-05 01:27 | 3.9K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-08-11 18:44 | 26K | |
![[IMG]](/icons/image2.gif) | statistics-business-..> | 2023-05-03 09:25 | 92K | |
![[ ]](/icons/compressed.gif) | statistics-business-..> | 2023-05-03 09:25 | 1.4M | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-05 07:49 | 3.2K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 09:39 | 9.4K | |
![[ ]](/icons/compressed.gif) | statistics-for-busin..> | 2023-05-03 10:07 | 14K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-05 15:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 11:19 | 10K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-06 03:43 | 3.3K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 10:07 | 10K | |
![[ ]](/icons/compressed.gif) | statistics-for-busin..> | 2023-05-03 09:19 | 138K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-06 10:17 | 3.4K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 09:23 | 12K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-08 06:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 09:20 | 12K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-08-05 04:44 | 2.7K | |
![[IMG]](/icons/image2.gif) | statistics-for-busin..> | 2023-05-03 09:43 | 9.3K | |
![[ ]](/icons/compressed.gif) | statistics-for-manag..> | 2023-05-03 09:22 | 145K | |
![[IMG]](/icons/image2.gif) | statistics-for-manag..> | 2023-08-05 03:41 | 2.4K | |
![[IMG]](/icons/image2.gif) | statistics-for-manag..> | 2023-05-03 09:37 | 7.7K | |
![[IMG]](/icons/image2.gif) | statistics-for-the-b..> | 2023-08-05 05:30 | 3.2K | |
![[IMG]](/icons/image2.gif) | statistics-for-the-b..> | 2023-08-17 17:27 | 18K | |
![[IMG]](/icons/image2.gif) | statistics-for-the-b..> | 2023-05-03 09:56 | 30K | |
![[ ]](/icons/compressed.gif) | statistics-for-the-b..> | 2023-05-03 09:56 | 69K | |
![[ ]](/icons/compressed.gif) | statistics-for-the-b..> | 2023-05-03 09:30 | 16K | |
![[IMG]](/icons/image2.gif) | statistics-for-the-b..> | 2023-05-04 01:51 | 11K | |
![[IMG]](/icons/image2.gif) | statistics-for-the-b..> | 2023-05-03 09:30 | 11K | |
![[IMG]](/icons/image2.gif) | statistics-gentle-in..> | 2023-08-05 15:33 | 4.2K | |
![[IMG]](/icons/image2.gif) | statistics-gentle-in..> | 2023-08-11 02:47 | 20K | |
![[IMG]](/icons/image2.gif) | statistics-gentle-in..> | 2023-05-03 10:20 | 51K | |
![[ ]](/icons/compressed.gif) | statistics-gentle-in..> | 2023-05-03 10:20 | 121K | |
![[ ]](/icons/compressed.gif) | statistics-informed-..> | 2023-05-03 13:42 | 14M | |
![[IMG]](/icons/image2.gif) | statistics-informed-..> | 2023-08-05 15:31 | 3.2K | |
![[IMG]](/icons/image2.gif) | statistics-informed-..> | 2023-05-03 10:28 | 25K | |
![[ ]](/icons/compressed.gif) | statistics-informed-..> | 2023-05-03 10:28 | 191K | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-08-05 03:39 | 2.7K | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-08-11 18:44 | 15K | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-05-03 09:44 | 39K | |
![[ ]](/icons/compressed.gif) | statistics-managemen..> | 2023-05-03 09:44 | 1.0M | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-08-06 08:45 | 2.7K | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-08-11 18:44 | 15K | |
![[IMG]](/icons/image2.gif) | statistics-managemen..> | 2023-05-03 10:02 | 40K | |
![[ ]](/icons/compressed.gif) | statistics-managemen..> | 2023-05-03 10:02 | 399K | |
![[IMG]](/icons/image2.gif) | stochastic-processes..> | 2023-08-05 03:39 | 2.9K | |
![[IMG]](/icons/image2.gif) | stochastic-processes..> | 2023-08-17 17:27 | 13K | |
![[IMG]](/icons/image2.gif) | stochastic-processes..> | 2023-05-04 02:26 | 28K | |
![[IMG]](/icons/image2.gif) | strategic-compensati..> | 2023-08-06 05:44 | 3.4K | |
![[IMG]](/icons/image2.gif) | strategic-compensati..> | 2023-08-17 17:27 | 13K | |
![[IMG]](/icons/image2.gif) | strategic-compensati..> | 2023-05-03 10:15 | 33K | |
![[ ]](/icons/compressed.gif) | strategic-compensati..> | 2023-05-03 10:15 | 1.1M | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-07 23:57 | 2.6K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-17 17:27 | 12K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 11:00 | 31K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 11:00 | 361K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-08 08:15 | 2.3K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:32 | 11K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 13:43 | 236K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 03:41 | 3.0K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:07 | 21K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:07 | 16K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 16:20 | 2.9K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-17 17:27 | 15K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:33 | 38K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:33 | 583K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 12:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-17 17:27 | 21K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:30 | 74K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:30 | 58K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 01:52 | 3.4K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-17 17:27 | 19K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 11:01 | 78K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 11:01 | 162K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 11:18 | 322K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 15:30 | 2.0K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:37 | 4.0K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:32 | 10K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 10:16 | 2.6K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:49 | 17K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:48 | 43K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 15:34 | 2.1K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:49 | 7.3K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 05:29 | 2.1K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 11:18 | 7.3K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 16:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-09 09:11 | 17K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:48 | 42K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:48 | 64K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 18:14 | 4.3K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-09 01:58 | 29K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:24 | 79K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:24 | 97K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 12:08 | 3.2K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:31 | 10K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 06:24 | 3.9K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-09 09:11 | 26K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:09 | 72K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:09 | 2.7M | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 14:34 | 2.2K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-09 09:11 | 8.7K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:42 | 24K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:42 | 370K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-08 10:58 | 3.1K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:32 | 18K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:32 | 23K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 01:51 | 3.2K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:47 | 19K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:47 | 129K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 15:47 | 2.2K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:50 | 16K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:50 | 16K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 09:34 | 20K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 02:46 | 2.8K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-12 20:37 | 14K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:16 | 30K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-03 10:16 | 183K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-08 14:32 | 2.5K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:35 | 7.5K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-09 12:14 | 2.5K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 09:34 | 7.5K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-05 01:51 | 2.9K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:20 | 15K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 05:44 | 3.0K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-04 02:20 | 15K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-04 02:20 | 627K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-08 14:32 | 3.0K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-03 10:42 | 11K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-06 03:41 | 4.7K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-08-12 20:37 | 30K | |
![[IMG]](/icons/image2.gif) | strategic-management..> | 2023-05-04 01:47 | 73K | |
![[ ]](/icons/compressed.gif) | strategic-management..> | 2023-05-04 01:47 | 1.3M | |
![[ ]](/icons/compressed.gif) | strategic-staffing-3..> | 2023-05-03 13:41 | 55K | |
![[ ]](/icons/compressed.gif) | strategic-staffing-j..> | 2023-05-03 14:08 | 16K | |
![[IMG]](/icons/image2.gif) | strategic_management..> | 2023-08-06 12:09 | 2.8K | |
![[IMG]](/icons/image2.gif) | strategic_management..> | 2023-05-04 02:12 | 10K | |
![[IMG]](/icons/image2.gif) | stress-management-li..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | stress-management-li..> | 2023-08-12 20:37 | 16K | |
![[IMG]](/icons/image2.gif) | stress-management-li..> | 2023-05-03 10:54 | 39K | |
![[ ]](/icons/compressed.gif) | stress-management-li..> | 2023-05-03 10:54 | 30K | |
![[IMG]](/icons/image2.gif) | structure-and-functi..> | 2023-08-06 07:46 | 3.6K | |
![[IMG]](/icons/image2.gif) | structure-and-functi..> | 2023-05-03 10:30 | 19K | |
![[ ]](/icons/compressed.gif) | structure-and-functi..> | 2023-05-03 10:30 | 0 | |
![[IMG]](/icons/image2.gif) | structure-and-functi..> | 2023-08-05 02:47 | 4.3K | |
![[IMG]](/icons/image2.gif) | structure-and-functi..> | 2023-05-03 09:19 | 26K | |
![[IMG]](/icons/image2.gif) | success-at-statistic..> | 2023-08-06 11:59 | 3.9K | |
![[IMG]](/icons/image2.gif) | success-at-statistic..> | 2023-08-12 20:37 | 19K | |
![[IMG]](/icons/image2.gif) | success-at-statistic..> | 2023-05-04 02:25 | 35K | |
![[IMG]](/icons/image2.gif) | success-in-practical..> | 2023-08-06 17:25 | 2.5K | |
![[IMG]](/icons/image2.gif) | success-in-practical..> | 2023-05-03 10:07 | 14K | |
![[ ]](/icons/compressed.gif) | success-in-practical..> | 2023-05-03 10:07 | 18K | |
![[IMG]](/icons/image2.gif) | successful-project-m..> | 2023-08-06 11:18 | 4.7K | |
![[IMG]](/icons/image2.gif) | successful-project-m..> | 2023-08-12 20:37 | 26K | |
![[IMG]](/icons/image2.gif) | successful-project-m..> | 2023-05-03 10:03 | 66K | |
![[ ]](/icons/compressed.gif) | successful-project-m..> | 2023-05-03 10:03 | 186K | |
![[IMG]](/icons/image2.gif) | supervision-concepts..> | 2023-08-07 23:57 | 3.2K | |
![[IMG]](/icons/image2.gif) | supervision-concepts..> | 2023-05-04 02:01 | 20K | |
![[ ]](/icons/compressed.gif) | supervision-concepts..> | 2023-05-04 02:01 | 11K | |
![[IMG]](/icons/image2.gif) | supervision-concepts..> | 2023-08-05 01:52 | 2.3K | |
![[IMG]](/icons/image2.gif) | supervision-concepts..> | 2023-05-03 11:15 | 12K | |
![[ ]](/icons/compressed.gif) | supervision-concepts..> | 2023-05-03 11:15 | 21K | |
![[IMG]](/icons/image2.gif) | supply-chain-logisti..> | 2023-08-05 17:22 | 4.1K | |
![[IMG]](/icons/image2.gif) | supply-chain-logisti..> | 2023-05-03 09:36 | 28K | |
![[ ]](/icons/compressed.gif) | supply-chain-logisti..> | 2023-05-03 09:36 | 8.6K | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-08-07 15:45 | 2.5K | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-08-17 05:48 | 17K | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-05-04 01:52 | 47K | |
![[ ]](/icons/compressed.gif) | supply-chain-managem..> | 2023-05-04 01:52 | 1.6M | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-08-08 06:37 | 2.5K | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-08-17 05:48 | 17K | |
![[IMG]](/icons/image2.gif) | supply-chain-managem..> | 2023-05-03 10:06 | 47K | |
![[ ]](/icons/compressed.gif) | supply-chain-managem..> | 2023-05-03 10:06 | 476K | |
![[IMG]](/icons/image2.gif) | supply-management-da..> | 2023-08-05 01:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | supply-management-da..> | 2023-05-03 10:59 | 21K | |
![[ ]](/icons/compressed.gif) | supply-management-da..> | 2023-05-03 10:59 | 12K | |
![[IMG]](/icons/image2.gif) | surgical-anatomy-and..> | 2023-08-05 01:54 | 3.9K | |
![[IMG]](/icons/image2.gif) | surgical-anatomy-and..> | 2023-05-03 10:21 | 20K | |
![[ ]](/icons/compressed.gif) | surgical-anatomy-and..> | 2023-05-03 10:21 | 5.7K | |
![[IMG]](/icons/image2.gif) | surgical-technology-..> | 2023-08-05 03:40 | 3.1K | |
![[IMG]](/icons/image2.gif) | surgical-technology-..> | 2023-05-03 10:10 | 22K | |
![[ ]](/icons/compressed.gif) | surgical-technology-..> | 2023-05-03 10:10 | 12K | |
![[ ]](/icons/compressed.gif) | surgical-technology-..> | 2023-05-03 13:43 | 624K | |
![[IMG]](/icons/image2.gif) | surgical-technology-..> | 2023-08-05 05:30 | 4.1K | |
![[IMG]](/icons/image2.gif) | surgical-technology-..> | 2023-08-17 05:48 | 21K | |
![[IMG]](/icons/image2.gif) | surgical-technology-..> | 2023-05-03 09:22 | 52K | |
![[ ]](/icons/compressed.gif) | surgical-technology-..> | 2023-05-03 09:22 | 48K | |
![[IMG]](/icons/image2.gif) | survey-accounting-5t..> | 2023-08-05 14:28 | 3.0K | |
![[IMG]](/icons/image2.gif) | survey-accounting-5t..> | 2023-08-17 05:48 | 14K | |
![[IMG]](/icons/image2.gif) | survey-accounting-5t..> | 2023-05-03 10:10 | 35K | |
![[ ]](/icons/compressed.gif) | survey-accounting-5t..> | 2023-05-03 10:10 | 254K | |
![[IMG]](/icons/image2.gif) | survey-economics-pri..> | 2023-08-06 19:14 | 3.3K | |
![[IMG]](/icons/image2.gif) | survey-economics-pri..> | 2023-08-17 05:48 | 16K | |
![[IMG]](/icons/image2.gif) | survey-economics-pri..> | 2023-05-03 09:45 | 53K | |
![[ ]](/icons/compressed.gif) | survey-economics-pri..> | 2023-05-03 09:45 | 149K | |
![[IMG]](/icons/image2.gif) | survey-mathematics-a..> | 2023-08-05 01:51 | 5.1K | |
![[IMG]](/icons/image2.gif) | survey-mathematics-a..> | 2023-08-17 05:48 | 26K | |
![[IMG]](/icons/image2.gif) | survey-mathematics-a..> | 2023-05-03 11:20 | 107K | |
![[ ]](/icons/compressed.gif) | survey-mathematics-a..> | 2023-05-03 11:20 | 960K | |
![[IMG]](/icons/image2.gif) | survey-of-economics-..> | 2023-08-06 07:48 | 2.2K | |
![[IMG]](/icons/image2.gif) | survey-of-economics-..> | 2023-05-03 09:58 | 12K | |
![[ ]](/icons/compressed.gif) | survey-of-economics-..> | 2023-05-03 09:58 | 56K | |
![[IMG]](/icons/image2.gif) | survey-operating-sys..> | 2023-08-06 10:14 | 3.3K | |
![[IMG]](/icons/image2.gif) | survey-operating-sys..> | 2023-08-17 05:48 | 19K | |
![[IMG]](/icons/image2.gif) | survey-operating-sys..> | 2023-05-03 11:02 | 45K | |
![[ ]](/icons/compressed.gif) | survey-operating-sys..> | 2023-05-03 11:02 | 2.6M | |
![[ ]](/icons/compressed.gif) | sustaining-the-earth..> | 2023-05-03 13:42 | 376K | |
![[ ]](/icons/compressed.gif) | swanson_criminv11e_t..> | 2023-05-03 09:39 | 16K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-08-06 05:44 | 2.8K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-05-03 10:00 | 14K | |
![[ ]](/icons/compressed.gif) | systems-analysis-and..> | 2023-05-03 10:00 | 28K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-08-05 14:40 | 2.6K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-05-03 11:00 | 14K | |
![[ ]](/icons/compressed.gif) | systems-analysis-and..> | 2023-05-03 11:00 | 90K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-08-05 05:29 | 3.3K | |
![[IMG]](/icons/image2.gif) | systems-analysis-and..> | 2023-05-03 10:49 | 18K | |
![[ ]](/icons/compressed.gif) | systems-analysis-and..> | 2023-05-03 10:49 | 41K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-08-05 16:23 | 3.7K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-08-17 05:48 | 23K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-05-03 10:13 | 59K | |
![[ ]](/icons/compressed.gif) | systems-analysis-des..> | 2023-05-03 10:13 | 438K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-08-06 09:42 | 3.7K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-08-17 05:48 | 23K | |
![[IMG]](/icons/image2.gif) | systems-analysis-des..> | 2023-05-03 11:26 | 59K | |
![[ ]](/icons/compressed.gif) | systems-analysis-des..> | 2023-05-03 11:26 | 205K | |
![[IMG]](/icons/image2.gif) | t9781455737659-400x6..> | 2023-08-05 16:35 | 3.9K | |
![[IMG]](/icons/image2.gif) | t9781455737659-400x6..> | 2023-09-18 04:50 | 20K | |
![[IMG]](/icons/image2.gif) | t9781455737659-400x6..> | 2023-05-03 09:36 | 45K | |
![[ ]](/icons/unknown.gif) | tanner_chapter1.doc | 2023-05-03 13:41 | 107K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-08-05 17:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-08-17 05:48 | 19K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-05-03 09:25 | 45K | |
![[ ]](/icons/compressed.gif) | taxation-individuals..> | 2023-05-03 09:25 | 222K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-08-05 01:09 | 3.7K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-08-15 06:43 | 18K | |
![[IMG]](/icons/image2.gif) | taxation-individuals..> | 2023-05-03 09:40 | 47K | |
![[ ]](/icons/compressed.gif) | taxation-individuals..> | 2023-05-03 09:40 | 293K | |
![[IMG]](/icons/image2.gif) | taxation-of-individu..> | 2023-08-08 20:02 | 3.2K | |
![[IMG]](/icons/image2.gif) | taxation-of-individu..> | 2023-05-03 09:54 | 17K | |
![[ ]](/icons/compressed.gif) | taxation-of-individu..> | 2023-05-03 09:54 | 467K | |
![[ ]](/icons/compressed.gif) | tb-007337668x-explor..> | 2023-05-03 11:14 | 1.2M | |
![[ ]](/icons/compressed.gif) | tb-007811277x-intern..> | 2023-05-03 10:54 | 188K | |
![[ ]](/icons/compressed.gif) | tb-0133864960-essent..> | 2023-05-03 09:57 | 166K | |
![[ ]](/icons/compressed.gif) | tb-0205028764-think-..> | 2023-05-03 11:18 | 214K | |
![[ ]](/icons/compressed.gif) | tb-0205626750-psycho..> | 2023-05-03 11:12 | 486K | |
![[ ]](/icons/compressed.gif) | tb-0205989802-anda-c..> | 2023-05-03 10:10 | 418K | |
![[ ]](/icons/compressed.gif) | tb-0321691237-elemen..> | 2023-05-03 09:31 | 118K | |
![[ ]](/icons/compressed.gif) | tb-0321890132-statis..> | 2023-05-03 10:32 | 146K | |
![[ ]](/icons/compressed.gif) | tb-0321919009-marieb..> | 2023-05-03 11:04 | 86K | |
![[ ]](/icons/compressed.gif) | tb-america-a-narrati..> | 2023-05-03 09:30 | 12K | |
![[ ]](/icons/compressed.gif) | tb-basic-clinical-la..> | 2023-05-03 10:42 | 5.8K | |
![[ ]](/icons/compressed.gif) | tb-cultural-psycholo..> | 2023-05-03 09:54 | 610K | |
![[ ]](/icons/compressed.gif) | tb-environment-and-s..> | 2023-05-03 10:18 | 8.5K | |
![[ ]](/icons/compressed.gif) | tb-evidence-based-pr..> | 2023-05-03 09:41 | 20K | |
![[ ]](/icons/compressed.gif) | tb-financial-managem..> | 2023-05-03 10:41 | 1.9M | |
![[ ]](/icons/compressed.gif) | tb-nursing-leadershi..> | 2023-05-03 11:21 | 17K | |
![[ ]](/icons/compressed.gif) | tb-nutrition-applied..> | 2023-05-03 11:13 | 83K | |
![[ ]](/icons/compressed.gif) | tb-pathophysiology-i..> | 2023-05-03 11:22 | 22K | |
![[ ]](/icons/compressed.gif) | tb-pharmacology-and-..> | 2023-05-03 10:30 | 4.5K | |
![[ ]](/icons/compressed.gif) | tb-pharmacotherapeut..> | 2023-05-03 09:52 | 15K | |
![[ ]](/icons/unknown.gif) | tb01-Test-Bank-for-B..> | 2023-05-03 11:04 | 54K | |
![[ ]](/icons/unknown.gif) | tb01-Test-Bank-for-U..> | 2023-05-03 13:41 | 70K | |
![[ ]](/icons/unknown.gif) | tb01_exercises.docx | 2023-05-03 13:42 | 125K | |
![[IMG]](/icons/image2.gif) | technology-action-co..> | 2023-08-05 02:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | technology-action-co..> | 2023-08-15 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | technology-action-co..> | 2023-05-03 10:40 | 69K | |
![[ ]](/icons/compressed.gif) | technology-action-co..> | 2023-05-03 10:40 | 157K | |
![[IMG]](/icons/image2.gif) | technology-action-in..> | 2023-08-06 11:15 | 4.0K | |
![[IMG]](/icons/image2.gif) | technology-action-in..> | 2023-08-15 06:43 | 21K | |
![[IMG]](/icons/image2.gif) | technology-action-in..> | 2023-05-04 02:06 | 87K | |
![[ ]](/icons/compressed.gif) | technology-action-in..> | 2023-05-04 02:06 | 157K | |
![[IMG]](/icons/image2.gif) | technology-in-action..> | 2023-08-05 01:52 | 3.6K | |
![[IMG]](/icons/image2.gif) | technology-in-action..> | 2023-05-03 09:48 | 18K | |
![[ ]](/icons/compressed.gif) | technology-in-action..> | 2023-05-03 09:48 | 14K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-08-06 07:46 | 5.5K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-08-15 06:43 | 31K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-05-04 02:24 | 68K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-08-06 03:41 | 4.9K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-08-15 06:43 | 26K | |
![[IMG]](/icons/image2.gif) | terrorism-and-wmds-a..> | 2023-05-04 02:23 | 50K | |
![[ ]](/icons/compressed.gif) | test-bank-8th-fundam..> | 2023-05-03 10:59 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-2014-found..> | 2023-05-03 09:12 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-2015-genet..> | 2023-05-03 10:33 | 82K | |
![[ ]](/icons/compressed.gif) | test-bank-advanced-p..> | 2023-05-03 10:06 | 4.0K | |
![[ ]](/icons/layout.gif) | test-bank-anatomy-ph..> | 2023-05-03 10:06 | 402K | |
![[ ]](/icons/compressed.gif) | test-bank-astronomy-..> | 2023-05-03 09:32 | 22K | |
![[IMG]](/icons/image2.gif) | test-bank-clinical-p..> | 2023-05-03 10:09 | 37K | |
![[ ]](/icons/compressed.gif) | test-bank-for-3-2-1-..> | 2023-05-04 01:56 | 48K | |
![[ ]](/icons/compressed.gif) | test-bank-for-a-hist..> | 2023-05-03 10:18 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-abnorm..> | 2023-05-03 11:03 | 35K | |
![[ ]](/icons/compressed.gif) | test-bank-for-accoun..> | 2023-05-03 09:38 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-accoun..> | 2023-05-03 10:30 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-acquir..> | 2023-05-04 02:15 | 47K | |
![[ ]](/icons/compressed.gif) | test-bank-for-adoles..> | 2023-05-04 02:21 | 84K | |
![[ ]](/icons/compressed.gif) | test-bank-for-advanc..> | 2023-05-04 01:55 | 42K | |
![[ ]](/icons/compressed.gif) | test-bank-for-alcamo..> | 2023-05-03 09:34 | 11K | |
![[ ]](/icons/compressed.gif) | test-bank-for-americ..> | 2023-05-03 10:48 | 12K | |
![[ ]](/icons/unknown.gif) | test-bank-for-americ..> | 2023-05-04 01:54 | 119K | |
![[ ]](/icons/compressed.gif) | test-bank-for-anatom..> | 2023-05-04 02:10 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-anatom..> | 2023-05-04 02:19 | 432K | |
![[ ]](/icons/compressed.gif) | test-bank-for-applie..> | 2023-05-04 01:58 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-arriba..> | 2023-05-03 10:00 | 1.7M | |
![[ ]](/icons/compressed.gif) | test-bank-for-assemb..> | 2023-05-03 09:58 | 8.1K | |
![[ ]](/icons/compressed.gif) | test-bank-for-audtin..> | 2023-05-03 09:51 | 16K | |
![[ ]](/icons/layout.gif) | test-bank-for-basic-..> | 2023-05-04 02:26 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-basic-..> | 2023-05-04 02:28 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-basic-..> | 2023-05-04 02:17 | 9.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-becker..> | 2023-05-03 09:31 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-biosta..> | 2023-05-03 10:03 | 6.0K | |
![[ ]](/icons/compressed.gif) | test-bank-for-bontra..> | 2023-05-03 14:02 | 32K | |
![[ ]](/icons/compressed.gif) | test-bank-for-brain-..> | 2023-05-03 10:25 | 33K | |
![[ ]](/icons/compressed.gif) | test-bank-for-buildi..> | 2023-05-04 02:18 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-busine..> | 2023-05-04 01:51 | 17K | |
![[IMG]](/icons/image2.gif) | test-bank-for-busine..> | 2023-08-06 12:01 | 3.2K | |
![[IMG]](/icons/image2.gif) | test-bank-for-busine..> | 2023-08-28 21:31 | 17K | |
![[IMG]](/icons/image2.gif) | test-bank-for-busine..> | 2023-05-03 10:12 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-busine..> | 2023-05-03 09:07 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-busine..> | 2023-05-03 11:08 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-busine..> | 2023-05-03 10:18 | 37K | |
![[ ]](/icons/compressed.gif) | test-bank-for-busine..> | 2023-05-03 10:06 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-calcul..> | 2023-05-04 02:29 | 7.9K | |
![[ ]](/icons/compressed.gif) | test-bank-for-canadi..> | 2023-05-03 13:43 | 0 | |
![[ ]](/icons/compressed.gif) | test-bank-for-canadi..> | 2023-05-04 02:05 | 32K | |
![[ ]](/icons/compressed.gif) | test-bank-for-cardio..> | 2023-05-04 01:55 | 190K | |
![[ ]](/icons/compressed.gif) | test-bank-for-child-..> | 2023-05-03 09:23 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-childr..> | 2023-05-03 09:58 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-childr..> | 2023-05-03 10:26 | 47K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clayto..> | 2023-05-04 01:57 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clinic..> | 2023-05-04 02:25 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clinic..> | 2023-05-03 09:33 | 1.9K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clinic..> | 2023-05-04 02:19 | 9.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clinic..> | 2023-05-04 02:00 | 7.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-clinic..> | 2023-05-04 02:23 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-close-..> | 2023-05-03 09:56 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-commun..> | 2023-05-04 02:13 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-commun..> | 2023-05-03 09:39 | 10K | |
![[ ]](/icons/compressed.gif) | test-bank-for-commun..> | 2023-05-04 02:06 | 19K | |
![[ ]](/icons/compressed.gif) | test-bank-for-compre..> | 2023-05-04 02:17 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-comput..> | 2023-05-04 02:23 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-comput..> | 2023-05-03 10:21 | 11K | |
![[ ]](/icons/compressed.gif) | test-bank-for-concep..> | 2023-05-04 02:04 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-connec..> | 2023-05-03 11:08 | 42K | |
![[ ]](/icons/compressed.gif) | test-bank-for-contem..> | 2023-05-03 13:43 | 66K | |
![[ ]](/icons/compressed.gif) | test-bank-for-contem..> | 2023-05-03 10:34 | 49K | |
![[ ]](/icons/compressed.gif) | test-bank-for-corner..> | 2023-05-04 02:14 | 10K | |
![[ ]](/icons/compressed.gif) | test-bank-for-corpor..> | 2023-05-03 10:08 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-cost-b..> | 2023-05-03 09:48 | 51K | |
![[ ]](/icons/compressed.gif) | test-bank-for-crimin..> | 2023-05-03 13:44 | 220K | |
![[IMG]](/icons/image2.gif) | test-bank-for-crimin..> | 2023-08-05 16:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | test-bank-for-crimin..> | 2023-08-19 11:51 | 17K | |
![[IMG]](/icons/image2.gif) | test-bank-for-crimin..> | 2023-05-03 10:37 | 36K | |
![[ ]](/icons/compressed.gif) | test-bank-for-crimin..> | 2023-05-03 09:33 | 12K | |
![[ ]](/icons/unknown.gif) | test-bank-for-dental..> | 2023-05-04 02:22 | 195K | |
![[ ]](/icons/compressed.gif) | test-bank-for-dental..> | 2023-05-03 09:36 | 5.9K | |
![[ ]](/icons/compressed.gif) | test-bank-for-dewits..> | 2023-05-04 02:28 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-diet-a..> | 2023-05-04 02:18 | 106K | |
![[ ]](/icons/unknown.gif) | test-bank-for-digita..> | 2023-05-03 10:44 | 97K | |
![[ ]](/icons/compressed.gif) | test-bank-for-digita..> | 2023-05-04 02:25 | 30K | |
![[ ]](/icons/compressed.gif) | test-bank-for-dimens..> | 2023-05-03 09:41 | 524K | |
![[ ]](/icons/compressed.gif) | test-bank-for-diseas..> | 2023-05-04 02:20 | 6.4K | |
![[IMG]](/icons/image2.gif) | test-bank-for-divers..> | 2023-08-05 05:30 | 4.3K | |
![[IMG]](/icons/image2.gif) | test-bank-for-divers..> | 2023-08-08 08:19 | 35K | |
![[IMG]](/icons/image2.gif) | test-bank-for-divers..> | 2023-05-03 11:09 | 90K | |
![[ ]](/icons/compressed.gif) | test-bank-for-drugs-..> | 2023-05-03 10:41 | 8.6K | |
![[ ]](/icons/compressed.gif) | test-bank-for-eberso..> | 2023-05-04 02:11 | 24K | |
![[ ]](/icons/compressed.gif) | test-bank-for-ecg-es..> | 2023-05-04 02:24 | 122K | |
![[ ]](/icons/compressed.gif) | test-bank-for-ecgs-m..> | 2023-05-04 02:24 | 19K | |
![[ ]](/icons/compressed.gif) | test-bank-for-ekg-pl..> | 2023-05-04 02:20 | 92K | |
![[ ]](/icons/compressed.gif) | test-bank-for-electr..> | 2023-05-04 02:16 | 50K | |
![[ ]](/icons/compressed.gif) | test-bank-for-elemen..> | 2023-05-03 10:08 | 11K | |
![[ ]](/icons/compressed.gif) | test-bank-for-employ..> | 2023-05-03 09:59 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-entrep..> | 2023-05-03 10:12 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-entrep..> | 2023-05-03 10:45 | 19K | |
![[ ]](/icons/compressed.gif) | test-bank-for-enviro..> | 2023-05-03 10:08 | 44K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 13:43 | 6.6K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-04 02:29 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-04 02:18 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 09:31 | 11K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 09:59 | 272K | |
![[ ]](/icons/unknown.gif) | test-bank-for-essent..> | 2023-05-04 02:20 | 68K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 10:46 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 09:59 | 7.1K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-04 02:25 | 45K | |
![[ ]](/icons/unknown.gif) | test-bank-for-essent..> | 2023-05-04 02:06 | 45K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-03 09:25 | 30K | |
![[ ]](/icons/compressed.gif) | test-bank-for-essent..> | 2023-05-04 02:17 | 71K | |
![[ ]](/icons/compressed.gif) | test-bank-for-ethics..> | 2023-05-04 02:13 | 26K | |
![[ ]](/icons/compressed.gif) | test-bank-for-eviden..> | 2023-05-04 02:02 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-evolut..> | 2023-05-03 10:05 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-explor..> | 2023-05-03 13:59 | 8.5K | |
![[ ]](/icons/compressed.gif) | test-bank-for-financ..> | 2023-05-03 13:43 | 42K | |
![[ ]](/icons/compressed.gif) | test-bank-for-financ..> | 2023-05-03 10:10 | 45K | |
![[ ]](/icons/compressed.gif) | test-bank-for-financ..> | 2023-05-03 10:35 | 142K | |
![[ ]](/icons/compressed.gif) | test-bank-for-financ..> | 2023-05-03 10:10 | 20K | |
![[ ]](/icons/compressed.gif) | test-bank-for-financ..> | 2023-05-03 10:43 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-focus-..> | 2023-05-04 02:20 | 9.9K | |
![[ ]](/icons/unknown.gif) | test-bank-for-forens..> | 2023-05-03 10:52 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-03 11:26 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-03 10:43 | 31K | |
![[ ]](/icons/unknown.gif) | test-bank-for-founda..> | 2023-05-04 02:21 | 178K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-04 02:21 | 20K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-04 02:09 | 19K | |
![[ ]](/icons/unknown.gif) | test-bank-for-founda..> | 2023-05-03 09:40 | 173K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-04 02:27 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-founda..> | 2023-05-04 02:21 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-fromme..> | 2023-05-04 02:11 | 10K | |
![[IMG]](/icons/image2.gif) | test-bank-for-fundam..> | 2023-08-06 11:15 | 3.3K | |
![[IMG]](/icons/image2.gif) | test-bank-for-fundam..> | 2023-08-25 12:28 | 18K | |
![[IMG]](/icons/image2.gif) | test-bank-for-fundam..> | 2023-05-03 09:59 | 39K | |
![[ ]](/icons/compressed.gif) | test-bank-for-fundam..> | 2023-05-03 10:25 | 31K | |
![[ ]](/icons/compressed.gif) | test-bank-for-fundam..> | 2023-05-03 13:43 | 70K | |
![[ ]](/icons/compressed.gif) | test-bank-for-fundam..> | 2023-05-04 02:04 | 24K | |
![[ ]](/icons/compressed.gif) | test-bank-for-genera..> | 2023-05-03 10:00 | 252K | |
![[ ]](/icons/compressed.gif) | test-bank-for-geneti..> | 2023-05-04 02:22 | 19K | |
![[ ]](/icons/layout.gif) | test-bank-for-geneti..> | 2023-05-03 09:35 | 132K | |
![[ ]](/icons/compressed.gif) | test-bank-for-geogra..> | 2023-05-03 09:58 | 2.8M | |
![[ ]](/icons/compressed.gif) | test-bank-for-geront..> | 2023-05-04 02:03 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-gift-o..> | 2023-05-03 10:07 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-give-m..> | 2023-05-03 09:30 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-global..> | 2023-05-03 11:17 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-goulds..> | 2023-05-04 02:12 | 10K | |
![[ ]](/icons/compressed.gif) | test-bank-for-guide-..> | 2023-05-03 09:53 | 7.1K | |
![[ ]](/icons/compressed.gif) | test-bank-for-guide-..> | 2023-05-03 10:59 | 12K | |
![[IMG]](/icons/image2.gif) | test-bank-for-guide-..> | 2023-08-05 01:51 | 3.1K | |
![[IMG]](/icons/image2.gif) | test-bank-for-guide-..> | 2023-09-14 17:47 | 19K | |
![[IMG]](/icons/image2.gif) | test-bank-for-guide-..> | 2023-05-03 10:59 | 145K | |
![[ ]](/icons/compressed.gif) | test-bank-for-hdev-3..> | 2023-05-03 10:24 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-hdev-4..> | 2023-05-03 10:32 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-04 01:54 | 34K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-03 10:27 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-04 02:21 | 45K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-04 02:18 | 9.6K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-04 02:24 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-health..> | 2023-05-03 10:21 | 29K | |
![[ ]](/icons/compressed.gif) | test-bank-for-holes-..> | 2023-05-03 09:44 | 11K | |
![[ ]](/icons/compressed.gif) | test-bank-for-human-..> | 2023-05-04 02:06 | 512K | |
![[ ]](/icons/layout.gif) | test-bank-for-human-..> | 2023-05-03 11:13 | 1.1M | |
![[IMG]](/icons/image2.gif) | test-bank-for-human-..> | 2023-08-06 07:46 | 4.1K | |
![[IMG]](/icons/image2.gif) | test-bank-for-human-..> | 2023-09-01 04:31 | 24K | |
![[IMG]](/icons/image2.gif) | test-bank-for-human-..> | 2023-05-03 09:44 | 54K | |
![[ ]](/icons/compressed.gif) | test-bank-for-human-..> | 2023-05-04 02:16 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-human-..> | 2023-05-03 11:01 | 85K | |
![[ ]](/icons/compressed.gif) | test-bank-for-human-..> | 2023-05-03 10:35 | 22K | |
![[ ]](/icons/unknown.gif) | test-bank-for-human-..> | 2023-05-03 13:42 | 70K | |
![[ ]](/icons/unknown.gif) | test-bank-for-igenet..> | 2023-05-03 13:42 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-immuno..> | 2023-05-03 09:27 | 8.6K | |
![[ ]](/icons/compressed.gif) | test-bank-for-inform..> | 2023-05-04 02:07 | 8.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-interm..> | 2023-05-03 10:56 | 25K | |
![[ ]](/icons/compressed.gif) | test-bank-for-interm..> | 2023-05-03 10:38 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-intern..> | 2023-05-04 02:18 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-intern..> | 2023-05-03 09:23 | 507K | |
![[ ]](/icons/compressed.gif) | test-bank-for-intern..> | 2023-05-03 09:54 | 6.3K | |
![[ ]](/icons/compressed.gif) | test-bank-for-intern..> | 2023-05-03 10:05 | 19K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 02:26 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 09:57 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 09:33 | 144K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 10:20 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 02:17 | 9.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 09:36 | 84K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 02:21 | 321K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 01:59 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 10:33 | 136K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 01:59 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 09:53 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-04 01:56 | 106K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 10:26 | 9.2K | |
![[ ]](/icons/compressed.gif) | test-bank-for-introd..> | 2023-05-03 13:43 | 39K | |
![[ ]](/icons/compressed.gif) | test-bank-for-kinns-..> | 2023-05-04 02:00 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-leadin..> | 2023-05-04 02:25 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-leadin..> | 2023-05-04 02:03 | 19K | |
![[IMG]](/icons/image2.gif) | test-bank-for-legal-..> | 2023-08-06 10:18 | 2.3K | |
![[IMG]](/icons/image2.gif) | test-bank-for-legal-..> | 2023-08-30 09:02 | 13K | |
![[IMG]](/icons/image2.gif) | test-bank-for-legal-..> | 2023-05-03 10:56 | 90K | |
![[ ]](/icons/compressed.gif) | test-bank-for-lehnes..> | 2023-05-04 02:09 | 4.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-lemone..> | 2023-05-04 01:54 | 36K | |
![[ ]](/icons/compressed.gif) | test-bank-for-let-03..> | 2023-05-04 02:14 | 41K | |
![[ ]](/icons/compressed.gif) | test-bank-for-little..> | 2023-05-04 02:12 | 6.9K | |
![[ ]](/icons/layout.gif) | test-bank-for-living..> | 2023-05-04 02:22 | 493K | |
![[ ]](/icons/compressed.gif) | test-bank-for-local-..> | 2023-05-04 02:28 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-macroe..> | 2023-05-03 11:07 | 821K | |
![[ ]](/icons/compressed.gif) | test-bank-for-macroe..> | 2023-05-03 10:28 | 9.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-macroe..> | 2023-05-03 09:42 | 236K | |
![[ ]](/icons/unknown.gif) | test-bank-for-manage..> | 2023-05-04 01:47 | 226K | |
![[ ]](/icons/compressed.gif) | test-bank-for-manage..> | 2023-05-03 09:28 | 450K | |
![[IMG]](/icons/image2.gif) | test-bank-for-manage..> | 2023-08-05 15:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | test-bank-for-manage..> | 2023-09-08 20:36 | 22K | |
![[IMG]](/icons/image2.gif) | test-bank-for-manage..> | 2023-05-03 10:02 | 49K | |
![[ ]](/icons/compressed.gif) | test-bank-for-managi..> | 2023-05-03 09:48 | 29K | |
![[ ]](/icons/compressed.gif) | test-bank-for-managi..> | 2023-05-03 11:05 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-market..> | 2023-05-03 10:32 | 857K | |
![[ ]](/icons/unknown.gif) | test-bank-for-market..> | 2023-05-03 13:42 | 105K | |
![[IMG]](/icons/image2.gif) | test-bank-for-marria..> | 2023-08-05 05:29 | 3.7K | |
![[IMG]](/icons/image2.gif) | test-bank-for-marria..> | 2023-08-18 17:37 | 19K | |
![[IMG]](/icons/image2.gif) | test-bank-for-marria..> | 2023-05-03 09:49 | 41K | |
![[ ]](/icons/compressed.gif) | test-bank-for-matern..> | 2023-05-03 10:43 | 3.5K | |
![[IMG]](/icons/image2.gif) | test-bank-for-mathem..> | 2023-08-05 04:34 | 4.2K | |
![[IMG]](/icons/image2.gif) | test-bank-for-mathem..> | 2023-08-14 15:10 | 21K | |
![[IMG]](/icons/image2.gif) | test-bank-for-mathem..> | 2023-05-03 10:02 | 44K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-03 10:13 | 26K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 01:57 | 51K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 02:15 | 50K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 02:18 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 01:58 | 7.3K | |
![[ ]](/icons/unknown.gif) | test-bank-for-medica..> | 2023-05-03 09:07 | 87K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 02:10 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 01:52 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 01:53 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-medica..> | 2023-05-04 02:21 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-merril..> | 2023-05-04 01:59 | 9.2K | |
![[ ]](/icons/compressed.gif) | test-bank-for-michlo..> | 2023-05-04 02:19 | 9.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-microb..> | 2023-05-04 01:48 | 48K | |
![[ ]](/icons/compressed.gif) | test-bank-for-microe..> | 2023-05-03 10:44 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-modern..> | 2023-05-04 02:20 | 6.3K | |
![[ ]](/icons/compressed.gif) | test-bank-for-modern..> | 2023-05-03 09:57 | 22K | |
![[ ]](/icons/compressed.gif) | test-bank-for-modern..> | 2023-05-03 09:42 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-mosbys..> | 2023-05-04 02:25 | 42K | |
![[ ]](/icons/compressed.gif) | test-bank-for-mosbys..> | 2023-05-04 02:23 | 93K | |
![[ ]](/icons/compressed.gif) | test-bank-for-mosbys..> | 2023-05-03 10:04 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-mosbys..> | 2023-05-04 02:29 | 8.9K | |
![[ ]](/icons/compressed.gif) | test-bank-for-multin..> | 2023-05-03 09:59 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-natura..> | 2023-05-03 10:39 | 16K | |
![[ ]](/icons/compressed.gif) | test-bank-for-neonat..> | 2023-05-04 02:01 | 6.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nursin..> | 2023-05-04 02:04 | 9.5K | |
![[ ]](/icons/unknown.gif) | test-bank-for-nursin..> | 2023-05-04 02:21 | 158K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nursin..> | 2023-05-04 02:08 | 24K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nursin..> | 2023-05-04 02:08 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nutrit..> | 2023-05-03 09:40 | 32K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nutrit..> | 2023-05-03 10:12 | 15K | |
![[ ]](/icons/unknown.gif) | test-bank-for-nutrit..> | 2023-05-03 11:11 | 162K | |
![[ ]](/icons/compressed.gif) | test-bank-for-nutrit..> | 2023-05-04 02:01 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-olds-m..> | 2023-05-04 01:53 | 102K | |
![[ ]](/icons/compressed.gif) | test-bank-for-operat..> | 2023-05-03 10:14 | 139K | |
![[ ]](/icons/compressed.gif) | test-bank-for-operat..> | 2023-05-03 10:17 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-operat..> | 2023-05-03 10:09 | 47K | |
![[ ]](/icons/compressed.gif) | test-bank-for-option..> | 2023-05-04 02:11 | 8.1K | |
![[IMG]](/icons/image2.gif) | test-bank-for-option..> | 2023-08-08 06:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | test-bank-for-option..> | 2023-08-18 10:49 | 18K | |
![[IMG]](/icons/image2.gif) | test-bank-for-option..> | 2023-05-04 02:11 | 38K | |
![[ ]](/icons/compressed.gif) | test-bank-for-oral-p..> | 2023-05-04 02:29 | 31K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 10:02 | 379K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 13:44 | 265K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 09:20 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 09:21 | 33K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 09:19 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-organi..> | 2023-05-03 10:47 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-orgb-3..> | 2023-05-04 02:12 | 10K | |
![[ ]](/icons/compressed.gif) | test-bank-for-our-se..> | 2023-05-03 10:45 | 32K | |
![[ ]](/icons/compressed.gif) | test-bank-for-out-of..> | 2023-05-03 13:44 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pathop..> | 2023-05-04 02:08 | 7.7K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pathop..> | 2023-05-04 02:21 | 25K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pathop..> | 2023-05-04 02:11 | 21K | |
![[IMG]](/icons/image2.gif) | test-bank-for-pathop..> | 2023-05-03 10:39 | 82K | |
![[ ]](/icons/unknown.gif) | test-bank-for-pediat..> | 2023-05-03 09:30 | 101K | |
![[ ]](/icons/compressed.gif) | test-bank-for-person..> | 2023-05-03 10:22 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-persua..> | 2023-05-03 10:34 | 35K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pharma..> | 2023-05-03 13:41 | 7.1K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pharma..> | 2023-05-04 02:16 | 498K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pharma..> | 2023-05-04 01:53 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pharma..> | 2023-05-04 02:28 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-pharma..> | 2023-05-04 02:22 | 35K | |
![[ ]](/icons/compressed.gif) | test-bank-for-phlebo..> | 2023-05-04 02:28 | 6.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-physic..> | 2023-05-04 02:03 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-physic..> | 2023-05-04 02:04 | 20K | |
![[ ]](/icons/compressed.gif) | test-bank-for-physic..> | 2023-05-03 10:36 | 6.4K | |
![[ ]](/icons/compressed.gif) | test-bank-for-physic..> | 2023-05-03 09:38 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-physio..> | 2023-05-03 09:31 | 36K | |
![[ ]](/icons/compressed.gif) | test-bank-for-police..> | 2023-05-03 10:52 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-princi..> | 2023-05-03 09:11 | 319K | |
![[ ]](/icons/compressed.gif) | test-bank-for-princi..> | 2023-05-03 09:26 | 3.5M | |
![[ ]](/icons/compressed.gif) | test-bank-for-princi..> | 2023-05-03 10:11 | 103K | |
![[ ]](/icons/compressed.gif) | test-bank-for-princi..> | 2023-05-03 09:49 | 524K | |
![[ ]](/icons/compressed.gif) | test-bank-for-princi..> | 2023-05-04 01:55 | 20K | |
![[ ]](/icons/unknown.gif) | test-bank-for-priori..> | 2023-05-03 10:12 | 60K | |
![[ ]](/icons/compressed.gif) | test-bank-for-priori..> | 2023-05-04 02:05 | 11K | |
![[ ]](/icons/unknown.gif) | test-bank-for-proced..> | 2023-05-03 10:36 | 74K | |
![[ ]](/icons/compressed.gif) | test-bank-for-produc..> | 2023-05-03 10:10 | 12K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psychi..> | 2023-05-03 09:23 | 1.6K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psychi..> | 2023-05-04 02:02 | 18K | |
![[ ]](/icons/unknown.gif) | test-bank-for-psycho..> | 2023-05-03 10:31 | 388K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psycho..> | 2023-05-03 10:31 | 26K | |
![[IMG]](/icons/image2.gif) | test-bank-for-psycho..> | 2023-08-05 01:52 | 4.0K | |
![[IMG]](/icons/image2.gif) | test-bank-for-psycho..> | 2023-08-10 04:13 | 21K | |
![[IMG]](/icons/image2.gif) | test-bank-for-psycho..> | 2023-05-03 10:00 | 50K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psycho..> | 2023-05-03 10:54 | 150K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psycho..> | 2023-05-03 10:50 | 40K | |
![[ ]](/icons/compressed.gif) | test-bank-for-psycho..> | 2023-05-03 10:51 | 44K | |
![[ ]](/icons/compressed.gif) | test-bank-for-public..> | 2023-05-03 09:25 | 20K | |
![[ ]](/icons/compressed.gif) | test-bank-for-quick-..> | 2023-05-04 02:00 | 7.1K | |
![[ ]](/icons/unknown.gif) | test-bank-for-radiog..> | 2023-05-03 09:32 | 85K | |
![[ ]](/icons/compressed.gif) | test-bank-for-radiog..> | 2023-05-04 02:23 | 12K | |
![[ ]](/icons/layout.gif) | test-bank-for-resear..> | 2023-05-04 01:55 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-respir..> | 2023-05-04 02:24 | 219K | |
![[ ]](/icons/unknown.gif) | test-bank-for-saunde..> | 2023-05-03 13:43 | 95K | |
![[ ]](/icons/layout.gif) | test-bank-for-sectio..> | 2023-05-03 09:23 | 302K | |
![[ ]](/icons/compressed.gif) | test-bank-for-sectio..> | 2023-05-04 02:07 | 156K | |
![[ ]](/icons/compressed.gif) | test-bank-for-seeley..> | 2023-05-03 09:18 | 713K | |
![[ ]](/icons/compressed.gif) | test-bank-for-seidel..> | 2023-05-04 02:26 | 49K | |
![[ ]](/icons/compressed.gif) | test-bank-for-shorte..> | 2023-05-04 01:55 | 23K | |
![[ ]](/icons/compressed.gif) | test-bank-for-small-..> | 2023-05-03 10:12 | 29K | |
![[ ]](/icons/compressed.gif) | test-bank-for-social..> | 2023-05-03 09:58 | 109K | |
![[ ]](/icons/compressed.gif) | test-bank-for-social..> | 2023-05-03 10:21 | 1.5M | |
![[ ]](/icons/compressed.gif) | test-bank-for-sonogr..> | 2023-05-04 02:27 | 7.3K | |
![[ ]](/icons/compressed.gif) | test-bank-for-south-..> | 2023-05-03 09:57 | 372K | |
![[ ]](/icons/compressed.gif) | test-bank-for-starti..> | 2023-05-03 11:22 | 89K | |
![[ ]](/icons/compressed.gif) | test-bank-for-strate..> | 2023-05-03 09:27 | 29K | |
![[ ]](/icons/compressed.gif) | test-bank-for-strate..> | 2023-05-03 14:04 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-supply..> | 2023-05-03 10:13 | 20K | |
![[ ]](/icons/unknown.gif) | test-bank-for-system..> | 2023-05-04 01:54 | 58K | |
![[ ]](/icons/compressed.gif) | test-bank-for-system..> | 2023-05-03 10:40 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-textbo..> | 2023-05-04 02:27 | 24K | |
![[ ]](/icons/compressed.gif) | test-bank-for-textbo..> | 2023-05-04 02:07 | 72K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-co..> | 2023-05-04 02:14 | 19K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-cu..> | 2023-05-03 10:30 | 48K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-de..> | 2023-05-04 02:12 | 24K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-hu..> | 2023-05-04 02:18 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-la..> | 2023-05-03 11:06 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-nu..> | 2023-05-04 02:22 | 0 | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-pr..> | 2023-05-03 10:43 | 40K | |
![[IMG]](/icons/image2.gif) | test-bank-for-the-pr..> | 2023-08-06 05:44 | 4.5K | |
![[IMG]](/icons/image2.gif) | test-bank-for-the-pr..> | 2023-09-17 19:43 | 25K | |
![[IMG]](/icons/image2.gif) | test-bank-for-the-pr..> | 2023-05-03 10:43 | 62K | |
![[ ]](/icons/compressed.gif) | test-bank-for-the-wo..> | 2023-05-03 10:31 | 1.2M | |
![[ ]](/icons/compressed.gif) | test-bank-for-therap..> | 2023-05-04 02:20 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-therap..> | 2023-05-03 10:32 | 5.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-tietz-..> | 2023-05-04 02:26 | 9.2K | |
![[ ]](/icons/compressed.gif) | test-bank-for-touris..> | 2023-05-03 13:41 | 5.3K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 10:11 | 33K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:21 | 4.8K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 14:00 | 5.2K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:14 | 142K | |
![[IMG]](/icons/image2.gif) | test-bank-for-unders..> | 2023-08-05 03:41 | 2.8K | |
![[IMG]](/icons/image2.gif) | test-bank-for-unders..> | 2023-05-03 11:21 | 8.2K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 11:21 | 305K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 11:12 | 85K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:20 | 125K | |
![[ ]](/icons/unknown.gif) | test-bank-for-unders..> | 2023-05-04 02:04 | 131K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 09:29 | 18K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:02 | 20K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-03 11:22 | 1.5M | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:11 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:29 | 14K | |
![[ ]](/icons/compressed.gif) | test-bank-for-unders..> | 2023-05-04 02:17 | 15K | |
![[ ]](/icons/compressed.gif) | test-bank-for-urinal..> | 2023-05-04 02:21 | 17K | |
![[ ]](/icons/compressed.gif) | test-bank-for-us-a-n..> | 2023-05-04 02:19 | 21K | |
![[ ]](/icons/compressed.gif) | test-bank-for-we-the..> | 2023-05-03 10:24 | 16K | |
![[ ]](/icons/unknown.gif) | test-bank-for-what-i..> | 2023-05-04 02:23 | 515K | |
![[ ]](/icons/compressed.gif) | test-bank-for-wilkin..> | 2023-05-04 02:22 | 18K | |
![[ ]](/icons/unknown.gif) | test-bank-for-wong-s..> | 2023-05-03 10:44 | 196K | |
![[ ]](/icons/compressed.gif) | test-bank-for-world-..> | 2023-05-03 09:38 | 5.8M | |
![[ ]](/icons/compressed.gif) | test-bank-foundation..> | 2023-05-03 10:13 | 8.3K | |
![[ ]](/icons/compressed.gif) | test-bank-introducto..> | 2023-05-03 09:50 | 5.7K | |
![[ ]](/icons/compressed.gif) | test-bank-joint-stru..> | 2023-05-03 10:28 | 29K | |
![[ ]](/icons/compressed.gif) | test-bank-mcgraw-hil..> | 2023-05-03 10:14 | 82K | |
![[ ]](/icons/compressed.gif) | test-bank-medical-su..> | 2023-05-03 09:37 | 6.8K | |
![[ ]](/icons/compressed.gif) | test-bank-new-perspe..> | 2023-05-03 09:40 | 1.7M | |
![[ ]](/icons/compressed.gif) | test-bank-operations..> | 2023-05-03 11:15 | 332K | |
![[ ]](/icons/compressed.gif) | test-bank-saladin-7e..> | 2023-05-03 10:28 | 13K | |
![[ ]](/icons/compressed.gif) | test-bank-starting-o..> | 2023-05-03 10:57 | 10K | |
![[ ]](/icons/compressed.gif) | test-bank-virtual-cl..> | 2023-05-03 13:42 | 7.3K | |
![[ ]](/icons/unknown.gif) | test-bank-virtual-cl..> | 2023-05-03 09:41 | 69K | |
![[ ]](/icons/compressed.gif) | test-banks-for-essen..> | 2023-05-03 10:16 | 17K | |
![[IMG]](/icons/image2.gif) | test_bank_for_3_2_1_..> | 2023-05-04 01:56 | 16K | |
![[ ]](/icons/compressed.gif) | test_bank_for_alexan..> | 2023-05-04 02:07 | 14K | |
![[ ]](/icons/compressed.gif) | test_bank_for_anatom..> | 2023-05-04 01:51 | 12K | |
![[IMG]](/icons/image2.gif) | test_bank_for_cardio..> | 2023-05-04 01:55 | 13K | |
![[ ]](/icons/compressed.gif) | test_bank_for_colleg..> | 2023-05-03 13:42 | 252K | |
![[ ]](/icons/unknown.gif) | test_bank_for_crimin..> | 2023-05-03 11:14 | 50K | |
![[IMG]](/icons/image2.gif) | test_bank_for_diet_a..> | 2023-05-04 02:18 | 10K | |
![[IMG]](/icons/image2.gif) | test_bank_for_ecg_es..> | 2023-05-04 02:24 | 8.4K | |
![[ ]](/icons/compressed.gif) | test_bank_for_essent..> | 2023-05-04 02:08 | 56K | |
![[IMG]](/icons/image2.gif) | test_bank_for_essent..> | 2023-05-04 01:57 | 13K | |
![[ ]](/icons/compressed.gif) | test_bank_for_essent..> | 2023-05-03 11:10 | 22K | |
![[IMG]](/icons/image2.gif) | test_bank_for_essent..> | 2023-05-04 02:17 | 16K | |
![[ ]](/icons/compressed.gif) | test_bank_for_experi..> | 2023-05-04 02:28 | 34K | |
![[IMG]](/icons/image2.gif) | test_bank_for_federa..> | 2023-08-05 03:41 | 3.2K | |
![[IMG]](/icons/image2.gif) | test_bank_for_federa..> | 2023-08-24 00:34 | 19K | |
![[IMG]](/icons/image2.gif) | test_bank_for_federa..> | 2023-05-03 11:03 | 66K | |
![[ ]](/icons/compressed.gif) | test_bank_for_fundam..> | 2023-05-03 13:44 | 136K | |
![[IMG]](/icons/image2.gif) | test_bank_for_human_..> | 2023-05-04 02:16 | 13K | |
![[ ]](/icons/compressed.gif) | test_bank_for_human_..> | 2023-05-03 13:43 | 141K | |
![[ ]](/icons/compressed.gif) | test_bank_for_inquir..> | 2023-05-03 11:13 | 18K | |
![[IMG]](/icons/image2.gif) | test_bank_for_introd..> | 2023-05-04 01:56 | 17K | |
![[ ]](/icons/compressed.gif) | test_bank_for_introd..> | 2023-05-04 02:23 | 10K | |
![[IMG]](/icons/image2.gif) | test_bank_for_managi..> | 2023-05-04 01:55 | 25K | |
![[ ]](/icons/compressed.gif) | test_bank_for_managi..> | 2023-05-04 01:51 | 154K | |
![[ ]](/icons/compressed.gif) | test_bank_for_market..> | 2023-05-04 01:49 | 323K | |
![[IMG]](/icons/image2.gif) | test_bank_for_medica..> | 2023-05-04 02:18 | 15K | |
![[ ]](/icons/compressed.gif) | test_bank_for_medica..> | 2023-05-04 01:52 | 16K | |
![[ ]](/icons/compressed.gif) | test_bank_for_mis_9t..> | 2023-05-04 01:57 | 63K | |
![[ ]](/icons/compressed.gif) | test_bank_for_operat..> | 2023-05-03 13:42 | 24K | |
![[ ]](/icons/compressed.gif) | test_bank_for_person..> | 2023-05-04 01:59 | 132K | |
![[IMG]](/icons/image2.gif) | test_bank_for_princi..> | 2023-05-04 01:55 | 14K | |
![[IMG]](/icons/image2.gif) | test_bank_for_respir..> | 2023-05-04 02:24 | 8.0K | |
![[IMG]](/icons/image2.gif) | test_bank_for_shorte..> | 2023-05-04 01:55 | 12K | |
![[IMG]](/icons/image2.gif) | test_bank_for_sociol..> | 2023-08-05 19:13 | 3.5K | |
![[IMG]](/icons/image2.gif) | test_bank_for_sociol..> | 2023-05-04 02:21 | 13K | |
![[IMG]](/icons/image2.gif) | test_bank_for_the_co..> | 2023-05-04 02:14 | 13K | |
![[ ]](/icons/compressed.gif) | test_bank_for_unders..> | 2023-05-04 01:52 | 120K | |
![[IMG]](/icons/image2.gif) | test_bank_for_unders..> | 2023-05-04 02:14 | 13K | |
![[IMG]](/icons/image2.gif) | test_bank_for_unders..> | 2023-05-04 02:20 | 13K | |
![[ ]](/icons/compressed.gif) | test_bank_for_unders..> | 2023-05-04 02:18 | 210K | |
![[ ]](/icons/compressed.gif) | testbank-timby-11e.zip | 2023-05-03 11:17 | 11K | |
![[ ]](/icons/unknown.gif) | testbank_ch01-978013..> | 2023-05-03 11:18 | 747K | |
![[ ]](/icons/compressed.gif) | testbank_free_bs5f_c..> | 2023-05-03 09:37 | 80K | |
![[ ]](/icons/compressed.gif) | textbook-of-basic-nu..> | 2023-05-03 10:13 | 13K | |
![[IMG]](/icons/image2.gif) | textbook-of-basic-nu..> | 2023-08-05 05:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | textbook-of-basic-nu..> | 2023-05-03 11:27 | 13K | |
![[ ]](/icons/compressed.gif) | textbook-of-basic-nu..> | 2023-05-03 11:27 | 11K | |
![[IMG]](/icons/image2.gif) | textbook-of-medical-..> | 2023-08-05 02:03 | 3.2K | |
![[IMG]](/icons/image2.gif) | textbook-of-medical-..> | 2023-05-03 09:27 | 22K | |
![[IMG]](/icons/image2.gif) | the-adolescent-devel..> | 2023-08-06 09:41 | 3.1K | |
![[IMG]](/icons/image2.gif) | the-adolescent-devel..> | 2023-05-03 10:14 | 21K | |
![[ ]](/icons/compressed.gif) | the-adolescent-devel..> | 2023-05-03 10:14 | 23K | |
![[IMG]](/icons/image2.gif) | the-african-american..> | 2023-08-09 15:47 | 3.6K | |
![[IMG]](/icons/image2.gif) | the-african-american..> | 2023-05-03 10:11 | 26K | |
![[ ]](/icons/compressed.gif) | the-african-american..> | 2023-05-03 10:11 | 15K | |
![[IMG]](/icons/image2.gif) | the-anatomy-and-phys..> | 2023-08-08 21:07 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-anatomy-and-phys..> | 2023-05-03 09:44 | 16K | |
![[IMG]](/icons/image2.gif) | the-art-of-public-sp..> | 2023-05-03 11:06 | 13K | |
![[IMG]](/icons/image2.gif) | the-art-of-public-sp..> | 2023-08-05 04:35 | 2.1K | |
![[IMG]](/icons/image2.gif) | the-art-of-public-sp..> | 2023-05-03 11:11 | 11K | |
![[IMG]](/icons/image2.gif) | the-art-of-theatre-t..> | 2023-08-05 01:40 | 3.4K | |
![[IMG]](/icons/image2.gif) | the-art-of-theatre-t..> | 2023-09-18 05:40 | 18K | |
![[IMG]](/icons/image2.gif) | the-art-of-theatre-t..> | 2023-05-03 11:04 | 53K | |
![[ ]](/icons/compressed.gif) | the-articulate-voice..> | 2023-05-04 02:29 | 165K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-08-05 20:18 | 3.3K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-05-03 09:18 | 25K | |
![[ ]](/icons/compressed.gif) | the-cultural-landsca..> | 2023-05-03 09:18 | 42K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-08-06 07:49 | 16K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-05-03 09:33 | 45K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-08-05 03:37 | 4.0K | |
![[IMG]](/icons/image2.gif) | the-cultural-landsca..> | 2023-05-03 10:36 | 15K | |
![[ ]](/icons/compressed.gif) | the-dental-hygienist..> | 2023-05-03 09:36 | 25K | |
![[IMG]](/icons/image2.gif) | the-dental-hygienist..> | 2023-08-08 06:39 | 3.8K | |
![[IMG]](/icons/image2.gif) | the-dental-hygienist..> | 2023-05-03 09:42 | 22K | |
![[ ]](/icons/compressed.gif) | the-dental-hygienist..> | 2023-05-03 09:42 | 17K | |
![[IMG]](/icons/image2.gif) | the-developing-child..> | 2023-08-06 12:06 | 3.4K | |
![[IMG]](/icons/image2.gif) | the-developing-child..> | 2023-05-03 09:36 | 19K | |
![[ ]](/icons/compressed.gif) | the-developing-child..> | 2023-05-03 09:36 | 134K | |
![[ ]](/icons/compressed.gif) | the-developing-human..> | 2023-05-03 09:50 | 704K | |
![[IMG]](/icons/image2.gif) | the-developing-human..> | 2023-08-05 04:36 | 2.8K | |
![[IMG]](/icons/image2.gif) | the-developing-human..> | 2023-05-03 10:39 | 15K | |
![[ ]](/icons/compressed.gif) | the-developing-human..> | 2023-05-03 10:39 | 51K | |
![[IMG]](/icons/image2.gif) | the-developing-perso..> | 2023-08-06 11:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | the-developing-perso..> | 2023-05-03 11:11 | 25K | |
![[ ]](/icons/compressed.gif) | the-developing-perso..> | 2023-05-03 09:18 | 415K | |
![[IMG]](/icons/image2.gif) | the-economy-today-sc..> | 2023-08-08 06:42 | 3.0K | |
![[IMG]](/icons/image2.gif) | the-economy-today-sc..> | 2023-05-03 09:39 | 17K | |
![[ ]](/icons/compressed.gif) | the-economy-today-sc..> | 2023-05-03 09:39 | 611K | |
![[IMG]](/icons/image2.gif) | the-family-dynamic-a..> | 2023-08-06 01:46 | 3.0K | |
![[IMG]](/icons/image2.gif) | the-family-dynamic-a..> | 2023-05-03 09:46 | 16K | |
![[ ]](/icons/compressed.gif) | the-family-dynamic-a..> | 2023-05-03 09:46 | 26K | |
![[IMG]](/icons/image2.gif) | the-family-eshleman-..> | 2023-08-08 00:41 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-family-eshleman-..> | 2023-05-03 10:00 | 15K | |
![[ ]](/icons/compressed.gif) | the-family-eshleman-..> | 2023-05-03 10:00 | 18K | |
![[IMG]](/icons/image2.gif) | the-future-of-busine..> | 2023-08-05 18:15 | 1.8K | |
![[IMG]](/icons/image2.gif) | the-future-of-busine..> | 2023-05-03 09:39 | 11K | |
![[ ]](/icons/compressed.gif) | the-future-of-busine..> | 2023-05-03 09:39 | 29K | |
![[IMG]](/icons/image2.gif) | the-human-body-in-he..> | 2023-08-05 03:40 | 3.7K | |
![[IMG]](/icons/image2.gif) | the-human-body-in-he..> | 2023-05-03 09:49 | 24K | |
![[IMG]](/icons/image2.gif) | the-labor-relations-..> | 2023-08-06 11:18 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-labor-relations-..> | 2023-05-03 09:40 | 16K | |
![[ ]](/icons/compressed.gif) | the-labor-relations-..> | 2023-05-03 09:40 | 13K | |
![[IMG]](/icons/image2.gif) | the-language-of-medi..> | 2023-08-05 02:46 | 3.9K | |
![[IMG]](/icons/image2.gif) | the-language-of-medi..> | 2023-05-03 09:37 | 22K | |
![[ ]](/icons/compressed.gif) | the-language-of-medi..> | 2023-05-03 09:37 | 23K | |
![[IMG]](/icons/image2.gif) | the-law-and-business..> | 2023-08-08 06:39 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-law-and-business..> | 2023-05-03 09:54 | 17K | |
![[ ]](/icons/compressed.gif) | the-law-and-business..> | 2023-05-03 09:54 | 17K | |
![[IMG]](/icons/image2.gif) | the-leadership-exper..> | 2023-08-08 09:18 | 2.9K | |
![[IMG]](/icons/image2.gif) | the-leadership-exper..> | 2023-05-03 09:21 | 19K | |
![[ ]](/icons/compressed.gif) | the-leadership-exper..> | 2023-05-03 09:20 | 16K | |
![[IMG]](/icons/image2.gif) | the-legal-environmen..> | 2023-08-06 03:28 | 1.8K | |
![[IMG]](/icons/image2.gif) | the-legal-environmen..> | 2023-05-04 01:48 | 12K | |
![[ ]](/icons/compressed.gif) | the-legal-environmen..> | 2023-05-04 01:48 | 15K | |
![[ ]](/icons/compressed.gif) | the-life-span-human-..> | 2023-05-03 09:42 | 33K | |
![[IMG]](/icons/image2.gif) | the-living-world-geo..> | 2023-08-05 17:22 | 3.4K | |
![[IMG]](/icons/image2.gif) | the-living-world-geo..> | 2023-05-03 10:36 | 23K | |
![[ ]](/icons/compressed.gif) | the-living-world-geo..> | 2023-05-03 10:36 | 33K | |
![[IMG]](/icons/image2.gif) | the-marriage-and-fam..> | 2023-08-05 21:05 | 4.2K | |
![[IMG]](/icons/image2.gif) | the-marriage-and-fam..> | 2023-05-03 10:32 | 24K | |
![[ ]](/icons/compressed.gif) | the-marriage-and-fam..> | 2023-05-03 10:32 | 115K | |
![[IMG]](/icons/image2.gif) | the-marriage-and-fam..> | 2023-08-06 10:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | the-marriage-and-fam..> | 2023-05-03 09:40 | 18K | |
![[ ]](/icons/compressed.gif) | the-marriage-and-fam..> | 2023-05-03 09:40 | 7.6K | |
![[IMG]](/icons/image2.gif) | the-micro-economy-to..> | 2023-08-06 17:25 | 3.0K | |
![[IMG]](/icons/image2.gif) | the-micro-economy-to..> | 2023-05-03 09:43 | 17K | |
![[IMG]](/icons/image2.gif) | the-molecules-of-lif..> | 2023-08-06 13:05 | 18K | |
![[IMG]](/icons/image2.gif) | the-molecules-of-lif..> | 2023-05-03 09:38 | 49K | |
![[IMG]](/icons/image2.gif) | the-murder-book-exam..> | 2023-08-05 04:31 | 2.6K | |
![[IMG]](/icons/image2.gif) | the-murder-book-exam..> | 2023-05-03 10:19 | 12K | |
![[IMG]](/icons/image2.gif) | the-muscular-system-..> | 2023-08-05 14:38 | 3.1K | |
![[IMG]](/icons/image2.gif) | the-muscular-system-..> | 2023-05-03 09:32 | 17K | |
![[IMG]](/icons/image2.gif) | the-nurses-role-in-p..> | 2023-08-05 01:11 | 3.9K | |
![[IMG]](/icons/image2.gif) | the-nurses-role-in-p..> | 2023-05-03 09:22 | 21K | |
![[IMG]](/icons/image2.gif) | the-phlebotomy-textb..> | 2023-08-05 14:38 | 3.7K | |
![[IMG]](/icons/image2.gif) | the-phlebotomy-textb..> | 2023-05-03 11:25 | 20K | |
![[ ]](/icons/compressed.gif) | the-phlebotomy-textb..> | 2023-05-03 11:25 | 14K | |
![[IMG]](/icons/image2.gif) | the-principles-of-le..> | 2023-08-05 04:37 | 3.2K | |
![[IMG]](/icons/image2.gif) | the-principles-of-le..> | 2023-05-03 09:39 | 19K | |
![[ ]](/icons/compressed.gif) | the-principles-of-le..> | 2023-05-03 09:39 | 155K | |
![[IMG]](/icons/image2.gif) | the-process-of-paren..> | 2023-08-07 11:32 | 3.6K | |
![[IMG]](/icons/image2.gif) | the-process-of-paren..> | 2023-05-03 09:56 | 19K | |
![[ ]](/icons/compressed.gif) | the-process-of-paren..> | 2023-05-03 09:56 | 146K | |
![[IMG]](/icons/image2.gif) | the-psychology-of-wo..> | 2023-08-06 12:14 | 3.2K | |
![[IMG]](/icons/image2.gif) | the-psychology-of-wo..> | 2023-05-03 10:16 | 19K | |
![[ ]](/icons/compressed.gif) | the-psychology-of-wo..> | 2023-05-03 10:16 | 113K | |
![[IMG]](/icons/image2.gif) | the-real-world-an-in..> | 2023-08-05 06:25 | 4.1K | |
![[IMG]](/icons/image2.gif) | the-real-world-an-in..> | 2023-05-03 10:10 | 27K | |
![[IMG]](/icons/image2.gif) | the-sociology-of-hea..> | 2023-08-06 11:17 | 3.2K | |
![[IMG]](/icons/image2.gif) | the-sociology-of-hea..> | 2023-05-03 11:18 | 20K | |
![[ ]](/icons/compressed.gif) | the-world-of-psychol..> | 2023-05-03 13:43 | 60K | |
![[IMG]](/icons/image2.gif) | theories-of-human-de..> | 2023-08-05 16:25 | 4.8K | |
![[IMG]](/icons/image2.gif) | theories-of-human-de..> | 2023-08-05 05:34 | 28K | |
![[IMG]](/icons/image2.gif) | theories-of-human-de..> | 2023-05-04 02:23 | 55K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-08-05 04:35 | 2.6K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-05-03 09:18 | 13K | |
![[ ]](/icons/compressed.gif) | theories-of-personal..> | 2023-05-03 09:18 | 16K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-08-05 03:41 | 4.1K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-05-03 09:43 | 23K | |
![[ ]](/icons/compressed.gif) | theories-of-personal..> | 2023-05-03 09:43 | 17K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-08-05 16:29 | 3.6K | |
![[IMG]](/icons/image2.gif) | theories-of-personal..> | 2023-05-03 09:48 | 24K | |
![[ ]](/icons/compressed.gif) | theories-of-personal..> | 2023-05-03 09:48 | 22K | |
![[IMG]](/icons/image2.gif) | theories-personality..> | 2023-08-05 01:09 | 5.1K | |
![[IMG]](/icons/image2.gif) | theories-personality..> | 2023-08-09 15:33 | 32K | |
![[IMG]](/icons/image2.gif) | theories-personality..> | 2023-05-04 01:47 | 82K | |
![[ ]](/icons/compressed.gif) | theories-personality..> | 2023-05-04 01:47 | 436K | |
![[IMG]](/icons/image2.gif) | theory-and-practice-..> | 2023-08-06 10:20 | 3.5K | |
![[IMG]](/icons/image2.gif) | theory-and-practice-..> | 2023-05-03 09:21 | 8.9K | |
![[IMG]](/icons/image2.gif) | therapeutic-exercise..> | 2023-08-06 11:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | therapeutic-exercise..> | 2023-05-03 11:05 | 18K | |
![[ ]](/icons/compressed.gif) | therapeutic-exercise..> | 2023-05-03 11:05 | 5.7K | |
![[IMG]](/icons/image2.gif) | thermal-radiation-he..> | 2023-08-06 08:46 | 3.8K | |
![[IMG]](/icons/image2.gif) | thermal-radiation-he..> | 2023-08-06 16:00 | 20K | |
![[IMG]](/icons/image2.gif) | thermal-radiation-he..> | 2023-05-04 02:23 | 42K | |
![[IMG]](/icons/image2.gif) | think-social-psychol..> | 2023-08-05 03:41 | 4.8K | |
![[IMG]](/icons/image2.gif) | think-social-psychol..> | 2023-05-03 09:33 | 35K | |
![[ ]](/icons/compressed.gif) | think-social-psychol..> | 2023-05-03 09:33 | 30K | |
![[IMG]](/icons/image2.gif) | think-sociology-cana..> | 2023-08-05 04:35 | 4.1K | |
![[IMG]](/icons/image2.gif) | think-sociology-cana..> | 2023-08-05 05:34 | 23K | |
![[IMG]](/icons/image2.gif) | think-sociology-cana..> | 2023-05-03 09:45 | 59K | |
![[ ]](/icons/compressed.gif) | think-sociology-cana..> | 2023-05-03 09:45 | 90K | |
![[IMG]](/icons/image2.gif) | think-sociology-carl..> | 2023-08-05 01:51 | 4.3K | |
![[IMG]](/icons/image2.gif) | think-sociology-carl..> | 2023-05-03 09:22 | 29K | |
![[ ]](/icons/compressed.gif) | think-sociology-carl..> | 2023-05-03 09:22 | 51K | |
![[IMG]](/icons/image2.gif) | thinking-about-women..> | 2023-08-05 03:40 | 4.1K | |
![[IMG]](/icons/image2.gif) | thinking-about-women..> | 2023-08-05 05:34 | 24K | |
![[IMG]](/icons/image2.gif) | thinking-about-women..> | 2023-05-03 10:41 | 62K | |
![[ ]](/icons/compressed.gif) | thinking-about-women..> | 2023-05-03 10:41 | 39K | |
![[IMG]](/icons/image2.gif) | thomas-calculus-earl..> | 2023-08-06 10:17 | 3.3K | |
![[IMG]](/icons/image2.gif) | thomas-calculus-earl..> | 2023-08-06 16:00 | 18K | |
![[IMG]](/icons/image2.gif) | thomas-calculus-earl..> | 2023-05-03 09:55 | 72K | |
![[ ]](/icons/compressed.gif) | thomas-calculus-earl..> | 2023-05-03 09:55 | 1.8M | |
![[ ]](/icons/unknown.gif) | thompson_mtt5_mc_01_..> | 2023-05-03 11:14 | 24K | |
![[IMG]](/icons/image2.gif) | tortora-100x100.jpg | 2023-08-05 04:34 | 2.8K | |
![[IMG]](/icons/image2.gif) | tortora.jpg | 2023-05-03 09:26 | 14K | |
![[IMG]](/icons/image2.gif) | traditions-encounter..> | 2023-08-05 03:37 | 4.1K | |
![[IMG]](/icons/image2.gif) | traditions-encounter..> | 2023-05-03 09:42 | 34K | |
![[ ]](/icons/compressed.gif) | traditions-encounter..> | 2023-05-03 09:42 | 36K | |
![[ ]](/icons/compressed.gif) | training-development..> | 2023-05-03 10:38 | 229K | |
![[IMG]](/icons/image2.gif) | training-in-interper..> | 2023-08-06 12:08 | 4.0K | |
![[IMG]](/icons/image2.gif) | training-in-interper..> | 2023-05-03 10:24 | 22K | |
![[ ]](/icons/compressed.gif) | training-in-interper..> | 2023-05-03 10:24 | 22K | |
![[IMG]](/icons/image2.gif) | transnational-manage..> | 2023-08-09 04:12 | 14K | |
![[IMG]](/icons/image2.gif) | transnational-manage..> | 2023-05-03 09:24 | 37K | |
![[IMG]](/icons/image2.gif) | transportation-a-sup..> | 2023-08-06 12:08 | 4.3K | |
![[IMG]](/icons/image2.gif) | transportation-a-sup..> | 2023-05-03 10:48 | 28K | |
![[ ]](/icons/compressed.gif) | transportation-a-sup..> | 2023-05-03 10:48 | 13K | |
![[ ]](/icons/compressed.gif) | trigonometry-8th-edi..> | 2023-05-03 13:44 | 1.8M | |
![[IMG]](/icons/image2.gif) | trigonometry-unit-ci..> | 2023-08-05 15:32 | 2.0K | |
![[IMG]](/icons/image2.gif) | trigonometry-unit-ci..> | 2023-08-05 09:59 | 8.6K | |
![[IMG]](/icons/image2.gif) | trigonometry-unit-ci..> | 2023-05-04 01:57 | 35K | |
![[ ]](/icons/compressed.gif) | trigonometry-unit-ci..> | 2023-05-04 01:57 | 2.2M | |
![[ ]](/icons/layout.gif) | trim_4e_ch01_ism.pdf | 2023-05-03 09:19 | 2.1M | |
![[ ]](/icons/compressed.gif) | trw2_Chapter_16.zip | 2023-05-03 10:10 | 24K | |
![[ ]](/icons/layout.gif) | tth_fa12_ch01_wp_sol..> | 2023-05-04 01:53 | 160K | |
![[ ]](/icons/layout.gif) | tuckwell_im_ch01.pdf | 2023-05-03 10:46 | 46K | |
![[IMG]](/icons/image2.gif) | understandable-stati..> | 2023-08-06 08:47 | 3.9K | |
![[IMG]](/icons/image2.gif) | understandable-stati..> | 2023-08-05 09:59 | 21K | |
![[IMG]](/icons/image2.gif) | understandable-stati..> | 2023-05-03 10:14 | 46K | |
![[ ]](/icons/compressed.gif) | understandable-stati..> | 2023-05-03 10:14 | 2.8M | |
![[ ]](/icons/compressed.gif) | understanding-abnorm..> | 2023-05-03 13:42 | 33K | |
![[IMG]](/icons/image2.gif) | understanding-and-ma..> | 2023-08-05 06:25 | 2.6K | |
![[IMG]](/icons/image2.gif) | understanding-and-ma..> | 2023-05-03 10:39 | 14K | |
![[ ]](/icons/compressed.gif) | understanding-and-ma..> | 2023-05-03 10:39 | 31K | |
![[ ]](/icons/compressed.gif) | understanding-busine..> | 2023-05-03 09:06 | 77K | |
![[ ]](/icons/compressed.gif) | understanding-busine..> | 2023-05-03 13:42 | 21K | |
![[IMG]](/icons/image2.gif) | understanding-essent..> | 2023-08-05 01:52 | 2.6K | |
![[IMG]](/icons/image2.gif) | understanding-essent..> | 2023-08-05 04:37 | 13K | |
![[IMG]](/icons/image2.gif) | understanding-essent..> | 2023-05-04 02:18 | 41K | |
![[ ]](/icons/compressed.gif) | understanding-essent..> | 2023-05-04 02:18 | 126K | |
![[IMG]](/icons/image2.gif) | understanding-financ..> | 2023-08-06 11:13 | 3.7K | |
![[IMG]](/icons/image2.gif) | understanding-financ..> | 2023-08-05 09:59 | 29K | |
![[IMG]](/icons/image2.gif) | understanding-financ..> | 2023-05-03 09:54 | 156K | |
![[ ]](/icons/compressed.gif) | understanding-financ..> | 2023-05-03 09:54 | 145K | |
![[IMG]](/icons/image2.gif) | understanding-manage..> | 2023-08-05 06:25 | 3.3K | |
![[IMG]](/icons/image2.gif) | understanding-manage..> | 2023-05-03 09:54 | 22K | |
![[ ]](/icons/compressed.gif) | understanding-manage..> | 2023-05-03 09:54 | 406K | |
![[IMG]](/icons/image2.gif) | understanding-manage..> | 2023-08-06 12:14 | 3.2K | |
![[IMG]](/icons/image2.gif) | understanding-manage..> | 2023-05-04 02:26 | 17K | |
![[ ]](/icons/compressed.gif) | understanding-manage..> | 2023-05-04 02:26 | 43K | |
![[IMG]](/icons/image2.gif) | understanding-medica..> | 2023-08-05 05:29 | 3.0K | |
![[IMG]](/icons/image2.gif) | understanding-medica..> | 2023-05-03 09:29 | 10K | |
![[IMG]](/icons/image2.gif) | understanding-normal..> | 2023-08-06 13:02 | 2.3K | |
![[IMG]](/icons/image2.gif) | understanding-normal..> | 2023-05-03 09:59 | 14K | |
![[ ]](/icons/compressed.gif) | understanding-normal..> | 2023-05-03 09:59 | 37K | |
![[ ]](/icons/compressed.gif) | understanding-nutrit..> | 2023-05-03 10:07 | 25K | |
![[ ]](/icons/compressed.gif) | understanding-nutrit..> | 2023-05-03 09:51 | 322K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-08-08 07:31 | 3.3K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-05-03 09:51 | 7.9K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-08-05 20:18 | 2.7K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-05-03 10:33 | 8.0K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-08-05 18:14 | 2.7K | |
![[IMG]](/icons/image2.gif) | understanding-nutrit..> | 2023-05-03 10:07 | 8.0K | |
![[ ]](/icons/compressed.gif) | understanding-pathop..> | 2023-05-03 11:18 | 20K | |
![[IMG]](/icons/image2.gif) | understanding-pathop..> | 2023-08-05 01:08 | 3.7K | |
![[IMG]](/icons/image2.gif) | understanding-pathop..> | 2023-05-03 11:18 | 13K | |
![[IMG]](/icons/image2.gif) | understanding-pathop..> | 2023-08-06 03:28 | 4.0K | |
![[IMG]](/icons/image2.gif) | understanding-pathop..> | 2023-05-03 09:30 | 25K | |
![[ ]](/icons/compressed.gif) | understanding-pathop..> | 2023-05-03 09:30 | 13K | |
![[IMG]](/icons/image2.gif) | understanding-pharma..> | 2023-08-05 05:30 | 2.7K | |
![[IMG]](/icons/image2.gif) | understanding-pharma..> | 2023-05-03 10:42 | 14K | |
![[IMG]](/icons/image2.gif) | understanding-psycho..> | 2023-08-05 14:38 | 2.9K | |
![[IMG]](/icons/image2.gif) | understanding-psycho..> | 2023-05-03 09:38 | 16K | |
![[ ]](/icons/compressed.gif) | understanding-psycho..> | 2023-05-03 09:38 | 64K | |
![[IMG]](/icons/image2.gif) | understanding-social..> | 2023-08-05 14:35 | 4.3K | |
![[IMG]](/icons/image2.gif) | understanding-social..> | 2023-05-03 09:45 | 28K | |
![[ ]](/icons/compressed.gif) | understanding-social..> | 2023-05-03 09:45 | 27K | |
![[IMG]](/icons/image2.gif) | understanding-terror..> | 2023-08-06 13:10 | 3.7K | |
![[IMG]](/icons/image2.gif) | understanding-terror..> | 2023-08-05 04:37 | 22K | |
![[IMG]](/icons/image2.gif) | understanding-terror..> | 2023-05-03 10:42 | 36K | |
![[ ]](/icons/compressed.gif) | understanding-terror..> | 2023-05-03 10:42 | 20K | |
![[IMG]](/icons/image2.gif) | understanding-the-am..> | 2023-08-05 05:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | understanding-the-am..> | 2023-08-05 04:37 | 28K | |
![[IMG]](/icons/image2.gif) | understanding-the-am..> | 2023-05-03 09:34 | 44K | |
![[ ]](/icons/compressed.gif) | understanding-the-am..> | 2023-05-03 09:34 | 275K | |
![[IMG]](/icons/image2.gif) | understanding-the-es..> | 2023-08-05 04:34 | 2.6K | |
![[IMG]](/icons/image2.gif) | understanding-the-es..> | 2023-05-03 11:11 | 14K | |
![[ ]](/icons/compressed.gif) | understanding-the-es..> | 2023-05-03 11:11 | 21K | |
![[IMG]](/icons/image2.gif) | unfinished-nation-co..> | 2023-08-06 11:13 | 3.3K | |
![[IMG]](/icons/image2.gif) | unfinished-nation-co..> | 2023-05-03 10:55 | 17K | |
![[ ]](/icons/compressed.gif) | unfinished-nation-co..> | 2023-05-03 10:55 | 148K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-05 06:24 | 4.5K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-08 11:12 | 22K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-05-03 11:24 | 56K | |
![[ ]](/icons/compressed.gif) | university-physics-m..> | 2023-05-03 11:24 | 1.2M | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-05 04:34 | 4.4K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-05-03 10:14 | 31K | |
![[ ]](/icons/compressed.gif) | university-physics-m..> | 2023-05-03 10:14 | 210K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-05 01:09 | 3.0K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-08 11:12 | 17K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-05-03 09:53 | 63K | |
![[ ]](/icons/compressed.gif) | university-physics-m..> | 2023-05-03 09:53 | 745K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-05 04:34 | 3.1K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-08-05 04:37 | 17K | |
![[IMG]](/icons/image2.gif) | university-physics-m..> | 2023-05-03 10:15 | 80K | |
![[ ]](/icons/compressed.gif) | university-physics-m..> | 2023-05-03 10:15 | 176K | |
![[IMG]](/icons/image2.gif) | urinalysis-and-body-..> | 2023-08-06 08:43 | 3.2K | |
![[IMG]](/icons/image2.gif) | urinalysis-and-body-..> | 2023-05-03 09:46 | 18K | |
![[ ]](/icons/compressed.gif) | urinalysis-and-body-..> | 2023-05-03 09:46 | 10K | |
![[IMG]](/icons/image2.gif) | using-mis-9th-editio..> | 2023-08-06 13:10 | 3.6K | |
![[IMG]](/icons/image2.gif) | using-mis-9th-editio..> | 2023-08-05 04:37 | 21K | |
![[IMG]](/icons/image2.gif) | using-mis-9th-editio..> | 2023-05-03 09:46 | 52K | |
![[ ]](/icons/compressed.gif) | using-mis-9th-editio..> | 2023-05-03 09:46 | 132K | |
![[IMG]](/icons/image2.gif) | using-mis-10th-editi..> | 2023-08-06 11:15 | 3.2K | |
![[IMG]](/icons/image2.gif) | using-mis-10th-editi..> | 2023-08-05 04:37 | 17K | |
![[IMG]](/icons/image2.gif) | using-mis-10th-editi..> | 2023-05-03 09:47 | 63K | |
![[ ]](/icons/compressed.gif) | using-mis-10th-editi..> | 2023-05-03 09:47 | 68K | |
![[IMG]](/icons/image2.gif) | using-r-for-introduc..> | 2023-08-06 05:44 | 3.3K | |
![[IMG]](/icons/image2.gif) | using-r-for-introduc..> | 2023-08-08 14:58 | 16K | |
![[IMG]](/icons/image2.gif) | using-r-for-introduc..> | 2023-05-04 02:22 | 37K | |
![[IMG]](/icons/image2.gif) | using-understanding-..> | 2023-08-05 16:23 | 3.8K | |
![[IMG]](/icons/image2.gif) | using-understanding-..> | 2023-08-08 14:58 | 23K | |
![[IMG]](/icons/image2.gif) | using-understanding-..> | 2023-05-03 09:51 | 113K | |
![[ ]](/icons/compressed.gif) | using-understanding-..> | 2023-05-03 09:51 | 259K | |
![[IMG]](/icons/image2.gif) | valerius8e20es_nm2.jpg | 2023-05-04 01:57 | 11K | |
![[ ]](/icons/compressed.gif) | vanders-human-physio..> | 2023-05-03 13:43 | 50K | |
![[IMG]](/icons/image2.gif) | vanders-human-physio..> | 2023-08-05 16:26 | 3.1K | |
![[IMG]](/icons/image2.gif) | vanders-human-physio..> | 2023-05-03 10:31 | 21K | |
![[ ]](/icons/compressed.gif) | vanders-human-physio..> | 2023-05-03 10:31 | 33K | |
![[IMG]](/icons/image2.gif) | vanputte-seeleys_ana..> | 2023-05-03 09:21 | 60K | |
![[IMG]](/icons/image2.gif) | varcarolis-foundatio..> | 2023-08-05 15:35 | 2.8K | |
![[IMG]](/icons/image2.gif) | varcarolis-foundatio..> | 2023-05-03 11:00 | 9.0K | |
![[ ]](/icons/compressed.gif) | varcaroliss-canadian..> | 2023-05-03 09:44 | 4.3K | |
![[IMG]](/icons/image2.gif) | vector-calculus-coll..> | 2023-05-03 10:11 | 14K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-08-09 02:03 | 3.1K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-05-03 09:27 | 21K | |
![[ ]](/icons/compressed.gif) | visual-anatomy-physi..> | 2023-05-03 09:27 | 14K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-08-05 17:21 | 3.5K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-08-05 06:28 | 17K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-05-03 09:55 | 63K | |
![[ ]](/icons/compressed.gif) | visual-anatomy-physi..> | 2023-05-03 09:55 | 198K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-08-05 05:30 | 3.7K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | visual-anatomy-physi..> | 2023-05-04 02:13 | 64K | |
![[ ]](/icons/compressed.gif) | visual-anatomy-physi..> | 2023-05-04 02:13 | 88K | |
![[IMG]](/icons/image2.gif) | visual-essentials-of..> | 2023-08-05 01:51 | 3.8K | |
![[IMG]](/icons/image2.gif) | visual-essentials-of..> | 2023-05-03 10:12 | 19K | |
![[ ]](/icons/compressed.gif) | visual-essentials-of..> | 2023-05-03 10:12 | 739K | |
![[IMG]](/icons/image2.gif) | visualizing-psycholo..> | 2023-08-05 06:25 | 3.4K | |
![[IMG]](/icons/image2.gif) | visualizing-psycholo..> | 2023-05-03 09:24 | 20K | |
![[ ]](/icons/compressed.gif) | visualizing-psycholo..> | 2023-05-03 09:24 | 439K | |
![[IMG]](/icons/image2.gif) | visualizing-technolo..> | 2023-05-03 10:16 | 22K | |
![[ ]](/icons/compressed.gif) | visualizing-technolo..> | 2023-05-03 10:16 | 15K | |
![[ ]](/icons/layout.gif) | vlcsnap-2016-11-30-2..> | 2023-05-03 13:41 | 237K | |
![[ ]](/icons/layout.gif) | vlcsnap-2016-11-30-2..> | 2023-05-03 11:07 | 232K | |
![[ ]](/icons/layout.gif) | vlcsnap-2016-11-30-2..> | 2023-05-03 11:08 | 227K | |
![[ ]](/icons/compressed.gif) | wallace_iso1_im_01.zip | 2023-05-03 09:31 | 124K | |
![[ ]](/icons/unknown.gif) | wallace_iso1_tif_01.doc | 2023-05-03 10:52 | 103K | |
![[IMG]](/icons/image2.gif) | wardlaws-contemporar..> | 2023-08-06 10:20 | 3.8K | |
![[IMG]](/icons/image2.gif) | wardlaws-contemporar..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | wardlaws-contemporar..> | 2023-05-03 09:22 | 41K | |
![[ ]](/icons/compressed.gif) | wardlaws-contemporar..> | 2023-05-03 09:21 | 301K | |
![[IMG]](/icons/image2.gif) | wardlaws-perspective..> | 2023-08-06 13:11 | 3.6K | |
![[IMG]](/icons/image2.gif) | wardlaws-perspective..> | 2023-05-03 09:51 | 26K | |
![[ ]](/icons/compressed.gif) | wardlaws-perspective..> | 2023-05-03 09:51 | 9.9K | |
![[IMG]](/icons/image2.gif) | watkins-100x100.jpg | 2023-08-05 04:35 | 3.8K | |
![[IMG]](/icons/image2.gif) | watkins-300x300.jpg | 2023-08-08 16:38 | 19K | |
![[IMG]](/icons/image2.gif) | watkins.jpg | 2023-05-03 09:44 | 39K | |
![[ ]](/icons/unknown.gif) | weiten.lloyd11_IM01...> | 2023-05-03 09:20 | 56K | |
![[ ]](/icons/unknown.gif) | wepeop10_ch01.rtf | 2023-05-03 09:36 | 229K | |
![[IMG]](/icons/image2.gif) | western-civilization..> | 2023-08-09 00:59 | 2.8K | |
![[IMG]](/icons/image2.gif) | western-civilization..> | 2023-08-05 04:37 | 18K | |
![[IMG]](/icons/image2.gif) | western-civilization..> | 2023-05-03 09:22 | 56K | |
![[ ]](/icons/compressed.gif) | western-civilization..> | 2023-05-03 09:22 | 389K | |
![[IMG]](/icons/image2.gif) | what-is-life-a-guide..> | 2023-08-06 10:19 | 4.0K | |
![[IMG]](/icons/image2.gif) | what-is-life-a-guide..> | 2023-05-03 09:54 | 27K | |
![[IMG]](/icons/image2.gif) | what-is-psychology-p..> | 2023-08-05 03:40 | 2.4K | |
![[IMG]](/icons/image2.gif) | what-is-psychology-p..> | 2023-05-04 02:23 | 12K | |
![[IMG]](/icons/image2.gif) | widmaier-vanders_hum..> | 2023-05-03 09:49 | 52K | |
![[ ]](/icons/unknown.gif) | wild_ibcd1_im_01.docx | 2023-05-04 02:02 | 51K | |
![[IMG]](/icons/image2.gif) | williams-basic-nutri..> | 2023-08-08 06:40 | 3.0K | |
![[IMG]](/icons/image2.gif) | williams-basic-nutri..> | 2023-05-03 09:46 | 17K | |
![[IMG]](/icons/image2.gif) | wongs-essentials-of-..> | 2023-08-08 06:41 | 3.9K | |
![[IMG]](/icons/image2.gif) | wongs-essentials-of-..> | 2023-05-03 10:43 | 24K | |
![[ ]](/icons/compressed.gif) | wongs-essentials-of-..> | 2023-05-03 10:43 | 15K | |
![[IMG]](/icons/image2.gif) | wongs-essentials-of-..> | 2023-08-06 13:05 | 4.4K | |
![[IMG]](/icons/image2.gif) | wongs-essentials-of-..> | 2023-05-03 09:53 | 28K | |
![[ ]](/icons/compressed.gif) | wongs-essentials-of-..> | 2023-05-03 09:53 | 13K | |
![[IMG]](/icons/image2.gif) | wongs-nursing-care-o..> | 2023-08-06 04:15 | 3.4K | |
![[IMG]](/icons/image2.gif) | wongs-nursing-care-o..> | 2023-05-03 10:44 | 20K | |
![[IMG]](/icons/image2.gif) | working-in-groups-is..> | 2023-08-05 01:56 | 4.1K | |
![[IMG]](/icons/image2.gif) | working-in-groups-is..> | 2023-05-03 09:39 | 21K | |
![[IMG]](/icons/image2.gif) | world-civilizations-..> | 2023-08-05 16:25 | 3.2K | |
![[IMG]](/icons/image2.gif) | world-civilizations-..> | 2023-05-03 10:49 | 27K | |
![[ ]](/icons/compressed.gif) | world-civilizations-..> | 2023-05-03 10:49 | 14K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-08-06 15:35 | 3.6K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-05-03 09:49 | 27K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-08-05 01:09 | 3.6K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-05-03 09:27 | 27K | |
![[ ]](/icons/compressed.gif) | world-regional-geogr..> | 2023-05-03 09:27 | 143K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-08-05 04:34 | 4.0K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-08-05 04:37 | 26K | |
![[IMG]](/icons/image2.gif) | world-regional-geogr..> | 2023-05-03 11:23 | 39K | |
![[ ]](/icons/compressed.gif) | world-regional-geogr..> | 2023-05-03 11:23 | 219K | |
![[ ]](/icons/compressed.gif) | worpol3_ch01.zip | 2023-05-03 09:43 | 11K | |
![[ ]](/icons/unknown.gif) | worpol4_ch01_TB.docx | 2023-05-03 10:52 | 50K | |
![[IMG]](/icons/image2.gif) | yukl-leadership_in_o..> | 2023-05-03 09:22 | 42K | |
![[IMG]](/icons/image2.gif) | zoology-10th-edition..> | 2023-08-05 03:40 | 3.3K | |
![[IMG]](/icons/image2.gif) | zoology-10th-edition..> | 2023-08-05 04:37 | 19K | |
![[IMG]](/icons/image2.gif) | zoology-10th-edition..> | 2023-05-03 10:40 | 57K | |
![[ ]](/icons/compressed.gif) | zoology-10th-edition..> | 2023-05-03 10:40 | 34K | |
|